diff --git a/.gitignore b/.gitignore index 32d6239..a47abb7 100644 --- a/.gitignore +++ b/.gitignore @@ -1,3 +1,6 @@ *.zip *.mrpack packwiz.exe +website/*.sqlite +website/dependency_tree_cache.json +venv \ No newline at end of file diff --git a/.packwizignore b/.packwizignore index 5a34d4f..8d19ea8 100644 --- a/.packwizignore +++ b/.packwizignore @@ -3,3 +3,6 @@ # Exclude README /README.md + +website +venv \ No newline at end of file diff --git a/website/collect-mod-descriptions.py b/website/collect-mod-descriptions.py new file mode 100644 index 0000000..bf7ed92 --- /dev/null +++ b/website/collect-mod-descriptions.py @@ -0,0 +1,245 @@ +#!/usr/bin/env python +""" +From the packwiz toml files, look up the mod descriptions from the modrinth API +and collect them into an html page using yattag. + +The toml files look like: + +``` +name = "almostunified-fabric-1.20.1-0.9.4" +filename = "almostunified-fabric-1.20.1-0.9.4.jar" +side = "both" + +[download] +url = "https://cdn.modrinth.com/data/sdaSaQEz/versions/iVBf0ICr/almostunified-fabric-1.20.1-0.9.4.jar" +hash = "ec47335d9d8b98c107a2b4cb4bada845669728f78c65df2ef2ee5e06d9ac866d276d09892896c216e30eb028a6fdd0a6cc92a8741eee1c14fa3d0ca24444cbdb" +hash-format = "sha512" +mode = "url" + +[option] +optional = false +default = false + +[update.modrinth] +mod-id = "sdaSaQEz" +version = "iVBf0ICr" +``` + +So the update.modrinth.mod-id is the one to look up. +""" + +import os +import toml +import requests +from yattag import Doc, indent +import requests_cache +import logging +from tqdm import tqdm +import json +import os + + +logging.basicConfig(level=logging.INFO) +logger = logging.getLogger(__name__) + +session = requests_cache.CachedSession('collectmoddescriptions', cache_control=True) + + +def collect_mod_info(directory): + mods = {} + files = os.listdir(directory) + for filename in tqdm(files, desc="Processing mod files", unit="file"): + if filename.endswith('.toml'): + file_path = os.path.join(directory, filename) + logger.debug(f"Processing file: {file_path}") + with open(file_path, 'r') as file: + data = toml.load(file) + if 'update' in data and 'modrinth' in data['update']: + mod_id = data['update']['modrinth'].get('mod-id') + if mod_id: + url = f"https://api.modrinth.com/v2/project/{mod_id}" + response = session.get(url) + if response.status_code == 200: + project_data = response.json() + mods[mod_id] = project_data + else: + raise Exception(f"Failed to fetch data for mod ID: {mod_id}") + return mods + +""" +Calculate the dependency tree of the flat list of mod version ids, such that mods that aren't +depended on by other mods are at the top level, and other mods are nested +under the top-level mods that depend on them (possibly mulitiple times). + +In the Modrinth schema, a project has versions, which have dependencies on other +project's versions. +""" +def get_mod_dependencies(version_id): + url = f"https://api.modrinth.com/v2/version/{version_id}" + response = requests.get(url) + if response.status_code == 200: + version_data = response.json() + dependencies = version_data.get('dependencies', []) + return [dep["project_id"] for dep in dependencies if dep.get('dependency_type') == 'required'] + else: + print(f"Error fetching version data: {response.status_code}") + return [] + +def build_dependency_tree(directory): + cache_file = 'dependency_tree_cache.json' + if os.path.exists(cache_file): + with open(cache_file, 'r') as f: + return json.load(f) + + dependency_tree = {} + files = os.listdir(directory) + for filename in tqdm(files, desc="Building dependency tree", unit="file"): + if filename.endswith('.toml'): + file_path = os.path.join(directory, filename) + with open(file_path, 'r') as file: + data = toml.load(file) + if 'update' in data and 'modrinth' in data['update']: + mod_id = data['update']['modrinth'].get('mod-id') + version_id = data['update']['modrinth'].get('version') + if mod_id and version_id: + dependencies = get_mod_dependencies(version_id) + dependency_tree[mod_id] = { + 'name': data['name'], + 'version_id': version_id, + 'dependencies': dependencies + } + + with open(cache_file, 'w') as f: + json.dump(dependency_tree, f) + + return dependency_tree + +def get_modrinth_url(slug): + return f"https://modrinth.com/mod/{slug}" + +def render_dependency_tree(tree, mod_id, mod_info, level=0): + doc, tag, text = Doc().tagtext() + mod_data = tree.get(mod_id) + if mod_data: + with tag('div', style=f"margin-left: {level * 20}px;"): + with tag('h3'): + with tag('a', href=get_modrinth_url(mod_info[mod_id]['slug'])): + text(mod_data['name']) + for dep_id in mod_data['dependencies']: + if dep_id in tree: + doc.asis(render_dependency_tree(tree, dep_id, mod_info, level + 1)) + return doc.getvalue() + +def generate_html(mod_info, dependency_tree): + doc, tag, text = Doc().tagtext() + + doc.asis('') + with tag('html'): + with tag('head'): + with tag('title'): + text('Mod Descriptions and Dependencies') + doc.stag('link', rel='stylesheet', href='pico.min.css') + doc.stag('link', rel='stylesheet', href='style.css') + + with tag('main', klass="container"): + with tag('h1'): + text('Mod Descriptions and Dependencies') + + with tag('h2'): + text('Mod Descriptions') + with tag('div', id='mod-descriptions'): + for mod_id, info in mod_info.items(): + with tag('div', klass='mod-description'): + with tag('h3'): + with tag('a', href=get_modrinth_url(info['slug'])): + text(info['title']) + with tag('p'): + text(f"Category: {info['categories']}") + with tag('p'): + text(info['description']) + + with tag('h2'): + text('Mods by Category') + categories = {} + for mod_id, mod_info_dict in mod_info.items(): + for category in mod_info_dict['categories']: + if category not in categories: + categories[category] = [] + categories[category].append((mod_info_dict['title'], mod_info_dict['slug'])) + + for category, mods in categories.items(): + with tag('h3'): + text(category) + with tag('ul'): + for mod_name, slug in mods: + with tag('li'): + with tag('a', href=get_modrinth_url(slug)): + text(mod_name) + + with tag('h2'): + text('Dependency Tree') + for mod_id in dependency_tree: + if not any(mod_id in dep['dependencies'] for dep in dependency_tree.values()): + doc.asis(render_dependency_tree(dependency_tree, mod_id, mod_info)) + + return indent(doc.getvalue()) + +def generate_dot_graph(mod_info, dependency_tree): + dot_content = "digraph ModDependencies {\n" + dot_content += " node [shape=box];\n" + + for mod_id, info in mod_info.items(): + url = get_modrinth_url(info['slug']) + dot_content += f' "{mod_id}" [label="{info["title"]}", URL="{url}"];\n' + + for mod_id, deps in dependency_tree.items(): + for dep in deps['dependencies']: + dot_content += f' "{mod_id}" -> "{dep}";\n' + + dot_content += "}" + return dot_content + + +def main(directory, output_filename, output_format='html'): + mod_info = collect_mod_info(directory) + dependency_tree = build_dependency_tree(directory) + + if output_format == 'html': + output_content = generate_html(mod_info, dependency_tree) + elif output_format == 'json': + import json + output_content = json.dumps({ + 'mod_info': mod_info, + 'dependency_tree': dependency_tree + }, indent=2) + elif output_format == 'dot': + output_content = generate_dot_graph(mod_info, dependency_tree) + else: + raise ValueError("Invalid output format. Use 'html', 'json', or 'dot'.") + + with open(output_filename, 'w', encoding='utf-8') as f: + f.write(output_content) + + print(f"File with mod descriptions and dependency tree has been generated: {output_filename}") + +if __name__ == '__main__': + import sys + if len(sys.argv) != 3: + print("Usage: python script.py ") + print("output_filename should end with '.html', '.json', or '.dot'") + sys.exit(1) + + directory = sys.argv[1] + output_filename = sys.argv[2] + + if output_filename.lower().endswith('.html'): + output_format = 'html' + elif output_filename.lower().endswith('.json'): + output_format = 'json' + elif output_filename.lower().endswith('.dot'): + output_format = 'dot' + else: + print("Error: output_filename must end with '.html', '.json', or '.dot'") + sys.exit(1) + + main(directory, output_filename, output_format) diff --git a/website/graph.svg b/website/graph.svg new file mode 100644 index 0000000..57d8b48 --- /dev/null +++ b/website/graph.svg @@ -0,0 +1,3760 @@ + + + + + + +ModDependencies + + + +defK2XM3 + + +AdventureZ + + + + + +9s6osm5g + + +Cloth Config API + + + + + +defK2XM3->9s6osm5g + + + + + +P7dR8mSH + + +Fabric API + + + + + +defK2XM3->P7dR8mSH + + + + + +sdaSaQEz + + +Almost Unified + + + + + +fM515JnW + + +AmbientSounds + + + + + +OsZiaDHq + + +CreativeCore + + + + + +fM515JnW->OsZiaDHq + + + + + +fM515JnW->P7dR8mSH + + + + + +k23mNPhZ + + +Aquamirae + + + + + +k23mNPhZ->P7dR8mSH + + + + + +fU7jbFHc + + +Obscure API + + + + + +k23mNPhZ->fU7jbFHc + + + + + +QgooUXAJ + + +Archers (RPG Series) + + + + + +pduQXSbl + + +AzureLib Armor + + + + + +QgooUXAJ->pduQXSbl + + + + + +QgooUXAJ->P7dR8mSH + + + + + +AqaIIO6D + + +Ranged Weapon API + + + + + +QgooUXAJ->AqaIIO6D + + + + + +XvoWJaA2 + + +Spell Engine + + + + + +QgooUXAJ->XvoWJaA2 + + + + + +lhGA9TYQ + + +Architectury API + + + + + +lhGA9TYQ->P7dR8mSH + + + + + +td9zQQBq + + +Archon + + + + + +td9zQQBq->P7dR8mSH + + + + + +8ooWzSQP + + +Spell Power Attributes + + + + + +td9zQQBq->8ooWzSQP + + + + + +bb2EpKpx + + +Argonauts + + + + + +bb2EpKpx->P7dR8mSH + + + + + +G1hIVOrD + + +Resourceful Lib + + + + + +bb2EpKpx->G1hIVOrD + + + + + +P0Mu4wcQ + + +Artifacts + + + + + +P0Mu4wcQ->lhGA9TYQ + + + + + +P0Mu4wcQ->9s6osm5g + + + + + +5aaWibi9 + + +Trinkets + + + + + +P0Mu4wcQ->5aaWibi9 + + + + + +lOOpEntO + + +AttributeFix + + + + + +lOOpEntO->P7dR8mSH + + + + + +8FdYDHF5 + + +AutoTag + + + + + +7zlUOZvb + + +AzureLib + + + + + +7zlUOZvb->P7dR8mSH + + + + + +g96Z4WVZ + + +BadOptimizations + + + + + +MBAkmtvl + + +Balm + + + + + +MBAkmtvl->P7dR8mSH + + + + + +sc2Pektv + + +Basic Weapons + + + + + +BgNRHReB + + +BCLib + + + + + +BgNRHReB->P7dR8mSH + + + + + +Kt4RVKEd + + +Friends&Foes - Beekeeper Hut (Fabric/Quilt) + + + + + +Kt4RVKEd->P7dR8mSH + + + + + +gc8OEnCC + + +BetterEnd + + + + + +gc8OEnCC->BgNRHReB + + + + + +gc8OEnCC->P7dR8mSH + + + + + +MpzVLzy5 + + +BetterNether + + + + + +MpzVLzy5->BgNRHReB + + + + + +MpzVLzy5->P7dR8mSH + + + + + +zCh7omyG + + +Better Archeology + + + + + +Ua7DFN59 + + +YUNG's API + + + + + +zCh7omyG->Ua7DFN59 + + + + + +5sy6g3kz + + +Better Combat + + + + + +5sy6g3kz->9s6osm5g + + + + + +5sy6g3kz->P7dR8mSH + + + + + +gedNE4y2 + + +playerAnimator + + + + + +5sy6g3kz->gedNE4y2 + + + + + +VdEsgz29 + + +Bingus & Floppa + + + + + +HXF82T3G + + +Biomes O' Plenty + + + + + +kkmrDlKT + + +TerraBlender + + + + + +HXF82T3G->kkmrDlKT + + + + + +1VSGxqkt + + +Block Runner + + + + + +1VSGxqkt->P7dR8mSH + + + + + +ohNO6lps + + +Forge Config API Port + + + + + +1VSGxqkt->ohNO6lps + + + + + +QAGBst4M + + +Puzzles Lib + + + + + +1VSGxqkt->QAGBst4M + + + + + +du3UfiLL + + +Bosses of Mass Destruction + + + + + +K01OU20C + + +Cardinal Components API + + + + + +du3UfiLL->K01OU20C + + + + + +du3UfiLL->9s6osm5g + + + + + +du3UfiLL->P7dR8mSH + + + + + +Ha28R6CL + + +Fabric Language Kotlin + + + + + +du3UfiLL->Ha28R6CL + + + + + +8BmcQJ2H + + +Geckolib + + + + + +du3UfiLL->8BmcQJ2H + + + + + +uy4Cnpcm + + +Bookshelf + + + + + +uy4Cnpcm->P7dR8mSH + + + + + +fEWKxVzh + + +Cadmus + + + + + +fEWKxVzh->P7dR8mSH + + + + + +fEWKxVzh->G1hIVOrD + + + + + +cChd25Tw + + +Cave Dweller Fabric + + + + + +cChd25Tw->P7dR8mSH + + + + + +cChd25Tw->8BmcQJ2H + + + + + +ccKDOlHs + + +oωo (owo-lib) + + + + + +cChd25Tw->ccKDOlHs + + + + + +Wnxd13zP + + +Clumps + + + + + +Wnxd13zP->P7dR8mSH + + + + + +e0M1UDsY + + +Collective + + + + + +wGKYL7st + + +Combat Roll + + + + + +wGKYL7st->9s6osm5g + + + + + +wGKYL7st->P7dR8mSH + + + + + +wGKYL7st->gedNE4y2 + + + + + +gMWAhU1n + + +Convenient Decor + + + + + +gMWAhU1n->P7dR8mSH + + + + + +OsZiaDHq->P7dR8mSH + + + + + +MI1LWe93 + + +Creeper Overhaul + + + + + +MI1LWe93->8BmcQJ2H + + + + + +MI1LWe93->G1hIVOrD + + + + + +M1953qlQ + + +Resourceful Config + + + + + +MI1LWe93->M1953qlQ + + + + + +cl223EMc + + +Cristel Lib + + + + + +cl223EMc->P7dR8mSH + + + + + +meZK2DCX + + +Dawn API + + + + + +meZK2DCX->P7dR8mSH + + + + + +QwxR6Gcd + + +Debugify + + + + + +1eAoo2KR + + +YetAnotherConfigLib + + + + + +QwxR6Gcd->1eAoo2KR + + + + + +t6BIRVZn + + +Decorative Blocks + + + + + +t6BIRVZn->P7dR8mSH + + + + + +fnAffV0n + + +Deeper and Darker + + + + + +fnAffV0n->P7dR8mSH + + + + + +fnAffV0n->1eAoo2KR + + + + + +US6QuKdU + + +DEUF Refabricated + + + + + +445bpKSe + + +Dimensional Sync Fixes + + + + + +uCdwusMi + + +Distant Horizons + + + + + +JrvR9OHr + + +Double Doors + + + + + +JrvR9OHr->e0M1UDsY + + + + + +vZoqTqwv + + +Dungeon Now Loading + + + + + +tpehi7ww + + +Dungeons and Taverns + + + + + +ENZmbSFZ + + +Dungeon Difficulty + + + + + +ENZmbSFZ->P7dR8mSH + + + + + +ENZmbSFZ->AqaIIO6D + + + + + +7YjclEGc + + +Dynamic Lights + + + + + +nBaXIQY9 + + +Eldritch End + + + + + +nBaXIQY9->7zlUOZvb + + + + + +P1Kv5EAO + + +Necronomicon API + + + + + +nBaXIQY9->P1Kv5EAO + + + + + +fRiHVvU7 + + +EMI + + + + + +OVuFYfre + + +Enhanced Block Entities + + + + + +OVuFYfre->P7dR8mSH + + + + + +NNAgCjsB + + +Entity Culling + + + + + +NNAgCjsB->P7dR8mSH + + + + + +4I1XuqiY + + +[EMF] Entity Model Features + + + + + +BVzZfTc1 + + +[ETF] Entity Texture Features + + + + + +4I1XuqiY->BVzZfTc1 + + + + + +26nL5g7F + + +Epic Knights'n'Mages - Fabric + + + + + +26nL5g7F->7zlUOZvb + + + + + +26nL5g7F->XvoWJaA2 + + + + + +RV1qfVQ8 + + +Explorer's Compass + + + + + +ZJTGwAND + + +End Remastered + + + + + +ZJTGwAND->P7dR8mSH + + + + + +ORX9fPw1 + + +FakerLib + + + + + +ORX9fPw1->P7dR8mSH + + + + + +Fb4jn8m6 + + +FallingTree + + + + + +uXXizFIs + + +FerriteCore + + + + + +ECOSu6pa + + +Friends&Foes - Flowery Mooblooms (Fabric/Quilt) + + + + + +ECOSu6pa->P7dR8mSH + + + + + +ohNO6lps->P7dR8mSH + + + + + +5WeWGLoJ + + +Forge Config Screens + + + + + +5WeWGLoJ->P7dR8mSH + + + + + +5WeWGLoJ->ohNO6lps + + + + + +mOgUt4GM + + +Mod Menu + + + + + +5WeWGLoJ->mOgUt4GM + + + + + +POQ2i9zu + + +Friends&Foes (Fabric/Quilt) + + + + + +POQ2i9zu->P7dR8mSH + + + + + +LJ5wlCDr + + +Fzzy Core + + + + + +LJ5wlCDr->P7dR8mSH + + + + + +LJ5wlCDr->Ha28R6CL + + + + + +XIpMGI6r + + +Gazebos (RPG Series) + + + + + +XIpMGI6r->P7dR8mSH + + + + + +LrYZi08Q + +LrYZi08Q + + + +XIpMGI6r->LrYZi08Q + + + + + +t7eXC8r7 + + +Gear Core + + + + + +t7eXC8r7->P7dR8mSH + + + + + +t7eXC8r7->Ha28R6CL + + + + + +t7eXC8r7->LJ5wlCDr + + + + + +8BmcQJ2H->P7dR8mSH + + + + + +TbriQCWD + + +Iris/Oculus & GeckoLib Compat + + + + + +hl5OLM95 + + +Geophilic + + + + + +f4hp6FTb + + +Grappling Hook Mod: Restitched + + + + + +ssUbhMkL + + +Gravestones + + + + + +ssUbhMkL->P7dR8mSH + + + + + +59rkB3YY + + +Guard Villagers (Fabric/Quilt) + + + + + +59rkB3YY->P7dR8mSH + + + + + +pJmCFF0p + + +Handcrafted + + + + + +pJmCFF0p->P7dR8mSH + + + + + +pJmCFF0p->G1hIVOrD + + + + + +lo90fZoB + + +Heracles + + + + + +lo90fZoB->P7dR8mSH + + + + + +lo90fZoB->G1hIVOrD + + + + + +5faXoLqX + + +Iceberg + + + + + +5ZwdcRci + + +ImmediatelyFast + + + + + +XJ9is6vj + + +ImmersiveMC + + + + + +XJ9is6vj->lhGA9TYQ + + + + + +XJ9is6vj->ohNO6lps + + + + + +eE2Db4YU + + +Immersive Armors + + + + + +CVBAErky + + +Immersive structures + + + + + +fECIioDQ + + +Immersive Structures II: Nether edition + + + + + +Orvt0mRa + + +Indium + + + + + +AANobbMI + + +Sodium + + + + + +Orvt0mRa->AANobbMI + + + + + +5ibSyLAz + + +Inventory Sorting + + + + + +xwHe8V3O + + +Invocations + + + + + +NkGaQMDA + + +Wizards (RPG Series) + + + + + +xwHe8V3O->NkGaQMDA + + + + + +YL57xq9U + + +Iris Shaders + + + + + +YL57xq9U->AANobbMI + + + + + +nvQzSEkH + + +Jade 🔍 + + + + + +u6dRKJwZ + + +Just Enough Items + + + + + +sNJAIjUm + + +Jewelry (RPG Series) + + + + + +sNJAIjUm->P7dR8mSH + + + + + +sNJAIjUm->AqaIIO6D + + + + + +sNJAIjUm->8ooWzSQP + + + + + +sNJAIjUm->5aaWibi9 + + + + + +sNJAIjUm->LrYZi08Q + + + + + +Bb3Fi2JX + + +Kev's TieredZ Modifiers + + + + + +ZSeB6n9M + + +Kev's Equipment Sets + + + + + +jq6pHt0U + + +Kev's Library + + + + + +zxQ8fN7I + + +Kobold Outposts + + + + + +atHH8NyV + + +Legendary Tooltips + + + + + +atHH8NyV->ohNO6lps + + + + + +atHH8NyV->5faXoLqX + + + + + +1OE8wbN0 + + +Prism + + + + + +atHH8NyV->1OE8wbN0 + + + + + +uJXTNuf0 + + +[Let's Do] Camping + + + + + +uJXTNuf0->lhGA9TYQ + + + + + +uJXTNuf0->5aaWibi9 + + + + + +yUBXc3AH + + +LibZ + + + + + +yUBXc3AH->9s6osm5g + + + + + +yUBXc3AH->P7dR8mSH + + + + + +gvQqBUqZ + + +Lithium + + + + + +XaDC71GB + + +Lithostitched + + + + + +67kVxsaO + + +Load My F***ing Tags + + + + + +TqCKvqjC + + +Load My Resources + + + + + +TqCKvqjC->P7dR8mSH + + + + + +oMitr7dU + + +MC Dungeons Armors + + + + + +oMitr7dU->9s6osm5g + + + + + +oMitr7dU->P7dR8mSH + + + + + +Aqlf1Shp + +Aqlf1Shp + + + +oMitr7dU->Aqlf1Shp + + + + + +FYpiwiBR + +FYpiwiBR + + + +oMitr7dU->FYpiwiBR + + + + + +u58R1TMW + +u58R1TMW + + + +oMitr7dU->u58R1TMW + + + + + +FZmGDE43 + + +MC Dungeons Weapons + + + + + +FZmGDE43->9s6osm5g + + + + + +FZmGDE43->P7dR8mSH + + + + + +FZmGDE43->Aqlf1Shp + + + + + +FZmGDE43->FYpiwiBR + + + + + +FZmGDE43->u58R1TMW + + + + + +GURcjz8O + + +Macaw's Bridges + + + + + +GURcjz8O->P7dR8mSH + + + + + +kNxa8z3e + + +Macaw's Doors + + + + + +kNxa8z3e->P7dR8mSH + + + + + +GmwLse2I + + +Macaw's Fences and Walls + + + + + +GmwLse2I->P7dR8mSH + + + + + +dtWC90iB + + +Macaw's Furniture + + + + + +dtWC90iB->P7dR8mSH + + + + + +w4an97C2 + + +Macaw's Lights and Lamps + + + + + +w4an97C2->P7dR8mSH + + + + + +okE6QVAY + + +Macaw's Paintings + + + + + +okE6QVAY->P7dR8mSH + + + + + +VRLhWB91 + + +Macaw's Paths and Pavings + + + + + +VRLhWB91->P7dR8mSH + + + + + +B8jaH3P1 + + +Macaw's Roofs + + + + + +B8jaH3P1->P7dR8mSH + + + + + +n2fvCDlM + + +Macaw's Trapdoors + + + + + +n2fvCDlM->P7dR8mSH + + + + + +C7I0BCni + + +Macaw's Windows + + + + + +C7I0BCni->P7dR8mSH + + + + + +NRjRiSSD + + +Memory Leak Fix + + + + + +9Qdvz1OV + + +Mine Cells - Dead Cells Mod + + + + + +9Qdvz1OV->P7dR8mSH + + + + + +9Qdvz1OV->ccKDOlHs + + + + + +3b1CFIR5 + + +Mob Plaques + + + + + +3b1CFIR5->P7dR8mSH + + + + + +3b1CFIR5->ohNO6lps + + + + + +3b1CFIR5->QAGBst4M + + + + + +avrKhvsK + + +Mobs of Mythology + + + + + +avrKhvsK->lhGA9TYQ + + + + + +avrKhvsK->7zlUOZvb + + + + + +PuyPazRT + + +SmartBrainLib + + + + + +avrKhvsK->PuyPazRT + + + + + +nmDcB62a + + +ModernFix + + + + + +Xt0pMhSq + + +More Totems of Undying + + + + + +51shyZVL + + +More Culling + + + + + +51shyZVL->9s6osm5g + + + + + +JiEhJ3WG + + +More Mob Variants + + + + + +JiEhJ3WG->P7dR8mSH + + + + + +derP0ten + + +Mutant Monsters + + + + + +derP0ten->P7dR8mSH + + + + + +derP0ten->ohNO6lps + + + + + +derP0ten->QAGBst4M + + + + + +kHc6jKsv + + +myLoot + + + + + +kHc6jKsv->P7dR8mSH + + + + + +40ytxGF2 + + +SpoornPacks + + + + + +kHc6jKsv->40ytxGF2 + + + + + +xP7vOoRA + + +Mythic Mounts + + + + + +xP7vOoRA->8BmcQJ2H + + + + + +nU0bVIaL + + +Patchouli + + + + + +xP7vOoRA->nU0bVIaL + + + + + +ERH7cFoy + + +Mythic Upgrades + + + + + +ERH7cFoy->P7dR8mSH + + + + + +ERH7cFoy->ccKDOlHs + + + + + +9daSQ9Yq + + +MythQuest ~ Weapons + + + + + +F8BQNPWX + + +Naturalist + + + + + +F8BQNPWX->8BmcQJ2H + + + + + +fPetb5Kh + + +Nature's Compass + + + + + +1s5x833P + + +Neruina - Ticking Entity Fixer + + + + + +1s5x833P->P7dR8mSH + + + + + +vI1QKJro + + +Nether Depths Upgrade + + + + + +vI1QKJro->8BmcQJ2H + + + + + +nPZr02ET + + +NetherPortalFix + + + + + +nPZr02ET->MBAkmtvl + + + + + +gsJ6q45e + + +Nicer Skies + + + + + +qQyHxfxd + + +No Chat Reports + + + + + +fU7jbFHc->P7dR8mSH + + + + + +ccKDOlHs->P7dR8mSH + + + + + +wOZRkmgG + + +Oxidized + + + + + +wOZRkmgG->P7dR8mSH + + + + + +c7m1mi73 + + +Packet Fixer + + + + + +FxXkHaLe + + +Paladins & Priests (RPG Series) + + + + + +FxXkHaLe->pduQXSbl + + + + + +FxXkHaLe->P7dR8mSH + + + + + +lP9Yrr1E + + +Runes + + + + + +FxXkHaLe->lP9Yrr1E + + + + + +FxXkHaLe->XvoWJaA2 + + + + + +y9clIFY4 + +y9clIFY4 + + + +FxXkHaLe->y9clIFY4 + + + + + +nU0bVIaL->P7dR8mSH + + + + + +tagwiZkJ + + +Polymorph + + + + + +tagwiZkJ->P7dR8mSH + + + + + +rcTfTZr3 + + +Presence Footsteps + + + + + +rcTfTZr3->P7dR8mSH + + + + + +AOyJhFvl + + +Projectile Damage Attribute + + + + + +AOyJhFvl->P7dR8mSH + + + + + +GuE5FpvB + + +Promenade + + + + + +GuE5FpvB->meZK2DCX + + + + + +GuE5FpvB->P7dR8mSH + + + + + +Udc4ShgP + + +Protection Balancer + + + + + +Udc4ShgP->P7dR8mSH + + + + + +Udc4ShgP->P1Kv5EAO + + + + + +FCFcFw09 + + +Pufferfish's Attributes + + + + + +FCFcFw09->P7dR8mSH + + + + + +hqQqvaa4 + + +Pufferfish's Skills + + + + + +hqQqvaa4->P7dR8mSH + + + + + +QAGBst4M->P7dR8mSH + + + + + +QAGBst4M->ohNO6lps + + + + + +AqaIIO6D->P7dR8mSH + + + + + +r3VgI4QN + + +Reacharound + + + + + +r3VgI4QN->P7dR8mSH + + + + + +uZQipe0a + + +ReBalance + + + + + +uZQipe0a->P1Kv5EAO + + + + + +sk4iFZGy + + +Remove Terralith Intro Message + + + + + +8oi3bsk5 + + +Terralith + + + + + +sk4iFZGy->8oi3bsk5 + + + + + +muf0XoRe + + +Repurposed Structures - Quilt/Fabric + + + + + +muf0XoRe->P7dR8mSH + + + + + +codAaoxh + +codAaoxh + + + +muf0XoRe->codAaoxh + + + + + +G1hIVOrD->P7dR8mSH + + + + + +MGRhpQYp + + +Revive + + + + + +MGRhpQYp->9s6osm5g + + + + + +MGRhpQYp->P7dR8mSH + + + + + +3MKqoGuP + + +Rogues & Warriors (RPG Series) + + + + + +3MKqoGuP->pduQXSbl + + + + + +3MKqoGuP->P7dR8mSH + + + + + +3MKqoGuP->XvoWJaA2 + + + + + +lP9Yrr1E->P7dR8mSH + + + + + +lyvwxqAy + + +Simply Skills + + + + + +lyvwxqAy->FCFcFw09 + + + + + +lyvwxqAy->hqQqvaa4 + + + + + +lyvwxqAy->XvoWJaA2 + + + + + +lyvwxqAy->8ooWzSQP + + + + + +bK3Ubu9p + + +Simply Swords + + + + + +bK3Ubu9p->lhGA9TYQ + + + + + +bK3Ubu9p->9s6osm5g + + + + + +rGWEHQrP + + +Small Ships + + + + + +rGWEHQrP->P7dR8mSH + + + + + +BVgHoKxg + + +Hellion's Sniffer+ + + + + + +PtjYWJkn + + +Sodium Extra + + + + + +PtjYWJkn->P7dR8mSH + + + + + +PtjYWJkn->AANobbMI + + + + + +oX6SohLj + + +Marium's Soulslike Weaponry + + + + + +oX6SohLj->lOOpEntO + + + + + +oX6SohLj->P7dR8mSH + + + + + +oX6SohLj->8BmcQJ2H + + + + + +oX6SohLj->AqaIIO6D + + + + + +qyVF9oeo + + +Sound Physics Remastered + + + + + +l6YH9Als + + +spark + + + + + +XvoWJaA2->9s6osm5g + + + + + +XvoWJaA2->P7dR8mSH + + + + + +XvoWJaA2->gedNE4y2 + + + + + +XvoWJaA2->8ooWzSQP + + + + + +XvoWJaA2->5aaWibi9 + + + + + +8ooWzSQP->P7dR8mSH + + + + + +40ytxGF2->P7dR8mSH + + + + + +H8CaAYZC + + +Starlight (Fabric) + + + + + +6L3ydNi8 + + +Starter Kit + + + + + +6L3ydNi8->e0M1UDsY + + + + + +kkmrDlKT->P7dR8mSH + + + + + +QivVPB8W + + +The Graveyard (FABRIC) + + + + + +QivVPB8W->8BmcQJ2H + + + + + +z6sMEexp + + +TieredZ + + + + + +z6sMEexp->8FdYDHF5 + + + + + +z6sMEexp->9s6osm5g + + + + + +z6sMEexp->P7dR8mSH + + + + + +z6sMEexp->yUBXc3AH + + + + + +FGlHZl7X + + +The Lost Castle + + + + + +FGlHZl7X->P7dR8mSH + + + + + +w6JSkKSH + + +Too Fast + + + + + +Pf8PJBb5 + + +True Darkness Refabricated + + + + + +Pf8PJBb5->9s6osm5g + + + + + +1imrOvDk + + +Valentine's Blessing(Lilypads, Roses, Cakes) + + + + + +XiC6HzoU + + +Gliders + + + + + +XiC6HzoU->P7dR8mSH + + + + + +bRAPbNyF + + +Vein Mining + + + + + +bRAPbNyF->P7dR8mSH + + + + + +oHGMwNDR + + +VillagersPlus + + + + + +oHGMwNDR->P7dR8mSH + + + + + +klXONLDA + + +Villages & Pillages + + + + + +klXONLDA->P7dR8mSH + + + + + +klXONLDA->Ua7DFN59 + + + + + +KplTt9Ku + + +Village Spawn Point + + + + + +KplTt9Ku->e0M1UDsY + + + + + +wGoQDPN5 + + +Vivecraft + + + + + +9eGKb6K1 + + +Simple Voice Chat + + + + + +XpGUobxt + + +VR Combat + + + + + +XpGUobxt->5sy6g3kz + + + + + +XpGUobxt->wGoQDPN5 + + + + + +B3INNxum + + +MC VR API + + + + + +B3INNxum->lhGA9TYQ + + + + + +Vr3O6THr + + +Wabi-Sabi Structures + + + + + +Vr3O6THr->P7dR8mSH + + + + + +oUoetxfR + + +Wall-Jump TXF + + + + + +lO0vzQUy + + +way2wayfabric + + + + + +lO0vzQUy->Ha28R6CL + + + + + +8DfbfASn + + +When Dungeons Arise + + + + + +NkGaQMDA->pduQXSbl + + + + + +NkGaQMDA->P7dR8mSH + + + + + +NkGaQMDA->lP9Yrr1E + + + + + +NkGaQMDA->XvoWJaA2 + + + + + +NkGaQMDA->8ooWzSQP + + + + + +sTZr7NVo + + +Wraith Waystones + + + + + +sTZr7NVo->P7dR8mSH + + + + + +sTZr7NVo->ccKDOlHs + + + + + +NcUtCpym + + +Xaero's World Map + + + + + +NcUtCpym->P7dR8mSH + + + + + +1bokaNcj + + +Xaero's Minimap + + + + + +1bokaNcj->P7dR8mSH + + + + + +1eAoo2KR->P7dR8mSH + + + + + +Ua7DFN59->P7dR8mSH + + + + + +XNlO7sBv + + +YUNG's Better Desert Temples + + + + + +XNlO7sBv->9s6osm5g + + + + + +XNlO7sBv->P7dR8mSH + + + + + +XNlO7sBv->Ua7DFN59 + + + + + +o1C1Dkj5 + + +YUNG's Better Dungeons + + + + + +o1C1Dkj5->9s6osm5g + + + + + +o1C1Dkj5->P7dR8mSH + + + + + +o1C1Dkj5->Ua7DFN59 + + + + + +2BwBOmBQ + + +YUNG's Better End Island + + + + + +2BwBOmBQ->9s6osm5g + + + + + +2BwBOmBQ->P7dR8mSH + + + + + +2BwBOmBQ->Ua7DFN59 + + + + + +z9Ve58Ih + + +YUNG's Better Jungle Temples + + + + + +z9Ve58Ih->9s6osm5g + + + + + +z9Ve58Ih->P7dR8mSH + + + + + +z9Ve58Ih->Ua7DFN59 + + + + + +HjmxVlSr + + +YUNG's Better Mineshafts + + + + + +HjmxVlSr->9s6osm5g + + + + + +HjmxVlSr->P7dR8mSH + + + + + +HjmxVlSr->Ua7DFN59 + + + + + +Z2mXHnxP + + +YUNG's Better Nether Fortresses + + + + + +Z2mXHnxP->9s6osm5g + + + + + +Z2mXHnxP->P7dR8mSH + + + + + +Z2mXHnxP->Ua7DFN59 + + + + + +3dT9sgt4 + + +YUNG's Better Ocean Monuments + + + + + +3dT9sgt4->9s6osm5g + + + + + +3dT9sgt4->P7dR8mSH + + + + + +3dT9sgt4->Ua7DFN59 + + + + + +kidLKymU + + +YUNG's Better Strongholds + + + + + +kidLKymU->9s6osm5g + + + + + +kidLKymU->P7dR8mSH + + + + + +kidLKymU->Ua7DFN59 + + + + + +t5FRdP87 + + +YUNG's Better Witch Huts + + + + + +t5FRdP87->9s6osm5g + + + + + +t5FRdP87->P7dR8mSH + + + + + +t5FRdP87->Ua7DFN59 + + + + + +Ht4BfYp6 + + +YUNG's Bridges + + + + + +Ht4BfYp6->9s6osm5g + + + + + +Ht4BfYp6->P7dR8mSH + + + + + +Ht4BfYp6->Ua7DFN59 + + + + + +ZYgyPyfq + + +YUNG's Extras + + + + + +ZYgyPyfq->9s6osm5g + + + + + +ZYgyPyfq->P7dR8mSH + + + + + +ZYgyPyfq->Ua7DFN59 + + + + + +Hcy2DFKF + + +YUNG's Menu Tweaks + + + + + +Hcy2DFKF->9s6osm5g + + + + + +Hcy2DFKF->P7dR8mSH + + + + + +Hcy2DFKF->Ua7DFN59 + + + + + +TLZe11Uj + + +Zenith + + + + + +TLZe11Uj->P7dR8mSH + + + + + +TLZe11Uj->ORX9fPw1 + + + + + +9sxDq6mj + + +Zenith Attributes + + + + + +TLZe11Uj->9sxDq6mj + + + + + +9sxDq6mj->P7dR8mSH + + + + + +9sxDq6mj->ORX9fPw1 + + + + + +14bALK1y + + +Zephyr + + + + + +14bALK1y->XvoWJaA2 + + + + + +14bALK1y->TLZe11Uj + + + + + +L6jvzao4 + + +Epic Knights: Shields Armor and Weapons + + + + + +L6jvzao4->lhGA9TYQ + + + + + +L6jvzao4->9s6osm5g + + + + + +fgmhI8kH + + +ChoiceTheorem's Overhauled Village + + + + + +fgmhI8kH->XaDC71GB + + + + + diff --git a/website/index.html b/website/index.html new file mode 100644 index 0000000..bbbc95e --- /dev/null +++ b/website/index.html @@ -0,0 +1,8 @@ + + +Minecraft Crawler + + +
+ +
\ No newline at end of file diff --git a/website/mods.dot b/website/mods.dot new file mode 100644 index 0000000..2c99f21 --- /dev/null +++ b/website/mods.dot @@ -0,0 +1,511 @@ +digraph ModDependencies { + rankdir=LR; + node [shape=box]; + "defK2XM3" [label="AdventureZ", URL="https://modrinth.com/mod/adventurez"]; + "sdaSaQEz" [label="Almost Unified", URL="https://modrinth.com/mod/almost-unified"]; + "fM515JnW" [label="AmbientSounds", URL="https://modrinth.com/mod/ambientsounds"]; + "k23mNPhZ" [label="Aquamirae", URL="https://modrinth.com/mod/aquamirae"]; + "QgooUXAJ" [label="Archers (RPG Series)", URL="https://modrinth.com/mod/archers"]; + "lhGA9TYQ" [label="Architectury API", URL="https://modrinth.com/mod/architectury-api"]; + "td9zQQBq" [label="Archon", URL="https://modrinth.com/mod/archon"]; + "bb2EpKpx" [label="Argonauts", URL="https://modrinth.com/mod/argonauts"]; + "P0Mu4wcQ" [label="Artifacts", URL="https://modrinth.com/mod/artifacts"]; + "lOOpEntO" [label="AttributeFix", URL="https://modrinth.com/mod/attributefix"]; + "8FdYDHF5" [label="AutoTag", URL="https://modrinth.com/mod/autotag"]; + "7zlUOZvb" [label="AzureLib", URL="https://modrinth.com/mod/azurelib"]; + "pduQXSbl" [label="AzureLib Armor", URL="https://modrinth.com/mod/azurelib-armor"]; + "g96Z4WVZ" [label="BadOptimizations", URL="https://modrinth.com/mod/badoptimizations"]; + "MBAkmtvl" [label="Balm", URL="https://modrinth.com/mod/balm"]; + "sc2Pektv" [label="Basic Weapons", URL="https://modrinth.com/mod/basic-weapons"]; + "BgNRHReB" [label="BCLib", URL="https://modrinth.com/mod/bclib"]; + "Kt4RVKEd" [label="Friends&Foes - Beekeeper Hut (Fabric/Quilt)", URL="https://modrinth.com/mod/friends-and-foes-beekeeper-hut-fabric"]; + "gc8OEnCC" [label="BetterEnd", URL="https://modrinth.com/mod/betterend"]; + "MpzVLzy5" [label="BetterNether", URL="https://modrinth.com/mod/betternether"]; + "zCh7omyG" [label="Better Archeology", URL="https://modrinth.com/mod/better-archeology"]; + "5sy6g3kz" [label="Better Combat", URL="https://modrinth.com/mod/better-combat"]; + "VdEsgz29" [label="Bingus & Floppa", URL="https://modrinth.com/mod/bingusandfloppa"]; + "HXF82T3G" [label="Biomes O' Plenty", URL="https://modrinth.com/mod/biomes-o-plenty"]; + "1VSGxqkt" [label="Block Runner", URL="https://modrinth.com/mod/block-runner"]; + "du3UfiLL" [label="Bosses of Mass Destruction", URL="https://modrinth.com/mod/bosses-of-mass-destruction"]; + "uy4Cnpcm" [label="Bookshelf", URL="https://modrinth.com/mod/bookshelf-lib"]; + "fEWKxVzh" [label="Cadmus", URL="https://modrinth.com/mod/cadmus"]; + "K01OU20C" [label="Cardinal Components API", URL="https://modrinth.com/mod/cardinal-components-api"]; + "cChd25Tw" [label="Cave Dweller Fabric", URL="https://modrinth.com/mod/cave-dweller-fabric"]; + "9s6osm5g" [label="Cloth Config API", URL="https://modrinth.com/mod/cloth-config"]; + "Wnxd13zP" [label="Clumps", URL="https://modrinth.com/mod/clumps"]; + "e0M1UDsY" [label="Collective", URL="https://modrinth.com/mod/collective"]; + "wGKYL7st" [label="Combat Roll", URL="https://modrinth.com/mod/combat-roll"]; + "gMWAhU1n" [label="Convenient Decor", URL="https://modrinth.com/mod/convenient-decor"]; + "OsZiaDHq" [label="CreativeCore", URL="https://modrinth.com/mod/creativecore"]; + "MI1LWe93" [label="Creeper Overhaul", URL="https://modrinth.com/mod/creeper-overhaul"]; + "cl223EMc" [label="Cristel Lib", URL="https://modrinth.com/mod/cristel-lib"]; + "meZK2DCX" [label="Dawn API", URL="https://modrinth.com/mod/dawn"]; + "QwxR6Gcd" [label="Debugify", URL="https://modrinth.com/mod/debugify"]; + "t6BIRVZn" [label="Decorative Blocks", URL="https://modrinth.com/mod/decorative-blocks"]; + "fnAffV0n" [label="Deeper and Darker", URL="https://modrinth.com/mod/deeperdarker"]; + "US6QuKdU" [label="DEUF Refabricated", URL="https://modrinth.com/mod/deuf-refabricated"]; + "445bpKSe" [label="Dimensional Sync Fixes", URL="https://modrinth.com/mod/dimensional-sync-fixes"]; + "uCdwusMi" [label="Distant Horizons", URL="https://modrinth.com/mod/distanthorizons"]; + "JrvR9OHr" [label="Double Doors", URL="https://modrinth.com/mod/double-doors"]; + "vZoqTqwv" [label="Dungeon Now Loading", URL="https://modrinth.com/mod/dungeon-now-loading"]; + "tpehi7ww" [label="Dungeons and Taverns", URL="https://modrinth.com/mod/dungeons-and-taverns"]; + "ENZmbSFZ" [label="Dungeon Difficulty", URL="https://modrinth.com/mod/dungeon-difficulty"]; + "7YjclEGc" [label="Dynamic Lights", URL="https://modrinth.com/mod/dynamic-lights"]; + "nBaXIQY9" [label="Eldritch End", URL="https://modrinth.com/mod/eldritch-end"]; + "fRiHVvU7" [label="EMI", URL="https://modrinth.com/mod/emi"]; + "OVuFYfre" [label="Enhanced Block Entities", URL="https://modrinth.com/mod/ebe"]; + "NNAgCjsB" [label="Entity Culling", URL="https://modrinth.com/mod/entityculling"]; + "4I1XuqiY" [label="[EMF] Entity Model Features", URL="https://modrinth.com/mod/entity-model-features"]; + "BVzZfTc1" [label="[ETF] Entity Texture Features", URL="https://modrinth.com/mod/entitytexturefeatures"]; + "26nL5g7F" [label="Epic Knights'n'Mages - Fabric", URL="https://modrinth.com/mod/epic-knightsnmages-fabric"]; + "RV1qfVQ8" [label="Explorer's Compass", URL="https://modrinth.com/mod/explorers-compass"]; + "P7dR8mSH" [label="Fabric API", URL="https://modrinth.com/mod/fabric-api"]; + "ZJTGwAND" [label="End Remastered", URL="https://modrinth.com/mod/endrem"]; + "Ha28R6CL" [label="Fabric Language Kotlin", URL="https://modrinth.com/mod/fabric-language-kotlin"]; + "ORX9fPw1" [label="FakerLib", URL="https://modrinth.com/mod/fakerlib"]; + "Fb4jn8m6" [label="FallingTree", URL="https://modrinth.com/mod/fallingtree"]; + "uXXizFIs" [label="FerriteCore", URL="https://modrinth.com/mod/ferrite-core"]; + "ECOSu6pa" [label="Friends&Foes - Flowery Mooblooms (Fabric/Quilt)", URL="https://modrinth.com/mod/friends-and-foes-flowery-mooblooms-fabric"]; + "ohNO6lps" [label="Forge Config API Port", URL="https://modrinth.com/mod/forge-config-api-port"]; + "5WeWGLoJ" [label="Forge Config Screens", URL="https://modrinth.com/mod/forge-config-screens"]; + "POQ2i9zu" [label="Friends&Foes (Fabric/Quilt)", URL="https://modrinth.com/mod/friends-and-foes"]; + "LJ5wlCDr" [label="Fzzy Core", URL="https://modrinth.com/mod/fzzy-core"]; + "XIpMGI6r" [label="Gazebos (RPG Series)", URL="https://modrinth.com/mod/gazebos"]; + "t7eXC8r7" [label="Gear Core", URL="https://modrinth.com/mod/gear-core"]; + "8BmcQJ2H" [label="Geckolib", URL="https://modrinth.com/mod/geckolib"]; + "TbriQCWD" [label="Iris/Oculus & GeckoLib Compat", URL="https://modrinth.com/mod/geckoanimfix"]; + "hl5OLM95" [label="Geophilic", URL="https://modrinth.com/mod/geophilic"]; + "f4hp6FTb" [label="Grappling Hook Mod: Restitched", URL="https://modrinth.com/mod/grappling-hook-mod-fabric"]; + "ssUbhMkL" [label="Gravestones", URL="https://modrinth.com/mod/gravestones"]; + "59rkB3YY" [label="Guard Villagers (Fabric/Quilt)", URL="https://modrinth.com/mod/guard-villagers-(fabricquilt)"]; + "pJmCFF0p" [label="Handcrafted", URL="https://modrinth.com/mod/handcrafted"]; + "lo90fZoB" [label="Heracles", URL="https://modrinth.com/mod/heracles"]; + "5faXoLqX" [label="Iceberg", URL="https://modrinth.com/mod/iceberg"]; + "5ZwdcRci" [label="ImmediatelyFast", URL="https://modrinth.com/mod/immediatelyfast"]; + "XJ9is6vj" [label="ImmersiveMC", URL="https://modrinth.com/mod/immersivemc"]; + "eE2Db4YU" [label="Immersive Armors", URL="https://modrinth.com/mod/immersive-armors"]; + "CVBAErky" [label="Immersive structures", URL="https://modrinth.com/mod/immersive-structures"]; + "fECIioDQ" [label="Immersive Structures II: Nether edition", URL="https://modrinth.com/mod/immersive-structures-ii"]; + "Orvt0mRa" [label="Indium", URL="https://modrinth.com/mod/indium"]; + "5ibSyLAz" [label="Inventory Sorting", URL="https://modrinth.com/mod/inventory-sorting"]; + "xwHe8V3O" [label="Invocations", URL="https://modrinth.com/mod/invocations"]; + "YL57xq9U" [label="Iris Shaders", URL="https://modrinth.com/mod/iris"]; + "nvQzSEkH" [label="Jade 🔍", URL="https://modrinth.com/mod/jade"]; + "u6dRKJwZ" [label="Just Enough Items", URL="https://modrinth.com/mod/jei"]; + "sNJAIjUm" [label="Jewelry (RPG Series)", URL="https://modrinth.com/mod/jewelry"]; + "Bb3Fi2JX" [label="Kev's TieredZ Modifiers", URL="https://modrinth.com/mod/kevs-tieredz-modifiers"]; + "ZSeB6n9M" [label="Kev's Equipment Sets", URL="https://modrinth.com/mod/kevs-equipment-sets"]; + "jq6pHt0U" [label="Kev's Library", URL="https://modrinth.com/mod/kevs-library"]; + "zxQ8fN7I" [label="Kobold Outposts", URL="https://modrinth.com/mod/kobold-outposts"]; + "atHH8NyV" [label="Legendary Tooltips", URL="https://modrinth.com/mod/legendary-tooltips"]; + "uJXTNuf0" [label="[Let's Do] Camping", URL="https://modrinth.com/mod/lets-do-camping"]; + "yUBXc3AH" [label="LibZ", URL="https://modrinth.com/mod/libz"]; + "gvQqBUqZ" [label="Lithium", URL="https://modrinth.com/mod/lithium"]; + "XaDC71GB" [label="Lithostitched", URL="https://modrinth.com/mod/lithostitched"]; + "67kVxsaO" [label="Load My F***ing Tags", URL="https://modrinth.com/mod/lmft"]; + "TqCKvqjC" [label="Load My Resources", URL="https://modrinth.com/mod/load-my-resources"]; + "oMitr7dU" [label="MC Dungeons Armors", URL="https://modrinth.com/mod/mcda"]; + "FZmGDE43" [label="MC Dungeons Weapons", URL="https://modrinth.com/mod/mcdw"]; + "GURcjz8O" [label="Macaw's Bridges", URL="https://modrinth.com/mod/macaws-bridges"]; + "kNxa8z3e" [label="Macaw's Doors", URL="https://modrinth.com/mod/macaws-doors"]; + "GmwLse2I" [label="Macaw's Fences and Walls", URL="https://modrinth.com/mod/macaws-fences-and-walls"]; + "dtWC90iB" [label="Macaw's Furniture", URL="https://modrinth.com/mod/macaws-furniture"]; + "w4an97C2" [label="Macaw's Lights and Lamps", URL="https://modrinth.com/mod/macaws-lights-and-lamps"]; + "okE6QVAY" [label="Macaw's Paintings", URL="https://modrinth.com/mod/macaws-paintings"]; + "VRLhWB91" [label="Macaw's Paths and Pavings", URL="https://modrinth.com/mod/macaws-paths-and-pavings"]; + "B8jaH3P1" [label="Macaw's Roofs", URL="https://modrinth.com/mod/macaws-roofs"]; + "n2fvCDlM" [label="Macaw's Trapdoors", URL="https://modrinth.com/mod/macaws-trapdoors"]; + "C7I0BCni" [label="Macaw's Windows", URL="https://modrinth.com/mod/macaws-windows"]; + "NRjRiSSD" [label="Memory Leak Fix", URL="https://modrinth.com/mod/memoryleakfix"]; + "9Qdvz1OV" [label="Mine Cells - Dead Cells Mod", URL="https://modrinth.com/mod/minecells"]; + "3b1CFIR5" [label="Mob Plaques", URL="https://modrinth.com/mod/mob-plaques"]; + "avrKhvsK" [label="Mobs of Mythology", URL="https://modrinth.com/mod/mobs-of-mythology"]; + "nmDcB62a" [label="ModernFix", URL="https://modrinth.com/mod/modernfix"]; + "mOgUt4GM" [label="Mod Menu", URL="https://modrinth.com/mod/modmenu"]; + "Xt0pMhSq" [label="More Totems of Undying", URL="https://modrinth.com/mod/more-totems-of-undying"]; + "51shyZVL" [label="More Culling", URL="https://modrinth.com/mod/moreculling"]; + "JiEhJ3WG" [label="More Mob Variants", URL="https://modrinth.com/mod/more-mob-variants"]; + "derP0ten" [label="Mutant Monsters", URL="https://modrinth.com/mod/mutant-monsters"]; + "kHc6jKsv" [label="myLoot", URL="https://modrinth.com/mod/myloot"]; + "xP7vOoRA" [label="Mythic Mounts", URL="https://modrinth.com/mod/mythic-mounts"]; + "ERH7cFoy" [label="Mythic Upgrades", URL="https://modrinth.com/mod/mythic-upgrades"]; + "9daSQ9Yq" [label="MythQuest ~ Weapons", URL="https://modrinth.com/mod/mythquest"]; + "F8BQNPWX" [label="Naturalist", URL="https://modrinth.com/mod/naturalist"]; + "fPetb5Kh" [label="Nature's Compass", URL="https://modrinth.com/mod/natures-compass"]; + "P1Kv5EAO" [label="Necronomicon API", URL="https://modrinth.com/mod/necronomicon"]; + "1s5x833P" [label="Neruina - Ticking Entity Fixer", URL="https://modrinth.com/mod/neruina"]; + "vI1QKJro" [label="Nether Depths Upgrade", URL="https://modrinth.com/mod/nether-depths-upgrade"]; + "nPZr02ET" [label="NetherPortalFix", URL="https://modrinth.com/mod/netherportalfix"]; + "gsJ6q45e" [label="Nicer Skies", URL="https://modrinth.com/mod/nicer-skies"]; + "qQyHxfxd" [label="No Chat Reports", URL="https://modrinth.com/mod/no-chat-reports"]; + "fU7jbFHc" [label="Obscure API", URL="https://modrinth.com/mod/obscure-api"]; + "ccKDOlHs" [label="oωo (owo-lib)", URL="https://modrinth.com/mod/owo-lib"]; + "wOZRkmgG" [label="Oxidized", URL="https://modrinth.com/mod/oxidized"]; + "c7m1mi73" [label="Packet Fixer", URL="https://modrinth.com/mod/packet-fixer"]; + "FxXkHaLe" [label="Paladins & Priests (RPG Series)", URL="https://modrinth.com/mod/paladins-and-priests"]; + "nU0bVIaL" [label="Patchouli", URL="https://modrinth.com/mod/patchouli"]; + "gedNE4y2" [label="playerAnimator", URL="https://modrinth.com/mod/playeranimator"]; + "tagwiZkJ" [label="Polymorph", URL="https://modrinth.com/mod/polymorph"]; + "rcTfTZr3" [label="Presence Footsteps", URL="https://modrinth.com/mod/presence-footsteps"]; + "1OE8wbN0" [label="Prism", URL="https://modrinth.com/mod/prism-lib"]; + "AOyJhFvl" [label="Projectile Damage Attribute", URL="https://modrinth.com/mod/projectile-damage-attribute"]; + "GuE5FpvB" [label="Promenade", URL="https://modrinth.com/mod/promenade"]; + "Udc4ShgP" [label="Protection Balancer", URL="https://modrinth.com/mod/protection-balancer"]; + "FCFcFw09" [label="Pufferfish's Attributes", URL="https://modrinth.com/mod/attributes"]; + "hqQqvaa4" [label="Pufferfish's Skills", URL="https://modrinth.com/mod/skills"]; + "QAGBst4M" [label="Puzzles Lib", URL="https://modrinth.com/mod/puzzles-lib"]; + "AqaIIO6D" [label="Ranged Weapon API", URL="https://modrinth.com/mod/ranged-weapon-api"]; + "r3VgI4QN" [label="Reacharound", URL="https://modrinth.com/mod/reacharound"]; + "uZQipe0a" [label="ReBalance", URL="https://modrinth.com/mod/rebalance"]; + "sk4iFZGy" [label="Remove Terralith Intro Message", URL="https://modrinth.com/mod/remove-terralith-intro-message"]; + "muf0XoRe" [label="Repurposed Structures - Quilt/Fabric", URL="https://modrinth.com/mod/repurposed-structures-fabric"]; + "G1hIVOrD" [label="Resourceful Lib", URL="https://modrinth.com/mod/resourceful-lib"]; + "M1953qlQ" [label="Resourceful Config", URL="https://modrinth.com/mod/resourceful-config"]; + "MGRhpQYp" [label="Revive", URL="https://modrinth.com/mod/revive"]; + "3MKqoGuP" [label="Rogues & Warriors (RPG Series)", URL="https://modrinth.com/mod/rogues-and-warriors"]; + "lP9Yrr1E" [label="Runes", URL="https://modrinth.com/mod/runes"]; + "lyvwxqAy" [label="Simply Skills", URL="https://modrinth.com/mod/simply-skills"]; + "bK3Ubu9p" [label="Simply Swords", URL="https://modrinth.com/mod/simply-swords"]; + "rGWEHQrP" [label="Small Ships", URL="https://modrinth.com/mod/small-ships"]; + "PuyPazRT" [label="SmartBrainLib", URL="https://modrinth.com/mod/smartbrainlib"]; + "BVgHoKxg" [label="Hellion's Sniffer+", URL="https://modrinth.com/mod/hellions-sniffer+"]; + "PtjYWJkn" [label="Sodium Extra", URL="https://modrinth.com/mod/sodium-extra"]; + "AANobbMI" [label="Sodium", URL="https://modrinth.com/mod/sodium"]; + "oX6SohLj" [label="Marium's Soulslike Weaponry", URL="https://modrinth.com/mod/mariums-soulslike-weaponry"]; + "qyVF9oeo" [label="Sound Physics Remastered", URL="https://modrinth.com/mod/sound-physics-remastered"]; + "l6YH9Als" [label="spark", URL="https://modrinth.com/mod/spark"]; + "XvoWJaA2" [label="Spell Engine", URL="https://modrinth.com/mod/spell-engine"]; + "8ooWzSQP" [label="Spell Power Attributes", URL="https://modrinth.com/mod/spell-power"]; + "40ytxGF2" [label="SpoornPacks", URL="https://modrinth.com/mod/spoornpacks"]; + "H8CaAYZC" [label="Starlight (Fabric)", URL="https://modrinth.com/mod/starlight"]; + "6L3ydNi8" [label="Starter Kit", URL="https://modrinth.com/mod/starter-kit"]; + "kkmrDlKT" [label="TerraBlender", URL="https://modrinth.com/mod/terrablender"]; + "8oi3bsk5" [label="Terralith", URL="https://modrinth.com/mod/terralith"]; + "QivVPB8W" [label="The Graveyard (FABRIC)", URL="https://modrinth.com/mod/the-graveyard-fabric"]; + "z6sMEexp" [label="TieredZ", URL="https://modrinth.com/mod/tieredz"]; + "FGlHZl7X" [label="The Lost Castle", URL="https://modrinth.com/mod/the-lost-castle"]; + "w6JSkKSH" [label="Too Fast", URL="https://modrinth.com/mod/too-fast"]; + "5aaWibi9" [label="Trinkets", URL="https://modrinth.com/mod/trinkets"]; + "Pf8PJBb5" [label="True Darkness Refabricated", URL="https://modrinth.com/mod/true-darkness-fabric"]; + "1imrOvDk" [label="Valentine's Blessing(Lilypads, Roses, Cakes)", URL="https://modrinth.com/mod/valentines-blessing-lilypads-roses"]; + "XiC6HzoU" [label="Gliders", URL="https://modrinth.com/mod/gliders"]; + "bRAPbNyF" [label="Vein Mining", URL="https://modrinth.com/mod/vein-mining"]; + "oHGMwNDR" [label="VillagersPlus", URL="https://modrinth.com/mod/villagersplus"]; + "klXONLDA" [label="Villages & Pillages", URL="https://modrinth.com/mod/villages-and-pillages"]; + "KplTt9Ku" [label="Village Spawn Point", URL="https://modrinth.com/mod/village-spawn-point"]; + "wGoQDPN5" [label="Vivecraft", URL="https://modrinth.com/mod/vivecraft"]; + "9eGKb6K1" [label="Simple Voice Chat", URL="https://modrinth.com/mod/simple-voice-chat"]; + "XpGUobxt" [label="VR Combat", URL="https://modrinth.com/mod/vr-combat"]; + "B3INNxum" [label="MC VR API", URL="https://modrinth.com/mod/mc-vr-api"]; + "Vr3O6THr" [label="Wabi-Sabi Structures", URL="https://modrinth.com/mod/wabi-sabi-structures"]; + "oUoetxfR" [label="Wall-Jump TXF", URL="https://modrinth.com/mod/wall-jump-txf"]; + "lO0vzQUy" [label="way2wayfabric", URL="https://modrinth.com/mod/way2wayfabric"]; + "8DfbfASn" [label="When Dungeons Arise", URL="https://modrinth.com/mod/when-dungeons-arise"]; + "NkGaQMDA" [label="Wizards (RPG Series)", URL="https://modrinth.com/mod/wizards"]; + "sTZr7NVo" [label="Wraith Waystones", URL="https://modrinth.com/mod/fwaystones"]; + "NcUtCpym" [label="Xaero's World Map", URL="https://modrinth.com/mod/xaeros-world-map"]; + "1bokaNcj" [label="Xaero's Minimap", URL="https://modrinth.com/mod/xaeros-minimap"]; + "1eAoo2KR" [label="YetAnotherConfigLib", URL="https://modrinth.com/mod/yacl"]; + "Ua7DFN59" [label="YUNG's API", URL="https://modrinth.com/mod/yungs-api"]; + "XNlO7sBv" [label="YUNG's Better Desert Temples", URL="https://modrinth.com/mod/yungs-better-desert-temples"]; + "o1C1Dkj5" [label="YUNG's Better Dungeons", URL="https://modrinth.com/mod/yungs-better-dungeons"]; + "2BwBOmBQ" [label="YUNG's Better End Island", URL="https://modrinth.com/mod/yungs-better-end-island"]; + "z9Ve58Ih" [label="YUNG's Better Jungle Temples", URL="https://modrinth.com/mod/yungs-better-jungle-temples"]; + "HjmxVlSr" [label="YUNG's Better Mineshafts", URL="https://modrinth.com/mod/yungs-better-mineshafts"]; + "Z2mXHnxP" [label="YUNG's Better Nether Fortresses", URL="https://modrinth.com/mod/yungs-better-nether-fortresses"]; + "3dT9sgt4" [label="YUNG's Better Ocean Monuments", URL="https://modrinth.com/mod/yungs-better-ocean-monuments"]; + "kidLKymU" [label="YUNG's Better Strongholds", URL="https://modrinth.com/mod/yungs-better-strongholds"]; + "t5FRdP87" [label="YUNG's Better Witch Huts", URL="https://modrinth.com/mod/yungs-better-witch-huts"]; + "Ht4BfYp6" [label="YUNG's Bridges", URL="https://modrinth.com/mod/yungs-bridges"]; + "ZYgyPyfq" [label="YUNG's Extras", URL="https://modrinth.com/mod/yungs-extras"]; + "Hcy2DFKF" [label="YUNG's Menu Tweaks", URL="https://modrinth.com/mod/yungs-menu-tweaks"]; + "TLZe11Uj" [label="Zenith", URL="https://modrinth.com/mod/zenith"]; + "9sxDq6mj" [label="Zenith Attributes", URL="https://modrinth.com/mod/zenith-attributes"]; + "14bALK1y" [label="Zephyr", URL="https://modrinth.com/mod/zephyr-mod"]; + "L6jvzao4" [label="Epic Knights: Shields Armor and Weapons", URL="https://modrinth.com/mod/epic-knights-shields-armor-and-weapons"]; + "fgmhI8kH" [label="ChoiceTheorem's Overhauled Village", URL="https://modrinth.com/mod/ct-overhaul-village"]; + "defK2XM3" -> "P7dR8mSH"; + "defK2XM3" -> "9s6osm5g"; + "fM515JnW" -> "OsZiaDHq"; + "fM515JnW" -> "P7dR8mSH"; + "k23mNPhZ" -> "P7dR8mSH"; + "k23mNPhZ" -> "fU7jbFHc"; + "QgooUXAJ" -> "AqaIIO6D"; + "QgooUXAJ" -> "P7dR8mSH"; + "QgooUXAJ" -> "XvoWJaA2"; + "QgooUXAJ" -> "pduQXSbl"; + "lhGA9TYQ" -> "P7dR8mSH"; + "td9zQQBq" -> "8ooWzSQP"; + "td9zQQBq" -> "P7dR8mSH"; + "bb2EpKpx" -> "G1hIVOrD"; + "bb2EpKpx" -> "P7dR8mSH"; + "P0Mu4wcQ" -> "5aaWibi9"; + "P0Mu4wcQ" -> "9s6osm5g"; + "P0Mu4wcQ" -> "lhGA9TYQ"; + "lOOpEntO" -> "P7dR8mSH"; + "7zlUOZvb" -> "P7dR8mSH"; + "MBAkmtvl" -> "P7dR8mSH"; + "BgNRHReB" -> "P7dR8mSH"; + "Kt4RVKEd" -> "P7dR8mSH"; + "gc8OEnCC" -> "BgNRHReB"; + "gc8OEnCC" -> "P7dR8mSH"; + "MpzVLzy5" -> "BgNRHReB"; + "MpzVLzy5" -> "P7dR8mSH"; + "zCh7omyG" -> "Ua7DFN59"; + "5sy6g3kz" -> "9s6osm5g"; + "5sy6g3kz" -> "P7dR8mSH"; + "5sy6g3kz" -> "gedNE4y2"; + "HXF82T3G" -> "kkmrDlKT"; + "1VSGxqkt" -> "QAGBst4M"; + "1VSGxqkt" -> "ohNO6lps"; + "1VSGxqkt" -> "P7dR8mSH"; + "du3UfiLL" -> "8BmcQJ2H"; + "du3UfiLL" -> "9s6osm5g"; + "du3UfiLL" -> "Ha28R6CL"; + "du3UfiLL" -> "K01OU20C"; + "du3UfiLL" -> "P7dR8mSH"; + "uy4Cnpcm" -> "P7dR8mSH"; + "fEWKxVzh" -> "G1hIVOrD"; + "fEWKxVzh" -> "P7dR8mSH"; + "cChd25Tw" -> "8BmcQJ2H"; + "cChd25Tw" -> "P7dR8mSH"; + "cChd25Tw" -> "ccKDOlHs"; + "Wnxd13zP" -> "P7dR8mSH"; + "wGKYL7st" -> "gedNE4y2"; + "wGKYL7st" -> "9s6osm5g"; + "wGKYL7st" -> "P7dR8mSH"; + "gMWAhU1n" -> "P7dR8mSH"; + "OsZiaDHq" -> "P7dR8mSH"; + "MI1LWe93" -> "8BmcQJ2H"; + "MI1LWe93" -> "G1hIVOrD"; + "MI1LWe93" -> "M1953qlQ"; + "cl223EMc" -> "P7dR8mSH"; + "meZK2DCX" -> "P7dR8mSH"; + "QwxR6Gcd" -> "1eAoo2KR"; + "t6BIRVZn" -> "P7dR8mSH"; + "fnAffV0n" -> "1eAoo2KR"; + "fnAffV0n" -> "P7dR8mSH"; + "JrvR9OHr" -> "e0M1UDsY"; + "ENZmbSFZ" -> "AqaIIO6D"; + "ENZmbSFZ" -> "P7dR8mSH"; + "nBaXIQY9" -> "7zlUOZvb"; + "nBaXIQY9" -> "P1Kv5EAO"; + "OVuFYfre" -> "P7dR8mSH"; + "NNAgCjsB" -> "P7dR8mSH"; + "4I1XuqiY" -> "BVzZfTc1"; + "26nL5g7F" -> "7zlUOZvb"; + "26nL5g7F" -> "XvoWJaA2"; + "ZJTGwAND" -> "P7dR8mSH"; + "ORX9fPw1" -> "P7dR8mSH"; + "ECOSu6pa" -> "P7dR8mSH"; + "ohNO6lps" -> "P7dR8mSH"; + "5WeWGLoJ" -> "P7dR8mSH"; + "5WeWGLoJ" -> "mOgUt4GM"; + "5WeWGLoJ" -> "ohNO6lps"; + "POQ2i9zu" -> "P7dR8mSH"; + "LJ5wlCDr" -> "Ha28R6CL"; + "LJ5wlCDr" -> "P7dR8mSH"; + "XIpMGI6r" -> "LrYZi08Q"; + "XIpMGI6r" -> "P7dR8mSH"; + "t7eXC8r7" -> "Ha28R6CL"; + "t7eXC8r7" -> "LJ5wlCDr"; + "t7eXC8r7" -> "P7dR8mSH"; + "8BmcQJ2H" -> "P7dR8mSH"; + "ssUbhMkL" -> "P7dR8mSH"; + "59rkB3YY" -> "P7dR8mSH"; + "pJmCFF0p" -> "G1hIVOrD"; + "pJmCFF0p" -> "P7dR8mSH"; + "lo90fZoB" -> "G1hIVOrD"; + "lo90fZoB" -> "P7dR8mSH"; + "XJ9is6vj" -> "ohNO6lps"; + "XJ9is6vj" -> "lhGA9TYQ"; + "Orvt0mRa" -> "AANobbMI"; + "xwHe8V3O" -> "NkGaQMDA"; + "YL57xq9U" -> "AANobbMI"; + "sNJAIjUm" -> "5aaWibi9"; + "sNJAIjUm" -> "8ooWzSQP"; + "sNJAIjUm" -> "AqaIIO6D"; + "sNJAIjUm" -> "LrYZi08Q"; + "sNJAIjUm" -> "P7dR8mSH"; + "atHH8NyV" -> "1OE8wbN0"; + "atHH8NyV" -> "5faXoLqX"; + "atHH8NyV" -> "ohNO6lps"; + "uJXTNuf0" -> "5aaWibi9"; + "uJXTNuf0" -> "lhGA9TYQ"; + "yUBXc3AH" -> "9s6osm5g"; + "yUBXc3AH" -> "P7dR8mSH"; + "TqCKvqjC" -> "P7dR8mSH"; + "oMitr7dU" -> "Aqlf1Shp"; + "oMitr7dU" -> "FYpiwiBR"; + "oMitr7dU" -> "9s6osm5g"; + "oMitr7dU" -> "u58R1TMW"; + "oMitr7dU" -> "P7dR8mSH"; + "FZmGDE43" -> "9s6osm5g"; + "FZmGDE43" -> "Aqlf1Shp"; + "FZmGDE43" -> "FYpiwiBR"; + "FZmGDE43" -> "P7dR8mSH"; + "FZmGDE43" -> "u58R1TMW"; + "GURcjz8O" -> "P7dR8mSH"; + "kNxa8z3e" -> "P7dR8mSH"; + "GmwLse2I" -> "P7dR8mSH"; + "dtWC90iB" -> "P7dR8mSH"; + "w4an97C2" -> "P7dR8mSH"; + "okE6QVAY" -> "P7dR8mSH"; + "VRLhWB91" -> "P7dR8mSH"; + "B8jaH3P1" -> "P7dR8mSH"; + "n2fvCDlM" -> "P7dR8mSH"; + "C7I0BCni" -> "P7dR8mSH"; + "9Qdvz1OV" -> "P7dR8mSH"; + "9Qdvz1OV" -> "ccKDOlHs"; + "3b1CFIR5" -> "P7dR8mSH"; + "3b1CFIR5" -> "QAGBst4M"; + "3b1CFIR5" -> "ohNO6lps"; + "avrKhvsK" -> "7zlUOZvb"; + "avrKhvsK" -> "PuyPazRT"; + "avrKhvsK" -> "lhGA9TYQ"; + "51shyZVL" -> "9s6osm5g"; + "JiEhJ3WG" -> "P7dR8mSH"; + "derP0ten" -> "ohNO6lps"; + "derP0ten" -> "QAGBst4M"; + "derP0ten" -> "P7dR8mSH"; + "kHc6jKsv" -> "40ytxGF2"; + "kHc6jKsv" -> "P7dR8mSH"; + "xP7vOoRA" -> "nU0bVIaL"; + "xP7vOoRA" -> "8BmcQJ2H"; + "ERH7cFoy" -> "P7dR8mSH"; + "ERH7cFoy" -> "ccKDOlHs"; + "F8BQNPWX" -> "8BmcQJ2H"; + "1s5x833P" -> "P7dR8mSH"; + "vI1QKJro" -> "8BmcQJ2H"; + "nPZr02ET" -> "MBAkmtvl"; + "fU7jbFHc" -> "P7dR8mSH"; + "ccKDOlHs" -> "P7dR8mSH"; + "wOZRkmgG" -> "P7dR8mSH"; + "FxXkHaLe" -> "P7dR8mSH"; + "FxXkHaLe" -> "XvoWJaA2"; + "FxXkHaLe" -> "lP9Yrr1E"; + "FxXkHaLe" -> "pduQXSbl"; + "FxXkHaLe" -> "y9clIFY4"; + "nU0bVIaL" -> "P7dR8mSH"; + "tagwiZkJ" -> "P7dR8mSH"; + "rcTfTZr3" -> "P7dR8mSH"; + "AOyJhFvl" -> "P7dR8mSH"; + "GuE5FpvB" -> "P7dR8mSH"; + "GuE5FpvB" -> "meZK2DCX"; + "Udc4ShgP" -> "P1Kv5EAO"; + "Udc4ShgP" -> "P7dR8mSH"; + "FCFcFw09" -> "P7dR8mSH"; + "hqQqvaa4" -> "P7dR8mSH"; + "QAGBst4M" -> "ohNO6lps"; + "QAGBst4M" -> "P7dR8mSH"; + "AqaIIO6D" -> "P7dR8mSH"; + "r3VgI4QN" -> "P7dR8mSH"; + "uZQipe0a" -> "P1Kv5EAO"; + "sk4iFZGy" -> "8oi3bsk5"; + "muf0XoRe" -> "P7dR8mSH"; + "muf0XoRe" -> "codAaoxh"; + "G1hIVOrD" -> "P7dR8mSH"; + "MGRhpQYp" -> "9s6osm5g"; + "MGRhpQYp" -> "P7dR8mSH"; + "3MKqoGuP" -> "P7dR8mSH"; + "3MKqoGuP" -> "XvoWJaA2"; + "3MKqoGuP" -> "pduQXSbl"; + "lP9Yrr1E" -> "P7dR8mSH"; + "lyvwxqAy" -> "8ooWzSQP"; + "lyvwxqAy" -> "FCFcFw09"; + "lyvwxqAy" -> "XvoWJaA2"; + "lyvwxqAy" -> "hqQqvaa4"; + "bK3Ubu9p" -> "9s6osm5g"; + "bK3Ubu9p" -> "lhGA9TYQ"; + "rGWEHQrP" -> "P7dR8mSH"; + "PtjYWJkn" -> "AANobbMI"; + "PtjYWJkn" -> "P7dR8mSH"; + "oX6SohLj" -> "AqaIIO6D"; + "oX6SohLj" -> "8BmcQJ2H"; + "oX6SohLj" -> "lOOpEntO"; + "oX6SohLj" -> "P7dR8mSH"; + "XvoWJaA2" -> "5aaWibi9"; + "XvoWJaA2" -> "8ooWzSQP"; + "XvoWJaA2" -> "9s6osm5g"; + "XvoWJaA2" -> "P7dR8mSH"; + "XvoWJaA2" -> "gedNE4y2"; + "8ooWzSQP" -> "P7dR8mSH"; + "40ytxGF2" -> "P7dR8mSH"; + "6L3ydNi8" -> "e0M1UDsY"; + "kkmrDlKT" -> "P7dR8mSH"; + "QivVPB8W" -> "8BmcQJ2H"; + "z6sMEexp" -> "8FdYDHF5"; + "z6sMEexp" -> "9s6osm5g"; + "z6sMEexp" -> "P7dR8mSH"; + "z6sMEexp" -> "yUBXc3AH"; + "FGlHZl7X" -> "P7dR8mSH"; + "Pf8PJBb5" -> "9s6osm5g"; + "XiC6HzoU" -> "P7dR8mSH"; + "bRAPbNyF" -> "P7dR8mSH"; + "oHGMwNDR" -> "P7dR8mSH"; + "klXONLDA" -> "Ua7DFN59"; + "klXONLDA" -> "P7dR8mSH"; + "KplTt9Ku" -> "e0M1UDsY"; + "XpGUobxt" -> "5sy6g3kz"; + "XpGUobxt" -> "wGoQDPN5"; + "B3INNxum" -> "lhGA9TYQ"; + "Vr3O6THr" -> "P7dR8mSH"; + "lO0vzQUy" -> "Ha28R6CL"; + "NkGaQMDA" -> "8ooWzSQP"; + "NkGaQMDA" -> "P7dR8mSH"; + "NkGaQMDA" -> "XvoWJaA2"; + "NkGaQMDA" -> "lP9Yrr1E"; + "NkGaQMDA" -> "pduQXSbl"; + "sTZr7NVo" -> "P7dR8mSH"; + "sTZr7NVo" -> "ccKDOlHs"; + "NcUtCpym" -> "P7dR8mSH"; + "1bokaNcj" -> "P7dR8mSH"; + "1eAoo2KR" -> "P7dR8mSH"; + "Ua7DFN59" -> "P7dR8mSH"; + "XNlO7sBv" -> "P7dR8mSH"; + "XNlO7sBv" -> "Ua7DFN59"; + "XNlO7sBv" -> "9s6osm5g"; + "o1C1Dkj5" -> "9s6osm5g"; + "o1C1Dkj5" -> "P7dR8mSH"; + "o1C1Dkj5" -> "Ua7DFN59"; + "2BwBOmBQ" -> "Ua7DFN59"; + "2BwBOmBQ" -> "9s6osm5g"; + "2BwBOmBQ" -> "P7dR8mSH"; + "z9Ve58Ih" -> "Ua7DFN59"; + "z9Ve58Ih" -> "P7dR8mSH"; + "z9Ve58Ih" -> "9s6osm5g"; + "HjmxVlSr" -> "9s6osm5g"; + "HjmxVlSr" -> "P7dR8mSH"; + "HjmxVlSr" -> "Ua7DFN59"; + "Z2mXHnxP" -> "Ua7DFN59"; + "Z2mXHnxP" -> "9s6osm5g"; + "Z2mXHnxP" -> "P7dR8mSH"; + "3dT9sgt4" -> "9s6osm5g"; + "3dT9sgt4" -> "P7dR8mSH"; + "3dT9sgt4" -> "Ua7DFN59"; + "kidLKymU" -> "9s6osm5g"; + "kidLKymU" -> "P7dR8mSH"; + "kidLKymU" -> "Ua7DFN59"; + "t5FRdP87" -> "9s6osm5g"; + "t5FRdP87" -> "P7dR8mSH"; + "t5FRdP87" -> "Ua7DFN59"; + "Ht4BfYp6" -> "9s6osm5g"; + "Ht4BfYp6" -> "P7dR8mSH"; + "Ht4BfYp6" -> "Ua7DFN59"; + "ZYgyPyfq" -> "9s6osm5g"; + "ZYgyPyfq" -> "P7dR8mSH"; + "ZYgyPyfq" -> "Ua7DFN59"; + "Hcy2DFKF" -> "9s6osm5g"; + "Hcy2DFKF" -> "P7dR8mSH"; + "Hcy2DFKF" -> "Ua7DFN59"; + "TLZe11Uj" -> "9sxDq6mj"; + "TLZe11Uj" -> "ORX9fPw1"; + "TLZe11Uj" -> "P7dR8mSH"; + "9sxDq6mj" -> "ORX9fPw1"; + "9sxDq6mj" -> "P7dR8mSH"; + "14bALK1y" -> "TLZe11Uj"; + "14bALK1y" -> "XvoWJaA2"; + "L6jvzao4" -> "9s6osm5g"; + "L6jvzao4" -> "lhGA9TYQ"; + "fgmhI8kH" -> "XaDC71GB"; +} \ No newline at end of file diff --git a/website/mods.html b/website/mods.html new file mode 100644 index 0000000..6ae5734 --- /dev/null +++ b/website/mods.html @@ -0,0 +1,5646 @@ + + + + Mod Descriptions and Dependencies + + + +
+

Mod Descriptions and Dependencies

+

Mod Descriptions

+
+
+

+ AdventureZ +

+

Category: ['mobs']

+

adds a new endboss and other creatures

+
+
+

+ Almost Unified +

+

Category: ['library', 'utility']

+

Unify all resources.

+
+
+

+ AmbientSounds +

+

Category: ['decoration']

+

#listentonature

+
+
+

+ Aquamirae +

+

Category: ['adventure', 'equipment', 'worldgen']

+

Ship graveyard with terrible deep sea creatures!

+
+
+

+ Archers (RPG Series) +

+

Category: ['adventure', 'equipment', 'game-mechanics']

+

🏹 Draw, Release, Conquer - Master the art of Archery!

+
+
+

+ Architectury API +

+

Category: ['library']

+

An intermediary api aimed to ease developing multiplatform mods.

+
+
+

+ Archon +

+

Category: ['adventure', 'equipment', 'magic']

+

Sorcery, Necromancy, Bosses, and More!

+
+
+

+ Argonauts +

+

Category: ['utility']

+

A guild and party mod to work and play together with your teammates on a server!

+
+
+

+ Artifacts +

+

Category: ['adventure', 'worldgen']

+

Adds various treasure items that can be found through exploration

+
+
+

+ AttributeFix +

+

Category: ['utility']

+

Removes arbitrary limits on Minecraft's attribute system. Fixes MANY mods!

+
+
+

+ AutoTag +

+

Category: ['library', 'utility']

+

Automatically populates some item, block and other tags (for mod compatibility)

+
+
+

+ AzureLib +

+

Category: ['game-mechanics', 'library', 'utility']

+

Based off Geckolib but now just for my own needs.

+
+
+

+ AzureLib Armor +

+

Category: ['library', 'utility']

+

A striped down Azurelib just for Armor!

+
+
+

+ BadOptimizations +

+

Category: ['optimization']

+

Optimization mod that focuses on things other than rendering

+
+
+

+ Balm +

+

Category: ['library']

+

Abstraction Layer (but not really)™ for Blay's multiplatform mods

+
+
+

+ Basic Weapons +

+

Category: ['adventure', 'equipment']

+

Adds vanilla+ weaponry - no extra fluff or sparkles

+
+
+

+ BCLib +

+

Category: ['library']

+

A Library Mod for the BetterX Team

+
+
+

+ Friends&Foes - Beekeeper Hut (Fabric/Quilt) +

+

Category: ['adventure', 'decoration', 'worldgen']

+

An addon for the Friends&Foes mod, adding a beekeeper hut structure.

+
+
+

+ BetterEnd +

+

Category: ['decoration', 'mobs', 'worldgen']

+

New Biomes, mysterious rituals and Mobs for your End

+
+
+

+ BetterNether +

+

Category: ['equipment', 'mobs', 'worldgen']

+

More Biomes, More Mobs, More Tools for the fiery Dimension

+
+
+

+ Better Archeology +

+

Category: ['adventure', 'decoration', 'worldgen']

+

Discover artifacts & fossils by encountering new structures that'll enhance your adventure and exploration!

+
+
+

+ Better Combat +

+

Category: ['adventure', 'equipment', 'library']

+

⚔️ Easy, spectacular and fun melee combat system from Minecraft Dungeons.

+
+
+

+ Bingus & Floppa +

+

Category: ['equipment', 'mobs']

+

This mod adds the legendary cats Bingus and Floppa, who will fight for your honor

+
+
+

+ Biomes O' Plenty +

+

Category: ['adventure', 'decoration', 'worldgen']

+

Adds 50+ unique biomes to enhance your world, with new trees, flowers, and more!

+
+
+

+ Block Runner +

+

Category: ['utility']

+

Encourages path building by making you run faster on certain blocks such as path blocks.

+
+
+

+ Bosses of Mass Destruction +

+

Category: ['adventure', 'worldgen']

+

Adds boss fights to minecraft

+
+
+

+ Bookshelf +

+

Category: ['library', 'utility']

+

An open source library for other mods!

+
+
+

+ Cadmus +

+

Category: ['utility']

+

A land claiming mod that allows users to claim land to protect your home from thieves, bandits and monsters, and admins to claim land with region flags and advanced protection

+
+
+

+ Cardinal Components API +

+

Category: ['library']

+

A data attachment API that is easy, modular, and extremely fast.

+
+
+

+ Cave Dweller Fabric +

+

Category: ['adventure', 'game-mechanics', 'mobs']

+

Fabric port of the cave dweller mod by Gargin.

+
+
+

+ Cloth Config API +

+

Category: ['library']

+

Configuration Library for Minecraft Mods

+
+
+

+ Clumps +

+

Category: ['storage', 'utility']

+

Clumps XP orbs together to reduce lag

+
+
+

+ Collective +

+

Category: ['library']

+

🎓 Collective is a shared library with common code for all of Serilum's mods.

+
+
+

+ Combat Roll +

+

Category: ['adventure', 'game-mechanics', 'library']

+

🧶 Adds combat roll ability, with related attributes and enchantments.

+
+
+

+ Convenient Decor +

+

Category: ['decoration', 'equipment', 'utility']

+

Decorative blocks with convenient functionality!

+
+
+

+ CreativeCore +

+

Category: ['library']

+

A core mod

+
+
+

+ Creeper Overhaul +

+

Category: ['adventure', 'mobs']

+

A mod which overhauls the vanilla creepers!

+
+
+

+ Cristel Lib +

+

Category: ['library', 'worldgen']

+

A Library mod for easy structure config and runtime datapacks.

+
+
+

+ Dawn API +

+

Category: ['library']

+

API that facilitates the creation of features.

+
+
+

+ Debugify +

+

Category: ['optimization', 'utility']

+

Fixes Minecraft bugs found on the bug tracker

+
+
+

+ Decorative Blocks +

+

Category: ['decoration']

+

Some new blocks to build with

+
+
+

+ Deeper and Darker +

+

Category: ['adventure']

+

A Minecraft 1.19+ mod which features more blocks, items, armors, and hidden mysteries to complement the new Deep Dark biome. Our website: https://kyanitemods.dev

+
+
+

+ DEUF Refabricated +

+

Category: []

+

Fixes entities duplicated UUIDs, removing log spam and preventing crashes.

+
+
+

+ Dimensional Sync Fixes +

+

Category: ['management', 'utility']

+

Fix potion/experience sync issue when players change dimension.

+
+
+

+ Distant Horizons +

+

Category: ['optimization', 'utility']

+

See farther without turning your game into a slide show

+
+
+

+ Double Doors +

+

Category: ['game-mechanics', 'utility']

+

🚪 Multiple identical double doors, trapdoors and fence gates can be opened simultaneously.

+
+
+

+ Dungeon Now Loading +

+

Category: ['adventure', 'mobs', 'worldgen']

+

Explore the vast, challenging dungeons that are loaded into your world! This mod introduces new dungeons, along with tricky, but fair bosses to fight at the end of the dungeon.

+
+
+

+ Dungeons and Taverns +

+

Category: ['adventure', 'worldgen']

+

A Structure Datapack adding dungeons, taverns and other structures to find while you explore the world.

+
+
+

+ Dungeon Difficulty +

+

Category: ['adventure', 'equipment', 'worldgen']

+

☠️ Increase the difficulty and get matching rewards.

+
+
+

+ Dynamic Lights +

+

Category: ['adventure', 'game-mechanics', 'utility']

+

Supported entities and items such as torches or lanterns emit light! Server-side only!

+
+
+

+ Eldritch End +

+

Category: []

+

Descend into madness with new end biomes, forbidden magic, and more.

+
+
+

+ EMI +

+

Category: ['library', 'utility']

+

A featureful and accessible item and recipe viewer

+
+
+

+ Enhanced Block Entities +

+

Category: ['optimization', 'utility']

+

Reduce block entity FPS lag with almost no compromises, and improve their visuals

+
+
+

+ Entity Culling +

+

Category: ['optimization']

+

Using async path-tracing to hide Block-/Entities that are not visible

+
+
+

+ [EMF] Entity Model Features +

+

Category: ['mobs', 'utility']

+

EMF is an, OptiFine format, Custom Entity Model replacement mod available for Fabric and Forge.

+
+
+

+ [ETF] Entity Texture Features +

+

Category: ['decoration', 'utility']

+

Emissive, Random & Custom texture support for entities in resourcepacks just like Optifine but for Fabric

+
+
+

+ Epic Knights'n'Mages - Fabric +

+

Category: ['equipment', 'magic']

+

A mod focused on adding new 3D-styled armors and weapons. This mod is supposed to use with Spell Engine.

+
+
+

+ Explorer's Compass +

+

Category: ['adventure', 'equipment', 'utility']

+

Allows you to locate structures anywhere in the world.

+
+
+

+ Fabric API +

+

Category: ['library']

+

Lightweight and modular API providing common hooks and intercompatibility measures utilized by mods using the Fabric toolchain.

+
+
+

+ End Remastered +

+

Category: ['adventure']

+

Make your journey to the End more Challenging and Engaging with End Remastered!

+
+
+

+ Fabric Language Kotlin +

+

Category: ['library']

+

This is a mod that enables usage of the Kotlin programming language for Fabric mods.

+
+
+

+ FakerLib +

+

Category: ['library']

+

(fabric port of a) Library mod, does nothing by itself

+
+
+

+ FallingTree +

+

Category: ['utility']

+

Break down your trees by only cutting one piece of it

+
+
+

+ FerriteCore +

+

Category: ['optimization', 'utility']

+

Memory usage optimizations

+
+
+

+ Friends&Foes - Flowery Mooblooms (Fabric/Quilt) +

+

Category: ['adventure', 'mobs', 'worldgen']

+

An addon for the Friends&Foes mod, adding one moobloom variant for each flower.

+
+
+

+ Forge Config API Port +

+

Category: ['library']

+

NeoForge's & Forge's config systems provided to other modding ecosystems. Designed for a multiloader architecture.

+
+
+

+ Forge Config Screens +

+

Category: ['utility']

+

Allows Forge's configs to be configured directly in-game. Quick and easy with a beautiful design!

+
+
+

+ Friends&Foes (Fabric/Quilt) +

+

Category: ['adventure', 'mobs', 'worldgen']

+

Adds outvoted and forgotten mobs from the mob votes in a believable vanilla plus style. (Copper Golem, Glare, Moobloom, Iceologer, Barnacle, Wildfire, Illusioner, Rascal, Tuff Golem)

+
+
+

+ Fzzy Core +

+

Category: ['game-mechanics', 'library', 'utility']

+

API used in fzzyhmstrs mods that provides various utilities for Kotlin mods

+
+
+

+ Gazebos (RPG Series) +

+

Category: ['adventure', 'magic', 'worldgen']

+

⛲️ Village structures hosting small spell libraries

+
+
+

+ Gear Core +

+

Category: ['equipment', 'game-mechanics', 'library']

+

Library mod for the creation of equipment modifiers that can apply entity attributes or track a variety of events like taking damage, killing mobs, and more.

+
+
+

+ Geckolib +

+

Category: ['game-mechanics', 'utility']

+

A 3D animation library for entities, blocks, items, armor, and more!

+
+
+

+ Iris/Oculus & GeckoLib Compat +

+

Category: []

+

Fixes GeckoLib animations not working if using a shaderpack with entity shadows.

+
+
+

+ Geophilic +

+

Category: ['adventure', 'worldgen']

+

A subtle-ish overhaul of vanilla Overworld biomes! Reworked!

+
+
+

+ Grappling Hook Mod: Restitched +

+

Category: ['adventure', 'equipment', 'transportation']

+

A port of Yyon's original grappling hook mod - The mod adds grappling hooks with several different modifiers to improve traversal within your world, ranging from force fields to double hooks.

+
+
+

+ Gravestones +

+

Category: ['adventure', 'decoration', 'utility']

+

A gravestones mod for fabric with tons of config options, an API, and more!

+
+
+

+ Guard Villagers (Fabric/Quilt) +

+

Category: ['equipment', 'mobs', 'utility']

+

Guards that help with village pest control

+
+
+

+ Handcrafted +

+

Category: ['decoration', 'utility']

+

Make your house a home!

+
+
+

+ Heracles +

+

Category: ['adventure', 'utility']

+

A tree-style questing mod, allowing pack makers to make and include completable quests for their players

+
+
+

+ Iceberg +

+

Category: ['library']

+

A modding library that contains new events, helpers, and utilities to make modder's lives easier.

+
+
+

+ ImmediatelyFast +

+

Category: ['optimization']

+

Speed up immediate mode rendering in Minecraft

+
+
+

+ ImmersiveMC +

+

Category: ['utility']

+

Makes Minecraft more immersive!

+
+
+

+ Immersive Armors +

+

Category: ['equipment']

+

A lot of unique and vanilla-faithful armor sets.

+
+
+

+ Immersive structures +

+

Category: ['adventure', 'worldgen']

+

Additional structure packs

+
+
+

+ Immersive Structures II: Nether edition +

+

Category: ['adventure', 'decoration', 'worldgen']

+

Additional nether structure packs

+
+
+

+ Indium +

+

Category: ['utility']

+

Sodium addon providing support for the Fabric Rendering API, based on Indigo

+
+
+

+ Inventory Sorting +

+

Category: ['storage', 'utility']

+

Quick, simple, and lightweight inventory sorting

+
+
+

+ Invocations +

+

Category: ['adventure', 'equipment', 'magic']

+

More Complicated Spell Casting for Spell Engine Inspired by Last Epoch

+
+
+

+ Iris Shaders +

+

Category: ['decoration', 'optimization']

+

A modern shaders mod for Minecraft intended to be compatible with existing OptiFine shader packs

+
+
+

+ Jade 🔍 +

+

Category: ['utility']

+

Shows information about what you are looking at. (Hwyla/Waila fork for Minecraft 1.16+)

+
+
+

+ Just Enough Items +

+

Category: ['library', 'utility']

+

JEI - View Items and Recipes

+
+
+

+ Jewelry (RPG Series) +

+

Category: ['adventure', 'equipment', 'magic']

+

💍 Find precious gems deep down, and craft them into powerful jewelry!

+
+
+

+ Kev's TieredZ Modifiers +

+

Category: ['adventure', 'equipment']

+

More Tieredz modifiers that support spell power and others!

+
+
+

+ Kev's Equipment Sets +

+

Category: ['adventure', 'equipment', 'magic']

+

Equipment set bonuses!

+
+
+

+ Kev's Library +

+

Category: ['library']

+

A library for all Kev's mods

+
+
+

+ Kobold Outposts +

+

Category: ['adventure', 'worldgen']

+

A small datapack adding jungle outposts of Kobold Warriors from Mythic Mobs!

+
+
+

+ Legendary Tooltips +

+

Category: ['adventure', 'equipment', 'utility']

+

Give your rare items a fancier tooltip! Also adds additional tooltip configuration options.

+
+
+

+ [Let's Do] Camping +

+

Category: ['storage']

+

How about we sleep outside today? Grab your backpack, pack the tent, grill, and sleeping bag, and let's go!

+
+
+

+ LibZ +

+

Category: ['library']

+

Open source library for a couple of Globox_Z mods

+
+
+

+ Lithium +

+

Category: ['optimization']

+

No-compromises game logic/server optimization mod

+
+
+

+ Lithostitched +

+

Category: ['library', 'utility', 'worldgen']

+

Library mod with new configurability and compatibility enhancements for worldgen

+
+
+

+ Load My F***ing Tags +

+

Category: ['cursed', 'utility']

+

Prevents Incorrect Tag Entries from breaking an entrie Tag

+
+
+

+ Load My Resources +

+

Category: ['utility']

+

Load resources on game start, like a resource pack, but enabled by default.

+
+
+

+ MC Dungeons Armors +

+

Category: ['adventure', 'equipment', 'magic']

+

Bringing the armors of Minecraft Dungeons to Minecraft

+
+
+

+ MC Dungeons Weapons +

+

Category: ['adventure', 'equipment', 'magic']

+

Adds the weapons, tools and weapon enchantments from Minecraft Dungeons

+
+
+

+ Macaw's Bridges +

+

Category: ['decoration']

+

A simple mod that adds a lot of bridges!

+
+
+

+ Macaw's Doors +

+

Category: ['decoration']

+

Adds vanilla doors with every wood color and new unique doors! +Such as western, garage, shoji and more...!

+
+
+

+ Macaw's Fences and Walls +

+

Category: ['decoration']

+

Adds new vanilla styled fences, walls and gates!

+
+
+

+ Macaw's Furniture +

+

Category: ['decoration', 'storage']

+

Decorate your world with wardrobes, drawers, chairs, desks, tables and more...!

+
+
+

+ Macaw's Lights and Lamps +

+

Category: ['decoration']

+

Adds vanilla styled lamps, torches, street lamps, paper lamps, wall lamps, slabs... Make your world brighter!

+
+
+

+ Macaw's Paintings +

+

Category: ['decoration']

+

Adds custom drawn paintings to fit in your world!

+
+
+

+ Macaw's Paths and Pavings +

+

Category: ['decoration']

+

Adds vanila styled paths and pavings!

+
+
+

+ Macaw's Roofs +

+

Category: ['decoration']

+

Build roofs with actual roofs instead of stairs!

+
+
+

+ Macaw's Trapdoors +

+

Category: ['decoration']

+

Adds vanila trapdoors in every plank variation, and some new trapdoors too!

+
+
+

+ Macaw's Windows +

+

Category: ['decoration']

+

Adds lots of Windows, Mosaic Glass, Blinds, Shutters, Curtains and more...!

+
+
+

+ Memory Leak Fix +

+

Category: ['optimization']

+

A mod that fixes random memory leaks for both the client and server

+
+
+

+ Mine Cells - Dead Cells Mod +

+

Category: ['adventure', 'mobs', 'worldgen']

+

Dead Cells content in Minecraft

+
+
+

+ Mob Plaques +

+

Category: ['mobs', 'utility']

+

Neat, tiny attribute displays for all mobs with great customization!

+
+
+

+ Mobs of Mythology +

+

Category: ['adventure', 'mobs', 'worldgen']

+

Discover a World of Mythological Creatures in Minecraft!

+
+
+

+ ModernFix +

+

Category: ['optimization', 'utility']

+

All-in-one mod that improves performance, reduces memory usage, and fixes many bugs. Compatible with all your favorite performance mods!

+
+
+

+ Mod Menu +

+

Category: ['utility']

+

Adds a mod menu to view the list of mods you have installed.

+
+
+

+ More Totems of Undying +

+

Category: ['adventure', 'equipment', 'magic']

+

A mod that adds seven mob-inspired totems to Minecraft.

+
+
+

+ More Culling +

+

Category: ['optimization', 'utility']

+

A mod that changes how multiple types of culling are handled in order to improve performance

+
+
+

+ More Mob Variants +

+

Category: ['decoration', 'mobs', 'social']

+

Adds new variants to existing mobs.

+
+
+

+ Mutant Monsters +

+

Category: ['mobs']

+

The mutants are back! Face scary creatures and powerful beasts like never before.

+
+
+

+ myLoot +

+

Category: ['adventure', 'utility', 'worldgen']

+

Instanced loot per player for a better looting experience on Multiplayer servers

+
+
+

+ Mythic Mounts +

+

Category: ['adventure', 'mobs', 'transportation']

+

Befriend legendary creatures to accompany you across the world!

+
+
+

+ Mythic Upgrades +

+

Category: ['equipment', 'worldgen']

+

Mythic Upgrades adds new mythic ways to upgrade Netherite gear with new ores.

+
+
+

+ MythQuest ~ Weapons +

+

Category: ['adventure', 'equipment', 'magic']

+

MythQuest is a thrilling Minecraft mod that introduces a fascinating twist to the game, incorporating the legendary realm of Greek mythology.

+
+
+

+ Naturalist +

+

Category: ['adventure', 'mobs', 'worldgen']

+

Adds new immersive wildlife with realistic behavior!

+
+
+

+ Nature's Compass +

+

Category: ['adventure', 'equipment', 'utility']

+

Allows you to locate biomes anywhere in the world.

+
+
+

+ Necronomicon API +

+

Category: []

+

A personal utility library for my mods.

+
+
+

+ Neruina - Ticking Entity Fixer +

+

Category: ['utility']

+

A Mod that prevents ticking-related crashes from bricking worlds

+
+
+

+ Nether Depths Upgrade +

+

Category: ['food', 'mobs', 'worldgen']

+

Nether Depths Upgrade is a small mod that adds some extra flora and fauna to the lava seas of the nether. A total of nine fish have been added, a new enchant and potion in order to explore the lava in the nether.

+
+
+

+ NetherPortalFix +

+

Category: ['game-mechanics', 'utility']

+

Ensures correct destinations when travelling back and forth through Nether Portals in Multiplayer.

+
+
+

+ Nicer Skies +

+

Category: ['decoration']

+

A mod which adds nebulas and changes stars and light.

+
+
+

+ No Chat Reports +

+

Category: ['social', 'utility']

+

Makes chat unreportable (where possible)

+
+
+

+ Obscure API +

+

Category: ['library', 'utility']

+

Auxiliary Library

+
+
+

+ oωo (owo-lib) +

+

Category: ['library']

+

A general utility, GUI and config library for modding on Fabric and Quilt

+
+
+

+ Oxidized +

+

Category: ['utility']

+

Adds more uses for vanilla copper

+
+
+

+ Packet Fixer +

+

Category: ['optimization', 'utility']

+

A simple mod to solve various problems with packets.

+
+
+

+ Paladins & Priests (RPG Series) +

+

Category: ['adventure', 'equipment', 'magic']

+

✨ Protect and heal your friends as a Paladin or a Priest

+
+
+

+ Patchouli +

+

Category: ['library', 'utility']

+

Accessible, Data-Driven, Dependency-Free Documentation for Minecraft Modders and Pack Makers

+
+
+

+ playerAnimator +

+

Category: ['library']

+

animate the player

+
+
+

+ Polymorph +

+

Category: ['utility']

+

No more recipe conflicts! Adds an option to choose the crafting result if more than one is available.

+
+
+

+ Presence Footsteps +

+

Category: ['decoration']

+

..An Overly complicated Sound Mod...

+
+
+

+ Prism +

+

Category: ['decoration', 'library', 'utility']

+

A library all about color! Provides lots of color-related functionality for dependent mods.

+
+
+

+ Projectile Damage Attribute +

+

Category: ['adventure', 'equipment', 'library']

+

🏹 Range weapon damage becomes configurable.

+
+
+

+ Promenade +

+

Category: ['adventure', 'mobs', 'worldgen']

+

Fancy and simplistic biomes and structures!

+
+
+

+ Protection Balancer +

+

Category: []

+

Allows to change the armor & protection mitigation formulas

+
+
+

+ Pufferfish's Attributes +

+

Category: ['game-mechanics', 'library', 'utility']

+

A Minecraft mod that adds more attributes to the game.

+
+
+

+ Pufferfish's Skills +

+

Category: ['adventure', 'game-mechanics', 'utility']

+

Adds a fully configurable skill system to the game.

+
+
+

+ Puzzles Lib +

+

Category: ['library']

+

Why's it called Puzzles you ask? That's the puzzle!

+
+
+

+ Ranged Weapon API +

+

Category: ['equipment', 'library']

+

🏹 Create fully functional bows and crossbows, with ease

+
+
+

+ Reacharound +

+

Category: ['utility']

+

Reacharound block placement.

+
+
+

+ ReBalance +

+

Category: []

+

Modpack utility mod that allows to balance out damage dealt by players.

+
+
+

+ Remove Terralith Intro Message +

+

Category: ['utility']

+

A datapack/mod to remove the intro message that appears with Terralith.

+
+
+

+ Repurposed Structures - Quilt/Fabric +

+

Category: ['worldgen']

+

Adds more variations of vanilla structures and features such as a Jungle Fortress!

+
+
+

+ Resourceful Lib +

+

Category: ['library']

+

Resourceful Lib

+
+
+

+ Resourceful Config +

+

Category: ['library']

+

Resourceful Config is a mod that allows for developers to make cross-platform configs

+
+
+

+ Revive +

+

Category: ['game-mechanics']

+

Revive your friends when they have died

+
+
+

+ Rogues & Warriors (RPG Series) +

+

Category: ['adventure', 'equipment', 'magic']

+

🗡️ Silent Blades, Mighty Blows - Dominate with martial skills!

+
+
+

+ Runes +

+

Category: ['magic']

+

🪨 Craft runes to serve as ammo for spells

+
+
+

+ Simply Skills +

+

Category: ['magic']

+

A comprehensive skill tree mod with a focus on combat specialisations (classes)

+
+
+

+ Simply Swords +

+

Category: ['equipment', 'magic']

+

Adds Spears, Glaives, Chakrams, Katanas, Greathammer/axes, Rapiers, and many more weapons!

+
+
+

+ Small Ships +

+

Category: ['adventure', 'game-mechanics', 'transportation']

+

Vanilla friendly Ships for Minecraft. Now with cannons!

+
+
+

+ SmartBrainLib +

+

Category: ['library', 'mobs', 'utility']

+

A brain library for Minecraft, making the brain system easier to use and manage

+
+
+

+ Hellion's Sniffer+ +

+

Category: ['decoration', 'mobs', 'worldgen']

+

A Sniffer expansion, adding new behaviors to the Sniffer, an ancient cave biome, and several new Sniffer-related plants.

+
+
+

+ Sodium Extra +

+

Category: ['cursed', 'optimization', 'utility']

+

A Sodium addon that adds features that shouldn't be in Sodium.

+
+
+

+ Sodium +

+

Category: ['optimization']

+

The fastest and most compatible rendering optimization mod for Minecraft

+
+
+

+ Marium's Soulslike Weaponry +

+

Category: ['adventure', 'equipment', 'mobs']

+

A minecraft mod that adds new bosses and legendary weapons

+
+
+

+ Sound Physics Remastered +

+

Category: ['adventure', 'utility']

+

A Minecraft mod that provides realistic sound attenuation, reverberation, and absorption through blocks.

+
+
+

+ spark +

+

Category: ['utility']

+

spark is a performance profiler for Minecraft clients, servers and proxies.

+
+
+

+ Spell Engine +

+

Category: ['game-mechanics', 'library', 'magic']

+

🪄 Data driven magic library

+
+
+

+ Spell Power Attributes +

+

Category: ['library', 'magic']

+

🔮 Spell Power entity attributes with related status effects and enchantments

+
+
+

+ SpoornPacks +

+

Category: ['library', 'utility']

+

API Library for automagically generating Resource files and injecting them as a Resource Pack

+
+
+

+ Starlight (Fabric) +

+

Category: ['optimization']

+

Rewrites the light engine to fix lighting performance and lighting errors

+
+
+

+ Starter Kit +

+

Category: ['adventure', 'management', 'utility']

+

📦 Give all new players joining the world configurable starter gear, items and/or potion effects. It can overwrite the initial inventory, or add the items after. Compatible with FTB Team Islands.

+
+
+

+ TerraBlender +

+

Category: ['library', 'worldgen']

+

A library mod for adding biomes in a simple and compatible manner!

+
+
+

+ Terralith +

+

Category: ['worldgen']

+

Explore almost 100 new biomes consisting of both realism and light fantasy, using just Vanilla blocks. Complete with several immersive structures to compliment the overhauled terrain.

+
+
+

+ The Graveyard (FABRIC) +

+

Category: ['adventure', 'mobs', 'worldgen']

+

A mod that adds structures, mobs, bosses and blocks themed aroung the graveyard.

+
+
+

+ TieredZ +

+

Category: ['equipment']

+

Adds tiers/modifiers to tools

+
+
+

+ The Lost Castle +

+

Category: ['adventure', 'worldgen']

+

Former structure of End Remastered, The Lost Castle introduces an enormous castle. Inside resides infinite fortune and mysteries from a long forgotten civilization that disappeared a long time ago...

+
+
+

+ Too Fast +

+

Category: ['utility']

+

Removes the "moved too quickly" warning and rubber-banding.

+
+
+

+ Trinkets +

+

Category: ['equipment', 'library', 'utility']

+

A data-driven accessory mod

+
+
+

+ True Darkness Refabricated +

+

Category: ['adventure', 'game-mechanics', 'utility']

+

A maintained fork of the 'True Darkness' mod for Fabric

+
+
+

+ Valentine's Blessing(Lilypads, Roses, Cakes) +

+

Category: ['decoration', 'food', 'worldgen']

+

Mod enhancing empty looking waters with colorful blooming lilypads and adds Valentine's day thematic decorations.

+
+
+

+ Gliders +

+

Category: ['equipment', 'transportation']

+

Gliders: essential for traversing terrain and preventing falls

+
+
+

+ Vein Mining +

+

Category: ['equipment', 'magic']

+

A lightweight, highly configurable Vein Mining enchantment for tools.

+
+
+

+ VillagersPlus +

+

Category: ['adventure', 'mobs', 'worldgen']

+

A villager extension mod, adding new villager types, trades and beautiful workstations.

+
+
+

+ Villages & Pillages +

+

Category: ['adventure', 'decoration', 'worldgen']

+

Structure mod that brings an exciting twist to Minecraft by introducing hostile and unfriendly pillages, providing a thrilling contrast to the peaceful villages.

+
+
+

+ Village Spawn Point +

+

Category: ['adventure', 'game-mechanics', 'worldgen']

+

🏙 Sets the spawn point in a new world to the center of a village.

+
+
+

+ Vivecraft +

+

Category: ['game-mechanics', 'library']

+

A Minecraft VR mod on a loader of your choice!

+
+
+

+ Simple Voice Chat +

+

Category: ['adventure', 'social', 'utility']

+

A working voice chat in Minecraft!

+
+
+

+ VR Combat +

+

Category: ['game-mechanics', 'utility']

+

Compatibility between Vivecraft and Better Combat.

+
+
+

+ MC VR API +

+

Category: ['library']

+

An API/Library mod that allows mods to inter-operate with Vivecraft.

+
+
+

+ Wabi-Sabi Structures +

+

Category: ['adventure', 'worldgen']

+

A collection of unique, quality structures based on the Japanese concept of "Wabi-Sabi"

+
+
+

+ Wall-Jump TXF +

+

Category: ['game-mechanics']

+

Wall jump, double jump, fence jump & more

+
+
+

+ way2wayfabric +

+

Category: ['library', 'utility']

+

Waystone -> Xaero's Minimap Waypoint sync for fabric

+
+
+

+ When Dungeons Arise +

+

Category: ['adventure', 'worldgen']

+

Adds various elegant -and likely hostile- roguelike dungeons and structures that generate on your worlds!

+
+
+

+ Wizards (RPG Series) +

+

Category: ['adventure', 'equipment', 'magic']

+

🧙🏻‍♂️ Destroy your enemies with Arcane, Fire and Frost magic

+
+
+

+ Wraith Waystones +

+

Category: ['adventure', 'magic', 'transportation']

+

A better way of transport

+
+
+

+ Xaero's World Map +

+

Category: ['adventure', 'transportation', 'utility']

+

Adds a full screen world map which shows you what you have explored in the world. Works great together with Xaero's Minimap.

+
+
+

+ Xaero's Minimap +

+

Category: ['adventure', 'transportation', 'utility']

+

Displays a map of the nearby world terrain, players, mobs, entities in the corner of your screen. Lets you create waypoints which help you find the locations you've marked.

+
+
+

+ YetAnotherConfigLib +

+

Category: ['library', 'management', 'utility']

+

A builder-based configuration library for Minecraft.

+
+
+

+ YUNG's API +

+

Category: ['library', 'worldgen']

+

Library mod for YUNG's mods.

+
+
+

+ YUNG's Better Desert Temples +

+

Category: ['adventure', 'decoration', 'worldgen']

+

A complete redesign of Minecraft's desert temples!

+
+
+

+ YUNG's Better Dungeons +

+

Category: ['adventure', 'decoration', 'worldgen']

+

A complete redesign of Minecraft's dungeons!

+
+
+

+ YUNG's Better End Island +

+

Category: ['adventure', 'decoration', 'worldgen']

+

An overhaul of the main End Island where the dragon fight takes place!

+
+
+

+ YUNG's Better Jungle Temples +

+

Category: ['adventure', 'decoration', 'worldgen']

+

A complete redesign of Minecraft's jungle temples!

+
+
+

+ YUNG's Better Mineshafts +

+

Category: ['adventure', 'decoration', 'worldgen']

+

A long-awaited and much-needed abandoned mineshaft overhaul!

+
+
+

+ YUNG's Better Nether Fortresses +

+

Category: ['adventure', 'decoration', 'worldgen']

+

A complete redesign of Minecraft's Nether fortresses!

+
+
+

+ YUNG's Better Ocean Monuments +

+

Category: ['adventure', 'decoration', 'worldgen']

+

A complete redesign of Minecraft's ocean monuments!

+
+
+

+ YUNG's Better Strongholds +

+

Category: ['adventure', 'decoration', 'worldgen']

+

A complete redesign of Minecraft's strongholds!

+
+
+

+ YUNG's Better Witch Huts +

+

Category: ['adventure', 'decoration', 'worldgen']

+

Adds overhauled witch huts to swamps!

+
+
+

+ YUNG's Bridges +

+

Category: ['adventure', 'decoration', 'worldgen']

+

Adds beautiful naturally generated bridges throughout the world!

+
+
+

+ YUNG's Extras +

+

Category: ['adventure', 'decoration', 'worldgen']

+

Extra structures, features, and vanilla+ content suitable for any modpack!

+
+
+

+ YUNG's Menu Tweaks +

+

Category: ['utility']

+

A small, lightweight mod that makes browsing menus a lot easier

+
+
+

+ Zenith +

+

Category: ['adventure', 'equipment', 'game-mechanics']

+

Fabric apotheosis port, changes and expands upon many systems

+
+
+

+ Zenith Attributes +

+

Category: []

+

Adds attributes, and an attributes viewer, used for Zenith

+
+
+

+ Zephyr +

+

Category: ['adventure', 'magic']

+

Zenith Affixes and Gems for the RPG Series

+
+
+

+ Epic Knights: Shields Armor and Weapons +

+

Category: ['equipment']

+

Adds medieval armor and weapons

+
+
+

+ ChoiceTheorem's Overhauled Village +

+

Category: ['adventure', 'worldgen']

+

Enhances and creates new villages and pillager outposts, that perfectly fit into your Minecraft world.

+
+
+

Mods by Category

+

mobs

+ +

library

+ +

utility

+ +

decoration

+ +

adventure

+ +

equipment

+ +

worldgen

+ +

game-mechanics

+ +

magic

+ +

optimization

+ +

storage

+ +

management

+ +

transportation

+ +

cursed

+ +

social

+ +

food

+ +

Dependency Tree

+
+

+ adventurez-1.4.20 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ cloth-config-11.1.118-fabric +

+
+
+
+

+ almostunified-fabric-1.20.1-0.9.4 +

+
+
+

+ AmbientSounds_FABRIC_v6.0.3_mc1.20.1 +

+
+

+ CreativeCore_FABRIC_v2.11.33_mc1.20.1 +

+ +
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ Aquamirae-6 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ Obscure-API-16 +

+ +
+
+
+

+ archers-1.2.5+1.20.1 +

+
+

+ ranged_weapon_api-1.1.2+1.20.1 +

+ +
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ spell_engine-0.15.8+1.20.1 +

+
+

+ trinkets-3.7.2 +

+
+ + + + +
+
+

+ azurelibarmor-fabric-1.20.1-2.0.6 +

+
+
+
+

+ archon-0.7.0 +

+
+

+ spell_power-0.11.1+1.20.1 +

+ +
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ Argonauts +

+
+

+ Resourceful Lib +

+ +
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ artifacts-fabric-9.5.12 +

+
+

+ trinkets-3.7.2 +

+
+
+

+ cloth-config-11.1.118-fabric +

+
+
+

+ architectury-9.2.14-fabric +

+ +
+
+
+

+ BadOptimizations-2.1.4-1.20.1 +

+
+
+

+ basicweapons-1.2.3+1.20.1 +

+
+
+

+ beekeeperhut-fabric-mc1.20.1-2.0.1 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ better-end-4.0.11 +

+
+

+ bclib-3.0.14 +

+ +
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ better-nether-9.0.10 +

+
+

+ bclib-3.0.14 +

+ +
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ betterarcheology-1.1.9-1.20.1 +

+
+

+ YungsApi-1.20-Fabric-4.0.5 +

+ +
+
+
+

+ bingus-1.20.1-fabric +

+
+
+

+ BiomesOPlenty-1.20.1-18.0.0.598 +

+
+

+ TerraBlender-fabric-1.20.1-3.0.1.7 +

+ +
+
+
+

+ BlockRunner-v8.0.4-1.20.1-Fabric +

+
+

+ PuzzlesLib-v8.1.21-1.20.1-Fabric +

+ + +
+
+

+ ForgeConfigAPIPort-v8.0.0-1.20.1-Fabric +

+ +
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ BOMD-1.7.5-1.20.1 +

+
+

+ geckolib-fabric-1.20.1-4.4.7 +

+ +
+
+

+ cloth-config-11.1.118-fabric +

+
+
+

+ fabric-language-kotlin-1.11.0+kotlin.2.0.0 +

+
+
+

+ cardinal-components-api-5.2.2 +

+
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ Bookshelf-Fabric-1.20.1-20.2.13 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ Cadmus +

+
+

+ Resourceful Lib +

+ +
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ cavedweller-1.3.0 +

+
+

+ geckolib-fabric-1.20.1-4.4.7 +

+ +
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ owo-lib-0.11.2+1.20 +

+ +
+
+
+

+ Clumps-fabric-1.20.1-12.0.0.4 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ combatroll-fabric-1.3.2+1.20.1 +

+
+

+ player-animation-lib-fabric-1.0.2-rc1+1.20 +

+
+
+

+ cloth-config-11.1.118-fabric +

+
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ convenientdecor-0.4.2 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ creeperoverhaul-3.0.2-fabric +

+
+

+ geckolib-fabric-1.20.1-4.4.7 +

+ +
+
+

+ Resourceful Lib +

+ +
+
+

+ resourcefulconfig-fabric-1.20.1-2.1.2 +

+
+
+
+

+ cristellib-1.1.5-fabric +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ Debugify-1.20.1+2.0 +

+
+

+ YetAnotherConfigLib-3.5.0+1.20.1-fabric +

+ +
+
+
+

+ decorative_blocks-fabric-1.20.1-4.1.3 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ deeperdarker-fabric-1.20-1.2.6 +

+
+

+ YetAnotherConfigLib-3.5.0+1.20.1-fabric +

+ +
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ DEUF_Refabricated-MC1.20.1-1.1.0 +

+
+
+

+ Dimensional Sync Fixes +

+
+
+

+ DistantHorizons-2.1.2-a-1.20.1-forge-fabric +

+
+
+

+ doubledoors-1.20.1-5.9 +

+
+

+ collective-1.20.1-7.80 +

+
+
+
+

+ Dungeon Now Loading-fabric-1.20.1-1.5 +

+
+
+

+ dungeons-and-taverns-3.0.3.f +

+
+
+

+ dungeon_difficulty-2.2.1+1.20.1 +

+
+

+ ranged_weapon_api-1.1.2+1.20.1 +

+ +
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ Dynamic Lights +

+
+
+

+ Eldritch_End-FABRIC-MC1.20.1-0.2.31 +

+
+

+ azurelib-fabric-1.20.1-2.0.30 +

+ +
+
+

+ Necronomicon-Fabric-1.4.2 +

+
+
+
+

+ emi-1.1.10+1.20.1+fabric +

+
+
+

+ enhancedblockentities-0.9+1.20 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ entityculling-fabric-1.6.6-mc1.20.1 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ entity_model_features_fabric_1.20.1-2.1.3 +

+
+

+ entity_texture_features_fabric_1.20.1-6.1.3 +

+
+
+
+

+ epicknightsnmages-0.0.2 +

+
+

+ azurelib-fabric-1.20.1-2.0.30 +

+ +
+
+

+ spell_engine-0.15.8+1.20.1 +

+
+

+ trinkets-3.7.2 +

+
+ + + + +
+
+
+

+ ExplorersCompass-1.20.1-2.2.3-fabric +

+
+
+

+ fabric-end-remastered-5.2.4 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ FallingTree-1.20.1-4.3.4 +

+
+
+

+ ferritecore-6.0.1-fabric +

+
+
+

+ flowerymooblooms-fabric-mc1.20.1-2.0.2 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ ForgeConfigScreens-v8.0.2-1.20.1-Fabric +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ modmenu-7.2.2 +

+
+
+

+ ForgeConfigAPIPort-v8.0.0-1.20.1-Fabric +

+ +
+
+
+

+ friendsandfoes-fabric-mc1.20.1-2.0.15 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ gazebo-1.1.1+1.20.1 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ gear_core-0.3.8+1.20.1 +

+
+

+ fabric-language-kotlin-1.11.0+kotlin.2.0.0 +

+
+
+

+ fzzy_core-0.5.1+1.20.1 +

+ + +
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ GeckoLibIrisCompat-Fabric-1.0.0 +

+
+
+

+ Geophilic v3.1.1 f15-48 +

+
+
+

+ grapplemod-1.8+1.20(.1) +

+
+
+

+ Gravestones +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ guardvillagers-2.0.9-1.20.1 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ handcrafted-fabric-1.20.1-3.0.6 +

+
+

+ Resourceful Lib +

+ +
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ Heracles +

+
+

+ Resourceful Lib +

+ +
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ ImmediatelyFast-Fabric-1.2.18+1.20.4 +

+
+
+

+ immersivemc-1.5.0-beta1-1.20.1-fabric +

+
+

+ ForgeConfigAPIPort-v8.0.0-1.20.1-Fabric +

+ +
+
+

+ architectury-9.2.14-fabric +

+ +
+
+
+

+ immersive_armors-1.6.1+1.20.1-fabric +

+
+
+

+ imst-2.1.0 +

+
+
+

+ imst_n-1.1.0.zip +

+
+
+

+ indium-1.0.34+mc1.20.1 +

+
+

+ sodium-fabric-0.5.11+mc1.20.1 +

+
+
+
+

+ InventorySorter-1.9.0-1.20 +

+
+
+

+ invoke-0.2.4 +

+
+

+ wizards-1.3.0+1.20.1 +

+ + + + + +
+
+
+

+ iris-1.7.2+mc1.20.1 +

+
+

+ sodium-fabric-0.5.11+mc1.20.1 +

+
+
+
+

+ Jade-1.20-fabric-11.10.0 +

+
+
+

+ jei-1.20.1-fabric-15.10.0.29 +

+
+
+

+ Jewelry-1.3.5+1.20.1 +

+
+

+ trinkets-3.7.2 +

+
+
+

+ spell_power-0.11.1+1.20.1 +

+ +
+
+

+ ranged_weapon_api-1.1.2+1.20.1 +

+ +
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ Kev's TieredZ Modifiers +

+
+
+

+ kevsequipmentsets-1.0.5 +

+
+
+

+ kevslibrary-1.1.0 +

+
+
+

+ kobold-outposts-2.0 +

+
+
+

+ LegendaryTooltips-1.20.1-fabric-1.4.5 +

+
+

+ Prism-1.20.1-fabric-1.0.5 +

+
+
+

+ Iceberg-1.20.1-fabric-1.1.18 +

+
+
+

+ ForgeConfigAPIPort-v8.0.0-1.20.1-Fabric +

+ +
+
+
+

+ letsdo-camping-fabric-1.0.0 +

+
+

+ trinkets-3.7.2 +

+
+
+

+ architectury-9.2.14-fabric +

+ +
+
+
+

+ lithium-fabric-mc1.20.1-0.11.2 +

+
+
+

+ lmft-1.0.2+1.20-fabric +

+
+
+

+ loadmyresources_fabric_1.0.4-1_MC_1.20 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ mcda-5.0.2 +

+
+

+ cloth-config-11.1.118-fabric +

+
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ mcdw-9.0.4 +

+
+

+ cloth-config-11.1.118-fabric +

+
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ mcw-bridges-3.0.0-mc1.20.1fabric +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ mcw-doors-1.1.1fabric-mc1.20.1 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ mcw-fences-1.1.2-mc1.20.1fabric +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ mcw-furniture-3.3.0-mc1.20.1fabric +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ mcw-lights-1.1.1-mc1.20.1fabric +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ mcw-paintings-1.0.5-1.20.1fabric +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ mcw-paths-1.0.5-1.20.1fabric +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ mcw-roofs-2.3.1-mc1.20.1fabric +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ mcw-trapdoors-1.1.3-mc1.20.1fabric +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ mcw-windows-2.3.0-mc1.20.1fabric +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ memoryleakfix-fabric-1.17+-1.1.5 +

+
+
+

+ minecells-1.8.3 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ owo-lib-0.11.2+1.20 +

+ +
+
+
+

+ MobPlaques-v8.0.1-1.20.1-Fabric +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ PuzzlesLib-v8.1.21-1.20.1-Fabric +

+ + +
+
+

+ ForgeConfigAPIPort-v8.0.0-1.20.1-Fabric +

+ +
+
+
+

+ mobs_of_mythology-fabric-1.20.1-2.0.2 +

+
+

+ azurelib-fabric-1.20.1-2.0.30 +

+ +
+
+

+ SmartBrainLib-fabric-1.20.1-1.14.2 +

+
+
+

+ architectury-9.2.14-fabric +

+ +
+
+
+

+ modernfix-fabric-5.19.0+mc1.20.1 +

+
+
+

+ more-totems-mod-2.16.0 +

+
+
+

+ moreculling-1.20.4-0.24.0 +

+
+

+ cloth-config-11.1.118-fabric +

+
+
+
+

+ moremobvariants-fabric+1.20.1-1.3.1 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ MutantMonsters-v8.0.7-1.20.1-Fabric +

+
+

+ ForgeConfigAPIPort-v8.0.0-1.20.1-Fabric +

+ +
+
+

+ PuzzlesLib-v8.1.21-1.20.1-Fabric +

+ + +
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ myLoot +

+
+

+ SpoornPacks +

+ +
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ mythic-mounts-1.20.1-7.2 +

+
+

+ Patchouli-1.20.1-84-FABRIC +

+ +
+
+

+ geckolib-fabric-1.20.1-4.4.7 +

+ +
+
+
+

+ mythicupgrades-4.1.3+mc1.20.1 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ owo-lib-0.11.2+1.20 +

+ +
+
+
+

+ mythquest-1.2 +

+
+
+

+ naturalist-fabric-4.0.3-1.20.1 +

+
+

+ geckolib-fabric-1.20.1-4.4.7 +

+ +
+
+
+

+ NaturesCompass-1.20.1-2.2.3-fabric +

+
+
+

+ Neruina-2.1.1-fabric+1.20.1 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ netherdepthsupgrade-fabric-3.1.6-1.20 +

+
+

+ geckolib-fabric-1.20.1-4.4.7 +

+ +
+
+
+

+ NetherPortalFix +

+
+

+ Balm +

+ +
+
+
+

+ nicer-skies-1.3.0+1.20.1 +

+
+
+

+ NoChatReports-FABRIC-1.20.1-v2.2.2 +

+
+
+

+ oxidized-1.8.2 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ packetfixer-fabric-1.4.2-1.19-to-1.20.1 +

+
+
+

+ paladins-1.3.1+1.20.1 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ spell_engine-0.15.8+1.20.1 +

+
+

+ trinkets-3.7.2 +

+
+ + + + +
+
+

+ runes-0.9.13+1.20.1 +

+ +
+
+

+ azurelibarmor-fabric-1.20.1-2.0.6 +

+
+
+
+

+ polymorph-fabric-0.49.5+1.20.1 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ PresenceFootsteps-1.9.4+1.20.1 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ projectile_damage-fabric-3.2.3+1.20.1 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ promenade-4.1.1 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ dawn-5.0.0 +

+ +
+
+
+

+ ProtectionBalancer-FABRIC-1.1.0 +

+
+

+ Necronomicon-Fabric-1.4.2 +

+
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ reacharound+1.20-1.3.0 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ ReBalance-FABRIC-1.1.0 +

+
+

+ Necronomicon-Fabric-1.4.2 +

+
+
+
+

+ remove-terralith-intro-message-1.0 +

+
+

+ Terralith_1.20.x_v2.5.4 +

+
+
+
+

+ repurposed_structures-7.1.15+1.20.1-fabric +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ Revive +

+
+

+ cloth-config-11.1.118-fabric +

+
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ rogues-1.1.0+1.20.1 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ spell_engine-0.15.8+1.20.1 +

+
+

+ trinkets-3.7.2 +

+
+ + + + +
+
+

+ azurelibarmor-fabric-1.20.1-2.0.6 +

+
+
+
+

+ simplyskills-1.5.0+1.20.1 +

+
+

+ spell_power-0.11.1+1.20.1 +

+ +
+
+

+ puffish_attributes-0.5.0-1.20-fabric +

+ +
+
+

+ spell_engine-0.15.8+1.20.1 +

+
+

+ trinkets-3.7.2 +

+
+ + + + +
+
+

+ puffish_skills-0.12.2-1.20-fabric +

+ +
+
+
+

+ simplyswords-fabric-1.55.0-1.20.1 +

+
+

+ cloth-config-11.1.118-fabric +

+
+
+

+ architectury-9.2.14-fabric +

+ +
+
+
+

+ smallships-fabric-1.20.1-2.0.0-b1.4 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ Sniffer+-fabric-1.20.1-0.3.0 +

+
+
+

+ sodium-extra-0.5.4+mc1.20.1-build.115 +

+
+

+ sodium-fabric-0.5.11+mc1.20.1 +

+
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ soulslike-weaponry-1.1.4.1-1.20.1-fabric +

+
+

+ ranged_weapon_api-1.1.2+1.20.1 +

+ +
+
+

+ geckolib-fabric-1.20.1-4.4.7 +

+ +
+
+

+ AttributeFix-Fabric-1.20.1-21.0.4 +

+ +
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ sound-physics-remastered-fabric-1.20.1-1.4.5 +

+
+
+

+ spark +

+
+
+

+ starlight-1.1.2+fabric.dbc156f +

+
+
+

+ starterkit-1.20.1-7.1 +

+
+

+ collective-1.20.1-7.80 +

+
+
+
+

+ The_Graveyard_3.1_(FABRIC)_for_1.20.1 +

+
+

+ geckolib-fabric-1.20.1-4.4.7 +

+ +
+
+
+

+ TieredZ +

+
+

+ autotag-2.0.2+1.20 +

+
+
+

+ cloth-config-11.1.118-fabric +

+
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ LibZ +

+ + +
+
+
+

+ tlc-fabric-1.0.1-1.20.X +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ toofast-fabric-1.20-1.2.0 +

+
+
+

+ True Darkness Refabricated +

+
+

+ cloth-config-11.1.118-fabric +

+
+
+
+

+ valentinesblessing 1.5.0 1.20.1 fabric +

+
+
+

+ vc_gliders-fabric-1.1.5 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ veinmining-fabric-1.5.0+1.20.1 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ VillagersPlus_3.1_(FABRIC)_for_1.20.1 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ villagesandpillages-fabric-mc1.20.1-1.0.0 +

+
+

+ YungsApi-1.20-Fabric-4.0.5 +

+ +
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ villagespawnpoint-1.20.1-4.4 +

+
+

+ collective-1.20.1-7.80 +

+
+
+
+

+ voicechat-fabric-1.20.1-2.5.19 +

+
+
+

+ VR-Combat_v1.0.2_Fabric_ALL +

+
+

+ bettercombat-fabric-1.8.5+1.20.1 +

+ + + +
+
+

+ vivecraft-1.20.1-1.1.11-fabric +

+
+
+
+

+ vrapi-3.0.9-1.20.1-fabric +

+
+

+ architectury-9.2.14-fabric +

+ +
+
+
+

+ Wabi-Sabi-Structures-2.0.0-1.20-Fabric +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ walljump-1.20.1-1.2.1-fabric +

+
+
+

+ way2wayfabric-0.0.6 +

+
+

+ fabric-language-kotlin-1.11.0+kotlin.2.0.0 +

+
+
+
+

+ When Dungeons Arise +

+
+
+

+ wraith-waystones-3.3.2+mc1.20.1 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ owo-lib-0.11.2+1.20 +

+ +
+
+
+

+ XaerosWorldMap_1.38.8_Fabric_1.20 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ Xaeros_Minimap_24.2.0_Fabric_1.20 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ YungsBetterDesertTemples-1.20-Fabric-3.0.3 +

+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ YungsApi-1.20-Fabric-4.0.5 +

+ +
+
+

+ cloth-config-11.1.118-fabric +

+
+
+
+

+ YungsBetterDungeons-1.20-Fabric-4.0.4 +

+
+

+ cloth-config-11.1.118-fabric +

+
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ YungsApi-1.20-Fabric-4.0.5 +

+ +
+
+
+

+ YungsBetterEndIsland-1.20-Fabric-2.0.6 +

+
+

+ YungsApi-1.20-Fabric-4.0.5 +

+ +
+
+

+ cloth-config-11.1.118-fabric +

+
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ YungsBetterJungleTemples-1.20-Fabric-2.0.5 +

+
+

+ YungsApi-1.20-Fabric-4.0.5 +

+ +
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ cloth-config-11.1.118-fabric +

+
+
+
+

+ YungsBetterMineshafts-1.20-Fabric-4.0.4 +

+
+

+ cloth-config-11.1.118-fabric +

+
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ YungsApi-1.20-Fabric-4.0.5 +

+ +
+
+
+

+ YungsBetterNetherFortresses-1.20-Fabric-2.0.6 +

+
+

+ YungsApi-1.20-Fabric-4.0.5 +

+ +
+
+

+ cloth-config-11.1.118-fabric +

+
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+
+

+ YungsBetterOceanMonuments-1.20-Fabric-3.0.4 +

+
+

+ cloth-config-11.1.118-fabric +

+
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ YungsApi-1.20-Fabric-4.0.5 +

+ +
+
+
+

+ YungsBetterStrongholds-1.20-Fabric-4.0.3 +

+
+

+ cloth-config-11.1.118-fabric +

+
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ YungsApi-1.20-Fabric-4.0.5 +

+ +
+
+
+

+ YungsBetterWitchHuts-1.20-Fabric-3.0.3 +

+
+

+ cloth-config-11.1.118-fabric +

+
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ YungsApi-1.20-Fabric-4.0.5 +

+ +
+
+
+

+ YungsBridges-1.20-Fabric-4.0.3 +

+
+

+ cloth-config-11.1.118-fabric +

+
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ YungsApi-1.20-Fabric-4.0.5 +

+ +
+
+
+

+ YungsExtras-1.20-Fabric-4.0.3 +

+
+

+ cloth-config-11.1.118-fabric +

+
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ YungsApi-1.20-Fabric-4.0.5 +

+ +
+
+
+

+ YungsMenuTweaks-1.20.1-Fabric-1.0.2 +

+
+

+ cloth-config-11.1.118-fabric +

+
+
+

+ fabric-api-0.92.2+1.20.1 +

+
+
+

+ YungsApi-1.20-Fabric-4.0.5 +

+ +
+
+
+

+ zephyr-0.5.0+1.20.1 +

+
+

+ zenith-1.2.3-1.20.1 +

+ + + +
+
+

+ spell_engine-0.15.8+1.20.1 +

+
+

+ trinkets-3.7.2 +

+
+ + + + +
+
+
+

+ [1.20.1-fabric]-Epic-Knights-9.8 +

+
+

+ cloth-config-11.1.118-fabric +

+
+
+

+ architectury-9.2.14-fabric +

+ +
+
+
+

+ [Fabric]CTOV-v3.4.6 +

+
+

+ lithostitched-fabric-1.20.1-1.1.8 +

+
+
+
+ \ No newline at end of file diff --git a/website/mods.json b/website/mods.json new file mode 100644 index 0000000..0c40c73 --- /dev/null +++ b/website/mods.json @@ -0,0 +1,46157 @@ +{ + "mod_info": { + "adventurez-1.4.20": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.20", + "1.20.1", + "1.21" + ], + "id": "defK2XM3", + "slug": "adventurez", + "project_type": "mod", + "team": "sMQl52lM", + "organization": null, + "title": "AdventureZ", + "description": "adds a new endboss and other creatures", + "body": "![Headline](https://i.imgur.com/zuOfip3.png)\n\n
\n\n[](https://discord.gg/cV4cJyGXqF) \n[](https://globox1997.github.io/wiki/mods/AdventureZ/)\n[](https://github.com/Globox1997/AdventureZ/issues)\n
\n\n\u201cDescription\u201d\n

\n\n This mod adds a new end boss to Minecraft besides other deadly creatures. The boss is called \"Blackstone Golem\" and will be the hardest enemy you ever encountered. If you will start a war against the Piglins, watch out, they will call their Beast for help! And maybe you\u00b4ll even get caught by the Soul Reaper which usually findable in the soul sand valley. Almost forgot to mention: Somebody has seen a weird looking small creature crawling around...\n\nEnable another end boss fight by adding [VoidZ](https://modrinth.com/mod/voidz) \n\n\u201cCreatures\u201d\n

\n
\nCreatures\n\nBlackstone Golem \n\n\n- Spawns with ritual\n\n\nPiglin Beast \n\n\n- Spawns randomly while attacking piglins and mining nether gold ore\n\n\nSoul Reaper (Mount: Nightmare) \n\n\n- Spawns in soul sand valley\n\n\nNecromancer \n\n\n- Spawns in nether fortress's\n\n\nSummoner (and its vanguard) \n\n\n- Spawns during thunderstorm\n\n\nBlaze Guardian \n\n\n- Spawns in nether fortress's\n\n\nDragon \n\n\n\n\nYou have to kill the Eye to reclaim the dragon egg. \nThe egg will feel the Fame you reached by killing the Eye and will hatch over time (about 10mins). \nAfter the Dragon hatched, tame it by feeding it with raw meat or orc skin. \nThe Dragon has to grow up one stage to be rideable (dragon saddle needed) and another stage to carry a chest.\n\n
\n\n\u201cBossSummoning\u201d\n

\n
\nBoss Summoning\n\nStone Golem Spawning \nGet 4 Gilded Blackstone Shards by bartering with piglins or find them in the nether bastions. \n \n\nBuild 4 Chiseled Polished Blackstone Holder by putting Chiseled Polished Blackstone into the stone cutter. \n \n\nPlace a circular area of blackstone blocks (or whatever is similar to blackstone) with a radius of 5 and put one each edge the stone holder just like this:\n \nAfter you placed all 4 shards into their holder the ritual will start..... \n\n\nThe Eye Spawning \nBuilt this altar and wait a little bit. \n\n\n
\n\n\n\u201cItems\u201d\n

\n
\nItems\n\n- Handbook ([Patchouli](https://modrinth.com/mod/patchouli) mod necessary)\n- Blackstone Golem drops: Blackstone Heart, Gilded Shard, Netherite, Blackstone\n- Soul Reaper drops: Wither Head, Coal\n- Piglin Beast drops: Gold Ingots, Piglin Flag\n- Necromancer drops: Enchanted Book\n- Summoner drops: Enchanted Book\n- Nightmare is tameable\n\nPiglin Flag \n \nThe Piglin Flag has to charge itself and when it\u00b4s charged and you get close, all aggressive Piglins will get calm.\n\n\nGilded Netherite Armor \n \nStronger version of the netherite armor but piglins won\u00b4t attack you! (And a full set effect)\n\n\nHandbook \n \n\n
\n\n[](https://globox1997.github.io)\n\n\n\u201cMisc\u201d\n

\n\n[](https://modrinth.com/mod/fabric-api)\n[](https://modrinth.com/mod/cloth-config)\n\n\n\nThis mod is developed for Fabric. \nThere are no plans to develop a Forge version. \n\n\nModpack Permission: \nFeel free to use it in any modpacks.\n\n\nBug Report: \nJust report bugs at the github page.\n\nLicense: \nSound effects are either licensed under [https://audiojungle.net/licenses/terms/audio_sfx_media_single](https://audiojungle.net/licenses/terms/audio_sfx_media_single) or modified sounds from vanilla Minecraft.\n\nFor an in game wiki book, install [Patchouli](https://modrinth.com/mod/patchouli) mod and check the creative inventory for an AdventureZ handbook.", + "body_url": null, + "published": "2023-04-18T20:03:04.944925Z", + "updated": "2024-07-20T18:22:24.385165Z", + "approved": "2023-04-20T22:07:33.588675Z", + "queued": "2023-04-19T20:42:22.970408Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "GPL-3.0-only", + "name": "GNU General Public License v3.0 only", + "url": null + }, + "downloads": 818374, + "followers": 309, + "categories": [ + "mobs" + ], + "additional_categories": [ + "adventure" + ], + "loaders": [ + "fabric" + ], + "versions": [ + "BI8491T1", + "V4ZECTUP", + "6483KEb7", + "3DMvG0s2", + "zrb4qqdJ", + "mBYmRou0", + "acNWrg1d" + ], + "icon_url": "https://cdn.modrinth.com/data/defK2XM3/bfebf4db35ca73d6c4d5c99c230b5b9f9b0de84c.png", + "issues_url": "https://github.com/Globox1997/AdventureZ/issues", + "source_url": "https://github.com/Globox1997/AdventureZ", + "wiki_url": "https://globox1997.github.io/wiki/mods/AdventureZ/", + "discord_url": "https://discord.gg/cV4cJyGXqF", + "donation_urls": [], + "gallery": [], + "color": 3348239, + "thread_id": "defK2XM3", + "monetization_status": "monetized" + }, + "almostunified-fabric-1.20.1-0.9.4": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20.1" + ], + "id": "sdaSaQEz", + "slug": "almost-unified", + "project_type": "mod", + "team": "aNgjGBk3", + "organization": "CMmmkdQy", + "title": "Almost Unified", + "description": "Unify all resources.", + "body": "![](https://i.imgur.com/yowlKWS.png)\n[![](https://i.imgur.com/u0EUHt8.png)](https://discord.com/invite/ThFnwZCyYY)\n[![](https://i.imgur.com/Z5PYH4R.png)](https://github.com/AlmostReliable/almostunified/wiki)\n
\n Text version if the thread design does not render\n\n ## What is Almost Unified?\n \n The mod is inspired by the idea of UniDict. An old, no longer maintained mod from the days of 1.12.2.\n \n Old versions of Minecraft used a system called the Ore Dictionary. Its purpose was to make the life of modders easier when adding new resources that might exist in other mods already. When used correctly, you could use resources from various mods in their recipes interchangeably. However, if you ever played a big modpack back in the days, you probably know that there were like 10 different ingots for each material because of many mods adding them.\n \n This often resulted in a lack of storage space because all these resources from the different mods didn't stack. Additionally, some mods didn't use the dictionary correctly for their recipes so a lot of the resources were useless.\n \n UniDict solved this issue by unifying the same resources from different mods so only one item for each resource was left and could be used for all recipes. So instead of having 10 different copper ingots, you will only have one which acts as the dominant universal copper ingot.\n \n A lot of time has passed since 1.12.2 and the Ore Dictionary is long gone. In today's modded Minecraft, there is the tag system which acts quite similar to the Ore Dictionary. Still, they also don't solve the problem of many similar resources from different mods.\n \n **Almost Unified** tries to solve this by working in a similar fashion as UniDict did.
\n Its goal is to have one dominant resource for each configured tag and make all recipes use this dominant entry.\n \n ## How does that work?\n \n By defining a priority mod list and target tags in the config, Almost Unified tries to find a dominant item for each entry and changes the recipes depending on that.\n \n In modern Minecraft, recipes are usually made of JSONs and are loaded when joining a world. Each loaded recipe is read by the mod and altered depending on different properties inside the JSON.\n \n For all inputs, the unification process tries to use the designated tag so all items will remain useful which means Almost Unified should also work in existing worlds.
\n For outputs, Almost Unified will use the dominant item.\n \n Since the modification happens before the recipe is loaded by the game, there are no demanding processes going on while the game is running.\n \n ## What features does Almost Unified have?\n \n The mod transforms existing recipes to have a unified resource list that players and packmakers can work with. It doesn't add its own recipes, resources, ore generation or similar content.\n \n Because there is a chance to have duplicate recipes when unifying, Almost Unified will take care of duplications and remove them.
\n Additionally, it hides all non-dominant entries from JEI/REI automatically.\n \n The mod is fully reloadable. Configs are loaded every time the unification process starts which means they can be edited on the fly. To restart the process, just rejoin the world or use the `/reload` command.\n \n ## Can you give an example?\n \n Think about having two mods (modA and modB) that both add Silver Ore. Additionally, they both add Silver Ingots and respective recipes to obtain the ingot such as blasting or smelting the ore.\n \n If one of those recipes doesn't accept a tag as input, Almost Unify will change that. Furthermore, it will pick one of the Silver Ingots as the dominant item depending on the mod priority list inside the `unify.json` config. The dominant Silver Ingot will then be used as output for all recipes no matter the mod.\n \n After the unification process, you will end up with some equal recipes. Almost Unified will merge them and change their namespace so it's visible that the recipe was changed. In the end, you will have recipes that accept tags as inputs and only the dominant item as output. Duplicate recipes are gone.\n \n ## More Information\n \n For more information like limitations, native integrations or the FAQ, check out the wiki.\n\n
", + "body_url": null, + "published": "2022-08-21T11:19:19.594924Z", + "updated": "2024-07-09T17:42:08.691231Z", + "approved": null, + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 222064, + "followers": 182, + "categories": [ + "library", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "5i3CDEPU", + "iPLl09Yp", + "HhEJwJjY", + "g6596Yhc", + "pxqDqMR6", + "IVGC6GrB", + "jzr8fnoX", + "6EEkziWr", + "adgBCDRT", + "nztD7CVi", + "dawIr2ll", + "1sPatF7i", + "XGrgybng", + "ZwTnMmsN", + "AqanTMTr", + "HPuyitzl", + "oq3dWrDm", + "fNkrtiCX", + "pWEJ9lt3", + "WD9vKXPX", + "v6TWHsCN", + "bFsMCCI6", + "F8ZrO9vc", + "NpapGvte", + "jqeqVVU7", + "diMbNXT8", + "7LOb0z3O", + "PNIkXs2V", + "PZ1V7Mci", + "NO4DBmZX", + "iWb6tbB4", + "kpra2XLr", + "SgSIjplb", + "Pe0tpYJe", + "sGZHzc7i", + "JSklQ9zu", + "bhmQdcdc", + "NvAPdMNm", + "YWoIpT1N", + "1UTu2EZZ", + "bpU76t3g", + "nbWcrGAi", + "lPrtVfBj", + "ya2hRYzy", + "YrBC9X9Q", + "X9usGUNQ", + "HfZeAiCX", + "qYNUAgzM", + "9iqXwRfp", + "ZkyaGWIx", + "ILB4Tm76", + "tYSS6Dib", + "VbNDGDII", + "vtOvInZA", + "Q9mxb7xs", + "cqbprPRc", + "Ocp2iq9E", + "xsvYCII8", + "9KNjI95c", + "XVbUWwC0", + "3xmHIA1J", + "S0wK1InC", + "OzxnzRxV", + "hXKgUk4D", + "hopcp0yt", + "WAGfVZjm", + "IkNQoRt2", + "80DhYnOt", + "LdpXU2mS", + "T3CnKiSU", + "Yyn03ljA", + "v6YSY0pw", + "Q1gWMYfR", + "hLr3jBxm", + "nrvWF22W", + "gUWPql3A", + "j1Ol0QER", + "NE5NsB65", + "vTWwDNWJ", + "x5KiRGNC", + "okZK8Lx5", + "NBNpbYAb", + "MkAI529t", + "ojpdph1V", + "lasgBuqp", + "KVOLhJSI", + "YDzvW95p", + "RiyZchYc", + "BesPYHZb", + "V7hJewmj", + "OplTfJDp", + "Uz6NJPcS", + "Cv3LWEEJ", + "ZT0u2HWk", + "ssbygc7n", + "fsSMrcgk", + "x8bJybK2", + "rMGSeDQz", + "wf3YSwoi", + "FAyhbLco", + "cwqdMHhD", + "hZvVvT8l", + "ZgDGxFc0", + "CSpPvatX", + "nLhRL3pq", + "sLS6oELk", + "W9q8bqP2", + "EGTJES1W", + "uqCiAPR4", + "ArjVJrdK", + "BAOk2AD7", + "1ov14RO9", + "tz9oQbzV", + "75K9jgbe", + "SiYTfq3f", + "jwZMFRqk", + "SYjdtQf1", + "vf8VT8aD", + "UvrZ6tFP", + "qVQ9f5D3", + "RjuumRfU", + "cSA0vt27", + "wzoXsAbJ", + "VUCF7R3A", + "IVNh2VAz", + "psiEddgv", + "mkiJRdLr", + "5THCGs2c", + "AzVUB6Vw", + "pcjL4aza", + "B9kFoHlt", + "7FxN2bNC", + "ncgNC12H", + "JQ3UqpzN", + "BnnMpdMG", + "MJwm2tmA", + "pqru65nb", + "brlyx43J", + "iPxDcTPR", + "k5BCFqKK", + "JZngR05p", + "iSU1L7cZ", + "8qeBGZYn", + "nFn0L5rw", + "cW3D2dSO", + "BiQhqfNX", + "8ALuKRsp", + "COPYJEcR", + "pchFVUfS", + "Vqb7bNrf", + "TbGxfXN7", + "vhMO7SQr", + "ETalPdiu", + "GPhV5diy", + "2bCWZOhd", + "iL1uzqLm", + "hrMz1WTy", + "YH1x7MeQ", + "HEFHUYYd", + "N5V4FGet", + "1S0kr114", + "EJj6qcep", + "MzOf4RYa", + "LKHPEmI5", + "eaBbozYP", + "IoeasYuS", + "PJdf652f", + "Jb8q6qK2", + "Kx0VExGM", + "MoAvkrMK", + "r3Jd2eXo", + "WpnR2Tvd", + "p33YZ9DO", + "ybQ1TnE4", + "UmPU7AO8", + "Ci0KgTme", + "uihVnGhm", + "3WDjplY2", + "vxSvv9JJ", + "yIAiMmGu", + "aTfTDomA", + "arDcFGHI", + "gXM8Ox27", + "XHsZ7uBE", + "XlEuGzig", + "yyVCxO7K", + "ylGLTJba", + "ihQZPM1X", + "uqVj6O6P", + "lrwYXo99", + "s5fw9UvM", + "fscv1Pjy", + "iVBf0ICr", + "oTclC5Xa" + ], + "icon_url": "https://cdn.modrinth.com/data/sdaSaQEz/icon.png", + "issues_url": "https://github.com/AlmostReliable/almostunified/issues", + "source_url": "https://github.com/AlmostReliable/almostunified", + "wiki_url": "https://github.com/AlmostReliable/almostunified/wiki", + "discord_url": "https://discord.com/invite/ThFnwZCyYY", + "donation_urls": [], + "gallery": [], + "color": 11892829, + "thread_id": "sdaSaQEz", + "monetization_status": "monetized" + }, + "AmbientSounds_FABRIC_v6.0.3_mc1.20.1": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.12.2", + "1.16.5", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.20.6", + "1.21" + ], + "id": "fM515JnW", + "slug": "ambientsounds", + "project_type": "mod", + "team": "4RhBAs8B", + "organization": null, + "title": "AmbientSounds", + "description": "#listentonature", + "body": "\n\n**Requires [CreativeCore](https://modrinth.com/mod/creativecore)**\n\nAdds a rich ambience to the minecraft world. It supports custom engines and works well with mods world gen mods.\n\nUse /cmdclientconfig to access the config menu.\n\nUse /ambient-debug to see which sounds are playing (especially provide this information if you run into any issues)\n\n[\n](https://bisecthosting.com/teamcreative)\n\nUse the promo code teamcreative to get 25% off the first month on any of the gaming servers!\n\n[](https://www.patreon.com/creativemd)", + "body_url": null, + "published": "2021-08-17T09:26:03.852346Z", + "updated": "2024-07-09T09:18:22.305606Z", + "approved": "2021-08-17T09:26:03.852346Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 3108005, + "followers": 2245, + "categories": [ + "decoration" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "BkXARkwZ", + "gFA6rBRh", + "2GbdNWGc", + "Sth6XBbQ", + "mDsLRr3N", + "lleFsB3J", + "e2gz3HUq", + "OsvzFd1y", + "yMtKbCEH", + "X8aI9NX6", + "eDgqY1Gy", + "dKw2Azzg", + "rOFJAh1B", + "SaQNGUEW", + "HzAe7PdZ", + "yNFnf8du", + "adl4Ncwv", + "gFtyQpNQ", + "pU05E7rb", + "oO7RFtWI", + "H0e9z1R6", + "73cNzWIl", + "FnnwJGsd", + "ZQN41zUK", + "D8qFUFSe", + "eB8o9LJz", + "OCSsOHGW", + "ppyL48by", + "NBW6NILj", + "S9iWVbEo", + "uQ9ET7hv", + "3AqrJrw1", + "OeOZOgyO", + "YT7FF3lB", + "nB0Tb6yU", + "LNo9BMgY", + "ohMKnW3z", + "UhavHRSW", + "Axhf30fN", + "UMnOkgCb", + "spvQUwSs", + "YBOPXA7f", + "YzNTPba6", + "9Tzh60G4", + "oYrYXOpd", + "4AfD1W6g", + "AqgfKYX9", + "mFnIDeOy", + "jDKRf1LG", + "HeOQezGR", + "3XEpPTC0", + "sRTEh2bn", + "4AGySW6x", + "V6l1fpvW", + "jvElWEG9", + "Ezr0c9Mn", + "P6V7wtJl", + "tBPV6HX5", + "uFkj6MGq", + "5sNrTJOv", + "rOt61sOt", + "LMxgEE6D", + "41K1ScgC", + "4Oi6qbIh", + "HJn2qd61", + "zFY28Q2o", + "3hcMOFBh", + "faJZJQyE", + "SWnTRY6J", + "udzi7qiX", + "rSZhsa1c", + "n7Rl5o6Y", + "T8ORjhFh", + "u3CNTWfF", + "Y5HfsfYu", + "eVwI6FD9", + "l4b3Ev57", + "igkw5jai", + "f8udQ9NA", + "fMT5SCgk", + "2z5buLUy", + "h5nUJIV3", + "zTT9Dzv8", + "LCNNNltd", + "R5ocwPul" + ], + "icon_url": "https://cdn.modrinth.com/data/fM515JnW/icon.png", + "issues_url": "https://github.com/CreativeMD/AmbientSounds/issues", + "source_url": "https://github.com/CreativeMD/AmbientSounds", + "wiki_url": null, + "discord_url": "https://discord.gg/W9QM3fS", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/creativemd" + } + ], + "gallery": [], + "color": 1055242, + "thread_id": "fM515JnW", + "monetization_status": "monetized" + }, + "Aquamirae-6": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.18.2", + "1.19.2", + "1.20.1" + ], + "id": "k23mNPhZ", + "slug": "aquamirae", + "project_type": "mod", + "team": "sO83oKB2", + "organization": null, + "title": "Aquamirae", + "description": "Ship graveyard with terrible deep sea creatures!", + "body": "
\n
\n\n*The once endless ocean, the waters of which were raised from the depths by gusty winds, the ocean that was sailed by brave voyagers and fearsome flotillas of pillagers, is now chained in ice and snow.*\n\n*Frozen in time... The ships of those who were unlucky froze in the merciless ice, at the same moment terrible creatures crawled out of the abyss into the light of day. Through the blizzard, only the rare sounds of the horns of those who still hope for rescue are heard. What could transform the once unbridled ocean so drastically?*\n\n###
Requires Obscure API
\n\n##
Features
\n\n- Ice location with unique generation. Maze on the surface, frozen ocean under the ice.\n- Generates in the vanilla Deep Frozen Ocean biome, making it compatible with all world generation mods.\n- Lots of different sized structures for survival.\n- Unique ambient: background sounds, music and particles.\n- Terrible deep-sea (and not only) creatures.\n- Ghost of Captain Cornelia: boss with complex animation and a set of deadly abilities.\n- Many weapons with various abilities.\n- Several sets of armor with unique effects of half-sets and full-sets.\n- Food, \u0441onsumable items, items with unique properties and decorations.\n- Many customization options via config file.\n\n
\n
\n\n

\n\n##
Obscuria Collection Mods
\n\n
\n

\n

\n

\n

\n

 

\n
\n\n#
Sponsored by [NameHero](https://nhtrx.com/?a=1494&oc=54&c=209&p=r&s1=)
\n\n####
Need your own server to play with friends? NameHero provides amazing hosting services with automatic server setup for any game version and an easy-to-use control panel for advanced customization. Create your own server in 5 minutes without any technical knowledge!
\n\n
", + "body_url": null, + "published": "2023-04-21T10:04:44.615725Z", + "updated": "2024-07-17T11:56:58.546562Z", + "approved": "2023-04-23T17:06:52.866618Z", + "queued": "2023-04-22T19:52:51.631906Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 568777, + "followers": 624, + "categories": [ + "adventure", + "equipment", + "worldgen" + ], + "additional_categories": [ + "food", + "magic", + "mobs" + ], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "kXsNZuKf", + "CAaXvTip", + "v2QyW19e", + "Wc9ngskb", + "ouUaC54p", + "7lX4KLFc" + ], + "icon_url": "https://cdn.modrinth.com/data/k23mNPhZ/e33ffb391c8c05f1ea99b09d00d5369e0ac44ae7.png", + "issues_url": "https://discord.gg/By29HCKgPx", + "source_url": null, + "wiki_url": "https://github.com/ObscuriaLithium/Aquamirae/wiki", + "discord_url": "https://discord.gg/jSHHJSUWdY", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/Obscuria" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/k23mNPhZ/images/e144fc02877a08a5b604948429d5e418ceab6f64.webp", + "featured": true, + "title": "Cover", + "description": null, + "created": "2023-04-25T21:22:14.458241Z", + "ordering": 1 + } + ], + "color": 2382222, + "thread_id": "k23mNPhZ", + "monetization_status": "monetized" + }, + "archers-1.2.5+1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20.1" + ], + "id": "QgooUXAJ", + "slug": "archers", + "project_type": "mod", + "team": "fxvOEILN", + "organization": null, + "title": "Archers (RPG Series)", + "description": "\ud83c\udff9 Draw, Release, Conquer - Master the art of Archery!", + "body": "![](https://cdn.modrinth.com/data/QgooUXAJ/images/11e2b43cda5d546815ce58e0d5198e0a25d8779e.png \"\")\n\n## \ud83c\udff9 Draw, Release, Conquer - Master the art of Archery!\n\n[![Modloader](https://img.shields.io/badge/Loader-Fabric-ecebe6?labelColor=263768&style=for-the-badge)](https://fabricmc.net)\n[![Connector](https://img.shields.io/badge/Forge-via_Sinytra_Connector-orange?style=for-the-badge)](https://modrinth.com/mod/connector)\n[![Discord](https://img.shields.io/discord/973561601519149057.svg?label=&logo=discord&logoColor=ffffff&color=7389D8&labelColor=6A7EC2&style=for-the-badge)](https://discord.gg/KN9b3pjFTM)\n\n### \u2728 Discover more of the RPG Series\n\n[![Paladins](https://cdn.modrinth.com/data/XIpMGI6r/images/3f19359bfd7521ba17bec818f125e87e09ef277e.png \"Paladins\")](https://modrinth.com/mod/paladins-and-priests \"\")\n[![Wizards](https://cdn.modrinth.com/data/XIpMGI6r/images/a7da965aa108daf95c10448c01423be49ce2338d.png \"Wizards\")](https://modrinth.com/mod/wizards \"\")\n[![Rogues](https://cdn.modrinth.com/data/XIpMGI6r/images/278d8c941af6dc763cf714b9f36f8b8366a60eb9.png \"Rogues\")](https://modrinth.com/mod/rogues-and-warriors \"\")\n[![Jewelry](https://cdn.modrinth.com/data/XIpMGI6r/images/747102d582732b8defa50a2c925c7d5a6f87d009.png \"Jewelry\")](https://modrinth.com/mod/jewelry \"\")\n\n# \ud83d\udce6 Installation\n\n### Required\n\n- [AzureLib Armor](https://modrinth.com/mod/azurelib-armor \"\")\n- [Ranged Weapon API](https://modrinth.com/mod/ranged-weapon-api \"\")\n- [Spell Engine](https://modrinth.com/mod/spell-engine \"\")\n\n### Strongly recommended\n- [Better Combat](https://modrinth.com/mod/better-combat \"\") for proper bow attributes\n\n# \ud83c\udff9 Features\n\n## Archery skills\n\nFind a Spell Binding Table in village [Gazebos](https://modrinth.com/mod/gazebos \"\"), or build your own.\n\nMake your Archery Manual (spellbook of archers), and unlock all the archery skills.\n\nArchery skills can be used with any bow or crossbow (vanilla, or even third party mods).\n\n![](https://cdn.modrinth.com/data/QgooUXAJ/images/97acd243f72f634742a683b6bf8f894fb7cb7853.png \"\")\n\n## New equipment\n\nExplore new, craftable spears, ranged weapons with varying characteristics, and armor pieces with archery bonuses!\n\nEquipment bonuses are configureable in `config/archers/items.json`.\n\n![](https://cdn.modrinth.com/data/QgooUXAJ/images/262305ebbf429052c39f5f104b2dcf9c2e913296.png \"\")\n\n## Auto-Fire Hook\n\nAuto-Fire Hook is a new, craftable gadget, that can be attached to any bow or crossbow, to automatically release fully charged arrows. So arrows can spam shot by hold the use key (right click).\n\nCompatible items are listed in the `archers:auto_fire_hook_attachables` data tag.\n\n![](https://cdn.modrinth.com/data/QgooUXAJ/images/28ce7b9a0c803e5f258bafeb1aa402e75ccd4605.png \"\")\n\n## Rebalanced enchantments\n\nRebalanced vanilla enchantments for ranged weapons to scale in an equivalent manner compared to melee enchantments.\n\n**Power** (for bows) gives +8% damage per level (instead of +50% per level).\n\n**Quick Draw** (for crossbows) reduce draw time by 10% damage per level (instead of 20% per level).\n\n**Infinity** available for Crossbows (turned on by default).\n\nThese changes are configurable in `config/archers/tweaks.json`.\n\n![](https://cdn.modrinth.com/data/QgooUXAJ/images/887a1ac03f225e8126f5c1dcd2e4fe90af5aaa45.png \"\")\n\n\n## Extended dungeon loot\n\nFind powerful archery equipment in dungeon loot chests!\n\nLoot table injections are configurable in `config/rpg_series/loot.json`.\n\n![](https://cdn.modrinth.com/data/QgooUXAJ/images/70aafa33211905bed21cc2e305a006bb3ca66304.png \"\")\n\n## New village structures\n\nFind Archery Ranges in villages, where archery equipment is being sold!\n\nThe spawn weight and limit are configureable in `config/archers/villages.json`.\n\n(When playing with Better Villages by JTL mod, it is recommended to disable spawning of small archery ranges in revamped villages, so only large ones will spawn)\n\n![](https://cdn.modrinth.com/data/QgooUXAJ/images/b3eacb45937d460007af06b0449b08e8a6dd76d9.png \"\")\n\n# \ud83d\udd27 Configuration\n\nSkill use mechanics and HUD can be configured under **Mod Menu / Spell Engine / Settings**.", + "body_url": null, + "published": "2023-11-02T19:34:49.954531Z", + "updated": "2024-07-08T15:08:56.337012Z", + "approved": "2023-11-08T00:02:57.664015Z", + "queued": "2023-11-05T23:03:48.587602Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 408865, + "followers": 376, + "categories": [ + "adventure", + "equipment", + "game-mechanics" + ], + "additional_categories": [ + "magic", + "worldgen" + ], + "loaders": [ + "fabric" + ], + "versions": [ + "VEUlYKJj", + "gMXRAwI2", + "dEHZfTdA", + "NvezilAw", + "Qh5DA0m3", + "kbLGIusC", + "HADxMSlV", + "8ZAr68x7", + "SsljDTVj", + "CLsGamjt", + "NiZ1NHR8", + "48ImjUZP", + "gUXCxkkN", + "VgerX2Af", + "SOJ4DVD4" + ], + "icon_url": "https://cdn.modrinth.com/data/QgooUXAJ/fe9138d3f1ee1625c7ee169e85e73c140189c386.png", + "issues_url": "https://github.com/ZsoltMolnarrr/Archers/issues", + "source_url": "https://github.com/ZsoltMolnarrr/Archers", + "wiki_url": null, + "discord_url": "https://discord.gg/KN9b3pjFTM", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/daedelus" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/QgooUXAJ/images/11e2b43cda5d546815ce58e0d5198e0a25d8779e.png", + "featured": false, + "title": "Logo", + "description": "Archers (RPG Series)", + "created": "2023-11-05T17:21:38.674475Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/QgooUXAJ/images/262305ebbf429052c39f5f104b2dcf9c2e913296.png", + "featured": false, + "title": "Items", + "description": null, + "created": "2023-11-07T22:07:16.136678Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/QgooUXAJ/images/28ce7b9a0c803e5f258bafeb1aa402e75ccd4605.png", + "featured": false, + "title": "Auto Fire Hook", + "description": null, + "created": "2023-11-08T09:59:21.781248Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/QgooUXAJ/images/70aafa33211905bed21cc2e305a006bb3ca66304.png", + "featured": false, + "title": "Loot", + "description": "Find archery equipment in dungeons", + "created": "2023-11-05T16:59:14.692374Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/QgooUXAJ/images/8657be3ab6cdf9c6802ae5f66f9efbce8e853572.png", + "featured": true, + "title": "Archers in-game", + "description": null, + "created": "2023-11-05T18:58:19.937793Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/QgooUXAJ/images/887a1ac03f225e8126f5c1dcd2e4fe90af5aaa45.png", + "featured": false, + "title": "Enchantments", + "description": "Rebalanced Vanilla Enchantments", + "created": "2023-11-05T16:59:36.573791Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/QgooUXAJ/images/97acd243f72f634742a683b6bf8f894fb7cb7853.png", + "featured": false, + "title": "Archery Skills", + "description": null, + "created": "2024-04-04T09:43:00.512054Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/QgooUXAJ/images/b3eacb45937d460007af06b0449b08e8a6dd76d9.png", + "featured": false, + "title": "Village structures", + "description": "Find new village structures, where archery equipment is sold", + "created": "2023-11-05T17:00:24.711284Z", + "ordering": 0 + } + ], + "color": 2574377, + "thread_id": "oU3MShr9", + "monetization_status": "monetized" + }, + "architectury-9.2.14-fabric": { + "client_side": "optional", + "server_side": "optional", + "game_versions": [ + "1.16.5", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19-pre1", + "1.19", + "1.19.1", + "1.19.2", + "22w42a", + "22w43a", + "22w44a", + "1.19.3-pre2", + "1.19.3", + "23w03a", + "1.19.4-pre3", + "1.19.4", + "23w13a", + "23w13a_or_b", + "23w18a", + "1.20-pre1", + "1.20-pre5", + "1.20", + "1.20.1", + "23w31a", + "23w32a", + "23w33a", + "23w35a", + "1.20.2-pre1", + "1.20.2-pre2", + "1.20.2-pre4", + "1.20.2", + "23w40a", + "23w41a", + "1.20.3-pre1", + "1.20.4", + "24w09a", + "24w12a", + "24w14potato", + "24w14a", + "1.20.5-pre1", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "lhGA9TYQ", + "slug": "architectury-api", + "project_type": "mod", + "team": "72qgsq9X", + "organization": "hUDBrSHN", + "title": "Architectury API", + "description": "An intermediary api aimed to ease developing multiplatform mods.", + "body": "# Architectury API\n\nTalk to us on [Discord](https://discord.gg/C2RdJDpRBP)!\n\nAn intermediary api aimed to ease developing multiplatform mods.\n\n### What is Architectury API\n\nArchitectury API is an api to abstract calls to fabric api and forge api as both loader has different implementations of\nwhat can be perceived as the same thing.\n\nArchitectury API updates regularly, with new hooks and features. Currently contains over **90** events hooks, networking\nabstraction, loader calls abstraction, game registry abstraction and an easy to use @ExpectPlatform annotation (Only\nworks on static methods).\n\n### Do I really need this API?\n\nArchitectury API is only one part of the architectury ecosystem, **Architectury Plugin** is the gradle plugin enabling\nall this multiplatform actions.\n\nArchitectury API is optional for projects built on architectury, you may create your architectury project with just\nArchitectury Plugin.\n\n### Advantages of Architectury\n\n- Open sourced\n- Less boilerplate for your multiplatform mod\n\n### Getting started with making multiplatform mods\n\nArchitectury Loom: https://github.com/architectury/architectury-loom (a fork of Fabric Loom adding multiplatform development capabilities)\n\nGradle Plugin: https://github.com/architectury/architectury-plugin (includes Architectury Injectables, for the `@ExpectPlatform` annotation)\n\nExample Mod: https://github.com/architectury/architectury-example-mod (a discontinued example mod using Architectury, if possible, use the templates instead)\n\nMod Templates: https://github.com/architectury/architectury-templates (a set of templates to get started using the Architectury toolchain)\n\n### Example: Usage of @ExpectPlatform\n![Exmaple of the @ExpectPlatform annotation, part of Architectury Injectables](https://camo.githubusercontent.com/78c68766affb70fbd88f9806e0e95f78765ec339448d7102065f2942be2b3215/68747470733a2f2f6d656469612e646973636f72646170702e6e65742f6174746163686d656e74732f3538363138363230323738313138383130382f3737363432383831343330393738353632302f756e6b6e6f776e2e706e673f77696474683d31313931266865696768743d343339)\n\n### Credits\n\nIn certain older versions, this library used to bundle typetools; you can find its license [here](https://github.com/jhalterman/typetools/blob/master/LICENSE.txt \"\")", + "body_url": null, + "published": "2020-11-16T10:40:17.116288Z", + "updated": "2024-07-22T09:13:06.286970Z", + "approved": "2020-11-16T10:40:17.116288Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 7956692, + "followers": 3030, + "categories": [ + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "37aObfvM", + "gyNUAhlG", + "7mmmFMxV", + "5KJz05dn", + "sqJXhMX9", + "y6rBiuLE", + "Vato9b7P", + "2AmdiW2X", + "YLbgW3at", + "iKqu0dIa", + "qFpMNY9p", + "JD5CZqrY", + "Uw4OUIpO", + "468H7PSo", + "xUSAkGXZ", + "yekAuTSi", + "kuKyhx4a", + "puJaYNe6", + "G6roBkfe", + "vhKOfGGy", + "JKUpiAOI", + "BO9pG04t", + "RRYxZ2Ss", + "LOJZqt02", + "PNRrEweK", + "ol14cqSs", + "6rv0zlku", + "99woqoda", + "uwTqwrar", + "k2CSXNeY", + "TytFoW0P", + "BrPyk75r", + "nEcl9mv3", + "z3PYgL8v", + "k5Vk58yE", + "mjtvukk4", + "dQVFn0lZ", + "mpqJwBvP", + "2nlsuqT0", + "OcSwv7Bd", + "PnEz49HI", + "oNHPgHOo", + "7tOt6yBe", + "kgP2KvTa", + "syUiA6EY", + "Hf0Bau1j", + "4EmMThpo", + "J78onBNb", + "4QsePUaY", + "DrzwF8io", + "M2TFuKCj", + "LkkGgJ54", + "Abuha336", + "hVpjPVqq", + "ZTaMrj4V", + "d9yizwYu", + "cRQNpVkN", + "iSSjXP6I", + "e5A7iji0", + "QbVhURET", + "QdSI5Jqt", + "TfrGiL2j", + "fgbaICgI", + "4ExwBLcT", + "Vx9peY9q", + "LLWnlbqB", + "AqHbhvJG", + "D9WJXiDA", + "I0bwxQis", + "fmyLcSUR", + "fuvw3iT3", + "BDGIzrTW", + "m9TL0O0B", + "XNSp0pec", + "Vfjfgr3q", + "H2eskN4C", + "MJMK72lb", + "CQS8sEfa", + "DDO8yQYm", + "RvJHT8eh", + "A6mEgIbA", + "mYz4gdHP", + "99U08qrM", + "l5BQFxY6", + "yayVtVT2", + "lbZY1Knw", + "SvFEBbXa", + "juDpYJd0", + "JzXLfsj6", + "aNnwGOML", + "HINkYiBY", + "nq5xHPXL", + "76Z4FAQ0", + "BCLEdiJm", + "GCR7RG35", + "JCUL4KKt", + "Qg9loogH", + "foPbHoIn", + "TZRm0P23", + "ZrvfXtKK", + "yaTUjhVv", + "xjWpId6m", + "cH9PCvfY", + "rJ54rLqX", + "FkwCidMg", + "Dlcr87N4", + "hFLxuJ0N", + "KE5bu0Vd", + "tXIP7YPz", + "MSHtHE4s", + "iIYfuRMT", + "i6EVpCCY", + "lvNmFud9", + "PbE00gCi", + "MGP3b9Aq", + "d5oFBHkM", + "umK9Amrq", + "ejJFmhZW", + "PEKDmPIQ", + "ZZxvV3Kl", + "9yZyQCYh", + "4QgrcQn8", + "sylbo6YH", + "JD6EmQHI", + "Hl08ZTHo", + "wkQeBjBR", + "dcM46wLr", + "SaBmdMXf", + "WFvj4t0k", + "Z7iWDzqB", + "s1gmP0Q3", + "1eob8ZdG", + "uhEeGdaK", + "41RubmTw", + "2xqs1Y6b", + "v3rn2fDT", + "wafgwqUm", + "xXsDyf0B", + "alc70oBu", + "GEBcq08y", + "1hOCMZsg", + "VwpnDGLt", + "ketja3QP", + "sGPVpzLh", + "9VVWBhOe", + "YiYBpQpv", + "OrdDd9xt", + "YxX289mS", + "I0TW1RGi", + "BmkZHo8Y", + "tJBAMkGO", + "7vxxSNtV", + "XZrvAVVY", + "SWry8g5q", + "6hcOpiuA", + "Kwuu4O4w", + "tJGqxo3S", + "LjNaLvHD", + "97NYBivp", + "gP2XH9Oe", + "gcCtfIqf", + "MDMnIYXn", + "fHBKIXLG", + "lh8TNghT", + "XXGqoxBe", + "ppDF7bGm", + "Xb48U4dI", + "oGBEjb15", + "NtVaa36c", + "jHxM99iS", + "ZBfefNWq", + "a9f986RP", + "XV72M5Gg", + "w5Kw8FAN", + "Z6666f4P", + "ScYnvqdx", + "Zw57dVyl", + "j5zDzQqi", + "o069zrDa", + "DIw2YTZ2", + "H3InwdRP", + "aQu6FcPv", + "HoIJp48v", + "ns7Xs1B6", + "eIZS4sYy", + "62fhHjWH", + "cysqWrDN", + "OFLHUcGo", + "NxbWyaxs", + "lReYANwU", + "7zJ2DJuN", + "jSGDiM9H", + "QNVGxVoq", + "7SbYSIdC", + "TWylwR7P", + "ON7CwM6M", + "6bcAfgt2", + "8y4xVR6z", + "8tNf9Wq9", + "5VA4z5O5", + "Xisp7QmU", + "Sbew3kXe", + "gyJ7kDpb", + "Ock52JGW", + "94pDo4Mg", + "NyIvjlpf", + "UWacXu6I", + "cSMWX5mK", + "msOhmxZv", + "tN1jacer", + "cv151FBM", + "RbSwgJzj", + "WtGJ04th", + "g64rcqrh", + "92SRnLOo", + "Hwb5NUwj", + "7anuQwt3", + "BD9Sr6TL", + "JJjGdSFd", + "hGR2Y1XK", + "hPS5IgBx", + "s7TNBlkA", + "mGUTSes6", + "tcThoSyZ", + "fz7a9s7w", + "bkK2w2SA", + "AIDo0TBH", + "puZezS6x", + "mzs29BUG", + "DRIeZqaG", + "JNXDm2dM", + "4P2tDXB8", + "TcnLTl81", + "WpILW4lU", + "ibcxOwwP", + "VFiyBfxr", + "5Df4To3D", + "BcFTKnjw", + "S8ah9mAL", + "m1ZNYMdO", + "3TLU8vWO", + "TDrn8LU6", + "iqtq80D9", + "8KEpDc47", + "ekLaVOwe", + "GASUTIWF", + "lLMy7N02", + "FS4xv173", + "Vd2WmEGD", + "kuK9g96U", + "7a4IcC0B", + "R5RNBeku", + "ng2Ah4fI", + "Jn96Vhkn", + "NNgyZexI", + "ibPc02al", + "RDKM6Ne0", + "whUFAS71", + "tBWqtdBO", + "Qf7DCvFk", + "dSE4T7Xl", + "AIFDESOL", + "ueVsvU6j", + "VojERyZc", + "pERZHG0d", + "ql0OowZw", + "3ChyUkZQ", + "WbL7MStR", + "1MKTLiiG", + "cde9Su0w", + "96L7fC9l", + "jJekxf2z", + "ioqQQnil", + "qbmXVUzs", + "5ofORDt8", + "ZBYAOSc6", + "L9jCGCSy", + "QMCCyxa5", + "oTflOmop", + "PU55znJx", + "kVjQWX0l", + "ZFDazCA3", + "1ROEGmfO", + "C2sB1Yq5", + "uo9eXNGR", + "PByNovaH", + "vEEP0bOY", + "TiDPj2Uz", + "814k8fLR", + "K1mZCldi", + "N6v35Fhx", + "WdiKTPMg", + "M57oafqk", + "SC8yTYVZ", + "CQnItbHC", + "FOAcMcjs", + "pdzYN3Za", + "jDrqxvlE", + "7SK856ow", + "ABmmUMl5", + "uicFHU6j", + "g3p4ZDht", + "4JZAlpn7", + "SbPQPVBq", + "geHK4z6i", + "qvgH61MM", + "nW3HvWVP", + "KDUH9htx", + "i0N0Veb4", + "cCIK28as", + "iqKljDnd", + "Th6yhTAa", + "vvN5UGnq", + "whouAO7b", + "NtU0dTSY", + "rFHVOzAZ", + "afBcyXjI", + "zQZVt59v" + ], + "icon_url": "https://cdn.modrinth.com/data/lhGA9TYQ/icon.png", + "issues_url": "https://github.com/architectury/architectury/issues", + "source_url": "https://github.com/architectury/architectury", + "wiki_url": null, + "discord_url": null, + "donation_urls": [ + { + "id": "github", + "platform": "Github", + "url": "https://github.com/sponsors/MaxNeedsSnacks" + }, + { + "id": "patreon", + "platform": "Patreon", + "url": "https://patreon.com/shedaniel" + } + ], + "gallery": [], + "color": 1315603, + "thread_id": "lhGA9TYQ", + "monetization_status": "monetized" + }, + "archon-0.7.0": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20.1" + ], + "id": "td9zQQBq", + "slug": "archon", + "project_type": "mod", + "team": "cFaH7uFK", + "organization": null, + "title": "Archon", + "description": "Sorcery, Necromancy, Bosses, and More!", + "body": "\n
\nSpoiler\n\n\n\n
\n\n

\"Archon\"

\n

Archon is an elemental based magic mod for Fabric 1.18+. It includes:

\n

- A Unique Mana System

\n

- Elemental Weapons with Abilities

\n

Spellcasting system with unique spells

\n

- Necromancy

\n

- Helpful Miscellaneous Items

\n

- Summonable Bosses

\n

- And More! 

\n

 

\n

If you have Patchouli installed, you can craft a Grimoire to view all about the content.

\n

 

\n

 

\n

\"\"

\n

REQUIRES SPELL POWER ATTRIBUTES \n

\nSpoiler\n\n\n\n
\n\nRecommended Mods:

\n

Patchouli: Allows you to use the guide book

\n

REI: Allows you to view all recipes

\n

 

\n

Compatible Mods:

\n

Spell Power Attributes: Spell damage boosted by critical damage

\n

EMI: REI alternative

\n

 

\n

 

\n

\"\"

\n

 

\n

 

\n

FAQ

\n
\n

Q: Can I configure this mod?

\n

A: Yes, you can find a config file in your run folder. You can configure many aspects of the mod, including the mana display position.

\n

Q: Will this be ported to Forge?

\n

A: No

\n

Q: What if I found an issue or have a suggestion?

\n

A: Create a detailed post on the github issues page

\n

Q: Why are some of the textures bad?

\n

A: I'm not a great artist, so I do what I can with textures

\n

 

\n

Tips

\n

1. You may add other mobs to the tags c:bossesarchon:creatures, and archon:players to allow souls to be dropped from modded mobs.

\n

2. You can customize the maximum mana of individual players by using the /mana setMax command

\n

3. To increase the difficulty of a modpack, it is recommended you adjust spell recipes to make them harder to craft

\n
\n

 

\n

\"\"

", + "body_url": null, + "published": "2023-11-27T22:53:57.267804Z", + "updated": "2024-08-06T12:40:15.387364Z", + "approved": "2023-11-30T22:05:05.307299Z", + "queued": "2023-11-27T23:04:52.092870Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "GPL-3.0-only", + "name": "GNU General Public License v3.0 only", + "url": null + }, + "downloads": 139791, + "followers": 31, + "categories": [ + "adventure", + "equipment", + "magic" + ], + "additional_categories": [ + "game-mechanics", + "mobs", + "utility", + "worldgen" + ], + "loaders": [ + "fabric" + ], + "versions": [ + "7PMR18Cs", + "HJaP589G", + "YVC9b3TB", + "SASDbmVF", + "cTrb2Cvg", + "lZt13Wur" + ], + "icon_url": "https://cdn.modrinth.com/data/td9zQQBq/a62e64f6fc83356a7e1d79d19785ed3a34fd4f34.png", + "issues_url": "https://github.com/Safrodev/Archon/issues", + "source_url": "https://github.com/Safrodev/Archon", + "wiki_url": null, + "discord_url": "https://discord.gg/muAnYRGXrq", + "donation_urls": [], + "gallery": [], + "color": 1902883, + "thread_id": "GUMYstXN", + "monetization_status": "monetized" + }, + "Argonauts": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.20", + "1.20.1", + "1.20.2", + "1.20.4" + ], + "id": "bb2EpKpx", + "slug": "argonauts", + "project_type": "mod", + "team": "dUaHb0Sk", + "organization": "N42M457t", + "title": "Argonauts", + "description": "A guild and party mod to work and play together with your teammates on a server!", + "body": "## Argonauts\n\n[![Made by Terrarium](https://images.teamresourceful.com/u/I80VLV.svg)](https://discord.terrarium.earth)\n[![Modrinth Partnership](https://images.teamresourceful.com/u/Bi4Cuo.svg)](https://discord.gg/modrinth-734077874708938864)\n[![Requires Resourceful Lib](https://images.teamresourceful.com/u/jUWHY2.svg)](https://modrinth.com/mod/resourceful-lib)\n[![Supports Cadmus](https://images.teamresourceful.com/u/zVzeTh.svg)](https://modrinth.com/mod/cadmus)\n[![Supports Heracles](https://images.teamresourceful.com/u/wZtXSD.svg)](https://modrinth.com/mod/heracles)\n\n### \ud83d\udcd6 About \ud83d\udcd6\n\nNamed after the great heroes who rode with Jason on the Argo,\nArgonauts is a utility mod that enables you to work together as\na team with other players on your multiplayer servers with different\nguilds and parties. \n\nIt allows you to chat with them using guild or\nparty chat, manage the permissions of your teammates and your teammates itself\nwith the handy gui, and participate in activities together with your team members,\nlike [Questing](https://www.modrinth.com/mod/heracles) and [Land Claiming](https://www.modrinth.com/mod/cadmus)\n\n### Team management GUI\n![Party Member gui](https://files.teamresourceful.com/r/FJianb.png)\n\n### Party/Guild Chat\n![Rick astley making an appearance in party chat](https://cdn.discordapp.com/attachments/881359242492252170/1112121200542490746/image.png)\n\n### Quest/Land Claiming Integration\n![Claiming land as a team with Cadmus and Argonauts](https://files.teamresourceful.com/r/l2xD5h.png)\n\n---\n
\n\n### Socials\n\n[![youtube-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/social/youtube-plural_vector.svg)](https://youtube.terrarium.earth)\n[![twitch-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/social/twitch-plural_vector.svg)](https://www.twitch.tv/terrariumearth)\n[![twitter-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/social/twitter-plural_vector.svg)](https://twitter.terrarium.earth)\n[![kofi-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/donate/kofi-plural_vector.svg)](https://kofi.terrarium.earth)\n[![discord-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/social/discord-plural_vector.svg)](https://discord.terrarium.earth)\n[![modrinth](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/available/modrinth_vector.svg)](https://modrinth.com/user/Terrarium)\n[![curseforge](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/available/curseforge_vector.svg)](https://www.curseforge.com/members/terrariumearth/projects)\n\n---\n\n### Check Out our Other Projects\n\"Handcrafted\"\n\"Chipped\"\n\"Ad\n\"Tempad\"\n\"Colorful\n\n\"Lil\n\"Vitalize\"\n\"Spirit\"\n\"Reaper\"\n\"Experience\n
\n", + "body_url": null, + "published": "2023-04-03T14:53:17.244097Z", + "updated": "2024-04-14T21:04:25.477981Z", + "approved": "2023-06-10T23:41:15.625946Z", + "queued": "2023-06-10T21:30:15.566307Z", + "status": "approved", + "requested_status": "unlisted", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 223385, + "followers": 177, + "categories": [ + "utility" + ], + "additional_categories": [ + "library", + "management", + "social" + ], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "ua5WCyVc", + "s6aYAqG9", + "2d1RRhRS", + "wxjTKLo3", + "Nntabg2y", + "IH2HFcvL", + "vxnbK7td", + "itpopxed", + "FAs8No0k", + "fvHqltx4", + "fvK2DdCB", + "dlmPwB2h", + "4WO9VSSE", + "6kWn2185", + "qaPDStz0", + "tbOrGAho", + "DXR5wmcD", + "NnwtMtFB", + "xKXMoidE", + "jJPVvZIA", + "mBXCaPlN", + "AzpOeqjn", + "axA0dUnz", + "fQP9S8Yw", + "AP8YzFpf", + "Rka22SAY", + "WJ2oWLzK", + "QRazdbGn", + "Pr2VnQgn", + "Lc96Obnn", + "Ibub9zqP", + "WWdnpWiV", + "EBD0qDzw", + "nP4rBNWT", + "r0eKAc5z", + "wLI6JsqG" + ], + "icon_url": "https://cdn.modrinth.com/data/bb2EpKpx/a1bd657608a465ee17d88307b936eb41bcdad502.png", + "issues_url": "https://github.com/terrarium-earth/Argonauts/issues", + "source_url": "https://github.com/terrarium-earth/Argonauts", + "wiki_url": null, + "discord_url": "https://discord.terrarium.earth", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/bb2EpKpx/images/bcd2c8729814155c0cd001861e785d7f3b717b25.png", + "featured": false, + "title": "Party/Guild chat", + "description": "Use party/guild chat to talk to your team members on a secure channel, with neat features like embed viewing", + "created": "2023-06-10T21:23:19.980967Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/bb2EpKpx/images/db695b9899b30e54ad82f2c117d1c74975801a9f.png", + "featured": false, + "title": "Cadmus integration (Land claiming)", + "description": "You can claim land as a team using Cadmus with Argonauts. Completely optional tho!", + "created": "2023-06-10T21:24:36.335023Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/bb2EpKpx/images/f4aa0d1f9f692679a681deb78ed70ef4d1a2075e.png", + "featured": false, + "title": "Party member management", + "description": "You can use our GUI to manage who is in your party and what permissions they have in it", + "created": "2023-06-10T21:22:26.635585Z", + "ordering": 0 + } + ], + "color": 1846356, + "thread_id": "bb2EpKpx", + "monetization_status": "monetized" + }, + "artifacts-fabric-9.5.12": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20.1", + "1.20.4", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "P0Mu4wcQ", + "slug": "artifacts", + "project_type": "mod", + "team": "6u3haPJ2", + "organization": null, + "title": "Artifacts", + "description": "Adds various treasure items that can be found through exploration", + "body": "![](https://raw.githubusercontent.com/ochotonida/artifacts/1.18/src/main/resources/logo.png)\n\nSome older versions of this mod can be found on curseforge: [Forge](https://www.curseforge.com/minecraft/mc-mods/artifacts) / [Fabric](https://www.curseforge.com/minecraft/mc-mods/artifacts-fabric)\n\nArtifacts is a mod which aims to make exploration more rewarding by adding various powerful items that cannot be crafted.\n\nThe items added by this mod can be found in chests in vanilla structures, through archaeology, or can very rarely be found worn by entities. All artifacts only have a few chests in which they can be found, so go out and explore! Additionally, a new underground campsite structure has been added. Mimics occasionally spawn in these campsites instead of a chests, which are dangerous enemies that attack players that get too close. Mimics always drop a random artifact when killed.\n\nEvery item added by this mod has a unique model when equipped. The full set of items and their descriptions can be found in the images tab. Sn up-to-date list of where each item can be found is available on the wiki on GitHub.\n\n![](https://user-images.githubusercontent.com/37985539/118691060-fdaaa400-b808-11eb-97c8-2f45ef277c52.png)\n\n## Frequently Asked Questions\n\n\n#### _Some items are too powerful, is there some way I can change that?_\n\nArtifacts adds various game rules that allow you to change or completely disable the effects of all items added by the mod.\nIn versions for Forge 1.19.2 and below, most of these config options are located in the server config. Unlike the client and common config files, server config files are located in your world save's _serverconfigs_ folder. Preventing specific items from spawning in chests is currently not possible without creating a data pack, but it is possible to change how rare artifacts are in general using the artifactRarity (for items in chests) and campsite count/mimicChance (for mimics) config options.\n\n#### _How do I change the amount of slots for my artifacts?_\n\nIf you're using the Forge version, It is possible to change the number of slots of each type using the Curios server config. The '/curios' command can also be used to add/remove slots for one specific player. If you want to change the slot an artifact can be placed in, you will need to create a data pack and change the item tags that determine the artifact's slot types.\nMore information on how to do all of these things can be found on the [Curios wiki](https://github.com/TheIllusiveC4/Curios/wiki/How-to-Use:-Users).\n\nIf you're using the Fabric version, modifying the number of slots players have requires creating a data pack. Information about the data formats used can be found on the [Trinkets wiki](https://github.com/emilyploszaj/trinkets/wiki/Trinkets-Data-Formats).\n\n#### _Which mod are you using to put artifacts on armor stands?_\n\n[Curious Armor Stands](https://www.curseforge.com/minecraft/mc-mods/curious-armor-stands \"\").\n\n#### _Can I still find artifacts if I add this mod to a world that has already been generated?_\n\nCampsites and mimics will only spawn in chunks that were generated after you downloaded the mod. You will still be able to find artifacts in unopened chests in existing chunks.\n\n#### [Forge] _Whey I try to open the Curios menu to equip my artifacts, nothing happens._\n\nSome server plugins can cause this (https://github.com/TheIllusiveC4/Curios/issues/131). If you're using plugins, verify that this issue also happens in a Forge-only environment before asking for help.\n\n[![](https://discordapp.com/api/guilds/298798089068609537/widget.png?style=banner2)](https://discord.gg/87pXJadaRr)", + "body_url": null, + "published": "2022-06-14T16:56:58.872057Z", + "updated": "2024-08-13T15:12:29.864419Z", + "approved": "2022-06-14T16:56:58.872057Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 611133, + "followers": 599, + "categories": [ + "adventure", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "vtfSrjwt", + "enKgSs94", + "mPPkxtPE", + "tr5a9mT8", + "e4CTWqPl", + "fSw9kqQh", + "V8ExzIs5", + "NyF72ZGD", + "o0rov6DO", + "qXHbzxWN", + "3uzmjVVv", + "qrgK6WbC", + "qYmael6x", + "aR9WUkuw", + "jNhlay28", + "l9VPEvbV", + "V30gGFiR", + "mqynvjMF", + "M29wAfi3", + "lEZPMdyg", + "NZW4ytS1", + "Mx3Od65u", + "v3E2bsYR", + "1DMHqctP", + "bJzHzT51", + "6DXOR2pO", + "b349kUSi", + "Czb4tu7o", + "bfIQoQHe", + "r3FHm0nE", + "bbR3MLn5", + "9LAXM8mY", + "DcVGTlgT", + "KmlubFpZ", + "IvSt1a0t", + "TdKHoxTe", + "IfIR5Ism", + "QocOGlCW", + "2GfgtAam", + "4dYkst1S", + "sHrGzycI", + "PebrQais", + "zdWM9d47", + "iyqyMkD3", + "9Kojdc30", + "DDQl0gcS", + "xSYcBxz1", + "e7pOMiUY", + "X7e1GWpM", + "edfEyLZL", + "yD2sUuih", + "EH6eSF3G", + "ssCNWbE6", + "Uetdhalv", + "lswKVrnX", + "dPhbqtM6", + "Odf79yb4", + "xGYyX1il", + "EAwGZiN8", + "9t7hc6bZ", + "AoKWNF4Z", + "LIJxLjYS", + "Ajy5hbi6", + "ybE3XjDX", + "WvvsDJxJ", + "gbxaQJBL", + "X75XmT50", + "8mZ5UnPo", + "U2iHcp5o", + "VlULYp87", + "2zjahdfM", + "gJMeLEjq", + "uYKiAW2x", + "X4J7A9Jl", + "bm5Am3Lg", + "1O1JZK36", + "Ua6Apv5x", + "SeeTaJsQ", + "VfXXlUYc", + "coaHNDhc", + "ZtCX7QxR", + "fcNXNA2P", + "CibbmvD9", + "ybdJhvVc", + "ZunWeb9t", + "dq6iQjYP", + "PwoGGJe5", + "GMcOLgEm", + "hTuOUk3O", + "EprKTxJ0", + "oLyJvXUR", + "jDAjEp8X", + "LxumgfoD", + "YL3oRJmh", + "jcPe37QH", + "o2Dxkk1w", + "gaxqqbHi", + "yh2oWH8q", + "GvpFCDSY", + "yfRlmBIB", + "k4LL0VHh", + "zFrdv9y8", + "HS4Gj6ih", + "nrhNa8EA", + "a2ALFzXl", + "NV50esMi", + "jSNuKYez", + "2s7befRd", + "uHFUM7yZ", + "aHLeaL2m", + "oLw9PXUb", + "5N2GJypV" + ], + "icon_url": "https://cdn.modrinth.com/data/P0Mu4wcQ/icon.png", + "issues_url": "https://github.com/ochotonida/artifacts/issues", + "source_url": "https://github.com/ochotonida/artifacts", + "wiki_url": "https://github.com/ochotonida/artifacts/wiki", + "discord_url": "https://discord.gg/87pXJadaRr", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/011b27804cc18af57e472790267a73d9ac03a23e.png", + "featured": false, + "title": "Shock Pendant", + "description": "Has a chance to strike attackers with lightning. Found in desert pyramids", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/076c11d33843c4b235be3545a750928f831546af.png", + "featured": false, + "title": "Digging Claws", + "description": "Increases the wearer's mining speed and base mining level. Found in abandoned mineshafts, buried treasure chests & village toolsmiths", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/0e2498f43ebdc1d7f71e903eab8940dfecbf8653.png", + "featured": false, + "title": "Cloud in a Bottle", + "description": "Allows the wearer to double jump. Found in pillager outposts, large underwater ruins, end cities & mineshafts", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/13a66e43218fce429742299e2f791c529a1c1975.png", + "featured": false, + "title": "Vampiric Glove", + "description": "Causes the wearer's melee attacks to absorb health. Found in mineshafts, desert pyramids & village armorers", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/1a7f9ac24d5a253dfe66eba1ef41f4eb64911c4c.png", + "featured": false, + "title": "Fire Gauntlet", + "description": "Causes the wearer's melee attacks to set targets on fire. Found in ruined portals, large underwater ruins & bastion treasure chests", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/22a5a367086dabe854526f24fc989807912f1a1f.png", + "featured": false, + "title": "Pickaxe Heater", + "description": "Automatically smelts mined ores", + "created": "2024-04-28T09:01:39.010315Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/25d520a97dca6f4a448edc983460e79f6a0a00b5.png", + "featured": false, + "title": "Everlasting Beef/Eternal Steak", + "description": "Not consumed when eaten. Dropped by cows killed by players, found in bastion stables & village butchers", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/3797512334b075f1a7147f75a3be744248705426.png", + "featured": false, + "title": "Feral Claws", + "description": "Increases the wearer's attack speed. Found in shipwrecks, buried treasure chests & village weaponsmiths", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/424a4109496812006522ac6ca70c74ee7ebc7c44.png", + "featured": false, + "title": "Lucky Scarf", + "description": "Applies an extra level of fortune to mined blocks. Found in treasure chests, ruined portals, strongholds & underwater ruins", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/518f58c323940e629433cb92fa1e115b48009de8.png", + "featured": false, + "title": "Whoopee Cushion", + "description": "Increases the wearer's flatulence. Found in desert pyramids & village tanneries", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/526f58902d6840a84284fd186a69fdf02915f283.png", + "featured": false, + "title": "Flippers", + "description": "Improves agility while swimming. Found in buried treasure chests, shipwrecks & large underwater ruins", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/5ea9189c441071cb9319402af866d24aa7078288.png", + "featured": false, + "title": "Night Vision Goggles", + "description": "Allows the wearer to see in the dark. Found in abandoned mineshafts, shipwrecks & ruined portals", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/5f2d761c5a7b91a3a8656f979401fdeefed2002c.png", + "featured": false, + "title": "Pocket Piston", + "description": "Increases knockback dealt by the wearer. Found in pillager outposts, nether fortresses & village toolsmiths", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/5f6eb8aedde6b2a7e43ebc7c9f7b7cf675ef9974.png", + "featured": false, + "title": "Plastic Drinking Hat", + "description": "Greatly reduces the time it takes to drink drinkable items. Found in abandoned mineshafts, buried treasure chests & nether fortresses", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/5fb6306e2e5eec07e05abd0b077421f67547eec8.png", + "featured": false, + "title": "Panic Necklace", + "description": "Increases the wearer's movement speed after taking damage. Found in abandoned mineshafts, bastion treasure chests & pillager outposts", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/6328bcac3e5f8fc3576b840893ffd7a96f3c8637.png", + "featured": false, + "title": "Steadfast Spikes", + "description": "Grants immunity to knockback. Found in pillager outposts, shipwrecks, bastion treasure chests & village armorers", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/6990d0b95084d8e9bd9a884a4fde4093abf233e3.png", + "featured": false, + "title": "Angler's Hat", + "description": "Increases Lure and Luck of the Sea by 1 level", + "created": "2024-04-28T09:02:50.508531Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/7034e883c0e562b133700b39687b69c30e96e832.png", + "featured": false, + "title": "Umbrella", + "description": "Can be used both as a shield and as a glider. Found in buried treasure chests, desert pyramids & village tanneries", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/720e621cb831db8f8228a9a042090b15d4ac690b.png", + "featured": false, + "title": "Thorn Pendant", + "description": "Has a chance to damage attackers. Found in desert pyramids & ruined portals", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/792729eea617db12d976c478eae786837f795f60.png", + "featured": false, + "title": "Power Glove", + "description": "Increases damage dealt by the wearer. Found in pillager outposts, ruined portals, strongholds & large underwater ruins", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/8d56d7ecfadfdf612e7c3ea88277efa7f8e33d66.png", + "featured": false, + "title": "Aqua-Dashers", + "description": "Allows the wearer to sprint on water. Found in mineshafts, buried treasure chests & strongholds", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/8f5c4c26b78dc3c9543ec95950970bdfea7903d3.png", + "featured": false, + "title": "Obsidian Skull", + "description": "The wearer becomes temporarily immune to fire damage when hurt by fire. Found in ruined portals, shipwrecks & mineshafts", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/a2d1393dab7e82a3626c30d5844aad572a37c68d.png", + "featured": false, + "title": "Helium Flamingo", + "description": "Allows the wearer to swim in the air for a short period of time. Found in stronholds & end cities", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/a90f95fb7aa651609cb7846a8419a30fc4474b52.png", + "featured": false, + "title": "Charm of Sinking", + "description": "The wearer can move freely in water. Found in desert pyramids, shipwrecks & village temples", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/a93c907f04a4b5a8508c41da95c7547b94e37249.png", + "featured": false, + "title": "Antidote Vessel", + "description": "Greatly reduces the duration of negative effects. Found in strongholds, bastion treasure chests & village temples", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/aa0107f4f218fbaef5b991fa96ff1f61dd5159f2.png", + "featured": false, + "title": "Chorus Totem", + "description": "A fatal hit teleports the player somewhere else", + "created": "2024-04-28T09:00:05.437319Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/b382452ad14426c0c7d4a7892e8e7591afcc4cab.png", + "featured": false, + "title": "Flame Pendant", + "description": "Has a chance to light attackers on fire. Found in desert pyramids & bastion stables", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/b6b377fda58e099565caadb4b80c060a3cde1b15.png", + "featured": false, + "title": "Cowboy Hat", + "description": "Increases the speed of ridden mounts", + "created": "2024-04-28T09:03:07.147606Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/c8b9964c056762a32a1ed9bba7b6255acda639ab.png", + "featured": false, + "title": "Villager Hat", + "description": "Decreases trading prices with villagers. Found in villages", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/cbb5d183e86b8c7c376f17c0557403495c3e63ea.png", + "featured": false, + "title": "Kitty Slippers", + "description": "Creepers avoid the wearer. Found in jungle temples, buried treasure chests & village tanneries", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/ce6d43fc6c0257fb0b5cf634174a79a1449d729f.png", + "featured": false, + "title": "Scarf of Invisibility", + "description": "Turns the wearer invisible. Found in desert pyramids, pillager outposts, shipwrecks & village tanneries", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/cf23d823e42489aa6fd02b3290248aa83401683e.png", + "featured": false, + "title": "Universal Attractor", + "description": "Attracts nearby items. Found in desert pyramids, ruined portals & shipwrecks", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/d2c5572788f62c9d86349805f6abcf976e08e9bf.png", + "featured": false, + "title": "Snowshoes", + "description": "Allows the wearer to walk on powder snow, and makes ice less slippery", + "created": "2024-04-28T09:01:15.892784Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/d489ff909b9047fa2d944a4c4ce6ed4f8cb6d6ed.png", + "featured": false, + "title": "Umbrella (Blocking)", + "description": "Can be used both as a shield and as a glider", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/d53bca9d0d1947db15f8d3de630d9405e13c6d34.png", + "featured": false, + "title": "Cross Necklace", + "description": "Increases the length of invincibility after taking damage. Found in bastion treasure chests, nether fortresses, pillager outposts and large underwater ruins", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/e2279f56e79b7e821df06edf61fdc3ebaae63780.png", + "featured": false, + "title": "Mimic", + "description": "Drops an artifact when killed", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/ec89b0ac3b29289bdb05e710c89be3ee748f8b19.png", + "featured": false, + "title": "Onion Ring", + "description": "Applies a haste effect after eating food", + "created": "2024-04-28T09:02:14.319560Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/ed445746d8c1ab261a831a96e57478a7d8645bcb.png", + "featured": false, + "title": "Bunny Hoppers", + "description": "Increases the wearer's jump height and prevents fall damage. Found in jungle temples, buried treasure chests, bastion stables & village tanneries", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/eefdef822049ba8d848aacb3b9fec4da0c782adc.png", + "featured": false, + "title": "Rooted Boots", + "description": "Slowly replenishes the wearers hunger while walking on grass", + "created": "2024-04-28T09:00:50.284857Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/f5b68c23e8d02742644b9092e3261ab63da9fd84.png", + "featured": false, + "title": "Snorkel", + "description": "Allows the wearer to breathe underwater. Found in buried treasure chests, shipwrecks & large underwater ruins", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/f5d6423517f898cf2a3dbb12c8cc08b2222f1d6c.png", + "featured": false, + "title": "Crystal Heart", + "description": "Increases the wearer's maximum health. Found in bastion treasure chests, end cities & pillager outposts", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/f8df0d38edcda36e6d8fe13f41552f70fd96b263.png", + "featured": false, + "title": "Golden Hook", + "description": "Increases experience dropped by creatures. Found in buried treasure chests, shipwrecks & bastion treasure chests", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/f97e834a38ba8a1ef926731854106a6260861745.png", + "featured": false, + "title": "Running Shoes", + "description": "Increases movement speed and step height while sprinting. Found in shipwrecks, nether fortresses & village armorers", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/P0Mu4wcQ/images/fa8a4d52cebae479c0e59b9172409dc8e9f2e7a2.png", + "featured": false, + "title": "Superstitious Hat", + "description": "Applies an extra level of looting to killed entities. Found in pillager outposts, strongholds, large underwater ruins & mineshafts", + "created": "2022-06-14T16:56:46.582836Z", + "ordering": 0 + } + ], + "color": 11177309, + "thread_id": "P0Mu4wcQ", + "monetization_status": "monetized" + }, + "AttributeFix-Fabric-1.20.1-21.0.4": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.12.2", + "1.13.2", + "1.14.2", + "1.14.4", + "1.15", + "1.15.1", + "1.15.2", + "1.16.1", + "1.16.2", + "1.16.3", + "1.16.4", + "1.16.5", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4" + ], + "id": "lOOpEntO", + "slug": "attributefix", + "project_type": "mod", + "team": "D9VMVOio", + "organization": null, + "title": "AttributeFix", + "description": "Removes arbitrary limits on Minecraft's attribute system. Fixes MANY mods!", + "body": "

Attribute Fixer

\n

Minecraft uses an attribute system to handle important calculations. It covers everything from armor values, to attack damage, to the maximum health of a mob. This system also introduced attribute caps, which limit how high any value can be. While this usually goes unnoticed, many mods are unknowingly affected by it. This mod significantly increases these caps to allow those mods to work as they were intended.

\n

Affected Attributes

\n\n\n

Like the mod and want to support me?

\n\n\n[![Nodecraft sponsor banner](https://assets.blamejared.com/nodecraft/darkhax.jpg)](https://nodecraft.com/r/darkhax)\n\n**This project is sponsored by Nodecraft. Use code [DARKHAX](https://nodecraft.com/r/darkhax) for 30% off your first month of service!**\n", + "body_url": null, + "published": "2023-06-07T06:12:44.154539Z", + "updated": "2024-02-01T20:21:44.537460Z", + "approved": "2023-06-09T23:51:52.304932Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LGPL-2.1-only", + "name": "GNU Lesser General Public License v2.1 only", + "url": null + }, + "downloads": 1381647, + "followers": 261, + "categories": [ + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "utiAPXIi", + "TjtoYsyI", + "4feEebkk", + "ZTRF7KcP", + "s7njSnD7", + "fbT8x6hb", + "ShbiE4Sr", + "dR12BCsZ", + "2tlCoSAq", + "RPr3pRGG", + "lXaaNiEz", + "przuZMs5", + "hWX258Ay", + "Py2zFNMB", + "28PrkuB5", + "CswSLDud", + "NPVSGGAA", + "nSSUlRzy", + "8VHAJ7XQ", + "bUTkWyrJ", + "XCSwOC6w", + "m6PV0M7j", + "HsxMK7lm", + "iH7jt6Rs", + "CXEA4uUw", + "8OXjuyAE", + "5i8cnhHt", + "GqHS3No8", + "ekJQu9eX", + "V2sZfGZ9", + "9GJHTfue", + "OBOrRWOZ", + "uEbi6Xkg", + "dwmeczek", + "U19owoad", + "MOmlYe1t", + "TQiqNvD9", + "zLoau2R7", + "ZxUp6vgd", + "8npdTCHg", + "8RGearAk", + "jpPdX8Gm", + "th3YfV05", + "BljpRtM8", + "hVsa3JJd", + "j86gIAeM", + "Vbz8pwb8", + "F1cS6XGU", + "WOvxX2lr", + "imnsBtKC", + "jnhW5VaZ", + "vYLbf5R7", + "TJFB90aP", + "jIgPLxgk", + "Ki9VOsWw", + "iWkwiAay", + "ZfLj4Yv8", + "8us1FakC", + "JOgBIRl3", + "faBIQKaU", + "meRWEfK3", + "2CqoWXFe", + "RDqSeyOX", + "mFAudhGF", + "oQQ5xZZY", + "z0Cg572G", + "yobCsC5K", + "cSTWE9cu", + "J9iztDbP", + "A8NdzVY8", + "Uv1kNYmC", + "CpvfFwkw", + "uV0rha3l", + "tpBJqwWE", + "bKUCDnQH", + "EAAquIie", + "ip7KQeBK", + "pAcjJrCr", + "I65bHWcF", + "RmLpa4og", + "X3nlVK64", + "7lsA3k7C", + "wkhqxp1Q", + "kXsL5oos", + "RI4sWcBO", + "4zmNqYTH", + "nXXStfhl", + "DpVr9OOR", + "xlL1HNMV", + "o8hFkfzu", + "YCmZhRO9", + "pYgL1KjE", + "pstYUA40", + "w0gEQWpC", + "SD6j6TWD", + "CCf6Xz7D", + "6AiILf8q", + "Qt4BEYlo", + "Y09GwS1A", + "Pjsot1vt", + "XAsKgBxc", + "qRtByEsL", + "M7v3NRKD", + "oAPOEZOh", + "tIjN25we", + "Qv0VR0pO", + "ZPZI5mAG", + "B5XgR60E", + "Y42wjyly", + "2Hp957Mc", + "byZmu5oc", + "umTqvP2X", + "uQr7JCs5", + "iaLfJR9t", + "cZrgJ3bC", + "rbc3xtzE", + "V5u3pVn6", + "eMw4fAKK", + "9i2o9Ch1", + "b3G59qDW", + "xnk0kHVU" + ], + "icon_url": "https://cdn.modrinth.com/data/lOOpEntO/eb101c911c7d86b138f052b678760f0ea645407a.png", + "issues_url": "https://github.com/Darkhax-Minecraft/AttributeFix/issues", + "source_url": "https://github.com/Darkhax-Minecraft/AttributeFix", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": 263172, + "thread_id": "lOOpEntO", + "monetization_status": "monetized" + }, + "autotag-2.0.2+1.20": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1" + ], + "id": "8FdYDHF5", + "slug": "autotag", + "project_type": "mod", + "team": "CuOWTsQ5", + "organization": null, + "title": "AutoTag", + "description": "Automatically populates some item, block and other tags (for mod compatibility)", + "body": "This is a purely technical mod with the aim to increase inter-mod compatibility. By \"purely technical\" I mean that it won't add any content to your game.\n\n### The Problem\n\nMod creators are encouraged to use tags where possible, e.g. when creating a recipe. If mods are supposed to work together though, they should all share a same base of common \"conventional\" tags, which group certain items together. Not all developers add their items to common tags though, which means that a person playing with many mods or a mod pack creator might need to create long lists of all items which fulfill certain criteria to add them to specific tags.\n\n### The Solution\n\nUpon loading a world, this mod will automatically populate some tags based on code conditions, covering all modded content as well.\n\nIt's mostly relevant for mod pack creators who need / want to configure mods by adding to specific tags - this allows them to e.g. easily add all armor items to a tag, because they'll all be bundled in `c:armor`.\n\nAs another example, all items which are equippable in the head slot will land in a tag called `c:head_equippables`:\n\n![Screenshot of the `c:head_equippables` tag](https://i.imgur.com/2E36FZS.png)\n \n\n### Additional Information\n\nFor an overview of the tags the mod currently adds, as well as the blacklist option via datapacks, [view the README on GitHub](https://github.com/apace100/autotag/blob/1.18/README.md).\n\nIf you have any suggestions for new tags, feel free to post them in the comments or [open an issue on GitHub](https://github.com/apace100/autotag/issues)!\n\n\n\nI hope this mod helps someone and makes their life a bit easier. :)\n\n----\n\nThe mod icon is a composition of modified icons created by Lorc and Delapouite, found on game-icons.net.", + "body_url": null, + "published": "2022-04-27T08:43:12.453767Z", + "updated": "2023-07-07T18:57:46.548975Z", + "approved": "2022-04-27T08:43:12.453767Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 528091, + "followers": 79, + "categories": [ + "library", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "zTLVD3Ir", + "iLNm8Z6p", + "50kM3UvN", + "VoyNngbb", + "sXJE2Hnq", + "cC57ynct", + "ocD9XA8D" + ], + "icon_url": "https://cdn.modrinth.com/data/8FdYDHF5/icon.png", + "issues_url": "https://github.com/apace100/autotag/issues", + "source_url": "https://github.com/apace100/autotag", + "wiki_url": "https://github.com/apace100/autotag/blob/1.18/README.md", + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": 12234661, + "thread_id": "8FdYDHF5", + "monetization_status": "monetized" + }, + "azurelib-fabric-1.20.1-2.0.30": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.15.2", + "1.16.5", + "1.17.1", + "1.18.2", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20-pre1", + "1.20-rc1", + "1.20", + "1.20.1", + "1.20.2-pre1", + "1.20.2-rc1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "7zlUOZvb", + "slug": "azurelib", + "project_type": "mod", + "team": "QhkAYHHd", + "organization": null, + "title": "AzureLib", + "description": "Based off Geckolib but now just for my own needs.", + "body": "
\n \"logo\"/ \n\n \"discord\"/ \n
\n\n\"logo\"/ \nAzureLib represents a branch derived from Geckolib 4.x, serving as an animation engine tailored for Minecraft Mods. It boasts various features, including support for intricate 3D keyframe-driven animations, over 30 different easing functions, concurrent animation capabilities, sound and particle keyframes, event-based keyframes, and numerous other functionalities. Currently, I'll focus on maintaining and supporting AzureLib; no help will be given to Geckolib.\n \n
\n\nThis library is compatible with the following Minecraft versions:\n\nForge: 1.16.5, 1.17.1, 1.18.2, 1.19.2, 1.19.3, 1.19.4, and 1.20.1.\n\nNeoForge: 1.20.1\n\nFabric: 1.16.5, 1.17.1, 1.18.2, 1.19.2, 1.19.3, 1.19.4, 1.20.1, and 1.20.2.\n\n

\nAre you a developer and want to use this library in your mod? Add the following to your build.gradle\n
\n
\n\n\n```\nrepositories {\n // The Maven with the mods source\n maven {url 'https://libs.azuredoom.com:4443/mods'}\n}\n\ndependencies {\n //Fabric or Quilt\n modImplementation \"mod.azure.azurelib:azurelib-fabric-MCVERSION:MODVERSION\"\n\n //Forge\n implementation fg.deobf(\"mod.azure.azurelib:azurelib-forge-MCVERSION:MODVERSION\")\n\t\t\n //NeoForge\n implementation fg.deobf(\"mod.azure.azurelib:azurelib-neo-MCVERSION:MODVERSION\")\n}\n```\n\n\n
\n
\n
\n\nNeed a server to play with friends? Don't know how to setup one? Just rent an already configured server from BisectHosting!\n \"logo\"/ \n\nClick on the picture above, select plan(at least 4GB), and use my code azuredoom to get 25% off your first month and enjoy playing with your friends!\n
\n
", + "body_url": null, + "published": "2023-01-24T08:01:23.547440Z", + "updated": "2024-08-08T18:36:40.503187Z", + "approved": "2023-01-24T23:09:37.922384Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 957905, + "followers": 132, + "categories": [ + "game-mechanics", + "library", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "LDZFNjki", + "CgVj70jh", + "zWykmtqo", + "39MGMY7Q", + "AM5t9a26", + "CILTq4BU", + "ecSsoPtT", + "bFRkE88b", + "NiGvu10T", + "A2PDoaYN", + "XjvMrBZP", + "QZl6JcqT", + "6E6SEgtW", + "XlOc0qD4", + "d3qfu6qK", + "kejusDPz", + "46GyZgcU", + "Ob4LvW1N", + "yqyQDwz9", + "85sdEQDz", + "ws5ltrOM", + "4EbS1K0B", + "WgwXzT4I", + "q1KHQlDP", + "C0AbA66Y", + "AOS1HMS3", + "s3NVVkqF", + "qJ1K7JXf", + "hp9oWPGg", + "CQxVwene", + "rO9fnyNv", + "mNFADOpS", + "uJMOWWi1", + "eDhc6PwH", + "jVn3VuKy", + "lD86FT86", + "23bXXrTF", + "3Seelhqf", + "pGYyND0o", + "SA51R0wI", + "MCwwOpAA", + "h8xIu6bq", + "THm4U3x8", + "EdI3NZ8B", + "o16VeU1k", + "SJwSDG54", + "AgDCEFJS", + "DkeMO9Sn", + "UgyGgCNs", + "ZhHmT85n", + "qZFJWCUa", + "fXDvk89W", + "qlpMymrJ", + "zlgKtE8W", + "718Xm7HY", + "MBUrNsW3", + "GvVTzPST", + "IdgSiGKG", + "oYKYf7Li", + "q3y63ODv", + "xpBVikme", + "ktjQhRRs", + "CpxCvHQQ", + "Fz8GPBkz", + "WueotSsr", + "4Pt9QBjR", + "lxdpSS8U", + "ygonoMoO", + "Jhp2RhYa", + "XIjQN1TW", + "yws3wl5I", + "CYSwiZAZ", + "DetHDInh", + "HQ7hGmDf", + "Z3kxk991", + "CmhHWtrD", + "3wKTLsKo", + "MFoYajet", + "wyevTvG7", + "mv7iI0lQ", + "C15fxzdr", + "Tt6zHnOo", + "jT8uIxfY", + "A09wwLB3", + "oo8Xty7y", + "ePxpoCDx", + "NORRoPn2", + "cZfOG11U", + "YdH6qt2h", + "yoKfdtL7", + "QWJEaKvC", + "9IuwELqZ", + "yIBD5S8t", + "9lnNzlnu", + "qAmMUZNj", + "oMbxe1OR", + "ODcAyNYI", + "9TuxoJbx", + "DGEw7QjV", + "eg8VQyVM", + "VQnCVvhG", + "eWJTX02v", + "eXwCSFV3", + "cNhUOA7O", + "rTeclYZd", + "nYVjiWgC", + "UIhcuDSq", + "ChqROpGv", + "INIvPmyu", + "YymrjZV9", + "PVRuFGjZ", + "W0wwB0Hv", + "NswkSiaQ", + "gxI8cpV3", + "nqtHPfvh", + "l608XFPw", + "pm7Sf1Jg", + "n5YYwrZi", + "Ni9A46bx", + "gEZVlx2m", + "EqxotszJ", + "35P9kNA9", + "Bs4rpkRG", + "hwBL9DR7", + "Yn9EKaTR", + "miI48LfV", + "NfA0siBg", + "NdPWTNH5", + "tws7SaxY", + "LFCq6wqj", + "SobCTvyT", + "60aemqHI", + "Iok4Y1tu", + "aNIG2pmx", + "sMNK4b5v", + "Vekm0Mhk", + "iZj7n8Uf", + "pow1BhHD", + "5BHwKd3I", + "Z0fa15Fx", + "HMnEDBB0", + "k72yP2A2", + "UImTvCvP", + "sIVfxVOd", + "4hNAvKAI", + "ZVd7vTXg", + "T5xicRIi", + "FDorWsCK", + "2JZKr1Bw", + "KIYYziAC", + "DjnFG5FW", + "ur5n5JIj", + "TSFHOoQM", + "FdFCkMSS", + "u5XFMprs", + "CuDUXs8U", + "6nhmlVRY", + "V5JC18gH", + "3VOFyxvC", + "bOqHcwhQ", + "3vtkcmXh", + "1IqiBCpf", + "b9jdtrbD", + "6LbNgd8q", + "3YVOOyCA", + "lsGwFCd2", + "dGtqSs9e", + "g2F0h4Tf", + "TCwQtuUG", + "UHtFGMID", + "lTZzoxxg", + "bdleovUt", + "9sSwjTg0", + "FXCjIXdW", + "W66evBBN", + "o5qRrro7", + "wzmaZqt7", + "JcYLQbfe", + "Ay9kanX4", + "Ip22i5b4", + "bys4Sc5B", + "NFynAQNo", + "M3p3eqLK", + "dhGwXMJu", + "ZmYIWve9", + "TSGsvYdU", + "zenq19yr", + "L1s8RSDX", + "D0bLIbTK", + "iIFBTUHS", + "cER5VNHL", + "5dv8qwoW", + "k9Fn6KP0", + "Fr6JjVvr", + "bVaPK8Sy", + "wONlizK0", + "kXYodRoA", + "3gx8onPi", + "muaMqdJl", + "1vbBfBUF", + "APALB3wK", + "oeFHniJp", + "xPqVyfJm", + "3OSNsoZ4", + "XRPphVxo", + "WlQkREEP", + "than2PF6", + "m8JZnPJ8", + "KSW3XGEj", + "3nCnwg86", + "mgmEOr5v", + "MiAvwTsp", + "xkTxgTbd", + "koJezPXx", + "fV2RTlUZ", + "DnkyjehT", + "xYfzNX4J", + "MypdtVHi", + "1ee0grls", + "1rxSvrbH", + "MGrdwXVO", + "nLKWdjwt", + "lxBYoePF", + "pnNMff6J", + "fmTwQneY", + "YQT2bEan", + "VY1OJFtA", + "K4Xvektd", + "8jJiPvb3", + "g8jhXp9m", + "SjKlCnGL", + "Fe1vh7No", + "5PDqsbek", + "vy8ELOKT", + "aw3oATeB", + "N9JTsBD8", + "ZbZRVMDk", + "nQVlebTu", + "E4KlGkuT", + "vWA1oPZA", + "9mLqz4dI", + "slF86HXv", + "uvHXq8x8", + "kOEw3YQp", + "s6A1WuaL", + "amRdq13Y", + "seiPiB6g", + "E792UfE3", + "NQBVqamH", + "3BWZplMi", + "7ArMEAFv", + "b0eDj4UK", + "OtqbFXWX", + "2SL92ryC", + "jS48rct7", + "mMYq4pIC", + "ahPnvQLM", + "LWfFXxVK", + "mkK9DK05", + "UODHILdy", + "9T2BfY4L", + "KYH0wHkW", + "b6ZbRUiv", + "AfYcnK1T", + "Wm3b8Luf", + "M7iDQQlh", + "i2q83KXF", + "yQ9C53z0", + "EljzngLy", + "nPvX1JjA", + "dFzNjQ0L", + "N62JM73M", + "TIYbF3gx", + "EPzhkFr1", + "lkzjKape", + "i1u7CRAj", + "NsySp9EC", + "hvB3N9Yi", + "P18ZECpQ", + "oLaGFvea", + "oYJxnIZP", + "SwQfADFV", + "bFZOwKoJ", + "Yj3256qK", + "MtQcBnxb", + "1UOFXP7Z", + "lWfGplRv", + "j36Nc9Ih", + "MFu2AZS3", + "zVOlAJG4", + "YmXgMa2c", + "90iavVCn", + "qzcRnqgH", + "qLMzxdfj", + "78VAR8Af", + "8U3Y5TWH", + "eOvnE5yT", + "v0ZLNrzx", + "YbvA0JCw", + "s4JrwNoK", + "VemaJSt8", + "WO94Q1Gy", + "NMGT0GXs", + "yjZGmSTT", + "ZY9K5p1O", + "KJQGDFUN", + "fyBiK5Hl", + "xfEYzLRv", + "2tHwS73E", + "ykCjVxwA", + "wGe9t51B", + "C62GB4Yz", + "d0iHa1xo", + "YgC1HBIj", + "KFgN0btI", + "mwZKQMRM", + "On1TvWx9", + "cCbnRfSG", + "mzIT2roR", + "2kN4fpl3", + "GKwcRv1q", + "PpaLjQZu", + "54F177Xt", + "Sn54uRsu", + "yRok11CS", + "Q60lHjxr", + "sApGmh1Z", + "VOGYh9nT", + "q9X55bwB", + "DzfbRcUe", + "EwuQSdhj", + "vGhaJNWP", + "lsVxxK6T", + "w96N0hPA", + "eUwn1BPS", + "YHTWld28", + "8nZNpkft", + "gYhIDhra", + "O8KVjTN5", + "oGXMQquQ", + "QSDLVKxm", + "bsnNPpOp", + "gIv24RDH", + "7I18OSAw", + "9vexPOvm", + "4F9tOuGj", + "mUK6cptR", + "lq3rkNTN", + "wiivWZbl", + "lcMiF768", + "OpOKoZAR", + "XE0J1R6T", + "zFsiShzM", + "eROWkpr4", + "YvnCE616", + "UUKMVVit", + "rox3uFiO", + "gT05c8ZO", + "UjTzIZkK", + "WGY1Yv2v", + "sfRsaRBT", + "3zLmMQZ7", + "PtzjRliU", + "4bYiLEbE", + "w9Dur2wP", + "et0BO663", + "nppDOHMO", + "J0uzPKne", + "erOZseuQ", + "HJx8TsoK", + "XVK9BMBE", + "pmHeiwu6", + "xjfrdtab", + "XlfRnHUg", + "nFfhNZVb", + "KmbdzuKz", + "v1VGH7Xg", + "hZkRWkCS", + "EyTmuSYv", + "Nek6fYfn", + "1b3KoLor", + "7K57xeOz", + "O3IsdQ42", + "fzHIjuby", + "Gh35yEvn", + "g3UiE4Ik", + "RtdyI6Ma", + "LvMWvvmu", + "RMh7aUQU", + "mwMlWVRg", + "jINMh4YO", + "4MmHli3Q", + "abMjWeUy", + "quUDsRjo", + "oUf8Tuep", + "SzBtQrWj", + "LoLYMwnx", + "cHitBxmD", + "3fXEsXvX", + "SJJPodOx", + "cxi9qNBI", + "UGmRMQUH", + "nin8FqfG", + "upSE2bBw", + "JpBsZqPz", + "DWAaxxkg", + "QVn21X4L", + "gFHEoIIv", + "eF9jnYYj", + "W1QPcckB", + "RR16eUUF", + "74cERDb0", + "awZyjgTZ", + "I0C3eDFp", + "ITiLDd6G", + "S2DxD0oM", + "a7bCp7ed", + "zNGsNuxw", + "K5Xk7SIA", + "Xw75I2ks", + "qmNj5M34", + "4Cctb3SN", + "I2DobuaI", + "HZSW8gn9", + "XK5iR8Ci", + "NnO7QQfY", + "SaLmGOo7", + "7n334ZeS", + "J92g3VL9", + "l48yl2d0", + "OJsHSlkn", + "3spuqjs3", + "NqwmlQXg", + "fofElKdN", + "cpUj6Tek", + "4kI4orrK", + "eXRmZkOQ", + "tEXOlp9x", + "XdhJ0NZE", + "kKo3IoPv", + "WIafMe6f", + "DwoUgN7a", + "mWoGfCHg", + "LKJtRHiF", + "pQKD9idR", + "zjyrEh7w", + "CTd6DuVh", + "s4isolVi", + "VRYJu70Y", + "8Vn0DGjG", + "9jOJreJb", + "pwcotaCL", + "z3eG6aJy", + "MVeEOXy7", + "9j89Llxl", + "9e6pFQts", + "rbwchgDW", + "ArWQhIN8", + "pNTzElux", + "GqrCTeqy", + "mbOe87wy", + "N04vaKQg", + "hVdfmcXN", + "Pix478W3", + "vS1NFZcL", + "KyLP8se2", + "ObfJleQ4", + "5iXUQnyB", + "pXVvefZa", + "hDCRekpP", + "9i4hgQOw", + "gmb04qx1", + "PuwPwoeM", + "UGP3xOLe", + "f1iaiKJq", + "Djd3N5Mq", + "VBriyO3I", + "MNOKWv6I", + "ZDJEWE0f", + "4EoMA0Wv", + "KStxjctT", + "H92mYqWw", + "Z0Wb9Inm", + "ED3AZJ5b", + "sBsHrLg5", + "QWU9LkEB", + "RNerwc03", + "KjzpqO8B", + "fAa5W5Jw", + "xCU9rrA1", + "6trWBBPw", + "uljqA6S3", + "SLTEqAM0", + "TGO2HqPO", + "hX1q6khy", + "RSqmxtf0", + "Aq2gZ8gh", + "Gr505HwS", + "4oOVNuE7", + "2LjRzDDG", + "4mrIH3OG", + "g6PDp0BF", + "Fg18g6Ps", + "nJ3SbQP9", + "pWZLWbtH", + "ptIQtsM8", + "TQtx58TK", + "E3heWq1e", + "mQtIdqnd", + "1T7YQHD0", + "nBnwRPna", + "QKfvbfZl", + "CE9eBx2A", + "FdgzdBAi", + "vQovN3Oq", + "Z89PdtY6", + "HSw3J77V", + "Agmrp2R9", + "snPsJZta", + "eh4zfjUN", + "ELGyXqxV", + "ZrepbGhL", + "wU7iool8", + "29ttB8pY", + "5Fprg2Sl", + "6oULTjIb", + "ydKnSteM", + "OzTNOyZC", + "MhKoCew7", + "BRy9wa64", + "vEOStZm8", + "bvQiDLJN", + "VCvHvlNc", + "d9tTAfFj", + "57ZiF6qo", + "QsdEfOQ9", + "AFMo1XPB", + "poC4xT0a", + "OjW7mivT", + "orGG6NWf", + "Afcko6qi", + "RQd45Rw1", + "YHZmhguA", + "9WQq5hKi", + "jeVSz8pS", + "L7fmwYGu", + "pXQvs2Jf", + "1bp7Ns4E", + "SscUP0bR", + "XQzIig1q", + "467ICIfC", + "kXroq08d", + "339SDb7V", + "r1KS8ed2", + "UyZrhcxN", + "8ATKbGPE", + "nnLXRvYo", + "rwal6YWA", + "qMI2B2qN", + "8wWhOH4Y", + "fz4opF9N", + "XZxLNAWn", + "86Fe7DNW", + "6O0lCZfD", + "n0qP50Xx", + "Scj0IRIt", + "IgD9w5uw", + "gGvkn42D", + "41Ny2DMr", + "n6yrwMpX", + "5dJdqn0s", + "q7fs9LHV", + "g3JDqHIP", + "xfqewlZg", + "iLkJT1J8", + "sKsCEJDd", + "pwMfXk9I", + "hFhxTtto", + "6bhnuF6Q", + "TxDiT9Xn", + "FxVPY2BE", + "tKXsG8Mo", + "UdHBVElA", + "JkmDNTqC", + "J2RQ79Cd", + "YJ15KKfh", + "KwI5CaZm", + "RUAkmwpB", + "MT2gMTZQ", + "WTaLBBnU", + "nkSgcQ36", + "dMbXY1ff", + "hzU7EILJ", + "N8yrMXuA", + "dZXnidOg", + "mvAlg4SO", + "lJtbUEkI", + "SzIbTbvd", + "2p0RQIO9", + "qSTY6bQK", + "TMCWgnOc", + "ziDGU832", + "9f1Jk3RN", + "cICoXSK4", + "uu6fNS0O", + "70C31VCb", + "fzcPc6Ln", + "l8s6uUJg", + "AcBj9wj5", + "zgM6meON", + "EPs109HU", + "aVsWyU5s", + "4TVJglzF", + "krjRsERf", + "x2PC7c0m", + "tVLe7kr4", + "nxukARmM", + "Nj3DO9WH", + "hHxiLVsO", + "F2r6TWtg", + "Q5t8GsWv", + "FHEsiMmT", + "krFZeoZS", + "A7oOjXqU", + "THP0xZwm", + "hV6T0AOo", + "6JwtMToL", + "ZJVPGPQp" + ], + "icon_url": "https://cdn.modrinth.com/data/7zlUOZvb/a722b12250c1f42c63dd269f2e4aeefd7611f8fd.png", + "issues_url": "https://github.com/AzureDoom/AzureLib/issues", + "source_url": "https://github.com/AzureDoom/AzureLib", + "wiki_url": "https://wiki.azuredoom.com/", + "discord_url": "https://discord.azuredoom.com/", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/7zlUOZvb/images/648061e53f606f4c757968ae575b82cfa5d098ab.png", + "featured": true, + "title": "Header", + "description": null, + "created": "2023-06-17T13:22:35.447209Z", + "ordering": 0 + } + ], + "color": 14729787, + "thread_id": "7zlUOZvb", + "monetization_status": "monetized" + }, + "azurelibarmor-fabric-1.20.1-2.0.6": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "pduQXSbl", + "slug": "azurelib-armor", + "project_type": "mod", + "team": "Rc21TkW5", + "organization": null, + "title": "AzureLib Armor", + "description": "A striped down Azurelib just for Armor!", + "body": "
\n \"logo\"/ \n\n \"discord\"/ \n
\n\n\"logo\"/ \n\nAzureLib Armor is a stripped-down version of AzureLib that is created just to provide its GeoArmor/GeoItem functions in a standalone library. All Armor creation steps are the same as AzureLibs armor creation as outlined here\n
\n\nThis library is compatible with the following Minecraft versions:
\nForge: 1.20.1
\nNeoForge: 1.20.1
\nFabric: 1.20.1, 1.20.2
\n\n
\nAre you a developer and want to use this library in your mod? Add the following to your build.gradle\n
\n
\n\n\n```\nrepositories {\n // The Maven with the mods source\n maven {url 'https://libs.azuredoom.com:4443/mods'}\n}\n\ndependencies {\n //Fabric or Quilt\n modImplementation \"mod.azure.azurelibarmor:azurelibarmor-fabric-MCVERSION:MODVERSION\"\n\t\t\n //NeoForge or Forge\n implementation fg.deobf(\"mod.azure.azurelibarmor:azurelibarmor-neo-MCVERSION:MODVERSION\")\n}\n```\n\n
\n
\n
\n\nNeed a server to play with friends? Don't know how to setup one? Just rent an already configured server from BisectHosting!\n \"logo\"/ \n\nClick on the picture above, select plan(at least 4GB), and use my code azuredoom to get 25% off your first month and enjoy playing with your friends!\n
\n
", + "body_url": null, + "published": "2023-09-13T11:50:24.229672Z", + "updated": "2024-08-08T19:44:22.401924Z", + "approved": "2023-09-17T23:03:11.957417Z", + "queued": "2023-09-14T20:21:47.219137Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 518301, + "followers": 79, + "categories": [ + "library", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "9bbXvGnM", + "HiaoHdpC", + "vGacZ7et", + "uS0DDcjU", + "JPr2oW5Y", + "CGsRGWoI", + "5QlOHrBl", + "L3HnD5nW", + "Cq590LIy", + "yWGqJK1V", + "lrCEX2GY", + "TIDKgPr0", + "YmGR9S95", + "KEyMkSHA", + "ai5WfbRk", + "DK4g6fMa", + "9n2jrnx3", + "QwIxxg78", + "YZiEy3n5", + "ua30NKvN", + "jDEK1u1B", + "GdXzOALG", + "cDTHl4AS", + "HtefwXnd", + "ka12t3Fh", + "u6L3DWbb", + "g9u9tbzR", + "w2NQRLDh", + "Yf39Af73", + "2nafSYxu", + "9xE8BJot", + "c8mVTtu8", + "fmpJ4FtO", + "ciHK5bjb", + "AMTbxp6F", + "CESijSYJ", + "YlYOr5gh", + "u5LveC5R", + "iWvLHBhO", + "YcMYlkHk", + "a78spxh3", + "jAXFnoa9", + "UmVN90iM", + "KgKtPqwp", + "UvMywSGU", + "raRVSHIf", + "GOSrUJFK", + "DU8gxLKd", + "bFJq08U0", + "pj8riCZf", + "DLqxipmE", + "Qm3kUy7D", + "vxo6gO2M", + "gvfnqPDh", + "vpBNaWPb", + "fcYA5aZr", + "aSrUCIgH", + "XmgbRdup", + "oaCHbdfR", + "DKiIckcm" + ], + "icon_url": "https://cdn.modrinth.com/data/pduQXSbl/e1ab3fc63a52df5d6f9b31e0d14eb045d4ae0674.png", + "issues_url": "https://github.com/AzureDoom/AzureLib-Armor/issues", + "source_url": "https://github.com/AzureDoom/AzureLib-Armor", + "wiki_url": "https://wiki.azuredoom.com/how-to-create-animated-armor", + "discord_url": "https://discord.azuredoom.com", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/pduQXSbl/images/648061e53f606f4c757968ae575b82cfa5d098ab.png", + "featured": true, + "title": null, + "description": null, + "created": "2023-09-13T11:51:49.880493Z", + "ordering": 0 + } + ], + "color": 14729787, + "thread_id": "Umuj8MuW", + "monetization_status": "monetized" + }, + "BadOptimizations-2.1.4-1.20.1": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "g96Z4WVZ", + "slug": "badoptimizations", + "project_type": "mod", + "team": "8syA22fZ", + "organization": null, + "title": "BadOptimizations", + "description": "Optimization mod that focuses on things other than rendering", + "body": "## BadOptimizations\nA collection of mostly micro optimizations that add up to something bigger!\n\n## Wait, what does this even do?\nIt does multiple things:

\n\n- **Avoid updating lightmap**

\n Updating lightmap textures are probably the most expensive part of the client tick. During each tick, the client will do some vector math to calculate lightmaps for blocks and the sky, then upload that new texture to the GPU. However, this can be completely avoided and cached if nothing affecting brightness is changed. This mod will cancel lightmap updates if nothing that changes brightness (e.g. gamma slider, potion effects) has changed. \n- **Sky color calculation optimizations**

\n Minecraft uses `CubicScampler.sampleColor` every frame to calculate the current sky color. This function loops 216 times to factor in surrounding biomes-even if all surrounding biomes are identical or have identical sky colors. This mod makes this function only get called if you are between biomes with different sky colors and only makes it get called every tick. Otherwise, a shorter, simpler and faster sky color calculation is used.\n- **Don't do debug logic if we don't need to**

\n Minecraft has four debug renderers that can be activated with a debug server: bees, game events, game test and villager AI. Even if there's nothing to process, the logic for these debug renderers are still executed. This mod will only execute them if debug is enabled and there is data to process.\n\n

\nThat's all the major ones, at least.\nYou can disable any optimization in the config file if you need to.\n

\n\n## But how much does it help?\n*(tested on my own PC with an RTX 3060, intel i7 12700 and 4GB of allocated ram on Fabulously Optimized)*

\nWithout toasts, it goes from 1926-1955 FPS:

\n

\nTo 2008-2023 FPS:

\n

\nAnd with toasts, it goes from 1351-1384 FPS:

\n

\nTo 1414-1458 FPS:

\n

\n\n## Dependencies?\nNone.\n\n*(Also available on [CurseForge](https://www.curseforge.com/minecraft/mc-mods/badoptimizations)!)*", + "body_url": null, + "published": "2023-12-03T23:38:30.615171Z", + "updated": "2024-06-15T06:13:29.544303Z", + "approved": "2023-12-04T21:20:58.458128Z", + "queued": "2023-12-04T00:26:01.608056Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 1605139, + "followers": 613, + "categories": [ + "optimization" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "4iRxgKYG", + "7EtZn21b", + "LvWnmLrW", + "CMQm449N", + "QPNT0tat", + "ww747oVi", + "R5epQB48", + "7mkIryQX", + "N83O7mRY", + "tPcndzIs", + "Rya4Prxg", + "P1VV7yAB", + "osrW6S8S", + "5iiizW8v", + "NPtJUzCQ", + "xrCxVWjv", + "csMggyw8", + "pYctvKKH", + "ByJJBuGh", + "frxUrBuZ", + "f80P5Er3", + "ajq5p3Cr", + "lVUqygYP", + "6qzarF6r", + "py5wZc1k", + "9vTW5SzW", + "ouYuE0eo", + "RppoOA91", + "o0gYJCDi", + "x9zMt7t7", + "Tyi2q14M", + "QFKaP0NG", + "PY8WFC19", + "YPx40hkR", + "WZB4pQ3u", + "l5RWBdez", + "yK1K2DcH", + "pNkHByNm", + "tfPcVhXP", + "NepFM2XR", + "74fRkfKB", + "PXrqBQZG", + "O6GYJnvX", + "vJEBno3y", + "84AEMPgv", + "DkQi3drk", + "KWwNfrjN", + "wlqlZ5hE", + "37M8Rd4S", + "KeVurIPw", + "8JJc3kIM", + "r88RTaW8", + "Go4FoZir", + "dAVlOLS6", + "cpFHy43X", + "bOuSwVyc", + "aKkny43Y", + "918aozAU", + "zLWPzGCh", + "Gsub2Uuo", + "ydYsXrGL", + "eT6Jsaq5", + "zZYSuJ5b", + "bpmrr094", + "lqrDW4fz", + "V222vBVT", + "HPufvV6Z", + "2Aygc6Sx", + "faqoQF36", + "QitPsCFU", + "fPU2qEYo", + "Yvu9MYgX", + "YIdCgnz1", + "LJwG3VNe", + "eCxTPnVB", + "iULB5JCQ", + "FPQdPmAW", + "xhGlhCut", + "GydKiUd0", + "iXgx6zFq", + "j3hOwXG0", + "XYBqWKD2" + ], + "icon_url": null, + "issues_url": "https://github.com/ItsThosea/BadOpitmizations/issues", + "source_url": "https://github.com/ItsThosea/BadOpitmizations", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": null, + "thread_id": "Pu25MPpk", + "monetization_status": "monetized" + }, + "Balm": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "MBAkmtvl", + "slug": "balm", + "project_type": "mod", + "team": "c1tw4qzj", + "organization": null, + "title": "Balm", + "description": "Abstraction Layer (but not really)\u2122 for Blay's multiplatform mods", + "body": "

\n \n \"Requires \n \n \"\" \n \n \"Join\n \n

\n\n[![](https://mods.twelveiterations.com/img/sponsor.png)](https://mods.twelveiterations.com/sponsor)\n\n## What is this?\n\nAbstraction Layer (but not really)\u2122 for Blay's multiplatform mods. This is a library mod, it does not add anything on its own.\n\nI do not recommend other modders to build on this as I will ruthlessly break backwards-compatibility as needed for my mods.\n\nNote that this is not a magic solution for running Forge and Fabric mods together, it's only a library my mods will depend on to make publishing for both versions easier.\n\n## Why is this?\n\nI can't just switch to Fabric and abandon all existing Forge users, but I also don't want to miss a Fabric train if there is one.\n\nTrying a port for fun showed that most of the platform-specific things can easily be hidden away from the actual mod code which doesn't have to care about modloader backends, which should hopefully make it much easier to support both mods at the same time.\n\nThere's other libraries that do the same thing, but given the amount of mods I maintain I don't want to put all my money on one boat only to deal with headaches once those other mods stop being supported.\n\n## How does this?\n\nIt just wraps all platform-specific code behind a unified API (in the simplest way possible, there is no magic involved) and provides superclasses to use in cases where platform-specific methods are added to Vanilla classes.\n\nIt also adds a simple network system (similar to Forge's) and a config layer with sync support.\n\n## Who is this?\n\nHi, I'm Blay and my Twitter is at [@BlayTheNinth](https://twitter.com/BlayTheNinth).", + "body_url": null, + "published": "2022-06-14T18:11:16.556742Z", + "updated": "2024-08-13T05:12:48.926403Z", + "approved": "2022-06-14T18:11:16.556742Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": "https://mods.twelveiterations.com/permissions" + }, + "downloads": 4253230, + "followers": 915, + "categories": [ + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "yIf5KdB1", + "C0Q1coDV", + "OxgGZ2zM", + "DIjNWWDQ", + "3FaeA4B3", + "pLCLIILr", + "KHoU8dQ1", + "U6WiexwY", + "KGco8pn9", + "3gG05xht", + "yCm0MvD8", + "bv4c7vz6", + "HaskpkVN", + "rLFLPShY", + "vtPaYjej", + "jLBnf4l1", + "i5Q1d7Pr", + "TQMftlzA", + "ZI4feWbU", + "SLR7Xv0p", + "AhzvhBQj", + "oqGuqpwK", + "DENsCzBf", + "nErKcTp9", + "xAQtenTo", + "1pxcbuZv", + "840UhUoL", + "9XoBRgjV", + "6X6csbpx", + "nFs2ZvOR", + "NhlpDRNn", + "zq3nXKQW", + "TbFmWuAA", + "O2nbMbp5", + "C60k8eYK", + "XYqAzGqP", + "XNus763a", + "qUWyGBdD", + "RAATKbAN", + "uATqqu4e", + "lRKNKP0w", + "ONL5pq9r", + "FDkt1ohj", + "o7IqP6Td", + "DAOUt1Jg", + "VYTPVkW0", + "RXK9iX99", + "wiayzjLV", + "rbUpGzGA", + "i8CwYuCi", + "I5betUED", + "NRF4uKO7", + "c1GjX2k1", + "Zq0Ko2UQ", + "d7a0S3hj", + "l551HLmO", + "BLkvfQ2x", + "CO57SmJl", + "ffUlrjOr", + "jdk8u9nq", + "x70MCuv3", + "sBs7NeXN", + "BJ0Uk3Di", + "fFosgnEu", + "qHXzOzUv", + "YL5MVHnr", + "N4NxIVYC", + "jPAtAJcJ", + "RYxPLFUw", + "NMOJStju", + "qIAY6mKt", + "JUrMdJP1", + "VIE9sG8O", + "f6LbzxNL", + "TGc6wvHK", + "lt2lEcIY", + "1hau5QwF", + "VH4LTqFp", + "H0a9rBTV", + "6ryA9MPE", + "Q0xpW61Y", + "hDWb6gW2", + "7rTXTEe7", + "uZyJkfxk", + "SLbLamWu", + "ZuihLitZ", + "C95JH5YK", + "zXq0pj5R", + "VhfHxcat", + "2OHf9GyZ", + "QiuQRA7s", + "kjIgNYGA", + "tC2vMFuQ", + "AUJXa9xo", + "v1tAteat", + "fzqus8s0", + "U79V1VMr", + "OjHYTM4n", + "z5z8sM4m", + "ctu48FWB", + "StgsQbVh", + "vFLrqKU8", + "2e2nF2M9", + "WYvcCUer", + "Rr2heMKC", + "GAFne6x4", + "huCbvMtN", + "vDreKB60", + "nw61Pdsu", + "OYyizALG", + "8wgOo6Ga", + "Bb8wmAjY", + "JWCXyAFI", + "ui9UH4JU", + "mFgQD0wf", + "oNCXVrO2", + "NcO6IJys", + "hmjqCs6P", + "Kqi0IFWL", + "uWfkL77n", + "8W86abn7", + "PlicZHtx", + "de1sItvo", + "sMLLTEoG", + "HbJsYDug", + "gkaYm86D", + "3gqKHTeW", + "vCTOJkNm", + "hAD7vTyA", + "7caOiXka", + "RV5SSz4D", + "nEvbheGT", + "pOkJbXvW", + "CefwKYLr", + "zWTNqB6D", + "k2kcNYeQ", + "DJFGAs9Y", + "RJLjsEUW", + "wxmX5QHo", + "KGIMKUgn", + "wuxxrMPw", + "Td8Oo2Gu", + "e2H9OL5X", + "s29lt6Zh", + "oQBUrm9F", + "b7Q7HRZD", + "YGxMJ2Hv", + "tM8zF89C", + "WyhvCQj3", + "8RGUWLPR", + "XglmmWsG", + "jLxcayMK", + "te3dfDiN", + "1PZPYo6D", + "w3go4VXD", + "rGJbXEKn", + "yWclRdjf", + "mzFmDC1Y", + "JyUWCsbN", + "A65ALFtK", + "2LJ9NkXc", + "ryOwjzmq", + "22lhs0MW", + "InVQrh0j", + "lRDrMehk", + "m9c4BAuv", + "s798wETE", + "G14DerBs", + "NelcQPdv", + "QEbBVP8S", + "VCJs63iY", + "6wqJaTSm", + "d0QFp1oD", + "l0EC6aJQ", + "mQSYta9T", + "Lj3KLOAy", + "wy39J2LP", + "Pz0YXByM", + "a1y9YTA2" + ], + "icon_url": "https://cdn.modrinth.com/data/MBAkmtvl/icon.png", + "issues_url": "https://github.com/TwelveIterationMods/Balm/issues", + "source_url": "https://github.com/TwelveIterationMods/Balm", + "wiki_url": "https://mods.twelveiterations.com/", + "discord_url": "https://discord.gg/VAfZ2Nau6j", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/BlayTheNinth" + }, + { + "id": "github", + "platform": "Github", + "url": "https://github.com/BlayTheNinth" + } + ], + "gallery": [], + "color": 9652237, + "thread_id": "MBAkmtvl", + "monetization_status": "monetized" + }, + "basicweapons-1.2.3+1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.20.1", + "1.20.2", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21-pre2", + "1.21", + "1.21.1" + ], + "id": "sc2Pektv", + "slug": "basic-weapons", + "project_type": "mod", + "team": "FoyK3Zr4", + "organization": null, + "title": "Basic Weapons", + "description": "Adds vanilla+ weaponry - no extra fluff or sparkles", + "body": "\n\n[Help translate this mod into *your* language](https://poeditor.com/join/project/vW0G3i42PX) | [\ud83c\udf0fVisit my website](https://khazoda.com) \n![US Flag](data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAAAXNSR0IArs4c6QAAAh1JREFUWEdjZBhgwDjA9jOMOmBwhYBo2lQbpn+MJv8ZGPnxpY3rO3rJSjr/GRleMzIyHBB+dOcazABwCIilTrVi/M84gYGBwZQYk6/u6CNGGT41G///+1su+uz+TUbxlNmKDAy/zzEwMAgQa+qFGB2E0p+/bxCrD6yOnVUDRP3/++8Dg6aaKqNYyrQp1upS2Y/ffGaQFeFlOHbzGYOVuhSYlhXmZXj89jOYjyx/vjkI1c4/f54S5QgWFmlkdczv3k1nFE+ZdsdKXUoZZAEIgBwBswwmhqwJ5CAqRAHYyP8MDHdBDvgPthjqW2Rfw0IB5gCQ5SBwmeU6A4Os9G6ifI1P0ZNnTmAHwIKcWBojCihwCUYIEHIEyK4rJ+eBEi1VANgBsGAPt9JgWHnsBgM6DXMUTPzqkRlfqGI7AwMDPATQUz62tABLA1SPAvRgR7ccXf6S6vejVA8BUgykVjYE2ck4YcPR46RYDlIbLsVBqhac6hmfPX8BLgcGCjC+kVH5NVCWg6PgdWzSiQF1wIBHwVtZtd////9jYdDUOEDXkLh+w+E/A8M/UBq4wsDAoE1XyxGW3WF8uXZD4F9VlYkD4YD/nz6tZHz+/LnC/89f1g6EA6TUVI3BbcLXUorqDIzMXYyMDH50cch/hk3///8tA7cJkS18IaOky8LAaM/IwChMC4f8Z/j/9g/D/4MST+5dhpk/uPoFtPA1ITNHQwAAWLMQ9nMJOhoAAAAASUVORK5CYII=)\n![Chinese Flag](data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAAAXNSR0IArs4c6QAAAZxJREFUWEftV7FOwlAUPbdQQSKaaNBFJmWSL3CTn1AHE51w0S/Qn3CSycHB+BHi5hewGSc2isaiEhToM/eRNi005LV5DQx0adN33znnnnvTd0uY8UUz5sdCwPw4YBVLx4YQJwLYB7CWUG/YBLw4RPeF5usDc0gH3os7t0JQdRopFQwIy9Gmi0jUNppv59Qulk4hxN005FTZxPJFHt/VD20CJBDRGbW3d58AVMaRmXTY6I/ifNlrdqLOAmwAq+MCVmrr+Ln6DNjOopYOc+jdfOkqR4cFCJecs0uXTaQrWXkfNPoY1HtwLEe6wevGVspzRkc9AgLMgwyyl/kJ3O61rZXUTxAQwAtsceYo58Ww3f3nX68XzEoWf49dHcmPMP0l4BeuC6LlgDYNWW9XAPdAas9MVgA7IFpDScpi+OJnzd3vOTjhQJi3iX0HwkoQJiCp7EN7QFt3KQIplUARK1bYQsBcOBB6GMUqaPRN8jAKPY6jY8XaUVcaSGJBq2zigYTjVEYyFbwoMd5I5m6a6VAaRbnu2Pn5L9CdmSrewoF/wfKsTZBdqQgAAAAASUVORK5CYII=)\n![Russian Flag](data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAAAXNSR0IArs4c6QAAAQpJREFUWEftlzFOAkEYhd/bA2hhjMRlK+EQUnoJQ0EClVzAu0BlsQWHMCAVh9BYEZg1rsVygH0GolhZLm+LnQPM9+XNTP43hHnRzEcjUJ8ENpusH0UcCOoBOK/ibhAoAK7KUmkct2Z7xiGBbfYxgfRQBfTfPcnpdetqzBDCUODTSeE/MEIjhpDNBdx5BLDYCxQCzkwCO25DJgf8l+kXSJevL9YE4sdn7xE0Ak0C9gRmt/feZ5i3O95nWAeBAqZhBGDHvN2ZwzSOASyYJ90hJEshATk6VLKv5GYi8aSVjNT0Yv0+Prbiz6Tbj6SBgMpKKYCCwKok08v1218ptY5jJ/xYy50S9fkZuVL4BkC/YFDaIqbbAAAAAElFTkSuQmCC)\n![Turkish Flag](data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAAAXNSR0IArs4c6QAAAZlJREFUWEftl7FKA0EQhv+JiCgSkWDlXaV5BtHSRxAUBAWttFEwjc9gE0EbrSwUBAXfQLEy+AzB6mJlLBJEETEr/8LGFDG3e1zcKzJVCLP7f/PP3N6ewHOIZ30MALLjwEtYXM0pta6ABQATfZqNhgAPLZHzqah6SQ3twGs4c6KUbPVJtOu2Iuq0ED1tSz0sbkCps/8Ub2uJbEo9mL0FsOgFALgjQANA3hNAkwAqiXgumNbLWrXnJMt/u+AKMDw/h/HyAToBvqMa3kr7iWCcHBhZXtLijPfyET6vb7QoYYbCQP//VXl0csQagJXnry705qyW4mmENQArpwOssLmyFqvNXBtIa4DJyr22mpvSgV7BPOYzCNurLdYAhaja7v3H4XFPgNG9HYyVdvV8EDYVAPafc2DbAraMgxr3qFo7YJ4Am6piB6QjwRqAfWVVdOEvCOa4HkzWAISmAJ0w/eUBZAT5O242ujnjBGA2IAidMKehOZBcrDe5mXgZeX4d+76QsBder2RmGLxeSpNMb1prsvNdkFZFrvsMHPgBtjvQTetR5nwAAAAASUVORK5CYII=)\n![Chilean Flag](data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAAAXNSR0IArs4c6QAAAbxJREFUWEdjZBhgwDjA9jOMOoCkEDA2buA6e7bhGzWjDe4Abcv+SAYGxtj/DAxWjAwM/NgssbOSO1BbYuVArgMYGRg+MjAwHvv37/9iaWmJ5SBzwA7QsZww4z8DQzohgyl1AIr5jIwzpSTEMxi1LPoTGBkZ5yNLujspMuzcdx/DPVR1ANj3/xMZtS0n7GVgYHBCtm33ugiwA3qmnERxBPUdwLAP5ICPDAwMfCBfi4lyMbg5KjFIiHEzvHj1leHilVcML19/Ydi9/wGYTwMHfAI54D/ImyBLu5ucwDQyQA4JajsAnAhhDoA5YvEMX7j9oBAoqdsH59PcAaBoKMkxBwc3KCTo7gB9HTEGPW1RhsUrr4IdAOIj5waahwBdywGoZShpYEAc8EZGBZwLiAE/GVkY2P//IUYp0WoYSXEA0aaSoHDUAaMhAAoBcGVEQrqhptJPIAdgVMfUtIGAWfsY38iqJjD8/4/SIKGbAxgZE8FNsreyyjP+/2ck2CSjpsMYGf/PFH58NwPeKH0tqxrJ9P8/uFHKgKNRSgUHfGRkYDj2j5Fxsejj24hGKRUMJtsIkvoFZNuCR+OoAwY8BABa5qUeipnrVQAAAABJRU5ErkJggg==)\n![Brazilian Flag](data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAAAXNSR0IArs4c6QAAA1dJREFUWEftV11Ik2EUfj7nflScuqnTbbkMf/IiwRuhoPUDKnRXFmSlFBVWIEQXUbqkdHNeRkElBkFBBYFdeBFYGXWRYBdFIbaZtbm/5ubPJjp/cl+839j0c9/mJopeeO72vuc85/nOe87zvqOwyUZtcn5sE9g6FcjQC2ooiqoFsA9A2gb1hgfAZ5qmn03cnH9BcjAVkLQLHwGo36CkkWA7xm/MXaKketFZmqKfrCW5hM+DVMDH0PTsWsJB0dQ5StIufA/gcLwIR7LSoStWQipIhMZgxVObO14I4t9LCJBzEccT3VKoxMW8LFbIa+c4mgxWTCwsxgPlJQToWCPK01OgLVJiT2oyZ4hjboEh8cY1GSskYibQoMpBY0FuCFjbpYLZJYLJLcSBEg9q1U6oMgO90GkZRbPRFhOJVQnkJwmZsz4kDZzSp8F0VOhKw8BJ8jq1E5pjZmbvx9QMU40vnumoRKISqMmVMsmTeAkMiNktQtHV8oiAhISm2oy6/c6QT9uwHfdNS79XBnMSSE3kQVekxIlcCcvflX4HPxcppPEEoGkKPK8fXQMG6Np+h/zUJZN42/SdFdc75mWqYfLNhZEPI1CRmcY0Wl6SIMz5oL4KfQM+7FRkMHvZCi/OH90NXh4Fn3MSDdeszDohQIgsN5/fj0aDBS/t46x1FoGTcgnIiJEKcJnwjJpznRCqqpTg9um96O7rQf7suzACwcCWIRsejoyGcMIqsEMkgLZYicrM8OsgEoEgGiGivy5Dtbwb9JyDRfarZwaNRiu+edlNGbEJr6hkuFUgZ4GQ0WvtUkGRLYZt1MtZDdKAnfUG1t4DsxOtv+yc/lGnoEyczExBmTglNAUV2lL4+TJYHERAA6aQieH30xDQLhjv9ofWLb55aIxW9LiXfGOagpVOzYUKXM7LDpG40FHE6MFyIyP4uN4YOvtXjnE0Ga2Y+hddmlcVomAS0hOkN0iPECOa8HEwDSMuEUsFZxf9TOLn9jHOknNVIObLSEz0oViJ4zlsfQiCfiDzbrTiz0z4vEdgw1xGcV/Hp+QBhRQlBBSSmH7YgXumvzF99TKn3jU/SHYlB+4IKT/wHuhfRfO5mDEPErKxqU+yILNNfZTGe3Dr6b91/hes51fFg7Vdgf+HBTaUIvl+0AAAAABJRU5ErkJggg==)\n![Spanish Flag](data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAAAXNSR0IArs4c6QAAAf9JREFUWEftls9KG1EUxr/LDIaihigmiokxNhFF0Kob8Q8lqSIodNVCwY15gu7adX0BX0F9A1ctFEqkBpGIGjWVUEVH1FFpdDTxT2LneppJcRcRYcbrwgN3e77f/c7l3I9BcDHB+ngGeDoO/PEEgoxoFEAQjPkseRtEChgzzlTV7sakoVFwIFXXGAbRhCWidzQl4Itzb3OMaTU+H5fl7ccUv9WSdL2Bpdz+ibwtYREA+XHPGADbls38/lvNsJQnkB+HuGKnH7oi4uQBxmMjRR3IXOrIXV3h5+IcettcUC+q0eGvNZ31ToCsfoGlqBM88R2/NQ5XbQkGw22wSaWmQhQFmF/+hYPNHPzXTqjqAez9b1ERsEPXokirx+jtbjENoijAykkzsvEoZpM7yBwR+gY+wVsfgHY6jhtHN3q8CWsB1herkYjHcF22ijmlCV5/P4bfBKFNf0Zl+xBaO/esBYj/IGQaHODRr1hISyiX/6K1/gRN7tdYO3YjFLq0FiCyxeG0ZaF+i0N9kUZz1gFdPoc08A6Zsy0MtlRZCzC1VIP3r86R3FjHy8Z2nKl2uGxJrOY8iCX28XHIZh6A8EUkfBWLBxD5GxIpYvMA0eT/RCRJkUfPBESKxHmokAkNCF2WR5kRSIl8lsIQFcKoxPlYxaGiPJ1YbtpmeWCjZweEO/APkC7PUs5ICzIAAAAASUVORK5CYII=)\n![Ukrainian Flag](data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAAAXNSR0IArs4c6QAAAPFJREFUWEftly0OwkAQhd9DgAPPco1CQRLCHSqagIIL7Cl6gVYhENyh/EgSKNcAD64VDIEEUMh2ELsH2O/lZTfzDaF8qMyHC/A/DbRtGpC1ECIDAK2S3sYV5F7kvrxE49WT8WrA2E0MyKwk6I9rmZyj0ZzGphOAi2rhb5pMaexmC8hQJwB37Nj1VYCmRgACNxq7Fg34m+kCuAb0G8gzX/cXuACuAfUGiszXHUbFqb8V0RnHJHcsjv5ECBUhoWD6UrIi68UCVqpkhCR17zD/WHGedQOgFgIoV0qBPXBfNrzjV0pVhUQT/tFyzRD/sxlptfAAnjpdtdS6E5YAAAAASUVORK5CYII=)\n![German Flag](data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAAAXNSR0IArs4c6QAAAQZJREFUWEftlzGywVAYhc9R0L23AaVUKvIQ0dmFwgwVy1FSvULxVoEKQ4wN2IImRiOF/801g0YbR5EsIN83J7lzziXED8V8ZAKfk4D30+zYFV2SIYDvlP6N2MxWzGF62K3/HOOWgFdtjUEbpAR9/Vrj5LBfDulVwx6I37fC7zBDnyU/nBFoKwQMmNPzwxjAl0IAwMkJmAh+w+oFBmV/IU3gWCxpP0EmkCUgT+A8qmiP4SUKtMdQLpBEQWyiMqIro2TXnJmZpI5Jzplsg56JBgndIHFFlESNsYFvnWSETfK1zfCxii9RvQPkugBSHaUAVsB1Wqhtn6NUWsdK+GOWKyU+52akSuEfvnJV++7ai6UAAAAASUVORK5CYII=)\n![Argentinian Flag](data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAAAXNSR0IArs4c6QAAAdNJREFUWEftV00vA1EUPS8t9dHS0FIVMY2NWJH4WIik/AGLxrbtf1CJhUQldvwCFlhrg02XNSxsLKyoRZPnI1GtlmrSVkT7dCbFhsR7OsbCJLN7955zz73z7hkCnR+iMz7+CfwdBQLb1M0IfADcBJC0mA0GXBDlJdha8bg2FQxVgbkw9TOGDS1Av8xJEFz1uJbI/A6VXkqgvwpeBTMa4CKzIbpRkcWvB4FKu2WFANWq598oSiaBEGXfOKjZEf0JrMtX+6LlPacvG6x1SVOhdfRRNAe5SdxytyB3lwDLHsHpLCB+VoRN6kfqzoLugSFuHkIEYgcR3JzsYWTcjEazEalUE0ydE7D1T/0OgcTxGvLJU3R0FNFmzSFf6oO1dxjxC4lbBSEF0udRWFgUzYY47rMtyGTqUTb2wD7oRYu9i0sFIQLKDMR2F1SgdocZxad6FIomjHmXucDVXSAyhIZSEg/3ZZwfRtBtvwZs07DYHdzVqwR+8hlyl/tJgP4Xkc67ALouI9WgBEJUuYrdteinQA6ZKFYMBML7QAD0I4RhUrVkgTBdBEPwR8l4g98s2Vtc1Rf6GCBpaVAq+TcJw9bqjEt+N6W85Gt5/u/8F9SyKp5c/wq8ArxDpsQcKiGYAAAAAElFTkSuQmCC)\n![Vietnamese Flag](data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAAAXNSR0IArs4c6QAAAbhJREFUWEftl71OAkEUhc/siiBIIEQkMUajmNhYEW2Mjb6EvIGFifEFqPQBjD+Fb6CVb6CNsdFYQScWFiaoIRAMf8vsmrtmCQSV2dnAUDjt7J3z3TP3zswyKB5MsT7+AUbLgeLc4obFtVUwRAZSGxbKTDcfYi/Pt876tgOFmeS6ruEIYGsDEe5Z1LrnJvYTr/k7VppfXuCcP1pAdDji3yoMKOm6nmIfs0unAHaHKd6hdUYATwCSsgAsrsF6N2XD8wRgyUZT3Ph2EM3LqvQSngB8m3740yF87hTVAEwcRDC24kM1UwbPGlIQnhwIX03Zoo2LqvQ2CAFQofm2Al0ZagkdtAU0rDcTzet61zzPGUKuCAHYfRvXEDqMgk1rfa1244gwgANBTvjTwR8hyInaSUUo8/ZRLNOGgb1w235nIRKX6QZXDjhiygEmz2N2LVDWrZzRdkOmHV07QJVPDrSyBmqZsm0KnYZUF8ZNA/XjSt8i7fzANQCJmwXe0/fUJTTnQIlSuAb46/KhOftccHE5eb4NRTP95Tv7NlT7HlD+IiJrlL4JO/dG2avYYyF5Ch+tHxNPqUgGK3fgC+Kzv47DL6DXAAAAAElFTkSuQmCC)\n![South Korean Flag](data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAAAXNSR0IArs4c6QAAAyBJREFUWEftV01oU0EQnq30oCgFCeYFtQjiQUETe5HquU1aqSjoodK0FgUPNtBKatCDR0WbtkI9FaW2laoY8FBr/64Vf9FEEUFvqZAXyA856KWQlW/Lhvfytsmrbc2lAyHJy87ON9/MfLthVGFjFY5PmwAEA6lU6mBVVVULY8y50SXhnF8lolA+n590OBzfWTabPc05f7HRgVX7M8bOsHQ6/ZYxdqx4QULXxSOXpq0J26dojFyaU7kP5/wdy2QyXBU80NNLN0JB8VOdx/1PIJBEQk/SyOi42EuVjBJAoCdIPm8D6XqSorEvNDQYXjUABB8ZfUxO566C78UL7ZZ9LABu3QkLp6MeN+Hz0GAfnW31U+TJuO1yIDh8kTWY7OxoEyy+mpmjYhAmAA8fjYmMpSOCgo3ODr+yDH/eREVG1Xs0qt5r7hXsNT07LxIACLxLRowgLACafY0iY9CO2nncR0yolxZ1St0bo9zzGROdNed85OhuNwGRPYAmlIwAhOwtbGApwdTMrKD6czRmqT+CJ4J3SWZeXFAwUftswARClhRrNc1JJ31ek5uyCbFCIjauTg2OEl6lDEy4+q+Zliwz2md/ClQB4nqOPl65TYc+vFfGR/ZLv5a1Y//rCUtPrAR6RQaKHRZicZoffkmtkxHTTz+afXTzd414tnvrFrr+bYHqwt20rd5ja3RXBeBU71N6sCND7kRcZDvQ0kqRn1lToMCB7RRqO77+AFACAIgncyUzq9+3k6aGL9nKXjkFeIjxkbNrlM+u8DRNzH0tuXnIf4LwMhq0ZCU1VY4hnCHDMKNolGOh1llD0fHLluDQEigrRrusEholWKVcANHVP01oSqOdbzxM94NNFnakrmCsoaz4btQCixJiB6ghTjHoN2YYWl4sIEYAyLxWW54EaTiGoaSgHrKMxFTKaikBFsMkE5BNeSjZvRvIHpJniZTesoeRRI+sm7wNhWzAiN3g0sl4HEOCYcUs2poCLFptcGMZ8FnWXzE++ZJXMtkHtodasRC9AFPdqsSVrOKXUqD7n9dyxOOcJwvX8rXQux6+m3/NKs7AXzJXyKihAGT7AAAAAElFTkSuQmCC)\n![Polish Flag](data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAAAXNSR0IArs4c6QAAAPVJREFUWEftl7FtAkEQRd+/AnBgIRBwEdAEIV0QIEFkSoLIAYGrgJAmLEcI9hBHcBRwY4FsHDk85oLdAvZ9fe1q3gjnI2c+MUB9GjgcskmSaGrYCHip4m0ICtCuLG3d7bY/box7A8fstMTsrQrov3dKq067tVAIYWbo/anwH5iwuULINgZjnwBsbwEKg4ZTgKuOITMP+C8zBogN+DeQ9wa+vyAGiA3UoYECp2EEXJX3BhucxjGwVZ4OZ5i5CAnS/K5kl7S/NNNTlUyy1ev+a/Gw4nM6nCRmU4PKpBQoBLtSWjf3n39S6ioknvCHlnuGqM9m5NXCN5RwZR7cq1WxAAAAAElFTkSuQmCC)\n![Romanian Flag](data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAAAXNSR0IArs4c6QAAAM5JREFUWEdjZBhgwDjA9jOMOmDwhIC2ZX8kAwNj7H8GBitGBgZ+bGnj3KQVRCWZz4FvcKn7yMjAcOwfI+Ni0ce3l4MUgUNAx3LCjP8MDOmETKeCA+BWMDL+nyn8+G4Go5ZFfwIjI+N8QpaD5KnpALB9jIyJjNqWE/YyMDA4DYgDGBj2gRzwkYGBgW+AHPAJ5ID/xFhOkygAxcKoA0ZDYDQERkNgNAQGQwgMeGU0sNXxgDdIBrxJBmsLDGijlNgGCS3UDZ5+AS18R4yZoyEAAKq7o02nQZUYAAAAAElFTkSuQmCC)\n![Swedish Flag](data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAAAXNSR0IArs4c6QAAAPdJREFUWEdjZBhgwDjA9jOMOmDwhIBU6a5IRkamWIb//60YGBj40dPGI/9AFKH+mxEM/TfCSU1CHxkYGY/9//9v8bNut+UgzeAQkC7dM4OB4X86PtOo5AAkKxhnPu12yWCULt2VwMDAOJ+QV6jvAJCN/xMZpUv37GVg+O80MA5g3McoU7r7438GBr6BcAAjA8MnRunS3f8JWQ6Sp00UMDCMOoCxZ24KUVFQqL4CJaaOv9VhOPFGh5jYw6uG8e8RHqIcQLFNOAwYdcDAp4HRcmA0BAZBZTTA1fGAN0gGvEkGK6IHtFFKq4qGGHMHT7+AGNfSQs1oCAAAx3e4g6mqpEIAAAAASUVORK5CYII=)\n![Japanese Flag](data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAAAXNSR0IArs4c6QAAAcpJREFUWEftl00oBGEYx//P7MeB4ugrFCdfyQVtKXFWbrIRtlhJKRfKnhzcnJQWRVEcUKQclOWkfNzk6jM7K6dxNLvzaDZbaNln1Jg9eM9Pv//vfeadeZ8hOLzI4Xz8C2RPBx4fY92KQr0A+xjIt+lsaAQ6MQxeKykp3DAzkh2Ixp7CYA7aFJoeS7RQXFgwTKqq9jNo5U/D38MIPECqGjtkoM0ZAURMAY2BPIcEXiiqxvhX4YYB5fwCeHoG11SBKyt+hbEsQLoOJbwE1+r6p0CurUaixw+jvdWSiDUBXYfH3we6vf82JDEUQGIwIJawJKDMzcP9ZefpkvStdXB5mUhCLsAMb2OLCGr0+BEfGxHVigXo9Aye0XERFMVFeN3dFNWKBVx7+3BNz4igyM3B6/GBqFYsQNc38HT1iqDc3AR9blZUKxYwad5AELi8ygiOT03A6OzIWJe8jKx8iJTIMdwToR/BXFYKfTt50YmWJQGTqCwtw724nBZuhsdDk+CGelG45Q6kqHT3ANfOHpTIEaBp4Lo6JNpbxW3/aOf8ZZQF17HDA4n5PBwdyVIHIjWUMtgHm4ZSAjSkG0rF74wNhdnzX2DD5kTI/w68AYGDx+85aexcAAAAAElFTkSuQmCC)\n\n\n\n\n\n![Basic Weapons Banner](https://github.com/Khazoda/basic-weapons/blob/Web-Assets/description_common/banner.png?raw=true)\n\n\n# Important\u00a0\u2694\ufe0f\nMinecraft has a bug where held items have gaps. \nWeapons from this mod are not immune to the bug, and I therefore highly recommend using the ModelGapFix mod:\n\n[![Model Gap Fix Download](https://github.com/Khazoda/basic-weapons/blob/Web-Assets/description_common/modelgapfix.png?raw=true)](https://modrinth.com/mod/modelfix)\n\n\n# About \ud83e\udd3a\n\nBasic Weapons adds **6** new weapon types of every vanilla tool material _(Wood, Stone, Iron, Gold, Diamond, Netherite)_ to complement the existing sword and axe in Minecraft. Each weapon is balanced around damage, attack speed, crafting costs, attack reach and special effects. \n_If you have Better Combat installed, the weapons are also balanced around number of enemies hit and combos._\n\n![Divider](https://github.com/Khazoda/basic-weapons/blob/Web-Assets/description_common/showcase.png?raw=true)\nWeapons should feel _unique, powerful, easy to use_ and _fair._ I made Basic Weapons because I was looking around for weapon mods that would fit seamlessly into vanilla gameplay, and didn't quite find what I was looking for. I hope that in creating Basic Weapons, I've made that search a little easier for those of you who've had a similar experience.\n\nThis high level overview should give you an idea of what each weapon is good and bad at:\n\n| Weapon | Damage | Speed | Baseline Effect | Reach |\n| ------------- | ------ | --------- | -------------------- | --------- |\n| Vanilla Sword | Medium | Medium | Sweeping | Medium |\n| Vanilla Axe | High | Slow | Shield Break | Medium |\n| Dagger | Low | Fast | | Medium |\n| Club | High | Slow | Slow target | Medium |\n| Hammer | High | Very Slow | Knock target upwards | Medium |\n| Spear | Medium | Medium | | Very High |\n| Quarterstaff | Low | Medium | Sweeping | High |\n| Glaive | High | Very Slow | Sweeping | High |\n\n![Divider](https://github.com/Khazoda/basic-weapons/blob/Web-Assets/description_common/divider_1.png?raw=true)\n# Bronze Integration \ud83d\udd36\nMy [Bronze mod](https://modrinth.com/mod/bronze) has explicit integration with Basic Weapons. \nEach weapon type will receive a bronze version when both mods are installed together.\n\n![Divider](https://github.com/Khazoda/basic-weapons/blob/Web-Assets/description_common/bronze_showcase.png?raw=true)\n\n\n![Divider](https://github.com/Khazoda/basic-weapons/blob/Web-Assets/description_common/divider_5.png?raw=true)\n\n# Better Combat Integration\u00a0\ud83d\udd25\n\n![Better Combat + Basic Weapons](https://github.com/Khazoda/basic-weapons/blob/Web-Assets/description_common/bettercombat.png?raw=true)\nBasic Weapons works well as a drop-in mod to spice up the weapon variety in your adventures, but it plays especially well when paired with [Better Combat](https://modrinth.com/mod/better-combat).\n\nWith Better Combat installed, quarterstaves receive exciting new attack combos, daggers and clubs can be paired with other weapons for dual-wielding mayhem, and the hammer even features a fully custom attack animation.\n\nIf any of this sounds interesting to you, I recommend you try the two mods out together. [Better Combat](https://modrinth.com/mod/better-combat) can take some getting used to at first, but it's well worth your time investment in the long term, bringing a new layer of strategy and fun to your weapon choices and fights.\n\nFor weapon stats with Better Combat integration, see below:\n\n| Weapon | Damage | Speed | Baseline Effect | Targets | Reach | Weapon-Type |\n| ------------- | ------ | --------- | -------------------- | ------- | --------- | ----------- |\n| Vanilla Sword | Medium | Medium | Vanilla Sweeping | Multi | Medium | One-handed |\n| Vanilla Axe | High | Slow | Vanilla Shield Break | Single | Medium | One-handed |\n| Dagger | Low | Very Fast | | Single | Medium | One-handed |\n| Club | High | Slow | Slow target | Single | Medium | One-handed |\n| Hammer | High | Very Slow | Knock target upwards | Single | Medium | One-handed |\n| Spear | Medium | Slow | | Single | Very High | Two-handed |\n| Quarterstaff | Low | Fast | Vanilla Sweeping | Multi | High | Two-handed |\n| Glaive | High | Very Slow | Vanilla Sweeping | Multi | High | Two-handed |\n\n![Divider](https://github.com/Khazoda/basic-weapons/blob/Web-Assets/description_common/divider_2.png?raw=true)\n\n# Frequently Asked Questions (FAQ) \ud83e\udde1\n\n- What are the recipes?\n- _`Recipes are unlocked in the vanilla recipe book when obtaining the requisite materials (e.g. picking up an iron ingot). You can also use a mod like EMI to view all recipes.`_\n- What are the mod's dependencies? \n _`Basic Weapons has no required dependencies except for the usual Fabric API/ QFAPI that most mods on Fabric and Quilt require. For an upgraded experience you can install this mod together with Better Combat for more exciting fights if you want.`_\n- Is there a forge/fabric/quilt version? \n _`Yes, all three! The downloads are named for whichever modloader they're for so just take a look at the file names :)`_\n- Can you backport the mod to Minecraft 1.X.X? \n _`Unfortunately I don't have the time to backport Basic Weapons to earlier versions. The mod will however support each new version of Minecraft.`_\n- I found a bug / my game crashed \n _`If you find any problems with Basic Weapons, please feel encouraged to create an issue on the GitHub repository issue tracker.\u00a0Bug reports are incredibly helpful, and help make Basic Weapons the best it can be.`_\n\n![Divider](https://github.com/Khazoda/basic-weapons/blob/Web-Assets/description_common/divider_4.png?raw=true)\n\n__Thank you to all the wonderful translation contributors!__\n- junshengxie\n- FirePhantom303\n- goofy_boyd9110260\n- nimbXnumb\n- Alexander317\n- Hexasan\n- GumIsNoob\n- Pituto\n- Stefan\n- Germinecraft\n- Germinecraft\n- Singlain\n- Yes20name\n- Darkwhite\n- DanioMalinowy\n- Ardufish123\n- Harjjw\n- lotl", + "body_url": null, + "published": "2023-09-20T15:19:55.364612Z", + "updated": "2024-08-12T20:45:15.284532Z", + "approved": "2023-10-01T21:19:39.960638Z", + "queued": "2023-09-30T14:00:18.665778Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 77231, + "followers": 170, + "categories": [ + "adventure", + "equipment" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "7z6FfHX0", + "Ht65pKah", + "4mPe9VXi", + "fOLWcsal", + "BSDKDe9g", + "v1ACpnlq", + "lO6fpkVX", + "vWq2LdvJ", + "KDo3r9hs", + "fkdERjjI", + "4WJQnJON", + "XkD1RmGm", + "xYyn0iPP", + "pevH0Ypf", + "AEYxWCqh", + "zSdnkMN9", + "q8nDO1XY", + "IYwDaEDI", + "j8dBif5J", + "tuT2hSeB", + "ltu6UBMx", + "nZF923u3", + "BOchCmpf", + "JsONNvkB", + "YBUTHRag", + "h0WwUNRU", + "o9KgAKrC", + "BufbXYSe" + ], + "icon_url": "https://cdn.modrinth.com/data/sc2Pektv/3182b515e0663c8bcd364f276b1648f182345f0a.gif", + "issues_url": "https://github.com/Khazoda/basic-weapons/issues", + "source_url": "https://github.com/Khazoda/basic-weapons", + "wiki_url": "https://basicweapons.khazoda.com", + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/sc2Pektv/images/b13b4fd37f6faf5358f89334646be730a58150fc.png", + "featured": true, + "title": "Version 1.2.9 Weapon Sprites", + "description": "All weapon sprites included in the 1.2.9 version of Basic Weapons.", + "created": "2024-08-12T19:51:30.328473Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/sc2Pektv/images/0640fa2da9d576ef0b5bf01240de409a7d362029.png", + "featured": false, + "title": "Spear", + "description": "What this cheap to make weapon lacks in damage it makes up for with it's super long attack range (this feature req. Better Combat)", + "created": "2023-09-30T13:23:48.225774Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/sc2Pektv/images/7b202fd8913fc73bead5eb2f16f2174867b6d4ea.png", + "featured": false, + "title": "Daggers", + "description": "Low damage, high attack speed. Dual wield them for super fast slicing!", + "created": "2023-09-30T13:20:24.172036Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/sc2Pektv/images/7d6c964870c40ecd6a4ee8f91e9ee0eeaaf59d85.png", + "featured": false, + "title": "Quarterstaff", + "description": "Swing this staff in style. It has fast, flashy combos with Better Combat installed. Without it, the staff still stands strong as a cheap, fast, useful weapon choice.", + "created": "2023-09-30T13:25:01.815817Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/sc2Pektv/images/88b2d5a5050b2af9be7c82bbda172709c274b847.png", + "featured": false, + "title": "Hammer", + "description": "Fling your enemies into the air with the unrivalled power of the hammer, but beware its super low attack speed.", + "created": "2023-09-30T13:21:20.142402Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/sc2Pektv/images/c7591bfb57e556fdc45e0869da4d894f92d1ed7c.png", + "featured": false, + "title": "Club (old sprite)", + "description": "Knocking enemies on the head with this might give them a short term concussion, but could save your life in a pinch!", + "created": "2023-09-30T13:22:29.380129Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/sc2Pektv/images/13717727b3de47835f1ab970c414e98ab5ead9fc.png", + "featured": false, + "title": "All Weapons (old club sprites, doesn't include glaive)", + "description": "All weapon sprites included in the first release of Basic Weapons", + "created": "2023-09-30T13:59:47.950787Z", + "ordering": 20 + } + ], + "color": 11465706, + "thread_id": "HBy7L4sY", + "monetization_status": "monetized" + }, + "bclib-3.0.14": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19", + "1.19.1", + "1.19.2", + "1.19.3-rc3", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.3", + "1.20.4", + "1.21", + "1.21.1" + ], + "id": "BgNRHReB", + "slug": "bclib", + "project_type": "mod", + "team": "TIxvW3h2", + "organization": "zg4J0wff", + "title": "BCLib", + "description": "A Library Mod for the BetterX Team", + "body": "\nBCLib is primarily a mod library for BetterEnd, BetterNether, Eden Ring and possible future mods from the BetterX team. \n\nFurthermore, BCLib creates **compatibility between different Nether/End mods**. This allows Biomes from different DataPacks and mods to generate in your world. For this (and many other features) BCLib uses its own world type: BetterX.\n\nThe library can be used by other developers to create their own mods. If you have suggestions or extensions, we are open to discussions and pull requests.\n\n### Key Features\n* Block templates for common types (plants with seedlings, wood types, signs, ...)\n* Simple API to create your own biomes, features, structures and much more\n* SurfaceRule/MaterialRule registry. This makes it possible for mods and datapacks to define additional SurfaceRules/MaterialRules for a dimension without editing/copying the vanilla rules.\n* API to create own world types\n* Manage tags\n* Simple UI layout toolkit\n* Recipe management\n* SDF tools\n* Config system with automatic synchronization between client/server\n* Manage world specific data\n* And many smaller extensions like color helper, block/item management, world patchers, etc.", + "body_url": null, + "published": "2022-07-22T20:27:25.973312Z", + "updated": "2024-08-13T18:00:56.063192Z", + "approved": "2022-10-11T22:25:02.758911Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 1576380, + "followers": 405, + "categories": [ + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "cMDt7fG3", + "FcJeV6Yg", + "E5bVN8yO", + "hyMhFkOC", + "scuWwIaO", + "y5bt0nDm", + "G6Nxs4C3", + "mqh4nTSp", + "kyFQ8QVW", + "vfltbwjl", + "CXLaMuHt", + "mKksn4EY", + "ipLcyock", + "WpPJmMjm", + "l2oWjhoi", + "v3SUqvCn", + "aykCQLhD", + "TMKsPs2I", + "yZskNeFO", + "iXZF8l0s", + "v2t3ERqV", + "ZzfMrZCj", + "L2Lkhe7y", + "sLid477I", + "WDnv1BOR", + "xSXBLwfQ", + "MCriQhNd", + "ZGx3XHOO", + "VIKYJnYA", + "D6bAamqR", + "o3lVyUSA", + "bccqbyya", + "ghLtVmRL", + "TPC86Pyz", + "HP1eF3Su", + "Z8nIBt5J", + "2RDeUu4R", + "2sXLB8a2", + "PtuzTpi8", + "wALe4CZS", + "TtIDsgcj", + "cZo4m0p7", + "RY7JTBN9", + "obkxwoJB", + "8CFJ4Oi8", + "vz0CZ7K5", + "vG7JnDsd", + "5NRCb8hh", + "dtxeKZRb", + "dDAUeYya", + "QMCodPrA", + "TxWM7AW8" + ], + "icon_url": "https://cdn.modrinth.com/data/BgNRHReB/1b057bebe91712f5d135b2240baaffa8cd3cf065.png", + "issues_url": "https://github.com/quiqueck/BCLib/issues", + "source_url": "https://github.com/quiqueck/BCLib/", + "wiki_url": null, + "discord_url": "https://discord.gg/kYuATbYbKW", + "donation_urls": [ + { + "id": "bmac", + "platform": "Bmac", + "url": "https://www.buymeacoffee.com/quiqueck" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/BgNRHReB/images/1685c2d4d5875006a5db18ec22b8f57952f1f51d.png", + "featured": false, + "title": "World Generator Settings", + "description": "The BetterX World Type offers some specialised Settings.", + "created": "2022-07-22T22:52:13.715321Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/BgNRHReB/images/2d7fa966accd575584269c1331171cc31a484e14.png", + "featured": false, + "title": "Mod Updater", + "description": "A special Screen that will inform Users that new Updtates of our Mods are available.", + "created": "2022-07-22T20:47:03.998489Z", + "ordering": 0 + } + ], + "color": 13614060, + "thread_id": "BgNRHReB", + "monetization_status": "monetized" + }, + "beekeeperhut-fabric-mc1.20.1-2.0.1": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "Kt4RVKEd", + "slug": "friends-and-foes-beekeeper-hut-fabric", + "project_type": "mod", + "team": "CjNZzGfz", + "organization": null, + "title": "Friends&Foes - Beekeeper Hut (Fabric/Quilt)", + "description": "An addon for the Friends&Foes mod, adding a beekeeper hut structure.", + "body": "
\n\n
\n\t\"Friends&Foes\n\t

Beekeeper Hut (Fabric)

\n
\n\n
\n\t

\n\t\t\n\t\t\t\n\t\t\n\t\t\n\t\t\t\n\t\t\n\t\t\n\t\t\t\n\t\t\n\t\t\n\t\t\t\t\n\t\t\n\t\t\n\t\t\t\n\t\t\n\t

\n
\n\n

\n\tFriends&Foes - Beekeeper Hut is a small addon adding the beekeeper hut structure. Structure can be found in meadow and flower forest biomes.\n\t
\n
\n\tBe aware that the main Friends&Foes mod is required to run this addon. Looking for the Forge or Quilt version?\n

\n\n

\ud83c\udf6f Beekeeper huts

\n

\n\t\n\t  \n\t\n

\n\n
\n\n

\u2699\ufe0f Other addons / compat datapacks

\n\n\n
\n\n

\ud83d\udcac Community

\n

\n\tFeel free to join our community at the discord server to chat, share your creations, ask any question or to simply be updated about the latest development of the mod and notified when the new release is out. Also don't hesitate to report any crash or bug via GitHub issues.\n

\n\n
\n\n

\ud83d\udc4b Support

\n\n

I will continue to develop my mods regardless of any support as it is my hobby, although most of my free time goes into development of my mods. So if you want to support me anyway, you can do that via Patreon or Ko-fi. That said, I do appreciate all of your support.

\n\n
\n\n

\ud83d\udcdc License

\n\n

\n\tThe mod is licensed with CC BY-NC-ND 4.0 license.\n

\n

\n\tFeel free to look over my code for examples of how i have implemented and solved various problems while writing this mod, incorporate snippets into your own code. Also feel free to use this mod in any modpack (although credit/link back to this page will be greatly appreciated).\n

", + "body_url": null, + "published": "2022-11-26T12:57:36.704366Z", + "updated": "2024-07-11T15:29:54.429984Z", + "approved": "2022-11-26T23:33:06.829248Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "CC-BY-NC-ND-4.0", + "name": "Creative Commons Attribution Non Commercial No Derivatives 4.0 International", + "url": null + }, + "downloads": 228360, + "followers": 132, + "categories": [ + "adventure", + "decoration", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "hqOD9ho4", + "m9JuxcTp", + "8tkUqpmp", + "abHkU7p3", + "i8e53L1m", + "aPlZhLQ1", + "8czokyP6", + "OXUOxwCC", + "ai5aYe3h", + "T4di0VX8", + "ahDgyTni", + "jZy55Iis", + "Er8wXYv6", + "1KYeUSUz", + "b8oxiTJ3", + "Iya1d63p", + "7kectHGL", + "ePDBld1C", + "1o87glRI", + "qwhZ4Roz" + ], + "icon_url": "https://cdn.modrinth.com/data/Kt4RVKEd/77fdea9bbb7252b1619dc9e0d38a77918a11de94.png", + "issues_url": "https://github.com/Faboslav/friends-and-foes-beekeeper-hut/issues", + "source_url": "https://github.com/Faboslav/friends-and-foes-beekeeper-hut", + "wiki_url": null, + "discord_url": "https://discord.com/invite/QGwFvvMQCn", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/Faboslav" + }, + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/faboslav" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/Kt4RVKEd/images/7fb7396e133b5032f1cd60eca6be77c81bab0333.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-26T13:20:48.053267Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/Kt4RVKEd/images/c309687b0543cf12ab12b0f77e44f5184ee6d1e9.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-26T13:20:54.705522Z", + "ordering": 0 + } + ], + "color": 11237211, + "thread_id": "Kt4RVKEd", + "monetization_status": "monetized" + }, + "better-end-4.0.11": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.3", + "1.20.4", + "1.21", + "1.21.1" + ], + "id": "gc8OEnCC", + "slug": "betterend", + "project_type": "mod", + "team": "R6ercWZQ", + "organization": "zg4J0wff", + "title": "BetterEnd", + "description": "New Biomes, mysterious rituals and Mobs for your End", + "body": "\n
 
\n

BetterEnd adds new biomes into the End. Each biome has its own atmosphere, resources and mobs. The sky will have a fresh look with purple nebulas and stars. All biomes have custom music (by Firel), sounds and effects to make them alive and interesting to explore. BetterEnd has a custom End generator and custom structures for the Central Island. With our new generator End islands will have different shapes, terrain, will be on different height. Inside islands you can find caves with unique resources.

\n\n## Main Features\n- 24+ new biomes (more will be added later)\n- 6 new mobs (with biome variations for some of them)\n- Many new blocks, including 9 wood types and 7 new stone types\n- Many new items, including new food sources, tools, armor and weapons\n- New mechanics like Infusion Rituals, Anvil Recipes, End tool progression and others\n- Integrations with other mods, for example 2 new sub-biomes for BYG biomes (1.16) and some new plants for them\n- Custom End world generator (configurable) with more possibilities than vanilla one\n- Configs for blocks, items, mobs, enchants and many other things\n\n\n## What others are saying\n
\n\n\n\n\n\n\n
\n\n## You might also like\n\n\n\n\n
BetterNether
More Biomes, More Mobs, More Tools for the fiery Dimension
Wunderreich
Advanced Vanilla-Like Mechanics and Tools
\n\n


\n\n
 
\n
 
", + "body_url": null, + "published": "2022-10-12T18:57:24.255261Z", + "updated": "2024-08-13T18:02:54.784593Z", + "approved": "2022-10-12T19:18:18.757247Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 1805752, + "followers": 1574, + "categories": [ + "decoration", + "mobs", + "worldgen" + ], + "additional_categories": [ + "equipment", + "food" + ], + "loaders": [ + "fabric" + ], + "versions": [ + "hJMQDYuT", + "ANsvdFr8", + "TndPF7zF", + "AuAjQ6Qf", + "aXZXyoTS", + "pYKzbYQf", + "A5xMcTpR", + "5CIFclEA", + "Col2KocA", + "HobFUbgX", + "YN2772kY", + "iIArs4ez", + "OTbfUxoF", + "Awusirku", + "uO0QtD3V", + "B96YRY3u", + "vQwGdQSo", + "V1430FVI", + "SLRbMICk", + "SH3iHjGi", + "tbyUkoxk", + "4q8NJYKQ", + "rOZj6LBv", + "Ppz6XYhV", + "Lr44qUSg", + "n2pzhoQD", + "otd2erfL", + "iPkONTDu", + "7QwyTILr", + "WAIDCJK8", + "F3omRrtz", + "kS8dZ2Lm", + "VRHPOZBe", + "kkssWr44", + "ZqwBf6Kh", + "ZG3hVtPL", + "FetSp6Um", + "yvOGk2s5", + "KYp60fr2", + "FSsjVa6J", + "dtwLeRnJ", + "10ST5zQJ", + "Cb3pODzn", + "euqcFwLv" + ], + "icon_url": "https://cdn.modrinth.com/data/gc8OEnCC/22fdef19992a21f7a16e53eb0ff2fe5e59766003.png", + "issues_url": "https://github.com/quiqueck/BetterEnd/issues", + "source_url": "https://github.com/quiqueck/BetterEnd", + "wiki_url": null, + "discord_url": "https://discord.gg/kYuATbYbKW", + "donation_urls": [ + { + "id": "bmac", + "platform": "Bmac", + "url": "https://www.buymeacoffee.com/quiqueck" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/gc8OEnCC/images/d903ddf62542142b8d09ad13349ca61aa2013994.jpeg", + "featured": false, + "title": "End Biomes", + "description": null, + "created": "2022-10-12T19:03:08.131865Z", + "ordering": 0 + } + ], + "color": 1317665, + "thread_id": "gc8OEnCC", + "monetization_status": "monetized" + }, + "better-nether-9.0.10": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19", + "1.19.1", + "1.19.2", + "1.19.3-rc3", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.3", + "1.20.4", + "1.21", + "1.21.1" + ], + "id": "MpzVLzy5", + "slug": "betternether", + "project_type": "mod", + "team": "E67Lfc4l", + "organization": "zg4J0wff", + "title": "BetterNether", + "description": "More Biomes, More Mobs, More Tools for the fiery Dimension", + "body": "\n
 
\n

With BetterNether your adventures in the fiery dimension will be even more exciting. The mod adds new biomes, plants and materials to the Nether. Among them there are new challenging monsters like the Naga, or dark dungeons where the creatures of Nether have taken over. Your new tools will bring unique improvements that will help you to survive. There are a lot of unique new blocks for builders together with variants of old familiar vanilla blocks.

\n\n## Main Features\n- Dozens of new plants for the Nether\n- New Nether-mobs\n- New unique biomes\n- Vertical and volumetric biome system (supporting other mods and datapacks)\n- Many new materials, recipes, food, tools and items\n- Ability to farm some materials using plant farms and mob farms\n- Many Nether structures, including big and rare Nether Cities\n- Integrations with other popular mods.\n\n\n## What others are saying\n
\n\n\n\n\n\n\n
\n\n## You might also like\n\n\n\n\n
BetterEnd
New Biomes, mysterious rituals and Mobs for your End
Wunderreich
Advanced Vanilla-Like Mechanics and Tools
\n\n


\n\n
 
\n
 
", + "body_url": null, + "published": "2022-10-12T15:08:36.987950Z", + "updated": "2024-08-10T23:25:22.415529Z", + "approved": "2022-10-12T16:06:58.856729Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 1510953, + "followers": 1218, + "categories": [ + "equipment", + "mobs", + "worldgen" + ], + "additional_categories": [ + "decoration", + "food" + ], + "loaders": [ + "fabric" + ], + "versions": [ + "sPFMoqd5", + "MaTuYgp1", + "jjV0S0fX", + "TBr8sToh", + "GihEl5wC", + "T5UEhmR2", + "CnOsJRy8", + "InVK1xFf", + "NGF0V14B", + "aYRNTIra", + "IXgqavpM", + "HCFzjRjZ", + "KjQwjub6", + "V1Ubr9Ix", + "nIbM8wr8", + "kf83dxUg", + "EgKbEvT2", + "mpeXF4p0", + "GvEaRCG9", + "p7J7Uasn", + "4MkxQteb", + "9kJblF2V", + "GcAIYp4g", + "IG7kgtJH", + "aVzW3Afg", + "yTtY9wjE", + "DTRhf6P8", + "LdQKgQqO", + "kuzkD1Dr", + "tWePKjVG", + "m70EkRqY", + "1485z59I", + "CtncSDC8", + "zvfv1sJF", + "iz7PX1xX", + "X0EFJ5IG", + "B4QtCd3h", + "NSS8HlzK", + "M1o6hR2m" + ], + "icon_url": "https://cdn.modrinth.com/data/MpzVLzy5/d35c76a6051d79b35ac33668772ee5a35f2c1f8e.png", + "issues_url": "https://github.com/quiqueck/BetterNether/issues", + "source_url": "https://github.com/quiqueck/BetterNether", + "wiki_url": null, + "discord_url": "https://discord.gg/kYuATbYbKW", + "donation_urls": [ + { + "id": "bmac", + "platform": "Bmac", + "url": "https://www.buymeacoffee.com/quiqueck" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/MpzVLzy5/images/0e4fbb3ee7ee777a137e8109dcbda125411d0428.gif", + "featured": false, + "title": "Create blue Obsidian", + "description": "Use a bucket of Water on a Lava-Source above Soulsand/-stone to generate blue Obsidian.", + "created": "2022-10-12T15:13:01.567523Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/MpzVLzy5/images/10fb1e56f03fb1735a145bccce7b7e512b91bdec.gif", + "featured": false, + "title": "Charge Obsidian", + "description": "Use a Lightning Rod to create crying (or weeping) obsidian.", + "created": "2022-10-12T15:13:07.918198Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/MpzVLzy5/images/61ddb1483ae5d83f4cacb30dd5ec6f217f8b2669.jpeg", + "featured": false, + "title": "Nether Biomes", + "description": "Some of the new Nether Biomes (rendered using Iris and Complementary Reimagined)", + "created": "2022-10-12T15:27:12.937923Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/MpzVLzy5/images/741793a74da48f1864ce98ead591694063edf65c.gif", + "featured": false, + "title": "Faster Obsidian Mining", + "description": "All Nether Pickaxes have improved mining speed for Obsidian Blocks", + "created": "2022-10-12T15:13:04.978616Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/MpzVLzy5/images/7b56a30cdb66635489cd456a2fb145fac6e62412.png", + "featured": false, + "title": "Freeform Portals", + "description": "Build arbitrary shaped nether portals, with all the previously enabled Obsidian Block", + "created": "2022-10-12T15:12:58.089740Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/MpzVLzy5/images/8524d6884e06556961117a7d74d7c8475234b0b7.gif", + "featured": false, + "title": "New Portal Frames", + "description": "All Full Obsidian related Blocks can be used as a portal Frame. Other mods can add new Frame-Blocks using the custom Tag *c:nether_pframe*", + "created": "2022-10-12T15:12:55.258774Z", + "ordering": 0 + } + ], + "color": 3744025, + "thread_id": "MpzVLzy5", + "monetization_status": "monetized" + }, + "betterarcheology-1.1.9-1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20-pre7", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4" + ], + "id": "zCh7omyG", + "slug": "better-archeology", + "project_type": "mod", + "team": "WGV0KdAx", + "organization": null, + "title": "Better Archeology", + "description": "Discover artifacts & fossils by encountering new structures that'll enhance your adventure and exploration!", + "body": "![Better Archeology Title](https://i.imgur.com/KG3zJMU.png)\n![Life & Death Update](https://i.imgur.com/MBQksdy.png)\n\nWith the theme of archeology being introduced in the Minecraft 1.20 \"Trails & Tales\" Update, it has quickly become clear that Mojang sadly only took a small step into the big world that is archeology.\n\nIt is our goal with this mod to improve upon the mechanics introduced in the update and expand the minecraft universe with new stuff to discover while staying true to the nature of the game.\n\nWe also plan to regularly update the mod to newer versions and provide new content in the weeks to follow.\n\nFor more in-depth info, visit our\u00a0[Wiki](https://github.com/Pandarix/BetterArcheology/wiki)!\n\n[![Video Link](https://i.imgur.com/p0IW2yD.png)](https://www.youtube.com/watch?v=2IiWwGYwBPU&lc=Ugx_0IxbUoUXGq2jmfB4AaABAg)\n\n[![Promotion Code](https://www.bisecthosting.com/partners/custom-banners/d60c79dc-ea5e-4e57-b18e-11518bc241e7.webp)](https://www.bisecthosting.com/Pandarix)", + "body_url": null, + "published": "2023-06-06T16:08:05.335173Z", + "updated": "2024-05-14T12:16:46.846336Z", + "approved": "2023-06-09T04:49:53.100623Z", + "queued": "2023-06-07T12:37:51.797154Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 815188, + "followers": 778, + "categories": [ + "adventure", + "decoration", + "worldgen" + ], + "additional_categories": [ + "equipment", + "game-mechanics" + ], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "mtxSVVAF", + "eoEx2R8p", + "sXGr31Up", + "AeIUTQsm", + "cdJqef2G", + "vTViLQvA", + "HRWQpkHM", + "EJHNTdmP", + "oYXfn8Ly", + "GQACULh1", + "9umhrcBO", + "F3wUE2KP", + "9adkVmnH", + "MHahjJWI", + "OzjIGnCo", + "52sCnPxy", + "sAb4sprI", + "y3iEgC9J", + "aJLMkfsn", + "vXE6rB0T", + "wiX5tzAE", + "Y42zbzPh", + "GgrL5nB5", + "Xhpwoecs", + "doxWGs8G", + "lh7aMzAa", + "5z3P73R4", + "x5DacI7P", + "vUlUODyr", + "WOKbVMrD", + "8f9j7B3i" + ], + "icon_url": "https://cdn.modrinth.com/data/zCh7omyG/289e82d740ce955d6a5ab6d1ecaa2efbdb9a5d40.png", + "issues_url": "https://github.com/Pandarix/BetterArcheology/issues", + "source_url": "https://github.com/Pandarix/BetterArcheology", + "wiki_url": "https://github.com/Pandarix/BetterArcheology/wiki", + "discord_url": null, + "donation_urls": [ + { + "id": "paypal", + "platform": "Paypal", + "url": "https://www.paypal.com/paypalme/ruvebell" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/zCh7omyG/images/1dc68b82a062a301b655c86e531bd296adbb4cc1.png", + "featured": false, + "title": "Stonehenge", + "description": null, + "created": "2023-06-07T12:33:27.883379Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/zCh7omyG/images/28d8eb45e7cc0c7a38476b816039b011e72f44fc.png", + "featured": false, + "title": "Sheep Fossil Site", + "description": "This is just one of the fossil site in BA", + "created": "2023-06-07T12:33:44.941778Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/zCh7omyG/images/2beafc5249f12a2fc16da1cb909c283a86baed51.png", + "featured": false, + "title": "Tumulus", + "description": "An old grave", + "created": "2023-06-07T12:33:14.546245Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/zCh7omyG/images/3424bf63dd0584b1d5cdab1d91c4af899c649afc.png", + "featured": false, + "title": "Mesa Ruins", + "description": "Inspired by \"Petra\", this mesa structure is completely made out of red sandstone and contains secrets", + "created": "2023-06-07T12:32:58.753489Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/zCh7omyG/images/cbb21bdc1de2cb7c5349e14f9343e45c45749ee1.png", + "featured": false, + "title": "Mott Structure", + "description": "A small structure used as a lookout long ago. It is surrounded with a moat.", + "created": "2023-06-07T12:32:16.396159Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/zCh7omyG/images/e0514b465adbebcca66359e1e8f4129b124cf02e.png", + "featured": true, + "title": "Jungle Temple", + "description": "This structure contains a lot of loot and adventure to seek!", + "created": "2023-06-07T12:10:40.393193Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/zCh7omyG/images/336589874e1af6eeafcb4103f017c722af25c927.png", + "featured": false, + "title": "Fossils", + "description": "Here is an overview of all fossils", + "created": "2023-06-07T12:09:03.283598Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/zCh7omyG/images/b45e02ef2749b57738c6a892093033a53bda7049.png", + "featured": false, + "title": "New Blocks", + "description": "Loot Vases, The Archeology Table, Fossiliferous Dirt", + "created": "2023-06-07T12:11:42.948636Z", + "ordering": 2 + }, + { + "url": "https://cdn.modrinth.com/data/zCh7omyG/images/0f8c6c55f56620754cafc1f88cec6a3ed7f67258.png", + "featured": false, + "title": "New Items", + "description": "Rusty Bomb, Totem of Souls & Torrents, Artifact Shard", + "created": "2023-06-07T12:12:22.994778Z", + "ordering": 3 + }, + { + "url": "https://cdn.modrinth.com/data/zCh7omyG/images/a9fb1c640b12581d4510931730c4ed010cb00bef.png", + "featured": false, + "title": "New Wood Type", + "description": "Rotten Wood and its variants can be found in ancient structures", + "created": "2023-06-07T12:13:10.169972Z", + "ordering": 4 + }, + { + "url": "https://cdn.modrinth.com/data/zCh7omyG/images/36c8f7a35175dac08e4c8c356b5b870506baffbd.png", + "featured": false, + "title": "Archeologist Villager", + "description": null, + "created": "2023-06-07T12:13:29.749930Z", + "ordering": 5 + } + ], + "color": 3810060, + "thread_id": "zCh7omyG", + "monetization_status": "monetized" + }, + "bettercombat-fabric-1.8.5+1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4" + ], + "id": "5sy6g3kz", + "slug": "better-combat", + "project_type": "mod", + "team": "fVvaiaa2", + "organization": null, + "title": "Better Combat", + "description": "\u2694\ufe0f Easy, spectacular and fun melee combat system from Minecraft Dungeons.", + "body": "![Better Combat](https://cdn.modrinth.com/data/5sy6g3kz/images/6d65cbe745229c36b7b97cb608926374724d8174.png)\n\n\n# Easy, spectacular and fun melee combat system from Minecraft Dungeons.\n\n‌\n[![Modloader](https://img.shields.io/badge/Loader-Fabric%20|%20Forge-ecebe6?labelColor=263768&style=for-the-badge)](https://fabricmc.net)\n[![Discord](https://img.shields.io/discord/973561601519149057.svg?label=&logo=discord&logoColor=ffffff&color=7389D8&labelColor=6A7EC2&style=for-the-badge)](https://discord.gg/KN9b3pjFTM)\n\n### \u2728 Looking for vanilla-friendly content? Try these!\n\n[![Archers](https://cdn.modrinth.com/data/XIpMGI6r/images/cd19a95a79f1157b33f31818aa615a280b206912.png \"Archers\")](https://modrinth.com/mod/archers \"\")[![Paladins](https://cdn.modrinth.com/data/XIpMGI6r/images/3f19359bfd7521ba17bec818f125e87e09ef277e.png \"Paladins\")](https://modrinth.com/mod/paladins-and-priests \"\")[![Wizards](https://cdn.modrinth.com/data/XIpMGI6r/images/a7da965aa108daf95c10448c01423be49ce2338d.png \"Wizards\")](https://modrinth.com/mod/wizards \"\")\n\n# \ud83d\udde1 Features\n\n![slash](https://cdn.modrinth.com/data/5sy6g3kz/images/38efa008bc297aa49572761bed1eff2399a1b2dc.gif \"\")\n![stab](https://cdn.modrinth.com/data/5sy6g3kz/images/d05e3c914008be42cb89db190ae73f767ca97873.gif \"\")\n![slam](https://cdn.modrinth.com/data/5sy6g3kz/images/89422bcaa8fcc18a05834da0b1027b07751e9722.gif \"\")\n\n### Fancy attack animations\nThis mod includes several one-handed, two-handed and dual wielded attack animation resources.\n### Accurate weapon collision detection\nNo more pixel hunting with your cursor, you can now just swing your weapon and hit whatever is in the way. Enjoy playing in third person view. :)\n### Natural look and feel\nAttacks have an upswing phase before the hit is actually performed, like in real life.\n### Weapon combos\nSome weapons have a sequence of different attacks.\n### Dual wielding\nDual wield any one handed weapons! Use the attack hotkey to alternately attack with main-hand and off-hand.\n### Reworked Sweeping Edge\nWeapon swing hitting multiple enemies deal reduced damage. To deal full weapon damage against all targets, you need to have Sweeping Edge enchantment.\n### Hold to attack\nHold the attack hotkey to spam attacks on cooldown (configurable).\n### Swing thru grass\nAttack instead of mining zero hardness blocks (configurable).\n### Support any item from any mod (with data files)\nAutomatic compatibility with most mods (weapons without attribute file, will be automatically assigned a matching weapon preset, based on item id).\n\nSuper easy to add dedicated compatibility, support via Discord for partnering modders.\n\n‌\n\n‌\n\n# \ud83d\udd28 Add compatibility to any weapon\n‌\n\nAdd uniquely created or out of the box behaviour to any weapon from any mod, by just creating **JSON** data files.\n\nCheck out our integration guide [here](https://github.com/ZsoltMolnarrr/BetterCombat#-integrate-your-mod \"integration guide\").\n\n‌\n\n# \ud83d\udd27 Configuration\n‌\n\n**Client side** settings can be accessed via the [Mod Menu](https://github.com/TerraformersMC/ModMenu).\n\n**Server side** config can be found at:\n\n- General properties: `config/bettercombat/server.conf`\n\n- Fallback compatibility: `config/bettercombat/fallback_config.conf`\n\nAutomatically created with default values, upon loading any game world for the first time. \n\n‌\n\n# \u26d3 Compatibility\n\n‌\n\nWith an open source and modular mindset, this project is aiming for maximal compatibility. However, mods trying to change the same mechanics will never be compatible (such as dual wielding mods).\n\n‌\n\n## \ud83e\udd1d Partnerships\n\n‌\n\nWe partnered up with the following mods, to fully utilise the JSON API of Better Combat:\n\n- [MC Dungeons Weapons](https://www.curseforge.com/minecraft/mc-mods/mcdw)\n\n- [MCDoom](https://www.curseforge.com/minecraft/mc-mods/mcdoom)\n\n- [MedievalWeapons](https://www.curseforge.com/minecraft/mc-mods/medievalweapons)\n\n- [Mythic Metals](https://www.curseforge.com/minecraft/mc-mods/mythicmetals)\n\n- [Simply Swords](https://www.curseforge.com/minecraft/mc-mods/simply-swords)\n\n- [Spectrum](https://www.curseforge.com/minecraft/mc-mods/spectrum)", + "body_url": null, + "published": "2022-07-04T18:54:33.189896Z", + "updated": "2024-08-13T20:18:40.795655Z", + "approved": "2022-07-04T18:54:33.189896Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "GPL-3.0-only", + "name": "GNU General Public License v3.0 only", + "url": null + }, + "downloads": 1675377, + "followers": 1766, + "categories": [ + "adventure", + "equipment", + "library" + ], + "additional_categories": [ + "game-mechanics" + ], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "3CYKBxen", + "ZZQdi3pp", + "S4e1NhvP", + "vm5jREUS", + "Hcp3uNRj", + "sLXa7pZ2", + "niYMwqqW", + "E4CYbWvp", + "9GkOwhi6", + "BRMMYk8d", + "KoaUFgOz", + "1LgYyboz", + "6JlobxTb", + "HEmwYD0Y", + "tsIlqS9N", + "FxeoNW9K", + "OrbwS3ba", + "PuxIMJUv", + "wRXLFzHT", + "QPaSohpX", + "yobLa8Ka", + "CnXOCzOj", + "I7g0lYYP", + "kxeqCjCH", + "KmpxvsMZ", + "UheSx89w", + "eGLGQ4Yk", + "MEUYYVie", + "TdFvUGT6", + "zegHXRXv", + "WVgEQ9QJ", + "NjDP73zB", + "On1e8jtw", + "y0zoIVe1", + "98YaFZL7", + "42LPvr1L", + "CoyQHb9O", + "IMIWqP8g", + "izFZF9kA", + "930mpjgq", + "a79fMnbx", + "xEhkVxqE", + "bEnzfxLu", + "K7ndD8PA", + "eUSBZeXF", + "zIQw5406", + "MFZphYTK", + "A8YxoUuj", + "LTis9RHk", + "p8SWuqxf", + "12NTMIyD", + "rza9ZYp8", + "vguKs2Nb", + "Nke3A2eE", + "V5vBq3d0", + "94av95p6", + "yXT851KE", + "lbdD31Ny", + "GtbdDOfI", + "6DYg9jqE", + "wTSLGiMF", + "lYxfimLA", + "6qfnRKuK", + "WzOMm40r", + "afUdG913", + "JFl05fYS", + "JhsT2Y4j", + "swcBOsdJ", + "k615Hdk1", + "V1lDVr1G", + "6HTqAnMI", + "L77HeQLR", + "d47dAzGT", + "rl0yYVw7", + "XvSy8PJ2", + "ruf8ut9b", + "cuvyLYI7", + "OFm6NkMk", + "T4rZupi3", + "hqLjlli1", + "4ShSUvSm", + "CkxcDUjA", + "feKuaHBR", + "A7doUWQz", + "NIjIeYjb", + "atUdkTWG", + "kEJR3PSs", + "BQWFvepZ", + "LihegvCM", + "kuw5o2Dr", + "ILTizRUG", + "QqOP1DU7", + "PvGH3nY4", + "arL7c9CT", + "zrwtpL0K", + "w9IwMtLV", + "OhqgJMfy", + "4w4MQjXp", + "idsKn7Hx", + "ITHUgmZn", + "5fGERlKw", + "pWDuRxK3", + "6OURqKIv", + "syqeTpM4", + "xCNriqWr", + "IYrQP8bS", + "QEmtU3sg", + "PqiSHyeM", + "8aZcgAEl", + "EGyKyHvF", + "SrGbPUa3", + "i9M7sKb9", + "ibYfuIUH", + "SsDWF33Q", + "SmUe5knN", + "PnxjxCao", + "ikZuTgOU", + "ur19k9Ub", + "kSb1Iy26", + "iU8XokZ7", + "YKHsErBH", + "Xb5ZbTnA", + "UYe5xso7", + "BVdzLiAa", + "ZV0EgiSw", + "WAsPRXZM", + "d51cgiPN", + "ukboeB3U", + "NB5z5KKf", + "Fzkl8bod", + "lO4Edvnc", + "NQcJaV5u", + "8zYbmr4Z", + "qIM9327j", + "MxaoPSMy", + "WqdF4IBa", + "8W0DfPzM", + "cdDnwbqD", + "T8lEKADG", + "kq2N9shS", + "Z6wHaEla", + "574qq9So", + "hNenqXi9", + "fyk4JACb", + "sKYHGkQb", + "RhDo0oHI", + "aMCXkh0U", + "2Q8QpAR9", + "1mMMpsqV", + "bFsjmpf4", + "LsvZlcsu", + "ay2HpHDe", + "jhqZUDtT", + "dXTkmeN8", + "DpMdn6Pf", + "qxfX3jsR", + "UjlaL0Fm" + ], + "icon_url": "https://cdn.modrinth.com/data/5sy6g3kz/icon.png", + "issues_url": "https://github.com/ZsoltMolnarrr/BetterCombat/issues", + "source_url": "https://github.com/ZsoltMolnarrr/BetterCombat", + "wiki_url": "https://github.com/ZsoltMolnarrr/BetterCombat", + "discord_url": "https://discord.gg/KN9b3pjFTM", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/5sy6g3kz/images/38efa008bc297aa49572761bed1eff2399a1b2dc.gif", + "featured": false, + "title": "One handed slash", + "description": null, + "created": "2022-07-04T19:06:54.784203Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/5sy6g3kz/images/6d65cbe745229c36b7b97cb608926374724d8174.png", + "featured": false, + "title": "logo", + "description": null, + "created": "2022-07-20T15:11:44.355491Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/5sy6g3kz/images/89422bcaa8fcc18a05834da0b1027b07751e9722.gif", + "featured": false, + "title": "One handed slam", + "description": null, + "created": "2022-07-04T19:06:55.907477Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/5sy6g3kz/images/d05e3c914008be42cb89db190ae73f767ca97873.gif", + "featured": false, + "title": "One handed stab", + "description": null, + "created": "2022-07-04T19:06:55.351982Z", + "ordering": 0 + } + ], + "color": 856615, + "thread_id": "5sy6g3kz", + "monetization_status": "monetized" + }, + "bingus-1.20.1-fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.18.2", + "1.19.4", + "1.20.1", + "1.20.4" + ], + "id": "VdEsgz29", + "slug": "bingusandfloppa", + "project_type": "mod", + "team": "xAwV02F4", + "organization": null, + "title": "Bingus & Floppa", + "description": "This mod adds the legendary cats Bingus and Floppa, who will fight for your honor", + "body": "![Bingus mod logo (cool)](https://cdn.modrinth.com/data/cached_images/43a99983d3b2bd626ea0b500270f95b362818995.jpeg)\n\u00a0\nBingus adds famous funny cats, Bingus and Floppa, as summonable pets that fight on your behalf.\n\n![Page Separator](https://cdn.modrinth.com/data/cached_images/632e59703cbabbd4208ff8269dede6fad09feb15.png)\n\u00a0\n\u00a0![Crafting a Bingus tTotem with a diamond, 4 amethyst, and a 4 fish](https://cdn.modrinth.com/data/cached_images/1bd193a8f865fb4e6656c1fd81ad347f0892d1cb.png)\n \nBingus Totems can be crafted using a diamond, 4 amethyst, and 4 of any fish. You spawn a Bingus from it using Mouse 2. An infinite amount of Binguses can be spawned, provided you have enough totems.\n\n[Note : in the 1.16.5 version, pink dye is used instead of amethyst.]\n\n![Page Separator](https://cdn.modrinth.com/data/cached_images/632e59703cbabbd4208ff8269dede6fad09feb15.png)\n\u00a0\n![Crafting a Floppa totem with a Netherite scrap, 4 copper ingots, and 4 fish](https://cdn.modrinth.com/data/cached_images/9c7b6d45346e707f411ff90f3e99a6be3b83860a.png)\n\nFloppa Totems are crafted using a netherite scrap, 4 copper, and 4 of any fish. Summoning a Floppa works the same as a Bingus, but Floppas have increased mobility and a special shockwave attack that can launch enemies into the air.\u00a0\n\n[Note : Floppas are not available in the 1.18 or 1.16 versions]\n\n![Page Separator](https://cdn.modrinth.com/data/cached_images/632e59703cbabbd4208ff8269dede6fad09feb15.png)\n\n![Bingus and Floppa party](https://cdn.modrinth.com/data/cached_images/18ecb9722b71db1b6bcbb74e41591dae1a4a6394.jpeg)\n\nBinguses can be recalled back into their totems by right clicking them, and they will automatically recall themselves into totems\u00a0upon death. Bingus Totems stack up to 8, so you can bring a decent amount with you before it begins to clutter your inventory.\n\n![Page Separator](https://cdn.modrinth.com/data/cached_images/632e59703cbabbd4208ff8269dede6fad09feb15.png)\n\n![Smelting a Bingus totem into Bingus ears](https://cdn.modrinth.com/data/cached_images/56692ec78a450a4a9ab14c1bbc13446ae662fdc1.png)\n\nYou can cook a Bingus Totem to get Bingus Ears. Bingus Ears have the protection of a Diamond Helmet and worse durability than iron, since one diamond is used up to create them. You are also able to cook a Floppa Totem to get Floppa Ears.\u00a0\n\n![Bingus ears on an armor stand and someone wearing Bingus ears](https://cdn.modrinth.com/data/cached_images/1a8f9df880b23e9f8234193972af1a1dc16b422f.jpeg)\n\n![Page Separator](https://cdn.modrinth.com/data/cached_images/632e59703cbabbd4208ff8269dede6fad09feb15.png)\n\n![An absolutely stunning photo of Bingus, painted with sheer inspiration and love](https://cdn.modrinth.com/data/cached_images/e3feff94fc4ef6f92dcbcf800814c10bd4b7a1ed.jpeg)\n\nThis mod also adds beautiful paintings of both Bingus and Floppa. Place them in your base to support the cause!\n\n![Page Separator](https://cdn.modrinth.com/data/cached_images/632e59703cbabbd4208ff8269dede6fad09feb15.png)\n\n\n\n[\u00a0[My Youtube](https://www.youtube.com/channel/UCX6MdtafUXzR9C7WRCBD1kg) ] [\u00a0[My Twitter](https://twitter.com/gavinvanhussen) ]\u00a0\n\n10,000 Downloads and I add pop cat and the pop cat dimension \ud83d\ude31\n\n![Page Separator](https://cdn.modrinth.com/data/cached_images/632e59703cbabbd4208ff8269dede6fad09feb15.png)", + "body_url": null, + "published": "2024-05-15T16:36:12.372223Z", + "updated": "2024-05-15T17:44:15.484572Z", + "approved": "2024-05-19T19:35:45.318236Z", + "queued": "2024-05-15T17:51:34.707984Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 649, + "followers": 10, + "categories": [ + "equipment", + "mobs" + ], + "additional_categories": [ + "magic" + ], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "pKzSfTlZ", + "nJSNgcCB", + "l25WBhS8", + "4AX94uzh", + "pqGBY4x0", + "50PbwXLS" + ], + "icon_url": "https://cdn.modrinth.com/data/VdEsgz29/899e305df12dac79be36498b5667c1bafc264fd2.png", + "issues_url": null, + "source_url": null, + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/VdEsgz29/images/0b854fbd60bd2a31b3f6bf57c59c68f2c920481b.jpeg", + "featured": false, + "title": "Binguses from above", + "description": "Are you worthy in their eyes?", + "created": "2024-05-15T17:08:07.035367Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/VdEsgz29/images/0cf09c0296789c83621fdfedc94f752b363620f0.png", + "featured": false, + "title": "Beautiful portrait", + "description": "This is true art", + "created": "2024-05-15T17:05:12.090050Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/VdEsgz29/images/35217a37c9a52859626f5a902ba6cba2a4da2dd1.jpeg", + "featured": false, + "title": "Lone Floppa totem", + "description": "He rests peacefully, awaiting his crafters return...", + "created": "2024-05-15T17:07:09.607446Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/VdEsgz29/images/3f3131c034614500c0ed8280ba4d419570b9b365.jpeg", + "featured": false, + "title": "Floppa admires the light", + "description": "A beauty some take for granted", + "created": "2024-05-15T17:07:31.676381Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/VdEsgz29/images/4dde1c45e11ca77feb8541339e7eca3778d14a23.png", + "featured": false, + "title": "Bingus Orb (1.16.5-1.18.2)", + "description": "An ancient relic", + "created": "2024-05-15T17:05:27.062850Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/VdEsgz29/images/4f4f1415dcc1318e48c5fa7d58865eb91cadb5f2.png", + "featured": false, + "title": "Binguses underwater", + "description": "Bingus base", + "created": "2024-05-15T17:04:18.502052Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/VdEsgz29/images/55ce3f91d3b93704234ece30d3907351b932711e.jpeg", + "featured": true, + "title": "Cat swarm", + "description": "An army befitting royalty", + "created": "2024-05-15T17:08:41.433919Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/VdEsgz29/images/8ae1fcb15c587105cfdcc7892466a626e659fca8.jpeg", + "featured": false, + "title": "Treetop Floppa", + "description": "Floppas waiting for a target from the top of the jungle", + "created": "2024-05-15T17:09:51.151628Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/VdEsgz29/images/9361820b1ff6ddb3af3a7c9b999bdbbf45902b58.jpeg", + "featured": false, + "title": "Bingus", + "description": "The OG", + "created": "2024-05-15T17:10:04.462563Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/VdEsgz29/images/bd8dda9169f616090c8614a58863e227023aa44a.jpeg", + "featured": false, + "title": "Bingus and Floppa party", + "description": "Big cave full of funny cats", + "created": "2024-05-15T17:06:13.309832Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/VdEsgz29/images/c4ce31569116ac64f6b42a72bfa1c1d8fe635583.png", + "featured": false, + "title": "So many Binguses....", + "description": "An army befitting a king", + "created": "2024-05-15T17:03:36.532344Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/VdEsgz29/images/cfadf5ee7fc791db9c1274209ba3be28790aca5e.png", + "featured": false, + "title": "Binguses enjoy sundown", + "description": "Nice weather", + "created": "2024-05-15T17:05:44.035392Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/VdEsgz29/images/ea4d0386622529ef90891063c48e7cc761c8334d.png", + "featured": false, + "title": "Camp Bingus", + "description": "Exploring with Binguses", + "created": "2024-05-15T17:04:54.439685Z", + "ordering": 0 + } + ], + "color": 14978220, + "thread_id": "MsHFqWJQ", + "monetization_status": "monetized" + }, + "BiomesOPlenty-1.20.1-18.0.0.598": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.7.10", + "1.8", + "1.8.8", + "1.8.9", + "1.9", + "1.9.4", + "1.10", + "1.10.2", + "1.11", + "1.11.2", + "1.12", + "1.12.1", + "1.12.2", + "1.13.2", + "1.14.3", + "1.14.4", + "1.15.1", + "1.15.2", + "1.16.1", + "1.16.3", + "1.16.4", + "1.16.5", + "1.17.1", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.20.6", + "1.21" + ], + "id": "HXF82T3G", + "slug": "biomes-o-plenty", + "project_type": "mod", + "team": "ANPfCD0y", + "organization": null, + "title": "Biomes O' Plenty", + "description": "Adds 50+ unique biomes to enhance your world, with new trees, flowers, and more!", + "body": "
\n\n![Biomes O' Plenty Logo](https://i.imgur.com/HQ2opH6.png)\n\n[![Donate via Ko-fi](https://i.imgur.com/4OG1WQj.png)](https://ko-fi.com/forstride) [![Follow on X](https://i.imgur.com/WNmQOhb.png)](https://x.com/Forstride) [![Join our Discord](https://i.imgur.com/N7eZOt0.png)](https://discord.gg/GyyzU6T)\n\n
\n\n## Description\n\n#### Biomes O' Plenty is an expansive biome mod for Minecraft that adds a slew of new, unique biomes to the Overworld, Nether, and End! To go along with the new biomes, it adds new plants, flowers, trees, building blocks, and much more!\n\n## Info and Terms\n\n### Requires [![GlitchCore Icon](https://i.imgur.com/zC7XoOh.png)](https://modrinth.com/mod/glitchcore) [GlitchCore](https://modrinth.com/mod/glitchcore) for Minecraft 1.20.4 and above! Also requires [Fabric API](https://modrinth.com/mod/fabric-api) for Fabric version.\n### Requires [![TerraBlender Icon](https://i.imgur.com/y2BgV5H.png)](https://modrinth.com/mod/terrablender) [TerraBlender](https://modrinth.com/mod/terrablender) for Minecraft 1.18 and above! It is not required for 1.17 and below, but in those versions you must use the Biomes O' Plenty world type when creating a new world!\n\nTo use the mod on a server for 1.18 and above, no changes to server.properties are required. For 1.15/1.16/1.17, the **level-type** setting in server.properties must be set to ***biomesoplenty*** (level-type can be added manually if it does not appear by default). For 1.12.2 and below, **level-type** must be set to ***BIOMESOP***. You must use either a new world, or use an NBT editor to make the necessary changes to your existing world, otherwise our biomes will not generate.\n\n*You may include this mod in a Modrinth-hosted modpack as long as you do not rehost the mod and only use builds uploaded directly by us, you do not sell the modpack or additional access to the mod via any means, and you follow any and all terms listed in the license for the version of the mod you are using.*\n\n## Soundtrack\n\n[![BOP Volume 1 Album Art](https://i.imgur.com/FQv9u95.png)](https://ludocrypt.bandcamp.com/album/bop-volume-1)\n\n#### Created by [LudoCrypt](https://ludocrypt.bandcamp.com/)\n\n## More by Glitchfiend\n\n[![Serene Seasons Logo](https://i.imgur.com/l4lO6VR.png)](https://modrinth.com/mod/serene-seasons) [![Tough As Nails Logo](https://i.imgur.com/r0ZlRwr.png)](https://modrinth.com/mod/tough-as-nails)", + "body_url": null, + "published": "2023-11-19T06:25:48.199721Z", + "updated": "2024-08-09T23:35:51.737759Z", + "approved": "2023-11-19T19:41:58.508068Z", + "queued": null, + "status": "approved", + "requested_status": "private", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 1205267, + "followers": 656, + "categories": [ + "adventure", + "decoration", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "qQSedQAe", + "MHt23aM2", + "jZ9cNlNL", + "f4yPGaXG", + "MEzjA1uC", + "mrtlegZu", + "AumfBXeK", + "hrwCqRrD", + "DdNoeZ7y", + "LVdJZOWW", + "SCfPOXUR", + "ILnlILCX", + "2HIFjKcK", + "xy22xkkm", + "zfZkkqOI", + "gtkhPwYT", + "2NdYOQFY", + "BFIq70qx", + "UW6k7hkr", + "1pjg8BQ6", + "Ve3a5aT5", + "N8kqvuVx", + "RCAVwIqC", + "qNUF45Iu", + "4wmQqBi2", + "L9JNWmVx", + "jGnxj2nh", + "wH4GYDph", + "zqnbwUqI", + "RPWM0uxE", + "VAMowgpu", + "OD0Wbw3I", + "1JwOd9Pd", + "CR4OH4Y9", + "3oR9Jxyi", + "tMbdXF7e", + "ubfOORLz", + "cXS6V6Q7", + "f60DKO8Z", + "jpNnx0lh", + "sETRVFEh", + "7mgFgE22", + "WkbvsBLz", + "aAesLKrN", + "O9s7NUJ3", + "agUp8ByE", + "l3mMk6t6", + "k7eoV7Kx", + "Cjq4ELMv", + "DTKqzXtI", + "HvP3wur7", + "4VEo0ZgL", + "UyGDwSm6", + "lewJ80k5", + "Hu7tyirA", + "9VVXKCBH", + "3SCEohjl", + "UnecYAg4", + "uPoXqKcI", + "U5dYhce9", + "NhlDhMLy", + "OP9qO9gK", + "2pmhbk70", + "XN50cIju", + "TrphhMTz", + "6PGpue1d", + "5D8bZ2p7", + "cvoXlLwE", + "KHX56dxo", + "ZMklaUR1", + "EwQMcu08", + "GnEEY5Vc", + "7qFT0sPn", + "fvo63Bax", + "VkD81RYO", + "GW6LtSDW", + "eY7dZpZe", + "sT4YxHV6", + "u7VHKOvl", + "GLAFnTYk", + "UGr7BSte", + "Po1gcTVF", + "AliUS6i3", + "tRCERIJk", + "5r5jhbpT", + "lsZHYVN7", + "oPo1E152", + "BpcLLSyH", + "4o5MrQJi", + "OezR7cLe", + "T50izbRd", + "KjRZwPFI", + "wgDtbXF7", + "7kWD1t3y", + "eOCoYYYO", + "L7xAU2Ge", + "ejSHH63s", + "OoeBfIu8", + "y04XQs0x", + "yaKzVmsT", + "84JOUHjk", + "WHXYCEh2", + "ogHtnQ4I", + "eEOOK1Ib", + "QX3YEqX6", + "aBFANagC", + "2akbAI9U", + "cYAOZMrF", + "eEaRirsE", + "KSyt5Tzu", + "UlC378bL", + "n6Q4yU0w", + "oZhhtzjH", + "bi3QZFMn", + "vuaG1PEn", + "thWDdHoQ", + "e5ZPXiEa", + "ZgOIfoB7", + "tmiFnQzD", + "AUFba680", + "VOwff6n8", + "53LTA0mf", + "shWYzN66", + "ayQHQnH7", + "7n6FqD3O", + "T2ThJO3U", + "urfVMd8W", + "I7x0XXxT", + "S8rYUCl8", + "iPp53Kh5", + "g5K8mcd9", + "69qWfuuf", + "s1fIZmY5", + "ELhU2o6l", + "m2FTxHSQ", + "aZKJthRX", + "cCkhBbrp", + "2EwwR7NW", + "t44v65Xb", + "PTD5LjUO", + "UxOil1cv", + "4VV8AmaA", + "6DZv7UFD", + "Xhyqtar5", + "I4cEV266", + "Y4WQt4Wz", + "sDyUqNpS", + "ZBk0SRxC", + "wAVnIsqm", + "4ihfkyRB", + "oDjesWhU", + "IzsL6XTR", + "g1rqxOyL", + "KFTeesad", + "yqi3Nk0z", + "jtilrRR9", + "uxNXnXDg", + "J1Nls159", + "5Uhz8uQX", + "SOWQnmkW", + "XruRZkHB", + "D3mSIKjR", + "6neHNumi", + "oyW0pvzx", + "ckGlhUX1", + "7Zz04iQW", + "Fnai9jQd", + "cF5xB67S", + "3gJywNF5", + "U88oXYgG", + "2yZ5X7wl", + "9Q4ENGnl", + "rTJgzire", + "ypxeGRhk", + "3UuLKR13", + "PKKGlpw4", + "Pbz5NdLk", + "HOb3WK4X", + "RoLFFHXJ", + "HZKak5xC", + "c82WECCK", + "f3Znixvz", + "CXEPTxk5", + "HIvHGPr4", + "G4kLXSUL", + "RuqpJJT6", + "hA5jNYfd", + "lGXmohqB", + "neRmdcgZ", + "OG79WrpY", + "91tB3Hqv", + "lzF76JPG", + "RmS8VQBw", + "CD8cszjM", + "TrzczCfR", + "AT9P40WY", + "3lElpCk5", + "rjTukIRC", + "CuFwxPOV", + "SH9i4use", + "AqlxegDK", + "VGnbfE97", + "BZBLhkWx", + "DjqQ2qIi", + "ZyTuwS0v", + "33QlrL4s", + "Qbk2baa3", + "eLThqDj6", + "C07pssmV", + "kqpTUseN", + "MZigyLFg", + "Mg6pcCKL", + "xsvm7ZPk", + "JkeEjmtq", + "2bWUzU9K", + "i7YclqVU", + "ZjSrCxYG", + "ywmrnaY6", + "yMaL3fAv", + "c8aVFFzB", + "li3DKVfM", + "GWthHPXp", + "9MhM9beI", + "IHjdeGtF", + "Tt6C4Fwb", + "Pk1hBsHz", + "DRPWMLfm", + "ep1qfgi2", + "ZVG4Nju2", + "ZQW5AF0W", + "k02IIWAG", + "3uhhlHdL", + "LUIDstaJ", + "fZVVmIGD", + "1Ld69UNT", + "IWM4HXCz", + "7u97c8kK", + "xNAQoytk", + "I086jgzE", + "Z8Ie3Zh5", + "npMp1xmu", + "VPUqXkiu", + "bQhqyqOs", + "vYM8uRQa", + "k8VXIWSD", + "gvzVLP5Z", + "Oo9HAymC", + "ZU3XOVZt", + "U7StQWdb", + "3kRozjdj", + "UkXbAqgG", + "h3uyp3I4", + "Qel9XJuU", + "lTsL0gjw", + "TMMtK8UM", + "UtrIvdqD", + "oinpmUF7", + "SwrGvcNV", + "4EhAV2na", + "NdLtpYH0", + "eM6bOfSI", + "sh6c2bhq", + "gPjfFRv7", + "w2wg9Otw", + "bQk7Mz5z", + "TaYRDvjm", + "AnqOo0IH", + "ebDwrPva", + "6IknQwyY", + "lPbhctqz", + "FwYce7lw", + "poohP71j", + "YX7wjhMg", + "F3fD6PF9", + "rfXnQ14G", + "QMe4uopf", + "cDe69hug", + "m2DBap7g", + "K8g2ENjx", + "pJ3JeU1r", + "Erv9lGKl", + "23IQwkbv", + "nkTnkhm8", + "n1J7v9qW", + "FnF7HH4L", + "QEFaoAWI", + "2PuGC5ag", + "MQJVGxRq", + "t1QpefUy", + "FqMEDzNB", + "chgVABfk", + "j3MhVZcH", + "pWNIggXb", + "sreJIRWz", + "Nm5h5CZW", + "OWblpkad", + "IFyhnpV0", + "dj3OoQyV", + "ZRDnrGJ2", + "wnir5SfX", + "i0HAW3wc", + "M0vFpRDD", + "YygTiohs", + "1u7SlNjm", + "SqGfFnf1", + "gfIE19b6", + "QhdgkRJi", + "IEvlNRth", + "BLGEpRPK", + "UGAgmzNm", + "r8veAFPB", + "Otkekd12", + "7h2BoJXi", + "D3voo8MP", + "ZenoAs4j", + "v098CQhk", + "cKZxVsvi", + "YT6RKJmi", + "kaNcew08", + "i7gQB3bR", + "2jYb6A4t", + "Kw7ccQfo", + "k34cuuib", + "DvMPFUIq", + "irWyTmoT", + "8YbSEEyf", + "anuAwxW8", + "BugixGP6", + "NImOx3n5", + "yBKETGdV", + "Aovj79Zk", + "TTiVUNOK", + "mVP3Arwu", + "kViEvJH6", + "gJIVU2m5", + "HUV8qzYe", + "sC0u0Rzs", + "WyHlGAQq", + "aPDn6oWj", + "hgslia3q", + "nT0jk22k", + "KPP0nB4p", + "d4QmtsvG", + "U3GrBXjk", + "T6hPnobU", + "zKZEv8m5", + "xUzYoaq3", + "724fvuTK", + "eASb15UT", + "S5l9lMW2", + "4sCsWabY", + "YEBYf4ul", + "qFYcw7EB", + "RLkqpHM2", + "VdbGBDYd", + "63CHdyG8", + "rhLLWMl8", + "Z8mz0c9t", + "ZBJsSABA", + "sDdD8TXw", + "SsG7vbCl", + "2e6iAGSg", + "AtAIIPU8", + "kUWhAt4U", + "nK5x0oZO", + "yP43ka3W", + "hkU2FKVZ", + "SLKgvWEA", + "4ysYBKak", + "XdsmV0so", + "7DOS1pfr", + "NTdu9ro6", + "HNeHGwDj", + "J4yWeZu0", + "YPMveoKv", + "XbF3F11s", + "meLoSpYo", + "Gi9DpjYA", + "zHUjzhN4", + "eOa6Hy05", + "fOOasz4C", + "zlf6TFyd", + "zIfpuvUy", + "K7ykNKeH", + "jHov2sjD", + "gyFTaFjR", + "7vX1n6nB", + "cjusO63e", + "lrBfF4aA", + "ox4xgcyI", + "Efh7TaAV", + "1w5kPI8d", + "MwxAsRhb", + "SJKwDWrO", + "5fcuJM1d", + "BKKZ23z5", + "TkXQMAVx", + "dToZbriB", + "Jx3dcXEo", + "afVPOP9K", + "VqVIBffH", + "fSGoK1Be", + "J5I27aby", + "TLF25SGz", + "WE8L1lm6", + "8ZmwFfM1", + "ymCKR4f4", + "SaTd4SiA", + "zlLrToK2", + "NgBuIXgo", + "NZSBIo6R", + "MlE9nwAJ", + "OWIbRqGB", + "BmeF8W8q", + "al2YU9Un", + "phgkohjT", + "kxeOtQXz", + "Svyz7pGl", + "lBcCohFI", + "MO6RxUMT", + "xw0Bvnut", + "72Fsi6No", + "CWJPs28w", + "Y1IqFY0q", + "HU7ktNiR", + "xXYe3uqF", + "mYfWTny1", + "FmdVxtwj", + "TmhPEC4O", + "DPIN0en1", + "b3TwAXQF", + "NjUoobr7", + "Fo7b06UG", + "iu4f5bom", + "9SS42lhI", + "9CZOMtXr", + "yMfsSR9H", + "DTkfn9tb", + "I5RB7ztP", + "x0sirqls", + "Ad9Db2xU", + "Yl0x0W9Y", + "g6BN7zl4", + "iCDqRtVg", + "MJAmx7kR", + "a3CRPSYA", + "nhU9qjGm", + "EXVZuLSb", + "UKI5IRCS", + "bFHCvo2T", + "U1qNyQaS", + "gTrcqR3N", + "PS8TqVr1", + "AyAhOFM5", + "MiVfO6Fv", + "P0aPMOJe", + "d3TF1dM3", + "Z7NzByu6", + "uY1UZl9Y", + "A3NNmagx", + "jyC4vgrb", + "2Xhc3OTl", + "LLRFxooW", + "Nu4aDEKx", + "VdOvc0q7", + "R8GBFpTO", + "nnTjSQwY", + "8O1E6Vwu", + "G8cszARc", + "8mm3Qg26", + "6HqQSi5I", + "qQ53WZoe", + "65Z3virC", + "QCY7k9X5", + "cmmdRhC1", + "CRf0UyaO", + "eNQAxNtX", + "Soxm9dS6", + "SU8jR2mH", + "63RtOiBQ", + "3KrpPMVz", + "AbM8MV0p", + "TzXp31fX", + "kQfd6RLI", + "YcMAtlqd", + "znADzDrI", + "6JMneomj", + "IuPVdrkg", + "zvvlzCrO", + "cSkQ21v1", + "vEBNy2H8", + "Dq3NbUVo", + "w3jwDWJ7", + "mPykKww3", + "JDux5s9E", + "j2s7oXVs", + "BTeuGzLu", + "nVwJHfaN", + "HWln5H49", + "18YqHYQp", + "OwgrKW2v", + "3okBGLok", + "U5KMJmI2", + "SPEqMrfQ", + "VbvxWJ3u", + "ZLHyfLmD", + "ZclO4mzh", + "C6lhz01d", + "M5lOxtEB", + "ldauE6cf", + "X0oezYET", + "VQMgmTVp", + "Mw3mrwVY", + "MoFvIBfU", + "RqlAVu3p", + "Sh1RGX4U", + "d5onqcoW", + "SgsNMyEu", + "Sx8xXujO", + "TY64fdTt", + "atqOhhZz", + "oanLPlrG", + "rlzog9C0", + "Ob65lEAO", + "3N7lJVX0", + "EGV44B8r", + "Pq4LoQc2", + "hhViIrFC", + "V4PEHE08", + "HPsCXDJ0", + "I7iglDaG", + "cocMcEbp", + "LqkqmroD", + "Pu1gaFpt", + "XeAi1eT0", + "qTsGYQod", + "TUFhbIxh", + "8gAcjG31", + "mudSHunJ", + "uL88uolb", + "O76TABAP", + "mUn4TUko", + "jPRftE8v", + "9S2oFTgP", + "y8gVyGBB", + "34Cke1mF", + "EHFZWM5H", + "v3GnOyW4", + "R89cUMn0", + "Ga63Phbs", + "DkvwFfrt", + "dEkDc40h", + "jf4e8Tua", + "oAfHRDHv", + "njXK95j6", + "ygEsw848", + "jd9Tegfl", + "ivWtmXUX", + "pnikPGmx", + "smRK1ADe", + "Oojsmv45", + "wKvXF3oA", + "ACpYxTtL", + "vTHJCkmd", + "IRMNVCUV", + "LB3cGirL", + "if5rWltp", + "R2dResY1", + "moZgHKsL", + "HZ2RHUWR", + "G8WdE1yF", + "Fe6xQqYr", + "uQmiVZ4h", + "6kQpAxKS", + "QMk5YHqk", + "trJOvdCI", + "84YdXU6b", + "cMRXCnRX", + "Vtw3j2Nq", + "JB0OrjOy", + "sLthNZPR", + "h6DYeP4M", + "DN5Jwvut", + "LnFHKLQo", + "cOcd6ief", + "wAgMUTDt", + "oS8pYUVD", + "PSDnbWXV", + "JDqW3chx", + "nSFOFnAJ", + "xY291G8c", + "ZkeNSdRv", + "8FNTdvn6", + "OBUCVNOR", + "jZa4Tw5E", + "d7Vs6Vg2", + "ztLGpgQ4", + "sbfw3ncN", + "z5GYf8If", + "5153yyCs", + "vnALFl4R", + "ANX9EuC9", + "D6RX3wok", + "mI3oI6Mg", + "c5p5E5ro", + "vueSqIUc", + "tZokPiWW", + "YoWpRk0h", + "arCaV2sp", + "HW6x860m", + "C7GyK9Rd", + "5Qm0Orzd", + "QfcR0AX4", + "ZJ95y8iK", + "tCnVXf1f", + "yT2d6k6j", + "Iy5c5F5e", + "stchU4IO", + "juSWBQtI", + "OkKMuLyV", + "IMoLwVsR", + "72TI8dxQ", + "eMaqcEQ5", + "6WODeizx", + "BOL8d08L", + "2TUPAROf", + "aNwyLT6R", + "L5Qqxm0X", + "rYi00x87", + "gFfg0IDg", + "NnA4jIYh", + "r3oBvRbI", + "uqwHHeMF", + "kcvAHJ4W", + "Qy3OvVy7", + "je80Id67", + "B97kh7lR", + "kgXIzkPV", + "GmPJ3Gs8", + "4YYzkW6f", + "g5J4Hz5y", + "J0q9v88f", + "WBx23VS1", + "QguyqzCn", + "HNcXVBNO", + "TkbZGbTR", + "aYI3ycw3", + "oOIhvN4o", + "prxfE7EA", + "L3jCPaKw", + "d6JBR1hj", + "BGlOeZhv", + "lRKGKzsi", + "WoCfZvI6", + "pvbWFhgy", + "LqRqbvHg", + "YcdK9YBQ", + "XHMlw9xw", + "VVoI9nC7", + "49vbbXnR", + "6mkPdLzk", + "QYbW5qLR", + "EWwhfGZy", + "3CCzPNGf", + "3Wt8vMh8", + "AuP4p31Q", + "QubAFZie", + "e9SrhcBa", + "EDuh3QL6", + "H05VYzPz", + "tTAouO6M", + "NbNt29n0", + "Q4gjANHK", + "3f2otu8t", + "qkhFu299", + "PxIECJXl", + "KJZm0WFA", + "SFIiuVnF", + "n5UXGxUP", + "Cc0JwJqc", + "664HbGfx", + "syKtXlM3", + "XM9mvoIM", + "yuhbOYDQ", + "1010qVI0", + "4608DNUh", + "kM2N14j5", + "upKW8qP1", + "ex2ocvCU", + "8AgU1EU6", + "t4v74jW0", + "2mIqGV1B", + "SFDR6RvU", + "yF7DSGaO", + "Uk6zeYSP", + "iMH59vbQ", + "c52b0kjt", + "CDUfzxfe", + "UJ81cWyI", + "TANJeKc3", + "zGTlhxtt", + "AMbTbDkR", + "oh7lplom", + "liIr6gdE", + "b9D8NYbW", + "dfZy06p0", + "HX6qzT6y", + "oGrK8qPF", + "SsoXW3J1", + "KSMfnf7b", + "5oD78tX6", + "SUGbgICj", + "q5xODrft", + "eiYtmIUu", + "E7Bp1eAd", + "PXeSjVot", + "97f362ET", + "5aTGY0Ai", + "gkmULtkj", + "E2dotKv6", + "lSDzBVwE", + "CTqMBfMb", + "uTb8qKm0", + "ACGRbxo3", + "R3RismAH", + "CstqM0eq", + "amwjcQWM", + "driXcN1l", + "oCFYu0N8", + "fRmdcPuM", + "1oIwRAp2", + "IHem3aaT", + "wedJz8vM", + "SpDjI6ki", + "ozyiELJh", + "SvbG7fpS", + "cy18FyBz", + "PWQ79aNo", + "5bXiDvxQ", + "Nb0H4WsH", + "KZR1Mmkd", + "Ut1vMLmD", + "V896YjeG", + "ZRCTGABz", + "gN0Xlzq5", + "NURjZiWR", + "I5F7a5Aa", + "sH2XfosD", + "i5ol4Ek8", + "DSEkT4O6", + "U7bPak0Z", + "MZDUxfq1", + "ta9PuUM4", + "eX6TVSny", + "pgZwlJNZ", + "axFtU6Vr", + "6GUDQi7m", + "ED7ukniU", + "gW6DAKzt", + "AqPXDhJp", + "cHqd0PUg", + "gqVbAkqx", + "Q7sQiax5", + "WkaF2A09", + "UmjXwFnl", + "UDT0lqHq", + "23MmEuGT", + "BDuSJd4V", + "Nry7v61f", + "a7PGwNFh", + "x3BHqHQZ", + "rawlE1em", + "6JG9w8gG", + "i6TDSoTv", + "z4zQMPAI", + "v3LVeEmK", + "YZwvgfdC", + "u1AJzmNG", + "zZ0u3rTA", + "XNW2CWwy", + "xlPK7RLN", + "1i6ddNuU", + "x9eXDVrz", + "3ZbhprZf", + "N1U4Acjt", + "4P7sEiiC", + "ktFhtpjk", + "9oRMhNz9", + "Rq80BQKG", + "wpDPymzw", + "R4m3Xr8f", + "zL4VLLm7", + "1srGWEgq", + "UMsZBqfc", + "zkgzvaMP", + "9jVgOuhe", + "upXDyRz1", + "iXsDgdHI", + "1kzfKJ37", + "ZvYvmekD", + "7EykIAqi", + "5W6OujIR", + "7pl2UiK0", + "eztLWT2x", + "O0cCZG2q", + "oDgG6oMk", + "KKV3CRR7", + "j48dgUur", + "RFUJI8ER", + "NimlZMNj", + "pFt2ZYDI", + "i3nLNHTX", + "6goPAdWu", + "p80smLbo", + "8TTCTCoO", + "trYnczgv", + "b9skrDoG", + "nZo71aW7", + "QRNBb9TD", + "VzAHYFDD", + "Vg11uV6V", + "xWCLKG97", + "1G1bUHyS", + "uyeAvMxY", + "Q5zSpjOQ", + "putfsRdj", + "trXtHfgY", + "h34x5qc9", + "hIjfCckm", + "uVakhZ0A", + "tO0ClnYs", + "jtmtlgWg", + "m5DdSppw", + "cW9B344w", + "ms3yI5s4", + "OH63tZSZ", + "VcgDlCKe", + "ya75bcId", + "6p7WUAwq", + "Dv4kuvtO", + "rPw9HAhM", + "L5qYwHNs", + "98pS73ga", + "rSgVBDmj", + "VDgjpVNS", + "mVICWPJh", + "fEsvY654", + "QK7BXT83", + "OzBAcjsc", + "tfLO9ZHe", + "C9R2HIMy", + "alvQbYb3", + "81dplrzP", + "ENqVOepQ", + "omtecojR", + "EROUxzLH", + "ARHbKSEJ", + "FwcmDR5G", + "5jn1VlVn", + "621eWZLD", + "vlbk7w48", + "IzEsL6cY", + "Bos41emo", + "Ug0GMftq", + "aMnKqANK", + "So0ydzEh", + "d7NHya0L", + "rrIFSKA9", + "j2e8j5ER", + "bpjvrtqy", + "1uueHVtM", + "3jPwDNxo", + "MFz56oO2", + "i7nua4hN", + "yiW6coXv", + "gYrqOpsV", + "rA45msN6", + "5P98pZF5", + "EMVOZJNw", + "gO9z8lvd", + "kyPKefRE", + "sFSjKe5g", + "OdKCH0gs", + "tLtc55Ik", + "Oj6CEmnC", + "w3oVCDEL", + "1bUzhK72", + "UsSuFKRA", + "FLPLXfog", + "hp8dC7qZ", + "1ZrqbPVF", + "zUVhyJ6B", + "g69haQux", + "eAc0Q3EO", + "ANFESG2m", + "1Mf9c2Zz", + "FehhZXb3", + "WMN825yK", + "F2oBBjn5", + "ImVoGyTL", + "4UJ6mONE", + "BUfPDjfU", + "btDrgE1a", + "feGjTjlf", + "SqY4tN8m", + "lvX48Ll3", + "UHBcg0Xg", + "uUVld7Ix", + "mHSVgELr", + "GYcFA8dg", + "OkumJmwQ", + "8N6tk2E2", + "CBDbC6qj", + "FQhWJX60", + "GWERvqL8", + "zpA3X03Q", + "992NeLHs", + "jFUZlXdH", + "byOkoOWx", + "ow1lsiHC", + "QK27jhtI", + "pXfbY1vH", + "b8DmBJUK", + "zWvr519j", + "40leXg1T", + "umQClWzL", + "CyCIeS4o", + "yRsvZp3J", + "BfOUIHMI", + "Y4tvj5Pw", + "J4HQLJGR", + "d9xTWuVo", + "MHVvCsKd", + "lVcksCCh", + "jjs0JzW5", + "mUTJ8WnQ", + "QyY8qTZz", + "jUeWuGjN", + "hIX3h5bX", + "jZ7EiMh2", + "y9s7zzFk", + "t7BTehXZ", + "V22rWT4D", + "bKfy9x1l", + "CREFDf4i", + "nrhf2u25", + "gQI3HXwF", + "3BenOJTF", + "99J6OOEv", + "d6Uk0kay", + "C3bJuxpz", + "bmi4GnB9", + "4F4Sigsz", + "XaMuTHMW", + "5bdsqaaO", + "FqAxI9bi", + "8Ley6cP2", + "On6XmpG8", + "gRcOU25T", + "mqKroZkc", + "WDpIfcOU", + "lJKLgCWC", + "HiUEwBLs", + "G3DXQ6l8", + "yCYorjoL", + "b1YZNPcN", + "17KeT4qd", + "rqb8djje", + "IG4abfrn", + "QbR1mw7G", + "xZErSsoZ", + "6QskAfrh", + "yBvZeZiK", + "R2b1KkUW", + "iAjrqwmc", + "o5xLUtik", + "UJHdYApe", + "vWpzJpxI", + "tevVUUJH", + "Vuq2S9cd", + "5iYuuGXM", + "2vTacX13", + "6qaMd1hl", + "Gogac5zG", + "wXLONVCZ", + "BSTGopFR", + "ei0Fj3Ly", + "rDy9y0WV", + "5qeSoVlQ", + "clMTCLjJ", + "FtoQUI1R", + "i5sNlAo1", + "q2mMVjhL", + "GTk81ojd", + "l2eEpCAO", + "ppi9JWHo", + "cOhhs61O", + "DSjKOrqT", + "jQ9Vvl5h", + "QWIBq6En", + "aZvKyduo", + "sYf59yqr", + "uf6leQj6", + "efzGclzF", + "eZkq0joG", + "wzhxlfi0", + "preFk7H3", + "Q4I8oGkr", + "1cHBKOqf", + "FhFMcL2W", + "qFRMuaWW", + "ntyL5yAg", + "E88lATA2", + "MyUI2fJr", + "pJwklFmJ", + "QE23mDCh", + "MeHdqSwm", + "pEOKwOF9", + "AQ6SsIfq", + "c3I06Ag6", + "jDfooVV8", + "9te3QIgt", + "j5wmFpuB", + "3mIWWOnq", + "6aC9FeUN", + "M4SrUfdd", + "ikHFMyzz", + "9soO0W8i", + "SlFjcIZb", + "BbN912XT", + "t8G6BqRf", + "cOSOwEVd", + "tVnQA4HG", + "XZyN6BM5", + "3R1fFVF9", + "xgIbGOak", + "O80gZogL", + "MvZqiFEw", + "pNVb33nH", + "8jkNd6W6", + "iwJR91pw", + "awWr1dxE", + "VarnNsk9", + "DtNAz8nI", + "abs7N9Sh", + "Mq88rfl3", + "CkLcSbYt", + "Va8kz42d", + "1A07jZve", + "e5wgKLKS", + "pQdjbQ4V", + "LxLf7shd", + "r60mg17v", + "rRtPYYNx", + "kV9NX9cB", + "jxrE1YbB", + "mJ22EmYT", + "HT2Z0FpN", + "UFJLKGcs", + "T7cHXb18", + "av4Xumhn", + "dFoZZclV", + "8fn9Ku3J", + "pvfVh4W5", + "SUWs7oi3", + "dksftv8C", + "hP5pr9hj", + "cNXUikol", + "UDteBhGf", + "g7TigkBC", + "aMMTVGhF", + "vuZV6akl", + "Mp5s6D2I", + "XrU4OCep", + "NAoVrWfk", + "CNdBaLyE", + "lSQclq0n", + "kL81nluZ", + "ekcYNevs", + "bZ0Bwfdb", + "VPvYXuvL", + "TnaiE8We", + "277j8GtC", + "gaAgufnV", + "7ENHDK8N", + "E4TeEeAA", + "fTotkxuJ", + "MZ6Z3jk1", + "2D4sNZIY", + "TGNabq0B", + "PBXn0Vmc", + "CETHzpHB", + "LJv2ACBS", + "q4g7s3wY", + "SI0BRMLV", + "3zQo42pr", + "IxYJX8iC", + "IElUJoxx", + "pbJ94Xvv", + "rJ8nLNiB", + "EFnU2eya", + "Qn8InKkV", + "ypAXc3ko", + "7jCtvTgB", + "Mfk6RiMH", + "n20TQPnK", + "SDElFOTn", + "1U58AUCE", + "d62VaUoG", + "VUuz9lXl", + "NBSltkBO", + "dGikKSjM", + "45wd2iUK", + "jaDTlNNc", + "SWI9X262", + "cgHWs636", + "743G1PQV", + "VeLkXLGz", + "6EWGjY6s", + "Hx2NyPOu", + "wgt463Ff", + "bN8QrncG", + "rPn6qGL9", + "BT61RMuK", + "21JFTZ17", + "p64ebT3b", + "jpKtVJkj", + "RtkuD7zH", + "bTCyiAA7", + "q5LaO71w", + "M46e4hMq", + "M1XdVYKH", + "vJv82cPR", + "pyfVVZ7y", + "eONVzcAh", + "C4ZuSnSw", + "IfM9A96J", + "vv7zK3mt", + "GcCt6jr6", + "ewNjvNEr", + "9lXhnsLE", + "cxLkYjdP", + "RcQGGCZT", + "9k9hPlDv", + "cUN47UBt", + "ByyqWv6o", + "M59CoFEI", + "pC9x2jP1", + "7wA16jvV", + "i5SREwWD", + "cAIGqcCp", + "YEwqoK93", + "PN2UPU3V", + "epj9mckc", + "Drg2TpmW", + "J8DhXPdN", + "T0achJ6F", + "OiQbj5oD", + "SbZfHtl2", + "hS2PCaeF", + "6LdmhlXB", + "SHVGplNQ", + "v5mUz0K0", + "8dJrALC4", + "QcPmDzHW", + "2bz4Hpnk", + "A6DIhLdy", + "pNrMlntg", + "PKYcyQFM", + "P0sivg8r", + "ZHujZmXA", + "sYOTOVKT", + "slcuUGNF", + "4FsnWAtM", + "bi5Z0evv", + "lhOcIGvz", + "du6hg0NK", + "4gfqDhdg", + "rP2gXCVN", + "WkYUtBcs", + "rp6qDnef", + "IVG4VRsq", + "cInByxyo", + "ZU73Pl2u", + "b6Zulp5y", + "aqdJYCNM", + "kKHJEX16", + "FrKQ6Uia", + "o9ZyRcFQ", + "fVvhQl1u", + "PprVF1OF", + "LkqGWSga", + "nOdGjXuQ", + "b20twxpd", + "LW9Sm9U5", + "SzFrbSNY", + "Ydi1Oicm", + "QklxOiFz", + "m1Bi4Bn1", + "4od17EzG", + "bk3g1Siz", + "ZlSeS3q2", + "N3HGoPIM", + "Nz1L7TyN", + "OXeb1L2u", + "HPotvYG5", + "NY0bYLsD", + "Fx26n94d", + "CoICCc3b", + "MXipzVx6", + "9OVsfSdZ", + "FRepWJy3", + "e0KR2pvI", + "9GZ6Shnh", + "aJofQjxd", + "T4btdZOv", + "1Ir4YSLQ", + "JwbVFpB9", + "9HfQhwHP", + "4Jt7tiUc", + "sfDGdIek", + "LjUVvFlk", + "Md2LMaGS", + "Uk3Ol715", + "trUSWwgj", + "UlgbjHv7", + "jmlgc7I8", + "ORcM9mLE", + "YKxdUwGI", + "ZQQvqE3B", + "ABxCYNe4", + "6O0g9FZR", + "5UaUBAmy", + "wpiEbJ3b", + "yiqyjqg6", + "7hGyHcUh", + "5Y7DQA7s", + "IwLDpGxR", + "vEKGqlv1", + "MV9d0Acm", + "c5Jjz8j7", + "czx552Bu", + "8waEzlzG", + "WKWGiNZU", + "On1qSBQg", + "GJX3bCbO", + "NO60qM2i", + "TyI3dnbw", + "BWr7sqzO", + "ZAAxu7Z1", + "SUHQfXGP", + "Z5H83UAx", + "zAvWfIlG", + "m3YuEuwh", + "HEKwZwsB", + "BzX7Mt5s", + "G8eLtr8o", + "CW77XaK3", + "peO5lWzX", + "ZXvqmLlR", + "nOgeIx1R", + "n1ztDJCb", + "ML1hDpuT", + "9APlM6R7", + "7xpevsUA", + "cUDrNAd8", + "akgxMMC6", + "wlf6Jd8K", + "Fvw6Vpj2", + "qnlj1Yhc", + "HBt2l7xa", + "oBF6lepX", + "qjNTlOG8", + "Lzo6WLaY", + "sTdaVjmU", + "a2ASiYS7", + "5pAMBNBS", + "AOMaA3sI", + "st6Shx2T", + "D33FUF0s", + "PEVVg5TJ", + "Z4FZeGUH", + "uZjmCf6g", + "a0SJGHxK", + "hWHJgRaQ", + "JfWmaMIP", + "kApvGfvZ", + "E9xI8xBp", + "NMl9htDe", + "mrgCXQHL", + "eAT0ib6T", + "sfl12mfR", + "uaMCyP8M", + "W1raNR4k", + "hBemQiZU", + "ReFzGzHa", + "6NP1mXAo", + "AOStnPbe", + "rTxpfmOQ", + "awy7lK8A", + "ExPOiAcC", + "kjmmfI1C", + "mJsuxZXp", + "GmyNc6uq", + "mAT8oo5F", + "Nvpy9hrF", + "9fzKeOQF", + "MH5XPLbr", + "dKwJJwJa", + "GE6nK9r4", + "vyed7aaU", + "YICTNd44", + "lGOiZvOb", + "Kszc6dg0", + "QdPWPb66", + "9hKqkFE9", + "q9uUTCoF", + "6L3iH6gh", + "pREzODMi", + "VIwdKKXg", + "KGzakHLC", + "xou9Os5c", + "wmQUHKG5", + "sPRPNAxY", + "aU3VRJ8B", + "9pVK9Oze", + "ffe7hoQz", + "7s8bIPEH", + "vvGvRiOk", + "MBYNO3sQ", + "2dlMmXCB", + "SPiyf6O8", + "Uk5ddC2c", + "aaXLiCN6", + "tGCRY7Uz", + "bts8p1sm", + "B1DMmaGx", + "QDfh2yEK", + "6HU2M5U1", + "x2PZq2rH", + "hcrFULLf", + "SR8cXLVX", + "Jta7y9kc", + "IA772c0m", + "oBc8hafz", + "u7JRShjB", + "T8yWCh2z", + "IV9IDyJz", + "AkZmAq6V", + "5BdzsuR4", + "qXkoGQWw", + "5n4G3GCQ", + "vDNXLHZs", + "FB043tZo", + "gRt9tUZM", + "WS8PWlTo", + "ZyBDbgEQ", + "mMxaAPfK", + "rfOWrEF0", + "N5z0RO5N", + "ERc8ZE60", + "J87gPmIB", + "sB7RmyUF", + "6u7aiY6B", + "IsOT78hj", + "wcImk1Jq", + "PkJVknBF", + "xjEI7CWR", + "9ZlghpHC", + "zb7gzRIm", + "KI9bswmJ", + "FKhI2qL6", + "wsDxfxsl", + "fYwnq7PW", + "lpuRfyQo", + "wfXlwpLQ", + "TijX58uq", + "wjyCkdmb", + "jFRB4A1u", + "iQelaXBx", + "16UCTgEd", + "AJMlqNAX", + "Tz5ZzOGR", + "2dEpM0cX", + "kJ8pxe9T", + "aOim8GuD", + "qoJriNQM", + "kx7Cj5hi", + "Ns4jcv6f", + "5Qipc1vO", + "J7jWSQby", + "VLinfFeN", + "ThBLmigg", + "5QnxArOl", + "9iFLf0xE", + "PQNnisBx", + "uBWnT5Qg", + "BN5VbqYi", + "S2iZuVWO", + "uHT6Dre7", + "7Wu9iJ16", + "oPDE4cIV", + "OCb3jtzf", + "4aYhA0gY", + "eXQh8i4o", + "J0DKoJDN", + "ZSDJN53V", + "B2Y5y3AD", + "ioW10VfG", + "xUz0Zm84", + "jsv8eSST", + "tWPXU4Ic", + "ZwEpfeLD", + "blPvmitI", + "btvHr5DC", + "LHzfefJg", + "9LjzhzNu", + "HL1DrLeZ", + "Yb4GhcZZ", + "h6kss5ph", + "fZloZ5yV", + "fL8ufyzH", + "vWUkoFje", + "SdG3wNpI", + "GZiW7PA7", + "RnnjvNoQ", + "8DkEAGVK", + "FyWIWpLA", + "ADs8CKX3", + "VL59xf6a", + "hG2V0XsZ", + "9Vi5CNH7", + "PVLfz5lS", + "e9GCGYCh", + "uoQrh3m3", + "o9J6JC69", + "P8sr6hR0", + "rJ5Vt2ks", + "KVIVGgxf", + "bNhigB9M", + "MgBddjM8", + "5qQ1mkW1", + "eJvfUOMP", + "I6RjZcTk", + "KYC4Mclb", + "aml6NrWt", + "sHyzwQjv", + "TrKI7BAm", + "gFqtQf9I", + "J2yur0RA", + "YPGrYQko", + "JTuklKuo", + "pJqc1jB7", + "2mSZsXVj", + "yOTZGHrz", + "quCZ8zEI", + "RLvZejhE", + "pbuGbBq3", + "ljtq5Ziq", + "6GUgjMHt", + "7ktxU5WH", + "NAvo4W1t", + "6jBtXM9a", + "V2UCUQdf", + "yAvoilx3", + "2WPwokAc", + "M0FFmycB", + "XGk13ktw", + "O01VEL62", + "HyelR2S6", + "XG9kXcDm", + "btLr9mIs", + "YhNFcoNN", + "m6guijhU", + "urtfjwMf", + "VWBYlxzB", + "H0ArgTE5", + "vNz3ITH5", + "WFXGdZd9", + "y0IlDeMe", + "LZ4tmMNQ", + "m2msKjGV", + "VXASf9Lx", + "GHYO8fmj", + "5n7Hd9Ek", + "y8MH2KNP", + "js2dx91M", + "6xvF7Vbv", + "umElIAtU", + "M4Q4EEUN", + "vu77Ua8S", + "bE29fEil", + "EhqtSxty", + "CBQacUKv", + "hykrvLue", + "eDGMj35T", + "iEH7SIXZ", + "9wxXEuZe", + "Nxd1GopW", + "PRYeCsn6", + "MQkMELNX", + "Ao015M2o", + "FVMFKPnM", + "sGxSD9Qk", + "bKDsl4JP", + "2f5MWWqL", + "5XiMG0sG", + "1RtRYREq", + "1Lqxgwm4", + "pLGFAvdg", + "AKJceBQy", + "6fGBuC8q", + "wcBtzhNA", + "e08owwYq", + "s2BdU0DG", + "H9uWmttL", + "qgaNlrvK", + "KIALDxy3", + "NlzjRcET", + "GaMYmPaD", + "seU9UjZq", + "EW8ilMtv", + "oLSulcbK", + "rFryshQR", + "lqUqQ45a", + "X5Mol2oX", + "4omSgyGY", + "TlWu2csN", + "imYFwzs0", + "UUfcxUN8", + "vePrgYhc", + "ELx4Rw10", + "SD2PQZDf", + "ohsYTUNM", + "l3uBAZLV", + "EQmkgQwf", + "FqGE2yaJ", + "nvuorFiZ", + "buQYZb5V", + "4woZS50A", + "e0oD9AsC", + "RsJivQt2", + "dIgPd7XN", + "kJ49P9Yy", + "MWE5sqHF", + "sl4amlLF", + "QqytBw9p", + "KBTQypIS", + "TsxDx2nm", + "NafpZHu2", + "SN81xj9o", + "crPS1O4P", + "NWeB78aT", + "MiPPFz3c", + "I63dniRm", + "XcowHA1V", + "ge7Apeu7", + "8mt7k4JF", + "QQDBTkt2", + "BVvj3hsQ", + "blIHLT5a", + "GgdJKsPf", + "3pMaGkYp", + "G1Qs34dN", + "bbRJ2hz7", + "w1QUSBaD", + "cpDeNtAc", + "WzBxFAIv", + "MbXFZM04", + "6LzOzK5M", + "4sMwIiCZ", + "4neTI4ML", + "IHmvlAFu", + "j41ZDu8j", + "EsKXwT3P", + "wuJD85aY", + "7wrvMgGa", + "wAIdYe65", + "t3N0ORyZ", + "dceuMJ6n", + "wwEA8DGp", + "tsoJU8yN", + "u8FnoEpH", + "jTxkw0g8", + "wdROWmWv", + "YwE0WtTB", + "I2r6x5wq", + "ZuIUTCpf", + "tWZy2q0n", + "Dx9d80TM", + "7zn79OrB", + "jOeyKh9o", + "KLjrUQql", + "n4C5k4TI", + "72UBI4qA", + "QzNd2MYf", + "lbOqSzdZ", + "sAWtkTFs", + "J8FfkwPL", + "2BfgF6DE", + "RQnEtb8A", + "PKzKPqaK", + "3hwc21VY", + "iXlmedmr", + "ZOXXDdBL", + "SaJUVW6p", + "G1opTsne", + "alM7yFeB", + "CCmTZPvI", + "Yk5yWk4y", + "SkdQxCUH", + "zaT2WZgM", + "XcC5gjFF", + "JbmmsivW", + "HbccZs52", + "kZ7r3eww", + "ZfiXgecc", + "zWgSNtWD", + "t9XqVdkk", + "nFxbSeNF", + "QnWQuHj0", + "TOH8P4SF", + "kzY0RnsJ", + "RDFOXExA", + "uJwRKqBn", + "5Abl7hOs", + "75aDMan9", + "aL6CCPnK", + "okPCWByE", + "9CmFSZqn", + "6sMfZ38c", + "tP5kEGoi", + "BMDgLzfj", + "TCPjNaJ0", + "IsClCU50", + "GPwtRZnE", + "88pJQLmP", + "tsB9gU1h", + "Qt9Lv7lt", + "9M4UWCdj", + "i9Cpf9ww", + "ROA0nXwi", + "1PCdX1YX", + "n5rIgSeZ" + ], + "icon_url": "https://cdn.modrinth.com/data/HXF82T3G/ffb870e12c325b795d54833f8f899126553ef06f.png", + "issues_url": "https://github.com/Glitchfiend/BiomesOPlenty/issues", + "source_url": "https://github.com/Glitchfiend/BiomesOPlenty", + "wiki_url": null, + "discord_url": "https://discord.gg/GyyzU6T", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/forstride" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/37acf06c3156e291045b9715a04d814d8a6b96d8.png", + "featured": true, + "title": "Coniferous Forest, Field, and Gravel Beach", + "description": null, + "created": "2024-02-16T05:00:18.848684Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/bcb82e2e3d338f6a5310677525a8d510ed3b7306.png", + "featured": false, + "title": "Wetland and Bog", + "description": null, + "created": "2023-11-19T06:24:44.057364Z", + "ordering": 2 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/76b8570c7f9c28b4a83f92d02ea4ed68b861795a.png", + "featured": false, + "title": "Redwood Forest", + "description": null, + "created": "2023-11-26T05:36:15.697397Z", + "ordering": 3 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/891243fadf7040363a0585a6e407f3a70ee5ba26.png", + "featured": false, + "title": "Seasonal Forest", + "description": null, + "created": "2023-11-27T00:49:32.235444Z", + "ordering": 4 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/ac8fce08216aff7197d68688ae76b4bd5dd242a8.png", + "featured": false, + "title": "Pasture", + "description": null, + "created": "2023-11-19T06:24:44.057364Z", + "ordering": 5 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/1c64aff4b907004df3aa47946529cb0f06c315f7.png", + "featured": false, + "title": "Lavender Field and Dune Beach", + "description": null, + "created": "2024-02-16T09:16:42.102237Z", + "ordering": 6 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/e153086212aef2416ea139952ca5faa795415f65.png", + "featured": false, + "title": "Bayou", + "description": null, + "created": "2023-11-19T06:24:44.057364Z", + "ordering": 7 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/91bec24289ce9c9151aefd28bb58ae472b42d756.png", + "featured": false, + "title": "Rainforest and Floodplain", + "description": null, + "created": "2024-01-28T22:19:30.703372Z", + "ordering": 8 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/087bf89d982ca99b26c7668687ed041f84012b0b.png", + "featured": false, + "title": "Tropics", + "description": null, + "created": "2023-11-20T12:27:29.937117Z", + "ordering": 9 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/bf4a586aa8b74bf2b6589d51bc81e723db8fad3b.png", + "featured": false, + "title": "Origin Valley", + "description": null, + "created": "2023-11-28T10:01:19.415729Z", + "ordering": 10 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/dddc2bc79b9ff00f831092955b28f6e194a4e8e0.png", + "featured": false, + "title": "Overgrown Greens", + "description": null, + "created": "2024-03-08T08:33:01.886034Z", + "ordering": 11 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/ea4f49022e730825783c4f590309571663223c04.png", + "featured": false, + "title": "Mediterranean Forest, Scrubland, and Woodland", + "description": null, + "created": "2024-04-03T01:13:23.175776Z", + "ordering": 12 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/2af220f68322acd0d4153272233c9b8c7ddc8b38.png", + "featured": false, + "title": "Lush Desert", + "description": null, + "created": "2023-11-19T06:24:44.057364Z", + "ordering": 13 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/d7a6d93711e36b617a3cd74a8f8c9ed26e936bf4.png", + "featured": false, + "title": "Volcano and Volcanic Plains", + "description": null, + "created": "2023-11-21T06:38:17.223844Z", + "ordering": 14 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/e5de02084c22e351d92167302a57aaccf9ee3754.png", + "featured": false, + "title": "Wasteland", + "description": null, + "created": "2023-11-27T00:50:12.663881Z", + "ordering": 15 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/58d14090705cc75f5c250450025016a84e72952a.png", + "featured": false, + "title": "Tundra and Cold Desert", + "description": null, + "created": "2023-11-19T06:24:44.057364Z", + "ordering": 16 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/ac58d07f520735877379b664863aaf5fa8785fc4.png", + "featured": false, + "title": "Hot Springs and Snowy Coniferous Forest", + "description": null, + "created": "2023-11-27T00:50:30.045283Z", + "ordering": 17 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/5bb12cd2c6a50ad870c7b00e0100df2b027a0a47.png", + "featured": false, + "title": "Snowblossom Grove", + "description": null, + "created": "2023-11-19T06:24:44.057364Z", + "ordering": 18 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/27d1111edae0f350b13b340d5a12a9b2c34afc30.png", + "featured": false, + "title": "Mystic Grove", + "description": null, + "created": "2023-11-29T23:08:40.815894Z", + "ordering": 19 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/914bd37ab7e2127c79699b5478065e41406724fa.png", + "featured": false, + "title": "Ominous Woods", + "description": null, + "created": "2023-11-28T00:23:51.120715Z", + "ordering": 20 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/7fb49c07c624ee302bbac239c21fa6ee553784f6.png", + "featured": false, + "title": "Glowing Grotto", + "description": null, + "created": "2023-11-19T06:24:44.057364Z", + "ordering": 21 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/6c5f79f76df3f5a1db0f740830942fb98f31d2ea.png", + "featured": false, + "title": "Undergrowth", + "description": null, + "created": "2023-11-22T04:51:48.291076Z", + "ordering": 22 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/ad7b4edd3e43f924c43136febfdc7655efe423bf.png", + "featured": false, + "title": "Erupting Inferno", + "description": null, + "created": "2023-11-19T06:24:44.057364Z", + "ordering": 23 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/f27bdd3c8bdb69bcef1f205a6e21a5ad6a99bbb4.png", + "featured": false, + "title": "Visceral Heap", + "description": null, + "created": "2023-11-27T00:50:47.377629Z", + "ordering": 24 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/4756fcb7850704243ec1c4693ce635a743e565f7.png", + "featured": false, + "title": "End Wilds", + "description": null, + "created": "2024-01-19T21:21:51.210075Z", + "ordering": 25 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/a4f76f319a7b02b843752d251401c67eb9c9b00c.png", + "featured": false, + "title": "End Reef", + "description": null, + "created": "2024-01-18T23:14:39.127799Z", + "ordering": 26 + }, + { + "url": "https://cdn.modrinth.com/data/HXF82T3G/images/bf95b82068947db72d27c2476c6449e7189a3bd2.png", + "featured": false, + "title": "End Corruption", + "description": null, + "created": "2024-01-18T23:14:49.726810Z", + "ordering": 27 + } + ], + "color": 5468828, + "thread_id": "StMVLoUQ", + "monetization_status": "monetized" + }, + "BlockRunner-v8.0.4-1.20.1-Fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4" + ], + "id": "1VSGxqkt", + "slug": "block-runner", + "project_type": "mod", + "team": "xTR2G4tB", + "organization": null, + "title": "Block Runner", + "description": "Encourages path building by making you run faster on certain blocks such as path blocks.", + "body": "

\n

\n

\n

\n

\n

\n

\ud83d\udcd6 About:

\n

Block Runner makes you run faster on certain blocks, it's that simple. Mainly useful for paths since grass paths now actually offer some benefit besides looking different.

\n

Works on all mobs, so e.g. riding a horse on path blocks will make you go even faster. The mod includes a config file that lets you set your own custom speed value for any block or block tag.

\n

\n

\ud83d\udcf7 Media:

\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n
  
Useful inventory tooltip telling you the new speed of blocks  Stone bricks only add a little bit of speed, in contrast to paths
 
\n

\n

\ud83d\udca1 FAQ:

\n

Q: How do I configure individual block speeds?
A: Block Runner uses a custom json config file. You can find it at .minecraft/config/blockrunner.json and add or remove your own custom speed values for blocks and block tags. To reload the config in-game run /reload (the same command that also reloads data packs).

\n

Q: How do I configure other settings in this mod on Forge?
A: Install my Config Menus for Forge mod and do it directly in-game!

\n

Q: How do I configure other settings in this mod on Fabric?
A: Editing configs directly in-game has not yet been implemented. Instead when in a world run the /config showfile <modid> command by choosing either CLIENT or SERVER (depending on the mod), then click the file name (ending with .toml) that appears in chat to be able to manually edit the config file in a separate editor. After saving the file, the config will automatically reload in-game after a couple of seconds, so no game restart required.

\n

Q: Where can I download this mod for Fabric on versions of Minecraft before 1.19?
A: Older downloads are found on the old project page.

\n

\n

\n

\n

\"Reddit\"

\n

\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n
  
 
  
 
  
 
  
 
  
 
\n

", + "body_url": null, + "published": "2022-07-18T08:10:10.085956Z", + "updated": "2024-03-04T12:27:30.521916Z", + "approved": "2022-07-18T08:10:10.085956Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MPL-2.0", + "name": "Mozilla Public License 2.0", + "url": null + }, + "downloads": 167199, + "followers": 131, + "categories": [ + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "IA3rRwoQ", + "gXVobCk3", + "QK9knPuq", + "5FkspYtw", + "mo1Obt1A", + "dWoCXPEu", + "aULGG4lU", + "xCUW1cP7", + "G3XxVPJG", + "2qUzLhWC", + "EjFjj2dx", + "MxlSUiGV", + "kOuDY1Dv", + "626UhUoq", + "11oLVaim", + "lCKS1F2X", + "lXccshcm", + "C3prHAc3", + "700a2Rfg", + "xwioY5WF", + "znd7Irxo", + "QJw0n4U3", + "PXmXRq4F", + "zn14Om6k", + "E2p8LXhl", + "GI1B68jE", + "WB3CUZm2", + "fe318hY2", + "XZRboWo4", + "AXfitwAe", + "HsI63CpT", + "5bqYSaV2", + "hIEybKWD", + "JCUr7it5", + "Bs0gyy0J", + "kdxrpqCj", + "mD4Ayqzc", + "xHSSVQ0d" + ], + "icon_url": "https://cdn.modrinth.com/data/1VSGxqkt/icon.png", + "issues_url": "https://github.com/Fuzss/blockrunner/issues", + "source_url": "https://github.com/Fuzss/blockrunner", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/1VSGxqkt/images/f1c1a0003c9f7bce86a83c97f10ed251421bd7eb.png", + "featured": true, + "title": null, + "description": null, + "created": "2023-01-09T11:28:34.661890Z", + "ordering": 0 + } + ], + "color": 10127435, + "thread_id": "1VSGxqkt", + "monetization_status": "monetized" + }, + "BOMD-1.7.5-1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.21" + ], + "id": "du3UfiLL", + "slug": "bosses-of-mass-destruction", + "project_type": "mod", + "team": "WtNpzxM2", + "organization": null, + "title": "Bosses of Mass Destruction", + "description": "Adds boss fights to minecraft", + "body": "## Are you looking to add some more exciting boss fights to your world? The aim of this mod is to create epic endgame boss fights.\n\nRight now, this mod has three bosses. The first is the **Night Lich**, found in rare towers in cold biomes - you'll need some soul stars as well! The second is the **Obsidilith**, which appears in rare structures in the end islands. The third is the **Nether Gauntlet**, which appears in rare structures in the nether. They can be accessed in creative via the /summon command.\n\n\n## FAQ\n\n**Can you port this mod to Forge or an older Minecraft version?**\n\n- I will not, but anyone else may do so.\n\n## Installation:\n\nInstalled like any regular fabric mod with dependencies below.\n\n- [Geckolib 3](https://www.curseforge.com/minecraft/mc-mods/geckolib/files)\n- [Fabric Language Kotlin](https://www.curseforge.com/minecraft/mc-mods/fabric-language-kotlin)\n- [Fabric API](https://www.curseforge.com/minecraft/mc-mods/fabric-api)\n- [Cardinal Components](https://www.curseforge.com/minecraft/mc-mods/cardinal-components)\n- [Cloth Config](https://www.curseforge.com/minecraft/mc-mods/cloth-config)\n\n[Dev Roadmap](https://docs.google.com/document/d/1FWIecLltFT8ySfeusy30RAh5R36tWVKUvW9p6qo66AU/edit?usp=sharing) \n\n[Private Feedback (google forms)](https://forms.gle/CNeK58ip6qCVzXiY9)", + "body_url": null, + "published": "2021-09-07T02:26:09.052991Z", + "updated": "2024-07-27T19:57:56.316186Z", + "approved": "2021-09-07T02:26:09.052991Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 636923, + "followers": 314, + "categories": [ + "adventure", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "k9TVypM4", + "RL4ZMqCD", + "z7cjnSIF", + "y0KjhYqU", + "3k5rfU6w", + "CTY7Q9Xs", + "gQWRmqCk", + "ki06LuGM", + "wCkpCd2l", + "k5GkdSyZ", + "YH4S0vod", + "s0gB9jTl", + "Pq5PzoYI", + "FjFb2iUx", + "1Q2KpDg4", + "GLaf28Uv", + "639TWWBs", + "ASi0NoBf", + "J2PI77PI", + "TVUDm3bh", + "7q5XBhQR", + "yoCCX4Cc", + "7pKMIuYh", + "O1BXugqn", + "mI7U2FMe", + "cgCAFjOh", + "yjgcPYVA", + "WqdFP96x" + ], + "icon_url": "https://cdn.modrinth.com//data/du3UfiLL/icon.png", + "issues_url": "https://github.com/miyo6032/bosses-of-mass-destruction/issues", + "source_url": "https://github.com/miyo6032/bosses-of-mass-destruction", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": 9305340, + "thread_id": "du3UfiLL", + "monetization_status": "monetized" + }, + "Bookshelf-Fabric-1.20.1-20.2.13": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.7.10", + "1.8.9", + "1.9", + "1.9.4", + "1.10", + "1.10.2", + "1.11.2", + "1.12", + "1.12.1", + "1.12.2", + "1.13.2", + "1.14.2", + "1.14.3", + "1.14.4", + "1.15.2", + "1.16.1", + "1.16.2", + "1.16.3", + "1.16.4", + "1.16.5", + "1.17.1", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4" + ], + "id": "uy4Cnpcm", + "slug": "bookshelf-lib", + "project_type": "mod", + "team": "qdYl5sw1", + "organization": null, + "title": "Bookshelf", + "description": "An open source library for other mods!", + "body": "

Bookshelf is a collection of code, frameworks, utilities, and other resources. Many mods utilize Bookshelf's code base to power their own mods.

\n\n

Why use a library mod?

\n

Library mods such as Bookshelf allow seemingly unrelated mods to share parts of the same code base. This reduces the amount of time and effort required to develop certain mods and features. The Library's code base is also tested in a wider range of circumstances and communities which can lead to less bugs and better performance in mods.

\n\n

Features for Players

\n

While this mod is primarily for mod authors, there are a few useful features for Players.

\n
    \n
  • Debug commands like /bookshelf hand to get item IDs.
  • \n
  • Many new datapack features like crafting recipes that damage items with durability rather than consuming them.
  • \n
\n\n

Features for Modders

\n\n\n

Like the mod and want to support me?

\n\n\n[![Nodecraft sponsor banner](https://assets.blamejared.com/nodecraft/darkhax.jpg)](https://nodecraft.com/r/darkhax)\n\n**This project is sponsored by Nodecraft. Use code [DARKHAX](https://nodecraft.com/r/darkhax) for 30% off your first month of service!**", + "body_url": null, + "published": "2023-06-07T05:15:26.501095Z", + "updated": "2024-07-22T23:52:56.040417Z", + "approved": "2023-06-09T23:52:07.518348Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LGPL-2.1-only", + "name": "GNU Lesser General Public License v2.1 only", + "url": null + }, + "downloads": 3434142, + "followers": 527, + "categories": [ + "library", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "xjeNGLnn", + "56i8eRKh", + "PZGsWc8g", + "c6rI4wLx", + "LhSYh07J", + "PWUJVO6I", + "wdTERZDI", + "dwkWy4x9", + "7SaLOcXb", + "a7NX6yCx", + "xd7kSAy9", + "lQkFmrFL", + "NQcoou8S", + "dQqgImVP", + "V5pDTRMs", + "2uF0w8wr", + "le5pU5uA", + "ApzkhL4Z", + "Olzb3SVZ", + "fWrtd8UG", + "TBjeoSpf", + "cV4KmoaZ", + "YB3eqiAt", + "PhnuDXbk", + "cgs7zfvP", + "WZjGqDAq", + "8L4yP15J", + "8zJ1PqMR", + "yjXVghbs", + "ms3MOOMP", + "afa3HGKA", + "1yqhJniX", + "udcdkhbt", + "ugn6SJpN", + "nl4owqRn", + "jccIlBgA", + "EHMkc6sH", + "m3PVQC5k", + "RF1E3hMZ", + "d02azXLH", + "WL9DtgXu", + "QZ9Bveku", + "ONc5vGeY", + "sff8EPRp", + "Rvs3nZmc", + "aD3jlQli", + "k9rGLLDO", + "jZz1TRa4", + "DfEufVRb", + "gzYatiVJ", + "creNGrIO", + "V4RvN0g6", + "7s49nzx8", + "M3fHUgfi", + "EBvl2grv", + "E4HXCMz2", + "UCtE5bno", + "M01Tpdbr", + "sNs8PDmu", + "yzT4RrEX", + "4ursSH1i", + "iC9CzTyD", + "yIbtdzjn", + "t9ZVOTBw", + "OgwReJI2", + "A7qO2wnx", + "ifJiRLzp", + "yhYN1VDU", + "SMO3Dw4k", + "bPTPQ54m", + "2gYrxztO", + "FeS2AG0a", + "NU44mhHy", + "NWF6tpOi", + "9xVZBwoY", + "gQz20aTI", + "R0X4Nxw9", + "A3iRGZjk", + "4f0v9ykj", + "acMnfJIw", + "EgbdaomH", + "sdNWd74Y", + "jDlHvncT", + "ixTnjyIS", + "cDLAK8A3", + "FoJVJ4fi", + "xyuMPyG6", + "7XQKABIy", + "IslkMtL3", + "cWdmQat2", + "W9iuLdLX", + "7Et3xeAp", + "8TOLoTM5", + "EsaLLiPU", + "bVQuFWK9", + "UpIIsouz", + "nufVXSap", + "RgRtkfdo", + "2YrfqhkV", + "OcFCEgj3", + "9SRAyMIx", + "yREOx9DH", + "N87xnUaw", + "HQmXqnzk", + "TUC3N5AG", + "m8JXnR03", + "T5flg8pP", + "It4a4TPb", + "1hw7ZrCZ", + "yChKwRqu", + "cObwBsYn", + "tqecVjz7", + "oTOrHIgW", + "y27gZjb2", + "gYIqUxaX", + "xGqDV2hO", + "cW6aKFYn", + "GNAkSYXb", + "GcVN5btm", + "P93TVHn8", + "oRWvMKUU", + "xg1CSW5H", + "lcssXwVy", + "rlRAUym1", + "Wz5tSJ7y", + "h20NBWK8", + "e3y3Xgh5", + "Alu395D3", + "lERvVYp0", + "WGMrsA2R", + "KdBFGWTW", + "eOJF7JWz", + "SMSiMuAU", + "L7MBJdvc", + "GGtZvCne", + "BZ1z5NjB", + "pbdqR9OJ", + "nCfcDqi4", + "pzpk6m1F", + "FOdBsOK7", + "YJ8pNO5k", + "LYyXRWrJ", + "4mMSKJKz", + "mbUVUl4U", + "UZ5X54Yx", + "BR6OShkE", + "AvMSZ2L3", + "5O3HuTjQ", + "z1SAP1gD", + "av5dWLvo", + "rl7YBCRw", + "cV0FBYZs", + "4h8Zg0z3", + "8q1x2gIH", + "qmqENRnT", + "JKJdxQj1", + "nxSL31Hf", + "tVhTJuzm", + "ZCjsXMOb", + "yaAkPPvP", + "vkKVJ0AJ", + "DqeC5U8S", + "HNl2Xqdi", + "xxngsWMJ", + "b8Wjn8dd", + "tg8UpnSh", + "avShzp7O", + "bE5YMNRH", + "hIjaUh9M", + "fGhlY87s", + "e3HFbr8o", + "p5prRTks", + "D0TR0QKi", + "wg7g8Tyv", + "M7ufwd9B", + "TsmhHPTm", + "sFDtMYcJ", + "u56547oZ", + "xUL5JvQy", + "q5HV9wga", + "pBbZfLSd", + "SQO3hhBM", + "raduWehg", + "T4gzOh9Z", + "gTjWou9j", + "bsL0G1rM", + "PxtYDuPR", + "vDMkuLJE", + "YxIxGLkb", + "4f1mQAu7", + "IQk17wTY", + "KwAspKOd", + "qTAWsGbM", + "QDkPunrN", + "r5HPQp0o", + "zrSkDGRq", + "6b0YKO6b", + "GgLyPGfN", + "1ZpgXMA0", + "6GUir36f", + "fKXL3taE", + "usvNzWke", + "mDx4UorG", + "J4OI6oP4", + "a2IcEYqh", + "e60qnZfY", + "Ax2B2nAY", + "QTtPIYue", + "16HLjmZT", + "icNl6XFc", + "WLfDs57H", + "ZMxynEzK", + "Lu0QiaRZ", + "qQJu8zdq", + "37qUlJJd", + "eg9cCu2R", + "xRHRpx7v", + "lZjNIeRo", + "eGjKz5tP", + "56SWLCgo", + "c6RauJtD", + "5lHG82XJ", + "Dyy6FHlh", + "2gDaHHHB", + "fu9Zc0KJ", + "ORCt7mMc", + "E4ohIXWV", + "g1s7iAWx", + "apPrD3F5", + "apCm2DJq", + "UzC9flz2", + "nia0HlWR", + "sN66pJ6J", + "qlWTIAaP", + "L0lki65W", + "SRpHD4LC", + "jj1DtYYF", + "A0CTEecu", + "GmRJFzqr", + "zjzKSqxd", + "mkDGr3gi", + "SMGpG7Sn", + "gQDlEB9u", + "kqe0mEuh", + "Qu0uEok5", + "lHARgYHY", + "sVZv8RtT", + "GJ2oIZOI", + "k7LQLQHX", + "cfmLYYsU", + "Z6E2br6v", + "qtQbJLMF", + "9TbrxGOt", + "XIC4eQEE", + "UD3twnma", + "7I0TWeuy", + "3QFeYCCL", + "bs0PhVST", + "HnrdMfxN", + "13ZAwwdK", + "4xMZlBLd", + "cGGVIREh", + "sf820U5M", + "WpDvHWti", + "v5sbCkld", + "TV2Uo0Qb", + "GmIHBlhZ", + "c1qTERNl", + "vymXM8hn", + "UERnsTik", + "jGW8M0h9", + "BbEh8hrs", + "j7uj4GZC", + "TJlHlHXO", + "PMkYr4ds", + "kt1Gry4l", + "HqlInySU", + "YbLDGpXR", + "VgH3XvHj", + "rFIsNQCK", + "PvxKRwCX", + "korgFl1I", + "uxXVXVmV", + "kFLiC1Om", + "MCSXzXCt", + "Fl26ndrs", + "fqFnkFBC", + "irgR1hbM", + "tTQhKrpB", + "Gn6zEnRQ", + "sLTq4u4P", + "s9Avglq1", + "ukbFBztI", + "FaxShwKr", + "NjCHHm83", + "ktIjb53y", + "F810ZeUC", + "4lEaj5SM", + "Qqj6egFU", + "mEKmkfpn", + "bgRd7lwW", + "jgLwtZNF", + "KgvR52de", + "CApQnTL6", + "n4pea70B", + "gT2bD9LV", + "7JS0Gpaw", + "s2Kb8bIF", + "yZISnV2K", + "RjNapUF4", + "JAXTTCtp", + "qUc6XwF7", + "UiCHLtCp", + "C7Ij4AUA", + "nfJ8vsBU", + "cXF3trmU", + "c1BztZ8r", + "RIWpCNGd", + "r8rsL2Dd", + "6msssxCZ", + "lyPNcSTC", + "M9LvWEMh", + "N2JvAQjd", + "TuKKfN64", + "sE4NPtRn", + "L8oVjsCA", + "mZ8Q1fwz", + "l6QVhHnY", + "4tRP8wjd", + "Nifvsd5B", + "xMpsteOC", + "QSANeAXL", + "ttIhX08x", + "reXj9eGY", + "Kfo2GpTn", + "ZC08LhIK", + "OB6JXTsX", + "IWyih8f1", + "CoKpLkRj", + "OylKvyOH", + "ivk366qh", + "cD1hS7Kn", + "pB7r1qG8", + "JKyWqb87", + "ib9GAdfh", + "9dUq4v2v", + "3lK0rIzN", + "SftAJPma", + "6MRQwH9M", + "SNlTr9AH", + "tHIaGoig", + "Xu4Lfc76", + "IhYufECi", + "bkbYdShx", + "MhuUzx2N", + "KA2oZcsh", + "hSTo8Ihv", + "k8dO9USn", + "tLR1rehh", + "iflmGxzU", + "PMbk6CuS", + "Z7xg6sK8", + "O0BOQK1r", + "ZYL0Vs6f", + "vnTe6wZa", + "hUwLEAFv", + "kMn9Z3m8", + "UGlyYBYP", + "WebSAz8z", + "72oCxMcF", + "PLBAWdcz", + "B8czhEPy", + "l0IZmDnG", + "29Fx4jjy", + "oNRUvz8R", + "vNQgsy10", + "ldqU8HJv", + "cSQ29W4j", + "aaUjuJHf", + "4YdyKVQr", + "HBWXzlzi", + "IiPsoLzS", + "nrkKo3sI", + "9aTmQe9M", + "hwwt2Y9Q", + "Lf8rtCZA", + "7OXYExai", + "ZtmdJLyl", + "tRPQfTGJ", + "3GmwDPJt", + "sqCz79i0", + "n0tNGf6w", + "8ukSrF13", + "2obHc8n1", + "FTioCuu9", + "RB4y5jmf", + "dwfC4LeL", + "6SRk1KvS", + "1wsHwhOX", + "TRONbhbw", + "mcP7oEUd", + "oNMsy3rC", + "T4qX4KyC", + "4qMKA2ga", + "29K6NhQN", + "W89IKgw3", + "rTYihjmN", + "bbLZrWxp", + "z8y5t381", + "xYby5gZf", + "qVuEKBW8", + "CUdSbsAX", + "zxt2JbtM", + "gpFaFgbC", + "EgtQUF1Q", + "LLXGCU1E", + "pwyVZzlk", + "WczHQX8S", + "vy2AuHWg", + "ZfR6eEUF", + "tFi3bT4f", + "qcAzJuaV", + "Qmsp79v0", + "grYZnSin", + "GoF0A6tp", + "MukHTq3m", + "kmhQyHnf", + "ZN9jLpS4", + "4mbkbYFq", + "zolppORl", + "foCgL0Cr", + "WnrRxYiN", + "fXdrKYRN", + "idKZLm10", + "CcYEz5bD", + "s34TAugp", + "qXx9D4GI", + "HlyWEESJ", + "efztZoak", + "Qwd8n3U7", + "EuXpspuh", + "dcKvDvYP", + "o0yoxITc", + "p5FDKkFp", + "WMaxnySd", + "DfQghwZK", + "PFR5SBNw", + "znzAPrsF", + "oPZQuh01", + "3N2w1V8w", + "zRPSVkkm", + "tNL9fblJ", + "dlIosAzN", + "4as3NEWX", + "N4nzlF9e", + "FalKyHy2", + "junqK9rD", + "nhtT7FeI", + "cX0TdMkL", + "ejgGgvjw", + "rYujYDTu", + "VoHg1FGE", + "l0G9D3cl", + "ZxukgBMo", + "INMMg0UB", + "j95jPKY8", + "iuJuggZm", + "jmFQU7xc", + "qpYo45pT", + "vxMLGwRU", + "3Ls1mfjv", + "oQzVs8sz", + "zhAx5VEp", + "aicxqNFN", + "TCRFKU8G", + "q2MKua8o", + "onF0lKxl", + "TYbA4LDI", + "FQIR5rmx", + "3ja8qEFi", + "9x2fu8Tk", + "G4sUnexa", + "Gs3BKRV2", + "eCYwxpWZ", + "E7kwCxN2", + "rLgumCw6", + "oAdarGZ0", + "Q7Kt40BP", + "4onWo3tS", + "GltK4jmZ", + "Z8D6VXGE", + "iKbk0fKr", + "WSHB22YH", + "elcxSrFY", + "LPnPvDEo", + "2S1OLrYx", + "bc6oLCjb", + "OtyX57bn", + "BM8PHs6k", + "E7Nd2WxJ", + "oTHh7GFl", + "dcB4Ef7C", + "XjK1tg8c", + "mScxeAzS", + "7s4nIWIu", + "6hODL6Zq", + "npUA6P6j", + "oThWxQDQ", + "ItGgw487", + "ZMDU9IYM", + "tVFmZMe1", + "ClaH2mQb", + "Y9IVRFJH", + "Ho65koku", + "ccA7OLWE", + "TNEjf25s", + "1i7GneX9", + "2LnrJ11g", + "iJouxfaf", + "1Eo7e2FG", + "IUch7Sb3", + "VdfPMCPQ", + "n9jtujPn", + "Syv4jQsJ", + "F0OxLhse", + "RDiPD9Tp", + "W1i1WOf6", + "p1RzMfkp", + "vEboyFg6", + "fcGMpupr", + "uayHNrHv", + "kjRBICHs", + "7TrPgkkL", + "LejsAnsN", + "IeNVW4eN", + "oQYGyR1a", + "CwAqFftX", + "p7uS0Z0h", + "UzKCzqis", + "RvZbX7dF", + "7QAU2vN5", + "vBocgbnF", + "16bs0BTw", + "fhz3aKwf", + "VbXpD08Y", + "Q3lRgskE", + "rZW0Frsc", + "peNCnxYb", + "TiSKmPrC", + "nUbEt04R", + "CXyHESwt", + "W9WhKJDL", + "aywi7n2U", + "smvshcDw", + "PuQYcRAn", + "tdDol2rv", + "Vsudl4Xg", + "tbJbxCyL", + "lxonC9Ab", + "edSw6K5J", + "XuYRK0VI", + "dtIZXlg0", + "aaLihTJx", + "x3soV9Fw", + "1S1o8cKe", + "YA9jCrlJ", + "OxHy5dFh", + "ewV2WiIi", + "HRLKutZx", + "a01ajLR1", + "qkdKHirl", + "qkD9UVrf", + "7IZfYwne", + "x8obmzer", + "YiWIhGjl", + "Xd9J5JSl", + "TPtzWEZx", + "edwGdVWK", + "P4x5ADrh", + "aHQit7Kk", + "i5nx9eBd", + "1O6RnmaD", + "5IhzYJKz", + "mcqQEpK9", + "HA2d8ae3", + "r1tMmocm", + "IxJIXnBe", + "JajTAGTc", + "L7OhssxE", + "5Q4H5Hnw", + "p2HjZ71x", + "7AII05H0", + "LcUHN5fE", + "iXgWg5uA", + "DESZyPAv", + "2GKw1bZi", + "SCJKSgl3", + "NpbleI9h", + "Zi7CnpR7", + "LiyVKzUU", + "zioNYVDf", + "y1SOG1Jv", + "YjGP8FTd", + "8I9ncq1a", + "GsRZo4nf", + "qti8G13A", + "ibIKsTG7", + "oumUlPS8", + "s877elUs", + "9pBljYtw", + "lRI0JG6d", + "6Bk2wfsw", + "cnLqLDPe", + "RSvwUDrE", + "Xa2WZiVB", + "gFYM7qhL", + "F6zAUF0A", + "MW3BaEya", + "KJP6LSHF", + "zRr2r7e8", + "YFiM510v", + "uQYKQ5H6", + "JwuYEpCO", + "zZZzXLjI", + "u6j4jDG3", + "soTtfJ6C", + "QcWkIeO9", + "HVENkSa0", + "MHljRSq1", + "p9veRYHx", + "io6TaW6G", + "XNtyHWja", + "obAkkhd5", + "Zzlg97jS", + "bsWaCHAy", + "200D5XFV", + "Cvdc5Cr0", + "YWoWIigT", + "gr256ktZ", + "2qeoMAlF", + "4LdRESvJ", + "opNxp5lm", + "oKxSzaMa", + "KNwb10Pd", + "oZ6LiNk1", + "aNf0PQ1X", + "GfDSpvDs", + "THEL9LvG", + "sg6nZ4GL", + "HT2MTfKR", + "uuXh3HN2", + "10D1gGbH", + "KXOxMSGw", + "XiUDORBP", + "xoHkdsqi", + "IQq2dpBH", + "vXDRFhOE", + "VW9oL3f4", + "KgiwYh05", + "wEleOMDC", + "ekHebOgI", + "F0StPlL1", + "rTRXPpaW", + "bReecQmZ", + "RuFR11gy", + "53isSbQU", + "T7AjfmZc", + "wSqibkGY", + "LGW0zItU", + "HKjwTPvK", + "JekLCEuD", + "JdalYQXW", + "k0V3ErXE", + "4J3dnz9p", + "PEAMTclB", + "wmLHJCYp", + "EQJpHrog", + "3tG2CAWS", + "zemfwmb8", + "hSHqivm8", + "kC4ErV0L", + "3DDXeB9L", + "v1BR5NkT", + "2lp65gDP", + "fIj4NTmG", + "GlctQ2b4", + "LYXD39dv", + "O06f5SuH", + "RLvWf3ty", + "MW6SvEH1", + "gNSNhbPq", + "MuxOnlJh", + "FocLjMq8", + "Lj1PDDPR", + "HcKU7OCA", + "hqibU0me", + "brZ45FkH", + "nN6Dx25h", + "QJgTkH1h", + "LXRWFfNc", + "yEKbnQU2", + "jZgrHsnq", + "RK7a1ypv", + "WWEitWfp", + "tHh4kNPz", + "eCbp0muu", + "QYmTXCUk", + "tEQeEwcs", + "lmV5oalp", + "fw4PHFep", + "aVnVkQ57", + "lPmrzGGR", + "nsZUjaog", + "HyfmEeYn", + "smh8Rkcl", + "dBTqGbKz", + "eLojzFVU", + "UlR9SKGQ", + "SQvGIYwF", + "OpbgNCys", + "akvvaPla", + "TKsnwSWw", + "cW3h9u4K", + "INbDzGeX", + "xmNSArnH", + "hO5BGi7i", + "62p35khM", + "tEOdOzRQ", + "2DfyTKA2", + "jRPTUoH9", + "rhEZogRk", + "dBwQE3dq", + "MFTvpQEI", + "7errAeE5", + "Jqf3ebWj", + "u08rKJS7", + "RcdY9u7c", + "zhNcdUwH", + "CUN3iyw4", + "ScJUeJcp", + "2FMtHDOX", + "zqNUZxkI", + "84x1KMHM", + "7ZIExCnn", + "h8fRovJH", + "SETj0Pm3", + "PBdIm8RC", + "e6vE7dPY", + "6nTUoNUZ", + "CWkCHDto", + "5p2gWZyg", + "eiBeWeXN", + "HzE5GUnN", + "e0v9Di1m", + "upXPQObg", + "vzvLdGWJ", + "BklsbWKV", + "TUj2RVoj", + "vi7uYUUP", + "RsN4T3gf", + "Ghrmchiz", + "5iUSmxWR", + "1wlZ8QLx", + "eVAGgQy4", + "DH1hvVFc", + "dKqpmZUH", + "rsxfgsbe", + "Ugg0BHzw", + "Y9dJIQiQ", + "9vNE6VmO", + "ITvz1qOP", + "7MdmTfam", + "qjvvoomr", + "ryjRojIe", + "oJTDpptp", + "qwrG4ttw", + "MGOBS88P", + "DJhaDSqP", + "IzhAw8sD", + "p1pjA79j", + "IqyjjMlc", + "YTnQoD1C", + "nTCbmMFE", + "fe0uY5zG", + "Fqqj6lzU", + "RbhUsKG7", + "DqfsG6UR", + "17aswY9x", + "WFAt5jle", + "LAxcRfOy", + "li0obcLo", + "f92nl2Qh", + "SIWoVauX", + "eE9qhKqL", + "Nyz7OWiy", + "iinFsfyb", + "bQ6QdBrh", + "CZeKjSO9", + "By2nWgrf", + "X8FUjZ4F", + "DXCpk1sK", + "MQ0iAiX7", + "UXG9Fryw", + "A9tZhH8G", + "THRk34xH", + "y7zsxBA5", + "4pWx2wQz", + "edCHinVZ", + "tVtCW45M", + "rP46Aexu", + "50GvOS98", + "IKGNAkBR", + "3r0plTRs", + "TyK687S4", + "qhQqQbjQ", + "RBAFlVHs", + "40pNM2Ao", + "zp8blJyB", + "gzQ01SKn", + "y1GaP6QR", + "RgZYjGmF", + "PwDJESCW", + "IFt3Sfg9", + "VdInO234", + "gWh6gsNl", + "ExcASmgA", + "lo8baJ8c", + "vGv57DQz", + "EXxPx92G", + "9Io1xkmP", + "fdgA9bai", + "eITQMF6j", + "XBWlluFZ", + "1A7Zs02h", + "TLwQiwSI", + "1N93qgKF", + "zHfC2Coe", + "kBUCHXCx", + "1SVKCoiV", + "mPFia1Xd", + "pPvwfNMH", + "thhhnLRM", + "MARtDRrM", + "aX1fLfTb", + "UGDWum7Z", + "gXIHCYRy", + "39uyedlG", + "xwtJHipv", + "VwaJvYO0", + "6wMCN81G", + "20Sz4pAk", + "rh436K8q", + "ptN2PpHf", + "veWM7uMC", + "dhiJvJu2", + "qI5whjao", + "8I8xfUeR", + "IL6yVQcP", + "PuPP4Blv", + "dPZreKSP", + "j9ZIwHbk", + "VpDTVinM", + "gbbqE9Vq", + "wUN9mpa1", + "6sca6thv", + "xAPgNaSu", + "T1yYwN5g", + "2BzHp22l", + "KFy9xmlE", + "BpwKEPje", + "l74QePql", + "WgKSdGY5", + "5lVi4B89", + "lzGkkv17", + "Lc6UBhNN", + "kwr4v10e", + "IEMu4VzI", + "PVaim8Ky", + "ZNQd9Iww", + "xLfCDtKk", + "do4zQJJA", + "uauLm9XU", + "aPC14YSf", + "j8P3xzdX", + "rpQAisbW", + "S6PUWaZn", + "SjVTwh0W", + "AxBpl9uY", + "ttSZX5Nf", + "62hlZ1rQ", + "6QCZ7LhF", + "JZnjHny8", + "xW5wDmDI", + "fkw2bMW4", + "vunmJJvj", + "xcnPKq3n", + "PQufPI3q", + "cLZRjuQj", + "WbuC3GYc", + "BhCyZSu4", + "LCvgOEc5", + "h1Wk6jak", + "vIscvSBD", + "8e2thQKY", + "m7cqdqTR", + "s5l0g0sS", + "m94q4GeH", + "OKwFClHU", + "3HH6zn00", + "IcWvhjdw", + "mdfEVCj1", + "laDKZaTT", + "B1dP2Axr", + "xdUDo7zG", + "XzTK5PlL", + "3HiEP9lf", + "GyqgRvRz", + "B004kZn8", + "iGz8Sfum", + "ytsLkeg0", + "YYMX4NKw", + "E91p7GWm", + "OokIY9t8", + "PTs0DrqL", + "nM3alyVk", + "16zPSHKb", + "XHmSlvpD", + "bKRq6FfI", + "bgtpnEgX", + "incFZOB4", + "wj2Iiewg", + "cnPTg0m8", + "ve8KGiJ5", + "1pWdGxkR", + "5lYvNN30", + "TQMIS4fk", + "JDIOMwx2", + "dH6uJvm7", + "96zaataP", + "zKDcNEo3", + "cuZN4X06", + "LUTchFvc", + "pSULsAQY", + "riVBgHg1", + "Veo82xGo", + "jLDcjnCm", + "c4b2TmiR", + "X9JByRlL", + "zozOd4AM", + "xObShtdR", + "NwR8CYEk", + "N6gUTQen", + "agzurVeI", + "GE5otVe5", + "E00CwMTB", + "exZ1SlS5", + "fy89ff5i", + "rvUsKoQu", + "thOmpSiJ", + "tNwsir0K", + "CBnLZwRS", + "QnbDuW1y", + "EHFZrVAS", + "ZoXv0RfJ" + ], + "icon_url": "https://cdn.modrinth.com/data/uy4Cnpcm/002e73d916fb63c9c85e212ac47fde4ef9c4a65f.png", + "issues_url": "https://github.com/Darkhax-Minecraft/Bookshelf/issues", + "source_url": "https://github.com/Darkhax-Minecraft/Bookshelf", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/uy4Cnpcm/images/46dee24e9da4addbfb5dd2d082a6b2b86832e2e2.png", + "featured": false, + "title": "Command: /bookshelf hand", + "description": "This is a debug command added by Bookshelf. You can use it to export game data of the held item in many different formats. For example the ingredient option will give you a JSON string that can be used in datapacks for things like recipe inputs.", + "created": "2023-06-07T05:15:12.382551Z", + "ordering": 0 + } + ], + "color": 5912118, + "thread_id": "uy4Cnpcm", + "monetization_status": "monetized" + }, + "Cadmus": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.20", + "1.20.1", + "1.20.2", + "1.20.4" + ], + "id": "fEWKxVzh", + "slug": "cadmus", + "project_type": "mod", + "team": "UTttDizz", + "organization": "N42M457t", + "title": "Cadmus", + "description": "A land claiming mod that allows users to claim land to protect your home from thieves, bandits and monsters, and admins to claim land with region flags and advanced protection", + "body": "## Cadmus\n\n[![Made by Terrarium](https://images.teamresourceful.com/u/I80VLV.svg)](https://discord.terrarium.earth)\n[![Modrinth Partnership](https://images.teamresourceful.com/u/Bi4Cuo.svg)](https://discord.gg/modrinth-734077874708938864)\n[![Requires Resourceful Lib](https://images.teamresourceful.com/u/jUWHY2.svg)](https://modrinth.com/mod/resourceful-lib)\n[![Supports Argonauts](https://images.teamresourceful.com/u/6toRNT.svg)](https://modrinth.com/mod/argonauts)\n\n---\n\n### \ud83d\udcd6 About \ud83d\udcd6\n\nNamed after the great king and founder of Thebes, Cadmus allows both players\nand server admins to protect their land from thieves and certain environmental\nelements.\n\nPlayers can claim land as an individual or as a [team](https://modrinth.com/mod/argonauts).\nServer owners can use the admin claim feature to claim chunks no player may touch,\nand even further than that, they can use the region flags system to enable or disable\ncertain rules from occuring in the claimed admin chunks\n\n### Land claiming\n![Very pog team claim shown on map](https://cdn.modrinth.com/data/fEWKxVzh/images/db695b9899b30e54ad82f2c117d1c74975801a9f.png)\n\n### Admin claims\n![Epic admin claim shown on map](https://cdn.modrinth.com/data/fEWKxVzh/images/b1b849f76ed8a0309b07204ae8a9c3fd2feec1bb.png)\n---\n\n
\n \n### Socials\n\n[![youtube-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/social/youtube-plural_vector.svg)](https://youtube.terrarium.earth)\n[![twitch-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/social/twitch-plural_vector.svg)](https://www.twitch.tv/terrariumearth)\n[![twitter-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/social/twitter-plural_vector.svg)](https://twitter.terrarium.earth)\n[![kofi-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/donate/kofi-plural_vector.svg)](https://kofi.terrarium.earth)\n[![discord-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/social/discord-plural_vector.svg)](https://discord.terrarium.earth)\n[![modrinth](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/available/modrinth_vector.svg)](https://modrinth.com/organization/terrarium)\n[![curseforge](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/available/curseforge_vector.svg)](https://www.curseforge.com/members/terrariumearth/projects)\n---\n\n### Check out our other projects\n\n\"Handcrafted\"\n\"Chipped\"\n\"Ad\n\"Tempad\"\n\"Colorful\n\n\"Lil\n\"Vitalize\"\n\"Spirit\"\n\"Reaper\"\n\"Experience\n
", + "body_url": null, + "published": "2023-04-03T15:03:06.219842Z", + "updated": "2024-04-14T19:25:12.719947Z", + "approved": "2023-06-10T23:41:36.334917Z", + "queued": "2023-06-10T23:18:59.604527Z", + "status": "approved", + "requested_status": "unlisted", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 200955, + "followers": 186, + "categories": [ + "utility" + ], + "additional_categories": [ + "adventure", + "management" + ], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "UoWYtzCg", + "FGCGeFyW", + "9i8w5mSi", + "9tQBYhqC", + "iTys6vmi", + "pVYAyVrQ", + "q81Ie8CX", + "Qteup2vd", + "JhNMy5tS", + "EeytPlfC", + "9QHgqjUX", + "pt9twRWr", + "RImnLJNY", + "LfDknJGW", + "ewLEwoQd", + "xdA3AEp0", + "57nr7uAi", + "8je72aHY", + "znI3q571", + "hFygPr1S", + "GCHwMPRc", + "GnaH9yDN", + "TmSKxFiA", + "rasMkf0c", + "g8mEsGDq", + "mmJ3qwUy", + "P8apXAz5", + "zLWAHqsb", + "oAW5rt8N", + "6m1pgn8o", + "G5ltngSg", + "yA4y65qw", + "vZaX0jeJ", + "e92t9xrq", + "UybXEq7f", + "JAcTHat9", + "EiatAg7l", + "vtGe3auv", + "kzMsPbNB" + ], + "icon_url": "https://cdn.modrinth.com/data/fEWKxVzh/5d5fcff12c939097701a1c57d8c437845fc3c0f9.png", + "issues_url": "https://github.com/terrarium-earth/Cadmus/issues", + "source_url": "https://github.com/terrarium-earth/Cadmus", + "wiki_url": null, + "discord_url": "https://discord.terrarium.earth", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/fEWKxVzh/images/b1b849f76ed8a0309b07204ae8a9c3fd2feec1bb.png", + "featured": false, + "title": "Admin claims", + "description": "Admins can claim land via command and set region flags that dictate how things work while within the claim", + "created": "2023-06-10T23:17:37.999264Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/fEWKxVzh/images/db695b9899b30e54ad82f2c117d1c74975801a9f.png", + "featured": false, + "title": "Land claiming", + "description": "You can use the land claiming UI to claim chunks in an area around you. its range is based on render distance", + "created": "2023-06-10T23:11:08.998139Z", + "ordering": 0 + } + ], + "color": 798251, + "thread_id": "fEWKxVzh", + "monetization_status": "monetized" + }, + "cardinal-components-api-5.2.2": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.18", + "1.18.1", + "1.18.2", + "1.19-pre1", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20-pre4", + "1.20", + "1.20.1", + "1.20.2-pre1", + "1.20.2-pre2", + "1.20.2-pre3", + "1.20.2-pre4", + "1.20.2-rc1", + "1.20.2", + "1.20.3-pre4", + "1.20.3", + "1.20.4", + "1.20.5-rc2", + "1.20.5", + "1.20.6", + "1.21-pre1", + "1.21-pre2", + "1.21-pre3", + "1.21-pre4", + "1.21-rc1", + "1.21", + "1.21.1" + ], + "id": "K01OU20C", + "slug": "cardinal-components-api", + "project_type": "mod", + "team": "oRC8ncO9", + "organization": "TtSa4imP", + "title": "Cardinal Components API", + "description": "A data attachment API that is easy, modular, and extremely fast.", + "body": "# ![Cardinal Components API](https://raw.githubusercontent.com/OnyxStudios/Cardinal-Components-API/1.18/banner.svg)\nA components API for Quilt and Fabric that is easy, modular, and extremely fast.\n\nDetailed information is available in the repository's [**wiki**](https://ladysnake.org/wiki/cardinal-components-api).\nThe information below is a condensed form of the latter.\n\n## Features\\*\n- \ud83d\udd17 Attach data to a variety of vanilla classes\n- \ud83e\udde9 Implement once, plug anywhere - modded data will be saved automatically\n- \ud83d\udce4 Synchronize data with a single helper interface\n- \ud83d\udc65 Choose how components are copied when a player respawns\n- \u23f2\ufe0f Tick components alongside their target\n- \ud83d\udee0\ufe0f Fine-tune everything so that it fits your needs\n- \u2604\ufe0f And enjoy the blazing speed of ASM-generated extensions\n\n*\\*Non exhaustive, refer to the wiki and javadoc for the full list.*\n", + "body_url": null, + "published": "2022-01-26T12:46:15.907492Z", + "updated": "2024-07-20T19:11:25.700936Z", + "approved": "2022-01-26T12:46:15.907492Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 1723588, + "followers": 435, + "categories": [ + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "WCcq6SE2", + "ymGlSdB7", + "UiFscSdF", + "XVi4pC8A", + "oI0J6zee", + "cBAcMXlz", + "rQt4CSD0", + "7inPiMmR", + "hRgkWC9v", + "tPfCTMiZ", + "h4Dd87o5", + "NGEFAf1u", + "HykM2Qyv", + "qW85eawp", + "IBZVrThp", + "DObEjZD4", + "jYO4yNFS", + "aZhN0ofV", + "ba9S2OFd", + "QZ2WtYGD", + "PrBgg2Mj", + "6sn1ODwV", + "YdQa8zdn", + "quTFtjka", + "tVPYyTPV" + ], + "icon_url": "https://cdn.modrinth.com/data/K01OU20C/c95792db39092b68abb6266237382281d441ad9d.webp", + "issues_url": "https://github.com/Ladysnake/Cardinal-Components-API/issues", + "source_url": "https://github.com/Ladysnake/Cardinal-Components-API", + "wiki_url": "https://ladysnake.org/wiki/cardinal-components-api", + "discord_url": "https://discord.ladysnake.org", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/upcraftlp" + } + ], + "gallery": [], + "color": 15000804, + "thread_id": "K01OU20C", + "monetization_status": "monetized" + }, + "cavedweller-1.3.0": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2" + ], + "id": "cChd25Tw", + "slug": "cave-dweller-fabric", + "project_type": "mod", + "team": "6kwVl5I1", + "organization": null, + "title": "Cave Dweller Fabric", + "description": "Fabric port of the cave dweller mod by Gargin.", + "body": "Fabric port of the cave dweller mod by Gargin.\nAll credits go to him for the initial release.\n\nFrom his description:\n\n\"The Cave Dweller is a complex entity that has multiple different animations, sounds, and behaviors.\n\n \n\nAs you explore caves, you will be stalked by this monster. As he gets closer, the cave sounds will get more intense.\"\n\nHas a lot of configuration options.\n\nThe code used for the port is based on SiverDx work to port the mod to other forge versions.\n(https://github.com/SiverDX/cave_dweller)\n\nRequires https://modrinth.com/mod/geckolib and https://modrinth.com/mod/owo-lib\n \n\n", + "body_url": null, + "published": "2023-07-28T00:36:59.784984Z", + "updated": "2023-11-11T17:20:16.530360Z", + "approved": "2023-07-29T20:57:57.739480Z", + "queued": "2023-07-28T00:44:48.786711Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 130042, + "followers": 128, + "categories": [ + "adventure", + "game-mechanics", + "mobs" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "Zx39FXIR", + "X3JuDd8y", + "Glf7UbjL", + "dBp4Mxqe", + "4jLGEL7V", + "VpeEAwbs", + "jQ0cjlP5", + "CJBdjaYn", + "Zt0zWDMU", + "WaH6SRE8", + "qIrI7qcp", + "DvonW5MK" + ], + "icon_url": "https://cdn.modrinth.com/data/cChd25Tw/28662c51cda09e51001e573e0b00a4838d6d9ab5.png", + "issues_url": null, + "source_url": null, + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": 1313290, + "thread_id": "cChd25Tw", + "monetization_status": "monetized" + }, + "cloth-config-11.1.118-fabric": { + "client_side": "optional", + "server_side": "optional", + "game_versions": [ + "1.14", + "1.14.1", + "1.14.2", + "1.14.3", + "1.14.4", + "1.15", + "1.15.1", + "1.15.2", + "1.16", + "1.16.1", + "1.16.2", + "1.16.3", + "1.16.4", + "1.16.5", + "1.17", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "22w43a", + "1.19.3-pre2", + "1.19.3", + "1.19.4-pre1", + "1.19.4", + "23w13a_or_b", + "1.20-pre6", + "1.20", + "1.20.1", + "23w31a", + "1.20.2", + "1.20.3", + "1.20.4", + "24w09a", + "24w14potato", + "24w14a", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "9s6osm5g", + "slug": "cloth-config", + "project_type": "mod", + "team": "z9omIQMN", + "organization": null, + "title": "Cloth Config API", + "description": "Configuration Library for Minecraft Mods", + "body": "[\"\"](https://discord.gg/Vs9AVkxjYY) [\"\"](https://www.patreon.com/shedaniel)\n\nCloth Config API is a config screen api.\n\n### Developers Wiki\n[https://shedaniel.gitbook.io/cloth-config/](https://shedaniel.gitbook.io/cloth-config/)\n\nNeed a server to play with friends? Or don't know how to setup one? Just rent a server that is already configured!\n\n[\"\"](https://www.bisecthosting.com/)\n\nClick on the picture above, select plan (at least 4 GB), use my code **shedaniel** to get **25% off** your first month and enjoy playing with your friends!\n\n![](https://i.imgur.com/AkpzyeC.png)", + "body_url": null, + "published": "2022-04-21T10:29:41.555173Z", + "updated": "2024-08-13T04:52:22.352860Z", + "approved": "2022-04-21T10:29:41.555173Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 13092321, + "followers": 6314, + "categories": [ + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "2E04stZn", + "vcrZcwvb", + "dhr1Royh", + "FtlBFpp0", + "tR748cRj", + "D7tEkaAc", + "mJwBHBVB", + "wqFP5baC", + "HvviXJZV", + "vb3noRwi", + "6vFGWMar", + "63NArvT8", + "re60xAev", + "hcuWsP3M", + "DmOAoTTg", + "d1D40LRO", + "gb0cZ2Qp", + "GH6kNTCk", + "31tLmbMI", + "KiKLKNrl", + "wOP2dCdL", + "CsdOwOro", + "ehzvjLXC", + "XInqR7zc", + "FPWqEBEx", + "c4kFw2we", + "hg9bSXT3", + "VazGdWq6", + "JaKvOQIz", + "Q0bdszKc", + "GcaDCWXk", + "gPqHXnrg", + "iYo4XV1L", + "szXeTOs6", + "EXrxCjl6", + "Fw7B2c97", + "72Wj1Wri", + "IVxgEGfU", + "M3yxljrZ", + "VYURtAAK", + "QXKLvmdz", + "6XGTNEII", + "X8YuGurB", + "XqZIxbLN", + "dVpHBgHi", + "y0kQixP8", + "aAaLEVNM", + "oIHJeqqQ", + "CXaMuU8e", + "xMTUxQCV", + "i0ExoqTD", + "BLMp2TRt", + "ZbWG3eJW", + "w2VZSLTf", + "o9dFD9SO", + "8AMPotFw", + "EUyHCmUW", + "mhFzbEwE", + "Sqf2NXVd", + "s7VTKfLA", + "JoLgnJ0G", + "YR0cy5Ll", + "EuWT3qek", + "LnfolBYb", + "IbAdAuBo", + "HvC4UPrB", + "rMIyh1ac", + "XkFQE0kx", + "jvy82BGQ", + "VmKENDcG", + "x8gS3Jdy", + "Q4D6X8wF", + "gYTUlUKu", + "srGqKdky", + "wjYUbvpn", + "YFpDLLdu", + "A4lNtO10", + "q2CkD3c1", + "KBfIrjbA", + "2FKRnZ92", + "J3FLptsi", + "nr1znv5v", + "3Ejdp6VI", + "o6AGzycg", + "4UgNKji6", + "w2LhUkqZ", + "NPcjyMhi", + "Y51gygcX", + "6GeyuE7Y", + "eBZiZ9NS", + "1MwQkf8u", + "hUXzyFVO", + "3TLtSX1e", + "JRZSHDFK", + "X9ucoGCn", + "znhJLkCd", + "PjKtC8lG", + "Yc8omJNb", + "HsTzbbnf", + "gY9NB5Rj", + "jMyYg8Uv", + "JYR3Y30y", + "KWjX5anR", + "Y9QgGQ59", + "7jtvrmVP", + "yPULtkhh", + "DqgODWcH" + ], + "icon_url": "https://cdn.modrinth.com/data/9s6osm5g/icon.png", + "issues_url": "https://github.com/shedaniel/ClothConfig/issues", + "source_url": "https://github.com/shedaniel/ClothConfig/", + "wiki_url": "https://shedaniel.gitbook.io/cloth-config/", + "discord_url": "https://discord.gg/Vs9AVkxjYY", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/shedaniel" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/9s6osm5g/images/baa0dc605540953f5262f24109ec7837c090a04c.png", + "featured": true, + "title": "Example Config Screen", + "description": null, + "created": "2022-04-21T10:31:01.159433Z", + "ordering": 0 + } + ], + "color": 11654752, + "thread_id": "9s6osm5g", + "monetization_status": "monetized" + }, + "Clumps-fabric-1.20.1-12.0.0.4": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.10.2", + "1.11.2", + "1.12", + "1.12.1", + "1.12.2", + "1.14.3", + "1.14.4", + "1.15.2", + "1.16.1", + "1.16.2", + "1.16.3", + "1.16.4", + "1.16.5", + "1.17", + "1.17.1-pre1", + "1.17.1-rc2", + "1.17.1", + "21w37a", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "Wnxd13zP", + "slug": "clumps", + "project_type": "mod", + "team": "twbRaNO5", + "organization": null, + "title": "Clumps", + "description": "Clumps XP orbs together to reduce lag", + "body": "Clumps groups XP orbs together into a single entity to reduce lag when there are many in a small area. On top of this, it also makes the player immediately collect the orbs once they touch the player, so you are not stuck with a bunch of orbs in your face.\n\n### Do I have to install it client or server side?\n* For **1.17 or newer versions** it is only required on **server side**.\n* For **older Minecraft versions** you have to install it on **both sides**.\n\nIf you would like to support me in my modding endeavors, you can become a patron via **[![Patreon logo](https://i.imgur.com/CAJuExT.png) Patreon](https://www.patreon.com/jaredlll08)**.\n\n[![Nodecraft sponsor banner](https://assets.blamejared.com/nodecraft/jared.jpg)](https://nodecraft.com/r/jared)\n\n**This project is sponsored by Nodecraft. Use code [JARED](https://nodecraft.com/r/jared) for 30% off your first month of service!**", + "body_url": null, + "published": "2023-06-04T08:54:48.176874Z", + "updated": "2024-08-13T07:49:18.862579Z", + "approved": "2023-06-09T23:48:35.117961Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 2999101, + "followers": 1430, + "categories": [ + "storage", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "9hlctcDE", + "2PT9pbRj", + "HWb4PbLd", + "YlKKvqsg", + "k8jlVbEc", + "gGoDFlua", + "gLaYxa4s", + "6fWV0xJt", + "WUfSMmN9", + "nZvGITpT", + "YBmchP0h", + "xVBjqLw6", + "8jfhokYb", + "fTWVa6NX", + "Km2A7nLe", + "2MDA8v5I", + "A8fHbFS6", + "D4jsjhXA", + "ihiDVwNa", + "F8pfwrMz", + "W9FnDe1l", + "aqIk2Edw", + "xGvjcE7h", + "HT5eROlq", + "KBjSLpWi", + "k0Jwkd3m", + "BLPxOCPb", + "14gDpVDM", + "At7EuPwE", + "ZG68IYMG", + "gKfIS5UE", + "CK3gP3au", + "ABZ5Czfa", + "gjSDwzYc", + "60tArTRZ", + "Ge8WfKwm", + "a4YkXTss", + "qMEjJ46Z", + "iKpD3bu5", + "v6nZL7ij", + "kX922wv5", + "QfW5PBK0", + "QqCGODhN", + "DeVfca9r", + "bXpU2lu9", + "Y3KgUihY", + "c5XwSPGO", + "LTLe60ZJ", + "dMXKxndc", + "qgAkNod5", + "iCqS0XV6", + "rcImocgP", + "ghtGew4o", + "JKr8b0On", + "THJnSpxM", + "WEPinRvr", + "cB8mFWgx", + "nZ5nhrKv", + "C52dmdfZ", + "4oD9zKPV", + "qE3ikVnU", + "3AH29I4c", + "pug6aepS", + "aogHNv3y", + "2ogOQExk", + "QdyDo2La", + "3H5r9v4h", + "EAjgpiKA", + "UutzgwbZ", + "QkUVbfJV", + "qy5gqUCM", + "BxGXjwSg", + "gRpWIMha", + "l4IskRR5", + "xJwCqvzt", + "oasiVUpa", + "ssnANiog", + "JJ8S77j7", + "dcOL77zc", + "lI1Rscqr", + "nLgUCki4", + "pePFYnZ8", + "yPvrslL3", + "eKxVcvwX", + "ptOjPKUD", + "nuz7LOld", + "JGu6BDFO", + "r69CWcGO", + "sh7X4I2y", + "2WUro9Vp", + "Hrt4D2se", + "hnxzDUav", + "UmFe4S0c", + "SYSnPECv", + "MkMRGkr6", + "1FT90X9E", + "Ke4qgpLt", + "uGVtPl4l", + "zkCCKRNT", + "oH2kHLZT", + "oTaQQP72", + "nvpGk3Xn", + "HkwE1Hla", + "N40QLcL8", + "jpwxpMB1", + "7mmSmyfc", + "wb2m4G4N", + "BcqP4XTU", + "FRktsfso", + "4h8s4N4m", + "UId1Oi4e", + "KYNXYqwG", + "MKiINIqy", + "N1HpDUJK", + "klW0myvn", + "hwWceR4m", + "t18CfscF", + "pu9hcKsp", + "3GURrv52", + "BlDe1jqg", + "Nbrq3pvu", + "IQGoFJYP", + "Y5BmdUtM", + "tiS16mGn", + "aTvlJ7V9", + "yvGMz75G", + "qPvk2bmy", + "na30ifJS", + "pf9z7BdE", + "EZUmgjMH", + "fTlqeNs3", + "LwT3i65m", + "5q2RWTZ9", + "zRROXgDL", + "GnrWAVQK", + "4AR5fMpn", + "30DEnQJE", + "fN6SUor0", + "ePSovy2R", + "yQVnODwU", + "l3neajc5", + "Z9fVV1cT", + "62dNqSyR", + "2oGTbJ0i", + "h7A9nDyj", + "Xe0n6L7a", + "JLW0F6Gv", + "fI2Xyf3B", + "7uEaptM0", + "KdL0z8sJ", + "6BTKfXuu", + "rr2I0f2d", + "TCo8qr8m", + "mMwP6MUu", + "FrcMJxfb", + "ATa0nUu5", + "2CnNdiUT", + "QMBYfAuO", + "tjDEdddl", + "eqzpUTwV", + "ShUp2kQ2", + "FszY2hte", + "jdeTwq6v", + "MWDyKE94", + "nAHGB5ls", + "hefSwtn6", + "LAhdYjOV", + "RE9nKxFT", + "5DAuFkN0", + "U9UF2NCO", + "U9tSAZs1", + "BBnb9L4J", + "fgAAuioX", + "s3z1jvdQ", + "twamfmIi", + "3ene3W1l", + "aeoQuGBI", + "jo7lDoK4" + ], + "icon_url": "https://cdn.modrinth.com/data/Wnxd13zP/e723aa383ad7161a541242097e1d3223f582b967.gif", + "issues_url": "https://github.com/jaredlll08/Clumps/issues", + "source_url": "https://github.com/jaredlll08/Clumps", + "wiki_url": null, + "discord_url": null, + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/jaredlll08" + } + ], + "gallery": [], + "color": 12368900, + "thread_id": "Wnxd13zP", + "monetization_status": "monetized" + }, + "collective-1.20.1-7.80": { + "client_side": "optional", + "server_side": "optional", + "game_versions": [ + "1.16.5", + "1.18.2", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "e0M1UDsY", + "slug": "collective", + "project_type": "mod", + "team": "UTtoE2WS", + "organization": null, + "title": "Collective", + "description": "\ud83c\udf93 Collective is a shared library with common code for all of Serilum's mods.", + "body": "

\"\"

The Fabric version requires the Fabric API.

\n

Collective is a shared library mod with common code for all of Serilum's mods.
It contains data and functions centralized in one place. Collective helps a great deal in maintainting both the Forge and Fabric versions.

Having access to the library's code environment, creates possibilities for current and future project features. The updating process is also made easier when there's an improvement for a function that is relevant to many others. For example this means having to update one project, instead of six. This saves time and makes me a little happier.

\n
    \n
  • Manages all config files of dependent mods.
  • \n
  • Variables for increased compatibility with other projects.
  • \n
  • Functions that convert data for mods.
  • \n
  • An event to replace and resupply entities.
  • \n
  • Networking code to send packets via the Common source set.
  • \n
  • Centralized backwards compatibility for major version changes.
  • \n
\n
\n

Configurable: ( how do I configure? )
transferItemsBetweenReplacedEntities
 (default = true): When enabled, transfer the held items and armour from replaced entities by any of the Entity Spawn mods which depend on Collective.
loopsAmountUsedToGetAllEntityDrops (default = 100, min 1, max 200): The amount of times Collective loops through possible mob drops to get them all procedurally. Drops are only generated when a dependent mod uses them. Lowering this can increase world load time but decrease accuracy.
findABlockcheckAroundEntitiesDelayMs (default = 30000, min 0, max 3600000): The delay of the is-there-a-block-around-check around entities in ms. Used in mods which depends on a specific blockstate in the world. Increasing this number can increase TPS if needed.

\n


------------------

You may freely use this mod in any modpack, as long as the download remains hosted within the Modrinth ecosystem.

Serilum.com contains an overview and more information on all mods available.

Comments are disabled as I'm unable to keep track of all the separate pages on each mod.
For issues, ideas, suggestions or anything else there is the Github repo. Thanks!


\"\"

", + "body_url": null, + "published": "2022-08-30T10:44:01.264939Z", + "updated": "2024-08-09T05:57:41.724619Z", + "approved": null, + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 5313855, + "followers": 1599, + "categories": [ + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "x9HQxamM", + "hiu6IY0I", + "AdE5H8pu", + "JlGCFdxJ", + "fgCbrjNG", + "VXFyIrnD", + "H2i6GWli", + "58aHDigc", + "en1zxPSV", + "wYescTDX", + "TxqDshVG", + "SPcx8ADU", + "7a2ZmR16", + "txSE4rTv", + "ADtGFhq6", + "U8mMfaEp", + "9cPokIfz", + "TCgTNzFO", + "naW7chmp", + "RXKgutLD", + "QffgYmeU", + "j2d90Z68", + "tua0AhT0", + "EkfgF5hZ", + "tm0jdAxT", + "HeTJtN5g", + "WAWhlRTC", + "WmEZOaNp", + "UlIUGksj", + "aGiCCmxd", + "BAcfv6tG", + "A3d7nEnO", + "PmzxGbPx", + "S3Cuo4Lp", + "F3ONlUSO", + "ZcqNR3vC", + "SE37mln1", + "VEHNsT4U", + "Ig2Ol066", + "YUtELJU6", + "FoXlZuPB", + "6QRFfcE9", + "oVFXzu5A", + "B1BOkfap", + "Orj2bXvF", + "NIs9W91F", + "EytdzFLt", + "FupxQuSZ", + "Co4pZHdN", + "1K8c5iLl", + "kiGHG0uS", + "9GxJjPZ6", + "IyVvcx4p", + "ThfQmKxn", + "AfDjpIaa", + "B5xGHe3B", + "B4ahhTqG", + "WV0FP7fX", + "IpQzGuDG", + "wcpbCBuz", + "m8EFP2Nx", + "6Jmp7x4n", + "7GaIObci", + "TlXkRgTI", + "LKtLAy3i", + "Fsx8FvlO", + "zGHCuYtv", + "2XwuYNRy", + "YkWnkOa4", + "UfN2ORVB", + "RpEVMN9G", + "hbDOA9WZ", + "Yzkht9vp", + "RdtZ7KTg", + "wItZM6Ay", + "RJLX6921", + "aq9iJHpI", + "XGwsZhdf", + "UuKpB7rl", + "6vqOUUV9", + "fHUAICta", + "33vFA4Rw", + "8ILNbXON", + "igtHbiEf", + "q0CrlnGw", + "SJJKVNC3", + "JYhFFMDN", + "BsTi72qT", + "VSeyRLDC", + "2BBNiaxn", + "iYAkFr9u", + "qKKO8WDP", + "ob3TOUMg", + "Ry07tYnF", + "4bLpWjXP", + "DUHESSpw", + "TImZvX4i", + "hcZX3LzL", + "woDOSBbR", + "uPUL2a8f", + "1EVtjc70", + "kG7dYlbf", + "Ru7CZbJ6", + "BzFhrKgf", + "zlm1xN4C", + "gWj7k53B", + "UdOuyNuu", + "XwW9QjGj", + "DKY2R6AP", + "Uql0V2oi", + "87hK2Nin", + "mOdtTzSR", + "CkuwnyGj", + "WqnnA6ZT", + "QRT505td", + "9cxU8hwL", + "TOiX3QgP", + "sP1zYWNs", + "cItvrLho", + "E7531LyQ", + "r7w9ZE5N", + "uWL6dZd9", + "ACmvfGkT", + "KHeENh4z", + "PVIskBgQ", + "awyU1egz", + "329I384J", + "S4aAd42R", + "SnJg8NYv", + "a1vy3IfM", + "BWgT7zC5", + "jCggRIqo", + "rFwr6M4a", + "JuVfVQNh", + "WZ0O7Fvb", + "SwZWi5dy", + "ZgkyK7yw", + "s08tDhX9", + "glzR1sF2", + "xx1tIil2", + "Z5eRiXRf", + "h9MDT0mP", + "KPghyuCS", + "ga5aXjg4", + "X0bxE6yQ", + "7DYCoNmu", + "QPcDpM52", + "EmXz7dPf", + "qRizL8M3", + "IMCNczMN", + "6WM4RyY8", + "jXsUu9Y5", + "LkIXFBh9", + "zdRbNPAb", + "dxbfPuck", + "h4IAxIcN", + "GCLh1N7B", + "A6vc8251", + "EcEMSfDp", + "iBN0SxXI", + "sCcutOgv", + "tGIZtt42", + "MmcCy4pq", + "U0uW2tay", + "RIUVRIKk", + "QnNnnJwe", + "MTOnIVYh", + "twlNCCQZ", + "n07ifpvg", + "H2WklRFY", + "KfifhNGa", + "yGr27JDz", + "53FUV1Uq", + "2PRksvUD", + "58jAZAWn", + "SGCNNPb5", + "zx9O62g4", + "JEMRoEAJ", + "2Xsseho5", + "4W9MhvVP", + "m5VczTmy", + "HKWRRx3K", + "e59RiZAX", + "CkGJ3LhD", + "cv727Eob", + "KYvEJ2a1", + "vcMSY8Fi", + "OxdtT21B", + "rEuPOJLM", + "Blq9POUC", + "ARUG4JK8", + "aeqfLXfC", + "wBf37HTD", + "BgO0iWHE", + "9FqgVuam", + "gVodoy3R", + "tlHCEexk", + "fI8lZIHR", + "yptbfu7o", + "JlJyCWBh", + "SLKUgOPp", + "X4rOSPgH", + "FEkFtY3h", + "xpZSdjdC", + "xrdIea6f", + "846kvQa3", + "eicsb9ST", + "wFEmTWXN", + "95gGmAsU", + "fUDCGv85", + "xah1yaEx", + "kWnmHBdy", + "mAk6IqQ8", + "ZtTeMhD7", + "4gmCn1j5", + "2B54i25i", + "kdHENWow", + "DVUjXjID", + "Xje7BwDB", + "YOI3Xne7", + "qFhVrFHH", + "oHf82VIY", + "zQP1NGGG", + "3cNwC7Aj", + "oqnNxKQu", + "yG1WG57Y", + "2NXDklr1", + "gnJ42s4o", + "4EVCsLej", + "ijrgCywa", + "YYGWMEUh", + "WrkGQzi9", + "xlI36HXp", + "C8FBulL0", + "FyXPc5Xt", + "g3GCIrpQ", + "SrKu6MTf", + "gOGGorlr", + "IRj4GHYN", + "JdMJonPk", + "HpY3QSyN", + "yZ36PvrB", + "3Rmlxe5D", + "WtJjqWbT", + "ksxBMniv", + "mZYSr5yV", + "tQFDdMS4", + "tuV0LNjg", + "eC0mUzex", + "HMuqiDvH", + "h1Nr7YQE", + "21NuXJmg", + "qsI9UaAd", + "diqQmTlH", + "6SaOeTxF", + "9eKucX05", + "TejH5yVN", + "VHUUVhpd", + "AiyW3zin", + "wrrTlIJF", + "ENkdohyK", + "1iTaechW", + "8QlyDLzP", + "kYcltUr3", + "DH2Uw1q0", + "QglVrie6", + "useRPkIs", + "JWejCr0E", + "qRwDLY6S", + "S9qRgvAh", + "JOZ4dnWA", + "kFYUiNdr", + "grG0cvd4", + "6gFL7JAS", + "knokhzZR", + "dOacl3VL", + "JDfU0wJN", + "QeFW2Wcv", + "a2YetAXf", + "pP8pJNYi", + "S3YWW5su", + "Viulse4H", + "HtL4kTlo", + "Yt0gz1EP", + "qoDXsKAx", + "WwbsCLJb", + "vsuIXz3R", + "S28Cqjaq", + "Wc1NXz6v", + "Ervzvnkq", + "TjEE4xxs", + "BAxGmIwF", + "M1d9XTle", + "hqVvmTb5", + "6JrAVVaY", + "HqfPw5YA", + "kFQaRYm3", + "dRA60O2n", + "6mzn39y2", + "BKf8M4dI", + "NUnjI0dq", + "R7AnNUib", + "m0EUfHd1", + "984tJ6qq", + "wpPA6EBu", + "6PtnrBra", + "e9pIvgtA", + "JYaTsjv4", + "fLJAeZ28", + "dngwo4jr", + "ziRAbeOw", + "f6EkKYPj", + "IxxnG7SG", + "SW4urIaE", + "bMAdpAVF", + "4OSj1ztV", + "tmd4BKmX", + "nA8IWHXW", + "x0DYC9m9", + "dMHwFGW6", + "GP6BBULx", + "hHHql4Ti", + "AnttraZr", + "p3nMHNNk", + "SNrP8xeR", + "LyyOu5dB", + "nxB16vx3", + "1pG1r1Zc", + "MoqPkrag", + "qnvzgvXC", + "WyB1pD5P", + "HWWPFuKO", + "vZE5q1pn", + "QDixcC6l", + "oXgmhznx", + "YAOoGe5E", + "WJBnGzXa", + "IJXvAPTN", + "1OdssahL", + "yxt2wRUF", + "fyn1QoRi", + "6F6qhu3P", + "fivbVDW8", + "v4m23B3y", + "TImdHmU5", + "uaq4XVNx", + "XdrIqz81", + "jpMdJtbS", + "aLJDDfeG", + "pUEgyfV4", + "xa9F4mD3", + "GCWD4JZi", + "8OkXVJtn", + "zTteSpme", + "ODKDGTON", + "tMeJbimo", + "DRXb4Ayc", + "PvuijvUl", + "tslDnj0T", + "64LWNqvg", + "w1vSb4TN", + "sokPQo6T", + "3MsEmAm0", + "kePBaq4a", + "ZxrOfQ2y", + "qgYAmMsK", + "sAE6MBPb", + "fE0ohius", + "fJuKhc8n", + "urM2VWqU", + "RNhYJa64", + "RXxjawWd", + "Iej5Urj6", + "3juidFTP", + "KczM4P88", + "LH8LDr4p", + "S3BtKtUw", + "ptTsBckw", + "BZRw9oKS", + "lUnfbPY3", + "db1q4qln", + "GiHLPR1f", + "TOmpATtJ", + "cwE1632c", + "JuOp9xUf", + "aBtrJprE", + "YYkIVCj7", + "EbteiHrL", + "NvHia9jD", + "Hr8gBVQf", + "CsJl6p1o", + "GIf7e4gX", + "Xz9KMXXo", + "MTb34BGn", + "YZdu9B77", + "W1CQ9UCz", + "3zY4oi5q", + "5ZoQQu2t", + "iOFH8ipX", + "1qPWXAIs", + "TobnIU5c", + "84QjDeoH", + "HupVHdCo", + "SqveMGRg", + "DWDAffzK", + "Unqy4gjy", + "hCxE3SS7", + "4ttoKXrw", + "18sTwL0R", + "CCKW4Xd1", + "VW8K8GR3", + "xCsh50Sx", + "Tkb68j4y", + "KziooBLq", + "mrTmqUOB", + "191cluA2", + "q5nfGCvh", + "FecmNcI4", + "SxoZltP1", + "xePFzQOH", + "pXOUjZel", + "ZkBUSkql", + "if3kU0mN", + "1gvBaGCT", + "NiZNvZHA", + "XN7ZRMQl", + "ZNn94mQX", + "Qm8iagWR", + "uaxyvM6e", + "It15JS95", + "NnjgoN9X", + "a0nxaF4M", + "Utdhu6D3", + "U1weAjEr", + "Vs95Wipv", + "BlMZE4KG", + "sITn4lge", + "reFHsVre", + "xR4GpQQO", + "Guw1MFbD", + "XLkFOqrG", + "x9soA5VO", + "dOF7dUCs", + "RIBgWcFh", + "VwFgkeo3", + "floVDJu4", + "iCJLK7gw", + "H2n1R6pS", + "689M13Hw", + "IWqe0xhd", + "Iye1knaH", + "fxbfpj3Q", + "eSwJ6Jur", + "ErE39oIR", + "Ma5eCRpx", + "o3b1sVZ4", + "O8eC3inz", + "G3H5BH6z", + "7S0oIe5q", + "HK8oyhxl", + "fUL01Mt7", + "FzLytMNQ", + "4LGriOCk", + "sER08lZE", + "524eYd9e", + "7IuTQBwp", + "VilhXhrg", + "KLFxHRAy", + "bgReRnUX", + "2VtKfyeT", + "EVFQgeo7", + "OSw2lM2Y", + "REuBA2oB", + "UrqWvr3J", + "sIdf5Lkv", + "NdYHdmxw", + "C3XJ3LnC", + "qFiBy1Qm", + "YNou8kTM", + "jSFlnx4D", + "fS2VaQGO", + "iaBJ2MRO", + "ifJ5Az1U", + "uiw4BKPp", + "UrAMPQpD", + "po8Pd5zJ", + "iaSdmMZ2", + "HlrfNV7P", + "6xMJF02f", + "HI2IPht1", + "muhm6F0r", + "VV7HqVW3", + "9lOTexdV", + "yStH1hUM", + "Lw2ywQ8i", + "vnbusFN0", + "luHV2zbl", + "eAG9mbhM", + "bjtOpW4b", + "J9HudrYI", + "UszXS78Y", + "iJJ449Mi", + "qTGyg6iv", + "ue6lfFHY", + "jRip6SNP", + "5Wg6Ceg4", + "uPswIBHn", + "Avo0Ze46", + "J8FzLWCm", + "ip1SDHWi", + "N3gJuMPK", + "nRIeqGRL", + "XlI8NkVB", + "Tfw8EHZB", + "KBvHrjeP", + "jxVCaujA", + "M6itXlHc", + "p3bUjtjB", + "W3Nc1IMI", + "nXqSt7Bl", + "9NXU59oU", + "VzIh9jNk", + "2dw1vkeD", + "v97SBC0t", + "1zbEORsv", + "KRFMwjJo", + "X5xn9Kl9", + "wipAhCa0", + "n9TNesVV", + "9TOlk3Td", + "WQlLYDH6", + "TyRZxRtk", + "F7gj2nfI", + "S2EeMHg4", + "Xpk7wmaD", + "M830kCW8", + "kvzKHLkx", + "TBZZ5bBc", + "1fwO1EYj", + "snPU1UdY", + "m1BId9fm", + "Y4d8roqC", + "EoDPrw5V", + "wr8FDooA", + "kvdC8nko", + "4yoITBxh", + "CC97dyED", + "Dhc2pLuW", + "hwGW33qv", + "a0zM6RiQ", + "aWMkM9hL", + "nuJkNPys", + "wbm1k1Uy", + "N0LGCA4x", + "QAOn2FAA", + "4aycctag", + "FlDkuCuI", + "f4tbzQaV", + "Naj0SudU", + "PIpWqJOc", + "4T0oqkvt", + "3yzltsrI", + "xHMYc1JC", + "KusUWajf", + "7TtePiZG", + "WEalMFiB", + "ENGS2tc8", + "RvihQRkv", + "I3HtlXHN", + "nB61R9dH", + "4iHuNLfn", + "6iMYiZxi", + "MPpjuvwT", + "o1macqEn", + "ctANGjyc", + "K9Y5Tmuu", + "HHgevNRj", + "yXljDige", + "MBk0FFCh", + "NYnB3DcI", + "qr3pOf0t", + "g5tMPpdR", + "80qlTsCw", + "MHJyqCC3", + "DdVIUqCP", + "tbkgq2aL", + "MCG5iTwv", + "qw4UzDLO", + "PvBc4Jcz", + "bB57FIWR", + "jVuY2dwJ", + "Uy25T54i", + "rfJmYdeg", + "pUnlL3bs", + "xzRso0Yk", + "qrcWWO62", + "SHI1hwZq", + "24TEOmrb", + "smscFOAi", + "O9BbrXZa", + "Pm14gLLo", + "QO93UsDJ", + "B7vmr30U", + "RKCtWE4y", + "mNrI5n8S", + "qXM06FG6", + "Vyv3JQDD", + "hYoENexj", + "V0tdocI5", + "GnBmHCCb", + "fdXbFXqd", + "msNO319F", + "57G5AqzS", + "L1MNl4Le", + "4wd19NbF", + "2zKjwrE1", + "CTDXt4Os", + "atnFXlWd", + "hbmYqtdl", + "JJEzOZro", + "HhsvWQiL", + "saNWZItW", + "ZaTRzQs8", + "4PHvK72M", + "lnq6mhee", + "Z5MOP6R2", + "XWSLaPrf", + "2TNlNeWA", + "ZKVNl16R", + "luRG8yDn", + "FyLSxR6l", + "FIkyMwC7", + "CACoN3MX", + "6vIosX3x", + "XxKKmaIQ", + "S6Wxy9id", + "zqXCzv7h", + "psosJ1H7", + "AK50QSYw", + "y0V56lSF", + "9JlIYT4f", + "8H8qNCfg", + "jQzdODij", + "gBU0FtR1", + "mLJbbJPj", + "H9p5Jgm9", + "LLEkBFJV", + "RN03Mkrs", + "vddVmQmc", + "Ix6FZ6dd", + "X11matRJ", + "4jghdgE7" + ], + "icon_url": "https://cdn.modrinth.com/data/e0M1UDsY/515b2b2ba7130da250b0a23ac01994cb6b6cc2d1.png", + "issues_url": "https://github.com/Serilum/.issue-tracker/labels/Library: Collective", + "source_url": "https://github.com/Serilum/Collective", + "wiki_url": null, + "discord_url": null, + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://patreon.com/serilum" + } + ], + "gallery": [], + "color": 4597000, + "thread_id": "e0M1UDsY", + "monetization_status": "monetized" + }, + "combatroll-fabric-1.3.2+1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4" + ], + "id": "wGKYL7st", + "slug": "combat-roll", + "project_type": "mod", + "team": "oKdlkn0S", + "organization": null, + "title": "Combat Roll", + "description": "\ud83e\uddf6 Adds combat roll ability, with related attributes and enchantments.", + "body": "![Combat Roll](https://cdn.modrinth.com/data/wGKYL7st/images/a76b8371abdb17c1f502b293eb1fc9f6a259fb9d.png)\n\nEver wanted to roll/dodge/dash in Minecraft? Here is your chance!\n------------------\n[![Modloader](https://img.shields.io/badge/Loader-Fabric%20|%20Forge-ecebe6?labelColor=263768&style=for-the-badge)](https://fabricmc.net)\n[![Discord](https://img.shields.io/discord/973561601519149057.svg?label=&logo=discord&logoColor=ffffff&color=7389D8&labelColor=6A7EC2&style=for-the-badge)](https://discord.gg/KN9b3pjFTM)\n\n\n‌\n\n# \ud83e\uddf6\ufe0f Features\n\n‌\n\n## Adds Combat Roll ability\nPress `R` to roll (by default). You can roll into any direction you are heading (forwards, backwards, sideways, etc...)\n\nThe combat roll ability has 4 seconds cooldown by default. (Server side configurable)\n\nCooldown of your combat roll ability can be seen on the main UI (aka HUD). (Client side configurable)\n\nExhaust (aka hunger) is added to the player upon rolling (Server side configurable)\n\nRoll ability can only be used when player is: not using item, not jumping, not swimming.\n\n**New!** Now with invulnerability frames! (Disabled by default, can be turned on at `config/combatroll/server.json5`)\n\n‌\n\n## Attributes\n\nThese new entity attributes determine the properties of the combat roll ability.\n\n`combatroll:distance` determines how far the player rolls (the default distance is 3 blocks, server configurable). For example:\n\n`/give @s leather_boots{AttributeModifiers:[{AttributeName:\"combatroll:distance\", Name:\"testing\", Amount:3.0, Operation:0,Slot:\"feet\",UUID:[I; 66453, 79497593, -201178, -16957605]}]} 1`\n\n`combatroll:recharge` determines how quickly the cooldown of the roll ability recovers. For example: \n\n`/give @s leather_leggings{AttributeModifiers:[{AttributeName:\"combatroll:recharge\", Name:\"testing\", Amount:0.5, Operation:1,Slot:\"legs\",UUID:[I; 66453, 79497593, -201177, -16957605]}]} 1`\n\n`combatroll:count` determines how many times a player can roll before having to wait for recharging (by default a player has 1 roll). For example: \n\n`/give @s leather_helmet{AttributeModifiers:[{AttributeName:\"combatroll:count\", Name:\"testing\", Amount:2, Operation:0,Slot:\"head\",UUID:[I; 66453, 79497594, -201177, -16957605]}]} 1`\n\n‌\n\n## Enchantments\nImprove various aspects of your combat roll ability with these enchantments.\n\n### Mulit-Roll\nCan be enchanted on helmets - Grants extra rolls (+1 roll / level)\n\n### Acrobat\nCan be enchanted on chests and legs - Increases the recharge speed of the roll cooldown (by +10% / level)\n\n### Longfooted\nCan be enchanted on boots - Increases the distance of your rolls (by 1 block / level).\n\n‌\n\n# \ud83d\udd27 Configuration\n\n‌\n\n### Fabric\n\nClient side settings can be accessed via the [Mod Menu](https://github.com/TerraformersMC/ModMenu).\n\n### Forge\n\nClient side settings can be accessed in Main Menu > Mods > Combat Roll > Config.\n\n### Server\n\n**Server side** configuration can be found in the `config` directory, after running the game with the mod installed.", + "body_url": null, + "published": "2022-09-19T17:04:44.140047Z", + "updated": "2024-08-14T17:32:20.152866Z", + "approved": "2022-09-20T23:03:23.345563Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "GPL-3.0-only", + "name": "GNU General Public License v3.0 only", + "url": null + }, + "downloads": 666246, + "followers": 435, + "categories": [ + "adventure", + "game-mechanics", + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "qjPNxjeI", + "QY3g1MPa", + "6Y4CdZNa", + "ruVouh8N", + "fwWMS64D", + "Ef4UURAJ", + "cNuQKeYa", + "bEkfuXFS", + "azj5HSxy", + "pGWBRn1i", + "g54fQTVc", + "oDqrlOkT", + "NjDgCyxY", + "VXixoSQM", + "UF8erTuU", + "Ucep0Cu5", + "VFPcEpGA", + "KYboqMGf", + "X1F0kcns", + "QCPx2IS2", + "LvVX8D1q", + "7xq1zpn0", + "DkP5RdK3", + "2YI9I4TO", + "EDsEsJtK", + "aJk5QhXt", + "u2ibYGVH", + "2Ae8EJZw", + "WOCP3kLf", + "oSQPSvZH", + "pzCkMdkj", + "h13cp5Hk", + "SzaC8Y3W", + "JrSJCgLX", + "qiJtKPOI", + "kJTOmZiq", + "4Kt64z82", + "RkJWufMO", + "Osxa4mmc", + "URzpc7Lq", + "ouVfwhi4", + "JkgJLz6x", + "b64nmuue", + "jsIwSe6h", + "B7ZtSwe2", + "iG0xPWUm", + "vOu5WIvs", + "bOQ2Cikd", + "mSQJJvNy", + "91FfnPM8", + "UQb9qD3J", + "XTopJ0Id", + "deyBZlUs", + "vaBqHK19", + "ljjcUkWs", + "81E06FMa", + "1QeyH5IG", + "8Q03X6HA", + "Aj08MYtw", + "PSEQMV1l", + "DYKVvo9P", + "js1pLjSF", + "slz81V0J", + "MzRHyyTC", + "gLzlXMlf", + "NP7Nwrwq", + "vdae5kTA", + "QiWlD1U9", + "hJQhKVxj", + "RBDMFemm", + "EXGDg1mc", + "ZFOUucav", + "tOGQOc87", + "GKj5mumX", + "KnHNGyLj", + "buCwQh9G", + "LNxSmECr", + "GmitzqXs", + "NhqiKzjd", + "Iu7dNK5J", + "S9W5W5gZ", + "n5c0ilso", + "yr87igvi", + "soyzSn1W", + "eVyBNuwl", + "cIHoyOhg", + "Btqy2YLV", + "FwTldg5l", + "8Zv39qno", + "jHvKJkv8", + "rwRYD8bX", + "ofN9RHSY", + "532t65Zz", + "FyOp03FS", + "sMyWCvwn" + ], + "icon_url": "https://cdn.modrinth.com/data/wGKYL7st/ec708f6b60ed75fceab14e0848e9906f99dd84e1.png", + "issues_url": "https://github.com/ZsoltMolnarrr/CombatRoll/issues", + "source_url": "https://github.com/ZsoltMolnarrr/CombatRoll", + "wiki_url": null, + "discord_url": "https://discord.gg/KN9b3pjFTM", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/wGKYL7st/images/a76b8371abdb17c1f502b293eb1fc9f6a259fb9d.png", + "featured": false, + "title": "title", + "description": null, + "created": "2022-09-20T16:32:49.285246Z", + "ordering": 0 + } + ], + "color": 3882312, + "thread_id": "wGKYL7st", + "monetization_status": "monetized" + }, + "convenientdecor-0.4.2": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.20", + "1.20.1", + "1.20.2" + ], + "id": "gMWAhU1n", + "slug": "convenient-decor", + "project_type": "mod", + "team": "j68iPoaP", + "organization": null, + "title": "Convenient Decor", + "description": "Decorative blocks with convenient functionality!", + "body": "![Convenient Decor](https://raw.githubusercontent.com/mim1q/ConvenientDecor/master/projectPage/images/header.jpg)\n\n[![Requires Fabric API](https://raw.githubusercontent.com/mim1q/ModPageAssets/main/badges/fabric-api.png)](https://modrinth.com/mod/fabric-api)\n[![Support me on Ko-Fi](https://raw.githubusercontent.com/mim1q/ModPageAssets/main/badges/ko-fi.png)](https://ko-fi.com/mim1q)\n[![Join my Discord](https://raw.githubusercontent.com/mim1q/ModPageAssets/main/badges/discord.png)](https://discord.gg/6TjQbSjbuB)\n\n## This mod introduces new decorative blocks, some of which also serve a convenient function!\n\n- 16 stylish lightning-attracting Umbrellas\n- Watering Can to keep your farmland permanently hydrated\n- Piles of Leaves and Hay that monsters can't walk through\n- Weather Vanes that predict when the weather will change\n- Decorative Shovels and Pitchforks\n- and more!\n\n## [Click here to see all of Convenient Decor's Features!](https://github.com/mim1q/ConvenientDecor/wiki)\n\n![Screenshot](https://raw.githubusercontent.com/mim1q/ConvenientDecor/master/projectPage/images/rainy_update.jpg)\n\n![Screenshot](https://raw.githubusercontent.com/mim1q/ConvenientDecor/master/projectPage/images/screenshot.jpg)\n\n[![Bisect hosting - use code LUNAPIXEL](https://raw.githubusercontent.com/mim1q/MineCells/1.20.x/projectPageAssets/hosting-code.png)](https://www.bisecthosting.com/p/lunapixel)\n", + "body_url": null, + "published": "2023-01-06T23:51:13.430374Z", + "updated": "2024-07-09T19:11:35.123177Z", + "approved": "2023-01-07T21:29:01.185912Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 204344, + "followers": 210, + "categories": [ + "decoration", + "equipment", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "5A6gGkEv", + "ns7z1JKC", + "sNJ4MvD5", + "Vcbcrl8C", + "heg2WqKa", + "G4qBJntO", + "FNplTKFi", + "N5ZG6AIP" + ], + "icon_url": "https://cdn.modrinth.com/data/gMWAhU1n/21ebea0e3f802dc4726be01e804514f2171d2625.png", + "issues_url": "https://github.com/mim1q/ConvenientDecor/issues", + "source_url": "https://github.com/mim1q/ConvenientDecor", + "wiki_url": "https://github.com/mim1q/ConvenientDecor/wiki", + "discord_url": "https://discord.com/invite/6TjQbSjbuB", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/mim1q" + } + ], + "gallery": [], + "color": 6908006, + "thread_id": "gMWAhU1n", + "monetization_status": "monetized" + }, + "CreativeCore_FABRIC_v2.11.33_mc1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.12.2", + "1.16.5", + "1.17.1", + "1.18.1", + "1.18.2", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.20.6", + "1.21" + ], + "id": "OsZiaDHq", + "slug": "creativecore", + "project_type": "mod", + "team": "FvoHe2qM", + "organization": null, + "title": "CreativeCore", + "description": "A core mod", + "body": "Nothing else than a simple core mod required by most of CreativeMD's mods.\n\n**Features**\n* Gui-Api\n* Config System (/cmdconfig or /cmdclientconfig)\n* Packet system (supports splitted packets)\n* Event system (by N247s)\n* Ingredients\n* Fake world\n\nI know everybody hates core mods, because it is an additional file you have to download, but it speeds up my progress. Over the years, I've created tones of useful methods and ways to achieve something. Now i can put all of it in CreativeCore and use it for all of my mods.\n\nLooking for a server to play with your friends. Our sponsor got you covered:\n\n[\n](https://bisecthosting.com/teamcreative)\n\nUse the promo code teamcreative to get 25% off the first month on any of the gaming servers!\n\n[](https://www.patreon.com/creativemd)", + "body_url": null, + "published": "2021-08-17T09:10:08.972681Z", + "updated": "2024-08-01T14:09:59.416852Z", + "approved": "2021-08-17T09:10:08.972681Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 3642078, + "followers": 1260, + "categories": [ + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "KQPGT13V", + "fV0nS6Hk", + "L9bEkcLq", + "Ut2oEist", + "Gtn66Aqe", + "BPf7DxkS", + "HXLfaO1w", + "GDD2swja", + "TOzFSAAH", + "THwrApyJ", + "T13Y5nnJ", + "83XzFjou", + "1AZhMXe7", + "6F8vqRhT", + "aoAZXkqx", + "NBWDWypC", + "eQufNu9G", + "AWyxmFgr", + "SKxhUs2I", + "xvWt9K90", + "qWKs9GSV", + "EedSY5Xu", + "khRcoGPl", + "DIBiWudq", + "nRJSPUNF", + "nm6yLGRw", + "JFyuzapJ", + "ug21xEGt", + "kwUXLQPI", + "Kwi2M0y8", + "F7Y6iM8c", + "YZCT4v9j", + "CzQzXAu0", + "tJeTcXuL", + "ts6gasiY", + "jQhcsIZs", + "OxSfDFIZ", + "qzcyyZEL", + "OJK97rFo", + "4eXUvr6G", + "cShf5aSJ", + "dEwpO45X", + "V9RNcrBX", + "29bs38V6", + "JY5JEBvP", + "VCCVSkwk", + "QLwVzqCy", + "NQQnmBuq", + "Z1JWpMGX", + "5dcbyNat", + "T7kYEKfo", + "i7eXEyKw", + "QIXwZNQZ", + "gVhlCeHa", + "7CPnWljL", + "FbEntYXT", + "xnASrsH1", + "LC8MF8Fw", + "JkgKOtJx", + "wLXDszYV", + "9XoRYjCa", + "cO816I6W", + "NdCQnmre", + "GT8PJauX", + "oKn0NhvA", + "FgLisPD3", + "pAXPThvx", + "qohSXqHo", + "kIfhbwdL", + "z12F1I9q", + "GKcyVz0N", + "OwUqgdCm", + "QsSBs6zK", + "WI5xsBkc", + "2GtNXZTI", + "SNNpSfXt", + "H6u7QFeC", + "EVlHjkMD", + "8nboCMSH", + "430wA8sU", + "ERTYohOX", + "VB2iKU0F", + "koMAf8WA", + "tEZ8zqTM", + "mJoFVCBu", + "MoXaKGLT", + "MX7E0r0c", + "G6uu8LDS", + "C006YLgY", + "9fdeU4xe", + "ti4bxUbD", + "7u94iqPw", + "U2uEG971", + "Ni0B7vXQ", + "oonxt8z5", + "fDgOInCW", + "ueXSZJ1Y", + "S1jem1QR", + "1A48v2hH", + "gTQpU2bC", + "jruRTyFW", + "E92fDExg", + "mbMcQfan", + "YnHGMBbt", + "bztnjU9L", + "k7nEB7oU", + "9BCArzMc", + "2xCOlHIP", + "kAitRU86", + "FHuLs5LQ", + "gQyd6kFR", + "zVsuq1CR", + "Msdrwz3h", + "uYRIuh4E", + "okK3RO4e", + "7aXiEPIY", + "vWwoWQNr", + "nLV2PH5v", + "R7jTgrCN", + "8TLXgCPO", + "KoQwFplo", + "6l0P4h6I", + "H2qW227x", + "GhnBaKkx", + "NHhWpLCK", + "HXHXexC5", + "XhbN7Hjf" + ], + "icon_url": "https://cdn.modrinth.com/data/OsZiaDHq/icon.png", + "issues_url": "https://github.com/CreativeMD/CreativeCore/issues", + "source_url": "https://github.com/CreativeMD/CreativeCore", + "wiki_url": null, + "discord_url": "https://discord.gg/W9QM3fS", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/creativemd" + } + ], + "gallery": [], + "color": 526344, + "thread_id": "OsZiaDHq", + "monetization_status": "monetized" + }, + "creeperoverhaul-3.0.2-fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19.2", + "1.20", + "1.20.1", + "1.21" + ], + "id": "MI1LWe93", + "slug": "creeper-overhaul", + "project_type": "mod", + "team": "hqXanNx3", + "organization": null, + "title": "Creeper Overhaul", + "description": "A mod which overhauls the vanilla creepers!", + "body": "\"Creeper\n\n\"Creeper\n\n
\n



\n
\n \n \"Discord\"\n \n \n \"Twitter\"\n \n \n \"YouTube\"\n \n \n \"Kofi\"\n \n
\n
\n\n
\n



\n
\n \"About\"\n

Creeper Overhaul replaces the vanilla creeper with a variety of different biome-specific creeper types, some\n friendlier than others :)

\n \n
\n
\n\n
\n



\n
\n

You may also be interested in

\n
\n
\n \n \"Creeper\n \n
A resource pack by lord_gogomines bringing the Creeper Overhaul creepers into vanilla Minecraft!
\n
\n
\n \n \"Creeper\n \n
A fan-made animation resource pack for Creeper Overhaul by wadoo154
\n
\n
\n\n
\n


\n
\n \"Credits\"\n


\n
\n
Josh/Joosh - Art
\n
ThatGravyBoat - Developer
\n
scratchy_sd - All creeper sounds
\n
ArkticBoi - Concept art
\n
\n
\n
\n\n
\n


\n
\n \"Our\n


\n
\n
Winter Overhaul - A mod that overhauls the vanilla snowy biomes!
\n
Creatures and Beasts - A mod that adds amazing creatures into Minecraft!
\n
Critters and Companions - A mod which adds a variety of friendly animals!
\n
\n\n\n\n\n\n\n\n
\n
\n\n
\n
\n \"Server.pro\"\n
\n
", + "body_url": null, + "published": "2023-03-03T15:09:07.445452Z", + "updated": "2024-07-07T23:26:11.655908Z", + "approved": "2023-03-03T17:54:32.024827Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 940761, + "followers": 900, + "categories": [ + "adventure", + "mobs" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "uvM6RoDm", + "lyLwyNit", + "E6e38jpN", + "lUsvfN4h", + "jm4WZz4c", + "JF5M63Wz", + "1IZXt1xU", + "5l2wYZ7U", + "dVCs4doR", + "ylecmMxK", + "Ap1DSAzz", + "Mw0Hq1SZ", + "Ha4SFIjy", + "neWvwdi5", + "NEbJZ2kV", + "LwO7oD6e", + "sdT7UrTi", + "kRYCO1il", + "jYKhYBMN", + "uom5d4OD", + "pv1EuPwm", + "sU6yfd5f" + ], + "icon_url": "https://cdn.modrinth.com/data/MI1LWe93/d42fb7a69f1e7a86584fa1ed43520af98acec065.png", + "issues_url": "https://github.com/bonsaistudi0s/Creeper-Overhaul/issues", + "source_url": "https://github.com/bonsaistudi0s/Creeper-Overhaul", + "wiki_url": null, + "discord_url": "https://discord.gg/sGwxnFV", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/bonsaistudios" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/MI1LWe93/images/086fb5d867a9383cf044529f2fce0eec7817735d.png", + "featured": false, + "title": "Spruce Creeper", + "description": "Just little lads :)", + "created": "2023-03-03T15:45:53.063057Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/MI1LWe93/images/137ff566df99319ec7b5289532dac45a4fd98ca2.png", + "featured": false, + "title": "Cave Creeper", + "description": "Just as good at hiding as the bamboo creeper, but much more dangerous :0", + "created": "2023-03-03T15:40:01.159656Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/MI1LWe93/images/2c62df063f68b0e4db19d212abe5199f65275833.png", + "featured": false, + "title": "Desert Creeper", + "description": "More cactus hats!", + "created": "2023-03-03T15:41:46.434844Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/MI1LWe93/images/4471e9377d224b6cc8e29cfa41db9cb84bacadfd.png", + "featured": false, + "title": "Hills Creeper", + "description": "Admiring the view", + "created": "2023-03-03T15:42:54.085186Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/MI1LWe93/images/5a52270c74001bbbfc98b2c504ce100569d7451c.png", + "featured": false, + "title": "Dripstone Creeper", + "description": "Dripped out", + "created": "2023-03-03T15:42:20.720273Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/MI1LWe93/images/61db8a9ec8ffd039ef5af31ae04953c107b6a1a0.png", + "featured": false, + "title": "Dark Oak Creeper", + "description": "Spooky ;-;", + "created": "2023-03-03T15:40:39.509341Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/MI1LWe93/images/6c60c62a950f2a8b20dcf7fc2f71bb022445715d.png", + "featured": false, + "title": "Ocean Creeper", + "description": "Just don't touch them and you should be fine", + "created": "2023-03-03T15:47:12.058613Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/MI1LWe93/images/7e33e32ade4ad14d941227e6d3d75d5727859c02.png", + "featured": false, + "title": "Jungle creeper", + "description": "Needs a haircut", + "created": "2023-03-03T15:43:27.998064Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/MI1LWe93/images/8aa82db07532a30e4744cca4981f96e70dbcb901.png", + "featured": false, + "title": "Savannah creeper", + "description": "Walking totem poles o-o", + "created": "2023-03-03T15:44:43.161356Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/MI1LWe93/images/a945a63109b11d0d3769879a6a9828878c57098b.png", + "featured": false, + "title": "Beach Creeper", + "description": "They like to carry their favourite shells on their heads\n\n", + "created": "2023-03-03T15:39:30.971764Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/MI1LWe93/images/b057daaf50b2a44649022aad767d260725117cd4.png", + "featured": false, + "title": "Badlands Creeper", + "description": "What a nice hat :)", + "created": "2023-03-03T15:38:11.363404Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/MI1LWe93/images/bc2078d7ea2ae5309d619ae5a67148db79548176.png", + "featured": false, + "title": "Snowy Creeper", + "description": "As long as you don't hurt them, they are pretty chill :) They even help you fight strays!", + "created": "2023-03-03T15:45:13.367963Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/MI1LWe93/images/d756f75abf41c80a56d64299f5147d373b4d430d.png", + "featured": false, + "title": "Bamboo Creeper", + "description": "They prefer to hide. But if you plan on making one angry, be sure to bring a panda!", + "created": "2023-03-03T15:38:38.995796Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/MI1LWe93/images/ebd3e997f5159108adc53515f320441692c836f8.png", + "featured": false, + "title": "Swamp Creeper", + "description": "Where did they get the skull ;0;", + "created": "2023-03-03T15:46:20.690629Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/MI1LWe93/images/effc972c752bb61c883bef31e366d17d34342102.png", + "featured": false, + "title": "Mushroom Creeper", + "description": "They are just here to be your friends :)", + "created": "2023-03-03T15:43:51.228804Z", + "ordering": 0 + } + ], + "color": 7103604, + "thread_id": "MI1LWe93", + "monetization_status": "monetized" + }, + "cristellib-1.1.5-fabric": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.20.6", + "1.21" + ], + "id": "cl223EMc", + "slug": "cristel-lib", + "project_type": "mod", + "team": "jQLbV11P", + "organization": null, + "title": "Cristel Lib", + "description": "A Library mod for easy structure config and runtime datapacks.", + "body": "Cristel Lib is a mod, which allows you to create configs for structures with code. or even with data!\n\n\u00a0\n\n## For players and modpack creators:\n- Create configs for every structure mod!\n\n## For mod creators:\n- Create configs for your structures\n- Use runtime datapacks, for adding data in-game\n- Load datapacks in Fabric and Forge with checks\n\n**How to do that? [Here](https://github.com/Cristelknight999/Cristel-Lib/blob/main/README.md) is a small tutorial.**\n\n\nCurrently this mod is utilized by [WWEE](https://modrinth.com/mod/expanded-ecosphere), [Towns and Towers](https://modrinth.com/mod/towns-and-towers) and [Terralith](https://modrinth.com/mod/terralith)!", + "body_url": null, + "published": "2023-05-01T17:37:55.454619Z", + "updated": "2024-07-29T17:14:40.495791Z", + "approved": "2023-05-03T03:12:12.233159Z", + "queued": "2023-05-01T18:49:30.105341Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "CC-BY-NC-ND-4.0", + "name": "Creative Commons Attribution Non Commercial No Derivatives 4.0 International", + "url": "https://creativecommons.org/licenses/by-nc-nd/4.0/" + }, + "downloads": 1428385, + "followers": 298, + "categories": [ + "library", + "worldgen" + ], + "additional_categories": [ + "cursed" + ], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "qyBhDCjL", + "QbWRJZhp", + "qTUoNGY9", + "BeiojRZG", + "rGfmEx0B", + "J0jTgCIB", + "HocdgthH", + "pLuCu0Ka", + "FsQL6FXV", + "U859rPyK", + "y3Ko1fGT", + "LlLYE55K", + "sc0QxThr", + "TRoJ8Yc4", + "wSQEXFVB", + "VGzwSAM8", + "FGDF6byY", + "vwJk3fWs", + "k0RzoTGC", + "BNcnK1k5", + "LRFIdFuW", + "amI1oyGG", + "tBnivdbu", + "rXMG4HtT", + "HiLmugPC", + "fANI0ba4", + "LOGne5BJ", + "oTRDEoMt", + "QzhenNWE", + "9e6KHhU3", + "3aypqSNl", + "ElM4X70m", + "jMYaXwo6", + "QKpglnFb", + "LXyrdywi", + "VjaAEPBl", + "V8kulhC0" + ], + "icon_url": "https://cdn.modrinth.com/data/cl223EMc/9ad4bececf55487f1a69862bb0a83d58347f71c8.jpeg", + "issues_url": "https://github.com/Cristelknight999/Cristel-Lib/issues", + "source_url": "https://github.com/Cristelknight999/Cristel-Lib", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/cl223EMc/images/11e68225a792104a309304e4865464f2e94fa239.png", + "featured": false, + "title": "Built-in Vanilla placement config", + "description": null, + "created": "2023-05-01T18:29:24.396580Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/cl223EMc/images/973fb1607ff3685e128a2362e0387dfb2e3a0e61.jpeg", + "featured": false, + "title": "Vanilla config", + "description": "Set spacing to 1 and seperation to 0 for every vanilla structure", + "created": "2023-05-01T18:28:30.841193Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/cl223EMc/images/dff51d0855ae4ed90adee6c3d26c1abfc0ea7a63.png", + "featured": false, + "title": "Built-in Vanilla Enable/Disable config", + "description": null, + "created": "2023-05-01T18:29:04.668138Z", + "ordering": 0 + } + ], + "color": 4870466, + "thread_id": "cl223EMc", + "monetization_status": "monetized" + }, + "dawn-5.0.0": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.2", + "1.16.3", + "1.16.4", + "1.16.5", + "1.17", + "1.17.1", + "1.18-pre7", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1" + ], + "id": "meZK2DCX", + "slug": "dawn", + "project_type": "mod", + "team": "b1MWOYh5", + "organization": null, + "title": "Dawn API", + "description": "API that facilitates the creation of features.", + "body": "[![Dawn API](https://dawnteammc.github.io/dawn_api/images/header.png)](https://dawnteammc.github.io/)\n\n[![Discord user count](https://img.shields.io/discord/504608980799062036?label=&color=424549&labelColor=7289da&style=for-the-badge&logo=Discord&logoColor=DDE4EF)](https://discord.gg/8ksTVJu)\n[![Twitter followers](https://img.shields.io/twitter/follow/DawnTeamMC?label=&color=424549&labelColor=1DA1F2&style=for-the-badge&logo=Twitter&logoColor=DDE4EF)](https://twitter.com/DawnTeamMC)\n\nThe Dawn API is a library mod for the latest version of Minecraft that adds utility classes for constructing a typical mod for the Dawn Team. \nIt is designed to be handy and ease with the creation of any feature in the game through builder classes, and a variety of tools for data fixing.\n\n**You can visit the [GitHub repository of the Dawn API for more information](https://github.com/DawnTeamMC/DawnAPI).**\n\n## \ud83d\udc7e Features\nOther than being a useful API, the Dawn API is also bundled with some in-game tools too:\n\n- `/health` - A command that allows easy control over an entity's health.\n- `/foodbar` - A command that allows easy control over an entity's food/saturation points.\n- `/motion` - A command that allows easy control over an entity's motion (velocity).\n- `/export` - A command that can export information/files of the game's content.\n- A custom TNT entity with more NBT data parameters than the vanilla TNT entity.\n- A flying block entity which reflects the flying counterpart of the vanilla falling block entity.\n\n## \u2764\ufe0f Support\n[![Patreon supporters](https://img.shields.io/endpoint.svg?url=https%3A%2F%2Fshieldsio-patreon.vercel.app%2Fapi%3Fusername%3DHugman%26type%3Dpatrons&style=flat-square)](https://patreon.com/Hugman)\n\nYou can support the Dawn API on the [Patreon page of the founder, main developer and maintainer of the Dawn Team mods (Hugman)](https://patreon.com/Hugman).\n\nBy supporting Hugman, you can get access to the following:\n\n- Vote for the next features to be added to the Dawn Team mods\n- Get exclusive screenshots of the next features to be added to Dawn Team mods\n- Get early access to the latest beta versions of Dawn Team mods with new features\n- Get early access to new mods from the Dawn Team mods\n\n**We do not want to lock any in-game feature of the Dawn Team mods behind a paywall, because we believe that any Minecraft mod should forever remain free to download and fully exploit/use.** \nSupporting via Patreon is a more of way to help Hugman to continue to improve the mods and show the gratitude you might have towards Hugman's work.\nSome money you donate may be used to pay for new features, such as music or art, but not all of it.\n", + "body_url": null, + "published": "2020-12-24T15:24:14.401463Z", + "updated": "2023-06-23T10:27:48.019024Z", + "approved": "2020-12-24T15:24:14.401463Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 927695, + "followers": 135, + "categories": [ + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "z1AnuBqL", + "JaBFuXdi", + "uRUleN0r", + "YuE6MGlV", + "PHjw5h8f", + "WJ6k3SXq", + "doeoldhP", + "iLhacE2M", + "7pn0dcIQ", + "Q0B4OwqG", + "qfwdF6MJ", + "fAfSLlHR", + "IzL2SJpD", + "YtZZOcAe", + "OgVBH2lQ", + "xzF6wvdF", + "8FVAcXqk", + "rJ2vYNjm", + "QAp3E5ko", + "EL9KYvwA", + "YdQQ22Uv", + "QBOrsu8S", + "CQqeHfpr", + "LZIVk6xR", + "L2u6Q14i", + "lna7Bzt5", + "u7OB1Acz", + "J6b05anw" + ], + "icon_url": "https://cdn.modrinth.com/data/meZK2DCX/a7bd4416e708b3004e46a5859d93fe8275004d7b.png", + "issues_url": "https://github.com/DawnTeamMC/DawnAPI/issues", + "source_url": "https://github.com/DawnTeamMC/DawnAPI", + "wiki_url": "https://dawnteammc.github.io/", + "discord_url": "https://discord.gg/8ksTVJu", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/Hugman" + } + ], + "gallery": [], + "color": 6047452, + "thread_id": "meZK2DCX", + "monetization_status": "monetized" + }, + "Debugify-1.20.1+2.0": { + "client_side": "optional", + "server_side": "optional", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "QwxR6Gcd", + "slug": "debugify", + "project_type": "mod", + "team": "ArPsDJdJ", + "organization": null, + "title": "Debugify", + "description": "Fixes Minecraft bugs found on the bug tracker", + "body": "
\n\n\n\n# Debugify\n#### Debugify is a project that fixes **over 70** bugs found on the bug tracker in Minecraft.\n(and does nothing more!)\n\n[![wakatime](https://wakatime.com/badge/github/W-OVERFLOW/Debugify.svg?style=for-the-badge)](https://wakatime.com/badge/github/W-OVERFLOW/Debugify)\n![Lines of Code](https://img.shields.io/tokei/lines/github/isXander/Debugify?color=%23ff4747&label=Lines%20of%20code&style=for-the-badge)\n\n[![](https://short.isxander.dev/bisect-img)](https://short.isxander.dev/bisect)\n\n
\n\n## What does this mod replace?\nThis mod replaces many mods and implements fixes from some others\n\n- **[BetterShields](https://modrinth.com/mod/bettershields)**\n- **[Shift-Scroll Fix](https://www.curseforge.com/minecraft/mc-mods/shift-scroll-fix)**\n- **[ForgetMeChunk](https://www.curseforge.com/minecraft/mc-mods/forgetmechunk)**\n- **[ChunkSavingFix](https://www.curseforge.com/minecraft/mc-mods/chunk-saving-fix)**\n- **[force-close-world-loading-screen](https://modrinth.com/mod/forcecloseworldloadingscreen)**: Missing option to remove menu fully (as it isn't a bug)\n- **[No Telemetry](https://www.curseforge.com/minecraft/mc-mods/no-telemetry/)**\n- **[ToolTipFix](https://www.curseforge.com/minecraft/mc-mods/tooltipfix)**\n- **[Title Fix Mod](https://modrinth.com/mod/title-fix-mod)**\n- **[Entity Collision FPS Fix Refabricated](https://www.curseforge.com/minecraft/mc-mods/entity-collision-fps-fix-fabric)**\n- **[Ctrl Q](https://www.curseforge.com/minecraft/mc-mods/ctrl-q)**: Missing other QOL features that aren't bugs.\n- **[Skeleton Aiming Fix](https://www.curseforge.com/minecraft/mc-mods/skeleton-aiming-fix)**\n- **[2x2 Surrounded Saplings Fix](https://modrinth.com/mod/8187)**\n\n**These superseded mods are not hard conflicts and can be used in conjunction with Debugify for any additional advanced features.**\n\n## Links and other info\n[GitHub](https://github.com/isXander/Debugify) \u2022 [Curseforge](https://curseforge.com/minecraft/mc-mods/debugify) \u2022 [Modrinth](https://modrinth.com/mod/debugify) \u2022 [Patched bug list](https://github.com/isXander/Debugify/blob/1.19/PATCHED.md) \u2022 [Discord](https://short.isxander.dev/discord)\n\n## What if I want to enable some bug fixes, but not others?\nDebugify has a configuration GUI accessible by Fabric's [Mod Menu](https://modrinth.com/mod/modmenu).\nIf you don't want to it, there is always the configuration file located at\n`.minecraft/config/debugify.json`\n\n![configuration menu](https://user-images.githubusercontent.com/43245524/191992486-4ba9bd8f-db37-4021-b302-7f54701d8b08.png)\n\n## Client, or Server?\nDebugify includes many fixes for both the client and server (all server fixes also apply to client).\nSo you should definitely use it on both.\n\n## Can I include this in my modpack?\nYes! Of course! I even added a little feature in the mod for you! The constant updates may be exhausting to maintain,\nso I added a config option that defaults new bug fixes to off, until you get round to looking at it.\n\n## Credits\n- [**isXander**](https://github.com/isXander) - Founder of project\n- [**Contributors**](https://github.com/isXander/Debugify/graphs/contributors) - For PRing new fixes!\n- [**MoonTidez**](https://github.com/MoonTidez) - Creating an awesome logo!\n\n### Translators\n- [**RaptaG**](https://github.com/RaptaG) - Greek\n- [**Altegar**](https://github.com/Altegar) - Ukrainian\n- [**ttrafford7**](https://github.com/ttrafford7) - Ukrainian\n- [**GodGun968**](https://github.com/GodGun968) - Chinese\n- [**Agentew04**](https://github.com/Agentew04) - Portuguese\n- [**localfossa**](https://github.com/localfossa) - Turkish\n- [**xMikux**](https://github.com/xMikux) - Traditional Chinese\n", + "body_url": null, + "published": "2022-03-17T20:44:31.607662Z", + "updated": "2024-06-19T15:45:45.535281Z", + "approved": "2022-03-17T20:44:31.607662Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 3896789, + "followers": 1886, + "categories": [ + "optimization", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "quilt" + ], + "versions": [ + "d1wGDnOg", + "rvmKzdit", + "lFcWshUo", + "nDA4zR8b", + "bDJ6C3ee", + "YToHBCxz", + "SL7w72eH", + "phRoW4cz", + "XcwsnmsZ", + "1pnb6cGl", + "fX9fSRpc", + "D3InZWhh", + "NR1MuP9t", + "ez77o4vP", + "ZSOeDjPU", + "rlPcRBXm", + "nElg9xeo", + "J3zRK5bi", + "FatqexKs", + "tWRyPcFL", + "NDu88Zwa", + "hY3DKYio", + "aOxCEP3D", + "CSWmF24f", + "pPFCiLjA", + "BCj6Z3cx", + "TCs1cNbH", + "7WXEKPNx", + "Tk0RAQMD", + "rKzPCLMb", + "jlIRKhk7", + "m21FBC92", + "XtJaW95T", + "ltSWiXrH", + "jxiMbq1j", + "GeIPOMAw", + "IWgfkuO9", + "vgor1UDw", + "h7UENtbi", + "BmkonV8u", + "LVTec1Rh", + "US297WEJ", + "7nWg7CpV", + "2CSuLT5g", + "4J87zok9", + "11cqAA0W", + "1Wc2PZ7G", + "IhcW4hp4", + "jl2bfULg", + "qGM9M0wh", + "9xvnFOIg", + "KB2xqwsT", + "W2UIVXCp", + "SCJtEeya", + "HdzIkYvh", + "pYAlD9TK", + "UvBWAMZL", + "l8A2i9nV", + "fgjgGIfI", + "GtD9tAHh", + "v2s5aT84", + "CQP9o8LS", + "oevI3RPR", + "jskCDMsk", + "l6S5WIlU", + "7SaNcvDx", + "6ckEWNPu", + "GTuKuQLA", + "6XDJoCks", + "ZSI78Xd3", + "pfPFUzJF", + "vJOKWGcy", + "gGTvKKDk", + "aQYNRsGo", + "abm18PGR", + "wJlrMn2x", + "mOk69fib" + ], + "icon_url": "https://cdn.modrinth.com/data/QwxR6Gcd/d1db8e74a5ad29908bd011ce271145cea349cd13.png", + "issues_url": "https://github.com/isXander/Debugify/issues", + "source_url": "https://github.com/isXander/Debugify/", + "wiki_url": null, + "discord_url": "https://short.isxander.dev/discord", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/isxander" + } + ], + "gallery": [], + "color": 12886909, + "thread_id": "QwxR6Gcd", + "monetization_status": "monetized" + }, + "decorative_blocks-fabric-1.20.1-4.1.3": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4" + ], + "id": "t6BIRVZn", + "slug": "decorative-blocks", + "project_type": "mod", + "team": "LAvuvrzP", + "organization": null, + "title": "Decorative Blocks", + "description": "Some new blocks to build with", + "body": "![Decorative Blocks](https://cdn.modrinth.com/data/t6BIRVZn/images/66279b43dfb227b0638a0b0eced4e652d398b538.png)\n\nA small mod that adds several new decorative blocks including:\n\n- Bonfire, toss blaze powder into fire (configurable)\n- Thatch, \"fluid\" from cutting open a hay bale with shears, remove with hoes\n- Wooden Palisades\n- Wooden Beam Blocks, designed by u/ksym_\n- Brazier\n- Chandelier, reverse craft-able with 4 torches\n- Rocky Dirt, reverse craft-able with 4 dirt\n- Stone Pillar\n- Big Chain, climbable\n- Bar Panel, trapdoor\n- Lattice, trapdoor\n- Wooden Seats, right-click to sit\n- Wooden Supports\n- Soul Fire Variants of Bonfire, Brazier and Chandelier(1.16)\n\n\n- (1.18+) Seats and Supports have additional states, pressing shift on the items show tooltips.\n- (1.20+) Configure bonfire activator using the item tag #decorative_blocks:bonfire_activators\n- (1.20+) Disable thatch feature using the gamerule decorative_blocks:disableThatch\n\n\n\n\n\n", + "body_url": null, + "published": "2024-01-05T18:23:12.372937Z", + "updated": "2024-02-08T12:03:56.912286Z", + "approved": "2024-01-08T02:12:20.586899Z", + "queued": "2024-01-05T18:35:10.732256Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 203903, + "followers": 146, + "categories": [ + "decoration" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "YdxbJ3tP", + "eM3MGsQ2", + "qTuAZCQt", + "d01M9HeP", + "CU6dOEb7", + "ttBtmOJ2", + "e3pfVkaA", + "ensj9Kq3", + "Y7mlGZfl", + "pPxO8N8z", + "i2lSuiiI", + "Alg5ZNeZ", + "o2s3euCf", + "AshrJbUC", + "ZtnvgVoB", + "S3UyJ84T", + "FibgWXh0", + "nGmyeiug", + "nhJ1G0zi", + "txbqjIbZ" + ], + "icon_url": "https://cdn.modrinth.com/data/t6BIRVZn/3e537abf5cdb9f897636e126acd460d9575b2d06.png", + "issues_url": "https://github.com/lilypuree/Decorative-Blocks/issues", + "source_url": "https://github.com/lilypuree/Decorative-Blocks", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/t6BIRVZn/images/2e84047b2d70ff2170981db7f0fd07d90d884215.png", + "featured": false, + "title": "A dungeon build", + "description": null, + "created": "2024-01-05T18:28:52.418889Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/t6BIRVZn/images/66279b43dfb227b0638a0b0eced4e652d398b538.png", + "featured": false, + "title": "Logo", + "description": null, + "created": "2024-01-05T18:31:26.571452Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/t6BIRVZn/images/acd3df9cce06042d02f1e0b92266e2d769eab683.png", + "featured": false, + "title": "A house build", + "description": null, + "created": "2024-01-05T18:27:39.836928Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/t6BIRVZn/images/f049d272d2931b878e1dc66cec559dd84adf5b94.png", + "featured": true, + "title": "A mineshaft build", + "description": null, + "created": "2024-01-05T18:27:17.419958Z", + "ordering": 0 + } + ], + "color": 14591024, + "thread_id": "K3zRw3Od", + "monetization_status": "monetized" + }, + "deeperdarker-fabric-1.20-1.2.6": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19.1", + "1.19.2", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4" + ], + "id": "fnAffV0n", + "slug": "deeperdarker", + "project_type": "mod", + "team": "YFnVO00Q", + "organization": null, + "title": "Deeper and Darker", + "description": "A Minecraft 1.19+ mod which features more blocks, items, armors, and hidden mysteries to complement the new Deep Dark biome. Our website: https://kyanitemods.dev", + "body": "![Deeper and Darker logo](https://kyanitemods.dev/assets/deeper_and_darker_banner.png)\n\n
\n \"Discord\" \"\u2022\" \n
\n\n## About\nDeeper and Darker is a mod that aims to enhance the Deep Dark in Minecraft. It adds many new features related to the Deep Dark and a new dimension called the Otherside. Some content from Deeper and Darker: blocks such as sculk stone, gloomslate, and sculk grime; items such as warden tools, the sculk transmitter, and sculk-related mob loot; warden armor; and three different Otherside biomes! Play the mod to find more content and explore hidden mysteries!\n\n## Translations\nWe hope to make Deeper and Darker available for everyone, everywhere. This is done with the help of the community! You can help translate the mod into your language by visiting our [Crowdin page](https://crowdin.com/project/deeper-and-darker)!\n\n## Guide\nDon't know how to begin with Deeper and Darker? Check out our [wiki](https://github.com/KyaniteMods/DeeperAndDarker/wiki)! (still a WIP)\n\n## Issues\nIf you ever experience any issues while playing with this mod, notify us on our [GitHub issue tracker](https://github.com/KyaniteMods/DeeperAndDarker/issues)! Follow the bug report guidelines and be as clear as you can.", + "body_url": null, + "published": "2022-08-15T23:47:37.646891Z", + "updated": "2024-02-01T00:43:47.095226Z", + "approved": null, + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 1296233, + "followers": 662, + "categories": [ + "adventure" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "quilt" + ], + "versions": [ + "zmp1LB6f", + "gWRODK5Q", + "qr1SDsRQ", + "vQCalsBD", + "exzshERl", + "KgYMq0zk", + "qi2DH2qg", + "ZbrcAoke", + "q4LMiB6a", + "YWgNPb6Z", + "dW4fJEGS", + "BxueFKJA", + "bEomsNE8", + "Z1CNQsOB", + "tqPSIRGd", + "kzN5jWrn", + "yt5JPvPy", + "29izFsIU", + "QG8B6a6i", + "pqVYNVoY", + "2dsMRTRQ", + "jb78cjt3", + "X7tslFgA", + "8YNGmA5A", + "MjflezeV", + "VaezarCx", + "yjzDdEJ8", + "qJBXtnKM", + "1flbYGIw", + "Ze2TE9b0", + "YFALMm6i", + "ymLEGdJs" + ], + "icon_url": "https://cdn.modrinth.com/data/fnAffV0n/cbcb38cd738e0b0d1c4b583d5bfb56838a4b101d.png", + "issues_url": "https://github.com/KyaniteMods/DeeperAndDarker/issues", + "source_url": "https://github.com/KyaniteMods/DeeperAndDarker", + "wiki_url": null, + "discord_url": "https://discord.gg/67nsqXZeej", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/fnAffV0n/images/052945bff1324f0e9da96c4d87c3117612154203.png", + "featured": false, + "title": "Phantoms", + "description": null, + "created": "2022-10-28T17:04:07.281764Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/fnAffV0n/images/1de71fa25290d1ab1a12c1c43aabed0b15821001.png", + "featured": false, + "title": "Echoing Cave", + "description": "Small cave generated with an echoing tree", + "created": "2022-10-28T16:56:19.401764Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/fnAffV0n/images/293623bce265e6187693682e86df19199009e859.png", + "featured": false, + "title": "Echoing Forest", + "description": "Loud and Clear", + "created": "2022-10-28T17:05:09.372622Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/fnAffV0n/images/412779efc8ccbba4c623cd3be5456bfc1ff9cba2.png", + "featured": false, + "title": "Echo Tree Layer Formation", + "description": "Look at those layers", + "created": "2022-10-28T16:51:22.441819Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/fnAffV0n/images/4165e03c43dce98974916f42de8e6119f1c0bb96.png", + "featured": false, + "title": "Echoing Cliffs", + "description": "Echoing Forest biome generated on a cool cliff", + "created": "2022-10-28T16:55:39.565426Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/fnAffV0n/images/827979f6a01b7e6683fe3388abb3ac2331478183.png", + "featured": false, + "title": "Otherside Caverns", + "description": null, + "created": "2022-10-28T17:01:52.779780Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/fnAffV0n/images/9d0ce9a28cb486455691d9fd839e23164206876b.png", + "featured": false, + "title": "Cool Otherside generation", + "description": null, + "created": "2022-10-28T16:56:11.231856Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/fnAffV0n/images/a58f60e100af07e60de0e5976d28794bbddc472e.png", + "featured": true, + "title": "The Otherside", + "description": "Below the Bedrock", + "created": "2022-10-28T17:04:40.731783Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/fnAffV0n/images/bb5803cc37b02c11c9f9735977ae338f94e84493.png", + "featured": false, + "title": "Ancient Temple", + "description": "Home of the Warden", + "created": "2022-10-28T17:01:27.882750Z", + "ordering": 0 + } + ], + "color": 6650215, + "thread_id": "fnAffV0n", + "monetization_status": "monetized" + }, + "DEUF_Refabricated-MC1.20.1-1.1.0": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "US6QuKdU", + "slug": "deuf-refabricated", + "project_type": "mod", + "team": "pzC89Qto", + "organization": null, + "title": "DEUF Refabricated", + "description": "Fixes entities duplicated UUIDs, removing log spam and preventing crashes.", + "body": "


\"\"

\n
                                                                   
\n
  
\n

DEUF Refabricated is a fabric port of the mod DEUF (Duplicated Entity UUID Fixer) by CAS-ual-TY. It fixes duped UUIDs, removing log spam and also fixing some crashes.

\n

This mod only needs to be present on the server to work. But it's recommended to be included in modpacks to fix these issues while on singleplayer.

\n

 

\n

The entities will only be fixed on spawn, which means that if your world already has duplicated entities, this will not fix it, you'll have to remove them. Future entities that spawn while this mod is installed will not be duplicated.

", + "body_url": null, + "published": "2023-11-23T07:28:06.265344Z", + "updated": "2024-06-13T16:40:16.290915Z", + "approved": "2023-11-26T03:01:24.816289Z", + "queued": "2023-11-23T07:30:05.202807Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 315282, + "followers": 24, + "categories": [], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "zdMcvPfo", + "pizP8FAq", + "J8DbEbsW" + ], + "icon_url": "https://cdn.modrinth.com/data/US6QuKdU/9d8534a557786fc68eb28926ba65b693dc0867e4.png", + "issues_url": null, + "source_url": null, + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": 13167377, + "thread_id": "E0mwDSmd", + "monetization_status": "monetized" + }, + "Dimensional Sync Fixes": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.18.2", + "1.19.2", + "1.20.1" + ], + "id": "445bpKSe", + "slug": "dimensional-sync-fixes", + "project_type": "mod", + "team": "cUoLaOIV", + "organization": null, + "title": "Dimensional Sync Fixes", + "description": "Fix potion/experience sync issue when players change dimension.", + "body": "## Dimensional Sync Fixes\nThis mod fixes two bugs.\n\n- Player's potion effects icons disappear for a bit of time after teleporting to a modded dimension.\n\n- Player's experiences in client bar disappear after teleporting to a modded dimension.\n## Misc\n[![image](https://www.bisecthosting.com/partners/custom-banners/75401fe6-76e7-471c-89e5-1edd37a950ad.webp)](https://bisecthosting.com/kasualix)", + "body_url": null, + "published": "2023-12-16T08:21:02.369653Z", + "updated": "2023-12-16T08:25:52.553853Z", + "approved": "2023-12-18T07:10:19.911756Z", + "queued": "2023-12-16T08:28:21.709314Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LGPL-3.0-or-later", + "name": "GNU Lesser General Public License v3.0 only", + "url": "https://github.com/MCTeamPotato/DimensionalSyncFixes/blob/1.19.2/LICENSE" + }, + "downloads": 111889, + "followers": 6, + "categories": [ + "management", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "R2sRG9XO", + "RHumPmXP", + "EcjrV5lh", + "Czaob9r1", + "jAIIdFG4", + "ytqWo3I1" + ], + "icon_url": "https://cdn.modrinth.com/data/445bpKSe/0b7c2c9c394af9dfa0bb077b736721490987220e.png", + "issues_url": "https://github.com/MCTeamPotato/Kasualix-Issue-Tracker", + "source_url": "https://github.com/MCTeamPotato/DimensionalSyncFixes", + "wiki_url": null, + "discord_url": "https://discord.gg/g8q3UHTpCP", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/kasualix" + } + ], + "gallery": [], + "color": 1315860, + "thread_id": "proJ1DcF", + "monetization_status": "monetized" + }, + "DistantHorizons-2.1.2-a-1.20.1-forge-fabric": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.16.3", + "1.16.4", + "1.16.5", + "1.17", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.20.6", + "1.21" + ], + "id": "uCdwusMi", + "slug": "distanthorizons", + "project_type": "mod", + "team": "FulsV5Ai", + "organization": null, + "title": "Distant Horizons", + "description": "See farther without turning your game into a slide show", + "body": "
\n \"Distant\n
\n\n\n\n
\n\nWhat does Distant Horizons do? \n
\nSimply put, it add simplified terrain past Minecraft's default view distance to improve performance and allow for longer draw distances.\n
\nNow you can finally enjoy that lookout tower you built on top of a mountain!\n\n![Cliffside Village](https://media.forgecdn.net/attachments/880/249/dh-512-rd.jpg)\n###
This photo was taken with a Minecraft render distance of 12 and a mod distance of 512.
\n

\n\n
\nIf you want to see a quick demo, check out the latest update video\n

\n\n\n\n


\n\n## Hey, Hey you! This is important!\n\nThe version support numbers are strict!
\nIf a version says it supports MC 1.18.1 it will NOT work on 1.18.2!
\n\nAnd: the mod is still in alpha. Things may change, break, crash or otherwise go wrong. You have been warned!
\nAlthough if you have problems feel free to leave an issue on the project's GitLab.\n
\n \n\n \n## FAQ:\n\n**Q: Forge or Fabric?**
\nA: MC 1.20.6 and newer - NeoForge and Fabric are both in the same jar.
\nMC 1.20.4 and older - Forge and Fabric are both in the same jar. \n\n**Q: Shaders?**
\nA: Yes, but only with certain shaders.
\n- Optifine: DH partially works with forward rendered shaders.\n- Iris (and equivalent ports): DH 2.1.0+ only works with Iris 1.7+ and only with shaders built with DH support in mind. \n - DH 2.0 and older don't work with Iris.\n\n**Q: Does this work with player created structures?**
\nA: Yes.\n\n**Q: Is there multiplayer support?**
\nA: Yes.\nAlthough currently the mod is only client side so you have to explore chunks for the mod to use them.\n\n
\n\n### Extended FAQ:\n\n\n\n
\n\n\n\n
\n\n\n\n\n\n

\n\n\n## Discord:\nJoin our Discord for news, updates, and help:\ndiscord.com/invite/xAB8G4cENx\n

\n\n\n## Support us:\n\nIf you want to help with development, join our discord and let us know!\n\nOtherwise if you can't help with development but still want to support Distant Horizons, check out our donation page:\n\nhttps://ko-fi.com/distanthorizons", + "body_url": null, + "published": "2022-01-23T05:46:55.026356Z", + "updated": "2024-06-26T00:01:35.253383Z", + "approved": "2022-01-23T05:46:55.026356Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 2135908, + "followers": 5053, + "categories": [ + "optimization", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "wTtGd14B", + "DezAJ8u0", + "x3yEpy5p", + "ruuHY8OM", + "2vU5aacx", + "28PMiKSx", + "JseXmZpZ", + "AHJ0mNv1", + "k5oJ58yR", + "JV4jiA1y", + "qLXa9pDD", + "FnXdZRJ7", + "z6ZQBfWx", + "Pn7d9p7i", + "KrGwvvWA", + "6ZzUWKxi", + "KEWnNiUP", + "8ctYpkCM", + "QdxhQapq", + "McgrFayO", + "ArHY9dmV", + "38p3qCjb", + "yEUygWBv", + "P4psgCf3", + "xBHpiuwg", + "qT4v0LBa", + "QLrBlpYY", + "mxvQyywi", + "oYqpZUCe", + "yqCZe843", + "f5ukM1Qm", + "mjIVHovM", + "zhP09epG", + "nLshnREE", + "s3sNOqn2", + "aOWEQ1nc", + "r8OABIpt", + "fAVxiMK6", + "3yoHVgxZ", + "6pQHeelV", + "VnKmHe1I", + "P8tkVBXd", + "XLWDF2NT", + "hsb0wIeu", + "xbRHd92j", + "3B15sgvb", + "HbiwjG8y", + "13xaVT4W", + "rvEYu8Iv", + "pllFih8s", + "TSpsYWzW", + "8z7hnzLN", + "T98hbY34", + "OwcStAhe", + "VPs4DNbT", + "YN8jhotL", + "9dof9TBP", + "NCz4yZ3v" + ], + "icon_url": "https://cdn.modrinth.com/data/uCdwusMi/icon.png", + "issues_url": "https://gitlab.com/jeseibel/distant-horizons/-/issues", + "source_url": "https://gitlab.com/jeseibel/distant-horizons", + "wiki_url": "https://gitlab.com/jeseibel/distant-horizons/-/wikis/home", + "discord_url": "https://discord.gg/xAB8G4cENx", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/distanthorizons" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/uCdwusMi/images/153a12159c2f00a59190623906b79245ddeaec8a.png", + "featured": false, + "title": "Variable Detail", + "description": "Fake chunks closer will become larger and less detailed the further they are from the player, increasing performance.", + "created": "2022-06-07T02:46:42.413300Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/uCdwusMi/images/1b27a855d3b44c0d1b7bc111b7e22d1c6f9a9e5d.png", + "featured": false, + "title": "Modded Terrain Generation", + "description": "Distant Horizons works with mod terrain generators! (Terralith 2.0 shown in this image)", + "created": "2022-06-07T02:51:26.416185Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/uCdwusMi/images/1fc59e3c050f6a06635ccf37aa2b8125bb9856c5.png", + "featured": false, + "title": "Detail levels", + "description": "The mod will render chunks at different detail levels depending on how far they are from you.", + "created": "2022-06-07T03:08:02.244410Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/uCdwusMi/images/53bd0a0be0d54480da03175ce1c6901df826f00f.png", + "featured": false, + "title": "Cliff side 2", + "description": "Vanilla render distance 4. Mod render distance 512.", + "created": "2022-06-07T02:52:29.740651Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/uCdwusMi/images/5dac2a283e66ed9da0f76ec5a8a6cd243309bff1.png", + "featured": false, + "title": "Cave/Nether support", + "description": " ", + "created": "2022-06-07T02:47:51.575910Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/uCdwusMi/images/5f1a20ee735c1dcd026e62228301f7d10928a299.png", + "featured": false, + "title": "The End", + "description": "Finding end cities will be much easier now. Photo taken by: Bunshaman", + "created": "2022-07-17T13:33:42.641700Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/uCdwusMi/images/65eb075cb80cf3f12cc403aa27a12b9377c40b36.png", + "featured": false, + "title": "Ciff side 1", + "description": "Vanilla render distance 4. Mod render distance 512.", + "created": "2022-06-07T02:52:53.882646Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/uCdwusMi/images/669f60450b322881d01972de2671ff5ab87dab3b.gif", + "featured": false, + "title": "Detail levels (gif)", + "description": "The mod will render chunks at different detail levels depending on how far they are from you.", + "created": "2022-06-07T03:08:24.100552Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/uCdwusMi/images/80be8f6d024e322dc5a7538a4a0b187f2bc87210.png", + "featured": false, + "title": "256 render distance", + "description": "By default the mod renders at 64, but can go up to 4096! (although anything above 512 may become difficult due to high RAM or GPU usage)", + "created": "2022-06-07T02:47:26.204976Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/uCdwusMi/images/8a194aa0cdd60a695550eb53110a6f61d880db57.jpeg", + "featured": false, + "title": "1024 render distance", + "description": "Showing MC 1.16", + "created": "2023-11-18T14:30:55.851012Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/uCdwusMi/images/9b85cf731ecc3100866ccc8e43d60d40c8d189ed.png", + "featured": true, + "title": "A Distant Horizon", + "description": null, + "created": "2022-06-07T02:50:17.573019Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/uCdwusMi/images/b0981e8472507c468d00b4e466d38c0801c7425e.png", + "featured": false, + "title": "Custom map support", + "description": "Pictured: Super Hostile Iceolation", + "created": "2022-06-07T02:48:58.993459Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/uCdwusMi/images/b743960d0cbdde7f54edc07de127bc59c6b06350.png", + "featured": false, + "title": "Client-side Multiplayer Support 1", + "description": "Photo taken from the Pioneer Survival server", + "created": "2022-08-20T19:56:07.314760Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/uCdwusMi/images/f379ba97a83c9ebe18da3ebed2de3f449117f8e8.png", + "featured": false, + "title": "Client-side Multiplayer Support 2", + "description": "Photo taken from the Pioneer Survival server", + "created": "2022-08-20T19:56:09.442323Z", + "ordering": 0 + } + ], + "color": 6061116, + "thread_id": "uCdwusMi", + "monetization_status": "monetized" + }, + "doubledoors-1.20.1-5.9": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.18.2", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "JrvR9OHr", + "slug": "double-doors", + "project_type": "mod", + "team": "9myZzd0c", + "organization": null, + "title": "Double Doors", + "description": "\ud83d\udeaa Multiple identical double doors, trapdoors and fence gates can be opened simultaneously.", + "body": "

\"\"

Requires the library mod Collective.

   This mod is part of The Vanilla Experience modpack and Serilum's RPG Bundle mod.
Double Doors is a minimalistic mod which adds the ability for identical double doors, trapdoors and fence gates to be opened simultaneously. This can be done by clicking any of the (wooden) doors, or via a single pressure plate or button. By default the mod will also find other connected door-type blocks and open those, up to a maximum of 10 blocks away. This can be toggled in the config.

Crouching will disable the double door feature and open/close the single block only.


Configurable: ( how do I configure? )
enableRecursiveOpening (default = true): Whether the recursive opening feature should be enabled. This allows you to for example build a giant door with trapdoors which will all open at the same time, as long as they are connected. The 'recursiveOpeningMaxBlocksDistance' config option determines how far the function should search.
recursiveOpeningMaxBlocksDistance (default = 10, min 1, max 32): How many blocks the recursive function should search when 'enableRecursiveOpening' is enabled.

enableDoors (default = true): When enables, the mod works with double doors.

enableFenceGates (default = true): When enables, the mod works with double fence gates.
enableTrapdoors (default = true): When enables, the mod works with double trapdoors.

enableModIncompatibilityCheck (default = true): Checks if there are other mods loaded with double door functionality. If found, it edits a line in their config to disable double doors. Fixes doors not opening due to code being ran twice.



Works with all the double door configurations, but also recursively with all others!




The Recursive Update (3.0)!
Any connected door-type block will now be found recursively and opened:

\r\n
Show Spoiler\r\n

\r\n
\r\n

 
By default the recursive function will open blocks 10 blocks away, but this can be changed with the 'recursiveOpeningMaxBlocksDistance' config:

\r\n
Show Spoiler\r\n

\r\n
\r\n

 

\r\n



Some more GIFs!
Click on any of the two doors and the other one will open as well:

\r\n
Show Spoiler\r\n

\r\n
\r\n



Open iron doors with a single button, or any other configuration.

\r\n
Show Spoiler\r\n

\"gif1\"

\r\n
\r\n

 

Works with trapdoors and fence gates on top of each other, by click or pressure plate/button.

\r\n
Show Spoiler\r\n

\"gif2\"

\r\n
\r\n


------------------

You may freely use this mod in any modpack, as long as the download remains hosted within the Modrinth ecosystem.

Serilum.com contains an overview and more information on all mods available.

Comments are disabled as I'm unable to keep track of all the separate pages on each mod.
For issues, ideas, suggestions or anything else there is the Github repo. Thanks!


\"\"

", + "body_url": null, + "published": "2022-09-01T14:30:59.023932Z", + "updated": "2024-08-09T00:13:52.005424Z", + "approved": null, + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 1208806, + "followers": 729, + "categories": [ + "game-mechanics", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "uMtSqq25", + "1cCIpEN2", + "ZMeDH05m", + "RBmJ0sL5", + "ySAnWVa4", + "GfHBpGiR", + "Kz8m9noN", + "GGogzoUX", + "bjwrtdCy", + "7YoUGcWO", + "NtQD1091", + "6ZMyUnaZ", + "IHDNX4M0", + "ldzOukBA", + "7Hq4Vu1h", + "ycQmvIga", + "VqbmtGI9", + "cczPWm1T", + "tUVGgQuz", + "X02YG8Ar", + "uE1IpYIR", + "5o1H17YL", + "zQaSjsXC", + "pMC1D1S6", + "Dv3IdFaR", + "AluVqjP1", + "x8joF98U", + "qIRwsGjm", + "5GzifXEr", + "koSEBEJN", + "i4vnRwZ9", + "jVeTO9sG", + "4Gl2grdz", + "VYzuL8wR", + "tc0qEExa", + "Ng9ISXia", + "DGSz62su", + "gD1pxTeg", + "T56W4nwq", + "m26JddLH", + "PYWSGxBg", + "cOJlU2VV", + "Svpi9MVy", + "2P1hF8zC", + "lVOR7EbI", + "sI6nU1bI", + "JgZWUQzs", + "4mNaY7Dm", + "NtXNTPiD", + "dIGF22CF", + "4GaDmDF5", + "jQ5ZvTEg", + "sW02ma9K", + "vRq35kRk", + "sMh3ix8W", + "zcGJKmD1", + "T5ELSHkr", + "v33tCYzi", + "iSrhkPRf", + "IX1EaUNx", + "noOLikKt", + "LnSdDS0F", + "b1xhLTE3", + "xY8NOS7J", + "G2Uykn6q", + "K8M8C81n", + "j7t5kHw4", + "D0X7OyKI", + "r73PhzrG" + ], + "icon_url": "https://cdn.modrinth.com/data/JrvR9OHr/icon.jpg", + "issues_url": "https://github.com/Serilum/.issue-tracker/labels/Mod: Double Doors", + "source_url": "https://github.com/Serilum/Double-Doors", + "wiki_url": null, + "discord_url": null, + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://patreon.com/serilum" + } + ], + "gallery": [], + "color": 4140828, + "thread_id": "JrvR9OHr", + "monetization_status": "monetized" + }, + "Dungeon Now Loading-fabric-1.20.1-1.5": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20.1" + ], + "id": "vZoqTqwv", + "slug": "dungeon-now-loading", + "project_type": "mod", + "team": "sRu0Cjd8", + "organization": null, + "title": "Dungeon Now Loading", + "description": "Explore the vast, challenging dungeons that are loaded into your world! This mod introduces new dungeons, along with tricky, but fair bosses to fight at the end of the dungeon.", + "body": "\n\n\n# About\nExplore the vast, challenging dungeons that are loaded into your world! The mod introduces a number of new dungeons to explore with various sizes and themes, along with a tricky boss to fight at the end of many structures. Obtain the new items to fight through a number of mobs that block your path. Reach the end of the dungeon and defeat the bosses to claim the reward and dungeon for yourself! Welcome to Dungeon Now Loading! Explore and discover, curious dungeoneers!\n\n# Goal\nOur goal is simple: to add 100 new challenging, but fair dungeons and bosses to the world of Minecraft. Minecraft is a sandbox game and players find their own way to enjoy the game, but we believe that there are players that want difficult challenges that demand more skills and knowledge from Minecraft. Our objective is to fill in that gap by adding fun challenges in the shape of dungeons and bosses, while providing more tools that the players can use to face the challenges. We update the mod regularly and every 1% increase in the percentage will be an update that adds in a new structure and boss or a significant update that changes the gameplay of the dungeons. If you are interested in joining our journey to 100%, try out our Dungeon Now Loading Mod!\n\n# \n![Discord](https://cdn.modrinth.com/data/cached_images/78655f8542a976bfbd438a5128706b10f95243e6.webp)\n\nWe have a friendly community in our discord and many activities going on such as:\n\n- Idea Polls\n- Update Announcements\n- Development Sneak Peek\n- Structure Suggestions\n- Checkpoint Player Head Submissions\n- Giving Feedbacks\n- Channels for Sharing Projects\n\nFeel free to stop by: \n\n**Discord Link:** [https://discord.gg/NawU3rgAhE](https://discord.gg/NawU3rgAhE)\n\n#\n![Patreon](https://cdn.modrinth.com/data/cached_images/d34f5f31439550656025a524cb7e51a7e8bc7db1.webp)\n\n\n\nWe also have Patreon! We really appreciate the support we get through Patreon because it lets us dedicate more time to the project and develop higher-quality dungeons and bosses. If you are interested in supporting us, you can check out our Patreon. We also have Patreon-exclusive content:\n\n- Tallest Battle Tower Mod\n- Creeper Dungeon\n- Weapon Dungeon\n- Early Access\n\n... and more coming soon!\n\n**Patreon Link:** [https://www.patreon.com/dungeonnowloading](https://www.patreon.com/dungeonnowloading)", + "body_url": null, + "published": "2024-04-18T20:40:34.173251Z", + "updated": "2024-05-13T08:57:02.546155Z", + "approved": "2024-04-19T05:36:19.091898Z", + "queued": "2024-04-18T21:01:55.296240Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 48328, + "followers": 246, + "categories": [ + "adventure", + "mobs", + "worldgen" + ], + "additional_categories": [ + "decoration", + "equipment", + "game-mechanics" + ], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "4ec709uf", + "dX87HM6Y", + "YgioyQai", + "VlU0PV0X", + "xRaq2k4c", + "dfvo8Siq", + "9wtZvBUJ", + "pAQkzzvR", + "nPc4JZud", + "9r9T19Iv", + "e2aaNGip", + "lYoa4Cf2" + ], + "icon_url": "https://cdn.modrinth.com/data/vZoqTqwv/d4f5abc97489df78a8743d3db4e616301ae8cb11.png", + "issues_url": null, + "source_url": "https://github.com/hexnowloading/DungeonNowLoading", + "wiki_url": "https://youtu.be/-lCfUTTDPt8", + "discord_url": "https://discord.gg/NawU3rgAhE", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/dungeonnowloading" + } + ], + "gallery": [], + "color": 1607821, + "thread_id": "iOOmEcNV", + "monetization_status": "monetized" + }, + "dungeons-and-taverns-3.0.3.f": { + "client_side": "optional", + "server_side": "required", + "game_versions": [ + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "23w43b", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "tpehi7ww", + "slug": "dungeons-and-taverns", + "project_type": "mod", + "team": "rThExdJv", + "organization": null, + "title": "Dungeons and Taverns", + "description": "A Structure Datapack adding dungeons, taverns and other structures to find while you explore the world.", + "body": "This datapacks adds (hopefully) vanilla like structures that are supposed to blend in with the rest of the game and feel like they belong there. going from environmental additions like fire watch towers and taverns to dungeons like badland minder outpost and illager hideout\n\nThis datapack also adds 12 new enchantments:\n\nWax Wings, Elytra Enchantment that doesnt make you lose durability while gliding slowly\n\nGravity, Crossbow Enchantment that pulls any Entity close to arrow impact, including yourself, up to 3 levels\n\nOutreach, Chestplate Enchantment that makes you able to interact blocks from further away\n\nPower Crossbow, Enchanted Weapon working like Bows with Power, but only working on Crossbows instead\n\nPiercing Bow, Enchanted weapon working like Crossbows Piercing, but only working on the Bow instead\n\nMultishot Bow, Enchanted weapon working like Crossbows Multishot, but only working on the Bow\n\nGhasted, Shoots Explosing Arrows with the strengh of a Ghast\n\nWither Coated, Weapon Enchantment that has the chance to apply the Wither Effect on an Entity, but halves the tools Durability. Mutex with Fire Aspect\n\nPhotosynthesis. Armour and Tools Enchantment that slowly regenerates Durability while exposed on sunlight, works if worn by armourstands. Mutex with Mending\n\nTraveler, Boots Enchantment that makes you slightly faster while sprinting and increases your stephight so you can walk up 1 block high slopes like a horse\n\nAntitoxin, Chestplate enchantment that makes you immune to any poison damage, not even flinching, But it damages your Chestplate instead. Mutex with Protection Enchantments like any of the Protection Enchantments\n\nIllagers Bane, Weapon Enchantment that deals more damage against Illager, like smite and sharpness its mutex to the other damage ups\n\nIf you dont Want those enchantments, use this datapack:\n[https://modrinth.com/datapack/nofun-dnt](https://modrinth.com/datapack/nofun-dnt)\n\nthe current structure list is:\n[See Here](https://modrinth.com/datapack/dungeons-and-taverns/gallery)\n\nif you have trouble to find dungeons, type \"/locate nova_structures:[\u200bsame name as the list above but with \"_\" instead of a space]\"\n\nI want to add more in the future but this is the first wave,\nI hope you enjoy and check out Walls who made all the loot tables for dungeons and structures", + "body_url": null, + "published": "2023-01-18T09:32:19.251896Z", + "updated": "2024-08-11T20:25:07.640055Z", + "approved": "2023-01-19T02:02:05.205540Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 1645245, + "followers": 2202, + "categories": [ + "adventure", + "worldgen" + ], + "additional_categories": [ + "equipment", + "game-mechanics", + "mobs" + ], + "loaders": [ + "datapack", + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "Bu5yOV7W", + "Xxd8P6Zd", + "3xZCKnNP", + "Jnkxo1iF", + "YpcauYaz", + "6jYRpbET", + "dLO6I3Nl", + "WfuA1Ai8", + "Q6eAdyTS", + "Mae0FR2O", + "6UAxzRAA", + "QS0c2TKO", + "xnCIjJAt", + "Ag2CCqRR", + "gycjhGu8", + "ftDL6az5", + "mKvlJEuC", + "uTKeYJtp", + "DOik2Tex", + "M0kmi04X", + "XU0RDl74", + "R8dnbQxW", + "izDu3Gb1", + "7exROg07", + "GtkzV91q", + "kcIxXe4e", + "JOwejnHw", + "bFY892GN", + "GALaKblF", + "YU0OIwaI", + "HdMGscqY", + "T69yfV93", + "kZX54y2P", + "fZUvwQng", + "cpJzZfzm", + "SD5oMTXr", + "xwTzTss5", + "J9ojWPrx", + "ojHpWOrz", + "d1sY0JqV", + "39mJLpd3", + "o1B7QqhO", + "OMafyUuX", + "R36cO4pA", + "UHxEgLka", + "HYerXxJh", + "iUQqUGSu", + "k5UAHKdy", + "GHO5nkWN", + "aAFAcp4I", + "PMP2xbsv", + "9LF8LPu8", + "rAD9sBYg", + "QmeQn0Mp", + "h2N7kIqz", + "PoMcAQWW" + ], + "icon_url": "https://cdn.modrinth.com/data/tpehi7ww/c0d9e67718784e9718a35bdc6c807fc0aa0711c7.png", + "issues_url": null, + "source_url": null, + "wiki_url": null, + "discord_url": "https://discord.com/invite/fPvvmcnKza", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/0188e5c2c8418fe7f056de3efaef386424ba66f7.png", + "featured": false, + "title": "Swamp Villages", + "description": "Find villages in swamp with... witches? seems like getting that mending librarian isn't going to be that easy.", + "created": "2023-10-13T20:56:35.754041Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/05e9af8c67bf6dfc4ff5277b54bf7931ac18e537.png", + "featured": false, + "title": "Jungle Villages", + "description": "Spawning in Jungles are now jungle villages", + "created": "2023-10-13T20:57:18.239195Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/0aee26dee6ca898f5f1f000d0c368561120f4a61.png", + "featured": false, + "title": "Toxic Lair", + "description": "Swamp Structure found in swamp biomes. Surface area has ruins with suspicious gravel but the inside leads to an underground structure with a miniboss and several trial spawner/vaults and ominous vaults. you can find Antidote, Piercing/Multishot bows here", + "created": "2024-06-29T19:46:26.867434Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/2c4a28854f9f8f8323017b089e3255c90569e032.png", + "featured": false, + "title": "Undead Crypts", + "description": "Another underground Dungeon with alot of bones, skulls and other stuff with 1 spawner room", + "created": "2023-01-18T10:35:46.062439Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/2fb524d268fdd2ba4ee7ff1387f845b8113815fb.png", + "featured": false, + "title": "Triden Trail Monument", + "description": "Grant Prismarine structure not spawning guardians naturally but from trial spawner here, you can obtain tridents, heart of the sea and other goodies here", + "created": "2024-06-29T19:47:48.441628Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/317c1069973b8347f378c79708352c4964de88fe.png", + "featured": false, + "title": "Hamlet", + "description": "Nether Village for the Piglins. this structure is fortified and filled to the brim with Piglins but exploring it might hold some treasure. You can find maps for Piglin Outstations here", + "created": "2023-10-13T21:05:02.187798Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/36899cd0357525041513f129916bb4ea9b3fec1b.png", + "featured": false, + "title": "Jungle Ruins", + "description": "You aren't a fan of the small Jungle temple? maybe search for Jungle ruins then. Bogged spawn here and you can find the Photosynthesis Enchantment here", + "created": "2023-10-13T20:46:06.611165Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/41218bb765900f0b879a749799c13992d2d733fb.png", + "featured": false, + "title": "Lone Citadel", + "description": "Probably Dungeons and Taverns biggest structure yet. Recreating the Lone Fortress from Minecraft Dungeons and bringing it to vanilla. Breezes and Strays are at home here. you can obtain Power Crossbows from here", + "created": "2024-06-29T19:49:11.380030Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/4bfda49b26e9c431e0a1019297096dc0d90e0424.png", + "featured": false, + "title": "Nether Port", + "description": "Nether Port are a middle sized structure spawning at lava level with a crimson plank walkway around the main Port structure containing 1 blaze spawner and some treasure rooms", + "created": "2023-10-13T21:01:36.332485Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/4db1b0fdbf882cad90631786dc386aa5c11e127b.png", + "featured": false, + "title": "Piglin Outstation", + "description": "This Outstation has Piglins spawning all the times and contains a secret vault guarded by piglin brutes. You can find maps for Piglin Donjons here", + "created": "2023-10-13T21:05:59.698024Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/5a5e1fdba75d015cbae730963826f0cb296d2588.png", + "featured": false, + "title": "Illager Manor", + "description": "Grand Illager Structure replacing 50% of all Woodland mansions, filled with Evokers, Vindicators, Pillager and Witches, but also jailed Iron Golem, Villager and Allays. You can find Illagers Bane here", + "created": "2024-06-29T19:41:54.711593Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/5a6da738e9a421e15f6c9ccee65014e2d4c03f06.png", + "featured": false, + "title": "Ruined Towns", + "description": "Ruined Towns are ruins from the past with rubble everywhere with suspicious gravel holding mostly just junk but maybe some sherds and other tressures", + "created": "2023-10-13T20:55:31.171174Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/635aef485a21db14e0f172a0df86d3045e998166.png", + "featured": false, + "title": "Nether Skeleton Tower", + "description": "An tower structure inside the Nether generating with an loot chest and some smaller structures around, guarded by skeletons. You can find Nether Keep or Nether Port maps here", + "created": "2023-10-13T21:00:19.697850Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/67d1587898744a18c891ff3af0d0913f31d7a774.png", + "featured": false, + "title": "Nether Skeleton Camps", + "description": "Small structure spawning in the nether with biome variants holding a few skeletons and a loot chest. you can find Skeleton Tower maps here", + "created": "2023-10-13T20:59:08.975847Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/67e0a84f8b45448cc51c519ae2039b8d2984cb92.png", + "featured": false, + "title": "End Castle", + "description": "Ends version of a Stronghold and Endcity Hybrid. you can find Gravity, Wax Wings, End Ship Keys, End Crystals and other things here. can be found either with an End Castle Map or Eyes of Ender", + "created": "2024-06-29T19:40:29.963627Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/72fec0eda0f25605076c66ad9387f1c68f012831.png", + "featured": false, + "title": "Piglin Donjon", + "description": "The Donjon is a Megastructure spawning rarely in crimson forest biomes containing several room types of the various bastion remnants and container crates filled with gold. also look out for hidden vault rooms. Ontop is a Coloseum for Vault keys", + "created": "2024-06-29T19:36:45.869456Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/791e8321b453e39efb27e7f395413af187b9b1be.png", + "featured": false, + "title": "Creeping Crypt", + "description": "Creeping Crypts are an structure found in taiga biomes, filled with creeper, gunpowder, suspicious gravel and if you are lucky, even an creeper spawner alongside the other trial spawner spawning creepr and undead", + "created": "2024-06-29T19:53:17.545158Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/7d92bafda8ae0586a777a3fc4acc12e16c67f1ef.webp", + "featured": false, + "title": "Illager Hideout", + "description": "A rare underground Dungeon that is filled with Illagers. a challenge for late game player who seek a challenge", + "created": "2023-01-18T10:08:39.109550Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/7ef44cedae0b12c37f4a57affb1151ce47a594ed.png", + "featured": false, + "title": "Nether Keep", + "description": "This Mega Structure is an giant tower spawning inside the nether, containing 3 blaze spawner rooms with their own treasure chests. bridges hold trial Spawner and arenas to obtain keys for the vault inside. you can obtain Ghasted and Wither Coated here", + "created": "2024-06-29T19:54:32.454739Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/81b65db25341bcaca0ecd146fee3d44b6e7b29b6.webp", + "featured": false, + "title": "Stray Fort", + "description": "This fort generates in cold biomes and is infested with strays and guard towers", + "created": "2023-01-18T10:09:44.118569Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/83cdac3acb02b628da4d8b8d6e0d514f66d53f61.png", + "featured": false, + "title": "Desert Ruins", + "description": "Desert ruins are an archeology structure with an custom desert village spawning around it containing more archeology. you can obtain Outreach here", + "created": "2024-06-29T19:50:38.430678Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/93dc2790ee15a172f5e7a9100790dedde9ea6b35.webp", + "featured": true, + "title": "Taverns", + "description": "Taverns are places where you find beds and a Trader selling maps to some of the dungeons or ruins of this datapack. you need to trade with the trader once for them to unlock the Map Trades", + "created": "2023-01-18T10:02:02.133148Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/9c324aff5f0835b4ffef7f8e40b26351761f6ee9.png", + "featured": false, + "title": "Bunker", + "description": "A somewhat rare structure that resembles surface exposed strongholds, they have a bigger room variety and dont have an end portal chamber", + "created": "2024-06-29T19:27:16.513618Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/a70b379f7f0b18e762c56f4ba7aa6794082b1cbc.png", + "featured": false, + "title": "Wells", + "description": "why should the desert be the only place to have unnecessary wells?", + "created": "2023-01-18T10:37:24.768197Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/ae3b6e769ad5f6c06893c257d99e625734639a00.jpeg", + "featured": false, + "title": "Remnants", + "description": "Remnants are rare enviromental ruins, not different from wild ruins but MUCH MUCH rarer. one of them is a classic village that is abandoned", + "created": "2024-08-12T05:21:22.888001Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/af2bf4d1adf04c85a9347a380bc34d927a4f83bc.png", + "featured": false, + "title": "Badlands Miner Outpost", + "description": "This unique Outpost is more about the mining operations in Badlands. a good way to get gold and tnt", + "created": "2023-10-13T20:43:34.951861Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/bdad5c3d0022ae0f87c4a1974622478c2203fbcc.png", + "featured": false, + "title": "Witch Villa", + "description": "Spawning in swamp biomes and Mangrove Swamps those structure act as witches woodland mansion with their own experiments and own backyard", + "created": "2023-10-13T20:53:34.473229Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/c55944ee3b90dafe32c7a2e09617620bc844e8e8.webp", + "featured": false, + "title": "Firewatch towers", + "description": "They are atmospheric builds to make the world feel more lived in. you can use them as a small base or just to find a nights rest ", + "created": "2023-01-18T10:03:02.455997Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/ccbe787a85e5f1a2437cb287857cbc8e0213e30d.png", + "featured": false, + "title": "Piglin Camps", + "description": "Spawning in the nether they act as smaller structures with 1 Piglin Brute and a loot chest. You can find Hamlet maps here", + "created": "2023-10-13T20:58:01.065049Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/d0b976bd2249898c7879136af18d4b2a616596ed.png", + "featured": false, + "title": "Illager Camps", + "description": "The Illager are on the move and set up camps all over the world!\nthose small structures are a small challenge you can interact with on your travels. you can find Illager Structure Maps here", + "created": "2023-01-18T10:34:16.419471Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/d3edc01465923590e4abc93a94b0c5879de2c2c5.png", + "featured": false, + "title": "Shrines", + "description": "Shrines leading down to 1-5 themed combat arenas that all follow 1 theme per shrine, amound of copper bulbs indicate how many rooms there are. you can find Shrine Keys, Ominous Shrine keys and Traveler here. Ominous vaults are only in lv 5 shrines", + "created": "2024-06-29T19:44:45.301799Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/da8d00e00d485cddb7c6b169353d9909da528019.webp", + "featured": false, + "title": "Mangrove Swamp Hut", + "description": "the witches moved into the mangrove swamp with 3 different hut styles", + "created": "2023-01-18T10:06:24.344753Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/df194e2f9456e25f3244a81c7aa42a492bb6b913.png", + "featured": false, + "title": "End Ships", + "description": "Lone Endships spawning within the end containing a vault needing an End Ship Vault Key. Those vaults always hold Elytra. Maybe even enchanted with Wax Wings", + "created": "2024-06-29T19:38:02.526215Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/e9e56a5f4263a4df8b827dd45b0da3b846759b5f.png", + "featured": false, + "title": "Wild Ruins", + "description": "Under wild ruins fall things like small camps, huts and dead redstone golems, they are environmental and supposed to add to making the world feel more lived in", + "created": "2023-01-18T10:32:50.245310Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/eb5c4c1c4d8e8e327fc185def65f1e6e8e76229e.png", + "featured": false, + "title": "Underground House", + "description": "'tis but a terraria reference", + "created": "2023-01-18T10:36:20.691908Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/f33b18104a9a692002a71506f567d3c19704f661.png", + "featured": false, + "title": "End Lighthouse", + "description": "Structures spawning in the End acting as Ends version of Taverns. you can find maps here for End Castles and obtain End Ship Keys", + "created": "2024-06-29T19:39:14.689494Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/tpehi7ww/images/fb617439fd291d6ada2e783327d7e712d5f7ac28.png", + "featured": false, + "title": "Conduit ruin", + "description": "A way to teach player how to build a conduit with hints in the chest in the prismarine ring as well as being an archeological site", + "created": "2023-10-13T20:42:51.635760Z", + "ordering": 0 + } + ], + "color": 1710102, + "thread_id": "tpehi7ww", + "monetization_status": "monetized" + }, + "dungeon_difficulty-2.2.1+1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20.1", + "1.20.2" + ], + "id": "ENZmbSFZ", + "slug": "dungeon-difficulty", + "project_type": "mod", + "team": "3LWpH3z4", + "organization": null, + "title": "Dungeon Difficulty", + "description": "\u2620\ufe0f Increase the difficulty and get matching rewards.", + "body": "![](https://cdn.modrinth.com/data/ENZmbSFZ/images/49610e16c8825d1354622e5d523b70573830f3ad.png \"\")\n\n[![Modloader](https://img.shields.io/badge/Loader-Fabric-ecebe6?labelColor=263768&style=for-the-badge)](https://fabricmc.net)\n![Availability](https://img.shields.io/badge/Available-1.18.2%20|%201.19%20|%201.19.1%20|%201.19.2%20|%201.19.3-ecebe6?labelColor=263768&style=for-the-badge)\n![Environment: Server](https://img.shields.io/badge/SERVER%20SIDE%20INSTALLATION-REQUIRED-ecebe6?labelColor=263768&style=for-the-badge)\n\n![Environment: Client](https://img.shields.io/badge/CLIENT%20SIDE%20INSTALLATION-REQUIRED-ecebe6?labelColor=263768&style=for-the-badge)\n[![Fabric API required](https://img.shields.io/badge/Fabric%20API-REQUIRED-ecebe6?labelColor=263768&style=for-the-badge)](https://www.curseforge.com/minecraft/mc-mods/fabric-api)\n[![Projectile Damage required](https://img.shields.io/badge/Projectile%20Damage-REQUIRED-ecebe6?labelColor=263768&style=for-the-badge)](https://www.curseforge.com/minecraft/mc-mods/projectile-damage-attribute)\n[![Discord](https://img.shields.io/discord/973561601519149057.svg?label=&logo=discord&logoColor=ffffff&color=7389D8&labelColor=6A7EC2&style=for-the-badge)](https://discord.gg/KN9b3pjFTM)\n\n### \ud83d\udd27 = this mod | \ud83d\udd29 = entity & loot attributes\n\n![](https://cdn.modrinth.com/data/ENZmbSFZ/images/0a3718915c8aa5f40dbec714f1f82e9625ef9adf.png \"\")\n\n# \ud83d\udce6 Features\n\n## \ud83d\udc68\u200d\ud83d\udc69\u200d\ud83d\udc67\u200d\ud83d\udc66 Per player difficulty\nThe more players are online, the stronger mobs spawn.\n\n## \u2620\ufe0f Zone specific difficulty\nMobs spawning at different locations (dimensions, biomes) have increased attributes (such as attack damage, health, armor) by different amount.\n\n(Generic example: all hostile mobs in the nether have more health, attack damage, armor)\n\n(Specific example: all creepers in the jungle have more health and movement speed)\n\n## \u2728 Zone specific rewards\nTo match zone specific difficulty, items looted from mob drops and chests, have increased attributes (such as attack damage, projectile damage, armor, max health, etc...) by different amount.\nSome loot tables have specific buffs to their items.\n\n(Generic example: all looted items in the nether are stronger)\n\n(Specific example: all weapons looted in desert pyramid chests have more attack damage)\n\n# \ud83e\uddd0 Examples\n\n## Loot chests in the nether\n\n![](https://cdn.modrinth.com/data/ENZmbSFZ/images/e4d17c155b8ca56c602b68225896f32fd08f1eca.png \"\")\n\n## Mobs\n\n![](https://cdn.modrinth.com/data/ENZmbSFZ/images/516d1932391916515026669cf6071e5859de0ef7.png \"\")\n\n\n# \ud83d\udd27 Configuration\n\nThis mod is fully configurable, for more details check out the [project readme](https://github.com/ZsoltMolnarrr/ProjectileDamage \"\").\n", + "body_url": null, + "published": "2022-07-16T22:43:08.064460Z", + "updated": "2024-06-18T15:24:32.329079Z", + "approved": "2022-07-16T22:43:08.064460Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "GPL-3.0-only", + "name": "GNU General Public License v3.0 only", + "url": null + }, + "downloads": 144276, + "followers": 215, + "categories": [ + "adventure", + "equipment", + "worldgen" + ], + "additional_categories": [ + "game-mechanics" + ], + "loaders": [ + "fabric" + ], + "versions": [ + "pdMFGWFb", + "ZB1rP0Gg", + "OAYrMWsn", + "nFBNCNjX", + "2e0OBkKo", + "3eqOHgyo", + "Nm7ok1Hg", + "6IGX3RML", + "kJ5XOuvQ", + "lfxzsJpa", + "epTpCL5T", + "ymAJ3UJx", + "LjuYrHpR", + "92g6yttv", + "9hkR7QGb", + "HsPMYEeO", + "Px9EsO80", + "HRMBXEo4", + "lWcXsUbx", + "k6ljMDXD", + "P9lwqkzT", + "cdbouhH3", + "5EHHGPcI", + "fB8cjx51", + "FYbSGPsw", + "lXoQFzVn", + "LBHhEKaH", + "ciQcQG77", + "DIxlZCnE", + "nKHf8dsy", + "toBOW0xJ", + "NGindg0j", + "AmSBNxgE", + "HMmYxIPw", + "LzGqjsdM", + "CjEPl7OU", + "aLVZ7ugY", + "sY5aFlxt", + "nnllzcQl" + ], + "icon_url": "https://cdn.modrinth.com/data/ENZmbSFZ/67aba460eeb29c8ff61348256ea58848ea975508.png", + "issues_url": "https://github.com/ZsoltMolnarrr/PowerScale/issues", + "source_url": "https://github.com/ZsoltMolnarrr/PowerScale", + "wiki_url": "https://github.com/ZsoltMolnarrr/PowerScale", + "discord_url": "https://discord.gg/KN9b3pjFTM", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/ENZmbSFZ/images/0a3718915c8aa5f40dbec714f1f82e9625ef9adf.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-07-17T11:51:05.031443Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ENZmbSFZ/images/49610e16c8825d1354622e5d523b70573830f3ad.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-09-25T13:50:44.056680Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ENZmbSFZ/images/516d1932391916515026669cf6071e5859de0ef7.png", + "featured": false, + "title": "example_mobs", + "description": null, + "created": "2022-07-17T12:41:56.659403Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ENZmbSFZ/images/e4d17c155b8ca56c602b68225896f32fd08f1eca.png", + "featured": false, + "title": "example_loot", + "description": null, + "created": "2022-07-17T12:41:55.078013Z", + "ordering": 0 + } + ], + "color": 5988192, + "thread_id": "ENZmbSFZ", + "monetization_status": "monetized" + }, + "Dynamic Lights": { + "client_side": "optional", + "server_side": "required", + "game_versions": [ + "1.17", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "7YjclEGc", + "slug": "dynamic-lights", + "project_type": "mod", + "team": "t8O7LLDb", + "organization": null, + "title": "Dynamic Lights", + "description": "Supported entities and items such as torches or lanterns emit light! Server-side only!", + "body": "# Tschipcraft's Dynamic Lights\n

\n \n\n \n

\n\n> A server-side data pack/mod for 1.17x-1.21x\n\n
\nYouTube showcase\n\n
\n\n## Features\n\nSupported entities and items such as torches or lanterns will emit light by using the light block added in 21w13a. Some items are water sensitive and only turn off or on inside water.\nAdditionally, all enchanted items will emit light level 6 while some enchants under certain conditions emit light level 9. \nFor a detailed overview of all supported items and entities, take a look at the wiki pages linked below.\n\nThis data pack/mod is completely server-side, but can also be installed on the client only for single-player worlds!\n\n[-> For a detailed overview and available settings, take a look at the wiki <-](https://github.com/Tschipcraft/dynamiclights/wiki)\n\n\n## Installation\n\nThis data pack is also available as a mod with an additional global config file and settings menu when installed alongside [MidnightLib](https://modrinth.com/mod/midnightlib).\n\nDecide if you want to download the pack as a pure data pack [DP] or packaged as a mod [Mod].
\nPut the pure data pack .zip file into the `datapacks` folder of your Minecraft world, or the mod into your `.minecraft/mods` folder.\n\n\n## Manage\n\nTo open the ingame menu, execute `/trigger tschipcraft.menu` or `/function #tschipcraft:menu`. There is a **Reset** and an **Uninstall** button.\n\n\n## Compatibility\n\n\n\nThis data pack follows the [Smithed](https://wiki.smithed.dev/conventions/) and essential [MC Datapacks Discord Server](https://mc-datapacks.github.io/en/conventions/index.html) Conventions to ensure data pack compatibility.\n\nSome sophisticated redstone contraptions may not work when this project is installed, since the light block is not pushable for some reason. Please report any issues on GitHub.\n\n\n## External Links\n\n\n\"CurseForge\n\n\n\n\"PlanetMinecraft\n\n\n\n\n \n \n \n\n\n\n\n\n", + "body_url": null, + "published": "2023-01-01T21:57:35.292298Z", + "updated": "2024-07-10T22:09:50.532359Z", + "approved": "2023-01-01T23:12:11.804888Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-Custom-License", + "name": "", + "url": "https://github.com/Tschipcraft/dynamiclights/blob/master/LICENSE" + }, + "downloads": 551755, + "followers": 1026, + "categories": [ + "adventure", + "game-mechanics", + "utility" + ], + "additional_categories": [ + "equipment" + ], + "loaders": [ + "datapack", + "fabric", + "forge", + "quilt" + ], + "versions": [ + "bs4XEbDA", + "XAwQ16nH", + "y03u5y3S", + "okEG0aAl", + "7cT5xqe9", + "s9Y3IyM9", + "Y1UP7YoY", + "3ZL3x0U9", + "bYYMl4xu", + "Hgo9cclp", + "Ely3MqGM", + "ZGEjOvYo", + "eU6PA0pr" + ], + "icon_url": "https://cdn.modrinth.com/data/7YjclEGc/0b491b5a8bfd478037f1392f1d3effc773758ef9.png", + "issues_url": "https://github.com/Tschipcraft/dynamiclights/issues", + "source_url": "https://github.com/Tschipcraft/dynamiclights", + "wiki_url": "https://github.com/Tschipcraft/dynamiclights/wiki", + "discord_url": null, + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/tschipcraft" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/7YjclEGc/images/0ca04c6ca2819da105baa4a75522165d18553bbc.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-06-16T09:24:42.469816Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/7YjclEGc/images/8fa8259fbe7033c335be97a191aec7a0d1f1b83c.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-01-01T22:15:53.402450Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/7YjclEGc/images/8b072ac4082ec0d46832ba816656e7a35b367986.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-01-01T22:16:01.629653Z", + "ordering": 2 + }, + { + "url": "https://cdn.modrinth.com/data/7YjclEGc/images/d6a430b85d60290abc46ba6e317c7323531b892f.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-01-01T22:16:06.985144Z", + "ordering": 3 + }, + { + "url": "https://cdn.modrinth.com/data/7YjclEGc/images/e34f7e148ad616695d3a5a92cf46a7314d7aaf3c.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-01-01T22:16:13.808048Z", + "ordering": 4 + }, + { + "url": "https://cdn.modrinth.com/data/7YjclEGc/images/0a07da1ad61bcb7ecfb19da43ea12c1b4b9f43c6.png", + "featured": true, + "title": null, + "description": null, + "created": "2023-01-01T22:16:19.199462Z", + "ordering": 5 + } + ], + "color": 9455648, + "thread_id": "7YjclEGc", + "monetization_status": "monetized" + }, + "Eldritch_End-FABRIC-MC1.20.1-0.2.31": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20.1" + ], + "id": "nBaXIQY9", + "slug": "eldritch-end", + "project_type": "mod", + "team": "duGEwVFw", + "organization": null, + "title": "Eldritch End", + "description": "Descend into madness with new end biomes, forbidden magic, and more.", + "body": "![EE](https://github.com/nvb-uy/cdn/blob/main/desc/eldritch_end/banner.png?raw=true)\n\n[![Discord](https://img.shields.io/discord/790272037578473512?label=Discord&color=393939&labelColor=8c51b0&style=for-the-badge&logo=discord&logoColor=white)](https://legacy.curseforge.com/linkout?remoteUrl=https%253a%252f%252flunapixel.studio%252fdiscord) ![Fabric and Forge](https://img.shields.io/static/v1?label=1.20.1&message=Fabric%20and%20Forge&color=393939&labelColor=8c51b0&style=for-the-badge&logo=curseforge&logoColor=white) [![Support us and get early access!](https://img.shields.io/static/v1?label=&message=Support%20us%20and%20get%20early%20access!&color=393939&labelColor=8c51b0&style=for-the-badge&logo=kofi&logoColor=white)](https://ko-fi.com/ElocinDev)\n\n[![FABRIC REQUIRES](https://img.shields.io/static/v1?label=FABRIC%20REQUIRES&message=Necronomicon%20API%20and%20AzureLib&color=393939&labelColor=347564&style=for-the-badge&logo=curseforge&logoColor=white)](https://legacy.curseforge.com/minecraft/mc-mods/eldritch-end/relations/dependencies) [![FORGE REQUIRES](https://img.shields.io/static/v1?label=FORGE%20REQUIRES&message=Necronomicon%20API,%20AzureLib%20and%20Connector&color=393939&labelColor=347564&style=for-the-badge&logo=curseforge&logoColor=white)](https://legacy.curseforge.com/minecraft/mc-mods/eldritch-end/relations/dependencies)\n\n![Eldritch End Description](https://github.com/nvb-uy/cdn/blob/main/desc/eldritch_end/1.png?raw=true)\n[![supportus](https://github.com/nvb-uy/cdn/blob/main/desc/eldritch_end/2.png?raw=true)](https://ko-fi.com/ElocinDev)\n\n**Eldritch End** is an end expansion mod inspired from **H.P. Lovecraft**'s work. It aims to bring the lovecraftian universe to the end, while being original. Adding new biomes, tons of blocks and items, horrible aberrations to fight, its own corruption mechanic, and more. It is also inspired from the **World of Warcraft's Visions of N'zoth** update.\n\n**The Biomes**\n\nFrom the desolated Hasturian Wastes, to the corrupted Primordial Abyss, delve yourself into eerie and dangerous biomes, but beware of the monsters. Tons of new biomes coming soon!\n\n**Configuration**\n\nEverything is configurable. Adjust the mod to fit your modpack perfectly. We aim to make everything configurable, including every detail. Feel free to request configs for features that aren't yet!\n\nThe current release of this mod is on beta. Early access releases will be available for [Ko-fi supporters](https://ko-fi.com/elocindev), including the first bosses, **Hastur, The King In Yellow** and **The Faceless**.\n", + "body_url": null, + "published": "2023-08-13T16:54:03.907700Z", + "updated": "2024-01-16T01:59:37.595820Z", + "approved": "2023-11-23T19:33:33.492957Z", + "queued": "2023-11-22T02:45:31.247108Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 248291, + "followers": 106, + "categories": [], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "DOsTSD8F", + "Wh8wEvni", + "wPFjIqNO", + "sIIGq8oW", + "hjijvYrR", + "vXVJC8l4", + "Ua1jQ8xb", + "Xx5Bo3G8" + ], + "icon_url": "https://cdn.modrinth.com/data/nBaXIQY9/9b299f9884a0572ee65e0164b44351c4d56ad89c.png", + "issues_url": null, + "source_url": null, + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/nBaXIQY9/images/d733e17a8eca9bfeb54aa1b884ca7582ac8ddd6b.png", + "featured": true, + "title": "The Eldritch End", + "description": "Primordial Abyss using Pastel Shader (v0.2.30 Generation)", + "created": "2023-12-05T08:46:49.670610Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/nBaXIQY9/images/89acfd60661d47892b06dd5776d72372bf4ceb93.png", + "featured": false, + "title": "The Aberration", + "description": "Lurker of the Primordial Abyss. Its attacks may not be the strongest, but they will make you fall in madness.", + "created": "2023-11-22T04:54:24.166354Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/nBaXIQY9/images/0ba37356cb840efe1299d3eacc7db2c5c9b4653b.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-22T04:54:13.483878Z", + "ordering": 3 + }, + { + "url": "https://cdn.modrinth.com/data/nBaXIQY9/images/17ce7aec4c5c299e240959b22c9d20e1deef817a.png", + "featured": false, + "title": "The Eldritch End", + "description": "Primordial Abyss + Hasturian Wastes using Complementary Reimagined (v0.1.0 Generation)", + "created": "2023-11-22T04:52:34.543823Z", + "ordering": 4 + } + ], + "color": 1319964, + "thread_id": "gwHl3hb5", + "monetization_status": "monetized" + }, + "emi-1.1.10+1.20.1+fabric": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.20.6", + "1.21" + ], + "id": "fRiHVvU7", + "slug": "emi", + "project_type": "mod", + "team": "OqEReJSr", + "organization": null, + "title": "EMI", + "description": "A featureful and accessible item and recipe viewer", + "body": "# EMI\nEMI is a featureful and accessible item and recipe viewer. It brings many new features, and optimizes for the user experience. Outside of the standard Fabric/Quilt API, EMI requires **zero** dependencies, and can be launched with the game simply and easily.\n\n![](https://cdn.modrinth.com/data/fRiHVvU7/images/0d3b5b33d0016b21834ce6f3602169f7c48de13f.png)\n\n![](https://cdn.modrinth.com/data/fRiHVvU7/images/f3c8b452eae6dde028c37e3a3e3792459468d865.png)\n\n## Runtime JEI Compat\nFor runtime JEI compat, all you need to do is install JEI alongside EMI and they will work together to share recipes. JEI will be hidden.\n\n## What does EMI bring to the table?\n\nOf course EMI comes with every feature you'd come to expect from the outset, viewing recipes, favoriting items, searching, and the like. But what's new that EMI offers?\n\n* A craftable mode for **quickly crafting** any recipes you're able to make, usable by toggle or as a config for empty searches\n* **Recipes** can be **favorited** with items, and also can be used to quickly craft at a button press\n* A **recipe tree** for breaking down the cost of a complex craft, showing you **every step**, how many **base ingredients** you need, and what you'll have leftover\n* A **recipe tree crafting mode**, counting up the materials and steps you need to be complete to finish a task, including **synthetic favorites** in your sidebar you can use to **craft every step** for exactly as much as you need\n* Smart display of **tags**, with translations, models, and tooltips, showing you ingredients at a glance, such as \"Planks\" instead of slowly rotating through every plank in the game.\n* Smart breakdowns of base costs, letting recipe trees automatically break down to base ingredients, and letting you define **your own defaults** as you play\n* **Tooltips** for recipes, tags, and ingredients showing you what will be crafted, and what makes up an ingredient\n* Binds for quick crafting **straight into your inventory or cursor**, one or many at a time, in conjunction with recipes favorites or the craftable mode\n* A **clean** and **modern** API, built from the ground up to be simple, powerful, and suit all of EMI's features\n* **Zero third party dependencies**. EMI only requires standard, first party Fabric/Quilt APIs\n\n\n## What does EMI stand for?\nIt doesn't, it's not an acronym. Or maybe it's an acronym without a meaning? If it makes you more comfortable, you can pick one from the list below, or make your own up.\n\n* Emi Memy Imi\n* Exhaustively Many Items\n* Explicitly Mandated Items\n* Endless Material Information\n* Expounded Minutia Introspection\n* Earnestly Made Imitation\n* Even More Items\n* Eminence, My Inception\n* Emi's Magic Inventory\n* Efficiently Managed Inventory\n* Exploring Modified: Iridescent\n* Expropriated Matter Insights", + "body_url": null, + "published": "2022-06-08T18:43:43.368416Z", + "updated": "2024-08-11T22:12:22.370166Z", + "approved": "2022-06-08T18:43:43.368416Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 1926548, + "followers": 1340, + "categories": [ + "library", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "y07Z99Fu", + "Q6tTbo1x", + "K65QAWMh", + "YXPSJa6e", + "iYEz2kTL", + "Selw0HYX", + "A8yQEzfW", + "E5xVJcgc", + "pgkoQN7L", + "D3LyTAws", + "wWQ7UZ2q", + "nZGKMwAA", + "yu6i46bx", + "n7JoPQix", + "LAmIsYNr", + "RgQ7FrsH", + "IoW80f9m", + "udXqkIbu", + "HoOD920y", + "olpu7zwd", + "cfYr580M", + "Nah0xUBl", + "QMDzRsgo", + "p9jbOqyn", + "tN2XQVEJ", + "ftT3b1yq", + "WhmdWccV", + "bAyIAOBL", + "ZxUKxSNd", + "UUi66xPS", + "e8yMWd29", + "X4bOWHC2", + "fI0dINR4", + "XmCUxxkW", + "jBccUcin", + "xmDkD61V", + "wMwDwu3J", + "JDYyc3km", + "k0JvR8fB", + "YjHd11wZ", + "AVh1lXN3", + "foXHvGih", + "7z5aEkkm", + "Sr03WyB4", + "FSHwx86x", + "cCpcaR2M", + "yQJ7B5nr", + "yKTNiAdh", + "57RIQAd7", + "o33Kccwv", + "9GlQFcnd", + "vlDdC1kL", + "lkS8hPC7", + "fS3fm4Dd", + "6mrLiOWt", + "dlvl62R7", + "mpzT6mBc", + "PuAYjGi1", + "s4KYdf4l", + "rKHPdZDJ", + "ZIS2bNb1", + "jGpO3aCU", + "wAp7hMUU", + "l9ixr9Dk", + "WGclw60s", + "iu1dOnJl", + "vy8MPD02", + "RPPRwMBI", + "DDkCVTmY", + "jOFzj21O", + "lnPekvZX", + "bTjX0Jsd", + "gEGU5Xir", + "rjkcKxdA", + "Xek2SeF3", + "yTEBSR8Y", + "gokBtbDo", + "t14D5ZJk", + "TGaxuN3i", + "4pbvOVlV", + "OTbAVSDE", + "MDskMT93", + "SKPXM4q6", + "OwZJfOuX", + "DBeXPclI", + "XjeprwvC", + "cbZWmhGq", + "NUdGBKhA", + "luelaLAf", + "XcvcmBXS", + "CIUgXtQR", + "jrHZcUei", + "ppVyb7ns", + "Bx4nG0q7", + "yAcaigy0", + "VSLv9j3b", + "gS3G7IQC", + "7DxyV3hH", + "BOUEFB16", + "ZYREdR8e", + "9Sl6aEEg", + "LzmUaL4c", + "kP4Ttjg3", + "ARMJwZQk", + "lFlnmxZX", + "99422QOb", + "rUnMUodd", + "gXppZuUk", + "SRfzqUwE", + "PA7CNBS1", + "GXDabLjD", + "ZHJCnRrV", + "SErzvird", + "fPRExx0b", + "lZUnNROf", + "P2jD6pvi", + "3ZTak90f", + "eo1v9M36", + "nxwHXyAp", + "VDBZ3FfS", + "vQWnMEgA", + "nROflJT2", + "Of9yAFuQ", + "IXuWMuh3", + "IOTLvGDt", + "3bWCInBV", + "T6JBXl6g", + "higCO4E4", + "YxwzpJCq", + "w5JiWCW7", + "pG5HGVTu", + "MkemtDIU", + "VyI9Fr1W", + "uWOLRJF1", + "dJR0haLe", + "nFk08aES", + "ozJzwpzN", + "IvAyCXEb", + "5Zld5CC5", + "t2VUPeY1", + "e637x6DP", + "mswL1Cx9", + "zA0tREKg", + "VNH5f0Hi", + "cZIemJcR", + "qnO2ZoJH", + "XbMku1KO", + "bAYhhGqf", + "I3JL1sI9", + "FZ64cRZE", + "vcybH53j", + "pYDQKFeb", + "STIuB6G5", + "10TkzyBV", + "LHHhqkL2", + "X5W6NKzV", + "Qhg4LbNd", + "xrNa7BYH", + "zuUJzYUV", + "WFt4jv0T", + "52yAooXY", + "De0PHzIx", + "WjW9CHfj", + "CLHwCTp1", + "JZDbqnxr", + "paDs62jv", + "YVPp8jzW", + "Jr0Yf8u2", + "oA5GgOHE", + "7jVTxOCF", + "5U4TG26Y", + "lOT4MTxG", + "L1Ew1Lqd", + "duZtEIpt", + "feTe8TlD", + "BBCH3lGq", + "v23AX0tn", + "mn3yNAK2", + "G8b88mou", + "YUxVrA2Y", + "BPGh6SPX", + "kQtM7WHz", + "bkE3fS2l", + "MdaKz81K", + "O7aSkZQW", + "X2ligAnL", + "B3nCpImc", + "TEc5cW0M", + "1i6tvCQX", + "et5qRkAD", + "9cfSTnIK", + "BSIAesA3", + "tKSmt8eh", + "YDTMLiJr", + "38WXrQH1", + "CAr87JlY", + "Qj9KohS3", + "khldbYJv", + "6zkJhbnx", + "DBMNFHj3", + "ZuZUW60m", + "Tg64Z6sA", + "r3B6x1If", + "F2UmhLRv", + "lElIQlYu", + "Tgsj5Iry", + "DCjY1O8T", + "Vkud1bpA", + "7SYqsFB9", + "WZsj6ARC", + "1D1XIvL7", + "rB7RxzsG", + "t0oce5tQ", + "DoKtwgI7", + "aHJUq2yS", + "sSgnWL3r", + "4mx41ehI", + "kr0VbAGZ", + "TEs5oCdP", + "ciMqRO3M", + "ZiWxCd0J", + "FRCRUfd3", + "MvPCuYYA", + "VQROU1Eb", + "WPGlB0Q4", + "K2ePWegL", + "r0H3gXol", + "kf0WMidK", + "fhrIZU0y", + "wGL8eTVV", + "E80ymIet", + "CUoRjscx", + "y6Pchk8E", + "COZQFEqG", + "RP9coq1M", + "LqtKhfge", + "idoOUaCk", + "mQ5vmtq6", + "bTfpCdYw", + "WYq0OMLK", + "LhbqNQf1", + "UCpCV4NB", + "EwkWJFiL", + "h8uRTkMm", + "4P7cDZh6", + "S95SltXc", + "uc0bAHRJ", + "5EF7qT9j", + "yAKyNAcX", + "m20CKFQP", + "LuKVNzSW", + "C7wDPBBO", + "VldBzgSe", + "KVRbalGS", + "bu1kRUXQ", + "IOqjd65y", + "WfgfLwLP", + "YnaTUIc5", + "Oh5hbbaI", + "kZ9XQdPd", + "V3N4J6qf", + "v5NJCWY9", + "SeSuTQxr", + "kFb4jT7Q", + "DqzrW6QN", + "HlfhF7AQ", + "ShejnJfY", + "LKSxkjKD", + "mqiPWBzS", + "qpiHDyUC", + "7XKOZJmG", + "EY0bsln7", + "hIuOBjbs", + "aD5TSGGI", + "jT5Qro6x", + "hyg4KnuZ", + "fTlqZTyF", + "P0MSenTX", + "gUG5ToEM", + "WsJqAKp7", + "OakBkMPU", + "Ph2khrMS", + "H9w4Ydog", + "mxCcRtpg", + "Q8CMK9N2", + "nXM9GfId", + "3E656I3R", + "4AAJllHB", + "2cTZQ8kN", + "ORJaB6VX", + "AoRrWyoO", + "wbgMJeMX", + "nKHd76xj", + "RNRM4uV3", + "pKhU2h5V", + "yzBWYzer", + "mh0nVpvd", + "oPrVxI1B", + "1CqxcckV", + "WL0Evl7s", + "frxcvFif", + "CT8YRMFZ", + "o9YEnMle", + "XLFgFOY5", + "QaDJ9Qul", + "sxxVZDxv", + "CuU3yQ5k", + "FPU1PaZ9", + "KzxcdPKP", + "Lz7REsqm", + "t6sA5eIt", + "M7ynHTnb", + "qlOQ1Ts3", + "vgP2BYpD", + "LPa8R1oT", + "wJJNXskX", + "pWonvbOv", + "rohQlpM0", + "ZP7ZK7Lj", + "SFAPEnOo", + "EiKbj434", + "79b5GcsK", + "LtMXoSYI", + "3KtYJ2Av", + "hAbEzEta", + "QXfQTnbM", + "Tk1KEPaS", + "56E4LTxT", + "pORJ7GVs", + "wjQy6sQv", + "l15ilTAR", + "AJ1mDwj6", + "jXyglcrU", + "1ocza6o7", + "crPExfgb", + "arTpMrYe", + "eLWsC2tY", + "940GsBY0", + "RvMwqywq", + "ynMAB9G5", + "eINRNebJ", + "cEuDNBVH", + "NYZWAPDB", + "qTM8LiKt", + "X6In4fQO", + "3pZIo9DE", + "36EFbBVx", + "DUkvQ7If", + "EaJzQKgN", + "danfgWqK", + "XuHFpyev", + "qFRA5N2t", + "43E0iqX3", + "r10gArKs", + "EJ5ehoSS", + "umtBPJhO", + "10yrqfdd", + "yJKM4MT2", + "PABSe7Zo", + "rO3GdrOm", + "x9hGUE2v", + "4Wza0ktp", + "FPjC6tiC", + "jYOMGYft", + "9RjArgzl", + "8bCpIouQ", + "et3Yda8g", + "hWsaLfXF", + "bvRrYwRL", + "UsF0weKt", + "4xHDcgGs", + "fgfL6Dkb", + "UJYtxEYG", + "8a9CXUGo", + "UcPFZeeY", + "8qHA9xh2", + "7eFmRnoY", + "dzfVGVCn", + "T0I7aPo5", + "mB9YETyo", + "QybkuIsL", + "WBHPrpGy", + "gI8Bw8ak", + "e7RuCuSB", + "wu6Lm26O", + "UFMTkoOy", + "UTsNvm4s", + "oco3Ru0n", + "3yd5CGg0", + "5grMgrk4", + "8wePCvSM", + "61eK5Qjc", + "iOJ2kiCY", + "251brana", + "OGkfV4Do", + "gCofWXuy", + "TK3FWW0Q", + "Nzw7ssBi", + "AR8gkjgI", + "oIJgMuQd", + "fxJ8ridT", + "Vnq1EITA", + "tzF0licw", + "UpPKrvOx", + "2DnY7e8V", + "pikNrU5i", + "BzLRE7QI", + "5PYnL6bp", + "kjfimrqy", + "x3JXUQXu", + "dR5R70l0", + "nkTNGPfi", + "uMsufpiT", + "h1PlnLK8", + "dx9JAxBH", + "SJ0JAHhd", + "ab3hfPOi", + "lDQkgadT", + "JaMPmwPX", + "85L01eYA", + "DrtzjH6o", + "WQy5U45G", + "DMiNrgtQ", + "pnNpzsjL", + "pum9p9G8", + "Nta4625W", + "o4jnHvit", + "VXzF7Jf3", + "6SFxCS4Z", + "V8GOoftG", + "oAh7Recf", + "dkw8xrHG", + "1vKrnGbh", + "4xudl8X1", + "spghOu2N", + "5b1435Qy", + "4pAJCVeU", + "k658ykiP", + "4a8tCBWN", + "NjI7RG5g", + "TwGLYmkp", + "axABqUYz", + "zRo9xfuw", + "QhG3TG8L", + "uzwdbmod", + "av8zEC0v", + "fIS5SA07", + "FLK7nYsj", + "m62N0vBZ", + "p8ct3Wd4", + "LGqZaZLs", + "harySgCU", + "MZiSLFZX", + "QT6oPqYH", + "5qgRXRYj", + "AnPwoFAK", + "VZf6Fgw4", + "sXVTxyV4", + "jLNbh0qb", + "vPa1eDs2", + "lHKRECLG", + "CNGDifV2", + "ivFE6ShM", + "XMKed62q", + "seQG8huJ", + "VddSrN3Y", + "PBtTeLpA", + "fCSXJrtb", + "BK77DVh0", + "1aiiSF65", + "wGAgdzBB", + "n08CRJmF", + "z5zG9Fow", + "3mJfd9uO", + "bh3A7AVy", + "YmCA8nld", + "axY1S64z", + "I4SRqJen", + "g1hOAOT4", + "2e7gkT1o", + "Wc09It2Z", + "JDfCnSAV", + "zWJ8RVZN", + "3mQc1o5v", + "TCiDdtjO", + "aFGm4ESK", + "CMkQ0Hch", + "5RZTe6DQ", + "37XeXpbT", + "z42fyZ0F", + "4zhp4O8u", + "SNTrPiyR", + "k8STZgoZ", + "b9OtrQB1", + "KRp4lW7A", + "pz7GGu38", + "7iQ5fd11", + "KjJWi09F", + "ZvkFcWos", + "BFmrAz9F", + "lmVVkVoj", + "6E85lIRF", + "BeIP838d", + "S3NXM8l7", + "lbtga1C5", + "Az4dsj6V", + "8KtEM1az", + "HhQ69HxF", + "OguvM0Pf", + "1z1WuvTj", + "SUb1qcBU", + "ilhFPSYz", + "6fblD6MH", + "ctLp6fsa", + "3PhmMBp9", + "wmULB9bu", + "s1tH07n6", + "KDi8Jvir", + "BduaXsAB", + "BHbwlThS", + "wKXTamt5", + "9gzeWU7v", + "X937lDzA", + "qf2E1fHW", + "RHEQI7Fc", + "q4ql2JIE", + "vwD58Ys7", + "pijKAUf5", + "uZ7UbDHM", + "IKIYLKyP", + "ejRBcDws", + "hrxmzv7I", + "sth5x8cn", + "sNV8HZRW", + "CMFWLyX6", + "X6p68pI0", + "1OQ73USb", + "TbXHNT8N", + "Plj7yw6W", + "k0u6LhLO", + "bm1PCRua", + "mhEIiLgH" + ], + "icon_url": "https://cdn.modrinth.com/data/fRiHVvU7/395fe5302b2bab612ef0623509f768f3c5a5ee0f.webp", + "issues_url": "https://github.com/emilyploszaj/emi/issues/", + "source_url": "https://github.com/emilyploszaj/emi/", + "wiki_url": "https://github.com/emilyploszaj/emi/wiki/", + "discord_url": "https://discord.gg/T2PuD9RTWV", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/fRiHVvU7/images/0d3b5b33d0016b21834ce6f3602169f7c48de13f.png", + "featured": false, + "title": "EMI", + "description": "EMI's recipe screen and interface", + "created": "2023-03-12T06:27:47.113202Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/fRiHVvU7/images/f3c8b452eae6dde028c37e3a3e3792459468d865.png", + "featured": false, + "title": "Recipe Tree", + "description": "Several instances of EMI's recipe tree", + "created": "2023-03-12T06:46:01.741792Z", + "ordering": 0 + } + ], + "color": 8190635, + "thread_id": "fRiHVvU7", + "monetization_status": "monetized" + }, + "enhancedblockentities-0.9+1.20": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.16.2", + "1.16.3", + "1.16.4", + "1.16.5", + "1.17", + "1.17.1", + "1.18", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "OVuFYfre", + "slug": "ebe", + "project_type": "mod", + "team": "O79BATDr", + "organization": null, + "title": "Enhanced Block Entities", + "description": "Reduce block entity FPS lag with almost no compromises, and improve their visuals", + "body": "## Enhanced Block Entities\n\nEBE is a **100% client side** Minecraft mod for the **[Fabric](https://fabricmc.net/use/)** mod loader which aims to increase the performance of block entity rendering, as well as offer customizability via resource packs.

\n**How does it work?** EBE Makes some block entities use baked block models rather than laggy entity models.

\n**Is it just an optimization mod?** EBE isn't *just* an optimization mod, some side effects of its optimizations are many visual improvements.
\nThese may include:\n- Smooth lighting on block entities\n- Being able to remodel block entities with block models\n- Toggling features like christmas chests\n- Being able to see block entities from as far away as possible\n

\n\n**What about animations?** The best part about EBE is that you still get to keep animations, while gaining the performance boost of baked models! Most animated block entity models will only render when absolutely necessary.

\n\n### [Indium](https://modrinth.com/mod/indium) is required to use EBE with [Sodium](https://modrinth.com/mod/sodium).

\n**Requires [Fabric API](https://modrinth.com/mod/fabric-api)**\n

\n\n\n## FAQ and Help\n\n**Q: I need help with the mod/need to report a bug!**
\n**A:** If you're having trouble setting up the mod or using it alongside other mods, I'd recommend you join our [Discord Server](https://discord.gg/7Aw3y4RtY9) and ask for help there. *If the issue is a BUG* please report it on our issue tracker (\"Issues\" tab at the top of the page)

\n\n**Q: My chests have glitched animations!**
\n**A:** You're likely using Sodium, which doesn't support certain Fabric Rendering features by default. If you need to use Sodium with EBE, you should install [Indium](https://modrinth.com/mod/indium).

\n\n**Q: My chests are invisible!**
\n**A:** You may be using a resource pack that conflicts with EBE. Open the Block Entity Settings menu (through EBE's Mod Menu entry or through vanilla Video Settings) and enable \"Force Resource Pack Compatibility\".

\n\n**Q: How is this different from [FastChest](https://www.curseforge.com/minecraft/mc-mods/fastchest)?**
\n**A:** FastChest does not preserve chest animations, and only optimizes chests (in a similar way to EBE). EBE also optimizes other block entities:\n- Ender Chests\n- Signs\n- Bells\n- Beds\n- Shulker Boxes\n- Decorated Pots\n

\n\n## FPS Boost\nRendering 1700 chests:\n### Vanilla\n![Before](https://github.com/FoundationGames/EnhancedBlockEntities/raw/116_indev/img/before.png)\n### With EBE\n![After](https://github.com/FoundationGames/EnhancedBlockEntities/raw/116_indev/img/after.png)
\nA 155% frame rate increase!\n\n## Resource Packs\nHere's an example of how you can customize chests with resource packs using EBE.

\n![Custom Chest GIF](https://user-images.githubusercontent.com/55095883/112942134-f67fe780-912f-11eb-8b11-cf316544c22b.gif)", + "body_url": null, + "published": "2021-03-01T00:33:17.073472Z", + "updated": "2024-06-13T19:44:57.246192Z", + "approved": "2021-03-01T00:33:17.073472Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 4027708, + "followers": 3700, + "categories": [ + "optimization", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "tUbREtJR", + "J7Zc989q", + "l4eXcVcY", + "oiMCXKDH", + "HHqDCd5p", + "bndJ1Eq5", + "Zl4ETunR", + "ILuyoK6c", + "qbUAJjs9", + "VOB3iJkd", + "5FTTHyNq", + "88qNYjJz", + "Id00LoSl", + "s76PBY7D", + "fZx04xgT", + "6NvQpIBY", + "fJLBqbZ5", + "Xdo5ZiRc", + "i3v1Skck", + "eIFo7wvq", + "xeHyTMq8", + "Ihazqamt", + "xUOoKrs2", + "BKpMtYZB", + "8OuTJDGd" + ], + "icon_url": "https://cdn.modrinth.com/data/OVuFYfre/icon.png", + "issues_url": "https://github.com/FoundationGames/EnhancedBlockEntities/issues", + "source_url": "https://github.com/FoundationGames/EnhancedBlockEntities", + "wiki_url": null, + "discord_url": "https://discord.gg/7Aw3y4RtY9", + "donation_urls": [], + "gallery": [], + "color": 13734690, + "thread_id": "OVuFYfre", + "monetization_status": "monetized" + }, + "entityculling-fabric-1.6.6-mc1.20.1": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "b1.7.3", + "1.7.10", + "1.8.8", + "1.8.9", + "1.12.2", + "1.16", + "1.16.1", + "1.16.2", + "1.16.3", + "1.16.4", + "1.16.5", + "1.17", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3-pre1", + "1.19.3-pre2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "NNAgCjsB", + "slug": "entityculling", + "project_type": "mod", + "team": "hLPrl6Gq", + "organization": null, + "title": "Entity Culling", + "description": "Using async path-tracing to hide Block-/Entities that are not visible", + "body": "# EntityCulling\n\nUsing async path-tracing to skip rendering Block/Entities that are not visible. [Website.](https://tr7zw.github.io/project/entityculling/)\n\nMinecraft skips rendering things that are behind you, so why is it rendering everything that you still can't see because of a wall in the way? This mod utilizes your other CPU cores/threads to do really quick path-tracing from your camera to all block/-entities to determine rather they are visible or not. During the rendering, the not visible ones will be skipped the same way entities behind you are.\n\n[![Shockbyte](https://tr7zw.dev/img/shockbyte_black.png?v=2)](https://shockbyte.com//partner/tr7zw)\n\n## Dependencies\n\n- none\n\n## Incompatible\n\n- none (With some mods you might need to add the blocks to the config whitelist to fix visual issues)\n\n## Tested with\n\n- Sodium\n- Iris\n- Optifine\n \n## Note to why it works even with Sodium/Optifine\n\nThis has been tested with other mods, Optifine(Optifabric), Iris, and Sodium, in all cases resulting in fps gains in places like Game Server lobbies.\n\nYou might wonder why it does increase the FPS with Sodium since Sodium has \"Use Entity Culling\" in its Advanced settings and enabled by default. The difference is that Sodium does a really quick pass based on the visible chunks, being way less aggressive and thereby still rendering entities that just happen to be in visible chunks, but not visible themselves.\n\n## FAQ\n\n### Does this have to be installed on the Server?\n\nNo, this is fully Client-side and can't be installed on servers.\n\n### Will this influence farms/mobs?\n\nNo. Since this mod just skips the rendering, mobs will still spawn/move/drop items.\n\n## Credits\n\nRoboTricker created the original server-side async raytracing occlusion culling implementation for Transport-Pipes.", + "body_url": null, + "published": "2022-05-25T10:09:09.784330Z", + "updated": "2024-06-14T21:20:00.112947Z", + "approved": "2022-05-25T10:09:09.784330Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LicenseRef-tr7zw-Protective-License", + "name": "", + "url": "https://github.com/tr7zw/EntityCulling/blob/1.18/LICENSE-EntityCulling" + }, + "downloads": 11104877, + "followers": 6045, + "categories": [ + "optimization" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "WiIRU3UP", + "AXYavMt5", + "Qek7k92S", + "2WBkUuat", + "2mzFyULh", + "mlP64Wt9", + "4GD4dwQK", + "LQ3vI7aU", + "WdlVJYKE", + "R0KPBo5r", + "1Vc3QD0W", + "b2cBCjB4", + "bRBO9ZzX", + "Wq0up4B4", + "bE2TQ25z", + "reIgRPky", + "N7HJbtfe", + "AdkBUIRs", + "WR6z6MYC", + "twdGLDHv", + "jFORrKV6", + "d3CbGntl", + "UvJN5Cy4", + "NB6TPjI8", + "374z4jcq", + "d20sUcYn", + "17Hi340V", + "BDwHAdWc", + "1MBmcSf1", + "LwvhfrTE", + "tUVHg6HN", + "pVb6ajsR", + "DkksI437", + "KSu61vcB", + "Ek0VIX9q", + "mBYyh1qv", + "HSirwtwV", + "2I1m95aJ", + "M5k1QJL1", + "knltv3Vh", + "iC2A1KnJ", + "McVB9vXT", + "7JR5qJ8f", + "dmSSEQmZ", + "l1SLPhB6", + "bpznplxY", + "sXviAk4G", + "SLiFyIon", + "bketoxVs", + "frGGaFrx", + "gO8hxcyv", + "ugIRhLoi", + "2LyjkgAv", + "PG8gMKcT", + "4Nq7hEtl", + "hyejM5za", + "SzEdoick", + "UHcskdEO", + "92bPVm5F", + "DHBIGCNn", + "F3RXDl1W", + "TOyoOLwn", + "7ZgGD02s", + "KRGWwoZW", + "1LVdHUaX", + "3VAtIiWX", + "cj8nR3eG", + "VgDjay7P", + "p2L3IXut", + "6U5rh26a", + "Gggee1My", + "LXLEbjiC", + "Bu3hSiJb" + ], + "icon_url": "https://cdn.modrinth.com/data/NNAgCjsB/icon.png", + "issues_url": "https://github.com/tr7zw/EntityCulling/issues", + "source_url": "https://github.com/tr7zw/EntityCulling", + "wiki_url": null, + "discord_url": "https://discord.gg/fWtMAkFaZF", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/tr7zw" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/NNAgCjsB/images/65781fbd7cda31b8c8e4a8def40bf445c10a1562.gif", + "featured": true, + "title": "Example of F3 stats", + "description": null, + "created": "2023-01-21T19:13:36.454610Z", + "ordering": 0 + } + ], + "color": 6052955, + "thread_id": "NNAgCjsB", + "monetization_status": "monetized" + }, + "entity_model_features_fabric_1.20.1-2.1.3": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.18.2", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20-pre1", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5-rc2", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "4I1XuqiY", + "slug": "entity-model-features", + "project_type": "mod", + "team": "fXLgMy6f", + "organization": null, + "title": "[EMF] Entity Model Features", + "description": "EMF is an, OptiFine format, Custom Entity Model replacement mod available for Fabric and Forge.", + "body": "
\n\n\"EMF\n\n# Entity Model Features\n \n[![Modrinth downloads](https://img.shields.io/modrinth/dt/entity-model-features?color=00AF5C&label=downloads&style=round&logo=modrinth)](https://modrinth.com/mod/entity-model-features)\n[![CurseForge downloads](https://cf.way2muchnoise.eu/full_844662_downloads.svg)](https://curseforge.com/minecraft/mc-mods/entity-model-features)\n\n[![Enviroment](https://img.shields.io/badge/Enviroment-Client-purple)](https://modrinth.com/mods?e=client)\n[![Discord](https://img.shields.io/discord/950942125225283634?color=blue&logo=discord&label=Discord)](https://discord.com/invite/rURmwrzUcz)\n\n[![Ko-fi](https://ko-fi.com/img/githubbutton_sm.svg)](https://ko-fi.com/traben)\n\nEntity Model Features (EMF) is a Fabric, Quilt & Forge mod that adds support for OptiFine's Custom Entity Models (CEM).
It's designed for anyone who wants to use the CEM resource pack features but to use mods such as Sodium, Continuity or ETF.\n\n\"EMF\n\n
\n\n## Required Mods\nPlease also install the below mods if you can, the obvious ones such as Sodium are not mentioned.\n\nIt should also go without saying EMF is NOT compatible with dorianpb's CEM and OptiFabric.\n#### Required\n- [Entity Texture Features (ETF)](https://modrinth.com/mod/entitytexturefeatures): \n EMF uses several features from my other mod ETF, so it is required. (primarily used to support the random model feature, the config screen, and allow textures set in models to vary like in OptiFine)\n\n#### Highly recommended\n- [Entity Culling](https://modrinth.com/mod/entityculling): This mod does wonders for reducing entity rendering lag, doing even more than Sodium's included entity culling. This is very beneficial when using animation heavy packs like Fresh Animations.\n\n\n## Fresh Animations?\nYes.\n\nit works :)\n\n\n\n
\n\n[Download Fresh Animations](https://www.planetminecraft.com/texture-pack/fresh-animations-v1-0/)\n\n\n## Features & OptiFine differences & Known Bugs\n\nUp-to-date feature details page : [Features & Optifine differences](https://github.com/Traben-0/Entity_Model_Features/blob/master/FEATURES.md)\n\n\n## FAQ\n\n> **Q:** Do all OptiFine CEM resource packs work?\n\n**A:** Most packs work fine, but I'm sure there are some exceptions, report any found issues [here](https://github.com/Traben-0/Entity_Model_Features/issues), or on my [discord](https://discord.com/invite/rURmwrzUcz).\n\n> **Q:** What's different between EMF and dorianpb's [CEM](https://modrinth.com/mod/cem)?\n\n**A:** EMF is in a complete state and has a nearly 1 to 1 parity with OptiFine CEM, EMF also does a few extra things like player animations and armor model support, with more ideas on the way :)\n\nEMF also does things differently under the hood with little to no hardcoding of support for vanilla models. Allowing full CEM support for various modded entities.\n\n> **Q:** Backports?\n\n**A:** Backports to 1.18 & 1.19 are planned.\nBackports to version 1.17 and below are not planned at this time.\n\n## License\n\nEMF is licensed under the [GNU Lesser Public License](LICENSE), version 3.0\n\n## Hosting Partner deal\n\n[![image](https://cdn.modrinth.com/data/BVzZfTc1/images/bfb592538f8206a6a2d72d19c90714bea91b0e07.png)](https://billing.kinetichosting.net/aff.php?aff=641)", + "body_url": null, + "published": "2023-03-31T23:58:40.453948Z", + "updated": "2024-07-09T06:29:41.470220Z", + "approved": "2023-04-03T00:59:48.707746Z", + "queued": "2023-04-02T02:40:36.198281Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 5411373, + "followers": 2912, + "categories": [ + "mobs", + "utility" + ], + "additional_categories": [ + "decoration" + ], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "yYaRtPUw", + "nXG5ZTWm", + "pcLQFqon", + "rVKOnrA7", + "T7mzJLz6", + "Dea94PIY", + "DjswzKtj", + "aDp7snRT", + "V2OyfXxm", + "Xd7QIIv1", + "GlVrMJfd", + "TEAO0eWy", + "6WfVnhiq", + "3ArUcFku", + "zTnuaNyR", + "I8BdGIyR", + "7bzU6chG", + "deVKWS49", + "MjDE57Jw", + "weH0Em4N", + "OZhKhqbO", + "Y4ERRvDT", + "7eRoc49u", + "8GH17mIS", + "NZKwy6yr", + "AzRidGwG", + "IL4RqqYZ", + "mOmY1cMH", + "EYEiSxf5", + "PuJLEdhx", + "5v32yTeK", + "F2rVuihD", + "kouKrQ96", + "ZZGFPXZF", + "ORrfX7aq", + "OPyB18gz", + "yVjuZyf5", + "e9hB4Qyw", + "NF2Ro84F", + "yHUWdpcz", + "nqu0vi2x", + "lu9zjvWC", + "n1DH6PLf", + "VfoKtE8J", + "akfHUoQf", + "TVhwNuR0", + "4jkePyqP", + "E6OJ69z6", + "ZAuTqMfx", + "c9lEcqYf", + "30r5YeHU", + "LnM9TQxd", + "wEcxaFJT", + "slWSM9OY", + "9ODYgM48", + "n6EyQyeN", + "b1pJegrh", + "p1Qt8SIh", + "33ddTlVK", + "VBeUopG1", + "S8VuZDQ4", + "nIQedooe", + "PETiI2Yb", + "yGROrq68", + "8FU1BYfi", + "JtRlIyBy", + "z0tRTgFX", + "9N7ilgif", + "hVYDL7YQ", + "kFcIMH1Z", + "r0UjM8gx", + "NtxuH8Wk", + "toEX8PUQ", + "hBdLuluo", + "L5j5Cgt6", + "Fhs6XUdV", + "j6G5CGoD", + "UTk9KIPl", + "zO7oFMiv", + "4e3OPRfB", + "eg7GqpgR", + "KKMsC88r", + "h4PnMR7D", + "AXMXly1R", + "K22doPG2", + "F3Urf59I", + "BA8z5Ryk", + "P6h6WCIY", + "PRB8TBBT", + "GZoWb3Sj", + "DqAqkeNx", + "IvKEtlkS", + "8iNRv6h2", + "Gnq4IVE1", + "EGtndKuU", + "9GIq2ND0", + "z5WFPrA6", + "zdcSsI7C", + "5VBMcfOB", + "OsioKrT1", + "xOy316Zc", + "Ac9PxwNw", + "1pzWwAvR", + "74Yx8tM6", + "WNdlhpAM", + "fbZGMUWW", + "KZVwrmUQ", + "TbpHIXxk", + "SS5qaBrE", + "8oFou220", + "zGa2nXth", + "ZnkxeBpm", + "ZVchszyB", + "tcrjMnUN", + "4seBWMhe", + "u3VqNoAu", + "c7TDawJ9", + "4ZslB2Hx", + "QEQnfRIO", + "uv7jW0CE", + "VifrfxZJ", + "5Pum9sao", + "r3qto42X", + "vyuiguoP", + "hxDtTc1Q", + "n5YI6Zh6", + "SH3Z72mF", + "S9HtDtJv", + "yvWntDTo", + "4vJjL6YG", + "95DrIgKD", + "7qhkYutC", + "9BeU4JMZ", + "DOvpgsS7", + "3DUWVimm", + "GCiXd1DU", + "lfYHLBCj", + "HuiMDCpB", + "KneJBt8W", + "dVfrkFFQ", + "rfh88j45", + "bwjbN1G7", + "kakr6cxQ", + "IzAfhCj5", + "rGuR7oQZ", + "fMRe5pGZ", + "652AHAwn", + "2hVd4znq", + "bCmmruN5", + "F1JjnEjo", + "mWAFiRcK", + "wa38cdv3", + "SfWhB6Bd", + "7bxh2EoP", + "aFlca15F", + "up2Xg2sy", + "jVIxXxpT", + "dzyn3ag2", + "mtJzKD3q", + "ORJKgPNp", + "rD5uCHNg", + "khwkB6ra", + "BitxFUOE", + "K0xj45PZ", + "9xVJZ8Xr", + "xvYCCPha", + "cqKSqPQH", + "gpqniM0d", + "QWCOTizL", + "ch6lB4Mh", + "ZBKoFavY", + "nAaR07o2", + "JN7NY56L", + "at9xKHYT", + "9PuZ3Kv1", + "sZcSLicd", + "S7FrTSoe", + "nYfJt8sH", + "OUq3XNDY", + "5SZ2FbHC", + "BzcsKF0w", + "av84l2vE", + "9BVLcBub", + "jkLvxFFA", + "g2i5i750", + "FTmtYNdf", + "84vLaMxp", + "zQC8LMqE", + "vk0zN6fZ", + "jRyhNivy", + "H7gAzW4H", + "wHepnZI4", + "38Yn9SZ2", + "ugKXobOO", + "DoBtcvMg", + "BO9AiBm5", + "UHf5zYNP", + "aQVIrXgg", + "iVQqb3JE", + "9QJQkXQO", + "FOD8MnMP", + "TNV0t1vr", + "xUK1iLCG", + "ZixDSoU6", + "YgS4jj90", + "XcnnBerM", + "t7AKPYYe", + "3cpNy8V0", + "UCckCwKd", + "jJH2hIKf", + "VzqipEu3", + "FW52tJir", + "7PdWWUFS", + "OCdB6lFh", + "pAJPbTr6", + "2fuWty2a", + "eIrkcho9", + "r01y00lj", + "5hE1VVkN", + "7Jih1uiK", + "ZwZs424m", + "Z36RFcid", + "f3RkrLlq", + "tU9R6Yhm", + "qELXEyUW", + "rFTf6MGx", + "hX4kT2fu" + ], + "icon_url": "https://cdn.modrinth.com/data/4I1XuqiY/7a6acd528931a1a0d1b60fd0925b88227fb345cc.png", + "issues_url": "https://github.com/Traben-0/Entity_Model_Features/issues", + "source_url": "https://github.com/Traben-0/Entity_Model_Features", + "wiki_url": "https://github.com/Traben-0/Entity_Model_Features/blob/master/FEATURES.md", + "discord_url": "https://discord.com/invite/rURmwrzUcz", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/traben" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/4I1XuqiY/images/2f32dbeadc25e46ef6c56f0e47e5eb5d305c8ea2.png", + "featured": false, + "title": "Fresh Animations 1.8 - working", + "description": "https://www.curseforge.com/minecraft/texture-packs/fresh-animations", + "created": "2023-04-01T00:10:40.951806Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/4I1XuqiY/images/6a28d3a7f7178334c22d2c7878b3c816128f39d8.png", + "featured": false, + "title": "Fresh animations Skeleton & Iris shader", + "description": null, + "created": "2023-04-01T00:53:15.985275Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/4I1XuqiY/images/9afb8d0168dfc5ce99b2d3796b114a2d6986dcd3.png", + "featured": false, + "title": "Custom player model - posing", + "description": null, + "created": "2023-04-01T00:09:51.584125Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/4I1XuqiY/images/a243ddc1979faacf3745a6fa74d6e46218f1dff9.png", + "featured": false, + "title": "pig2", + "description": "https://www.planetminecraft.com/texture-pack/shiny-s-entity-models-plus-optifine/", + "created": "2023-04-01T00:09:06.189987Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/4I1XuqiY/images/a6fe81b299dff2877272c143ecf97b65a79bec39.png", + "featured": false, + "title": "Fresh animations Pillager & Iris shaders", + "description": null, + "created": "2023-04-01T00:53:57.239209Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/4I1XuqiY/images/b1faba6938262d67ff523a6eda870f0131b5960a.png", + "featured": false, + "title": "Fresh animations & Iris shaders", + "description": null, + "created": "2023-04-01T00:52:25.069954Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/4I1XuqiY/images/f62f4ec3152716aead6b53119049def9106f0b26.png", + "featured": false, + "title": "Custom enderman model", + "description": "https://www.planetminecraft.com/texture-pack/enhanced-endermans/", + "created": "2023-04-01T00:12:03.802474Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/4I1XuqiY/images/49f5b98dfef5b073a3971750673d343e1f92efe5.png", + "featured": true, + "title": "Custom pig model", + "description": "https://www.planetminecraft.com/texture-pack/shiny-s-entity-models-plus-optifine/", + "created": "2023-04-01T00:08:40.731617Z", + "ordering": 1 + } + ], + "color": 3154715, + "thread_id": "4I1XuqiY", + "monetization_status": "monetized" + }, + "entity_texture_features_fabric_1.20.1-6.1.3": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.16.5", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "22w11a", + "22w12a", + "1.19-pre3", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4-pre3", + "1.19.4", + "1.20-pre1", + "1.20-pre6", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5-rc2", + "1.20.5", + "1.20.6", + "1.21-rc1", + "1.21", + "1.21.1" + ], + "id": "BVzZfTc1", + "slug": "entitytexturefeatures", + "project_type": "mod", + "team": "6YS2sPMy", + "organization": null, + "title": "[ETF] Entity Texture Features", + "description": "Emissive, Random & Custom texture support for entities in resourcepacks just like Optifine but for Fabric", + "body": "\n\n# Entity Texture Features\n\n[![Enviroment](https://img.shields.io/badge/Enviroment-Client-purple)](https://modrinth.com/mods?e=client)\n[![Discord](https://img.shields.io/discord/950942125225283634?color=blue&logo=discord&label=Discord)](https://discord.gg/invite/rURmwrzUcz)\n\n[![Ko-fi](https://ko-fi.com/img/githubbutton_sm.svg)](https://ko-fi.com/traben)\n\n## \ud83e\udd14 What does this mod do?\n\nETF is a Fabric (Quilt compatible) & Forge mod that adds many new _Entity Texture Features_, including entity and player skin features!\nThis way, ETF achieves more OptiFine parity on the Fabric mod loader. If you want more OptiFine features on Fabric, you can either check [this list](https://lambdaurora.dev/optifine_alternatives), made by LambdaAurora, **or** you can use the [Fabulously Optimized modpack](https://modrinth.com/modpack/fabulously-optimized), which includes **all** the OptiFine parity mods!\n\n### Featuring:\n\n- [\ud83c\udfb2](https://github.com/Traben-0/Entity_Texture_Features/blob/master/.github/README-assets/RANDOM_GUIDE.md) Custom & random entity textures with the OptiFine format, including even more properties!\n- [\ud83d\udca1](https://github.com/Traben-0/Entity_Texture_Features/blob/master/.github/README-assets/EMISSIVE_GUIDE.md) Emissive/glowing entity textures with the OptiFine format\n- [\ud83d\ude11\ufe0f](https://github.com/Traben-0/Entity_Texture_Features/blob/master/.github/README.md#-blinking-textures) Blinking mobs\n- [\ud83c\udfa8](https://github.com/Traben-0/Entity_Texture_Features/blob/master/.github/README-assets/SKIN_GUIDE.md) Player skin features\n\n## Compatibility\n\n- OptiFine's random/custom or emissive entity resource packs - \"\u2705\" **Fully compatable**\n- [Entity Model Features (EMF)](https://modrinth.com/mod/entity-model-features) - \"\u2705\" **Fully compatible**\n- [dorianpb's CEM mod](https://modrinth.com/mod/cem) - \"\u2705\" **Fully compatible**\n- [Sodium](https://modrinth.com/mod/sodium) - \"\u2705\" **Fully compatible**\n- [Iris Shaders](https://modrinth.com/mod/iris) - \"\u2705\" **Fully compatible**
(Support varies depending on the shader)\n- Mod added entities - \"\u2705\" **Compatible**
(Only if the mod creator used the vanilla rendering code to render their mobs)\n\n## Settings & configuration\n\n- Settings can be changed in-game using [Mod Menu](https://modrinth.com/mod/modmenu), the settings button in the resource pack screen, or by editing the config file, located under `config/entity_texture_features.json`\n- A few of these options can also be changed via the [Puzzle mod](https://modrinth.com/mod/puzzle)\n\n\"Options\"\n\n## Mod support\n\n- This mod should be compatible with any mod added entities as long as they extend `LivingEntityRenderer` class for rendering and utilise it correctly\n- Any mod displaying an entity in a custom GUI can force the default texture by having the `entity.getblockstate` set to either `null` or of type `VOID_AIR`, the same can be achieved by settings the display mob's UUID to `UUID.nameUUIDFromBytes((\"GENERIC\").getBytes())`. \n\n## FAQ\n\n My entities are invisible/broken!\n\n> Custom Entity Models is not a feature provided by ETF. If your entities are invisible or look corrupted you'll need to instal my other mod [Entity Model Features EMF](https://modrinth.com/mod/entity-model-features) as well (this includes resource packs such as Fresh Animations). Keep in mind that the CEM mod is still in alpha development and may still occur issues.\n\n Blocks and items are not emissive!\n\n> ETF does not support emissive block and item texture, for that you'll need to install [Continuity](https://modrinth.com/mod/continuity).\n\n My game is lagging, help!\n\n> If you are experiencing lag please check your most recent log file to see if any errors are being logged, sometimes an incorrectly written properties file or missing textures may lag the system.\n\n It doesn't work!\n\n> Check if any issues are not actually a problem in the properties file, a few packs seem to be pointing to a texture that doesn't exist.\n So far all mob entities support random & emissive textures, but there may still be some quirks. If you find bugs you can either [report them in GitHub](https://github.com/Traben-0/Entity_Texture_Features/issues/new?assignees=Traben-0&labels=bug&template=bug_report.md&title=%5BBUG%5D+%22short+issue+description%22) or get support in the Discord server (linked on the top of the page).\n\n> Emissives are broken with Complimentary shaders, what do I do?\n\n>Complementary shaders has its own in-built emissive textures that usually work fine but will conflict with some resource packs. You can either disable Complimentary's emissives or ETF's emissives to fix this.\n\n My question isn't here!\n\n> Feel free to check ETF's [Discord](https://discord.gg/invite/rURmwrzUcz) to ask your questions or check the FAQ there :)\n\n## Change log\n\n [Changelog](https://github.com/Traben-0/Entity_Texture_Features/blob/master/common/CHANGELOG.md).\n\n## License\n\nThis mod is under the [GNU Lesser General Public License, v3.0](https://github.com/Traben-0/Entity_Texture_Features/blob/master/LICENSE).\n\n## Hosting Partner deal\n\n[![image](https://cdn.modrinth.com/data/BVzZfTc1/images/bfb592538f8206a6a2d72d19c90714bea91b0e07.png)](https://billing.kinetichosting.net/aff.php?aff=641)", + "body_url": null, + "published": "2022-01-26T02:02:53.096382Z", + "updated": "2024-08-09T13:41:39.944768Z", + "approved": "2022-01-26T02:02:53.096382Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 6198734, + "followers": 3229, + "categories": [ + "decoration", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "rvORsiwY", + "igj1EGYp", + "VdCygkuY", + "cTsJc9mK", + "iq9aafTJ", + "5tJdClkt", + "x4cswgvr", + "YK6hbErS", + "4DHV11l8", + "rLglVZBD", + "Og4Fk1Gg", + "vo1W0O1c", + "2w3yK8ef", + "AU8nwgOC", + "19voaoNq", + "OdzRH5hf", + "QaiqMN0D", + "L3JBkP55", + "POlskI3s", + "u3M5ROEs", + "WJg60WDZ", + "h7rIUxdF", + "3F0EV29D", + "x6zan49H", + "wI51X2ac", + "j6zaFIbZ", + "qGxqikLB", + "CEwUXkFY", + "zlCVtyS1", + "pOLLRXDQ", + "mljXTSw5", + "6UVt0xKb", + "lq1awVaR", + "XfchKMdL", + "ptpn9s7b", + "j5mWTLsV", + "7May6Ejt", + "hPQ5s52n", + "EGdnjG3x", + "uqLRu1PW", + "OL9wO7bF", + "nYzDnjGu", + "H7f9f2Hm", + "OyYm6CF5", + "d9gMEg0u", + "TaGhdtXR", + "APJvLWU9", + "9NpVaZxr", + "x8Pit8go", + "SKqP2pir", + "papGjlzO", + "QsuMVUdW", + "54GbAtvM", + "bOQr82Zm", + "9kpb92ws", + "j4OXiMqp", + "DwccS9tS", + "3B1xFsMB", + "tAME1Wi0", + "JNAjFCrB", + "XSgZG7Of", + "DN1z6Rl1", + "5mPRy5B6", + "XtpLGzEl", + "eb3qN1Fh", + "IpxKu0s8", + "wTmbgEgJ", + "VfJvxmE3", + "jRXrqPM7", + "VwBWDCzu", + "n9Zf0dPL", + "52RDBmQM", + "VxapEncs", + "8lkMJvNv", + "JPIC9ofE", + "QsPxlaAU", + "VWCXOQHF", + "HardtwjZ", + "ypX5P3jM", + "8XpXayfO", + "2OehSxqW", + "66q1EPRX", + "pMzvW79S", + "Tco32Bce", + "qZD3Vz9Z", + "4kzv6TQX", + "4YtziSu7", + "KBKeI45D", + "qzvSoyZZ", + "LLomGi3h", + "zNoUjaus", + "4OthHiGq", + "EhGfnoWY", + "aceDD6ip", + "Oh47k6kw", + "v95SmVXw", + "XwoPXFzL", + "fC3sNana", + "c3cpFF9t", + "CMYwvsPh", + "a4YzsmzU", + "kdNqcBQc", + "iBJRmSSb", + "ukr1WwVj", + "RMULKA7R", + "pAutSR2J", + "ZBGeGF7v", + "dSPko9qP", + "Ta6jwq1b", + "zIpRfJGw", + "wxqoWaxp", + "ETRrZyMz", + "T44uuxSa", + "nh5y85z7", + "CVHxjotn", + "Mm7KueIp", + "YeIziE6s", + "Q9VTlArC", + "yRJhlMwY", + "F7ZC75ln", + "4WOYtIge", + "4uGw2AoC", + "Jgnmccap", + "eqnLj0Ty", + "4DE0PgtE", + "qDWfufU7", + "lUY6MJko", + "y0I4mWUY", + "GJVl52mI", + "XcYyHBoY", + "AQ2U68wI", + "KGXpEmat", + "3RLtsfa8", + "44EA2Mfc", + "a8t3JGbs", + "ukn1ghoY", + "ASCvruGN", + "XgIVyuTx", + "FysgUMLL", + "l0EV3qFb", + "OnEUQPyg", + "ZrDXMT2l", + "DpEWP7FH", + "JRibkDsJ", + "diGHap5j", + "yDMz18wR", + "2z3GEBu5", + "9Em1LjD2", + "YrPJBVE6", + "tHwXqOG3", + "SMadIAU1", + "YqUYA4M8", + "HYMRNMcV", + "4LF51uza", + "7p3trw3A", + "59Fqhpg2", + "tcUfGg9x", + "UPenaMj3", + "Uya9vIxu", + "1Y3lxOX6", + "bK1a8KjO", + "OMNc4V5W", + "CjSVdAQR", + "ZXM48A5X", + "q5A2Cw7C", + "FSl57i99", + "7VZjYO7s", + "P5g3heP4", + "Z9uVc7X6", + "nnUuovth", + "iH5neQHO", + "9kZkB6eN", + "sBsNALne", + "2OrXvTpT", + "Xbz4ll09", + "xyMgzx36", + "WBLEReJT", + "7k32PYDx", + "aG9vZFHa", + "2zQ0rZri", + "eextCads", + "OK9i79fO", + "afcH17re", + "pwgniYj5", + "JXVDzP1d", + "XWSoEIYq", + "rCXSoyuo", + "CYT8LLOy", + "y75zt2Q0", + "gk3vF5vW", + "XsZ4b9CV", + "dgT81Q7W", + "9QYcSXx8", + "nu6lLhfO", + "CroB7LMQ", + "9nW7nT5B", + "vZ6VAHMU", + "gZQRrDJJ", + "clmSOM1p", + "tDUk08od", + "GhCAoeBk", + "1bZPXsmm", + "fFrpuPUR", + "VUb6WFfs", + "ajyiETwv", + "JwYwU8O2", + "CS4RfTDP", + "DVbS2kIx", + "r2xjfoD7", + "Agoi7AFd", + "MkzAXXDx", + "HemjHHpQ", + "aAcnoDHg", + "lnml1I18", + "e6fBwrPY", + "J87dYeyN", + "zkfGUaiV", + "3tzts2g9", + "gANduojd", + "x8Ir5T4F", + "PgeQ36xC", + "PrakWydh", + "6Ac6931r", + "rM5QKUL3", + "S4usf2jN", + "Arc3HTmh", + "OeSpIaIB", + "VnLAcknD", + "k30YZ0Zn", + "rVPyqDN2", + "YddGVt6V", + "9RdjaYYX", + "5mF9Ab6l", + "hr5gYdUa", + "DPuUdAbv", + "F3u2dEJG", + "BFUhkRCR", + "2udTpE8m", + "I7SvV3EL", + "yaOnJg8M", + "YnTygVlO", + "hC5AKKJz", + "qMoPCh9Z", + "o6exVMSl", + "6l1huD9q", + "KM8du29H", + "plgKIT6A", + "mKoCRI98", + "6RYOhhX3", + "TqwqW5dU", + "Vw0ikic1", + "T2VMc813", + "voFRojSn", + "NnvvKWlp", + "gSrsrmM1", + "36v1VCUb", + "6QKgVWs7", + "HFGqlRF0", + "zD4sJfuB", + "MwkhPYhf", + "A7CURPNe", + "NjD64J4h", + "vIbkWQvH", + "qvVrfelg", + "5hJWmW4r", + "SlF8LSPu", + "49aHHHOT", + "MbHYReOp", + "Hek1NTiF", + "ItQYro3P", + "jXc7eTKi", + "n97nAS3C", + "5a6694zO", + "LLAlgYfT", + "Gk2KxA6E", + "o42Lt8Ps", + "LGn4SuPQ", + "7Ew95Sjt", + "ZteQulNO", + "L1SXrTf0", + "YlyRB8o6", + "B633wDbe", + "A9d30Vws", + "pecEuozV", + "EHDdciG6", + "wzrdfTio", + "9I7jjOEm", + "meNVCVgn", + "Iqpdkpj4", + "aUpC497W", + "JvRwC1fO", + "VLe3jHDO", + "8czGsT2L", + "9yI5y8D9", + "DRwkMBEF", + "U2vgczps", + "sDShx7xX", + "VzqvqFHV", + "B1q81bZb", + "gMK5T2cg", + "fqFnWIXs", + "1Gi8YY84", + "9qagksz6", + "EDWEfvFs", + "O3jDICoH", + "IFRfepfL" + ], + "icon_url": "https://cdn.modrinth.com/data/BVzZfTc1/fa03aea7027f38b272a249d26cbe4cb7e94becf1.png", + "issues_url": "https://github.com/Traben-0/Entity_Texture_Features/issues", + "source_url": "https://github.com/Traben-0/Entity_Texture_Features", + "wiki_url": "https://github.com/Traben-0/Entity_Texture_Features/blob/master/.github/README.md", + "discord_url": "https://discord.com/invite/rURmwrzUcz", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/traben" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/BVzZfTc1/images/525bb5f97b5122cb4d72c9bc5b6b56e0c4f9b8ec.png", + "featured": false, + "title": "skin features example", + "description": null, + "created": "2022-03-04T10:05:50.151293Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/BVzZfTc1/images/5260909bc44abcade39ce46ec57d0edf6107ffb0.png", + "featured": true, + "title": "examples", + "description": "examples", + "created": "2022-03-04T10:05:21.619020Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/BVzZfTc1/images/bfb592538f8206a6a2d72d19c90714bea91b0e07.png", + "featured": false, + "title": "Kinetic hosting", + "description": null, + "created": "2023-11-25T09:08:37.812290Z", + "ordering": 0 + } + ], + "color": 12363099, + "thread_id": "BVzZfTc1", + "monetization_status": "monetized" + }, + "epicknightsnmages-0.0.2": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20.1" + ], + "id": "26nL5g7F", + "slug": "epic-knightsnmages-fabric", + "project_type": "mod", + "team": "4nWHeBGV", + "organization": null, + "title": "Epic Knights'n'Mages - Fabric", + "description": "A mod focused on adding new 3D-styled armors and weapons. This mod is supposed to use with Spell Engine.", + "body": "![Epic Knights'n'Mages Banner](https://cdn.discordapp.com/attachments/763829849004834826/1177985397335277630/LOGOKNM.png?ex=65747f64&is=65620a64&hm=984d2fd65a082fd790af23fe2be0cac757b24359382c700501753d31b74439f8&)\n\n![](https://img.shields.io/badge/1.20.1%20-msg?style=for-the-badge&label=Minecraft%20Version&color=0096f0&cacheSeconds=https%3A%2F%2Fwww.curseforge.com%2Fminecraft%2Fmc-mods%2Fgeckolib&link=https%3A%2F%2Fwww.curseforge.com%2Fminecraft%2Fmc-mods%2Fgeckolib) \n [![](https://img.shields.io/badge/Fabric%20-msg?style=for-the-badge&label=Modloader&color=0096f0&cacheSeconds=https%3A%2F%2Fwww.curseforge.com%2Fminecraft%2Fmc-mods%2Fgeckolib&link=https%3A%2F%2Fwww.curseforge.com%2Fminecraft%2Fmc-mods%2Fgeckolib)](https://fabricmc.net/) [![](https://img.shields.io/badge/REQUIRED-message?style=for-the-badge&logo=modrinth&label=Spell%20Engine&labelColor=gray&color=%230096f0)](https://modrinth.com/mod/spell-engine) [![](https://img.shields.io/badge/REQUIRED-message?style=for-the-badge&logo=modrinth&label=Azurelib&labelColor=gray&color=%230096f0)](https://modrinth.com/mod/azurelib)\n\n---\n\nEpic Knights'n'Mages Fabric is an official port of the Forge counterpart. But because there is no available Fabric Version of Ars Nouveau it is compatible with Spell Engine.\n\nNote: This mod is still in progress, so it could crash and contain bugs.\u00a0\u00a0\n\n### Compat for\n- [Better Combat](https://modrinth.com/mod/better-combat)\n- [Spellblades and Such](https://modrinth.com/mod/spellblades-and-such)\n- [Wizards](https://modrinth.com/mod/wizards)\n\nNote: You need Wizards ore Spellblades and Such to use spells!\u00a0\u00a0\n\n---\n\n[![](https://cdn.discordapp.com/attachments/1031970397152886806/1117698680447836190/Banner.png)](https://www.bisecthosting.com/p/lunapixel)\n\u00a0", + "body_url": null, + "published": "2024-01-28T16:19:50.622913Z", + "updated": "2024-04-14T17:22:48.429621Z", + "approved": "2024-01-31T05:03:32.841856Z", + "queued": "2024-01-28T16:30:54.110278Z", + "status": "archived", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "GPL-3.0-only", + "name": "GNU General Public License v3.0 only", + "url": "https://github.com/VeroxUniverse/EpicKnightsnMages-Fabric/blob/master/LICENSE" + }, + "downloads": 7438, + "followers": 22, + "categories": [ + "equipment", + "magic" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "V5RpEuTJ", + "hrNxEvik" + ], + "icon_url": "https://cdn.modrinth.com/data/26nL5g7F/5291743f1fc56d6a42eff729ae8b9a75b8fb0fef.png", + "issues_url": null, + "source_url": "https://github.com/VeroxUniverse/EpicKnightsnMages-Fabric/tree/master", + "wiki_url": null, + "discord_url": "https://discord.gg/28E3kQk7RD", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/26nL5g7F/images/36f528c2b551bbeea9bfe62f183f5e89ae3e395a.png", + "featured": false, + "title": "Knight Armor", + "description": null, + "created": "2024-01-28T16:23:54.888277Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/26nL5g7F/images/d7bf75d82082e41a2a1f824a5e5c98ba39835edb.png", + "featured": false, + "title": "Wizard Armor", + "description": null, + "created": "2024-01-28T16:23:37.557175Z", + "ordering": 0 + } + ], + "color": 10005431, + "thread_id": "JJsIsHmt", + "monetization_status": "monetized" + }, + "ExplorersCompass-1.20.1-2.2.3-fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19.2", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "RV1qfVQ8", + "slug": "explorers-compass", + "project_type": "mod", + "team": "SP6IRC9w", + "organization": null, + "title": "Explorer's Compass", + "description": "Allows you to locate structures anywhere in the world.", + "body": "![Explorer's Compass](https://i.imgur.com/HWRqFas.png)\n\nExplorer's Compass is an item that allows you to locate structures anywhere in the world. If you're looking for a compass that can locate biomes, check out [Natures's Compass](https://modrinth.com/mod/natures-compass).\n\n## Features\n\n- Right-click with the Explorer's Compass to open a GUI through which you can select a structure or group of structures to search for\n- Shift-right-click to reset the compass state\n- Information about a structure search is displayed on the HUD\n- When the compass is not pointing at a structure, it will point at the world spawn\n- Supports all registered structures, both vanilla and modded\n- Adjust properties like maximum search radius and blacklisted structures in the config file\n\n## Images\n\n![Information about a located structure is displayed on the HUD](https://i.imgur.com/h6ZHGDM.png)\n\n*Information about a located structure is displayed on the HUD*\n\n![The compass GUI, through which you can select a structure to search for](https://i.imgur.com/Q49Pvjv.png)\n\n*The compass GUI, through which you can select a structure to search for*\n\n## Recipe\n\n![Recipe](https://i.imgur.com/xSE8VSc.png)\n\n*The crafting recipe for the Explorer's Compass*\n\n## Modpacks\n\nYes, you can use this mod in your modpack.\n\n## Support\n\nIf you enjoy the mod and would like to support the project, feel free to [leave a donation on PayPal](https://www.paypal.com/donate/?business=46ZL2PNVP4XKE). Support is greatly appreciated!\n\n## Sponsor\n\nThis project is sponsored by BisectHosting. If you're looking for a server, check out their hosting plans and [use promo code\u00a0*Chaos*\u00a0at checkout](https://www.bisecthosting.com/chaos) to get 25% off your first month!\n\n[![](https://www.bisecthosting.com/partners/custom-banners/0998de1c-6d3e-4370-a553-0da42e986c68.png)](https://bisecthosting.com/chaos)", + "body_url": null, + "published": "2023-09-10T20:55:20.397318Z", + "updated": "2024-06-25T23:30:24.945778Z", + "approved": "2023-09-17T08:05:27.365330Z", + "queued": "2023-09-15T23:56:35.776580Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "CC-BY-NC-SA-4.0", + "name": "Creative Commons Attribution Non Commercial Share Alike 4.0 International", + "url": null + }, + "downloads": 621527, + "followers": 262, + "categories": [ + "adventure", + "equipment", + "utility" + ], + "additional_categories": [ + "game-mechanics", + "technology", + "worldgen" + ], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "mrxdJNRd", + "ggrXqdX7", + "oTdBRYxv", + "YkK8Bd84", + "rSKjK9Um", + "MTVqWk7F", + "uT6NnI6k", + "GUGRFm5k", + "9ntdShFb", + "JS0ehUbr", + "HBqrimuF", + "LEIJ1nqr", + "McHastx1", + "fnGyuS1M", + "qrNGp7hk", + "PfGCVLCo", + "spaa8r54", + "fmB2Imhp", + "2NHCWNgL", + "h4tPQHhq", + "P2h8tm0k", + "PheZubcO", + "u5Lx1NuZ", + "Wt733DFj", + "X6bg9eeC", + "ssYpfm9c", + "N07w27mM", + "Jlcqzf5e", + "Y20y30IK", + "sMc2HTnr", + "4mslBAc1", + "LEbHaAQc" + ], + "icon_url": "https://cdn.modrinth.com/data/RV1qfVQ8/16aee9631790996daba4d0dc5fe75f4e894ccaee.png", + "issues_url": "https://github.com/MattCzyr/ExplorersCompass/issues", + "source_url": "https://github.com/MattCzyr/ExplorersCompass", + "wiki_url": null, + "discord_url": null, + "donation_urls": [ + { + "id": "paypal", + "platform": "Paypal", + "url": "https://www.paypal.com/donate/?business=46ZL2PNVP4XKE" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/RV1qfVQ8/images/dfee69ce5ee069929c0fd4f082e94a3fc4c125a5.png", + "featured": false, + "title": "Found Structure", + "description": "Information about a located structure is displayed on the HUD", + "created": "2023-09-10T22:52:54.912687Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/RV1qfVQ8/images/b55e4284984fd0cfb4190a0d9d1e0e302bdb85e9.png", + "featured": false, + "title": "Select Structure", + "description": "The compass GUI, where you can select a structure to search for", + "created": "2023-09-10T22:53:50.702580Z", + "ordering": 1 + } + ], + "color": 4934475, + "thread_id": "aNgfksPu", + "monetization_status": "monetized" + }, + "fabric-api-0.92.2+1.20.1": { + "client_side": "optional", + "server_side": "optional", + "game_versions": [ + "18w49a", + "18w50a", + "19w02a", + "19w03a", + "19w03c", + "19w04a", + "19w04b", + "19w05a", + "19w06a", + "19w07a", + "19w08a", + "19w08b", + "19w11a", + "19w11b", + "19w12a", + "19w12b", + "19w13a", + "19w13b", + "19w14a", + "19w14b", + "1.14-pre1", + "1.14-pre3", + "1.14", + "1.14.1-pre2", + "1.14.1", + "1.14.2-pre2", + "1.14.2-pre4", + "1.14.2", + "1.14.3", + "1.14.4-pre5", + "1.14.4", + "19w34a", + "19w35a", + "19w36a", + "19w37a", + "19w38b", + "19w39a", + "19w40a", + "19w41a", + "19w42a", + "19w44a", + "19w45a", + "19w45b", + "19w46a", + "19w46b", + "1.15-pre1", + "1.15-pre2", + "1.15-pre3", + "1.15-pre4", + "1.15-pre5", + "1.15-pre6", + "1.15-pre7", + "1.15", + "1.15.1", + "1.15.2-pre1", + "1.15.2-pre2", + "1.15.2", + "20w06a", + "20w07a", + "20w08a", + "20w09a", + "20w10a", + "20w11a", + "20w12a", + "20w13a", + "20w13b", + "20w14infinite", + "20w14a", + "20w15a", + "20w16a", + "20w17a", + "20w18a", + "20w19a", + "20w20a", + "20w20b", + "20w21a", + "20w22a", + "1.16-pre1", + "1.16-pre2", + "1.16-pre3", + "1.16-pre4", + "1.16-pre5", + "1.16-pre6", + "1.16-pre7", + "1.16-pre8", + "1.16-rc1", + "1.16", + "1.16.1", + "20w27a", + "20w28a", + "20w29a", + "20w30a", + "1.16.2-pre1", + "1.16.2-pre2", + "1.16.2-pre3", + "1.16.2-rc1", + "1.16.2", + "1.16.3", + "1.16.4", + "20w45a", + "20w46a", + "20w48a", + "20w49a", + "20w51a", + "1.16.5", + "21w03a", + "21w05a", + "21w05b", + "21w06a", + "21w07a", + "21w08a", + "21w10a", + "21w11a", + "21w13a", + "21w14a", + "21w15a", + "21w16a", + "21w17a", + "21w18a", + "21w19a", + "21w20a", + "1.17-pre1", + "1.17-rc1", + "1.17", + "1.17.1-rc2", + "1.17.1", + "21w37a", + "21w38a", + "21w39a", + "21w40a", + "21w41a", + "21w42a", + "21w43a", + "21w44a", + "1.18-pre1", + "1.18-pre2", + "1.18-pre3", + "1.18-pre4", + "1.18-pre5", + "1.18-pre6", + "1.18-pre7", + "1.18-rc1", + "1.18-rc2", + "1.18-rc3", + "1.18-rc4", + "1.18", + "1.18.1", + "22w03a", + "22w06a", + "22w07a", + "1.18.2-pre1", + "1.18.2-pre2", + "1.18.2-pre3", + "1.18.2-rc1", + "1.18.2", + "22w11a", + "22w12a", + "22w13a", + "22w13oneblockatatime", + "22w14a", + "22w15a", + "22w16b", + "22w17a", + "22w18a", + "22w19a", + "1.19-pre1", + "1.19-pre2", + "1.19-pre4", + "1.19-rc1", + "1.19", + "1.19.1-pre2", + "1.19.1-pre4", + "1.19.1-pre6", + "1.19.1-rc2", + "1.19.1-rc3", + "1.19.1", + "1.19.2", + "22w42a", + "22w43a", + "22w44a", + "22w45a", + "22w46a", + "1.19.3-pre1", + "1.19.3-pre2", + "1.19.3-pre3", + "1.19.3", + "23w03a", + "23w04a", + "23w05a", + "23w06a", + "23w07a", + "1.19.4-pre1", + "1.19.4-pre2", + "1.19.4-pre3", + "1.19.4", + "23w12a", + "23w13a", + "23w13a_or_b", + "23w14a", + "23w16a", + "23w17a", + "23w18a", + "1.20-pre1", + "1.20-pre2", + "1.20-pre3", + "1.20-pre5", + "1.20-pre6", + "1.20-pre7", + "1.20", + "1.20.1", + "23w31a", + "23w32a", + "23w33a", + "23w35a", + "1.20.2-pre1", + "1.20.2-pre2", + "1.20.2-pre4", + "1.20.2-rc1", + "1.20.2", + "23w40a", + "23w41a", + "23w42a", + "23w43a", + "23w43b", + "23w44a", + "23w45a", + "23w46a", + "1.20.3-pre1", + "1.20.3-pre2", + "1.20.3", + "1.20.4", + "23w51b", + "24w03b", + "24w04a", + "24w05a", + "24w06a", + "24w07a", + "24w09a", + "24w10a", + "24w11a", + "24w12a", + "24w13a", + "24w14potato", + "24w14a", + "1.20.5-pre1", + "1.20.5-pre2", + "1.20.5-pre3", + "1.20.5-pre4", + "1.20.5-rc2", + "1.20.5", + "1.20.6-rc1", + "1.20.6", + "24w18a", + "24w19b", + "24w20a", + "24w21b", + "1.21-pre1", + "1.21-pre3", + "1.21-pre4", + "1.21", + "1.21.1-rc1", + "1.21.1" + ], + "id": "P7dR8mSH", + "slug": "fabric-api", + "project_type": "mod", + "team": "BZoBsPo6", + "organization": null, + "title": "Fabric API", + "description": "Lightweight and modular API providing common hooks and intercompatibility measures utilized by mods using the Fabric toolchain.", + "body": "# Fabric API\n\nEssential hooks for modding with Fabric.\n\nFabric API is the library for essential hooks and interoperability mechanisms for Fabric mods. Examples include:\n\n- Exposing functionality that is useful but difficult to access for many mods such as particles, biomes and dimensions\n- Adding events, hooks and APIs to improve interopability between mods.\n- Essential features such as registry synchronization and adding information to crash reports.\n- An advanced rendering API designed for compatibility with optimization mods and graphics overhaul mods.\n\nAlso check out [Fabric Loader](https://github.com/FabricMC/fabric-loader), the (mostly) version-independent mod loader that powers Fabric. Fabric API is a mod like any other Fabric mod which requires Fabric Loader to be installed.\n\nFor support and discussion for both developers and users, visit [the Fabric Discord server](https://discord.gg/v6v4pMv).\n\n## Using Fabric API to play with mods\n\nMake sure you have install fabric loader first. More information about installing Fabric Loader can be found [here](https://fabricmc.net/use/).\n\nThe downloaded jar file should be placed in your `mods` folder.", + "body_url": null, + "published": "2021-01-22T11:04:41.419169Z", + "updated": "2024-08-11T14:28:27.511100Z", + "approved": "2021-01-22T11:04:41.419169Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "Apache-2.0", + "name": "Apache License 2.0", + "url": null + }, + "downloads": 19522052, + "followers": 11817, + "categories": [ + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "KZS9tylY", + "EW33COvi", + "Vz2fCyj1", + "TiRfiHCC", + "3auffiOJ", + "yKxt6vQd", + "mzWtLKwY", + "I5uJBxv3", + "NB6ZFJFw", + "PRBzeeTW", + "SX46NK1K", + "C3VkBnFi", + "APdJVxfY", + "WNbTdkLS", + "PfY0kOEk", + "R1AfzdaQ", + "7g9p2881", + "qrEy5YGE", + "BabMEX3f", + "WSJOUdKs", + "1chh3gx2", + "yOnIEotM", + "ePwgymTJ", + "fC5RTD55", + "Y3EXNN7S", + "IFHFSVDc", + "aRmkQPrs", + "7hZJzidC", + "AB1fvWV8", + "aqfJ1ZuZ", + "bXYTGKvj", + "JicWt7qw", + "LWAYx3hL", + "ai7D22n3", + "VFSs6Ujy", + "1v932ZMY", + "y4zn8BT1", + "oKPs1SgF", + "BGFFpdzl", + "3OPzLHVJ", + "HMBgn02e", + "jYJIwG4c", + "zqUXAY4L", + "GmcSmmPF", + "pO03bZZA", + "ZNI3l5o3", + "fupc7s32", + "BzWRlGLN", + "52Zx3vLX", + "Tbl6vl8j", + "sv0yIUjC", + "nAbEPgYx", + "v8I9HEA4", + "QVDJylQ7", + "9albznND", + "7nKP4yUa", + "YwHHPNVI", + "tZqJpmCW", + "crBXiDCW", + "lnkOzZ0b", + "iF0q9SQK", + "aa7GjDs9", + "7UNh2PBF", + "IothiuUB", + "7RI2g67e", + "JysUXOMs", + "rNfaRTfl", + "f2Y3vhQu", + "5XLBQVFI", + "wmUvwv00", + "jifaWih8", + "nPHDYMfc", + "tkaL7rcq", + "gmvBfE4x", + "exn4lPJ8", + "bNe2h4sb", + "BUu5qPlZ", + "JBCGfIWh", + "XnQSD5Ie", + "GcaiauBc", + "n9VMDfcg", + "XYe2MNMi", + "bTnRtObn", + "LfUdA4Sf", + "CW216TFl", + "hFzTbYRu", + "x9ZqLRwc", + "Y7X8Hhka", + "FgmJUe3S", + "qkvl3xDD", + "51YGaK6m", + "PgLQbTH9", + "2EyE2SxG", + "iPJqMlJy", + "mQsw49fV", + "7NCd11cy", + "EWwPPL6y", + "9E3POSah", + "QyoYoS1L", + "6PjGUXft", + "q3B57giZ", + "duXtu7Mv", + "ct54kLn6", + "UW9fZnIN", + "XTHo3Zv2", + "LnDlY6qD", + "E43TEQUr", + "GQvJGWo8", + "no2tybzZ", + "TqJCrZRc", + "Ih6Z2LPA", + "epLznJvj", + "3WigUN4i", + "TrIel4SO", + "JG3trBMB", + "iGsZlV1Z", + "w1hoJyvR", + "aaxysYSr", + "P4dVOjdB", + "2crJecHK", + "g6dqlhZA", + "Sk17Arv8", + "LDBk6Gkw", + "w04KtwfS", + "AXjFPkGO", + "w7WYHFXQ", + "wI5SUVrP", + "oIkwUl43", + "zy7W9w8D", + "6xwSUlAN", + "kGajkc8S", + "SfYgWJcE", + "gpl4Fj6D", + "jDDozYmj", + "hW7nEpTZ", + "WySSeVkG", + "XwTuWbpO", + "Ua4lc5tg", + "HVDOfdmY", + "eWxc51hM", + "kpHh05FP", + "1Clf5dTa", + "U1MW7MAt", + "hyFOWGxi", + "XuINwA4Z", + "fs6Evior", + "caAUQUkM", + "RmrI7aQl", + "bIivV1Nw", + "QV7vnKKc", + "FGedIovs", + "NvpxBurp", + "38hxkT6t", + "IIqfpBaC", + "nNKIpQi1", + "KugUHHeo", + "levT8TBv", + "ELyTc2mR", + "3s09jk3z", + "ERBf7VT3", + "dbfSq8gn", + "T4me78o3", + "iRrnCNpj", + "F5kyXfQb", + "5u1C2PFE", + "lO97gbkP", + "fJLeal0h", + "ELM4vP2I", + "foukWeKL", + "DV6pvooZ", + "qXBnqLRc", + "fHPZAS6s", + "a8f8UOYM", + "cYqIQo6h", + "8Q9AiNzI", + "yZHVE5uS", + "476bZqxy", + "PsMx4chP", + "HqAMsbpy", + "5ddKSVe9", + "LTcOldqW", + "sf5KQYnF", + "xypy8s9d", + "RlLMBaqw", + "LoB1lXAQ", + "X74E54Pq", + "Gb8k1YeO", + "h3AFkvAF", + "fV3kAyxg", + "RLzY3ZyY", + "XwvTqkqr", + "LrJRgLWV", + "uvA4N5rC", + "2YoDvysd", + "Qnv15UTu", + "MeLFgiB0", + "eQrQQE1p", + "XRQRuLgk", + "Lx1AX1td", + "NI4JkISw", + "L0wmxvVG", + "ynl2hvIH", + "5OBoG05F", + "jhX16Zcz", + "i2mlXS4U", + "vwTV4Agb", + "Fvd4Zkyo", + "W6IAFO72", + "CQRo7bxt", + "U7YDQZjA", + "rVazA1wF", + "ti8dGWwg", + "GS00Csiv", + "44wTrwmg", + "6zAqUmO0", + "n1BGDH9X", + "O2qc6nsy", + "FRg18j3a", + "Z92GEPU2", + "fSPo6UtM", + "N9qZdjt3", + "ljGdqEqS", + "qQC5klDH", + "2q6Dmb8u", + "XqodfB4f", + "wF33uVr9", + "8TLEIaci", + "io0wt4Ai", + "1dB65ppH", + "GbZ13YI1", + "ALjNbsdy", + "kZ8Z5Xwx", + "roD21Eou", + "KCmSPU8b", + "XYuF5hfV", + "jvr2zzlL", + "8eKkyfGa", + "1bgrYcMk", + "k6xnp0Hz", + "JM6MJue5", + "4wIURb45", + "81uX9Q66", + "kJMpYKrv", + "zpmtKxfV", + "pAdwyjJP", + "iW7F3Rkl", + "eNDeMswm", + "suesdaHb", + "cGdCXkjZ", + "ruet8er8", + "lIsi9TdU", + "L6oNo6Hx", + "RNDPXNQg", + "rrnLvsbL", + "AGabiBYy", + "MR89IvfQ", + "RtAjPwHu", + "rjQkRuiu", + "TGB25RLi", + "34iyRwzB", + "vuHWOQsB", + "jy6ehlNe", + "qgqitIMI", + "25waSV2L", + "5gPmK81C", + "d21cnfln", + "J5JHDJKa", + "HnCisPYp", + "D2fqWC01", + "QF33F6to", + "hlEg3Ozs", + "hcZrl16R", + "1gnEwdMi", + "1n6nGkCj", + "WcqtO6g6", + "KXNNWSBt", + "Abp6x34K", + "q7i31UcD", + "jewlv99C", + "Rc4DKtpu", + "iOvG1Rif", + "sJHVkrRE", + "WzEfKGJu", + "1TOAhSZW", + "fiMbeNUu", + "cO903CY4", + "2jFjAUSt", + "DP0Ius6z", + "Ys8c8itO", + "rU0jh5Rv", + "4Zmxh5NU", + "GkKh6DGq", + "lEthR8FU", + "wkID6YQU", + "qPNxv5qZ", + "YyI4A4tt", + "ybc5Fjql", + "PsJFXTI2", + "cw07UNpY", + "xSa6h9gv", + "gBLh1BAK", + "7lA83Whn", + "7zjdfV3v", + "BIUjYtXO", + "9RTllJIs", + "N5hYQpLP", + "zcpbyWSH", + "1bDn0oLI", + "ZCRPU7zu", + "qaApHOxA", + "ClXHxfOV", + "Vp6ARkhq", + "aP6jwPyA", + "yGfXqDYu", + "TcdLJQkj", + "4TrYrOhI", + "5NTTynba", + "UxiJdq3q", + "Vh55Sosk", + "DCqjhIiP", + "RLPbgBGP", + "ScMraOCG", + "ic9HilAb", + "xw5YrDHt", + "3dK7BAmw", + "RiOE32Re", + "g2QSvr4g", + "B9qTR9oh", + "i6yKzgtO", + "L55bHtC9", + "5qwmtjaP", + "nFK910wv", + "23nCK0zM", + "qmeurUwp", + "RljeA1em", + "Hw9K1dUH", + "DViguGBA", + "tAqtfwEb", + "6qikX5Zw", + "vD9PxKZt", + "CHkbQuNz", + "nR3Lb75e", + "HkwJBiOP", + "mHW3ZSDH", + "uNHA8hFl", + "IOVsvUHu", + "Xivipob5", + "VqmivTIF", + "SQ4CPyrs", + "qGPfVyPw", + "pZTsfuSa", + "TNF6hDpc", + "gtUkBmSy", + "SI4Cri3X", + "YC7ealNj", + "7jVcrYVZ", + "FvApKY5i", + "pKzU4NF4", + "St6VBaEb", + "GWhMfYFJ", + "ct7BsEJ1", + "ZR9hBADo", + "WkR4r28V", + "3NQwzj0b", + "LCbP8k6I", + "KvmAjA9G", + "odx4vw2k", + "g5y6g6Oq", + "Fb66M9rQ", + "ClUU6TVG", + "X6LKWJUx", + "9B6jUUyL", + "VDl94Lx0", + "gtgzO8r7", + "EuJENaAz", + "XgS3g0uq", + "fjsrOLR7", + "vM5SpVPC", + "SbrYJtHJ", + "rQOQL6nC", + "ef3DimVt", + "zihmTu83", + "zPS1p5ul", + "CI09738V", + "3XrQEeEu", + "zd2RW4Xi", + "Bnw2XweM", + "qgTkxcag", + "X6NzLlSk", + "eGAKaHl7", + "eq9NNGcv", + "t8gxHRxl", + "DCcAtmIm", + "nfZMS1GK", + "wNjT7tOI", + "BBBRpjOG", + "nV2Cc214", + "LoZHv9Ac", + "8w6BMMkH", + "yfzhMeRZ", + "J6yPQoBy", + "2aTn2k1M", + "inQsbwtD", + "bVa5NyiC", + "g8jHG8t2", + "DxWH1HyN", + "V0Yx8gzI", + "4JKJwzcT", + "2kDcV5Rp", + "EepWkllY", + "cdPFdaZ4", + "VKwiy2Fm", + "oAVHz54U", + "nSk00F5M", + "o68l3pK3", + "II8sVuAK", + "b3GuijTJ", + "wNNNnSQB", + "JXjDyWqh", + "Fk7dLlzZ", + "KXxIfJ4K", + "avb6CBpt", + "aXrklWT4", + "AqFdVh6X", + "5LO7hoyJ", + "xgzl8S6m", + "Vr6Eq12L", + "h0HoxKBz", + "NScgrIrE", + "fpveFNDq", + "iTTMUPdd", + "GzcQEsBn", + "2Q9R2Z5W", + "gjN9CB30", + "zdAac4ij", + "owCnLYun", + "6mslMyea", + "QtAVpmoX", + "c1p9mmFg", + "dX8yiqT6", + "oLjJzxjk", + "iEU93RnX", + "uHo75xmS", + "im91Yq9s", + "PrZIpVLI", + "UZCSOkHS", + "oAi2pJFx", + "gMpobWLJ", + "xU3d1ArH", + "OeX96oTd", + "lyaaKFpp", + "5b23omah", + "XT25p2RV", + "QlWozpGb", + "lSNmBh6P", + "mBOaVuXE", + "8JmQ2bVs", + "QNXr6ta7", + "9N0AONyO", + "IQ3UGSc2", + "cCwCSFzJ", + "7PoSQfpH", + "gK5r4m48", + "z5eIXbzz", + "LwU7RcOt", + "rwtrPdHf", + "LbPFAxci", + "imV7tC6t", + "RLIPEHHI", + "v2e6feGG", + "5mzrfkuD", + "2ZVOAfTp", + "Mp3ilM3K", + "ONHLJRj5", + "5eX37YdU", + "ruKoLG2a", + "RSZHmY2f", + "1rPtAM25", + "qh9BpS0Q", + "rrB1aFl6", + "qN4IdGPY", + "ucX1SrPo", + "n5KmwVUC", + "o2TrD6Eo", + "a1Bgv73y", + "31ES0yWr", + "Y7dZDIq6", + "ZXFuyLm4", + "xzPDsj4Y", + "gKz1DWWR", + "PUNMV5UU", + "2veYst24", + "YuaoI45J", + "qR6UgeLi", + "4R7v9Sf6", + "8rCmUasd", + "jQNYE4m1", + "jv9slnyk", + "tOJMtumY", + "mNuoiBpM", + "kbtdliUm", + "KKt1P7YW", + "mGIxWbTy", + "7BiQSUvg", + "EaJiKt73", + "B5ukNuTY", + "ptyffaeX", + "Rm5XIX2N", + "E7uu0uCd", + "PmzPicLN", + "pGXtbsj1", + "BMFJwerO", + "Bg5KcCr6", + "5csZv4Dd", + "4NpVpLMY", + "INRZVF8u", + "GxqbUxtc", + "BpTF8BtN", + "VO0pdfjT", + "tWv6sqTb", + "UWMXoG0K", + "yLERB0ld", + "ujdG5zAV", + "e2jFn9b5", + "O3Hx0v9e", + "RS6s817x", + "MfJTZ2gj", + "UxKTFgii", + "Pi1d5Ub1", + "HoO8uHlA", + "AuDVe22s", + "kNiwhB71", + "PXC4DUqw", + "AnCs0z08", + "qwFMzWsq", + "pT09syaU", + "6woB9qxm", + "OGjjpVM3", + "wIj7jjb3", + "lWMN0I1E", + "pBYk3WbR", + "64nlF7yO", + "jqrQwxen", + "3NXSq101", + "gFSJzMSV", + "sHhBYUuX", + "eLL0jpsb", + "s9txaq7F", + "U2sut1z2", + "Zp275COe", + "IuzkNe9N", + "hUwPVCw8", + "e04JMV6V", + "4XRtXhtL", + "3KmOcp6b", + "a0U5nQcV", + "Zl4LIQbN", + "p6L5EWXf", + "XG2HDjDi", + "JYx8wTgt", + "3fY6NddT", + "6Iv0Y14L", + "EsaWeELS", + "RAzwgZkP", + "XV9QDCar", + "BC3dQECI", + "uLpYu4FP", + "hjQL60eb", + "gjysTPsx", + "9nx74dYD", + "lfbnci9q", + "v5jQhQ10", + "yTwwfX8B", + "Yq33fioO", + "yQIU5REa", + "8rIblgME", + "Uxjomqbn", + "IbqSWauI", + "w4AD78Aa", + "hFVWjqsX", + "5GqVAvvY", + "YDlOLdpm", + "gugCMs27", + "JDGZPBY3", + "gdGDJ2bh", + "4SE1VOoA", + "t5sg5W2X", + "7R87xyfz", + "8GHkHEa9", + "BXfHW8Ww", + "UYTSD4aj", + "DTb2fq9B", + "25Hm7c3j", + "U2QS5FNi", + "pCfxz2JH", + "mrB7EiW4", + "MtLQsb99", + "QL74kcxU", + "rcnGIuHL", + "qbOkGdTB", + "vWbvdIxT", + "3RABUs9m", + "6XyLcjn4", + "PbVeub96", + "i7ZuGTZS", + "jZGQj0SC", + "d6AIXpak", + "wRYBRKfJ", + "WJ830YlF", + "7MPbPZS0", + "soTZU9Bz", + "HnvZbc6z", + "HJHzm5Yp", + "1ld37x4U", + "7rnoQ392", + "Sd7u3cNN", + "3EgKhiTb", + "CeVWqAVr", + "VOZ8sKAb", + "IzS7xNr6", + "sqGaf7I2", + "1cCEN67v", + "6iOab8Tp", + "nOI7bsDO", + "CMRcHhfl", + "R98cmuxG", + "67xsScMW", + "95QMsRyb", + "hfsU4hXq", + "V7gqra8F", + "Pz1hLqTB", + "P8odwADJ", + "AaOg5lro", + "TenXkoRu", + "9Oj5Kedy", + "GobJMGkD", + "nENKf47R", + "U5yOpfRr", + "jyKnHEDY", + "unERf4ZJ", + "ThzLBe5M", + "E67zJhaF", + "qvrUMd9Z", + "LMabW8IV", + "xYrkbzlg", + "OCKrSzAZ", + "s5UrEfIY", + "6mQyGxQ8", + "o0y85XuU", + "WM12byEn", + "W7Sx4qvX", + "Xru23QG1", + "xMssmsXr", + "qMk5NmAs", + "JxkMjQqZ", + "R0aqiP3n", + "eONqge2p", + "E6YKBZtg", + "B7GygbYq", + "8aHBU22O", + "5U5Y73uW", + "n2c5lxAo", + "rSrmGeeJ", + "K1pOTt6K", + "MYvpypD6", + "FLGCXPFi", + "zn7AQtxP", + "hFdJG9fY", + "hZp3OTog", + "P7fEfdSc", + "uIYkhRbX", + "XheZ9iGK", + "sIo7d89K", + "KIPTaPqJ", + "fO05PwUR", + "LKgVmlZB", + "lcnQpW9C", + "27G0kpIF", + "Tt0NzFL1", + "mQnPDt5N", + "I3OHfQBA", + "r0FNcItN", + "Jy5LrolV", + "pYtlDijL", + "B8hbaMOT", + "QmY4nUvp", + "ROFwKb90", + "Wp5mH29T", + "F40Zv8vc", + "1sf8i9fy", + "DnwAgNmV", + "lRcC0FRh", + "1Pj9mogm", + "znrh6Yyo", + "Hi8quJUM", + "tzxGqDe8", + "Y39HzGbx", + "tFw0iWAk", + "Hk8zAzIB", + "gaXnTtGJ", + "837zpBLd", + "fgu4rome", + "1SZKVmdh", + "TpZ2i93f", + "ZI1BEw1i", + "Og20ksSg", + "jzcdFzPc", + "8PjIM8Rd", + "nyAmoHlr", + "JXpzzvU6", + "FhOnpSMY", + "BVLAIn5Q", + "97By7e74", + "DushQOTf", + "ejEanIXC", + "Gy5s400X", + "qk28POfr", + "6g95K303", + "YblXfKtI", + "mAiJMJSa", + "DfUQXHFa", + "qg6wQgub", + "Yolngp3s", + "Uppy4qHd", + "fdestf2d", + "yGY1P8Yr", + "JQ07mKWY", + "SfxxnaeS", + "JMCwDuki", + "ORqSdnJ8", + "E43lIzib", + "cAJWRbQt", + "5ngsQlW8", + "7HnviItK", + "nBKoUaUC", + "2sYBLn0C", + "e3cgXQ6I", + "jYPNoqlj", + "92lczH6b", + "tWshyEgT", + "XxkTbJzb", + "cXkV2nJO", + "p9GxFWDv", + "TvatZFJI", + "cmnVMpqB", + "f9JMbGv4", + "8GVp7wDk", + "dBMtQPll", + "vEBS94Zq", + "cpC3P6YE", + "fjL26nka", + "U8tA9DvG", + "FFgraWZB", + "X7fZBPdI", + "bnOsLTYu", + "DLrJPVCZ", + "UgdmocrA", + "3O5raQ1L", + "YG53rBmj", + "5FwMHnbp", + "Ca6gRk94", + "atH5wCfH", + "9p2sguD7", + "t7ARQ1lQ", + "oewq0SPx", + "jYlYpyl9", + "vgnJPkyY", + "2ovmmsss", + "aOORgwbx", + "nrGbafeF", + "htRy7kbI", + "AwBEF5aU", + "O0ZgFsuV", + "A1IDokGa", + "WovL05Nr", + "65jl2uF9", + "ba99D9Qf", + "axDEQtMs", + "xklQBMta", + "BOnMBe9t", + "za8EviCq", + "qhBAD6lk", + "ouNIk6kN", + "cM9AhPFx", + "zrJxy4cn", + "D7jXLoRF", + "94EiEX8x", + "tftr9Gex", + "w41vyG5F", + "GCdY4I8I", + "kAQqRNrK", + "bWfIZwG6", + "191HCCtF", + "AVWxA6CK", + "RMl45Lr7", + "ik31TLQH", + "sswM8UzU", + "ICmfMxxh", + "auwFTj9W", + "v9iq0iHT", + "P7uGFii0", + "tAwdMmKY", + "1uMtrDCU", + "ZrFtKs5T", + "MtIGbixh", + "FXHCHBBg", + "U6iuRBNQ", + "IdbZAPPF", + "vOCP22mm", + "HXzEJYgV", + "MiIndOKP", + "IHIHC1yO", + "1cXs6RWI", + "GT0R5Mz7", + "oIVA3FbL", + "mDmQIaOM", + "Y0cpssyN", + "vMQdA5QJ", + "ocg4hG3t", + "iS2jNAxk", + "hpxN9iW3", + "YF44uv1l", + "EY5IAcV9", + "vEv7eHR6", + "oGwyXeEI", + "VAjB0MYF", + "bK6OgzFj" + ], + "icon_url": "https://cdn.modrinth.com/data/P7dR8mSH/icon.png", + "issues_url": "https://github.com/FabricMC/fabric/issues", + "source_url": "https://github.com/FabricMC/fabric", + "wiki_url": "https://fabricmc.net/wiki/", + "discord_url": "https://discord.gg/v6v4pMv", + "donation_urls": [], + "gallery": [], + "color": 12367004, + "thread_id": "P7dR8mSH", + "monetization_status": "monetized" + }, + "fabric-end-remastered-5.2.4": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.3", + "1.16.4", + "1.16.5", + "1.17.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.21", + "1.21.1" + ], + "id": "ZJTGwAND", + "slug": "endrem", + "project_type": "mod", + "team": "Ss2f4ZeZ", + "organization": null, + "title": "End Remastered", + "description": "Make your journey to the End more Challenging and Engaging with End Remastered!", + "body": "

 

\n

\"End

\n

  

\n

\"Discord\"      \"PayPal\"      \"Youtube

\n

 

\n

End Remastered overhauls the way players get to the End and makes the experience way more interesting by forcing them to fully explore the beautiful world of Minecraft. Adding 16 totally new Ender Eyes hidden all around your world, this mod will make your playthrough a lot more enjoyable.

\n

 

\n

Supported Versions: 1.16.3, 1.16.4, 1.16.5, 1.17.1, 1.18.1, 1.18.2, 1.19, 1.19.1, 1.19.2, 1.19.3, 1.19.4, 1.20, 1.20.1, 1.21!

\n

 

\n

Our Partners:

\n

 

\n

\n

 

\n

Thanks to Apex Hosting for partnering with End Remastered!
Are you looking for a place to play Minecraft with your friends?
Well, look no further because Apex Hosting got you covered! With their great and easy to use Control Panel and their multiple servers spread across the entire globe, you can have your own Minecraft server up and running in about 5 minutes. Use this link: https://billing.apexminecrafthosting.com/aff.php?aff=4481 or click on the image below to get started now!

\n

 

\n

Want to support us directly, you can also donate through PayPal: Learn More!

\n

 

\n

 The Mod Content:

\n

 

\n

Exploration is the main focus of End Remastered, and to reach the End and beat the Ender Dragon, you will have to find 16 custom eyes by exploring vanilla structures and fighting vanilla bosses. Once you have at least 12 eyes, you can follow them until you reach the Stronghold. You have to put the 12 custom eyes in the portal in order to open it. If there's a vanilla eye of ender in one of the frames, you can remove it by right clicking on it with a custom eye.

\n

 

\n

 

\n

\"The

\n

The Eyes are a really important part of End Remastered, just like Vanilla Ender Eyes, they allow you to activate the portal to the End. However, unlike Vanilla Ender Eyes, they are not dropped by Endermen, but must be found by exploring, fighting and mining. For more info, click the spoiler tag below.

\n

 

\n
\n

1. Old Eye - Found in Desert Pyramids

\n

Legends say this eye once belonged to one of the great Sandworms

\n

2. Nether Eye - Found in Nether Fortresses

\n

It was lost by a demon in the battle between the Aether and the Nether

\n

3. Cold Eye - Found in Igloos

\n

One of the last artifacts left behind by the Iceologers before they all suddenly vanished from the world

\n

4. Rogue Eye - Found in Jungle Pyramids

\n

This eye is believed to have given our ancestors the knowledge of Redstone

\n

5. Black Eye - Found in Buried Chests

\n

Pirates say it gave sight to the legendary Black Pearl

\n

6. Magical Eye - Dropped by Evokers

\n

Without this eye, the Evoker has no power

\n

7. Lost Eye - Found in Mineshafts

\n

It is told that it was forged by the first blacksmiths of time

\n

8. Corrupted Eye - Found in Pillager Outposts

\n

The eye of a greedy king faded in solitude. Legend says it will bring infinite fortune to its owner

\n

9. Wither Eye - Dropped by The Wither

\n

Has witnessed destruction. Maybe it also witnessed your stuff disappear

\n

10. Guardian Eye - Get it by Killing Elder Guardian

\n

It has seen many warriors drown into the depths of the sea

\n

11. Witch Eye - Craft it using the witch pupil

\n

 This pupil is believed to have seen the ancient brewing recipes that were lost in time.

\n

12. Cursed Eye - Found in Bastions treasure chest

\n

 A powerful yet destructive artifact; the Piglins swore to protect it at the cost of their lives

\n

13. Exotic Eye - Craft it using aquatic items

\n

 Those who followed this eye were never seen again; rumors say they found the great city of Atlantis, or lost their way trying

\n

14. Evil Eye - Buy it from a master cleric

\n

 A holy talisman said to protect its owner from bad luck

\n

15. Undead Eye - Craft it using an Undead Soul

\n

 Remembrance of the past lives of those who live in death

\n

16. Cryptic Eye - Have a small chance to get it when enchanting

\n

 No information about this eye

\n
\n

 \"The

\n

 

\n

End Remastered also adds some items to the game. Click the spoiler button to see the crafting recipe for all the items.

\n

 

\n
\n

The Witch Eye:

\n

\"End

\n

 

\n

The Exotic Eye:

\n

\"Exotic

\n

 

\n

The Undead Eye:

\n

\"Undead

\n

*You can get the Undead Soul by killing a skeleton horse.

\n
\n

 

\n

 

\n

 

\n

Support:

\n

We always try to be aware of issues in End Remastered, if you experience a bug while playing our mod, please report it in the comments or the \"Issues\" section to help us keep the experience fun and enjoyable for all players.

\n

 

\n

 CLICK HERE to join our discord server to speak, chat, report problems or play with us :)

", + "body_url": null, + "published": "2021-09-07T01:04:06.593494Z", + "updated": "2024-08-13T18:39:20.508517Z", + "approved": "2021-09-07T01:04:06.593494Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 704690, + "followers": 434, + "categories": [ + "adventure" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "OTVFe6yb", + "wAg3uLaS", + "JUEJKAmI", + "jcNTvfUz", + "baputuVX", + "MK3fVFKt", + "IEuB5jdI", + "pr8v984r", + "uPNva0ZJ", + "suITIY4S", + "fzwTUCMa", + "JZPwni3A", + "FFGAR6F6", + "27FhBFfh", + "9OkkRvff", + "CYis3W3g", + "4wKvHwVW", + "KAQYIK7C", + "iB0XOHDe", + "nnRhGEm1", + "gQ0Wkzi1", + "FDWSuS28", + "neybLvjT", + "sDjdcYM0", + "79zWp4GJ", + "SQS2aSUl", + "2EgEIy6p", + "oSTrvMua", + "hZaVwWXz", + "aqYxfNAS" + ], + "icon_url": "https://cdn.modrinth.com//data/ZJTGwAND/icon.png", + "issues_url": "https://github.com/Jack-Bagel/End-Remastered/issues", + "source_url": "https://github.com/Jack-Bagel/End-Remastered", + "wiki_url": null, + "discord_url": "https://discord.com/invite/D9cxayDNSP", + "donation_urls": [], + "gallery": [], + "color": 3159598, + "thread_id": "ZJTGwAND", + "monetization_status": "monetized" + }, + "fabric-language-kotlin-1.11.0+kotlin.2.0.0": { + "client_side": "optional", + "server_side": "optional", + "game_versions": [ + "18w44a", + "18w45a", + "18w46a", + "18w47a", + "18w47b", + "18w48a", + "18w48b", + "18w49a", + "18w50a", + "19w02a", + "19w03a", + "19w03b", + "19w03c", + "19w04a", + "19w04b", + "19w05a", + "19w06a", + "19w07a", + "19w08a", + "19w08b", + "19w09a", + "19w11a", + "19w11b", + "19w12a", + "19w12b", + "19w13a", + "19w13b", + "3D-Shareware-v1.34", + "19w14a", + "19w14b", + "1.14-pre1", + "1.14-pre2", + "1.14-pre3", + "1.14-pre4", + "1.14-pre5", + "1.14", + "1.14.1-pre1", + "1.14.1-pre2", + "1.14.1", + "1.14.2-pre1", + "1.14.2-pre2", + "1.14.2-pre3", + "1.14.2-pre4", + "1.14.2", + "1.14.3-pre1", + "1.14.3-pre2", + "1.14.3-pre3", + "1.14.3-pre4", + "1.14.3", + "1.14.4-pre1", + "1.14.4-pre2", + "1.14.4-pre3", + "1.14.4-pre4", + "1.14.4-pre5", + "1.14.4-pre6", + "1.14.4-pre7", + "1.14.4", + "19w34a", + "19w35a", + "19w36a", + "19w37a", + "19w38a", + "19w38b", + "19w39a", + "19w40a", + "19w41a", + "19w42a", + "19w44a", + "19w45a", + "19w45b", + "19w46a", + "19w46b", + "1.15-pre1", + "1.15-pre2", + "1.15-pre3", + "1.15-pre4", + "1.15-pre5", + "1.15-pre6", + "1.15-pre7", + "1.15", + "1.15.1-pre1", + "1.15.1", + "1.15.2-pre1", + "1.15.2-pre2", + "1.15.2", + "20w06a", + "20w07a", + "20w08a", + "20w09a", + "20w10a", + "20w11a", + "20w12a", + "20w13a", + "20w13b", + "20w14infinite", + "20w14a", + "20w15a", + "20w16a", + "20w17a", + "20w18a", + "20w19a", + "20w20a", + "20w20b", + "20w21a", + "20w22a", + "1.16-pre1", + "1.16-pre2", + "1.16-pre3", + "1.16-pre4", + "1.16-pre5", + "1.16-pre6", + "1.16-pre7", + "1.16-pre8", + "1.16-rc1", + "1.16", + "1.16.1", + "20w27a", + "20w28a", + "20w29a", + "20w30a", + "1.16.2-pre1", + "1.16.2-pre2", + "1.16.2-pre3", + "1.16.2-rc1", + "1.16.2-rc2", + "1.16.2", + "1.16.3-rc1", + "1.16.3", + "1.16.4-pre1", + "1.16.4-pre2", + "1.16.4-rc1", + "1.16.4", + "20w45a", + "20w46a", + "20w48a", + "20w49a", + "20w51a", + "1.16.5-rc1", + "1.16.5", + "21w03a", + "21w05a", + "21w05b", + "21w06a", + "21w07a", + "21w08a", + "21w08b", + "21w10a", + "21w11a", + "21w13a", + "21w14a", + "21w15a", + "21w16a", + "21w17a", + "21w18a", + "21w19a", + "21w20a", + "1.17-pre1", + "1.17-pre2", + "1.17-pre3", + "1.17-pre4", + "1.17-pre5", + "1.17-rc1", + "1.17-rc2", + "1.17", + "1.17.1-pre1", + "1.17.1-pre2", + "1.17.1-pre3", + "1.17.1-rc1", + "1.17.1-rc2", + "1.17.1", + "21w37a", + "21w38a", + "21w39a", + "21w40a", + "21w41a", + "21w42a", + "21w43a", + "21w44a", + "1.18-pre1", + "1.18-pre2", + "1.18-pre3", + "1.18-pre4", + "1.18-pre5", + "1.18-pre6", + "1.18-pre7", + "1.18-pre8", + "1.18-rc1", + "1.18-rc2", + "1.18-rc3", + "1.18-rc4", + "1.18", + "1.18.1-pre1", + "1.18.1-rc1", + "1.18.1-rc2", + "1.18.1-rc3", + "1.18.1", + "22w03a", + "22w05a", + "22w06a", + "22w07a", + "1.18.2-pre1", + "1.18.2-pre2", + "1.18.2-pre3", + "1.18.2-rc1", + "1.18.2", + "22w11a", + "22w12a", + "22w13a", + "22w13oneblockatatime", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "Ha28R6CL", + "slug": "fabric-language-kotlin", + "project_type": "mod", + "team": "tn8Zu9Q7", + "organization": null, + "title": "Fabric Language Kotlin", + "description": "This is a mod that enables usage of the Kotlin programming language for Fabric mods.", + "body": "This is a mod that enables usage of the Kotlin programming language for Fabric mods.\n\nNote: This does not add content! This is a dependency other mods use for compatibilty.\n\nThis mod works independently of the version of Minecraft used, as it only depends on Fabric Loader being available.\n\nFor modders: See -> https://github.com/FabricMC/fabric-language-kotlin#usage", + "body_url": null, + "published": "2021-08-25T19:14:27.159100Z", + "updated": "2024-08-07T07:57:57.329184Z", + "approved": "2021-08-25T19:14:27.159100Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "Apache-2.0", + "name": "Apache License 2.0", + "url": null + }, + "downloads": 8804646, + "followers": 4203, + "categories": [ + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "wdRa3g1U", + "1qsZV7U7", + "nrHxebpS", + "5VOQ5nq2", + "iAzZrqan", + "tmzNRXlM", + "D2Y5G2KO", + "5Aq3SFbi", + "MrMwCJlh", + "allNCj2E", + "FrvEFBGt", + "UJQzC6Jw", + "yLIAMDzv", + "esSFbyFg", + "lgFl3olb", + "Ibros2FW", + "MkcO8aQ0", + "qgTQJrUS", + "ADg3gvlr", + "5J7lguFF", + "65oEzjEs", + "s10JMAtS", + "Cqe2URk8", + "48ri5y9r", + "D8aag9dT", + "DmCixAtU", + "atZwzPrT", + "vnTAITh8", + "psNjlsLR", + "VJUqKopR", + "JjrWZ7m8", + "vlhvI5Li", + "ZMokinzs", + "a7MqDLdC", + "afsFajDC", + "kdDGGNEt" + ], + "icon_url": "https://cdn.modrinth.com/data/Ha28R6CL/icon.png", + "issues_url": "https://github.com/FabricMC/fabric-language-kotlin/issues", + "source_url": "https://github.com/FabricMC/fabric-language-kotlin/", + "wiki_url": "https://fabricmc.net/wiki/", + "discord_url": "https://discord.gg/v6v4pMv", + "donation_urls": [], + "gallery": [], + "color": 7958500, + "thread_id": "Ha28R6CL", + "monetization_status": "monetized" + }, + "fakerlib-0.1.4": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20.1" + ], + "id": "ORX9fPw1", + "slug": "fakerlib", + "project_type": "mod", + "team": "sPNAW1ew", + "organization": null, + "title": "FakerLib", + "description": "(fabric port of a) Library mod, does nothing by itself", + "body": "A small library mod needed for Zenith, adds some dev QOL stuff\nA fabric port of [Placebo](https://www.curseforge.com/minecraft/mc-mods/placebo) by Shadows_Of_Fire, all credits to him", + "body_url": null, + "published": "2023-10-13T01:55:30.973025Z", + "updated": "2024-07-05T06:46:08.084267Z", + "approved": "2023-10-13T18:50:29.970552Z", + "queued": "2023-10-13T04:21:18.137302Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 151514, + "followers": 2, + "categories": [ + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "bub9MKmL", + "FpOAD3wZ", + "tW2rTlJm", + "tfe2f0dM", + "jTpW5oyr", + "XQnqySmt", + "jJFLHYyi", + "JZlZzSdJ", + "XuouEowv", + "qyN8KLhE", + "7pRFET6N" + ], + "icon_url": "https://cdn.modrinth.com/data/ORX9fPw1/8faa9b4c352c5602411f2f72deee73c1eba89fbd.png", + "issues_url": "https://github.com/TheWinABagel/FakerLib/issues", + "source_url": "https://github.com/TheWinABagel/FakerLib", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": 460036, + "thread_id": "Le7aXzsz", + "monetization_status": "monetized" + }, + "FallingTree-1.20.1-4.3.4": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.17", + "1.17.1", + "21w39a", + "21w43a", + "1.18-pre2", + "1.18", + "1.18.1", + "22w05a", + "22w06a", + "1.18.2-pre3", + "1.18.2", + "22w13a", + "22w14a", + "22w17a", + "22w19a", + "1.19-pre5", + "1.19", + "1.19.1", + "1.19.2", + "22w43a", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "23w40a", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "Fb4jn8m6", + "slug": "fallingtree", + "project_type": "mod", + "team": "ZF72r4Yn", + "organization": null, + "title": "FallingTree", + "description": "Break down your trees by only cutting one piece of it", + "body": "[![Discord Server](https://img.shields.io/discord/1007349372444491856.svg?logo=Discord&colorB=7289da)](https://discord.gg/uXWsRftdy7)\n[![Curseforge Downloads](http://cf.way2muchnoise.eu/short_349559_downloads.svg)](https://www.curseforge.com/minecraft/mc-mods/falling-tree)\n[![Modrinth Downloads](https://img.shields.io/modrinth/dt/fallingtree?logo=Modrinth)](https://modrinth.com/mod/fallingtree)\n\nThis mod will change the way you break trees. 4 modes are available:\n* Instantaneous: Break one log and the whole tree will fall\n* Shift down: Break a block and the log will slowly shift down as you cut it (good if you don't want to \"cheat\" too much but are lazy to go cut top log blocks \ud83d\ude1b)\n* Fall items: Break one log and the whole tree will fall with an animation\n* Fall blocks: Break one log and the whole tree will fall on the floor with an animation\n\n![Demonstration of breaking a tree](https://github.com/Rakambda/FallingTree/raw/minecraft/1.20.1/assets/demo.gif)\n![Another demonstration of breaking a tree](https://github.com/Rakambda/FallingTree/raw/minecraft/1.20.1/assets/demo2.gif)\n\nSeveral options are available in the config file:\n\n* Customize what is considered as a tree (log blocks & leave blocks).\n* Customize what tools can be used (add more axes, allow everything, ...).\n* Turn leaf breaking on/off.\n* Option to disable the effect of the mod by sneaking (can be reversed).\n* Change speed depending on the tree size.\n* Damage tools or not (can set it to break the tool by the amount of blocks there were in the tree).\n* Let tools at 1 durability if it's going to break.\n\nCheck out the [wiki](https://github.com/Rakambda/FallingTree/wiki) for some more information.\n\n---\n\n* For Fabric users, **Fabric API** is required.\n* For Neoforge/Forge users, **Cloth Config API** is optional on the client and allows you to have a config GUI in game.\n Starting Minecraft 1.21, enchantments needs to be added separately through a datapack [available here](https://modrinth.com/datapack/fallingtree-enchantments).\n\nNOTE: On servers this mod can be server-side only, client isn't required (except if you use the change speed feature and/or enchants configurations).", + "body_url": null, + "published": "2021-01-11T19:27:26.315086Z", + "updated": "2024-08-05T18:25:10.546146Z", + "approved": "2021-01-11T19:27:26.315086Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 1581275, + "followers": 1433, + "categories": [ + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "ClS5aGDu", + "by7f3jqu", + "wYPHBZnq", + "IvWeyNRf", + "ecFvHSSj", + "hYRTlWck", + "KA0lsBqm", + "frFjp7XE", + "Oy2HfoQu", + "HhiMtvaB", + "MBqZmh7k", + "rolL2W5j", + "VBOnAt36", + "fy6OOm9Q", + "PjU0ylA8", + "IjfKe2LK", + "BjxlB5ad", + "nDc9P6UR", + "T0QtOBLV", + "VlJQWF9M", + "4FktLQ41", + "QtHstonj", + "m2oM2Xzb", + "YBlmxpFC", + "Bhm08p1U", + "vT2GkHlJ", + "PCbggfQI", + "8h9olfhO", + "XpnXvmmg", + "1HEbx8wR", + "O7EzwYaR", + "k08wKfdA", + "K2xDwQMA", + "jHljfMeN", + "izrF4sw0", + "pM721YNG", + "48Uga7jj", + "RhvVV7aI", + "Wll71SI1", + "wm1VgWAh", + "Ge9TTua8", + "LI0g8wDL", + "UiUNxrl7", + "XzUcHIz2", + "MNaOu00H", + "EcPbQcBT", + "I4HjcOo5", + "hnXlvYfp", + "Brv0vjTc", + "GMOPXKvF", + "CaTPjokz", + "aMFJxIHm", + "qtfvfhdv", + "GS7o9NMO", + "1u6nezii", + "djHFleaq", + "Fn9hSpZQ", + "2qvQxa1B", + "ivSkiG78", + "TuLQv2oz", + "cvdeCtGH", + "8GR9mmKD", + "zv2J7DYl", + "1nneGSqI", + "mKpQdYKO", + "8XmHwXLO", + "LoJuqMMZ", + "9K3tdqQy", + "YMLyKqOj", + "k2geZqGH", + "3sdO7qgf", + "YlfhOTW2", + "iAX7H9LQ", + "LTbIi2M1", + "kgBh4dSx", + "bQrEMzOP", + "KRs7tr5H", + "dj8wmIBS", + "PgS4RtQX", + "Rcuv9i9M", + "9kSv8gsK", + "5DSiBB1r", + "qrxLiOcL", + "E4f85gRR", + "TIoBK1U1", + "2TNwaTtm", + "cMkbt0f5", + "NveCqCkX", + "BQ6i1U5X", + "rK4GkUX6", + "59SG26Fv", + "1TSCSQ4C", + "iszfrsgL", + "P55fppyL", + "XrkGy9Ky", + "reXqEJgT", + "yRWIgpnS", + "66mp0b9v", + "oXRivlMX", + "6KJqXkV0", + "frsJrlLk", + "kPSbFSaC", + "8q3U34GC", + "SQSRyVeT", + "BJ2K7C0J", + "NAMMnpkI", + "HojA8R8T", + "BdqBwLsv", + "NF3wLCFV", + "KW9Dm2r0", + "7vuduZD7", + "tOzqGtqB", + "7PRbBpzE", + "KRt1RhNH", + "akjkv5e2", + "Ua1F3TBl", + "H9oeRV3c", + "t9r6pZcy", + "snIN7mL9", + "Fi75hN4R", + "yr3p0Npt", + "HnH1cLYq", + "2u9Dpwhc", + "Gkt6UcDh", + "NrtzFkZE", + "BaMypQ7l", + "nZoL7IuF", + "mb15RrXi", + "2yoOOkuy", + "eEwiTLCR", + "1KVSR1de", + "twGJKI2m", + "l93ivqBS", + "WBPlgiIE", + "QpKTY6aW", + "oHSfaH3b", + "QIna9i7h", + "2N0TfdG9", + "kLEJADsa", + "cFiOvvih", + "mSIK8OOH", + "7x1mqvWh", + "CfGRP162", + "uni2ZHB8" + ], + "icon_url": "https://cdn.modrinth.com/data/Fb4jn8m6/icon.png", + "issues_url": "https://github.com/RakambdaOrg/FallingTree/issues", + "source_url": "https://github.com/RakambdaOrg/FallingTree", + "wiki_url": "https://github.com/RakambdaOrg/FallingTree/wiki", + "discord_url": "https://discord.gg/uXWsRftdy7", + "donation_urls": [ + { + "id": "github", + "platform": "Github", + "url": "https://github.com/sponsors/RakSrinaNa" + } + ], + "gallery": [], + "color": 394500, + "thread_id": "Fb4jn8m6", + "monetization_status": "monetized" + }, + "ferritecore-6.0.1-fabric": { + "client_side": "optional", + "server_side": "optional", + "game_versions": [ + "1.16.5", + "1.17", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "uXXizFIs", + "slug": "ferrite-core", + "project_type": "mod", + "team": "2JhABx1f", + "organization": null, + "title": "FerriteCore", + "description": "Memory usage optimizations", + "body": "This mod reduces the memory usage of Minecraft in a few different ways. A high-level technical description of the changes is available [here](https://github.com/malte0811/FerriteCore/blob/main/summary.md).\n\nThe amount of memory saved will depend on the pack. In version 2.5.9 of [All Of Fabric 3](https://www.curseforge.com/minecraft/modpacks/all-of-fabric-3) it reduces the RAM usage (heap size) from 1,792 MB to 984 MB. For comparison the same setup with Hydrogen instead of FerriteCore uses 1,335 MB. \nThese values were measured after generating a world with a fixed seed and waiting for two minutes.\nThe project picture is a cropped version of [this](https://commons.wikimedia.org/wiki/File:Magnetic-core_memory,_at_angle.jpg) picture.\n\n### FAQ\n\n#### Should I install this on the server or just on the client?\n\nSome optimizations are client-side only, but there are some rather high-impact optimizations that are relevant on the server too. So you should install it on both sides.\n\n#### Is this compatible with [other mod]?\n\nMost likely yes. The only exception is Hydrogen, which is compatible with all recent FerriteCore versions *on Minecraft versions where Hydrogen is officially released*. This means that 1.18+ builds are not compatible with Hydrogen, since it has been officially archived and won't receive any releases on these versions.", + "body_url": null, + "published": "2021-04-03T07:04:43.971189Z", + "updated": "2024-06-16T09:45:34.688950Z", + "approved": "2021-04-03T07:04:43.971189Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 9901149, + "followers": 6032, + "categories": [ + "optimization", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "GeyB7u1y", + "Mc6hHgQU", + "hjsymojR", + "LG5zF5LP", + "5rLOvzfo", + "2XHUVaPQ", + "HjttFjoa", + "JQl5JoCm", + "oP38VFTJ", + "1FrNtQTK", + "OhmGV4Hp", + "c9p5gemS", + "FMdIAsIi", + "OhuTVpQH", + "776Z5oW9", + "AvWRJcqx", + "zkszypjI", + "7epbwkFg", + "xyl3NViI", + "fwozdl4o", + "fs07zE6w", + "6gwDuh90", + "3UkWIj4a", + "kwjHqfz7", + "CtXsUUz6", + "GHcKib6J", + "YrvjR5sX", + "RbR7EG8T", + "zI3uKvrU", + "l9p9zXTR", + "FCnCG6PS", + "ULSumfl4", + "unerR5MN", + "DG5Fn9Sz", + "tfQSdUpc", + "85kC2OMr", + "pguEMpy9", + "agJm6Vrw", + "PPnbi6JY", + "HWBrlwWv", + "i9RcCdZv", + "7slRrLO6", + "BkJB5PPB", + "wmIZ4wP4" + ], + "icon_url": "https://cdn.modrinth.com/data/uXXizFIs/icon.jpg", + "issues_url": "https://github.com/malte0811/FerriteCore/issues", + "source_url": "https://github.com/malte0811/FerriteCore", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": 5129796, + "thread_id": "uXXizFIs", + "monetization_status": "monetized" + }, + "flowerymooblooms-fabric-mc1.20.1-2.0.2": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "ECOSu6pa", + "slug": "friends-and-foes-flowery-mooblooms-fabric", + "project_type": "mod", + "team": "J5jfIlFX", + "organization": null, + "title": "Friends&Foes - Flowery Mooblooms (Fabric/Quilt)", + "description": "An addon for the Friends&Foes mod, adding one moobloom variant for each flower.", + "body": "
\n\n
\n\t\"Friends&Foes\n\t

Flowery Mooblooms (Fabric)

\n
\n\n
\n\t

\n\t\t\n\t\t\t\n\t\t\n\t\t\n\t\t\t\n\t\t\n\t\t\n\t\t\t\n\t\t\n\t\t\n\t\t\t\t\n\t\t\n\t\t\n\t\t\t\n\t\t\n\t

\n
\n\n

\n\tFriends&Foes - Flowery Mooblooms is a small addon for the Friends&Foes mod, adding one moobloom variant for each flower. Mooblooms can be found in meadow and flower forest biomes. You can check the wiki to get more information about the mooblooms.\n\t
\n
\n\tBe aware that the main Friends&Foes mod is required to run with this addon. Looking for the Forge or Quilt version?\n

\n\n

\ud83d\udc2e Moobloom variants

\n\n\t\n\t\t\n\t\t\t\n\t\t\t\n\t\t\n\t\t\n\t\t\t\n\t\t\t\n\t\t\n\t\t\n\t\t\t\n\t\t\t\n\t\t\n\t\t\n\t\t\t\n\t\t\t\n\t\t\n\t\t\n\t\t\t\n\t\t\t\n\t\t\n\t\t\n\t\t\t\n\t\t\t\n\t\t\n\t\t\n\t\t\t\n\t\t\t\n\t\t\n\t\t\n\t\t\t\n\t\t\t\n\t\t\n\t\t\n\t\t\t\n\t\t\t\n\t\t\n\t\t\n\t\t\t\n\t\t\t\n\t\t\n\t\t\n\t\t\t\n\t\t\t\n\t\t\n\t\t\n\t\t\t\n\t\t\t\n\t\t\n\t\t\n\t\t\t\n\t\t\t\n\t\t\n\t\t\n\t\t\t\n\t\t\t\n\t\t\n\t\t\n\t\t\t\n\t\t\t\n\t\t\n\t\t\n\t\t\t\n\t\t\t\n\t\t\n\t\n
\n\t\t\t\t\n\t\t\t\t

Allium

\n\t\t\t
\n\t\t\t\t\n\t\t\t\t

Azure Bluet

\n\t\t\t
\n\t\t\t\t\"Allium\n\t\t\t\n\t\t\t\t\"Azure\n\t\t\t
\n\t\t\t\t\n\t\t\t\t

Blue Orchid

\n\t\t\t
\n\t\t\t\t\n\t\t\t\t

Cornflower

\n\t\t\t
\n\t\t\t\t\"Blue\n\t\t\t\n\t\t\t\t\"Cornflower\n\t\t\t
\n\t\t\t\t\n\t\t\t\t

Dandelion

\n\t\t\t
\n\t\t\t\t\n\t\t\t\t

Lilac

\n\t\t\t
\n\t\t\t\t\"Dandelion\n\t\t\t\n\t\t\t\t\"Lilac\n\t\t\t
\n\t\t\t\t\n\t\t\t\t

Lily of the Valley

\n\t\t\t
\n\t\t\t\t\n\t\t\t\t

Orange Tulip

\n\t\t\t
\n\t\t\t\t\"Lily\n\t\t\t\n\t\t\t\t\"Orange\n\t\t\t
\n\t\t\t\t\n\t\t\t\t

Oxeye Daisy

\n\t\t\t
\n\t\t\t\t\n\t\t\t\t

Peony

\n\t\t\t
\n\t\t\t\t\"Oxeye\n\t\t\t\n\t\t\t\t\"Peony\n\t\t\t
\n\t\t\t\t\n\t\t\t\t

Pink Tulip

\n\t\t\t
\n\t\t\t\t\n\t\t\t\t

Poppy

\n\t\t\t
\n\t\t\t\t\"Pink\n\t\t\t\n\t\t\t\t\"Poppy\n\t\t\t
\n\t\t\t\t\n\t\t\t\t

Red Tulip

\n\t\t\t
\n\t\t\t\t\n\t\t\t\t

Rose Bush

\n\t\t\t
\n\t\t\t\t\"Red\n\t\t\t\n\t\t\t\t\"Rose\n\t\t\t
\n\t\t\t\t\n\t\t\t\t

Sunflower

\n\t\t\t
\n\t\t\t\t\n\t\t\t\t

White Tulip

\n\t\t\t
\n\t\t\t\t\"Sunflower\n\t\t\t\n\t\t\t\t\"White\n\t\t\t
\n\n
\n\n

\u2699\ufe0f Other addons / compat datapacks

\n\n\n
\n\n

\ud83d\udcac Community

\n

\n\tFeel free to join our community at the discord server to chat, share your creations, ask any question or to simply be updated about the latest development of the mod and notified when the new release is out. Also don't hesitate to report any crash or bug via GitHub issues.\n

\n\n
\n\n

\ud83d\udc4b Support

\n\n

I will continue to develop my mods regardless of any support as it is my hobby, although most of my free time goes into development of my mods. So if you want to support me anyway, you can do that via Patreon or Ko-fi. That said, I do appreciate all of your support.

\n\n
\n\n

\ud83d\udcdc License

\n\n

\n\tThe mod is licensed with CC BY-NC-ND 4.0 license.\n

\n

\n\tFeel free to look over my code for examples of how i have implemented and solved various problems while writing this mod, incorporate snippets into your own code. Also feel free to use this mod in any modpack (although credit/link back to this page will be greatly appreciated).\n

", + "body_url": null, + "published": "2022-12-26T14:57:52.084142Z", + "updated": "2024-07-12T21:06:31.650924Z", + "approved": "2022-12-29T00:04:00.569410Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "CC-BY-NC-ND-4.0", + "name": "Creative Commons Attribution Non Commercial No Derivatives 4.0 International", + "url": null + }, + "downloads": 258081, + "followers": 137, + "categories": [ + "adventure", + "mobs", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "5M5dsgCD", + "O4Fs6WJc", + "3cL5lQsy", + "GsS6NNb8", + "sIWLxRbg", + "tt954J6g", + "xk7NejA9", + "L3vFNtdV", + "Wgz5qVrH", + "J3uitZ4J", + "YnZpHfXW", + "s0xEE5NG", + "8hGXA5Xh", + "47Q5hJRa", + "HEV9pM7D", + "3Z4muvU0", + "D9jX5JX6", + "EMRjqe5x", + "JiGl6eSQ", + "hqkiYyDU", + "aE0YWywy", + "WCqqJrJB" + ], + "icon_url": "https://cdn.modrinth.com/data/ECOSu6pa/ade1d3e6e116aabbcf453abcbb678a78d4e898dd.png", + "issues_url": "https://github.com/Faboslav/friends-and-foes-flowery-mooblooms/issues", + "source_url": "https://github.com/Faboslav/friends-and-foes-flowery-mooblooms", + "wiki_url": "https://github.com/Faboslav/friends-and-foes/wiki/Moobloom", + "discord_url": "https://discord.gg/QGwFvvMQCn", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/Faboslav" + }, + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/faboslav" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/ECOSu6pa/images/1b2f0d915cff5aa19a69b929acf0ed7e261becfa.png", + "featured": false, + "title": "Oxeye Daisy Moobloom", + "description": null, + "created": "2022-12-28T17:17:29.918523Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ECOSu6pa/images/2d12466f1982171140330c36ac48aaeba0a50a2b.png", + "featured": false, + "title": "White Tulip Moobloom", + "description": null, + "created": "2022-12-28T17:17:36.354461Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ECOSu6pa/images/41eff07c029403a58cec21b2cb2f21dc03297ee7.png", + "featured": false, + "title": "Lilac Moobloom", + "description": null, + "created": "2022-12-28T17:17:27.198426Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ECOSu6pa/images/52cc370051aa3dbc83520ca9b18604c31484014a.png", + "featured": false, + "title": "Pink Tulip Moobloom", + "description": null, + "created": "2022-12-28T17:17:31.743322Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ECOSu6pa/images/623b75779963f7c6af8803917470932cd6dc7625.png", + "featured": false, + "title": "Peony Moobloom", + "description": null, + "created": "2022-12-28T17:17:30.852438Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ECOSu6pa/images/6275b7c891a78de1f301fd60b0cc9b013bf0ef0b.png", + "featured": false, + "title": "Blue Orchid Moobloom", + "description": null, + "created": "2022-12-28T17:17:24.487062Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ECOSu6pa/images/6e84ca471f46f8c69dcd6e46d9ca9eb771b9a0a0.png", + "featured": false, + "title": "Allium Moobloom", + "description": null, + "created": "2022-12-28T17:17:22.762247Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ECOSu6pa/images/7426436d74246665c0401195357c9695a9b5a43e.png", + "featured": false, + "title": "Lily of the Valley Moobloom", + "description": null, + "created": "2022-12-28T17:17:28.116608Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ECOSu6pa/images/b5821ffc7b3430cb17bcb0bf22094a90f87507eb.png", + "featured": true, + "title": "Cornflower Moobloom", + "description": null, + "created": "2022-12-28T17:17:25.403580Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ECOSu6pa/images/b771f44865bd05b66fc1efe65b71dd41721d46cf.png", + "featured": false, + "title": "Azure Bluet Moobloom", + "description": null, + "created": "2022-12-28T17:17:23.614501Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ECOSu6pa/images/d489073d7152b208e9bb6b609f9daee7828867b5.png", + "featured": false, + "title": "Dandelion Moobloom", + "description": null, + "created": "2022-12-28T17:17:26.339512Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ECOSu6pa/images/e91e33e688b36fa3225a330e99d551edae2c32b6.png", + "featured": false, + "title": "Poppy Moobloom", + "description": null, + "created": "2022-12-28T17:17:32.550673Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ECOSu6pa/images/eb7ccb471bf7260a560ed3c2cf1ecde3ea6f41a6.png", + "featured": false, + "title": "Rose Bush Moobloom", + "description": null, + "created": "2022-12-28T17:17:34.596684Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ECOSu6pa/images/ed45077eaff52b008ebc7a0b2eac7f3dd29e697d.png", + "featured": false, + "title": "Red Tulip Moobloom", + "description": null, + "created": "2022-12-28T17:17:33.615718Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ECOSu6pa/images/f49f04d8a81e0f44e0f6015c75a3c81ce3fa5989.png", + "featured": false, + "title": "Sunflower Moobloom", + "description": null, + "created": "2022-12-28T17:17:35.480944Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ECOSu6pa/images/f5ef73b703c6756fcbd41fa0a3bfdfddb32afb2a.png", + "featured": false, + "title": "Orange Tulip Moobloom", + "description": null, + "created": "2022-12-28T17:17:28.986224Z", + "ordering": 0 + } + ], + "color": 14932122, + "thread_id": "ECOSu6pa", + "monetization_status": "monetized" + }, + "ForgeConfigAPIPort-v8.0.0-1.20.1-Fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16", + "1.16.1", + "1.16.2", + "1.16.3", + "1.16.4", + "1.16.5", + "1.17", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "ohNO6lps", + "slug": "forge-config-api-port", + "project_type": "mod", + "team": "Lcr15WUK", + "organization": null, + "title": "Forge Config API Port", + "description": "NeoForge's & Forge's config systems provided to other modding ecosystems. Designed for a multiloader architecture.", + "body": "

\n

\n

\n

\n

\n

Forge Config API Port is a modding library for mod developers that provides both NeoForge's & Forge's whole config system to other modding ecosystems. Allows developers to use NeoForge configs on Fabric & Forge and Forge configs on Fabric & NeoForge.

\n

The library is built with a multiloader architecture in mind by also offering a mod loader independent common distribution, so there needs to be as little platform specific code as possible.

\n

\n

\n

\u25b6\ufe0f Allows developers to continue using the same code for creating their configs as they do on NeoForge & Forge.

\n

\u25b6\ufe0f Same package and class names as NeoForge & Forge, no refactoring required when porting!

\n

\u25b6\ufe0f Built for a multiloader architecture: Simply setup your configs in a common module!

\n

\u25b6\ufe0f Users don't need to install any additional library on the mod loader the chosen config system is native to (NeoForge / Forge), everything is built in there!

\n

\u25b6\ufe0f Check out the developer wiki for instructions on how to use Forge Config API Port in your project!

\n

\u25b6\ufe0f Install Forge Config Screens for in-game configuration!

\n

\n

\n

\u23e9 INSTALLATION REQUIRED ON CLIENT & REQUIRED ON SERVER

\n

\u23e9 REQUIRES FABRIC API TO BE INSTALLED (FABRIC)

\n

\n

\n

\ud83c\udf1f Thanks to the Forge team for putting the config api together in the first place!

\n

\n", + "body_url": null, + "published": "2021-12-03T10:23:02.288424Z", + "updated": "2024-08-09T20:54:34.167214Z", + "approved": "2021-12-03T10:23:02.288424Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MPL-2.0", + "name": "Mozilla Public License 2.0", + "url": null + }, + "downloads": 4387038, + "followers": 1454, + "categories": [ + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "VpvE1h2H", + "16w4kT84", + "3h8hgyqP", + "AxEvkjh5", + "notOZAjX", + "GJ0aBxFN", + "2eL7Opm5", + "JpOqHq5p", + "jwtFMyhT", + "eYeUbc3T", + "86FCTo9M", + "rXgI0k5P", + "h7joEojU", + "WjwjuiDp", + "p2C10JUL", + "4JaArhTS", + "XGKEYlsw", + "K7z34XSj", + "vlllTHgw", + "akDg87hC", + "JdloDJit", + "KjE2hCJv", + "XhjJZ5uE", + "fI5AsaV4", + "CkM0mGHX", + "H1LkHOeQ", + "hRGdglV6", + "FtpEL8G9", + "tlNCwMwZ", + "sJryrwj9", + "tqRbIeBK", + "bh0uyJuX", + "alqrny5V", + "cjmImt9R", + "6J0K7FyD", + "3VCgXZ79", + "TFLCxTVc", + "mFoJ8qnh", + "ou26o2qg", + "MkqOn4Yc", + "2TybfFU8", + "oYUxEUGk", + "nlcnay8A", + "1cG1sI8e", + "ewYccCIi", + "CtENDTlF", + "f5d9VI72", + "52l6IXEd", + "14GbpcF7", + "lQ2BNzNV", + "jygSIEk6", + "y5ADtIQp", + "hSymtRZz", + "8ZEqzvgl", + "aQOysw5j", + "d4o2DIW4", + "RRZz6X5Y", + "uVasUkyz", + "WjsrL3PB", + "REA2Y3hn", + "IS7wNJuv", + "P3GfPe5a", + "Uc2L9JYx", + "sK1XwxTt", + "1bZs84f5", + "r8gESJiS", + "xbVGsTLe", + "cPR7Hb0e", + "izawYWhx", + "MuoYnIrW", + "s4eBrY4J", + "6b78kro0", + "LDpciQaD", + "Xm6O1nBK", + "3CoAOP6V", + "lB4p4JnZ", + "d4Qud7sf", + "6ftTLYo0", + "wMoOojVd", + "2z1n7Pal", + "YsY7k4Pu", + "7HZj0EzA", + "sg4l7fSX", + "JGO1znQN", + "BUhcggUR", + "h919yvVV", + "ArqXhVnP", + "SaPUeEYL", + "wYilHKuK", + "e8y2gnx1", + "mCucKtTS", + "wx8Ha8eB", + "BNTJgetj", + "ydIrnr9Q", + "Y2gd8YHL", + "UGsNw3aI", + "QTVwgKKS", + "FRzdKdgh", + "GOreNSW6", + "6k3FSGda", + "bnhVDSAh", + "gtorYSGm", + "6x66hBcK", + "POOzpdre" + ], + "icon_url": "https://cdn.modrinth.com/data/ohNO6lps/cb3b942cc18a66a0f35f802e004713f134e46cc2.png", + "issues_url": "https://github.com/Fuzss/forgeconfigapiport/issues", + "source_url": "https://github.com/Fuzss/forgeconfigapiport", + "wiki_url": "https://github.com/Fuzss/forgeconfigapiport/wiki", + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/ohNO6lps/images/201d6c2cd17e10032e9651bc0070007b4774286c.png", + "featured": true, + "title": null, + "description": null, + "created": "2024-01-11T10:36:12.400637Z", + "ordering": 0 + } + ], + "color": 11377989, + "thread_id": "ohNO6lps", + "monetization_status": "monetized" + }, + "ForgeConfigScreens-v8.0.2-1.20.1-Fabric": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.19.4", + "1.20", + "1.20.1" + ], + "id": "5WeWGLoJ", + "slug": "forge-config-screens", + "project_type": "mod", + "team": "D3qg0yDo", + "organization": null, + "title": "Forge Config Screens", + "description": "Allows Forge's configs to be configured directly in-game. Quick and easy with a beautiful design!", + "body": "

\n

\n

\n

\n

\ud83d\udcd6 About:

\n

Config Menus for Forge allows for editing config files for all mods directly in-game without having to ever touch a single file again.

\n

\n

\ud83d\udcda Contents:

\n

\n

Most notably, this mod allows for: editing all of Forge's config types (including server configs, as well as syncing with an online server and other players), setting default configs to be used when creating new worlds, a powerful and immersive search, proper handling for editing lists with various data types, an easy to use interface for dealing with all configs added by a single mod at a glance, and much more.

\n

\n

When opening a mods config menu you'll be greeted with a file selection screen listing all config files added by the mod. The restore defaults button allows for resetting a single config file as a whole (you can tell a config has been modified when it's name is in italics). There is also a button for opening the actual config file in an editor. The copy to defaults button allows you to set this config as a default config to be used whenever the config is recreated (mainly useful for server configs when creating new worlds).

\n

\n

When a config is open, you'll find a big list with all config options and categories. The button to the right of every option will restore it's default value. When an option is hovered, a tooltip will provide additional information, including the internal key, description, range, allowed values, and the default value. On the bottom, the cancel button can be used for discarding changes, the done button will save all changes to the config file.

\n

\n

The path bar on top shows where you currently are within the active config file. But there's more: It also functions as a navigation bar. You can click on previous categories to go back to them.

\n

\n

Searching is quite fancy, the current query is highlighted, and found entries are sorted accordingly. Results will be located in the current, as well as all subsequent categories. And best of all, the search field can be cleared again with a simple left-click.

\n

\n

Editing more complex values such as strings, enums and lists is done via a separate screen. In this case, an enum value can be chosen from a list where all choices can be viewed at a glance.

\n

\n

Editing lists on the other hand looks quite a bit different. All values are entered as strings and will be converted and checked automatically. Sometimes, the type of a list cannot be determined by Config Menus for Forge, so you'll be promted to choose the type yourself, or edit the option directly in the config file instead (not yet implemented). Also lists cannot be saved when invalid entries have been added, they need to be manually corrected before that.

\n

\n

Editing server configs is a bit different from other config types. They exist for every single world, so to edit a server config from the main menu you'll have to select a world. When you're currently playing in a world this world will be selected automatically. This message is shown when Config Menus for Forge has to create the server config first as it doesn't exist yet.

\n

\n

This message is shown when playing on an online server. Server configs can only be edited by server operators. When doing so, they'll be synced back to the server and from there to all other clients. In singleplayer no warnings are shown and no syncing happens as everything is done locally.

\n

\n

\ud83d\udca1 FAQ:

\n

Q: Can I edit server configs with this mod?
A: YES!

\n

Q: Can I edit server configs while on a multiplayer server?
A: Yes again! The only limitations are that you need to be an operator on that server, and Config Menus for Forge needs to be installed server-side as well.

\n

Q: I can't edit Forge's client config!
A: You have OptiFine installed, Forge's client config can't be used then. This has nothing to do with Config Menus for Forge.

\n

Q: I'm a server owner and I don't want anyone to edit the server's configs while it is running.
A: Simply don't install Config Menus for Forge on your server, everything but editing server configs will still work for your players.

\n

Q: I'm a mod developer and I already added custom backgrounds for Configured. Do I need to do it for this mod again?
A: No, Config Menus for Forge uses the resources provided by mods for Configured as well. There are other developer options planned for the future though. In case you're unsure about adding a custom background to the config menus for your mod, check out the instructions on the mod page for Configured.

\n

Q: I'm a developer and I want my mod to use these config menus. What do I need to do?
A: Nothing really. Just ask your users to install this mod alongside yours. You don't need to add a dependency or anything like that.

\n

\n

\ud83c\udfc6 Credits:

\n

Developing Config Menus for Forge was helped and inspired by:

\n\n

\n

\n

\n

\"Reddit\"

\n

\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n
  
 
  
 
  
 
  
 
  
 
\n

", + "body_url": null, + "published": "2023-06-09T20:23:48.587313Z", + "updated": "2023-07-30T10:26:47.428427Z", + "approved": "2023-06-11T22:54:00.848663Z", + "queued": "2023-06-09T20:27:57.181172Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MPL-2.0", + "name": "Mozilla Public License 2.0", + "url": null + }, + "downloads": 494885, + "followers": 170, + "categories": [ + "utility" + ], + "additional_categories": [ + "library", + "management" + ], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "d8rW8rDg", + "onp8kYQo", + "JwsEoVZ1", + "UOV19nXG", + "NJRmTOlf", + "S0IeqYrp", + "1jVBPRNS", + "n1EMZ4oz", + "YUDLu26S", + "nwy63zfI" + ], + "icon_url": "https://cdn.modrinth.com/data/5WeWGLoJ/bf276f7b508fb8cd64f5190691dc19c1b98dcd41.png", + "issues_url": "https://github.com/Fuzss/forgeconfigscreens/issues", + "source_url": "https://github.com/Fuzss/forgeconfigscreens", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/5WeWGLoJ/images/b422431f2df483b89e127d1aae6b511fbdc68b01.png", + "featured": true, + "title": null, + "description": null, + "created": "2023-06-09T20:25:32.738015Z", + "ordering": 0 + } + ], + "color": 14108187, + "thread_id": "5WeWGLoJ", + "monetization_status": "monetized" + }, + "friendsandfoes-fabric-mc1.20.1-2.0.15": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "POQ2i9zu", + "slug": "friends-and-foes", + "project_type": "mod", + "team": "mcV4vJ1O", + "organization": null, + "title": "Friends&Foes (Fabric/Quilt)", + "description": "Adds outvoted and forgotten mobs from the mob votes in a believable vanilla plus style. (Copper Golem, Glare, Moobloom, Iceologer, Barnacle, Wildfire, Illusioner, Rascal, Tuff Golem)", + "body": "
\n\n
\n\t\"Friends&Foes\"\n
\n\n
\n\n
\n\t\n\t\t\"Ko-fi\"\n\t\n\t\n\t\t\"Patreon\"\n\t\n\t\n\t\t\"Discord\"\n\t\n\t\n\t\t\"Wiki\"\n\t\n
\n\n
\n\n

\n\tFriends&Foes adds outvoted and forgotten mobs from the mob vote. One of the main goals is to further expand upon original concepts and add new vanilla-like features related to all the mobs.\n

\n\n

\n\tYou can check wiki for a detailed overview of implemented mobs and features.\n

\n\n
\n
\n\n

\n\t\"Tuff\n\t  \n\tTuff Golem\n

\n\n

\n\tTuff Golem, a statuesque mob, which can hold and display any item you give it, but be careful when it is not sleeping it loves to take spontaneous strolls.\n\tWant your tuff golem to stay put? Stick it in place with a honeycomb. If you want to build this sleeping beauty, gather a tuff block, a wool block of any color, and a pumpkin.\n

\n\n

\n\t\n\t\t\"Tuff\n\t\n\t\n\t\t\"Sleeping\n\t\n

\n\n
\n
\n\n

\n\t\"Rascal\"\n\t  \n\tRascal\n

\n\n

\n\tDiscover Rascal, a mischievous little creature located in the mines, that finds joy in the game of hide-and-seek.\n\tIt\u2019s both playful and helpful, giving you hints as you search for it.\n\tFind it three times and it will reward you with the bundle of your dreams!\n

\n\n

\n\t\n\t\t\"Rascal\n\t\n\t\n\t\t\"Rascal\n\t\n

\n\n
\n
\n\n

\n\t\"Copper\n\t  \n\tCopper Golem\n

\n\n

\n\tMeet the Copper Golem, a pocket-sized, comedic marvel that finds joy in randomly pressing copper buttons.\n\tLike any other copper creations it will oxidize over time, but do not worry, maintenance is a breeze! For a quick makeover, grab an axe or a honeycomb.\n\tIf you want to build this little creature, gather a copper block, a pumpkin, and a lightning rod.\n

\n\n

\n\t\n\t\t\"Copper\n\t\n\t\n\t\t\"Copper\n\t\n

\n\n

\n\tOther features related to the copper golem:\n

\n\n\n
\n
\n\n

\n\t\"Glare\"\n\t  \n\tGlare\n

\n\n

\n\tIntroducing the Glare, grumpy and cute mossy companion living in the lush caves that hates the darkness.\n\tDo you share a disdain for the dark? In that case glare can show you areas that are dark enough for monsters to spawn.\n\tIf you want to tame or breed this little cutie, you will need the glow berries, but be careful, glares tends to snack on them regularly, leaving no leftovers.\n

\n\n

\n\t\n\t\t\"Baby\n\t\n\t\n\t\t\"Flying\n\t\n

\n\n
\n
\n\n

\n\t\"Iceologer\"\n\t  \n\tIceologer\n

\n\n

\n\tEncounter the Iceologer, a lonely illager who lives deep in the snows.\n\tYou can find him by searching for a small spruce cabin among the trees.\n\tBut be careful on your adventure though, as years of living in the wild has made his heart colder than the ice around him. If he spots you, brace for icy attacks, turning your adventure into a frosty challenge.\n

\t\n\n

\n\t\n\t\t\"Iceologer\n\t\n\t\n\t\t\"Iceologer\n\t\n

\n\n

\n\tOther features related to the iceologer:\n

\n\n\n
\n
\n\n

\n\t\"Moobloom\"\n\t  \n\tMoobloom\n

\n\n

\n\t\tPresenting the Moobloom, sun-kissed cow, covered with a beautiful flowers, living mostly in the flower forests.\n\t\tThese flower-covered companions are not only a sight to behold, but also engage in a harmonious synergy with bees.\n\t\tAs they traverse, the mooblooms leave a trail of blooming flora, turning each step into a mesmerizing journey through nature's wonders.\n

\n\n

\n\t\n\t\t\"Buttercup\n\t\n\t\n\t\t\"Flowery\n\t\n

\n\n

\n\tOther features related to the moobloom:\n

\n\n\n
\n
\n\n

\n\t\"Wildfire\"\n\t  \n\tWildfire\n

\n\n

\n\tWildfire, the master of blazes, which is protected by four shields.\n\tThis encounter is not a friendly one, watch out for its shield debris barrage and ground-shaking shockwave attack.\n\tWhen cornered, it summons blazes for reinforcement. Conquer the challenge, wield strategy against this fiery sentinel in it's citadel domain.\n

\n\n

\n\t\n\t\t\"Citadel\n\t\n\t\n\t\t\"Wildfire\n\t\n

\n\n

\n\tOther features related to the wildfire:\n

\n\n\n
\n
\n\n

\n\t\"Mauler\"\n\t  \n\tMauler (The Great Hunger)\n

\n\n

\n\tIntroducing the Mauler, pint-sized predator roaming savannas, badlands, and deserts. They are on a quest for chickens, rabbits, and more.\n\tYou can feed them enchanted goodies to store experience points and later extract them using bottles. But beware the more experience points, the bigger and hungrier the Mauler!\n

\n\n

\n\t\n\t\t\"Maulers\n\t\n\t\n\t\t\"Fed\n\t\n

\n\n
\n
\n\n

\n\t\"Illusioner\"\n\t  \n\tIllusioner\n

\n\n

\n\tEncounter the Illusioner, a cunning trickster armed with a bow who lives in the taiga. You can find him by searching for a small shack or his training grounds.\n\tApproach with caution, for the blinding spell may leave you in the dark, making it challenging to distinguish between illusion and reality.\n

\n\n

\n\t\n\t\t\"Illusioner\n\t\n\t\n\t\t\"Illusioner\n\t\n

\n\n

\n\tOther features related to the illusioner:\n

\n\n\n
\n
\n\n

\n\t\"Zombie\n\t  \n\tZombie Horse (Trap)\n

\n\n

\n\tEver wanted to ride a Zombie Horse? If so, approach one during a thunderstorm, and magic may happen \u2013 you might even catch a glimpse of the four horsemen.\"\n

\n\n

\n\t\n\t\t\"Zombie\n\t\n\t\n\t\t\"Four\n\t\n

\n\n
\n
\n\n

\u2699\ufe0f Compatibility / addons

\n\n

\n\tFriends&Foes is designed to be fully compatible with all other mods, and it currently offers few addons and datapacks:\n

\n\n\n\n
\n
\n\n

\ud83d\udcac Community

\n\n

\n\tFeel free to join our community at the discord server to chat, share your creations, ask any question or to simply be updated about the latest development of the mod and notified when the new release is out.\n\tAlso don't hesitate to report any crash or bug via GitHub issues.\n

\n\n
\n
\n\n

\ud83d\udc4b Support

\n\n

\n\tI will continue developing my mods as a hobby because I truly enjoy it. If you'd like to support me, you can do so on Patreon or Ko-fi. Your support is greatly appreciated.\n

\n\n
\n
\n\n

\ud83d\udcdc License

\n\n

\n\tThe mod is licensed with CC BY-NC-ND 4.0 license.\n

\n\n

\n\tPlease feel free to explore my code for examples of how I've tackled and solved various challenges while developing this mod. You're welcome to incorporate code snippets into your own projects. Also feel free to use this mod in any modpack (although credit/link back to this page will be greatly appreciated).\n

\n\n

\n\tYou can also look into the blockbench directory which contains all the models & palettes and into the textures directory for textures. Get inspired, but please don't just copy & paste any of it as your own.\n

", + "body_url": null, + "published": "2021-11-30T18:51:56.671504Z", + "updated": "2024-08-08T08:48:48.672436Z", + "approved": "2021-11-30T18:51:56.671504Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "CC-BY-NC-ND-4.0", + "name": "Creative Commons Attribution Non Commercial No Derivatives 4.0 International", + "url": null + }, + "downloads": 1081108, + "followers": 961, + "categories": [ + "adventure", + "mobs", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "AxBVyA7t", + "o4gcpw6y", + "oH9S375Y", + "9wGxDeH6", + "YC1sVwKi", + "zYRtnZvg", + "HVVMeXgJ", + "iN09SYXy", + "XtGFdhX9", + "dvjc2XOu", + "FZFq4Ema", + "6MpjbLt5", + "YvFOl8Bj", + "1phPZNKp", + "wd7nlwTh", + "grDSfiH9", + "OSy3RqVT", + "xew642cY", + "JTWGDwfq", + "9pZnrCEg", + "J2qYjJym", + "ajBbuM2s", + "KH1w3oLu", + "6Cmh5YSV", + "QvjjdadT", + "qz2ldM5N", + "hxguT2gs", + "v21TQelR", + "TcM4tRJ7", + "Yjrstzo1", + "JQQE0MDN", + "WEKs4Gzi", + "B8ok5rkQ", + "f7FE8BOQ", + "mPNYVc36", + "1OLdoHY8", + "PoExTab9", + "4g9pqcnb", + "ehdfvCaY", + "Kvw1yOok", + "QAbiMX9D", + "TpWs4qkZ", + "tZA4cN56", + "QQS19nR4", + "m64gtMds", + "Jsdg9Vdb", + "Iv428CmW", + "Crslv49b", + "3zNGt6OO", + "WQZ9ebz4", + "pQmUbqto", + "3FVNQJtJ", + "ykIDboku", + "xKXHVCic", + "VfxJd2gZ", + "OgLEVcMB", + "UBXgjNPD", + "JIATnP33", + "cv2Z5TeF", + "BtVbpXpI", + "8qglDdZL", + "vuoofvbI", + "tskp7Z3D", + "52EREVeS", + "y6KpibrX", + "2SipCC1i", + "MiBqZBsv", + "sOJClw11", + "SU1EqlX1", + "pD5OVT7d", + "C4NWve97", + "XcgvPUp6", + "YtAjRrfb", + "tNDGSs7W", + "stIrA2mf", + "Vkel37Wl", + "YXJ5HjQ4", + "2lRXnhPt", + "Gkwz0rh3", + "8UQz8WkJ", + "sUdjTPy9", + "bXZMYYSu", + "xcNwCgCf", + "reIeyKCI", + "JxlQnDSm", + "E8LwBJMB", + "xFp91lPb", + "rMBwAFKw", + "2zT5IsZn", + "FfV5RZtG", + "MgPeBaFm", + "urDP0Mks", + "Kb4BAIiW", + "fIVygPXT", + "ddxbZHMo", + "PZbsEZnM", + "wDUnqBPw", + "YzFbZDqf", + "OlVJ8ahy", + "M2ODdeV4", + "qTeJRLKK", + "gk5dDlrR", + "EIfFhwOu", + "b4ZXQbVM", + "lvSLGWr8", + "W2yZIWA0", + "p6lLwZf8", + "c4Tf9jDE", + "6kaPrdEr", + "5yiPi37T", + "CMug8Nwz", + "LZzdbygV", + "QvJYpDoC", + "PfSA6SDk", + "4eMajyde", + "26fAfGgV", + "HvqsBfw0", + "aCuiSICB", + "Z68VzSVz", + "8xNQP6ZL", + "LnC7lGqa", + "zxOxhVpj", + "v5vES96a", + "qG2UAsUU", + "oySjcwvW", + "SQtSVwfX", + "qW0WctEv", + "w4munIOn", + "ZwT3P3r1", + "rgdXDISd", + "9EafjRDg", + "eFXrwJOp", + "R0XpNHG6", + "MPZvaf8n", + "vdPkDecg", + "uhJiFqKQ", + "9olxX6gt", + "Cj94ptyN", + "orOaPuRF", + "IONq4poo", + "2BxMoFlR", + "aZeaT5a0", + "8ka351gb", + "kYTt4Ehb", + "GQgp1zFs", + "ovLd4SVh", + "7oBxQsEA", + "3dNoplGc", + "POL3xp4J", + "DDah3XPq", + "5zx4fKYL", + "8L400TgG", + "FH9xm6im", + "QciM5FRU", + "tSJjj2sJ", + "lTXrw3sM", + "VZMHJHas", + "fzG0atxM", + "7o6ui70P", + "5OJFL0qh", + "iQaxiH0B", + "hhznmvt7", + "jZiqu6jr", + "atOVJW4r", + "6WYNxXTX", + "6fCZ74qJ", + "bNXBxTdP", + "wLo3XZD8", + "SBdp9ewK", + "4aox9Qdx", + "ss9VjCNm", + "UJGDSXkw", + "IeUAzwHJ", + "DDOuFryg", + "ykHnawpb", + "yElIlUZd", + "Ds6RWjdK", + "cJ77Cj1H", + "gUVuld6l", + "VZd5wszQ", + "JQ01UhXy", + "1323LawF", + "EBqgwFsI", + "UqR5SJWS", + "IUU9KFVC", + "2LcgEGTy", + "3idej3u2", + "TkYNII32", + "s3P4Iy75", + "4jUyhUpS", + "aMQuoJeC", + "6kH6k4m2", + "N6XcYLg2", + "c25ZTHe6", + "6MBbfjvK", + "649c8iVS", + "dv8mCl0Q", + "pE7ey5D1", + "MQVEGudX", + "RCH5rELP", + "hlo9X0CC", + "YBFdVqeB", + "UEvmY4bD", + "RwSCWy4k", + "pBMhNQrV", + "iaCS8mXi", + "QDAD0EqU", + "8XKWbNSM" + ], + "icon_url": "https://cdn.modrinth.com/data/POQ2i9zu/fe23f8f297e91811bc1cdff3a617b4a5249fae16.jpeg", + "issues_url": "https://github.com/Faboslav/friends-and-foes/issues", + "source_url": "https://github.com/Faboslav/friends-and-foes", + "wiki_url": "https://github.com/Faboslav/friends-and-foes/wiki", + "discord_url": "https://discord.com/invite/QGwFvvMQCn", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/Faboslav" + }, + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/faboslav" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/POQ2i9zu/images/838bc8d410b57bd84bc66ab53fb764e4c1953d1f.jpeg", + "featured": true, + "title": "Logo", + "description": null, + "created": "2023-01-08T11:47:13.241236Z", + "ordering": -1 + }, + { + "url": "https://cdn.modrinth.com/data/POQ2i9zu/images/3da3b283e6e705dd9ba7351400cf8da513ca55ec.png", + "featured": false, + "title": null, + "description": "Illusioner shooting villager with his bow", + "created": "2022-03-29T21:25:59.456404Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/POQ2i9zu/images/4bc74af0418cc347868c5865f544d5b675280392.png", + "featured": false, + "title": null, + "description": "Iceologer Cabin structure in the snowy taiga biome", + "created": "2022-03-29T21:25:58.612605Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/POQ2i9zu/images/57118a145f44eee48c85318f72c56d672a6624b2.png", + "featured": false, + "title": null, + "description": "One of four variants of copper golem workstation structures", + "created": "2022-03-29T21:26:02.701196Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/POQ2i9zu/images/75785182602f9fd39c71935c7be422141270b8ab.png", + "featured": false, + "title": null, + "description": "Beekeeper with a new village structure", + "created": "2022-03-29T21:25:56.954865Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/POQ2i9zu/images/9b7825bec480cd5eb728c2ae69b21a10a624dfce.png", + "featured": false, + "title": null, + "description": "Bee pollinating moobloom's flowers", + "created": "2022-03-29T21:25:56.144813Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/POQ2i9zu/images/e8211ce28dda0bb5d754d003ec9fcdce2ec9d3c2.png", + "featured": false, + "title": null, + "description": "Unaffected and exposed copper golems", + "created": "2022-03-29T21:23:27.835581Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/POQ2i9zu/images/f793db73879387337198b2725deca9dc20733527.png", + "featured": false, + "title": null, + "description": "Iceologer summoning ice chunk", + "created": "2022-03-29T21:25:57.717675Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/POQ2i9zu/images/f9dca10e24d6dd10a67e6d1a8797f9b71dac10ab.png", + "featured": false, + "title": null, + "description": "Illusioner Shack structure in the taiga biome", + "created": "2022-03-29T21:26:00.341938Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/POQ2i9zu/images/fc7d4198ca82933401b316e10cf59114a646a167.png", + "featured": false, + "title": null, + "description": "One beehive for each wood variant", + "created": "2022-03-29T21:26:01.266876Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/POQ2i9zu/images/fe5f53aecd1e97f18552914f00847d4f8c8a8297.png", + "featured": false, + "title": null, + "description": "Glare flying in the lush caves", + "created": "2022-03-29T21:23:41.814986Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/POQ2i9zu/images/ffd03e2c2530397a503874e5c3546d3b3f30e709.png", + "featured": false, + "title": null, + "description": "All four stages of the copper button", + "created": "2022-03-29T21:26:01.960849Z", + "ordering": 0 + } + ], + "color": 9196354, + "thread_id": "POQ2i9zu", + "monetization_status": "monetized" + }, + "fzzy_core-0.5.1+1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1" + ], + "id": "LJ5wlCDr", + "slug": "fzzy-core", + "project_type": "mod", + "team": "F7zc3ZJZ", + "organization": null, + "title": "Fzzy Core", + "description": "API used in fzzyhmstrs mods that provides various utilities for Kotlin mods", + "body": "![Main Banner for the Fzzy Core mod](https://i.imgur.com/WRgL9Oq.png)\n\nWelcome to Fzzy Core! This is the base API that powers some kotlin mods made by fzzyhmstrs (that's me!). Besides offering some basic utility functions that come in handy for many different types of mods, Fzzy Core includes the basic framework of the Modifier System, a flexible and powerful system for modifying... almost anything!\n\n\nFzzy Core has KDoc integrated into the source for guidance on use. I'm also working on creating a wiki!\n\n[![Bisect Hosting Banner](https://www.bisecthosting.com/partners/custom-banners/85a7141b-76c9-4f0c-bd04-21f4b0d56c4a.webp \"Bisect Hosting Banner\")](https://bisecthosting.com/fzzyhmstrs)\n\n

\n\n\n_Fzzy Core is currently for Fabric. No port to Forge is planned at this time._\n\n_Fzzy Core is part of my project to split Amethyst Core into more functional component parts. This mod is the base of those parts, other APIs in my catalog build upon this base (like Amethyst Core for magic mods)_\n\n### Coding Utils\n\nFzzy core contains several utilities that make coding mods just a bit easier! These utilities include:\n\n* A base Enchantment Class that can be easily integrated with a configuration system to disable/enable individual enchantments.\n* A wrapper for Text that avoids headaches involved with multi-version mods and having to constantly battle merge conflicts on Text changes\n* A persistent effect system that allows for creation of delayed, repeating (or non-repeating) events that aren't tied to a specific objects tick or other messy implementation.\n* A particle creation system that allows for placing client-side particles at a certain spot in a players POV. This allows for items with particles dripping off them, a torch that emits smoke, etc.\n\n \n### Synced Configuration System\n\nCreate an easy-to-manage config system that allows for version control over time, and automatically syncs server configs to joining clients!\n\n* Takes advantage of some of Kotlin's unique functionality for a simple and clean looking implementation\n* Helper methods for automatic updating of config files to new versions, capturing the information from the old version before replacing it with the update.\n* Simple implementation of auto-syncing functions.\n\n \n### Custom Flavor Items\n\nAdd basic or tool items with flavortext!\n\n* Default implementation is simply some new lines in the lang file\n* Optional methods for more complex text\n* Also adds description text, for explaining what flavortext means, or for describing item functionality\n\n \n### Mana Items\n\nAdds a simple framework for creating items that use mana instead of being damaged in the typical way.\n\n \n### Modifier Framework\n\nThe Modifier Framework is a flexible and extensible system designed as a parallel to the vanilla Enchanting system. Modifiers aim to solve two of the biggest problems I found with Enchanting: They are easily removable, and they do not internalize their functionality (besides a couple damage methods). Enchantments are also more boring than they could be, displaying their tier with a simple number. Modifiers aim to fix all of those issues!\n\n* Modifiers are designed to be permanent, acting more like affixes. Grindstones can't remove them, for example.\n* Modifiers are designed to internalize their functionality, and can be called as one unit rather than piecemeal.\n* Modifiers act via a \"family tree\" that allow for flavorful tiers. Think of a sword going from \"Rusty\" to \"Shiny\" to \"Gleaming\" etc.\n\n \n\nThe library comes with builtin helper method for displaying modifiers\nAn example tooltip demonstrating modifiers in gold text \n\nSee the wiki link above for more details on these features. Once implemented, a Modifier system can do just about anything. Amethyst Core, for example, has a built-in AugmentModifier that does things from affecting mana cost and cooldown, to changing spell damage or range, to triggering advanced effects like afflicting every mob in a 12 block radius around the caster with Wither upon any successful spell cast.\n\n \n\nModifers can be as simple as a container for passing vanilla AttributeModifiers, or much more complex than the AugmentModifier described above. They could even be used purely for flavor if desired!\n\n \n### Nbt Util\n\nFzzy Core includes a simple util for performing some useful actions on NBT\n\n* read and write BlockPos with a single helper method, instead of manually saving X, Y, Z coords or doing Long conversion\n* Several NbtList utilities for reading from, adding to, and removing from NbtLists\n* An ItemStackId system for attaching a unique identifier to certain itemstacks. This allows, for example, an ItemStack keyed to a specific block entity... or much more!\n* A helper method for transferring non-enchantment NBT from one stack to another.\n\n \n### Raycaster Util\n\nA simple set of helper methods for locating objects\n\n* Server-sided raycasting for detection of game objects without needing to do fancy networking\n* Helper methods for entities, blocks, and locating things in areas around a point (like a player)\n* Ability to check for entities with arbitrarily rotated cuboids. Minecraft's default detection systems all use boxes aligned to the XYZ grid. This is useful for something like checking what enemies a spell hits, even if the player is looking diagonally and up a hill.\n\n \n### Event Registry\n\nRegistry for adding and tracking basic ticking objects not related to specific objects like entities.\n\n* Useful for creating periodic clocks that only fire every X ticks, allowing for creation of tick methods that don't fire every single tick. In fact, the registry comes with a 1 second, 1.5 second, and 2 second interval clock built in.\n* Adds a TickUppable interface and Ticker class for registration of objects to the registry.\n\n \n### Item Model Registry\n\nWant to make a custom trident but can't figure out how in heck to make the in-hand Trident appear like MC's does? This registry is for you!\n\n* Register custom item models for specific render modes (in hand, on ground, etc)\n* Integrates with the standard Fabric BuiltinItemRendererRegistry.DynamicItemRenderer\n\n \n### EffectQueue\n\nHate how adding passive status effects sometimes results in statuses \"fighting\" in the GUI, with statuses rapidly swapping back and forth?\n\n* This simple utility unifies the additions of all status effects passed into it into a predictable order\n* Uses all the standard status effect information you expect with addStatusEffect\n\n \n### Trinket Utils\n\nFzzy Core integrates optionally with Trinkets, adding some utility functions that can be used with them\n\n* getTrinketStacks provides a list of all Tirnkets equipped to the passed living entity\n* the AugmentTasks interface allows for creation of Trinkets that interact with special enchantments call Augments. These augments allow for trinkets with customizable passive and active abilities.", + "body_url": null, + "published": "2023-02-03T15:16:31.426932Z", + "updated": "2024-04-28T18:37:32.363372Z", + "approved": "2023-02-03T22:56:39.748980Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 341943, + "followers": 32, + "categories": [ + "game-mechanics", + "library", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "ndIps2V5", + "b1r9hqit", + "TyedjopD", + "jlbK22fV", + "nXjBTlU8", + "kA5GUcQN", + "GUEK1Dqr", + "o5HyRhRQ", + "fCsc7KDn", + "KkoGimcF", + "xiosgEv7", + "yqlqLvu8", + "KmK6eyb1", + "srGr0kEF", + "fmbpBARS", + "SsxOstvS", + "R0Z86IqQ", + "w27F4mQN", + "Pa1sgpF0", + "cFoQ21i8", + "VhXzJU5B", + "sTtZBmX2", + "KzdbDTuK", + "gDkoqjEK", + "98ulVIFp", + "Okk8QtaS", + "eKWH3jGK", + "s2zkvlJ6", + "eKJOisy1", + "8VDWk1sx", + "FAARzWkk", + "LDtlokNZ", + "yFyhdjxb", + "7aws6Qws", + "TNQO1KHX", + "iT0usf7m", + "lUj1i8VZ", + "tb0jIpzn", + "G6CaE33O" + ], + "icon_url": "https://cdn.modrinth.com/data/LJ5wlCDr/88d1d3e749b81e988eb3a12b60b259cf516b0bec.png", + "issues_url": "https://github.com/fzzyhmstrs/fc/issues", + "source_url": "https://github.com/fzzyhmstrs/fc", + "wiki_url": null, + "discord_url": "https://discord.gg/Fnw2UbE72x", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/fzzyhmstrs" + } + ], + "gallery": [], + "color": 14341573, + "thread_id": "LJ5wlCDr", + "monetization_status": "monetized" + }, + "gazebo-1.1.1+1.20.1": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.20.1" + ], + "id": "XIpMGI6r", + "slug": "gazebos", + "project_type": "mod", + "team": "mpCiHK0E", + "organization": null, + "title": "Gazebos (RPG Series)", + "description": "\u26f2\ufe0f Village structures hosting small spell libraries", + "body": "![Gazebos title](https://cdn.modrinth.com/data/XIpMGI6r/images/fddc777f0d28eea856016f0705de63050de8b0f0.png \"\")\n\n## \u26f2\ufe0f Find gazebos in villages, hosting small spell libraries.\n\n[![Modloader](https://img.shields.io/badge/Loader-Fabric-ecebe6?labelColor=263768&style=for-the-badge)](https://fabricmc.net)\n[![Discord](https://img.shields.io/discord/973561601519149057.svg?label=&logo=discord&logoColor=ffffff&color=7389D8&labelColor=6A7EC2&style=for-the-badge)](https://discord.gg/KN9b3pjFTM)\n\n## \u2728 Discover more of the RPG Series\n\n[![Archers](https://cdn.modrinth.com/data/XIpMGI6r/images/cd19a95a79f1157b33f31818aa615a280b206912.png \"Archers\")](https://modrinth.com/mod/archers \"\")\n[![Paladins](https://cdn.modrinth.com/data/XIpMGI6r/images/3f19359bfd7521ba17bec818f125e87e09ef277e.png \"Paladins\")](https://modrinth.com/mod/paladins-and-priests \"\")\n[![Wizards](https://cdn.modrinth.com/data/XIpMGI6r/images/a7da965aa108daf95c10448c01423be49ce2338d.png \"Wizards\")](https://modrinth.com/mod/wizards \"\")\n[![Jewelry](https://cdn.modrinth.com/data/XIpMGI6r/images/747102d582732b8defa50a2c925c7d5a6f87d009.png \"Jewelry\")](https://modrinth.com/mod/jewelry \"\")\n[![Rogues](https://cdn.modrinth.com/data/XIpMGI6r/images/278d8c941af6dc763cf714b9f36f8b8366a60eb9.png \"Rogues\")](https://modrinth.com/mod/rogues-and-warriors \"\")\n\n# \ud83d\udce6 Installation\n\n### Required\n\n- [Spell Engine](https://modrinth.com/mod/spell-engine \"\")\n\u00a0\n\n# \u26f2\ufe0f Features\n\u00a0\nAdds new structures into villages, containing Spell Binding Table, so you may find a faster way to obtain Spell Books.\n\nGazebos commonly spawn in villages, this can be configured in `config/gazebo/villages.json`.\n\nGazebo variants:\n\n- Desert\n\n- Plains\n\n- Savanna\n\n- Snowy\n\n- Taiga\n\n\n![Gazebo variants](https://cdn.modrinth.com/data/XIpMGI6r/images/7f2bfa1fa65bc88a886a48c791ad92d9bdf735ef.jpeg \"\")", + "body_url": null, + "published": "2023-05-23T22:29:13.359588Z", + "updated": "2024-06-27T19:22:38.874606Z", + "approved": "2023-05-24T00:28:47.963569Z", + "queued": "2023-05-23T22:55:29.640572Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 309053, + "followers": 162, + "categories": [ + "adventure", + "magic", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "KWKgiB4F", + "7msgkeH4", + "sdLRR99K", + "DG1rAX5v", + "7OXOb67d" + ], + "icon_url": "https://cdn.modrinth.com/data/XIpMGI6r/1ed69629d4295c976ae21ca1355f104d58e58924.png", + "issues_url": "https://github.com/ZsoltMolnarrr/Gazebo/issues", + "source_url": "https://github.com/ZsoltMolnarrr/Gazebo", + "wiki_url": null, + "discord_url": "https://discord.gg/KN9b3pjFTM", + "donation_urls": [ + { + "id": "github", + "platform": "Github", + "url": "https://github.com/sponsors/ZsoltMolnarrr" + }, + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/daedelus" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/XIpMGI6r/images/278d8c941af6dc763cf714b9f36f8b8366a60eb9.png", + "featured": false, + "title": "Rogues 275", + "description": null, + "created": "2024-06-20T20:21:14.028836Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/XIpMGI6r/images/3f19359bfd7521ba17bec818f125e87e09ef277e.png", + "featured": false, + "title": "Paladins 275", + "description": null, + "created": "2023-11-17T16:11:47.831252Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/XIpMGI6r/images/747102d582732b8defa50a2c925c7d5a6f87d009.png", + "featured": false, + "title": "Jewelry 275", + "description": null, + "created": "2023-11-17T16:11:17.315251Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/XIpMGI6r/images/7f2bfa1fa65bc88a886a48c791ad92d9bdf735ef.jpeg", + "featured": true, + "title": "Gazebo variants", + "description": null, + "created": "2023-05-23T22:32:15.932426Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/XIpMGI6r/images/a7da965aa108daf95c10448c01423be49ce2338d.png", + "featured": false, + "title": "Wizards 275", + "description": null, + "created": "2023-11-17T16:11:59.653186Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/XIpMGI6r/images/cd19a95a79f1157b33f31818aa615a280b206912.png", + "featured": false, + "title": "Archers 275", + "description": null, + "created": "2023-11-17T16:10:41.975563Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/XIpMGI6r/images/fddc777f0d28eea856016f0705de63050de8b0f0.png", + "featured": false, + "title": "Gazebos Title", + "description": null, + "created": "2023-05-26T07:32:02.239105Z", + "ordering": 0 + } + ], + "color": 5673548, + "thread_id": "XIpMGI6r", + "monetization_status": "monetized" + }, + "gear_core-0.3.8+1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1" + ], + "id": "t7eXC8r7", + "slug": "gear-core", + "project_type": "mod", + "team": "LcgMezQr", + "organization": null, + "title": "Gear Core", + "description": "Library mod for the creation of equipment modifiers that can apply entity attributes or track a variety of events like taking damage, killing mobs, and more.", + "body": "![Gear Core Heading Banner](https://i.imgur.com/1Te0eVW.png \"Gear Core Heading Banner\")\n\n[![Bisect Hosting Banner](https://www.bisecthosting.com/partners/custom-banners/85a7141b-76c9-4f0c-bd04-21f4b0d56c4a.webp \"Bisect Hosting Banner\")](https://bisecthosting.com/fzzyhmstrs)\n\n## New as of 0.3.0, Gear Sets!\nCreate custom gear set bonuses via datapack! Create RPG set bonuses for any combination of items, the sets can have tiers, custom formatting, and can be applied to virtually any item! Tooltips for your set bonuses appear automatically in the relevant sets, and there is even EMI support for displaying all of the sets, their items, and the bonus descriptions!\n\nGear sets support Attributes, including custom attributes, and Equipment Modifiers. Currently only attributes can be added strictly via datapack, modifiers have to be created in code before being referenced in a gear set. Somewhere in my \"want to do\" list is datapack-based equipment mods, so stay tuned!\n\nHere is an example Gear Set from Imbued Gear. All of the bonuses are active in this picutre:\n![Example Gear Set Tooltip](https://i.imgur.com/dJDe0oT.png)\n\nAnd here is the JSON used to create it. Soon I'll have documentation of the format in wiki.\n\n```java\n{\n \"name\": \"set.imbued_gear.lich_kings\",\n \"active_formatting\": [\n \"GREEN\",\n \"BOLD\"\n ],\n \"items\": {\n \"tag\": \"imbued_gear:lich_kings_gear\"\n },\n \"bonuses\": {\n \"2\": {\n \"name\":\"lich_kings_amplifier\",\n \"attribute\": \"amethyst_core:spell_amplifier\",\n \"amount\": \"2.0\",\n \"operation\": \"ADDITION\"\n },\n \"4\": {\n \"name\":\"lich_kings_duration\",\n \"attribute\": \"amethyst_core:spell_duration\",\n \"amount\": \"0.15\",\n \"operation\": \"MULTIPLY_TOTAL\"\n },\n \"5\": \"imbued_gear:horde_master\"\n }\n}\n```\n\n## Equipment Modifiers\n\nLibrary mod that facilitates the creation of equipment modifiers that can apply standard Minecraft entity attributes or track a variety of events like taking damage, killing mobs, mining blocks, and more. These modifiers aren't affected by grindstones, enchanting tables, or other Minecraft features. These modifiers use the Fzzy Core modifier framework; as such they can be arranged into lineages that pass from one to the next rather than simply stacking numerically.\n\n

\n\n## Current Item Support and Example\nGear Core has built-in modification support for `ArmorItem`, `ToolItem`, `BowItem`, `CrossBowItem`, `ShieldItem`, `TridentItem`, and `Trinket`, but provides a framework (with the help of Fzzy Core) for making any other type of item modifiable.\n\n#### Example of Equipment Modifiers in action via _Gearifiers_:\n\n![https://i.imgur.com/aPJanNb.png](https://i.imgur.com/aPJanNb.png)\n\n## Modification Features of an Equipment Modifier\nEquipment modifiers can affect the following aspects of equipment:\n\n### Attribute Modifiers\nStandard [Minecraft Attributes](https://minecraft.fandom.com/wiki/Attribute) can be attached to equipment modifiers. These attributes stack on top of whatever innate attributes the gear has and on top of other modifications.\n\n### Durability Modifier\nThe durability of the gear can be modified using a Fzzy Core `PerLvlI` instance, which allows for flat changes to durability or percentage changes (or both!).\n\n### Post Hit Events\nPost-hit event consumers can be added to an Equipment Modifier. These consumers are fired on the `postHit` method of `ItemStack`, allowing implementations to perform actions after a player has hit something.\n\n### Post Mine Events\nSimilar to the post-hit events, consumers can also be added for `postMine`, which fires after a player has successfully broken a block.\n\n### On Use Events\nAdd activated abilities to items! These events fire on the `use` method, like any right click action. The events only fire if the items innate `use` isn't successful.\n\n### Incoming Damage Modification and Event\nDamage modification functions can be attached to equipment modifiers, both allowing for event code upon a player getting damaged, and for damage modification (reduction by 10% of all magic damage, for example).\n\n### Mob Kill Events\nAn event that fires when a player kills a mob, similar structure to all the other events, implementations pass a special consumer to the Modifier for it to process.\n\n### Other Modifiers\nOther types of modifiers can be attached to equipment modifiers, with a `ModifierProcessor` available so an implementation can decide what to do with them.\n\n## Modifier Rolling System\nGear Core provides a modifier randomization system for adding of random modifiers to certain gear. Check out _Gearifiers_ for a thorough example of this system in action. The short story of how this system works:\n\n### Modifier Targets\nGear Core adds `EquipmentModifierTarget`s. These work is a similar manner to `EnchantmentTarget` in Minecraft, but they are an extendable class rather than an enum. When the modifier rolling system is picking modifiers, it will only pick modifiers from the proper targets.\n\n### Weight\nLike loot and other things in Minecraft, modifiers can be provided with a weight. This weight works exactly as you'd expect.. every modifier who matches up to the target is put into a pool X times based on it's weight, and the total pool is used for random modifier rolls.\n\n### Rarity\nModifiers can be given a rarity. This is an enum that defines the formatting of the modifier on the item tooltip, with the different rarities providing different colors (and some bold)\n|Rarity|Format|\n|---|---|\n|Legendary|Gold, Bold|\n|Epic|Light Purple|\n|Rare|Aqua|\n|Uncommon|Dark Green|\n|Common|Gray|\n|Bad|Dark Red|\n|Really Bad|Dark Red, Bold|\n\n### Toll\nEach modifier takes a certain toll on the rolling pool. The pool starts with a certain amount of toll it can spend, with each modifier added spending it's toll out of that pool until there isn't enough left for the next roll to succeed. The default toll is 5, with a default pool of about 5.75 on average.\n\nProviding different tolls allows for fine tuning of selection probability.\n\n### Persistence and Availability for Rolling\nA modifier can be created to be `persistent`, which prevents it from being removed on a reroll. This might be used for \"innate\" modifiers or for \"cursed\" modifiers.\n\nModifiers can also be marked as unavailable for random selection. This might be used, again, for \"innate\" modifiers that aren't part of a random chance system but are simply provided with every instance of the item.\n", + "body_url": null, + "published": "2023-02-10T21:42:47.550800Z", + "updated": "2024-03-13T19:21:33.585263Z", + "approved": "2023-02-10T23:17:09.607572Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 151530, + "followers": 21, + "categories": [ + "equipment", + "game-mechanics", + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "V0DSOwCu", + "pfmaQw0s", + "LZNzoU5Q", + "e8hAAiiZ", + "xsZgycGj", + "WJ1xH29P", + "pOiB6Vmq", + "E5fzUBF8", + "Td3HXUy3", + "rXr2Nz6d", + "attE4Cs5", + "2HpnQo3T", + "G4esITMk", + "3BzaAERl", + "pRgEsJAD", + "XzvmnVMr", + "LY5YqgfS", + "QjZlwMVs", + "iP5zAz3C", + "aw9axYzY", + "HCquB11Y", + "grWeF5cS", + "XjuCo9AK", + "mfJTwFYU", + "cHBSK6qE", + "6TiIYm6U", + "42udwzHC", + "Jezhi8Ti", + "BgXZQR1y", + "MQdLL7jS", + "KEHQgxlJ", + "2prHsmEu", + "v6loQDr9", + "13jKK1tr", + "Ewaf3kww", + "l69oqEC6", + "1SLKkOMn", + "P4ypUmuv", + "t3mgJT6c", + "IrvKwgxh", + "f18jMRyn", + "hSuoBYTi", + "YCBcJ59B", + "zsMQOVkQ", + "HIdVXPa1", + "I4jtbg7D" + ], + "icon_url": "https://cdn.modrinth.com/data/t7eXC8r7/a27540ad37c518ca853d3d4b83d40ef362e9db67.png", + "issues_url": "https://github.com/fzzyhmstrs/gc/issues", + "source_url": "https://github.com/fzzyhmstrs/gc", + "wiki_url": null, + "discord_url": "https://discord.gg/Fnw2UbE72x", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/fzzyhmstrs" + } + ], + "gallery": [], + "color": 7127391, + "thread_id": "t7eXC8r7", + "monetization_status": "monetized" + }, + "geckolib-fabric-1.20.1-4.4.7": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.12.2", + "1.15.2", + "1.16.5", + "1.17.1", + "1.18.2", + "1.19.1", + "1.19.2", + "22w42a", + "1.19.3-pre2", + "1.19.3-pre3", + "1.19.3-rc2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "8BmcQJ2H", + "slug": "geckolib", + "project_type": "mod", + "team": "XGT1SohE", + "organization": null, + "title": "Geckolib", + "description": "A 3D animation library for entities, blocks, items, armor, and more!", + "body": "
\n\"logo\"/ \n\n\"discord\"/ \"patreon\"/ \n\n

GeckoLib is an animation engine for Minecraft Mods, with support for complex 3D keyframe-based animations, 30+ easings, concurrent animation support, sound and particle keyframes, event keyframes, and more. Available for Forge 1.12/1.15/1.16/1.17/1.18/1.19, Fabric 1.16/1.17/1.18/1.19, and Quilt 1.18/1.19.

\n\n\"logo\"/ \n

You can view installation instructions for modders here.\n\n
\n\nFor non-modders, just download the mod and put it in your mods folder like normal. You can also click the following images for a list of versions for each mod loader.

\n\n\"logo\" \"logo\" \"logo\" \n\n\"logo\"/ \n\nGeckoLib provides detailed documentation in the form of a wiki. We spent many hours writing the wiki, so please read it!\n\n\"logo\"/ \n\nIf you have questions or need help getting up and running with questions, join our discord!\n\n\n\"logo\"/ \nPull requests are welcome. For significant changes, please open an issue first to discuss what you would like to change.\n\n\n\n\"logo\"/ \n\"logo\"/ \n\n

Sponsored by BisectHosting

\n\nNeed a server to play with friends? Don't know how to setup one? Just rent an already configured server from BisectHosting!\n\n\"logo\"/ \n\nClick on the picture above, select plan(at least 4GB), and use my code gecko to get 25% off your first month and enjoy playing with your friends!\n
", + "body_url": null, + "published": "2022-08-07T03:30:16.186586Z", + "updated": "2024-08-07T19:40:32.509487Z", + "approved": null, + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 3855273, + "followers": 991, + "categories": [ + "game-mechanics", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "qsDdTKC4", + "WlJpUDzh", + "qL484XIi", + "uGcjKjMT", + "qTaRycbQ", + "RQJwyPuD", + "136B88lJ", + "bpKnMhEa", + "UKhnnujs", + "FQM6xvXj", + "3wOAeMp4", + "FULWdgD2", + "PCuF7vta", + "EMhe8KDf", + "VoJWQ0A5", + "LjY1py3L", + "NieUKm9V", + "FBez9mw0", + "bfDs5CGO", + "e46ntzMz", + "Lufe4XGu", + "pZg4ShGq", + "rnpkwA6U", + "23iMZ077", + "cPl587dh", + "aybWUDvp", + "MdTCpBJs", + "kd7nev5i", + "UyGeKl49", + "HfqFVm6P", + "QahGC1tv", + "m9AnbIdD", + "wAM2IwJW", + "z7ttczzS", + "Xy0nEDNy", + "eEj1SnTD", + "iRoNiwjq", + "ZFwnAEum", + "ssDvxZOr", + "a2zhIVW2", + "GMevGe2P", + "aavqJAu0", + "oTCPZRK2", + "TuPk6QZp", + "2EGIW2Bk", + "Ac58BAut", + "bQR9FtHO", + "2gh3yA6d", + "sZX0Ksio", + "s3lOSctd", + "pOOaURnj", + "t3kOAVy9", + "txnNTpPP", + "BuycnCr6", + "KeljFi5f", + "xArw9Rpd", + "N3QQyyNO", + "R5tKL3H0", + "lFeJ1Y6Z", + "985FODzz", + "Mb3tsipy", + "CdZDxK19", + "VwYAuIe2", + "dZ80RpWZ", + "IWsrMj74", + "fU0VPYUQ", + "ZARTsAr0", + "nWu6K0d8", + "J7M9EKvT", + "ZnAjp6NS", + "toUneKTa", + "YcJlytqm", + "PePYVhnE", + "GTDBRhSM", + "x78E4Tlx", + "GvdbRgRZ", + "TBflAYyp", + "Wtqi370i", + "Yr6avANW", + "ktczq9M5", + "Wl4D0Y5t", + "PrXWMSTC", + "4EE9OtNu", + "8YJ2SCwm", + "r2mQozkq", + "QSWXbrQt", + "AnSkgs2g", + "K7FKS2QU", + "yicTO4gk", + "af2O77o6", + "ScTMGjW0", + "znZYx5xF", + "6CPHVMxL", + "YRXoztI9", + "ZjycXvlH", + "D7zKpl75", + "Lk6yJhJI", + "9NhnjTrH", + "6uVE2Ntc", + "KozOahEp", + "JUfF6Jer", + "E4nh57qb", + "T8CaK9d5", + "w1DWrZwm", + "QCo5GZL2", + "aJWSPyUh", + "BVbxR0lq", + "eProCvAi", + "dlFzExiC", + "8lHNv1BR", + "5GVTBPUE", + "qUDA5Ozd", + "bhPmYcTR", + "C4VIuMdv", + "wvgmgrMa", + "sa9wyf1R", + "nQTlPpY3", + "BHwMnQiT", + "AnwcpwtS", + "ULE87UoX", + "vJkUTLKD", + "Lrxf2dfv", + "BKXKWNHN", + "e14z89Tc", + "lt84hTBS", + "iYQH7uEL", + "p29L54mf", + "YADnFBNq", + "xXGDe6P5", + "f3XhBRHz", + "lDhul8lN", + "PXKR9X73", + "TiAfTtVK", + "pnqQuYJn", + "rjdRQUqS", + "ZMaBVc0E", + "oeKXWdtC", + "Zl8TorMb", + "vpi1hsCQ", + "1aPT3e1t", + "JTvFZCgx", + "M3YdkbNy", + "aqERQH8d", + "cddgJkS9", + "tW58wvXj", + "Sgjcv40y", + "1ZrdoKlp", + "UhSQdxcp", + "OaVRMrL9", + "5XPm4pRO", + "V1WV1xOD", + "QS9XNW9P", + "gvGNfUeU", + "Rh21CzYm", + "faphAyqV", + "PGdyqE3B", + "NqzcbCO3", + "s3u1zFH2", + "LEndENkm", + "86Mbu5mU", + "AGtXkmMt", + "eHT3dHPd", + "fUME5kUI", + "xhCnuSjR", + "mXxld3t8", + "G46UXN4P", + "p2dalTPH", + "8vkpQIf8", + "8jw6t6DH", + "zOvnacPM", + "LHmZ1Krb", + "We6XodNB", + "rWeVCWgR", + "KfwWK3E2", + "LhezFear", + "QvVmqFDc", + "H1mCsWKb", + "wBBaWvGV", + "DgA0gMMc", + "vFTTggHa", + "g90LsOdt", + "daSMlw4L", + "uk7FQRvC", + "E1Z2wSuT", + "WspBbYOH", + "OoBHBsUu", + "bYYpbnJG", + "u8LHqLYt", + "lTKMOGfM", + "NVpH4rdV", + "wwh0ZFLu", + "Z7uH6V77", + "Wc0K0JdF", + "Cpb3NEuc", + "cxFfuDw6", + "zcE0moFY", + "AQq8fMnZ", + "6hvy9UPH", + "jIvd4A4a", + "TPK2iTqH", + "UQGoJDhn", + "Z8ZwOmeO", + "HSMmTQz5", + "ECNL11XI", + "6ptEPw1M", + "zUwlnUJD", + "FEkGX3MJ", + "GF04iZJU", + "zgFD8eDN", + "blSVr08Y", + "1myM5wR4", + "YaWDUJEE", + "ATPZfRS1", + "lxzmD9V4", + "AwczxULS", + "8QvnKtLJ", + "CHEy45yh", + "rnr7nYuM", + "KqLqSsme", + "oTLyaKlW", + "vmiN6kCm", + "gOx2as1z", + "eynJ8oNP", + "cYRFw6kc", + "d48ItbMp", + "QTZrKfzq", + "RXmXb7fC", + "woswYEKK", + "cv3DdC41", + "roB0GDEp", + "6mx7VPLs", + "A4mByKCk", + "fWtfrvf2", + "ApKEGN4z", + "B4kTh670", + "e503GzWn", + "qq4z76WF", + "5bofFrdJ", + "V5QnDeov", + "UuuqztzH", + "oPgOSBzN", + "ISrpRn5q", + "GVK2FvVE", + "B9QFOUgq", + "xeICIALe", + "BphtIZ9i", + "tkFgcZ7f", + "RCo2zVmf", + "MOUhkQH6", + "gkLopHQN", + "9McGNAut", + "jeyby0vh", + "ivvYEVfa", + "Ks3ebpYi", + "496UKM7k", + "WErUOFCR", + "KyRLWNQb", + "5bspDn1H", + "LsTR7vL2", + "TW9RyHl8", + "Jfq413xC", + "t7b6BuZg", + "5gvx4EoC", + "Z4SMiN06", + "Bz42AtzS", + "WBHev6kG", + "19vAzqod", + "i86GnJGu", + "VHbOcZ8J", + "NlQP6qIW", + "gDKBrobB", + "6AmfrKIK", + "RsTqpaFp", + "B46dYvsx", + "yQBqORty", + "wO1uihQr", + "oOD7OqIv", + "nnfDaAnr", + "OitMQuA2", + "QQiBbYQ7", + "KImFOI2k", + "pyB0jIsx", + "NWOU2OY5", + "jM7tAFAm", + "LgQ7WQ4T", + "sw6GjiBg", + "WcZ8Wvmt", + "1V70r7yv", + "slWFrHeX", + "pXlv5nlE", + "9xn1SoTo", + "WxC8HFLo", + "jK2C8NsI", + "qsvFEDEz", + "vv4Q0406", + "72yIIxm4", + "zg4T7LyQ", + "OYa6KHmE", + "74JZpmum", + "6JGPZhtp", + "T5k4FbjP", + "mAODxf2E", + "EzafgqHc", + "pGvbH3X6", + "O6hsDmwQ", + "VrjtFfc1", + "ya8amp9E", + "I5gM8tUd", + "iS7jylhp", + "eqdCWw5e", + "9IHFGXrW", + "ehZxw0RG", + "JuxOFZ5Z", + "3Gbmf2F3", + "sct1O8ti", + "2o74MJEa", + "yAwAC6tt", + "UCl2KRDj", + "SP8zSYhc", + "R76ya2BV", + "BDftClTQ", + "rF4Es4hd", + "4ysPVX1z", + "yzLdtOfi", + "lwqsfRMW", + "kFy9fnMx", + "11VBhLU2", + "TUMEJhCC", + "UvKZBX05" + ], + "icon_url": "https://cdn.modrinth.com/data/8BmcQJ2H/7638e6cddbc4d675c3dd874c8be5ae01efcfe31b.png", + "issues_url": "https://github.com/bernie-g/geckolib/issues", + "source_url": "https://github.com/bernie-g/geckolib", + "wiki_url": "https://github.com/bernie-g/geckolib/wiki", + "discord_url": "https://discord.gg/pPEqBgJtZW", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/8BmcQJ2H/images/5e8cd1323a6e90ce6572eae71e109b6a7fb8e5c9.jpeg", + "featured": true, + "title": null, + "description": null, + "created": "2023-02-13T15:43:35.064485Z", + "ordering": 0 + } + ], + "color": 2105379, + "thread_id": "8BmcQJ2H", + "monetization_status": "monetized" + }, + "GeckoLibIrisCompat-Fabric-1.0.0": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.18.2", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "TbriQCWD", + "slug": "geckoanimfix", + "project_type": "mod", + "team": "vOPPtsyL", + "organization": null, + "title": "Iris/Oculus & GeckoLib Compat", + "description": "Fixes GeckoLib animations not working if using a shaderpack with entity shadows.", + "body": "# Iris / Oculus & GeckoLib Compat\n\nFixes GeckoLib entities' animations not working while using shaderpacks that have entity shadows.\n\nExample of a GeckoLib entity working with Insanity Shader, using entity shadows.\n\n\n", + "body_url": null, + "published": "2024-01-07T19:47:34.800790Z", + "updated": "2024-03-16T05:05:38.990789Z", + "approved": "2024-01-11T04:09:05.524461Z", + "queued": "2024-01-07T20:00:47.487710Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 430912, + "followers": 92, + "categories": [], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "3Q4qBNwT", + "UoSPDBmz", + "uWXuMaW4" + ], + "icon_url": "https://cdn.modrinth.com/data/TbriQCWD/5b0cd877e80dc7167a73df5160f7b0cd43b15f43.png", + "issues_url": "https://github.com/nvb-uy/geckoanimfix/issues", + "source_url": "https://github.com/nvb-uy/geckoanimfix", + "wiki_url": null, + "discord_url": "https://discord.gg/LUNAPIXEL", + "donation_urls": [], + "gallery": [], + "color": 14933974, + "thread_id": "U8Rs22dr", + "monetization_status": "monetized" + }, + "Geophilic v3.1.1 f15-48": { + "client_side": "optional", + "server_side": "required", + "game_versions": [ + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "hl5OLM95", + "slug": "geophilic", + "project_type": "mod", + "team": "VnZb9yVa", + "organization": null, + "title": "Geophilic", + "description": "A subtle-ish overhaul of vanilla Overworld biomes! Reworked!", + "body": "![](https://i.imgur.com/yJbL99N.png) \n\n### \ud83c\udf32 About\n**Geophilic** is a data pack/mod that improves vanilla Overworld biomes in a subtle and simple way! Main inspiration comes from scrapped illustrations for what was supposed to be the *Wild Update* \u2014 this is essentially a collection of relatively light improvements to vanilla biomes without any new blocks, items, or even biomes.\n\nGeophilic adds variety to a host of biomes. You can find a plethora of new features, from simple fallen trees to forest clearings. There are boulders, tree stumps, bushes, moss, and more. Trees remain true to vanilla, with the one major change being how tall trees generate, so you don't bump your head so often!\n\nCare was taken to keep vanilla gameplay progression and feel. Geophilic does not make use of block palettes that would not be found in vanilla, nor does it add wood types to biomes they're not found in by default.\n\nIn short, this isn't meant to be an epic worldgen overhaul, but rather a simplistic and nice update to the feel of vanilla biomes.\n\n### \ud83d\udce6 Content\n**v3.0.0 and above,** almost every non-ocean biome gets an overhaul.\n\n**v2.4.0:** Badlands, Birch Forest, Cherry Grove, Dark Forest, Deep Ocean, Desert, Eroded Badlands, Flower Forest, Forest, Jungle, Meadow, Old Growth Birch Forest, Old Growth Pine Taiga, Old Growth Spruce Taiga, Plains, Savanna, Savanna Plateau, Snowy Plains, Snowy Slopes, Stony Shore, Sunflower Plains, Swamp, Taiga, Windswept Forest, Windswept Savanna, Wooded Badlands\n\nSee the gallery for pictures!\n\n### \ud83d\udcdd Notes\nFabric/Quilt mod version requires either **[Fabric API](https://modrinth.com/mod/fabric-api)** or **[Quilted Fabric API](https://modrinth.com/mod/qsl)**!\n\nNew versions of the pack may differ slightly. I may make any changes, including the removal of features. While Minecraft can handle this and updating the mod won't corrupt your world, it's still good practice to make regular backups.\n\n### \ud83d\udda5 Compatibility\nThis pack modifies only vanilla biome files, which means it's fully compatible with mods and data packs that do terrain, such as **[Tectonic](https://modrinth.com/datapack/tectonic)** or **[Lithosphere](https://modrinth.com/datapack/lithosphere)**!\n\nIf a data pack says it reworks vanilla biomes, it is likely partially or fully incompatible.\n\nCompatibility with **Terralith** is planned.\n", + "body_url": null, + "published": "2022-12-03T15:03:54.365448Z", + "updated": "2024-08-01T15:06:22.478478Z", + "approved": "2022-12-03T19:03:37.102621Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 1006506, + "followers": 1333, + "categories": [ + "adventure", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "datapack", + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "UVovWaKz", + "5T4xt43L", + "2pwkQOab", + "J3Yi0Oyl", + "t5q8uDOI", + "68Z9J1jm", + "La998k4Z", + "vpqrdMks", + "zbdvhxBX", + "FWgzqH4O", + "O7bCIVMg", + "gYwqQrkH", + "gKMt1GJV", + "RFwbzma9", + "aEPbY2ib", + "RUAxosdK", + "Z2iaqbZb", + "Th8LOkDF", + "K4PF6ees", + "kVzJHQxV", + "DgAc8DJ8", + "wU4A1GgO", + "vEXGEu0m", + "CrNx5KYz", + "pv4KqECY", + "y3P3rM3c", + "5yBBBe0B", + "YGI0A2aN", + "LSWMMsCf", + "eygL9HIq", + "Ya0B2hqO", + "6Gaj7A47", + "unAXrpYL", + "5qMqMp2z", + "Tw3v1YmL", + "4kTbArMI", + "9mPgtCnM", + "WCyhs86R", + "fKmASpVj", + "g6ZyyvZ1", + "RRNZbxAa", + "uh7dVeoT", + "x6WC71YJ", + "9kdw5gA3", + "PTRQLP5p", + "nngEF8U5", + "wJNAJmGH", + "oCR4pvWu", + "DI57oxoL" + ], + "icon_url": "https://cdn.modrinth.com/data/hl5OLM95/0a857b9f9e96f9f09fe6a32868be3bbb07f1fed1.jpeg", + "issues_url": "https://github.com/everloste/my-mc-projects/issues", + "source_url": null, + "wiki_url": null, + "discord_url": "https://discord.gg/4qE2GuGz2J", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/hl5OLM95/images/54b2b6f08b335992a9067fdcd00e371adcafa6ad.jpeg", + "featured": false, + "title": "Plains", + "description": null, + "created": "2024-06-17T17:47:55.707901Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/hl5OLM95/images/5cbbe481978c2e51f7a972619ed1fe455c33aede.png", + "featured": true, + "title": "Thumbnail", + "description": null, + "created": "2024-07-22T15:35:41.809283Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/hl5OLM95/images/031c97e62fe8ce836d2aa24819dcaeb0608553e9.png", + "featured": false, + "title": "Savanna", + "description": null, + "created": "2024-07-21T18:26:17.528612Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/hl5OLM95/images/1fcadf030b006a43dcf2e322e1b5e375584aa9f7.png", + "featured": false, + "title": "Old Growth Birch Forest", + "description": null, + "created": "2024-07-21T18:22:17.928859Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/hl5OLM95/images/22dc24219fe0b135c40709a37cd5afe43df2eff7.png", + "featured": false, + "title": "Forest", + "description": null, + "created": "2024-07-21T18:22:28.630287Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/hl5OLM95/images/389c2b7bce8e077df0846929c855f96a37612d50.png", + "featured": false, + "title": "Taiga", + "description": null, + "created": "2024-07-21T18:21:59.731397Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/hl5OLM95/images/3f633cb7238a24d9c055e028e38db7bcf244698e.png", + "featured": false, + "title": "Plains", + "description": null, + "created": "2024-07-21T18:21:40.178210Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/hl5OLM95/images/7dc2c9baec20dbc45780b41646abf59432418425.png", + "featured": false, + "title": "Cherry Grove", + "description": null, + "created": "2024-07-21T18:23:10.236788Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/hl5OLM95/images/a444618ec4a12ffd34f1be681631380985a124d7.png", + "featured": false, + "title": "Swamp", + "description": null, + "created": "2024-07-21T18:22:07.605288Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/hl5OLM95/images/a70a234a405844b5703de0856a58a4f9d8bd9a63.jpeg", + "featured": false, + "title": "Dark Forest", + "description": null, + "created": "2024-07-26T13:47:53.790820Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/hl5OLM95/images/ed2565da9c7626c3a78422134147457c20d7530f.png", + "featured": false, + "title": "Stony Shore", + "description": null, + "created": "2024-07-21T18:22:54.260429Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/hl5OLM95/images/f5607ddb4b95cd2ecb06bc8d212222322192bbf2.png", + "featured": false, + "title": "Snowy Taiga", + "description": null, + "created": "2024-07-21T18:22:37.891572Z", + "ordering": 1 + } + ], + "color": 13813900, + "thread_id": "hl5OLM95", + "monetization_status": "monetized" + }, + "grapplemod-1.8+1.20(.1)": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20-pre2", + "1.20-pre4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4" + ], + "id": "f4hp6FTb", + "slug": "grappling-hook-mod-fabric", + "project_type": "mod", + "team": "3GfLr2n3", + "organization": null, + "title": "Grappling Hook Mod: Restitched", + "description": "A port of Yyon's original grappling hook mod - The mod adds grappling hooks with several different modifiers to improve traversal within your world, ranging from force fields to double hooks.", + "body": "[![](https://raw.githubusercontent.com/squeeglii/grapplemod-restitched/latest/docs/media/banner.png)](https://github.com/squeeglii/grapplemod-restitched)\n\n[![Minecraft Version](https://img.shields.io/badge/Minecraft-v1.20.1-blue?style=flat-square)](https://www.minecraft.net/en-us)\n[![Fabric Loader Version](https://img.shields.io/badge/Fabric_Loader-v0.14.21-AA8554?style=flat-square)](https://fabricmc.net/use/installer/)\n[![Cloth Config Version](https://img.shields.io/badge/Cloth_Config-v11.0.99-pink?style=flat-square)](https://modrinth.com/mod/cloth-config)\n[![Mod Menu Version](https://img.shields.io/badge/Mod_Menu-v7.1.0-indigo?style=flat-square)](https://modrinth.com/mod/modmenu)\n[![GPL-3.0](https://img.shields.io/badge/License-GNU_GPL_3.0-mint?style=flat-square)](https://www.gnu.org/licenses/gpl-3.0.en.html)\n\n[![Modrinth](https://img.shields.io/modrinth/dt/f4hp6FTb?logo=modrinth&style=flat-square)](https://modrinth.com/mod/grappling-hook-mod-fabric)\n[![Curseforge](https://cf.way2muchnoise.eu/short_grappling-hook-restitched.svg?badge_style=flat)](https://www.curseforge.com/minecraft/mc-mods/grappling-hook-restitched)\n\n---\n\n# Project Overview\n\nA classic Grappling Hook mod with great physics and a wide range of customizations! This Minecraft mod is written for\nthe Fabric & Quilt mod loaders for modern versions of Minecraft (1.18.2+) - Changes tend to focus on making it more\nextendable, as well as improving compatibility with other mods. Improvements to older features are also being sprinkled\nin from time to time.\n\nThis mod's official project pages can be found below:\n\n- [Modrinth](https://modrinth.com/mod/grappling-hook-mod-fabric)\n- [CurseForge](https://curseforge.com/minecraft/mc-mods/grappling-hook-restitched) \n\nFabric compatibility *comes first* due to its current adoption in the Minecraft Modding community, however Quilt is\nsupported by the mod currently! In the case that either Mod Loader encounters a problem, make sure to\n[submit a bug report!](https://github.com/squeeglii/grapplemod-restitched)\n\n\n\n## \ud83d\udd17 Origins\n\nThis repository is an unofficial fork of Yyon's [Grappling Hook Mod](https://github.com/yyon/grapplemod), which was \nwritten to support the Forge mod loader. It has a history stretching back all the way to its MCreator roots in 2015,\nimplementing improved physics, upgrades, and better integrations since.\n\nYou can find the links to its official project pages (and the downloads) here:\n\n- [Modrinth](https://modrinth.com/mod/grappling-hook-mod/versions)\n- [CurseForge](https://www.curseforge.com/minecraft/mc-mods/grappling-hook-mod) (More up-to-date? Last checked 19/6/23)\n\nThis fork's root stems from the 1.19.2 version of v13, created under the original scope of providing an alternative\nunder the Fabric & Quilt ecosystems, as well as updating these ports to future versions. With the original scope met,\nfuture versions now focus on enhancements on top of the original work, as well as perpetual support into the future.\n\n\n## \u260e\ufe0f Contact\n\n- **Discord:** [Support Server or](https://discord.gg/94c45XagEH) @CG360\n- **GitHub:** [/squeeglii](https://github.com/squeeglii)\n\n\n## \ud83d\udcdc Credits:\n\nSee [ATTRIBUTIONS.md](/ATTRIBUTIONS.md) for credits with attached licenses, such as for sounds and code.\nThere are some smaller credits also found on [the original Forge repository!](https://github.com/yyon/grapplemod/)\nwhich have been omitted here.\n\n### Technical Contributions\n\n- **Original Mod** - Yyon\n- **Textures** - Mayesnake\n- **Forge 1.18+** - Nyfaria\n- **Fabric/Quilt 1.18.2+** - CG360\n\n### Translations\n\n- **Russian** - Blueberryy\n- **French** - Neerwan\n- **Brazilian Portuguese** - Eufranio\n\n\n\n\n--- \n\n# Contributing\n\nPull Requests and Issues are always welcome! Try to stick to templates where available but deviate if some components\ndon't apply. Detail is important when debugging an issue or trying to implement a new system however so prioritise\nthat!\n\nThanks for any help in advance! :) -- I keep an eye out for Issues and PRs fairly regularly.\n", + "body_url": null, + "published": "2023-01-31T20:14:03.088565Z", + "updated": "2024-04-11T18:36:55.005343Z", + "approved": "2023-01-31T23:24:19.983701Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "GPL-3.0-only", + "name": "GNU General Public License v3.0 only", + "url": null + }, + "downloads": 85911, + "followers": 200, + "categories": [ + "adventure", + "equipment", + "transportation" + ], + "additional_categories": [ + "game-mechanics", + "technology", + "utility" + ], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "81imr9xt", + "gRWmdvYi", + "vlTSfOb7", + "jU8HX4xs", + "b0f3DjH9", + "W6qOowji", + "hCM8GFKF", + "vx3oANWA", + "9pNyxgqP", + "bQeyzMZD", + "IO00h8S8", + "CaGRczWJ", + "otJf5CZE", + "4jhOSRMT", + "AiLB2UHa", + "EdKFI1Ou", + "GeAu8lj6", + "zLppgv1R", + "VHGNAncT", + "75UiTn6Y", + "Zd2U69mW", + "oLKGXLm3", + "Xbsq80cZ", + "A9mDZad2", + "Fc0QaDU9", + "yMEfJZyV", + "qyUBAWIF", + "fxknkOZr", + "OfeixF2X", + "cVw6majO", + "V3Z75EG8", + "S1qg9J1s", + "A6VKCyyT", + "hoQ8bPO5", + "r9nj2grN", + "V2lmPZP9", + "jVjsFtrx" + ], + "icon_url": "https://cdn.modrinth.com/data/f4hp6FTb/f1f4c69dee8a46df11d37cbe43b8f13ccb34c4ae.png", + "issues_url": "https://github.com/squeeglii/grapplemod-restitched/issues", + "source_url": "https://github.com/squeeglii/grapplemod-restitched", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/f4hp6FTb/images/6d5b0a8b60881d3e436c65633bb8f9fc987ba42b.png", + "featured": true, + "title": "Just swinging <3", + "description": null, + "created": "2023-01-31T20:18:40.084864Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/f4hp6FTb/images/fe7ca9623ffcfb49f19255769d8fc3ea01c7abc8.png", + "featured": false, + "title": "Every Item + Upgrade makes a return!", + "description": null, + "created": "2023-01-31T21:12:57.573765Z", + "ordering": 2 + }, + { + "url": "https://cdn.modrinth.com/data/f4hp6FTb/images/acba4edccee8248ed20625cff156d300c4b67b5b.png", + "featured": false, + "title": "Brought back the rope physics!", + "description": null, + "created": "2023-01-31T20:19:24.069731Z", + "ordering": 3 + } + ], + "color": 3151379, + "thread_id": "f4hp6FTb", + "monetization_status": "monetized" + }, + "Gravestones": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16", + "1.16.1", + "1.16.2", + "1.16.3", + "1.16.4", + "1.16.5", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.20", + "1.20.1" + ], + "id": "ssUbhMkL", + "slug": "gravestones", + "project_type": "mod", + "team": "ggl32fu7", + "organization": null, + "title": "Gravestones", + "description": "A gravestones mod for fabric with tons of config options, an API, and more! ", + "body": "# Gravestones\nA highly configurable, easy to use, and elegant Gravestones mod for Fabric MC. It even has an easy to use API for developers!\n\n## Screenshots\n\n![Screenshot 1](https://i.imgur.com/mOFGTal.png \"Configuration\")", + "body_url": null, + "published": "2020-10-21T22:19:51.707450Z", + "updated": "2023-06-18T07:52:45.604747Z", + "approved": "2020-10-21T22:19:51.707450Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 229491, + "followers": 204, + "categories": [ + "adventure", + "decoration", + "utility" + ], + "additional_categories": [ + "economy", + "equipment" + ], + "loaders": [ + "fabric" + ], + "versions": [ + "aYKuGUjP", + "tE7Np54Q", + "DnDEqs7j", + "LGdI5jXK", + "QB79QSK5", + "TpnSObJ7", + "it1lfLQh", + "DoolHsey", + "D1RoGXmH", + "Uw9uAQaY" + ], + "icon_url": "https://cdn.modrinth.com/data/ssUbhMkL/icon.png", + "issues_url": "https://github.com/Geometrically/Gravestones/issues", + "source_url": "https://github.com/Geometrically/Gravestones", + "wiki_url": null, + "discord_url": null, + "donation_urls": [ + { + "id": "paypal", + "platform": "Paypal", + "url": "https://modrinth.com" + }, + { + "id": "patreon", + "platform": "Patreon", + "url": "https://modrinth.com" + } + ], + "gallery": [], + "color": 7037535, + "thread_id": "ssUbhMkL", + "monetization_status": "monetized" + }, + "guardvillagers-2.0.9-1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19.2", + "1.20.1", + "1.20.4", + "1.21" + ], + "id": "59rkB3YY", + "slug": "guard-villagers-(fabricquilt)", + "project_type": "mod", + "team": "GPzLcjlp", + "organization": null, + "title": "Guard Villagers (Fabric/Quilt)", + "description": "Guards that help with village pest control", + "body": "

This is a fabric port of Guard Villagers by almightytallestred for 1.18, get the original forge version here

\n

 

\n

Are you tired of your village dying off because its golem is too lazy?

\n

Are you tired of essentially defending it all by yourself?

\n

This mod adds Guards as a solution, as well as new villager-related AI changes.

\n

 

\n\n

 

\n

Guards 

\n
\n

These spawn in villages in groups of six, equipped with either an iron sword or a crossbow. They're prepared to fight any threat to the village (possibly including you!). To make new guards, shift + right click on a nitwit or unemployed villager with a sword or crossbow.

\n

If you have hero of the village, they will gain the ability to follow and fight for you when you click the follow button, and right clicking them will open up the guard inventory, allowing you to give them armor, and swap out their weapons! For their offhand slot, you can either give them a shield, or some food. If they have a shield, they will use it to block attacks, crossbow guards with a shield won't be able to kick enemies if they're blocking. If they have food (or a potion), they will start eating or drinking if they are low on health. Clicking the patrol button will allow you to set patrol points for guards, melee guards will walk around the point while ranged guards will snipe enemies and stand still on their point.

\n

You will only be able to gain access to their inventory if you have hero of the village. 

\n

\"\"

\n

 

\n
\n

AI Changes

\n
\n

Witches attack villagers. *true by default 

\n

\"\"

\n

In raids, illagers kill any animal they see. *false by default \"\"

\n

Villagers and Illagers are scared of polar bears. *true by default 

\n

\"\"Clerics heal low-health guards, villagers, and players with Hero of the Village using regeneration potions, and smiths repair iron golems with ingots.\"\"

\n
\n

 

\n

 

\n

 

", + "body_url": null, + "published": "2023-07-26T15:14:49.274390Z", + "updated": "2024-06-22T07:25:32.745879Z", + "approved": "2023-07-28T04:11:43.510624Z", + "queued": "2023-07-26T15:20:32.265207Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 508054, + "followers": 305, + "categories": [ + "equipment", + "mobs", + "utility" + ], + "additional_categories": [ + "worldgen" + ], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "iLtCWap8", + "Ssye56cQ", + "UrrJvzbo", + "cgcChDzn", + "Kzz6E5Ap", + "50QCPkoV", + "86pJMC8z", + "KHaX9b0a", + "agfIZx8L", + "AFCrmgZ8", + "6q8vX11Q" + ], + "icon_url": "https://cdn.modrinth.com/data/59rkB3YY/de6a0dca1d4d1f1e1c97409b51683cc7348797a6.png", + "issues_url": null, + "source_url": null, + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": 4008228, + "thread_id": "59rkB3YY", + "monetization_status": "monetized" + }, + "handcrafted-fabric-1.20.1-3.0.6": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.21", + "1.21.1" + ], + "id": "pJmCFF0p", + "slug": "handcrafted", + "project_type": "mod", + "team": "Xoedlg0p", + "organization": "N42M457t", + "title": "Handcrafted", + "description": "Make your house a home!", + "body": "
\n\n![Handcrafted](https://cdn.modrinth.com/data/pJmCFF0p/e89faefc522d601db2a5fd70136f37ef7ce18569.png)\n\n---\n\n[![Made by Terrarium](https://images.teamresourceful.com/u/I80VLV.svg)](https://discord.terrarium.earth)\n[![Requires Resourceful Lib](https://images.teamresourceful.com/u/jUWHY2.svg)](https://modrinth.com/mod/resourceful-lib)\n---\n### \ud83d\udcd6About \ud83d\udcd6\n\n
\n
\n\nFrom the creators of Chipped, we now present Handcrafted! A mod to make your house into your\nhome! :D\n\nAre you looking for a fantasy, steampunk or medieval feel? Or do you want to stick to a more vanilla decor? Look no\nfurther! We've created over 250 furniture pieces for you to choose from. Be it chairs, tables, benches or desks;\nwe got it all packaged neatly into a single mod. This mod will provide all the furniture you could ever need to make\nyour blocky house a home!\n\n---\n
\n \n### Developers:\nAlex Nijjar, CodexAdrian, MsRandom, ThatGravyBoat\n### Artists:\nKekie6, Facu, Marc-IceBlade\n\n\n---\n\n### Socials\n\n[![youtube-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/social/youtube-plural_vector.svg)](https://youtube.terrarium.earth)\n[![twitch-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/social/twitch-plural_vector.svg)](https://www.twitch.tv/terrariumearth)\n[![twitter-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/social/twitter-plural_vector.svg)](https://twitter.terrarium.earth)\n[![kofi-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/donate/kofi-plural_vector.svg)](https://kofi.terrarium.earth)\n[![discord-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/social/discord-plural_vector.svg)](https://discord.terrarium.earth)\n[![modrinth](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/available/modrinth_vector.svg)](https://modrinth.com/organization/terrarium)\n[![curseforge](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/available/curseforge_vector.svg)](https://www.curseforge.com/members/terrariumearth/projects)\n---\n\n### Check out our other projects\n\n\"Handcrafted\"\n\"Chipped\"\n\"Ad\n\"Tempad\"\n\"Colorful\n\n\"Lil\n\"Vitalize\"\n\"Spirit\"\n\"Reaper\"\n\"Experience\n
\n", + "body_url": null, + "published": "2022-12-17T04:16:15.143741Z", + "updated": "2024-08-11T05:41:10.394507Z", + "approved": "2022-12-17T21:32:43.746914Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LicenseRef-Terrarium-Licence", + "name": "", + "url": "https://github.com/terrarium-earth/Handcrafted/blob/1.19.2/LICENSE" + }, + "downloads": 1438472, + "followers": 1003, + "categories": [ + "decoration", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "SvQXAiw0", + "qVMD8016", + "ObyTbz5Y", + "LJgzvQtK", + "gbgfSnEl", + "L6NU016l", + "TJsqhWdJ", + "1T5CxgQS", + "CIBw8EwL", + "3sAF1sOy", + "dAMY6HS6", + "6BibizXy", + "TibVWO3A", + "D9pMWV3t", + "v0XitsjG", + "LRGknhXL", + "ZGq9NQIR", + "6OMQdw1o", + "m0WP1gSr", + "SOwrisFm", + "6b44IXap", + "vubSuo15", + "YQuxr8hD", + "SoA6eBqA", + "MPhYzWOS", + "M0X2ttRF", + "GAYpqdwW", + "3zvGd4JS", + "ZchWqhla", + "P3JtKryj", + "cW2OAnzC", + "ElUtugfP", + "U8hBYpzW", + "ki3VtzBN", + "M4OyV9RU", + "6GmqUG4E", + "pqv17yvf", + "Rvi0vF2O", + "shCmJ2Kt", + "naTDwrvS", + "N7wZwOFy", + "NRw0CDAc", + "zwBvws3E", + "K4jSQsxb", + "mrzuFu6N", + "rdUpc8bF", + "W2C0E2KC", + "f7tGbQaE", + "wcwzTL8u", + "yeyZ6DeE" + ], + "icon_url": "https://cdn.modrinth.com/data/pJmCFF0p/e89faefc522d601db2a5fd70136f37ef7ce18569.png", + "issues_url": "https://github.com/terrarium-earth/Handcrafted/issues", + "source_url": "https://github.com/terrarium-earth/Handcrafted", + "wiki_url": null, + "discord_url": "https://discord.terrarium.earth", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/pJmCFF0p/images/5c27ab93854934bf4b1925ec5463d12a18d4ff1f.png", + "featured": false, + "title": "Castle", + "description": "creds: kekie6", + "created": "2022-12-21T00:00:14.337864Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/pJmCFF0p/images/64929678ab4399804429a66a6d1007b654416e5e.png", + "featured": false, + "title": "Bedroom", + "description": "creds: championhestu", + "created": "2022-12-17T20:24:27.236888Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/pJmCFF0p/images/68f1437fc9e5203c1768b6473b337269fec767c4.png", + "featured": false, + "title": "Cozy Home!", + "description": "creds: squishy", + "created": "2022-12-17T20:24:26.014436Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/pJmCFF0p/images/9833fbfd94ff08f757ad046dac1cdd9757dec3a0.png", + "featured": false, + "title": "Doggo", + "description": "creds: kekie6", + "created": "2022-12-21T00:00:11.291052Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/pJmCFF0p/images/bc7121e442b03492985bf68886873beb6d1901a8.png", + "featured": false, + "title": "Living Room", + "description": "creds: aPurpleShrimp", + "created": "2022-12-17T20:24:29.475240Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/pJmCFF0p/images/df88483c90907f378fc3164ce4aed0c35e8ec812.png", + "featured": false, + "title": "Kitchen", + "description": "creds: championhestu", + "created": "2022-12-17T20:24:28.306458Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/pJmCFF0p/images/70b0e5ec2935778ad5bd4daf4f0ed498ffcdfeff.png", + "featured": false, + "title": "Bamboo", + "description": "creds: sircolor", + "created": "2023-06-11T19:19:19.656402Z", + "ordering": 7 + }, + { + "url": "https://cdn.modrinth.com/data/pJmCFF0p/images/9ecc28cef3b792236c383517d4fe0c4f02bcd768.png", + "featured": false, + "title": "Cherry Bedroom", + "description": "creds: sircolor", + "created": "2023-06-11T19:19:42.593984Z", + "ordering": 8 + }, + { + "url": "https://cdn.modrinth.com/data/pJmCFF0p/images/e0e54f71028553fbbec0d50543766d7b91c36c75.png", + "featured": true, + "title": "Cherry Bedroom", + "description": "creds: moony", + "created": "2023-06-11T19:21:11.156710Z", + "ordering": 9 + }, + { + "url": "https://cdn.modrinth.com/data/pJmCFF0p/images/8c018d5c19a36986eff834abc024de00646005b9.png", + "featured": false, + "title": "Cherry House", + "description": "creds: moony", + "created": "2023-06-11T19:22:47.081622Z", + "ordering": 10 + } + ], + "color": 4666140, + "thread_id": "pJmCFF0p", + "monetization_status": "monetized" + }, + "Heracles": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20", + "1.20.1" + ], + "id": "lo90fZoB", + "slug": "heracles", + "project_type": "mod", + "team": "t5ZlBlgR", + "organization": "N42M457t", + "title": "Heracles", + "description": "A tree-style questing mod, allowing pack makers to make and include completable quests for their players", + "body": "## Heracles\n\n[![Made by Terrarium](https://images.teamresourceful.com/u/I80VLV.svg)](https://discord.terrarium.earth)\n[![Modrinth Partnership](https://images.teamresourceful.com/u/Bi4Cuo.svg)](https://discord.gg/modrinth-734077874708938864)\n[![Requires Resourceful Lib](https://images.teamresourceful.com/u/jUWHY2.svg)](https://modrinth.com/mod/resourceful-lib)\n[![Supports Argonauts](https://images.teamresourceful.com/u/6toRNT.svg)](https://modrinth.com/mod/argonauts)\n\n### \ud83d\udcd6 About \ud83d\udcd6\n\nNamed after the hero Heracles who reclaimed his spot in Olympus by completing\n12 quests, Heracles is a comprehensive questing mod that allows pack makers\nto create tree style quests that can be distributed via the config folder\nfor users to play and complete.\n\n### Quest Tree\n![Quest tree](https://cdn.modrinth.com/data/lo90fZoB/images/1853273143a28a37a664ba7637096a8bae6ad149.png)\n\n### Quest descriptions\n![Quest description](https://cdn.modrinth.com/data/lo90fZoB/images/9d8cf79e75b3324b1b390527d09cca0c6581a60a.png)\n\n### Quest tasks\n![Quest tasks](https://cdn.modrinth.com/data/lo90fZoB/images/0f85c8541d69808ee85bf514f7909a11a5e2d8d5.png)\n\n---\n
\n\n### Socials\n\n[![youtube-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/social/youtube-plural_vector.svg)](https://youtube.terrarium.earth)\n[![twitch-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/social/twitch-plural_vector.svg)](https://www.twitch.tv/terrariumearth)\n[![twitter-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/social/twitter-plural_vector.svg)](https://twitter.terrarium.earth)\n[![kofi-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/donate/kofi-plural_vector.svg)](https://kofi.terrarium.earth)\n[![discord-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/social/discord-plural_vector.svg)](https://discord.terrarium.earth)\n[![modrinth](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/available/modrinth_vector.svg)](https://modrinth.com/user/Terrarium)\n[![curseforge](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/available/curseforge_vector.svg)](https://www.curseforge.com/members/terrariumearth/projects)\n\n---\n\n### Check Out our Other Projects\n\n\"Handcrafted\"\n\"Chipped\"\n\"Ad\n\"Tempad\"\n\"Colorful\n\n\"Lil\n\"Vitalize\"\n\"Spirit\"\n\"Reaper\"\n\"Experience\n
", + "body_url": null, + "published": "2023-04-03T14:52:59.247435Z", + "updated": "2024-06-07T19:09:26.494151Z", + "approved": "2023-06-10T23:40:42.449503Z", + "queued": "2023-06-10T22:47:07.036018Z", + "status": "approved", + "requested_status": "unlisted", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 420470, + "followers": 213, + "categories": [ + "adventure", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "5jkZmVDv", + "VLtolKMC", + "5H0nvQsn", + "CBIb2kpS", + "gt5tf1XL", + "YZI6vPta", + "G1CWGYEm", + "fAbq55C2", + "JPFzWPXx", + "Pmcq3tv6", + "2uxrMqv5", + "a8LXzDtV", + "IrcdFzq0", + "XFtTyYCL", + "H7UX723U", + "Cky5TTeb", + "twGfrpGe", + "RwpZ2V4a", + "tI079rtP", + "xbu1uKaP", + "EIB5x30f", + "bxTeA2rh", + "VvRew3uj", + "I9MyuVK3", + "OwQr8mq4", + "FYw6AtH4", + "zm5LWfwy", + "2cxcYOjO", + "3vDa7732", + "LrenCGC9", + "bDyT030F", + "nB9tFKSl", + "7bYShbuw", + "TaP0WLhY", + "YQKRFt0D", + "91tIOVPy", + "2NIUNiNZ", + "qdE4Jp1W", + "2NX3Tp47", + "BgK36Jkb", + "qPL66hoz", + "CcJk2Nz6", + "NcH63TrF", + "jpWS7kBz", + "jKhNeEIk", + "3aABskCg", + "XFqquTji", + "8zxzPvyF", + "GXxKjxGE", + "UVyQoEfQ", + "PDQvbfPK", + "9ZUSHiZa", + "Iw91uuFK" + ], + "icon_url": "https://cdn.modrinth.com/data/lo90fZoB/81b2b095d5570e29f29604c6c5c69eaf9f4033bc.png", + "issues_url": "https://github.com/terrarium-earth/Heracles/issues", + "source_url": "https://github.com/terrarium-earth/Heracles", + "wiki_url": null, + "discord_url": "https://discord.terrarium.earth", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/lo90fZoB/images/0f85c8541d69808ee85bf514f7909a11a5e2d8d5.png", + "featured": false, + "title": "Quest tasks", + "description": "Tasks will show up in the task screen, showing which tasks a quest has and how complete they are", + "created": "2023-06-10T22:42:35.627023Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/lo90fZoB/images/1853273143a28a37a664ba7637096a8bae6ad149.png", + "featured": false, + "title": "Quest trees", + "description": "Quests can be placed in groups, with dependencies that unlock quests one after the other as they are completed", + "created": "2023-06-10T22:35:49.305976Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/lo90fZoB/images/9d8cf79e75b3324b1b390527d09cca0c6581a60a.png", + "featured": false, + "title": "Quest descriptions", + "description": "Quest descriptions can be highly modifiable, allowing you to customize quests to your hearts content, even allowing you to embed the tasks and rewards wherever you want in the description", + "created": "2023-06-10T22:29:39.594409Z", + "ordering": 0 + } + ], + "color": 3414574, + "thread_id": "lo90fZoB", + "monetization_status": "monetized" + }, + "Iceberg-1.20.1-fabric-1.1.18": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.16.5", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "5faXoLqX", + "slug": "iceberg", + "project_type": "mod", + "team": "fGvFvA3S", + "organization": null, + "title": "Iceberg", + "description": "A modding library that contains new events, helpers, and utilities to make modder's lives easier.", + "body": "

This mod is a library for other mods, it doesn't do anything by itself.

\n

This library contains new events, helpers, and utilities to make modder's lives easier.  Usable on both client and server side, for Forge mods.

\n

This was made to help make my own mods more easily, and so I will only be able to provide limited support if you are using it for your own purposes.

\n

  

\n

You are free to use this library in the development of your mods or in modpacks!

\n

 

\n

\n

Problems, feature request, something else?  Join us on Discord!

", + "body_url": null, + "published": "2022-11-15T06:48:55.303423Z", + "updated": "2024-08-13T17:04:53.118191Z", + "approved": "2022-11-15T12:14:27.734514Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "CC-BY-NC-ND-4.0", + "name": "Creative Commons Attribution Non Commercial No Derivatives 4.0 International", + "url": null + }, + "downloads": 3397504, + "followers": 946, + "categories": [ + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "WMylSLYE", + "qC0waeNX", + "bhT2LnaE", + "AyFtfJ8s", + "FdzVLDky", + "UJsiu2dC", + "wog3r1ZM", + "VoOBBJRg", + "9bBGjbU5", + "9KXcgYGq", + "puRtyl3V", + "3TiGuxtb", + "3lLfxs9z", + "cmURUo50", + "nE38KiNU", + "cqJP89n5", + "sOqIWJ9P", + "hri3ka9m", + "iP294YId", + "Pp4dRoJ9", + "SLE7PvYD", + "D2tqnVgT", + "ZU8xMA8r", + "Ozakzb1f", + "hkA16Cxw", + "ByWltyMl", + "uu7sqQDO", + "snRtsUWd", + "HV5U2z6b", + "PV85ACAe", + "ZioCfzuX", + "iIPGBAEi", + "boNnPeth", + "on8rI52b", + "bzpNVY0n", + "xs03Scvd", + "KOhh2r9Q", + "mHSJEvNU", + "O29o2aJ6", + "BBGKdAYE", + "lh9LKSGI", + "xv4REAKm", + "a0UaxBwg", + "4QBRMk8G", + "s6y2ff9n", + "XZHGrhCM", + "PgPTzfzl", + "JZY5iUsi", + "cuqTedJZ", + "ZnzQX7R1", + "C9BWI2MC" + ], + "icon_url": "https://cdn.modrinth.com/data/5faXoLqX/fadafde0faf68b37947c8df97ba4e5a6725f4b6a.png", + "issues_url": "https://github.com/AHilyard/Iceberg/issues", + "source_url": "https://github.com/AHilyard/Iceberg/", + "wiki_url": "https://github.com/AHilyard/Iceberg/wiki/Item-Selectors-Documentation", + "discord_url": "https://discord.gg/S5NQjbXPnb", + "donation_urls": [ + { + "id": "paypal", + "platform": "Paypal", + "url": "https://www.paypal.com/donate/?business=NYKUAV883JKA2&no_recurring=0&item_name=Thank+you+for+considering+a+donation.+It+helps+to+support+me+by+allowing+me+to+spend+more+time+making+mods+and+games.¤cy_code=USD" + } + ], + "gallery": [], + "color": 5018852, + "thread_id": "5faXoLqX", + "monetization_status": "monetized" + }, + "ImmediatelyFast-Fabric-1.2.18+1.20.4": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "5ZwdcRci", + "slug": "immediatelyfast", + "project_type": "mod", + "team": "wkdnKsNZ", + "organization": null, + "title": "ImmediatelyFast", + "description": "Speed up immediate mode rendering in Minecraft", + "body": "
\n

ImmediatelyFast

\n \n \n \n \n\n
\n\n \n \n\n

ImmediatelyFast is an open source Minecraft mod which improves the immediate mode rendering performance of the client.\n
It is designed to be lightweight and compatible with other mods.

\n
\n\n## Optimizations\nImmediatelyFast generally optimizes all immediate mode rendering by using a custom buffer implementation which batches\ndraw calls and uploads data to the GPU in a more efficient way. \nThe following parts of the immediate mode rendering code are optimized:\n\n- Entities\n- Block entities\n- Particles\n- Text rendering\n- GUI/HUD\n- Immediate mode rendering of other mods\n\nIt also features targeted optimizations where vanilla rendering code is being changed in order to run faster. \nThe following parts of the rendering code are optimized with a more efficient implementation:\n\n- Map rendering\n- HUD rendering\n- Text rendering\n\n## Performance\nHere are some performance comparisons of areas the mod optimizes particularly well:\n\nIf other mods are listed in the table this means that this mod also optimizes that part of the game.\n\nTest Hardware: Ryzen 5 1600, 32GB DDR4, GTX 1060\n\nFPS Numbers were taken from external tools (in this case MSI Afterburner) and averaged over a couple of seconds. \nIf you decide to test this yourself keep in mind that ImmediatelyFast can only improve FPS in a scenario where your CPU\nis the bottleneck (Most likely the case if your GPU isn't ancient or you use very heavy shaders).\nSlower CPUs will benefit more from this mod than really fast CPUs.\n\n### Entity Rendering\nGenerally FPS should be around **2x higher** on busy servers. [Tested using IF 1.1.7 on 1.19.3]\n\n_Tested on a spigot server with 1000 cows in a 3x3 box on screen._\n\n| Other mods | Without ImmediatelyFast | With ImmediatelyFast | Improvement |\n|-----------------|-------------------------|----------------------|-------------|\n| None | 16 FPS | 60 FPS | 3.75x |\n| Sodium | 21 FPS | 82 FPS | 3.90x |\n| Iris and Sodium | 60 FPS | 76 FPS | 1.27x |\n\n### Map Rendering\nGenerally FPS should be around **5x higher** when there are many maps on screen. [Tested using IF 1.1.1 on 1.19.3]\n\n_Tested on a fabric server with the [Image2Map](https://modrinth.com/mod/image2map) mod and around 930 maps on screen._\n\n| Other mods | Without ImmediatelyFast | With ImmediatelyFast | Improvement |\n|-----------------|-------------------------|----------------------|-------------|\n| None | 50 FPS | 310 FPS | 6.20x |\n| Sodium | 47 FPS | 320 FPS | 6.81x |\n\n### HUD Rendering\nGenerally FPS should be around **40% higher** in almost all scenarios. [Tested using IF 1.1.7 on 1.19.3]\n\n_Tested on a spigot server with different HUD elements on screen (Scoreboard, Potion effect overlay, Bossbars, Filled Chat, Extra hearts, Full Hotbar)._\n\n| Other mods | Without ImmediatelyFast | With ImmediatelyFast | Improvement |\n|---------------------|-------------------------|----------------------|-------------|\n| None | 250 FPS | 380 FPS | 1.52x |\n| Sodium | 335 FPS | 630 FPS | 1.88x |\n| Exordium and Sodium | 740 FPS | 840 FPS | 1.14x |\n\n### Text Rendering\nGenerally FPS should be around **2x higher** when there are many signs or holograms around you. [Tested using IF 1.1.7 on 1.19.3]\n\n_Tested on a spigot server with 200 signs (Filled with text) on screen._\n\n| Other mods | Without ImmediatelyFast | With ImmediatelyFast | Improvement |\n|-----------------|-------------------------|----------------------|-------------|\n| None | 70 FPS | 125 FPS | 1.79x |\n| Sodium | 110 FPS | 300 FPS | 2.73x |\n\n### Block-Entity Rendering\nGenerally FPS should be around **20% higher** when there are many block entities around you. [Tested using IF 1.1.7 on 1.19.3]\n\n_Tested on a spigot server with 400 chests on screen._\n\n| Other mods | Without ImmediatelyFast | With ImmediatelyFast | Improvement |\n|-----------------|-------------------------|----------------------|-------------|\n| None | 170 FPS | 205 FPS | 1.20x |\n| Sodium | 315 FPS | 410 FPS | 1.30x |\n\n## Compatibility\nImmediatelyFast is structured to interfere with mods as little as possible.\nIt should work fine with most if not all mods and modpacks.\n\nKnown incompatibilities:\n\n- OptiFabric / OptiFine\n- Most closed source \"clients\" like LunarClient and LabyMod\n\nIf you encounter any issues, please report them on the [Issue Tracker](https://github.com/RaphiMC/ImmediatelyFast/issues).\n\n## Developer API\nYou can read the latest version of the API docs [here](https://github.com/RaphiMC/ImmediatelyFast/blob/1.20/API_DOCS.md).\n\n## Partners\nYourKit supports open source projects with innovative and intelligent tools\nfor monitoring and profiling Java and .NET applications.\nYourKit is the creator of [YourKit Java Profiler](https://www.yourkit.com/java/profiler/),\n[YourKit .NET Profiler](https://www.yourkit.com/.net/profiler/),\nand [YourKit YouMonitor](https://www.yourkit.com/youmonitor/).\n\n[![YourKit](https://www.yourkit.com/images/yklogo.png)](https://www.yourkit.com)\n\n---\n\nKinetic Hosting offers extremely affordable deals on servers with very good hardware! If you'd like to cash in on the good deals click the image below and use code **RaphiMC** at checkout for 15% off your first month!\n\n[![Kinetic Hosting](https://i.imgur.com/jPflkGt.png)](https://billing.kinetichosting.net/aff.php?aff=47)\n\nCredits to [sydist](https://github.com/sydist) for making the logo!\n", + "body_url": null, + "published": "2022-10-01T16:19:12.500476Z", + "updated": "2024-08-10T22:55:50.573106Z", + "approved": "2022-10-01T16:26:11.439503Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 8091605, + "followers": 3363, + "categories": [ + "optimization" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "ybGjtkj1", + "R8MXsvBe", + "56ly78y2", + "MXrToyOy", + "HjPptbpI", + "Lj7lpgeu", + "IihbNw9x", + "an4lUoZ0", + "1oWTStwD", + "f2Av82pv", + "slaIcF1K", + "Xc7f8wNQ", + "FcqoS76s", + "MK5xuarZ", + "vjevJCO1", + "IYnEX1ly", + "sTQ5rCbF", + "Ly9dRsAI", + "zkmYKBLC", + "zImGOGqD", + "A6GCxAD1", + "vA8NWTKD", + "VUTuPIlE", + "UDnjDzur", + "mo9q5fMn", + "M7dmS1xe", + "VoFPEhPL", + "EHbdx1pF", + "aWcTiEn8", + "K3zjbY4P", + "d6gX5lox", + "YVmLXIsi", + "q6hvGX5B", + "CdpFa9ts", + "izX4Zjnu", + "IpEJi0ih", + "D73h6MNI", + "4yVqQKQO", + "fnLm3B23", + "8IFFeKYy", + "fZkbywLp", + "Jci0UG9F", + "1OT6gCmX", + "cpgGVZDs", + "eiqdESrg", + "4IDo27OL", + "LEmCbzHA", + "aptjkgGB", + "15Hwli83", + "24BUZiRe", + "KjMKYa1K", + "2cEsJ6Ix", + "5arZz0qz", + "mGqxsY9X", + "VaRB1Uaj", + "m8P58epq", + "pQRqrmzs", + "FtHQIJZd", + "i5OWJDBj", + "xFmHwVvA", + "CG88v2FZ", + "XHrRgyGN", + "d4HBt40d", + "1BSUFszc", + "kQq0Qobv", + "h38wJYho", + "9RDk8aOc", + "4Y4VXGXE", + "fZa7YlyA", + "gAAnfzrT", + "LJYd35mB", + "hgQwRPhD", + "yhuSOfHc", + "Hh5as8hY", + "EANGsMsP", + "Tf6O7B9h", + "lPyP6Kcf", + "zKKDqwCd", + "nSd5x28T", + "xSKg5aqE", + "txcO4lNF", + "tpfQ6Vm5", + "I5zOy70w", + "ZhW5WW22", + "ADkpsbyz", + "9DJ47QhP", + "bHjLCRu6", + "dTZfskbw", + "YniADsYA", + "NJ17fqEK", + "BwkXA4tK", + "A7g0Ha7U", + "cswW9vJQ", + "e8XCF1RN", + "3jiSnSnx", + "mbeaDZtb", + "CdkNJPmV", + "yPspsvFQ", + "yciHw2oP", + "bqv414X0", + "MPg7LytK", + "DBSdeovn", + "VNkQO9oa", + "Vz2ebSk4", + "3EgIBnht", + "ZGMKFbmk", + "eKcnzuDu", + "4x5lLRwI", + "nxuFR8Zx", + "kij8vKAw", + "hh8K3O8j", + "6xkpzpoh", + "zM9yMVsk", + "10hJ1wKC", + "sZaOJ6hY", + "3sz82ybY", + "2JSRDFi1", + "sbQQizAw", + "59UuNTrz", + "v2sxhCOI", + "ToyOhEyt", + "xC3SC47B", + "ezKTj0NE", + "s2nB1I8Z", + "bxOczWO3", + "FEOsWs1E", + "7DjvwG1b", + "GbH3WLI3", + "XJv24FpT", + "u2AFTh8j", + "TqFSrfXD", + "Zmg9Im8A", + "RbjZFqTz", + "cnnaUyZd", + "PApQEGE3", + "Lw7F67te", + "7Twx0B8r", + "Xj7xCxJ1", + "9HwVBmbJ", + "Z4sPylCR", + "bKXy6tWA", + "LNw8xhY1", + "cxatW0Qh", + "1ZDtilFf", + "2Ps4um76", + "8eoEPo8E", + "CdHWqPx2", + "rH9ktH6J", + "wrvAzLRZ", + "NjjMcdYf", + "Rh3MdqnM", + "lTRPaThw", + "Cq7J3qt5", + "aY5V6MjG", + "iByzP2fT", + "N1D10Unu", + "jQuacF3O", + "KIBNJ6Eg", + "yhbD6glS", + "XHrZaGCh", + "8j42F49p", + "LJDBWhHU", + "5P52J1TG", + "us6sBMnH", + "115Ubn3O", + "wXKNaUIY", + "DQelIUm0", + "5PNUSQdg", + "nASiIiZX", + "Z3V4Ooz5", + "qoAsDnt8", + "HX5WEfoR", + "7twUbHcf", + "XgQjD9fF", + "wO9OiAE5", + "fZXxgmhr", + "D5RdEm0i", + "DA0kxiSe", + "EYfMojUm", + "UBGmAH7G", + "15AO7hhI", + "hzBCNiAq", + "bNDIzPW6", + "99R9TBcr", + "FOlIrxtD", + "scqbRe6G", + "1wCtstqk", + "5P3Jndqo", + "3hcQtIB6", + "ntbcEUWv", + "RTOwYh47", + "IigNsjFB", + "9i03nYHg", + "cKYC4Ibz", + "jMIMrEow", + "ZzknynUP" + ], + "icon_url": "https://cdn.modrinth.com/data/5ZwdcRci/8335dd505094a79b4ad306935b10f724e2b76d8b.png", + "issues_url": "https://github.com/RaphiMC/ImmediatelyFast/issues", + "source_url": "https://github.com/RaphiMC/ImmediatelyFast", + "wiki_url": null, + "discord_url": "https://discord.gg/dCzT9XHEWu", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/rk_01" + } + ], + "gallery": [], + "color": 2829613, + "thread_id": "5ZwdcRci", + "monetization_status": "monetized" + }, + "immersivemc-1.5.0-beta1-1.20.1-fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.18.2", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20.1", + "1.20.2", + "1.20.4" + ], + "id": "XJ9is6vj", + "slug": "immersivemc", + "project_type": "mod", + "team": "GEO7eYvZ", + "organization": null, + "title": "ImmersiveMC", + "description": "Makes Minecraft more immersive!", + "body": "# ImmersiveMC\n\nAre you sick of in-game GUIs? Do you want to make your game immersive, whether you're in VR or not? Do you want to take Vivecraft to the next level?\n\nThen you'll love ImmersiveMC!\n\n![Non-VR User Crafting a Diamond Pickaxe](https://github.com/hammy3502/immersive-mc/raw/1.19.x/docs/ImmersiveMCNonVRCrafting.gif)\n![Non-VR User Interacting with a Chest](https://github.com/hammy3502/immersive-mc/raw/1.19.x/docs/ImmersiveMCNonVRChest.gif)\n![VR User Taking a Music Disc out of a Chest and Putting it into a Jukebox](https://github.com/hammy3502/immersive-mc/raw/1.18.x-multiloader/docs/ImmersiveVRChestAndJukebox.gif)\n![VR User Using Ranged Grab to Grab an Iron Sword from a Distance](https://github.com/hammy3502/immersive-mc/raw/1.18.x-multiloader/docs/ImmersiveVRGrab.gif)\n\n## Requirements\n\nImmersiveMC is available for Forge and Fabric/Quilt!\u00a0Make sure to download the one for your modloader and Minecraft version of choice\n\n**IMPORTANT! ImmersiveMC has a few requirements/dependencies that MUST be installed! These are:**\n- [Architectury API](https://modrinth.com/mod/architectury-api)\u00a0is required\u00a0for Minecraft versions 1.18.2 and higher.\n- [mc-vr-api](https://modrinth.com/mod/mc-vr-api)\u00a0if you're playing in VR.\n- [Forge Config API Port](https://modrinth.com/mod/forge-config-api-port) if you're playing under Fabric or NeoForge.\n- [Fabric API](https://modrinth.com/mod/fabric-api) if you're playing under Fabric.\n\n## What is ImmersiveMC?\n\nThe goal of ImmersiveMC is to make Minecraft more immersive! It most obviously does this by minimizing the amount of GUIs you need to interact with.\n\nYou can use things such as the crafting table, furnaces, and brewing stands without having to open a GUI, and even more when you're in VR! Check out all of the features that ImmersiveMC offers at the wiki linked above!\n\n## VR?\n\nThere's VR support! In fact, this mod was primarily built to make VR a better experience!\n\nYou'll need my API mod,\u00a0[mc-vr-api](https://modrinth.com/mod/mc-vr-api)\u00a0to use this in VR. With this mod installed, you'll be able to use your actual hands to place items, instead of just right clicking!\n\n## Notes\n\n- **ImmersiveMC is needed on both the server and the client if you're playing multiplayer! ImmersiveMC is\u00a0NOT\u00a0a client-side only mod!**\n\n## Need Help?\n\nCheck out [the wiki](https://immersivemcwiki.hammy275.com/)! Still need help? Come [join the Discord](https://discord.gg/gZP6xjMtgW)!\n\n## Version Support\n\nAll versions currently supported should be available from the featured versions section on the side! If there isn't a version already available there for some new Minecraft version, it should be there soon!\n\nThere are no plans to backport ImmerisveMC to older versions of Minecraft, nor are there any plans to port it to minor versions of Minecraft that have newer versions. For example, there are no plans to port ImmersiveMC to 1.19.0, as 1.19.2 already exists. Note that as of 1.19.3, what is and isn't a minor version is more ambiguous due to Mojang's new update strategy for Minecraft: Java Edition.\n\n## Discord\n\nCome\u00a0[join the ImmersiveMC Discord server](https://discord.gg/gZP6xjMtgW)\u00a0for support and announcements of ImmersiveMC updates!\n\n## Modpacks and Redistribution?\n\nFeel free to use this mod in any modpack as long as you do NOT charge for it!", + "body_url": null, + "published": "2023-04-30T21:40:53.381894Z", + "updated": "2024-05-17T04:00:51.543235Z", + "approved": "2023-05-02T21:25:19.661774Z", + "queued": "2023-04-30T21:59:50.341757Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 93709, + "followers": 138, + "categories": [ + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "89OsmJXJ", + "jfS4H9Wj", + "3Ojr2Jam", + "cRy1oM6b", + "kXUJaK8Y", + "i69MK5kl", + "qKPg8HKf", + "202E3Z97", + "NMgMQC70", + "OkSkAQ3s", + "NnNJBgca", + "OXWFKsuF", + "GAht6Ide", + "PVHBQtzc", + "ZrWfnGjk", + "6WZKSkmu", + "SpN8qg8m", + "tjanngKU", + "6zhwBMAw", + "qrcCYITF", + "WrW04FvW", + "eABoY2Tl", + "VjrA6nhf", + "QM4DtADl", + "66DBYRa8", + "jgmm8VYI", + "1x01Gqey", + "kBf1Ug0F", + "FOk3lqoI", + "lPNfKyO1", + "FkmKliCB", + "Bchcn3MG", + "RvW8bfxs", + "pQs3qebO", + "OA6BJIGb", + "q1Zgpjlm", + "9RdU9zj1", + "OkOQMZcw", + "fMBKwSSH", + "JjCLHUjo", + "A0jFLTfX", + "sLGj7pCf", + "gOR7THIo", + "dr2XyKvc", + "B6Ue64Ti", + "hQmSwLsy", + "vS5JQVdH", + "gZMYjZSa", + "KS4u6s2Y", + "BFyvHOYf", + "mJYs0GdP", + "dEMxKEhk", + "UVlwHyHh", + "Zi3eLFTy", + "DBVFHGcf", + "U1aPg4Em", + "MCaxASPU", + "OS7QK6eI", + "7XwVfuEv", + "t1yvWF7M", + "L9JORYkb", + "4S0yHMFJ", + "PrtC4432", + "WCDzIvS9", + "t9VOQIxc", + "sKyrlf6A", + "dCky2xx4", + "72UIXHBh", + "9aArUk5x", + "XQ1Qbk08", + "DQMt2KpB", + "LdXRmUAE", + "hqDFZKNI", + "hY0m4rBa", + "mawKJYPi", + "ZJ4K1sPH", + "CHSlhbhd", + "4kNaTmVI", + "nZQ8Jgxm", + "3YFDPYgn", + "WciXXnNI", + "9vTCCmNm", + "hnwvWJdF", + "Dy9SN1WR", + "PjH01NoM", + "xGWohOgx", + "8h0srrLU", + "KjFXfE2g", + "M4u3ge9B", + "o4Yo5qux", + "XnThYYvn", + "8fHrt5CZ", + "FLZgDs5m", + "AM0H7GA6", + "bWf73ezv", + "9Vt4l6vN", + "3ffIE2He", + "eBHxriYH", + "SUFMns1G", + "F9dKUctD", + "jAW9YNhI", + "1LWnTvhL", + "Nssrp6jT", + "Fc5v0cmb", + "zmIfD5DX", + "D5i0F490", + "ibM4ZHlR", + "9WuIPYts", + "dHqWuyO8", + "JddTsw6I", + "qmJ4mbeM", + "70b7V1mz", + "oZ9A2Rpf" + ], + "icon_url": "https://cdn.modrinth.com/data/XJ9is6vj/97b8bb2e88871543cc5c26c681952ffe31a279ae.png", + "issues_url": "https://github.com/hammy275/immersive-mc/issues", + "source_url": "https://github.com/hammy275/immersive-mc", + "wiki_url": "https://immersivemcwiki.hammy275.com/", + "discord_url": "https://discord.gg/gZP6xjMtgW", + "donation_urls": [], + "gallery": [], + "color": 5452843, + "thread_id": "XJ9is6vj", + "monetization_status": "monetized" + }, + "immersive_armors-1.6.1+1.20.1-fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.18.2", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20.1" + ], + "id": "eE2Db4YU", + "slug": "immersive-armors", + "project_type": "mod", + "team": "KZQRFiSD", + "organization": null, + "title": "Immersive Armors", + "description": "A lot of unique and vanilla-faithful armor sets.", + "body": "![Banner](https://cdn.modrinth.com/data/eE2Db4YU/images/9895c3b82c950bdf86555e8fc40cea126c178737.jpeg)\n\nImmersive Armors adds a bunch of Vanilla-friendly and unique armor sets to the game.\nIn contrast to boring copy and pasted armors, Immersive Armors focuses on visually enhanced armors, some with capes or custom models.\nMost of them provide exclusive effects like Berserk mode, bounceback, spikes, divine protection, and more.\nCrafting recipes are properly registered in the Vanilla recipe book. Enchantments, repairing, dyeing works as expected.\n\n![Armor](https://cdn.modrinth.com/data/eE2Db4YU/images/ae575ad2d73ce5c92d2938f56bcbb433d1b88ff8.png)\n\n# Translations\nImmersive armors is translated in a lot of languages via machine translation,\nbut since the quality is often quite bad you are welcome to join the translation team here:\nhttps://crowdin.com/project/immersive-armors\nFeel free to down vote bad ones and submit yours.\n\n![Armor](https://cdn.modrinth.com/data/eE2Db4YU/images/8ee925197d945aa3953a9c9ab5f9a33646a966ae.png)", + "body_url": null, + "published": "2022-11-18T18:45:45.835068Z", + "updated": "2023-08-02T15:46:52.890620Z", + "approved": "2022-11-18T22:04:09.047695Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "GPL-3.0-only", + "name": "GNU General Public License v3.0 only", + "url": null + }, + "downloads": 864331, + "followers": 579, + "categories": [ + "equipment" + ], + "additional_categories": [ + "adventure", + "technology", + "utility" + ], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "8zc3zEFW", + "1PcCmYLz", + "Fnk0EJwr", + "5uiUnvye", + "Yn2CAOij", + "1U3DkDVr", + "VBk7S2bX", + "Q1g8JJHw", + "NheGToLD", + "Pf671XJn", + "86lniCMA", + "POktemQL", + "8AvINxSe", + "puIgSf0Q", + "p4HOkt75", + "FRLk2Lkw", + "ItFDHfOh", + "nArYo9sW", + "iDMhZCMm", + "w61PUaAX", + "AlYb7jho", + "dAVrV26p", + "XSa0AGrb", + "x1pccFdD", + "dJFvp5Wg", + "wBiGtevJ", + "sXVjEWet", + "4s4bYRc1", + "gTwv9hmK", + "oCP9oZik", + "tvRKy6uB", + "gy3647YQ", + "llUK5UYa", + "hHnnvpr6", + "ZznTwDbG", + "T62TvUwh", + "bPXk0QuM", + "jsxq6CbE", + "JqkaFvnt", + "NuQuRX6P", + "MqJ5KT5k", + "bD6ogyqk", + "NMMsoxx6", + "XnHpnpHJ", + "rHmDsz9m", + "NjYog86R", + "rv6WHkIG", + "rtwSKTmr", + "etf2tkKo", + "ncEyML1F", + "1iL7L4Cx", + "Waf0D48D", + "g70ZMcU2", + "xETsRqxv", + "MIbWIfzI" + ], + "icon_url": "https://cdn.modrinth.com/data/eE2Db4YU/2704a877d726b9689d1edfa96f85725e97b4d4f0.jpeg", + "issues_url": "https://github.com/Luke100000/ImmersiveArmors/issues", + "source_url": "https://github.com/Luke100000/ImmersiveArmors", + "wiki_url": null, + "discord_url": "https://discord.gg/agxcvAdj2a", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/conczin" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/eE2Db4YU/images/0955c6753e63a512655caca3868aad2919f456e4.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-18T22:19:21.627614Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/eE2Db4YU/images/34fd0bfacdd42c10f8b9d7ad25838b58f4604ab3.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-18T22:19:33.229141Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/eE2Db4YU/images/8ee925197d945aa3953a9c9ab5f9a33646a966ae.png", + "featured": true, + "title": null, + "description": null, + "created": "2022-11-18T22:18:59.782530Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/eE2Db4YU/images/9895c3b82c950bdf86555e8fc40cea126c178737.jpeg", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-18T22:15:54.443534Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/eE2Db4YU/images/ae575ad2d73ce5c92d2938f56bcbb433d1b88ff8.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-18T22:18:18.444699Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/eE2Db4YU/images/deafe1fd601b0983616e8bd301899aae38e037a3.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-18T22:18:39.476391Z", + "ordering": 0 + } + ], + "color": 15773804, + "thread_id": "eE2Db4YU", + "monetization_status": "monetized" + }, + "imst-2.1.0": { + "client_side": "optional", + "server_side": "required", + "game_versions": [ + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "CVBAErky", + "slug": "immersive-structures", + "project_type": "mod", + "team": "hJrwdhvG", + "organization": null, + "title": "Immersive structures", + "description": "Additional structure packs", + "body": "# **Welcome to Immersive Structure!**\n[![Discord Badge](https://img.shields.io/discord/894248275841003542?color=blue&logo=discord \"Join our Discord Server\")](https://discord.gg/JzYEw7PxQv)\n[![GitHub Badge](https://img.shields.io/appveyor/build/ChoiceTheorem/ChoiceTheorem-s-overhauled-village?color=black&logo=github)](https://github.com/ChoiceTheorem/ChoiceTheorem-s-overhauled-village)\nThe Youtube channel is [here](\"https://www.youtube.com/channel/UCUSv0t-aWToQkpP5eonHmlA)\n![Twitter Follow](https://img.shields.io/twitter/follow/ChoiceTheorem?style=social)\n![](https://img.shields.io/badge/environment-server-orangered?style=flat-square)\n[![](https://www.bisecthosting.com/partners/custom-banners/fa0fa4a0-0318-4aef-b48f-7f9efd845b70.webp)](https://bisecthosting.com/CT)\n## **Description**\nThis mod adds various new structures to Minecraft's overworld. The final goal is to add more structures that perfectly fit Minecraft worlds. This mod adds multiple buildings that suit the ambience and aesthetics of that biome. This pack will add around 30 unique structures to the game by completion.\nThere will be no backporting beyond 1.19 for the mod version and 1.18.2 for the datapack version.\n\n
FAQs\nThese are just some of the most asked questions I've had from people, but if you have any more, please leave a comment below and I'll try to help you as best I can.\n\n**1. Is it safe to update Immersive structures to a newer version?**\nYes. If any serious problems arise because of that, let me know.\n\n**2. Is it safe to add Immersive structures to an already existing world?**\nYep. Just note that the new structures will only spawn in newly generated chunks.\n\n**3. Is this mod for Forge or Fabric/Quilt?**\nAll of them. I have a universal version for three mod loaders.\n\n**4. How can I locate the new structures?**\nFor 1.18.2: /locate imst:[structure_from_list]
For 1.19+: /locate structure imst:[structure_from_list]\n\n**5. Does Immersive structures modify existing vanilla structures?**\nNo\n\n**6. How can I report bugs/issues/suggestions?**\nPlease go to my GitHub repo and make an issue there. A discord message will do.\n\n**7. Can I include Immersive structures in my modpack?**\nSure, but make sure to give credit and a link to our page.\n\n**8. Can I have Immersive structures for 1.x.x, please?**\nSuppose it's lower than 1.19, no. Don't ask this question ever again. The technical limit is too high here.\n\n**10. Can I give Choicetheorem any kind of commission or support?**\nI can't take any commissions or monetary support due to a lack of time and mean to receive payments.\n\n**11. Can I use it on Aternos or any 3rd party downloads?**\nYes, but you can download it via Modrinth, not Curseforge.\n\n**12. Is this server-side or client-side mod?**\nImmersive Structures is a server-side mod.\n
\n\n
Images\nSome fantastic footage from the mod.\nAll pictures are taken with complementary shaders or complementary reimagined shaders.\n\n![](https://media.forgecdn.net/attachments/473/586/2022-06-26_21.png)\n![](https://media.forgecdn.net/attachments/473/584/2022-06-21_12.png)\n
\n\n## **Credits**\n+ Vichy0623 for codesigning the builds

\n\n
Compatible mods\n\n+ Most world generation mods like Terralith, Oh Biome you'll go, Biomes O plenty.\n+ Various structure mods like Town&Tower and Repurposed structures.\n+ Any other structure packs by ChoiceTheorem like ChoiceTheorem's overhauled village.\n
", + "body_url": null, + "published": "2022-07-09T15:48:22.443878Z", + "updated": "2024-07-28T08:50:19.206697Z", + "approved": "2022-07-09T15:48:22.443878Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "CC-BY-NC-SA-4.0", + "name": "Creative Commons Attribution Non Commercial Share Alike 4.0 International", + "url": null + }, + "downloads": 208758, + "followers": 382, + "categories": [ + "adventure", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "datapack", + "fabric", + "forge", + "quilt" + ], + "versions": [ + "s8BGCLGu", + "7SDA6FyX", + "avSpKzc6", + "QhF6sVFu", + "NKTqQ0bO", + "e7rJNBPs", + "danTqbxA", + "C1fCIQSh", + "f8kEK0IG", + "sBY4jR5x" + ], + "icon_url": "https://cdn.modrinth.com/data/CVBAErky/icon.jpeg", + "issues_url": "https://github.com/ChoiceTheorem/Immersive-structures/issues", + "source_url": "https://github.com/ChoiceTheorem/Immersive-structures", + "wiki_url": null, + "discord_url": "https://discord.gg/JzYEw7PxQv", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/CVBAErky/images/a0b730425598ef825f636092411dcc17843266c5.png", + "featured": false, + "title": "Flower dome", + "description": null, + "created": "2023-02-16T14:19:02.457190Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/CVBAErky/images/dc194c2dcc9f21004047f5734ddbd8bd562890f3.png", + "featured": true, + "title": "Majestic Airship", + "description": "Airships can be found in jungle biomes.", + "created": "2023-03-04T14:25:33.538431Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/CVBAErky/images/c2e016ab2ea15ad15a7063fee5fed62c69ac1123.png", + "featured": false, + "title": "Observatory", + "description": "Observatory for exploring the snowy landscape and the sky.", + "created": "2023-03-04T14:27:24.454940Z", + "ordering": 3 + } + ], + "color": 3360029, + "thread_id": "CVBAErky", + "monetization_status": "monetized" + }, + "imst_n-1.1.0.zip": { + "client_side": "optional", + "server_side": "required", + "game_versions": [ + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20" + ], + "id": "fECIioDQ", + "slug": "immersive-structures-ii", + "project_type": "mod", + "team": "IZADHP3E", + "organization": null, + "title": "Immersive Structures II: Nether edition", + "description": "Additional nether structure packs", + "body": "# **Welcome to Immersive Structure II:Nether edition!**\n[![Discord Badge](https://img.shields.io/discord/894248275841003542?color=blue&logo=discord \"Join our Discord Server\")](https://discord.gg/JzYEw7PxQv)\n[![GitHub Badge](https://img.shields.io/appveyor/build/ChoiceTheorem/ChoiceTheorem-s-overhauled-village?color=black&logo=github)](https://github.com/ChoiceTheorem/ChoiceTheorem-s-overhauled-village)\nThe Youtube channel is [here](\"https://www.youtube.com/channel/UCUSv0t-aWToQkpP5eonHmlA)\n![Twitter Follow](https://img.shields.io/twitter/follow/ChoiceTheorem?style=social)\n![](https://img.shields.io/badge/environment-server-orangered?style=flat-square)\n[![](https://www.bisecthosting.com/partners/custom-banners/fa0fa4a0-0318-4aef-b48f-7f9efd845b70.webp)](https://bisecthosting.com/CT)\n## **Description**\nThis mod adds various new structures to Minecraft's nether. The final goal is to add more structures that perfectly fit Minecraft worlds. This mod adds multiple buildings that suit the ambience and aesthetics of that biome. This pack will add around 20 unique structures to the game by completion.\nThere will be no backporting beyond 1.19.\n\n
FAQs\nThese are just some of the most asked questions I've had from people, but if you have any more, please leave a comment below and I'll try to help you as best I can.\n\n**1. Is it safe to update Immersive Structure II:Nether edition to a newer version?**\nYes. If any serious problems arise because of that, let me know.\n\n**2. Is it safe to add Immersive Structure II:Nether edition to an already existing world?**\nYep. Just note that the new structures will only spawn in newly generated chunks.\n\n**3. Is this mod for Forge or Fabric/Quilt?**\nAll of them. I have a universal version for three mod loaders.\n\n**4. How can I locate the new structures?**\nFor 1.18.2: /locate imst:[structure_from_list]
For 1.19+: /locate structure imst:[structure_from_list]\n\n**5. Does Immersive structures modify existing vanilla structures?**\nNo\n\n**6. How can I report bugs/issues/suggestions?**\nPlease go to my GitHub repo and make an issue there. A discord message will do.\n\n**7. Can I include Immersive Structure II:Nether edition in my modpack?**\nSure, but make sure to give credit and a link to our page.\n\n**8. Can I have Immersive Structure II:Nether edition for 1.x.x, please?**\nSuppose it's lower than 1.19, no. Don't ask this question ever again. The technical limit is too high here.\n\n**9. Can I give Choicetheorem any kind of commission or support?**\nI can't take any commissions or monetary support due to a lack of time and mean to receive payments.\n\n**10. Can I use it on Aternos or any 3rd party downloads?**\nYes, but you can download it via Modrinth, not Curseforge.\n\n**11. Is this server-side or client-side mod?**\nImmersive Structures is a server-side mod.\n
\n\n
Images\nSome fantastic footage from the mod.\nAll pictures are taken with complementary shaders or complementary reimagined shaders.\n\n
\n\n## **Credits**\n+ Vichy0623 for codesigning the builds

\n\n
Compatible mods\n\n+ Most world generation mods like Terralith, Oh Biome you'll go, Biomes O plenty.\n+ Various structure mods like Town&Tower and Repurposed structures.\n+ Any other structure packs by ChoiceTheorem like ChoiceTheorem's overhauled village.\n
", + "body_url": null, + "published": "2023-04-30T12:41:32.512342Z", + "updated": "2023-06-11T09:14:00.220154Z", + "approved": "2023-05-02T02:04:57.575533Z", + "queued": "2023-04-30T12:52:08.281765Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "CC-BY-NC-ND-4.0", + "name": "Creative Commons Attribution Non Commercial No Derivatives 4.0 International", + "url": null + }, + "downloads": 98145, + "followers": 80, + "categories": [ + "adventure", + "decoration", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "datapack", + "fabric", + "forge", + "quilt" + ], + "versions": [ + "ZsverLaJ", + "h6rZCAks", + "fumkeRgL", + "1NBeRr6k", + "tMnaV87R", + "DQPdL75T" + ], + "icon_url": null, + "issues_url": "https://github.com/ChoiceTheorem/Immersive-structures-nether/issues", + "source_url": "https://github.com/ChoiceTheorem/Immersive-structures-nether", + "wiki_url": null, + "discord_url": "https://discord.gg/JzYEw7PxQv", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/fECIioDQ/images/07f358442a8e43b9599ddb3ed12ed8da1d73811e.png", + "featured": true, + "title": "Crimson farm", + "description": null, + "created": "2023-04-30T12:49:00.798068Z", + "ordering": 0 + } + ], + "color": null, + "thread_id": "fECIioDQ", + "monetization_status": "monetized" + }, + "indium-1.0.34+mc1.20.1": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.16.5", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "Orvt0mRa", + "slug": "indium", + "project_type": "mod", + "team": "X5s94xjx", + "organization": null, + "title": "Indium", + "description": "Sodium addon providing support for the Fabric Rendering API, based on Indigo", + "body": "Indium is an addon for the rendering optimisation mod [Sodium](https://modrinth.com/mod/sodium), providing support for the Fabric Rendering API. The Fabric Rendering API is required for many mods that use advanced rendering effects, and is currently not supported by Sodium directly. Indium is based upon the reference implementation Indigo, which is part of Fabric API with source available [here](https://github.com/FabricMC/fabric/tree/1.17/fabric-renderer-indigo). (licensed Apache 2.0)\n\n# Frequently Asked Questions\n## Which mods require Indium?\nAny mod that uses the Fabric Rendering API will require Indium when used with Sodium. These include: Campanion, Bits and Chisels, LambdaBetterGrass,\nContinuity, Packages, and many more. Some of these mods may function without an implementation of the Fabric Rendering API, but have broken textures and models.\n\n## Does Indium affect performance?\nIndium's impact on performance should be negligible, however mods that use the Fabric Rendering API could themselves impact performance. Indium will not provide a performance benefit over using only Sodium.\n\n## Is Indium a replacement for Sodium?\nNo, Indium is an addon mod for Sodium - you must use both mods together to get Fabric Rendering API support with Sodium's rendering optimisations.\n\n## Do I need Indium if I don't use Sodium?\nNo, Indigo is provided as part of Fabric API as the reference implementation of the Fabric Rendering API. Indigo disables itself when Sodium is installed.\n\n## Is Fabric API required?\nYes. To use Sodium with mods that require the Fabric Rendering API, you need *both* Fabric API to provide the rendering API and Indium to implement the rendering API.\n\n## Will it be merged into Sodium?\nFabric Rendering API support is not currently a priority for the Sodium developers, and will not be explored until Sodium is in a more stable state.\n\n## Which versions of Sodium are supported?\nSodium 0.2.0 or newer is required for all versions of Indium. I support the latest stable versions of Sodium for 1.18 and 1.19. Iris may not always be compatible with the latest release or build of Indium - please ask the Iris support channels if you have issues.", + "body_url": null, + "published": "2021-07-19T17:56:39.449041Z", + "updated": "2024-07-01T18:34:04.893901Z", + "approved": "2021-07-19T17:56:39.449041Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "Apache-2.0", + "name": "Apache License 2.0", + "url": null + }, + "downloads": 8748964, + "followers": 7207, + "categories": [ + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "Zk2jPxcx", + "uTvfCUBM", + "mfNlBb6U", + "1ApUEVoW", + "CVUGSVU0", + "Rxzic9a0", + "D0fLM4o1", + "ZxoJeTLg", + "TpvP0qDc", + "lK43uDfu", + "Rli2nU8i", + "H4bOnadw", + "H45YVREb", + "mJ7WqoOY", + "WG5jreCt", + "yTfou6df", + "BoAba4K3", + "KqmHL1pI", + "85NvAOjQ", + "tMamyl08", + "U94NcDpV", + "qqiFL8NF", + "M7szjcI4", + "WTH3T2cR", + "oYQsfz9e", + "9dgIzesu", + "yTh7W27h", + "OPwFzZCT", + "HIQfyNd3", + "hfBawPLH", + "6UQwWURe", + "Lue6O9z9", + "tD2IqHXC", + "nTorcOMQ", + "Aouse6P7", + "VlLxDisa", + "XPsoVC5n", + "w4F7PG0f", + "gofbpynL", + "K4hsdO9H" + ], + "icon_url": "https://cdn.modrinth.com/data/Orvt0mRa/icon.png", + "issues_url": "https://github.com/comp500/Indium/issues", + "source_url": "https://github.com/comp500/Indium", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": 9132472, + "thread_id": "Orvt0mRa", + "monetization_status": "monetized" + }, + "InventorySorter-1.9.0-1.20": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4" + ], + "id": "5ibSyLAz", + "slug": "inventory-sorting", + "project_type": "mod", + "team": "OsHRhj5s", + "organization": null, + "title": "Inventory Sorting", + "description": "Quick, simple, and lightweight inventory sorting", + "body": "### Inventory Sorting \nQuick, simple, and lightweight Inventory sorter built for Fabric \n\"\" \n\n\n\n\n\nWays to sort an inventory: \n- Clicking the appropriate sort button\n- Using the keybind\n- *Middle clicking an empty slot\n- *Double clicking an empty slot\n- */sort or /sortme command\n\n*works server-side only with vanilla clients!\n\n\u00a0\nYou can edit the config in game using the mod Mod Menu or by manually editing the config file.\n\nVanilla clients can use the /invSort command to edit the config as well.\n\n\u00a0\n\nInventories can now be blacklisted in game(as of 1.8.2). Hold left control and press the sort button in an inventory. Or use the /invsort blacklist cmd. OP is required.\n\nFeatures two types of blacklists :\n- Do Not Sort - This inventory is not sortable and a button will not be displayed, but your inventory can.\n- Hide Buttons - Both the opened inventory and your inventory cannot be sorted, buttons will not be displayed for either.\n\n\u00a0\n\n\u00a0\n\nTired of a messy inventory?\n\nBefore \n\"Before\"\n\nAfter \n\"After\"\n\u00a0\n\nNote: \nInventory Sorting is required to be installed on the server as well. Unfortunately this prevents you from sorting inventories on a server that do not have the mod installed. Having a server component allows the sorting to be smoother and better on the network/server. When initiating the sort, your client simply tells the server to sort the inventory you're using, rather than your client spamming the server manually moving the items around.", + "body_url": null, + "published": "2022-12-12T18:42:36.173136Z", + "updated": "2024-01-29T02:51:24.317005Z", + "approved": "2022-12-12T21:26:20.767524Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 641534, + "followers": 468, + "categories": [ + "storage", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "ZsKcCN1N", + "oRCj8lkB", + "c28ouOKs", + "bg38oxcP", + "tr2ZGtz4", + "MO3Q3zs2" + ], + "icon_url": "https://cdn.modrinth.com/data/5ibSyLAz/5590c9168b256a538bcc7704f2984b7ee29f9c1b.png", + "issues_url": "https://github.com/kyrptonaught/Inventory-Sorter", + "source_url": "https://github.com/kyrptonaught/Inventory-Sorter", + "wiki_url": null, + "discord_url": null, + "donation_urls": [ + { + "id": "paypal", + "platform": "Paypal", + "url": "https://www.paypal.com/donate/?business=EU3B5KCHV8QNW&no_recurring=0&item_name=Hi%21+It%27s+Kyrptonaught%2C+thanks+a+bunch+for+supporting+the+development+of+my+minecraft+mods%21+Anything+is+appreciated%21¤cy_code=USD" + } + ], + "gallery": [], + "color": 5029116, + "thread_id": "5ibSyLAz", + "monetization_status": "monetized" + }, + "invoke-0.2.4": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20.1" + ], + "id": "xwHe8V3O", + "slug": "invocations", + "project_type": "mod", + "team": "GGudKiSj", + "organization": null, + "title": "Invocations", + "description": "More Complicated Spell Casting for Spell Engine Inspired by Last Epoch", + "body": "IF YOU'RE HAVING TROUBLE WITH SPELLBLADES AND THIS MOD, UPDATE THIS MOD TO AT LEAST VERSION 0.0.7\n\n \n\nInvocations is a mod all about combining three basic spells that don't do anything on their own in order to invoke powerful spells that make the long and intricate casting worth it.\n\n \n\nBasically, you have three basic spells that exists simply to act as a \"code\" for the actual spell you're casting, each basic spell increases the power by a certain amount and the spell you cast depends on the value.\n\n \n\nThis mod requires Wizards, which requires its own set of dependencies. Fabric only.\n\n \n\n \n\nList of currently available invocations in the images!\n\n \n\nUnbound Invocations is a special book that allows you to shuffle through the list of invocations randomly and then select the one the one that you want as you shuffle. This way, you can adopt a semi-random playstyle where you don't know what spell you're gonna cast next!\n\n \n\nFire Invocations:\n\nI. Rising Flame\n\nII. Flame Ray\n\nIII. Scorching Wind\n\nIV: Trailblaze\n\nV. Greater Fireball\n\nVI. Supernova\n\nVII. Meteorite Buckshot\n\nVIII. Volatile Meteorite Fragment\n\nIX. Ragnarok\n\n \n\nArcane Invocations:\n\nI. Arcane Shillelagh\n\nII: Blink\n\nIII: Amethyst Burst\n\nIV: Ender's Gaze\n\nV: Magic Missile\n\nVI: Sonic Boom\n\nVII: Hijack\n\nVIII: Draining Contagion\n\nIX: Agonizing Blast\n\n \n\nFrost Invocations:\n\nI: Glacial Hammer\n\nII: Ice Barage\n\nIII: Shared Suffering\n\nIV: Glacial Upheaval\n\nV: Glacial Cascade\n\nVI: Frozen Resonance\n\nVII: Icestorm\n\nVIII: Frozen Aura\n\nIX: Deathchill", + "body_url": null, + "published": "2023-11-23T01:43:19.821191Z", + "updated": "2024-07-05T14:08:44.948156Z", + "approved": "2023-11-25T22:55:00.639881Z", + "queued": "2023-11-23T01:48:28.262247Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 155240, + "followers": 48, + "categories": [ + "adventure", + "equipment", + "magic" + ], + "additional_categories": [ + "game-mechanics", + "mobs" + ], + "loaders": [ + "fabric" + ], + "versions": [ + "DaBNU00v", + "gpO8heG5", + "k2Xb0Xvs", + "HYy0EuOW", + "EkEmKcEy", + "Mi2cAYnV", + "zGJH66UK", + "s62bq7YK", + "XKDV9Yjr" + ], + "icon_url": "https://cdn.modrinth.com/data/xwHe8V3O/ace3bc240ea26f336a9a69ef97dc1606a00698ad.png", + "issues_url": "https://github.com/cleannrooster/invocations-spellengine/issues", + "source_url": "https://github.com/cleannrooster/invocations-spellengine", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/xwHe8V3O/images/44ef008cb362591224184812167d2969fb0edf51.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-23T01:48:19.695911Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/xwHe8V3O/images/ace3bc240ea26f336a9a69ef97dc1606a00698ad.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-23T01:46:24.684555Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/xwHe8V3O/images/cafec5810778892a0846f8d4a2d14955a2d8d145.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-23T01:48:12.823561Z", + "ordering": 0 + } + ], + "color": 1905677, + "thread_id": "uJIctPlV", + "monetization_status": "monetized" + }, + "iris-1.7.2+mc1.20.1": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.16.5", + "1.17", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "YL57xq9U", + "slug": "iris", + "project_type": "mod", + "team": "1HMZl6Mn", + "organization": null, + "title": "Iris Shaders", + "description": "A modern shaders mod for Minecraft intended to be compatible with existing OptiFine shader packs", + "body": "![Iris: An open-source shaders mod compatible with OptiFine shaderpacks](https://raw.githubusercontent.com/IrisShaders/Iris/trunk/docs/banner.png)\n\n## Links\n\n* **Visit [our website](https://irisshaders.dev) for downloads and pretty screenshots!**\n* **Visit [the shaders section](https://modrinth.com/shaders) to find shader packs!**\n* Visit [our Discord server](https://discord.gg/jQJnav2jPu) to chat about the mod and get support! It's also a great place to get development updates right as they're happening.\n* Visit [the developer documentation](https://github.com/IrisShaders/Iris/tree/trunk/docs/development) for information on developing, building, and contributing to Iris!\n\n## Installation\n\nYou can find a guide to installation [here](https://github.com/IrisShaders/Iris/blob/1.20.3/docs/guide.md).\n\n## FAQ\n\n- Find answers to frequently asked questions on our [FAQ page](https://github.com/IrisShaders/Iris/blob/1.19.4/docs/faq.md).\n- Iris supports almost all shaderpacks, but a list of unsupported shaderpacks is available [here](https://github.com/IrisShaders/Iris/blob/1.19.4/docs/unsupportedshaders.md).\n- A list of unfixable limitations in Iris is available [here](https://github.com/IrisShaders/Iris/blob/1.19.4/docs/usage/limitations.md).\n\n## More Info\n\nMore info can be found on our [README](https://github.com/IrisShaders/Iris/blob/trunk/README.md).", + "body_url": null, + "published": "2021-05-27T05:11:15.690120Z", + "updated": "2024-07-01T00:12:04.439550Z", + "approved": "2021-05-27T05:11:15.690120Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 13405639, + "followers": 11381, + "categories": [ + "decoration", + "optimization" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "BKUpdPtO", + "7ULwjID9", + "lQjKfhXZ", + "lAEtBzCu", + "AosvzXCO", + "ZmYHYMB0", + "YwBoFV6P", + "2wf4jsBO", + "RtuAfhnO", + "Hw3w5BnI", + "NSpfOv4N", + "FlQkLIVP", + "zBuHbv6a", + "gYVKINAq", + "QGPs4R2V", + "TzYtPcBt", + "bQeFkabl", + "I6p5WO3q", + "Ys3JxjYh", + "zMKAM7mH", + "LXMLAG5t", + "lFtR0yEB", + "7GHcCn6V", + "L401QBlK", + "yaROAJzO", + "nwP12ckH", + "XU7Kt1A6", + "lIUI5vjD", + "gXVJmMNx", + "Onlo6jbu", + "sWytL469", + "IlClEy6H", + "M18bSfGf", + "B9iwsuD9", + "tKYOPll0", + "tZs9ixBh", + "F92T6Nh1", + "q2kq4WQK", + "KDxcEpjX", + "pkGrlTNQ", + "SEOrgwmF", + "oubLAbu3", + "Si7uxNXL", + "fylOAYZi", + "gvvRO0WD", + "WwSkfJxS", + "wEz86aj9", + "nnr56Joh", + "r8IxC3aO", + "3tbkyayi", + "1BCkW8RE", + "RRjXTE6G", + "nM05XWOf", + "WPiyWv9b", + "61raaF2M", + "RoOgJaef", + "vujluWvJ", + "qLOWxC5n", + "KlpiaRLV", + "5Ox2LQ1C", + "HgbdQHa6", + "erJnRbFe", + "unkwzrN7", + "LGMDKOTZ", + "1turazSM", + "zKrz2FCx", + "j0DONNcY", + "bhSk1gCX", + "py8Wa69O", + "mBwD8Zhm", + "pMwSdnE7", + "Fnx41igH", + "Sg0JZGHa", + "gcpVAwdy", + "7cPNddw8", + "ExtC2pRY", + "mVGu4Ze2", + "xRdKiTLA", + "rKiitlRl", + "di8i8GvL", + "su0G9MUF", + "347HlKZS", + "1g7raUdU", + "RpjxjFWm", + "7MJ26Y79", + "AQqB1OqQ", + "5tSr0LHs", + "9YEwbzW6", + "4dFzaTaP", + "URWeWMAt", + "4VLJ3QSD", + "W00rBT3R", + "IBYlCS75", + "Sc0OZ0Ze", + "lBRgIigc", + "HzhiSGif", + "ibsBZ9bl", + "MU0L4OZM", + "pVNPPrMY", + "Sqfk9myM", + "4rtFWyuc", + "wtbkjLwi", + "P8R7yx6t", + "Zra3j4VJ", + "C7jhLYbl", + "nfElruJM", + "DsjYuGMO", + "9a8qLmTR", + "O7RZrusV", + "ogIRhnAJ", + "LgOJIpIS", + "wN6PuLPa", + "ogjxrwGQ", + "ZKp9SOIC", + "LBcmOpqU", + "CXOiI98u", + "DKiqtWdm", + "qpkCdX4h", + "xzCURg7P", + "Cjwm9s3i", + "Xl7oywRL", + "kGdJ11Rt", + "JHbrO6Zq", + "JjUWi3Lj", + "45ETshvT", + "KHQ2Hnpt", + "BvVRER1H", + "gPXdh2Es", + "RYnrr5zv", + "G5dd9TM4", + "keLlmlCc", + "1CMVXDHo", + "hq98tuSS", + "1bvcmYOc", + "C9Tu8Kbn", + "kuOV4Ece" + ], + "icon_url": "https://cdn.modrinth.com/data/YL57xq9U/dc558eece920db435f9823ce86de0c4cde89800b.png", + "issues_url": "https://github.com/IrisShaders/Iris/issues", + "source_url": "https://github.com/IrisShaders/Iris", + "wiki_url": null, + "discord_url": "https://discord.gg/jQJnav2jPu", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/coderbot" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/YL57xq9U/images/1c3d0dfbedf31dbee4e30e20c5329e5db9a881ae.png", + "featured": false, + "title": "Crying Obsidian Sky", + "description": "Complementary Shaders 4.4 dev3", + "created": "2022-02-28T02:35:42.372271Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/YL57xq9U/images/2fbd04f5d123577696e29b28bb7981a2bc95a0c8.png", + "featured": false, + "title": "Wide Mountain", + "description": "woodiertexas - Complementary Shaders", + "created": "2022-02-28T02:34:59.422420Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/YL57xq9U/images/d382106b9a2b943d06107c31c139c77849f1a0e8.png", + "featured": true, + "title": "A nice sunset", + "description": "Complementary Shaders 4.4 dev5", + "created": "2022-02-28T02:26:00.883959Z", + "ordering": 0 + } + ], + "color": 263172, + "thread_id": "YL57xq9U", + "monetization_status": "monetized" + }, + "Jade-1.20-fabric-11.10.0": { + "client_side": "optional", + "server_side": "optional", + "game_versions": [ + "1.16.4", + "1.16.5", + "1.17.1", + "1.18.2", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20-pre1", + "1.20-rc1", + "1.20", + "1.20.1", + "23w31a", + "23w32a", + "23w33a", + "1.20.2-pre2", + "1.20.2-pre3", + "1.20.2-pre4", + "1.20.2", + "1.20.3", + "1.20.4", + "24w14potato", + "1.20.5-pre1", + "1.20.5-pre2", + "1.20.5", + "1.20.6-rc1", + "1.20.6", + "1.21-pre2", + "1.21-pre3", + "1.21-pre4", + "1.21-rc1", + "1.21", + "1.21.1" + ], + "id": "nvQzSEkH", + "slug": "jade", + "project_type": "mod", + "team": "UadxHcYS", + "organization": null, + "title": "Jade \ud83d\udd0d", + "description": "Shows information about what you are looking at. (Hwyla/Waila fork for Minecraft 1.16+)", + "body": "# Jade \ud83d\udd0d\n\n
\n\nJade is the information HUD mod - Hwyla/Waila for modern Minecraft versions. Designed for better user experience and API.\n\nJade can be installed only on the client side. But many features require Jade on the server side. (item storage, horse stats, bees in beehive...)\n\n**For mod integration, try Jade Addons: [Forge](https://modrinth.com/mod/jade-addons-forge) [Fabric](https://modrinth.com/mod/jade-addons-fabric)**\n\n### Keys (default):\n\n - Keypad 0: Open configuration screen\n - Keypad 1: Toggle overlay\n - Keypad 2: Toggle liquid display\n - Keypad 3: Show recipes (Requires JEI)\n - Keypad 4: Show uses (Requires JEI)\n - Keypad 5: Narrate target\n\n### Notable changes compared to Hwyla:\n\n - API re-design\n - More vanilla addons\n - Higher configurability\n - Better accessibility\n\n[![Interested in supporting me and the development of mods? BisectHosting is the perfect solution. New customers can use the promotion code \"snownee\" to get a 25% discount on their first month of a gaming server. With 24/7 support and fast response times, you can expect top-notch service for all your gaming needs.](https://www.bisecthosting.com/partners/custom-banners/e826c64b-9e14-433d-a083-26f659f8a41c.webp)](https://rb.gy/oktbru)\n", + "body_url": null, + "published": "2021-09-18T08:14:16.544897Z", + "updated": "2024-08-03T00:45:13.170521Z", + "approved": "2022-12-11T14:21:53.979193Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "CC-BY-NC-SA-4.0", + "name": "Creative Commons Attribution Non Commercial Share Alike 4.0 International", + "url": null + }, + "downloads": 3929104, + "followers": 2022, + "categories": [ + "utility" + ], + "additional_categories": [ + "library" + ], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "q4ZaJMOV", + "okzqmJFR", + "O39MFDEw", + "8DsBPWqM", + "z8VJxqga", + "9GFhyVbZ", + "Nt1CVXe1", + "SZ31HOeG", + "5Fxr8pEV", + "NVeL7bLQ", + "vgkS7FsN", + "PEUxgEMw", + "w0i23DFm", + "i73JWEGw", + "oUfYzPSq", + "cFq5o17s", + "uVdWPdsM", + "ZASePpsm", + "tLH7cjnK", + "ada2ALjB", + "JSi5dyS2", + "uaCBZukC", + "HIL9jJQF", + "LmXOtmIi", + "AncyVLy5", + "ru21sPo2", + "xk54zw9v", + "EgZGElBL", + "cTMLt7UP", + "bhyR7YNm", + "BWdNl4EE", + "nTS7zONb", + "aYg0KAo5", + "KuAs1UBn", + "6LbXMvIy", + "XVLI5QsX", + "MOFr6hcb", + "qIHOeHzS", + "Vh3wXVs6", + "MSJGBHIo", + "5HiwJ7Se", + "aS8nBmNK", + "IIpnN0Qf", + "lcQiLHVM", + "kd04zQ7y", + "ujkXpLkl", + "F5BnRKSt", + "xQcxjdfW", + "C9KywtGd", + "4bCqgRsR", + "H3ou3KBw", + "D1aUQmSl", + "rVfNqnx6", + "vFMaIupn", + "YaELNGeC", + "2zfdBx1K", + "u3ts4cHu", + "P36LnXE0", + "rTAmf6cM", + "YtsKFrlw", + "oeEzN4Af", + "3vOfkZtg", + "2iRQrBk4", + "Vw8iMb7Y", + "rBcIqjdI", + "SlsObyHn", + "7ykNJqNq", + "o2sXK6XR", + "OPfSqApE", + "jyvjSF1Y", + "ckXpheui", + "SpOQVu02", + "UEoiUewC", + "5gvujWrb", + "Uwt21lf2", + "4YnO5I9T", + "XbNEZjWV", + "A3Qmrqh1", + "kX0whWaT", + "njXu5ySg", + "pyljMVxx", + "kp0HjPre", + "gUfoXs8r", + "1WeR5Hfq", + "K048p8ZE", + "TqNnpjse", + "ChB6svaA", + "XoEjMfV6", + "GCErLUDu", + "huOVr6wC", + "QhvPNPdp", + "uLIwu0Qg", + "W8oT3BAr", + "dxGKPrkW", + "soTdTMDe", + "zNQTQths", + "cqz4BTbh", + "akD4smps", + "L2um3gq1", + "CciLEAMK", + "fNHCa6bl", + "9rrZAORZ", + "dF9pXzzi", + "NKpz2O5U", + "zBRTR48S", + "VX7bhedt", + "RZQxZtl6", + "lwgbRGaY", + "yksHdZ4j", + "BnscDKcL", + "kIHvC4Li", + "AXsURWBl", + "re9m40O9", + "X6kFPDSp", + "Ou5F0zCg", + "5JH8igBc", + "43DuyPgG", + "Yx2HKOrO", + "H9wg0p1c", + "NruPjXIH", + "kEtH9pf8", + "wqbAqgyJ", + "pc7Loi6P", + "gF1TRsRm", + "ZMaraV5t", + "K1QP6zk7", + "19gb5iEa", + "fYjkxRNy", + "xzFnPn44", + "y0Qgfue5", + "YWwchlKJ", + "4O1mPdg9", + "MLYKnVCk", + "Um5AmLft", + "NVvPo5yc", + "vlM1OUBd", + "VQc9njMw", + "1866MBfo", + "eNY0Rg8n" + ], + "icon_url": "https://cdn.modrinth.com//data/nvQzSEkH/icon.png", + "issues_url": "https://github.com/Snownee/Jade/issues?q=is%3Aissue", + "source_url": "https://github.com/Snownee/Jade", + "wiki_url": null, + "discord_url": null, + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/snownee" + }, + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/snownee" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/nvQzSEkH/images/0bf8da81675d890d2bccba0ed0f51a0fabef5267.png", + "featured": false, + "title": "Redstone support", + "description": null, + "created": "2022-12-11T09:22:23.125333Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/nvQzSEkH/images/25295e11ad9a003df27cea972bffb1c1323d5e52.png", + "featured": false, + "title": "Horse stats", + "description": null, + "created": "2022-12-11T09:22:24.186008Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/nvQzSEkH/images/4b47304960861088536652dfcc9dbf42ef59ce5e.png", + "featured": false, + "title": "Item storage", + "description": null, + "created": "2022-12-11T09:15:43.263966Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/nvQzSEkH/images/6582f2217c9ce0d9fdc694e0f945dbe2ba10b5e2.png", + "featured": false, + "title": "Shows targeted face, position and distance", + "description": null, + "created": "2022-12-11T09:34:30.088195Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/nvQzSEkH/images/7d10e9c837c33d81b39950fb2f7bacc85df92ee3.gif", + "featured": false, + "title": "Harvestability and mining progress", + "description": null, + "created": "2022-12-11T09:46:54.705238Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/nvQzSEkH/images/80e67bb1f4c38d64a1561a7080a663711507c4f8.png", + "featured": false, + "title": "Shows item names in inventory", + "description": null, + "created": "2022-12-11T09:22:25.339079Z", + "ordering": 0 + } + ], + "color": 11322548, + "thread_id": "nvQzSEkH", + "monetization_status": "monetized" + }, + "jei-1.20.1-fabric-15.10.0.29": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.8", + "1.8.8", + "1.8.9", + "1.9", + "1.9.4", + "1.10", + "1.10.2", + "1.11", + "1.11.2", + "1.12", + "1.12.1", + "1.12.2", + "1.13.2", + "1.14.2", + "1.14.3", + "1.14.4", + "1.15.1", + "1.15.2", + "1.16.1", + "1.16.2", + "1.16.3", + "1.16.4", + "1.16.5", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "u6dRKJwZ", + "slug": "jei", + "project_type": "mod", + "team": "H2zAm1Kt", + "organization": null, + "title": "Just Enough Items", + "description": "JEI - View Items and Recipes", + "body": "# Just Enough Items\nJEI is an item and recipe viewing mod for Minecraft, built from the ground up for stability and performance.\n\n![JEI Recipe GUI](https://cdn.modrinth.com/data/u6dRKJwZ/images/ee0ea4051573264d2b4edb53f9d4e634faa11f21.png)\n\n## Controls\n\n### Inventory:\n*(Minecraft Options -> Controls)*\n\nShow **R**ecipes: *Hover over item + R* \nShow **U**ses: *Hover over item + U* \nToggle Item List **O**verlay: *Control + O* \n\n### Item List:\nShow Recipes: *Click Item or type R* \nShow Uses: *Right-Click Item or type U* \nNext/Previous page: *Scroll Wheel* \n\n### Search:\nSelect Search Bar: *Click or Control + F* \nClear Search: *Right Click* \nPrevious Search: *Up Arrow * \nSearch by Mod Name: *Type @ in front of a word (@thaum)* \nMultiple terms work together *(wand @thaum)* \n\nExclude search terms: *Type - in front of a word (@thaum -wand)* \n\nSearch terms that have spaces in them: *Type \"\" around the words (\"two words\")*\n\n### Recipe View:\nNext/Previous page: *Scroll Wheel* \nShow all Recipes: *Click the recipe category's name* \nMove items into crafting area: *Click the [+] button. Shift-Click to move multiple sets of items.* \n\n
\nView advanced controls\n\n### Advanced Search:\nSearch by Tooltip Only: *Type # in front of a word* \nSearch by OreDict name: *Type $ in front of a word* \nSearch by Creative Tab: *Type % in front of a word* \nMultiple Searches: *Separate terms with | characters, like \"wrench|hammer\"* \n\n### With Cheat Mode Active:\nGet a full stack of Items: *Click Item* \nGet one Item: *Right-Click Item* \nDelete Item: *Drop an Item into the Item List* \n\n### With Item List Edit Mode Active: \n*(These controls are shown in-game on the item tooltip)*\n\nHide Item: *Control-Click Item* \nHide Items and Sub-Items: *Control-Right-Click Item* \nHide all Items from a mod: *Control-Shift-Click Item*\n\n
\n\n## FAQ\n### Can I include JEI in my mod pack?\nOf course!\n\n### Can JEI run client-only, or with a vanilla server?\nYes, with some features disabled:\n- The \"Move items into crafting area\" [+] buttons.\n- Cheating in items that have lots of NBT data.\n- Deleting items.\n\n### Where can I find the ___ feature from NEI?\n\n[The chart here shows which mods support each feature.](https://docs.google.com/spreadsheets/d/1NEWZjKvWB-SibY1BXc1zoYkK7AhjMMBZess9wMy--6w/edit#gid=0)\n\n### I have an issue / bug / crash / report / request, where can I send it?\n[JEI Github Issues Page](https://github.com/mezz/JustEnoughItems/issues)\n\n## Support\n[Become a patron on Patreon](https://www.patreon.com/mezz)", + "body_url": null, + "published": "2023-01-27T05:19:03.821699Z", + "updated": "2024-08-14T11:46:34.408987Z", + "approved": "2023-01-29T05:17:57.073755Z", + "queued": null, + "status": "approved", + "requested_status": "unlisted", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 3977522, + "followers": 2382, + "categories": [ + "library", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "6QsZu0uX", + "vddb9IRK", + "OVe9dyBJ", + "3ejA11GM", + "qKnM5pVe", + "gpjhQ3Zu", + "PiSUF4VW", + "ncEE6r1H", + "85UZZXZe", + "971wponi", + "LZWS3nvb", + "VJouNQwg", + "djhxtBGb", + "fE3iesnY", + "ZEnNPdH9", + "5sH8sAhG", + "O6p3WH9E", + "ixCur6un", + "HStB0V3w", + "3IxUFvQD", + "3kM1ubIv", + "sH5rGNRc", + "75fa8Sn1", + "t5Kyzdn8", + "zCSFAyki", + "fmo3QBJD", + "y3JtdWY2", + "dw0hAkOV", + "RGfBHRed", + "QhGtXrPt", + "ZaqzdCAV", + "ipvO9rVR", + "FOGtceSJ", + "bMGyArLn", + "DEt3Xzzc", + "4g4FFT7K", + "bP4Zixz2", + "q87Alexs", + "aODxpC0g", + "l4ejVRvD", + "EOyOaHS6", + "PjDF8rN8", + "BnU3Pek7", + "7ptsxo3m", + "44C8KIQG", + "WxVr2N6m", + "noQMP2vg", + "Rk40Oewy", + "qF5wAhaF", + "gKx28huk", + "u8WOPvco", + "WxCwbDRB", + "if2HqYaS", + "ZJHZBAsl", + "Jat1mJdM", + "tf0xkdm8", + "YCyceAPD", + "AZea1kon", + "S7Ynl4ee", + "UjB6NUbz", + "AEumxvYI", + "9ltW1k7t", + "COwRqXou", + "hc5FfeJi", + "jPEaAMYh", + "xi4BgzYZ", + "DNF88dfr", + "a38nfrYD", + "ec0Y4mun", + "QgaaJnt7", + "jvSMoeMO", + "cdHYhbPX", + "w6fpSAaw", + "VDbBe5hM", + "Wv4kF6Zm", + "tT53ulpk", + "NY2sGWgd", + "jqyqFvG1", + "5qY9968h", + "5f605EHB", + "42WmFJOD", + "HdXRqIIC", + "REqq6tTJ", + "pCdKFclU", + "kdrhVo2x", + "FZ8oQA3B", + "FyEPTTTB", + "c31ADEAB", + "FZl4g2dC", + "bfezw35J", + "JZaKgwZK", + "UebODZvW", + "9dJBituw", + "RUT1n3qz", + "7tfMfjGD", + "KMjCAxiH", + "JpmTcJGN", + "EUSIlxsV", + "UjonCtDo", + "NtAmjCAM", + "Y9yyRYTM", + "OlZFTYXv", + "1qCHfuO9", + "Oarq5sGS", + "UV5MMCuY", + "IuVwdwOC", + "kFuD1Gz7", + "ekQac9hy", + "kxAgS5G2", + "mcFhxyWS", + "5WyLUEBw", + "ROFXmMEj", + "RzwsUzXc", + "tOBHoIbZ", + "eBCI8fPU", + "upXU99Zn", + "8oDBr8BZ", + "c8MdBbyv", + "8A5wo5Mz", + "Y3kTriuV", + "ZSQFvJYr", + "FmN9hx0a", + "EvWVIXEL", + "eZaQLUKr", + "VydGujwQ", + "86TCecyO", + "6OYsLxVr", + "iAEb1YPj", + "bJJjJJ9L", + "Ne8MjRCx", + "Cn4fICl5", + "jWBG2UYT", + "MPl1Y3vX", + "dZqoQJmc", + "UyITwSfW", + "xNOCMN6F", + "eMQqHaEl", + "VJL3zf1f", + "Y7lrn3JZ", + "6dD1kVGR", + "EaYdYtZx", + "VdrFvDMM", + "idYI1lxS", + "INoP03TU", + "RAtTx4ic", + "j80wbOMg", + "ps02DHX4", + "1GZBGClF", + "D2uOJtFt", + "zqxb40Y7", + "ZApUnqOO", + "4w4affZq", + "cdZsXk1b", + "2Y2BPMcy", + "5sq5cg1M", + "IkOZLHyu", + "zS8KBEOS", + "pcJlZDUc", + "G4XOSKl6", + "ERRL7l73", + "YIrg6UrE", + "svhhqeE7", + "enuGDv6D", + "hC05dIZX", + "gInhckja", + "etKTnoPu", + "tQr8jfIU", + "wjsxbU0x", + "y8ZRUI5i", + "xAAQsbvu", + "y738rZ5k", + "zeVrmpvP", + "RGBlX47H", + "LCWHprGl", + "F0LWZEqx", + "inDNvU32", + "JRwb6FzX", + "KeNnd9mP", + "EE23rUNm", + "rbjiLk8N", + "w5NBWxUf", + "NVPfvHQV", + "xB1fddxL", + "jAZALIc9", + "lgfCyccA", + "NkcmWkjj", + "ovK9vDXZ", + "zy4VO1Qj", + "ssXBvuwm", + "XaoWk5j5", + "zCYfzD1N", + "D5jYu6Tb", + "qlzCvbxg", + "WLYOG4Q0", + "MH2wwfDT", + "9z3jfW7r", + "oF8VoLti", + "xamdDSuC", + "ApgwO37z", + "T8xT1Piy", + "TgNSCvp9", + "9ttGt1LA", + "gB6eZIn2", + "2vebLdaz", + "wTKUeLXy", + "mk2vRPJP", + "UNoWOQAt", + "JERalwjv", + "UaR6oCq2", + "mfCz0M8i", + "oAjCLsEY", + "scxaLoE5", + "kgsV4BzE", + "EKenR1Wq", + "FvBymUsB", + "8hpGILSB", + "Mam2dOxs", + "Ycolgs09", + "Ksyps35A", + "iaQEd9xh", + "9rVoTIif", + "1XwN4s7V", + "Y6wIW2Sd", + "qi4CEOWE", + "ioahqlSG", + "f6290pCX", + "TWGoBtEU", + "4lwdGsFR", + "49JP4OAX", + "ZJfhRMPL", + "UshruK3Y", + "hJmElE3C", + "BEG5pCUY", + "MrIAJbKN", + "kQ5Ze7OT", + "Q7FoKZYW", + "gCf0GPKA", + "7MYzTvsf", + "g51cSSaM", + "MDsypZ7T", + "di7nZp7g", + "n0hvCcH2", + "OOCssA5u", + "uc1RXar5", + "ZvjBWW8m", + "jFTx0nMX", + "ZD1MXOVs", + "N0loP1J4", + "JtNUpLk1", + "T9reJ0gv", + "AKcZl6Fn", + "kkZvUoVY", + "S8q2YckO", + "V0EpSQow", + "lkuYvti1", + "SM96zdkN", + "UXLjfs7P", + "fjKpVVHx", + "cVZ0MO4w", + "7rBa86cD", + "pZnzpJAQ", + "2yBtSzRc", + "yKJepHjk", + "xOYLKOlo", + "9WZo5MAg", + "n0rPNhWU", + "dzFPVDGd", + "O6XzFPDi", + "M58K2eBP", + "2qMXcepu", + "ofDwFDaL", + "xlZS802f", + "IsuAX32E", + "OSlIF4dE", + "ZU0Y8sXr", + "r4TqQNJ7", + "eqBwUM0h", + "7yTR7JSi", + "2AfgdiRf", + "sqokihlN", + "WmaMf31x", + "n6biLACr", + "DqvZ8wJI", + "lImKSKss", + "DCgbaems", + "4CXMkun1", + "Y00MXjf2", + "tVIKjfse", + "uXlZz5SQ", + "S3H92iIr", + "jMQrZMdx", + "qcPhFLk0", + "2VVrGtfL", + "AtbpeIYL", + "fAtUZyd5", + "tqoHySkU", + "KzFW16jx", + "2whQOvCo", + "AJqQgRCF", + "i5LhlJRc", + "IVWaJ41H", + "fGOeNVB8", + "YSQD46Wt", + "Y4OlPVWp", + "i2IdocPT", + "EILwujq2", + "VKniCVQ6", + "7bq8aXVP", + "fhTtcPDe", + "Q6h011ST", + "XAICSXwk", + "29tzHqg2", + "nR96LqIM", + "hgC5ypxM", + "VQyZn5iX", + "Ja0Uijw9", + "PfZwFO0z", + "h9vdk1QR", + "nTr3nOm7", + "zbHgKNYq", + "Ie915g1B", + "k0yFJSSY", + "YRBSUeZU", + "sozo3baf", + "AnNfULiw", + "AlnMIQzz", + "cjNrXGWk", + "xghi0iwE", + "TxFIj7fe", + "a1LvIpcA", + "iIYInCHS", + "uAIa1PBc", + "Unx1eNnA", + "ftOHT4fV", + "We5qshOz", + "qwD8GOZo", + "jvrLjXMt", + "o7xnBJug", + "r3XBhq2X", + "MKoS2shO", + "EH2s4IqW", + "Fa7Qe214", + "6QBzWkHO", + "VPQVcs7c", + "xUEVENNN", + "VLntC18E", + "RfX9tFj0", + "nSazlYo6", + "3MEIwXQ4", + "ypJCZ3BJ", + "JTuBKmgH", + "ZZGSysXe", + "AXktlL00", + "ShnW30Rg", + "e6suJ00N", + "C9JFb9in", + "7PBVhF2r", + "pghMZzP9", + "nu8VeuuP", + "VnLnitip", + "pXQk1BFV", + "rXNNU3Tl", + "2RcWdG7H", + "3JNuF1dZ", + "L1BZgyfm", + "2hbjvQOt", + "NyXxzrbw", + "2XaZHDLp", + "U9lR9mfI", + "wctWXmqK", + "BpRpPbNy", + "V42iqSf1", + "4Z6I0uJB", + "1QwhThmq", + "RitgNTUv", + "ZTTxbxqN", + "HbEvMXpP", + "6WMtOmF5", + "q9Dm7UnY", + "BvAzYKwA", + "pBF6Gzvd", + "9ZxYoa1g", + "2Q9RXXvU", + "8J3VITov", + "o3GraPsb", + "bRjepS12", + "B51W8Bay", + "JJ4r4Mfj", + "hdmGbP4l", + "YMsM2JdD", + "T63278Hk", + "QsOyyl0n", + "jQe1aCoz", + "Ov9EFnEP", + "1Z8zFcPX", + "GJBrPaew", + "V2HsZEXW", + "NsR7HSB9", + "6uDcuW1u", + "7uUZmbU3", + "nLDBza3j", + "9FSJKo3P", + "2zG1S0ph", + "U82HSgXV", + "PY3Lq1Yh", + "rsYhriFi", + "u94mQep3", + "iK2Iwah4", + "ENpsocxb", + "lCtHXKYb", + "h5NlGl3w", + "jOgPHMhz", + "uKxGXSXv", + "dS4qrAdM", + "TFl4smur", + "AvQkhM7h", + "e1g9MwrS", + "ecAXPXcx", + "Idvyz2MC", + "kRZAZpkj", + "Ey7wkXzJ", + "xTkWWZiI", + "X6omuhOd", + "RADeO04u", + "oZI61Dyu", + "pQfH6gO2", + "2c638FNM", + "fsXFgvo6", + "YDqRU4Vs", + "hIpJGixG", + "ObC8cb6L", + "wnCGkghb", + "4SwVPLuc", + "kHkosSfv", + "2zTTJjhi", + "GKxrSuxq", + "7yck5RO7", + "DZ2oynXd", + "QpsuIxAg", + "6nYS9IBT", + "CMEHFQr4", + "bfqLpnHg", + "F4OcHgnI", + "7xy81Lff", + "yhQka4oE", + "lkr37jXa", + "ifpyRInV", + "UHOnES0i", + "fEL6R9R8", + "JIhGg5Ed", + "3iwIxml7", + "4C94cun5", + "fzRDCPqh", + "41AVxwo5", + "kmlLLGSl", + "2TcBz4hE", + "mpCo3Qkv", + "tFe0bORq", + "XE9NophO", + "UzTlxVjH", + "6siTxB6E", + "oay6x5p0", + "CliLhZsR", + "tsHjtGmC", + "w2ty1Pvc", + "9yVloBkq", + "gstgwHJm", + "pQ5kmerL", + "b7H6cBRF", + "csXI3SzR", + "BMm17PCW", + "KaDU3mW3", + "3Q58ElGy", + "YZdkvmVN", + "BOqQZ2XH", + "czBTbGnA", + "Hx93ajjf", + "RQ45eFSa", + "qSr25weG", + "QsyhIFzP", + "diz2ZpQT", + "6aDgbIOK", + "jFevkGmb", + "81X1ut7D", + "JVfl2JKi", + "D2EmNSwH", + "QzCN2sqk", + "3NFLyeGD", + "aCS0AwDM", + "Q8ZsRNDg", + "OzMyHNRf", + "bWh2C7yf", + "dlBBrmUl", + "5p9huQid", + "LcZZ4RSJ", + "MncxbRpx", + "SqczrVMH", + "x0QbGxiM", + "nT4ZZUNZ", + "ddaEUz0Y", + "tqmqWCND", + "e9Uoh5tW", + "gRFKQq9U", + "7KKHsBvJ", + "67CpZolw", + "6RXvSRoY", + "WgEQQvWl", + "q5UJHoIM", + "HqC8ffuV", + "DxF04z6O", + "JNgVDuc8", + "R2w3RV8e", + "EpzlwtBL", + "1mvokYOU", + "1Z632DTt", + "zEdEXTKm", + "DqINKDgf", + "KxY2G48H", + "hki8H1JL", + "RZace9rY", + "J4ZluW4N", + "BYb1EBSs", + "HBQFz9k0", + "R88XJROB", + "5uPfrTTC", + "yccWrox2", + "GrF41Iry", + "Vus6KLPm", + "bmJZd8jg", + "7u7gwhiv", + "FsI0uxnk", + "7UzQdpc1", + "KY2hSVfN", + "fyLzB6zb", + "uxygBcTt", + "eO1GZe6I", + "zZqfyCcQ", + "XWuClje2", + "4bVoEiBO", + "fIVdHGnB", + "EGlDWMxZ", + "kuLrzkyH", + "eQwcxK3V", + "WD5VioMe", + "VF3K3qO6", + "4UpZHqvm", + "Uv0pxSst", + "ki2ZuEpv", + "sTeG1Zjn", + "Xm7XETTC", + "g9BY7MLt", + "WREVMlhW", + "bMOVCo32", + "2ecNKTuM", + "YGnCqODj", + "L9azsEOk", + "96o5RpLP", + "IVO8GCiN", + "FZIbBMQg", + "U1DQDduU", + "syTAQ83b", + "yJfVHfyE", + "R8J75t84", + "20nq1kex", + "l76f3IWd", + "3Q5Xzx5d", + "ge5G79ih", + "vBcctFTo", + "cvGAn8Gv", + "msPUAAAN", + "K7diPSVC", + "OjiYocnk", + "iJnCxT9R", + "tb0OUHn9", + "awPQGOv0", + "hgwkmKgP", + "UaElluJ1", + "uZS3rdO6", + "qNHn3HOe", + "zuPDkWOB", + "4uIMWqWe", + "DR2WcXH9", + "ARTzzFeq", + "b13C8a4L", + "aFJ7qFZS", + "5nourJFL", + "lWnV3kK7", + "CyFNyFB8", + "pDir5hhu", + "rdxSD1Oq", + "Nhnlx1OT", + "gKDlEcND", + "OB0DdfgL", + "g5ktA74P", + "kjx8HSqV", + "KYBcRLrz", + "C8diLaa5", + "Rz0zlmfI", + "91z6erit", + "yf2P10Ge", + "aOpbOsdS", + "Q9bTNE9O", + "lCwLASEu", + "X08bjPPJ", + "NyQsdSYR", + "KQxuQzdb", + "M6uvW6Ma", + "VDQbH5O7", + "Csmhlzet", + "LM8edefa", + "8jlLQ8gj", + "8WGUp5qS", + "omvNB6TR", + "HOvPiKx1", + "8CaRFRl1", + "Xj8V8b3F", + "pGhbW1s8", + "hhMMfzcQ", + "xyCifuk4", + "sj6rqzK3", + "elgKKQUa", + "OiF6Xsd9", + "cRI6jvJU", + "aM3v2laQ", + "Rf3mIcN8", + "Wb1Yo1OL", + "L03zbPJj", + "GfXOq1SS", + "A3IN88yU", + "39oD4WfY", + "qeBCVPk4", + "eo29oZSe", + "Jytxbk3Y", + "IzNdTQKI", + "ad973pMV", + "52p8oTx1", + "7eK1K8AS", + "MdqjNOzR", + "YaMmfYQh", + "8JI4wXRi", + "omyZE3mm", + "I8MLZ0Rl", + "H6KMEybZ", + "XUxNf9vA", + "wmWdy0Rw", + "BknWwRbA", + "vbecIkhy", + "DkKEESc0", + "zm2RvKVQ", + "w00PILi1", + "qxFj8jsC", + "Euz7KpzA", + "bMDUOOPe", + "bs90Qpap", + "DVD4fsoI", + "F6rkxS2a", + "1n22VZMO", + "wm3fpjSW", + "zH0VtC4H", + "gVQcAZHp", + "Oq2HmpFK", + "3gBaWzNn", + "UC2i5OSm", + "NsMsYcA4", + "VDqnQWQ4", + "j6ZUU381", + "yjrMpuqc", + "ezuktekI", + "ZKfsA8cc", + "WxUJO28g", + "jlJxdYPq", + "6oEshh0b", + "vYQUoBXc", + "s3JQo4Ej", + "yKpMvb2C", + "zny0yHFs", + "6yF0Vfmo", + "8fLOWGFs", + "rmx4cylD", + "OeVeEOde", + "15gc0sCM", + "m8yKnWCj", + "oz3Cn9l3", + "mT1mMAe7", + "BTYhuLkl", + "ND253lie", + "K9fEY8Cd", + "78pCTkLF", + "XKVBgoqD", + "di6NC6pW", + "JcFVw4TM", + "QrDZZNj0", + "xDh52z9i", + "8xalaiUE", + "GHM8qrL6", + "HWUXyHAT", + "iSWrePts", + "Vn0Gj2Au", + "cpK7Jo4W", + "ooLfNZL7", + "32HzslLi", + "pbeWbPEi", + "JvCZwNlq", + "EjFAeAIw", + "ciDTLXtB", + "SK3idyUW", + "tNNFKuT2", + "ZglJgirV", + "m1M3VNkM", + "5ldB4WSe", + "1SB3iYxY", + "RyzQURND", + "WBmXr97U", + "v0efaBRF", + "M9Adt44w", + "IAMFV877", + "RDVR7QLO", + "K2uFRxeF", + "NDZXz2E9", + "sPerriK0", + "cxdaADIU", + "fjShRhcN", + "g3fYVU8v", + "ZeVia5j0", + "4JOv70Rh", + "YbcXCAx5", + "xMLqJl0y", + "UFlcRunt", + "gWflZ22O", + "nxa3bSVY", + "WGjI3d6Y", + "T5QDTFb9", + "WVk1qt4C", + "he3y2Qva", + "IKt1Udj0", + "j6XZ4sq5", + "hU4OKp54", + "wiWI2J1V", + "YJN5Q3tA", + "ndTYsgcW", + "aOAIQkp2", + "cx78VW5A", + "hDsOqHd4", + "yl6Y5MiH", + "rtjmI1xz", + "DVaHmuX1", + "UoFhMo8o", + "hFlLwUBy", + "YEPxYEtg", + "9fYJitHH", + "W9wcTiP0", + "UMsu1W1J", + "Lzxmj0rM", + "MdfiQQKd", + "Bmg3ySNO", + "ssez1hQ2", + "CxtjtSQi", + "aM6DOLI8", + "KoPomDOx", + "bovZc77S", + "rbwGt6wU", + "9WLUcwrV", + "NFshgc51", + "lFBqJ8Hc", + "gwQETmgV", + "qMfbG9Nk", + "gRu8M0P6", + "gBEb2OQf", + "h1YiuWHh", + "jFFDHJpZ", + "zLapnRnN", + "PNG1nRWr", + "2o62E5Td", + "njepWG0M", + "jzn0bjty", + "ZATl4I3q", + "ZwITsjL9", + "vaGHDvru", + "exHmGper", + "y7omevbw", + "WrDsMyL6", + "ykTCAuxM", + "xqq4ooRG", + "beKD5Ry3", + "ur0w32Xy", + "Cl6WE7RA", + "wA1fdRFj", + "lZZI667Z", + "Ri2cPuWG", + "QJuTvep2", + "RnWEIiwe", + "nUguaYWW", + "CUVHPPjp", + "M7M0yEsK", + "9NRQnk4y", + "YnmTeMt3", + "Lajs7CNN", + "BOD6LFZ1", + "fJbtDGS1", + "PclP6p2d", + "cW7GIZSX", + "ZmIU1Wo4", + "2CNuKic4", + "ryaxn9Kc", + "MDefxU0d", + "bGdv09TF", + "CrdWyeZw", + "txoVvn6s", + "MrD6AVur", + "4kojwFe1", + "g0EkPlst", + "tNEVhwid", + "Gajo5TQ4", + "WOZCZK2l", + "U3GmsnD7", + "AnU2GkIW", + "pLkiJEt5", + "892aafrE", + "nsqVicRc", + "eQAtIENW", + "18Y6mA6Q", + "il7Onj1Q", + "9dkhPV7z", + "K45XDbcn", + "dk5pB7w5", + "mIJy0WVq", + "FAuVnkXG", + "F3BTPYyB", + "oBF8c2kH", + "H3gcE79A", + "HogXAAA5", + "WtszdsBj", + "T3bHi9st", + "FIwviNDV", + "iRHE9itQ", + "FBlG8ZOs", + "UXaNqDMn", + "XC01BTja", + "ReRJTsgB", + "fJ2K6iGh", + "IMpOrx6B", + "8L1o9wef", + "uNEp4Qwv", + "m8lqc9Hn", + "J2PaGhq5", + "6bzt1ho6", + "vwMyavhx", + "9LpzqxbY", + "OvnGYD6r", + "J2KPDHzz", + "tj2zmV2L", + "ELqvgP9s", + "vIdO812K", + "S8UPlA8v", + "bnyYIJkO", + "JmXnFlLN", + "Yeu28G03", + "SWxfstTZ", + "klaZBSJf", + "xm50tjl0", + "bUYCjv93", + "V1SDvG76", + "6ZYkw4k4", + "QyIiLlGS", + "hZmiFZvJ", + "iBNmA42D", + "4Lsq0xKY", + "8BsOVSa8", + "4Ffxmtno", + "fmMwpkzJ", + "vVzdBpKl", + "hrGXJ2xW", + "BWuGH1v2", + "p4VqBI4C", + "HHSOHmYG", + "FSgHLosR", + "cEkAp4P4", + "QUXYROao", + "oyjxTYwb", + "iIegp4tn", + "hNm6ZFHz", + "UzKCVoYF", + "MidHk9Yi", + "P2S0ae2r", + "FuCzftld", + "ysjUVYNL", + "PxncueKp", + "iKYoHbsC", + "Xv1EV5uu", + "88SP9adL", + "gbFPx5DJ", + "cStbeJfG", + "cbUPFMIa", + "MKI0kht4", + "dYFNQ8TJ", + "1Ke07Kz1", + "nNq7As4P", + "sRto5aNc", + "1TMKkS2w", + "L9QkVJCV", + "F3pmZfZa", + "IujzpcRq", + "WKZYIGBX", + "tXyIvcSK", + "YFURX1uH", + "XrhIWwqS", + "6TwOVGwP", + "xZcmyK2f", + "sHnL7S7h", + "GJP8W1BO", + "toviFT8A", + "NPNaG8n5", + "rgrekUZW", + "M3wSyA5v", + "EF0cajUf", + "ko5DFj34", + "EzIdnoLP", + "Ebex84SP", + "RHbm97lL", + "IPXi4DNG", + "TiQC6p3C", + "SfNh6psW", + "wCODlFmX", + "fmLpzTEE", + "6WkEvpwv", + "jfG38KmG", + "OIO9T8uT", + "Q2iCDEZD", + "b2WuAwQM", + "t4K93NNO", + "i5Werzq2", + "OuK0fSjH", + "k7Cs4xuv", + "HIqTyQbt", + "DgocaFb4", + "eeGcu6ms", + "WBsvFfqc", + "vc1aNlft", + "kkd9LVzL", + "eqDU4qpz", + "3h6iNpLb", + "QU0GhsVd", + "YNIS0pf5", + "hlDyrs1R", + "rqAxjXHV", + "2FqdsETs", + "ZRZTXH7S", + "Oo2ZCQvL", + "XJEE5jh8", + "I5NF7TS8", + "lHQ8bdRP", + "YwQFA0cA", + "pGd1f6ua", + "zWMOePKF", + "YwrF5Iup", + "2OfV8Rdc", + "OiQ3h3GD", + "3qY1PxDG", + "84qrg5qQ", + "OK7CsCU0", + "CHoxOwin", + "3rKqgfHT", + "X3Gcyd8G", + "AWDc1gvo", + "8tuMuqCU", + "kNyDlH5e", + "hwiX3QEW", + "h9bgGdAZ", + "Jt9QTTKS", + "3Aj7ReXQ", + "fYYbW8p6", + "TGyXvhmf", + "B0iYTaYZ", + "Lq5JsIzy", + "qCC482Fi", + "ZfAeHBku", + "M7qEEO4o", + "eAnWfUwn", + "kDh98POF", + "P00ZIfi4", + "XQ64EIh7", + "RSb2efqB", + "IHKGhPTs", + "vE4m1TOJ", + "wFZEKApy", + "QNPtWGjc", + "Trl9C44l", + "24Px4lWg", + "YKouKfRn", + "ZpKzCeqd", + "APbSozCK", + "N7XhQIxm", + "7fGlHdtS", + "RrVdYau9", + "5PNRBAQg", + "CYAPPj1y", + "NOWE7iU4", + "MbNNbfPe", + "KmvOFVsq", + "e64hPbFe", + "2YsaDC32", + "D3ajEOlZ", + "uo1T3LZe", + "p3coBH5M", + "UVEgiwwd", + "MzYyCvGj", + "ZIlCP6py", + "JmDRMOih", + "or53SppR", + "BevivaZt", + "nkwtquY9", + "pZtammcO", + "BpsxvDSk", + "v0Rcv2tq", + "AdUnjPZV", + "ntGyeXeI", + "du2YSd3n", + "YyoC89Sf", + "T1Orvh7H", + "WN9ted1c", + "sKhbpWOM", + "k6euk42v", + "dJp49Sed", + "xIHMyf2w", + "7EPM4jah", + "itiKrENg", + "GJoGpfc7", + "zBPhKjKF", + "jGXoaPDY", + "U0VUUPFa", + "tzZ9FuFi", + "OmSRkdue", + "9kvIMFoE", + "MfnjhPwY", + "sxpG3k2h", + "sDUCT4FZ", + "OI8T01aP", + "CTU4Tw8P", + "pIc0G8fV", + "F3NL7H6G", + "MGo8i9B0", + "BiSpYBZK", + "EJfSyADk", + "ugxf8fQh", + "t8RKO7Qp", + "RlLEaBRf", + "41LPMfOZ", + "eSxCvnJJ", + "A4fxWbGN", + "iQFJeUiD", + "NKqwwMtn", + "ANW2QrY2", + "u4GtERjS", + "ylniemwA", + "sqKHEGEd", + "x1tJy0wF", + "kuVUe0bb", + "XfUmEXQH", + "ScDfWKOd", + "qwgwqIB2", + "uxp1wFdH", + "hJZfZnOK", + "AOe9gMIj", + "W50ap5Xq", + "GzOhXg20", + "KzAqQHqh", + "A4juSP00", + "Hd2Kdtg8", + "qNCz0qsG", + "pgwQf6hP", + "ABGaRYD8", + "alK8Y0CN", + "rN5uxwV4", + "Ub0CdJKl", + "Q4KKmmaj", + "jTf7i3kP", + "LKn4jdQ5", + "pXZEQXxn", + "SrnsBqCw", + "IYwq4ihT", + "zEbWRtBH", + "h135cBlv", + "Ze5rRbtE", + "HxBB0D6d", + "UFlEKR24", + "s0hfE5pD", + "kdAHbEPk", + "v5q5c6pI", + "UagUhC36", + "UWv9kDXP", + "wretcptO", + "exv9rzG9", + "56y8XLEL", + "5OPWStD4", + "py7MNwSD", + "Z9hpZuiO", + "C5MNAnyW", + "KZS4tDaP", + "SgbwJgxl", + "7BOmECkr", + "yCtelD9P", + "fbiFV1oW", + "fcwFnzik", + "CTklEuex", + "MJvCCuQI", + "RDpSf3lQ", + "IXyKgHzi", + "5fC89Wfg", + "wnJkNAYP", + "32Omv1WW", + "f7b9Jnvk", + "XY1wZ2iE", + "tx9ryx1b", + "4o9roYZs", + "qgZFDrtm", + "pXpftyDd", + "EviN3vr6", + "Q3swpSWx", + "86dofjKJ", + "bQbzgoA4", + "JiL4lC6t", + "MmwBFKdo", + "fhpZ1ZU0", + "W0qVDPfI", + "qSZi35Rm", + "W0ZrkNZL", + "yICSVtZ6", + "pkE5Xei5", + "ZutmWrpn", + "CYS9UQlJ", + "U3KckkgS", + "7iPukfyj", + "Dudz7I4x", + "XGGw9Vvz", + "6sLEHsmY", + "r5K7JNWo", + "VspUxsw4", + "rH9XFtRr", + "rzwAVWyB", + "WwvAWnwD", + "5Rpx4puz", + "IZL2URWU", + "KIiHyimG", + "pETlq4dj", + "5sqlmqOH", + "iR8LiDZQ", + "HE4aDAc0", + "2bVezdSP", + "t3s8W7uo", + "kxM3T9xl", + "KxjM9m5U", + "xsuGg1kD", + "gGQrrkP0", + "taHSX8Kg", + "xERKU3jN", + "lTFrnWhL", + "9Rh0nxv5", + "XhKKvBW3", + "EBlTMfSq", + "Kj6JhjPZ", + "Puh7Jcoh", + "f63U1S98", + "TZe7MoGh", + "IYuSlU93", + "mAkICB3g", + "XYJr4Ytt", + "v5PtYPG3", + "PYT1qfqF", + "Fk1ha5l9", + "c8AmcZ29", + "1Z8NMxe4", + "N9EKokrL", + "fprY4V2j", + "te62Rqrn", + "s4ZMXbOk", + "g0KdTGiA", + "odbHZNst", + "QdLvswVO", + "s48OTOkE", + "CwVG5D8C", + "cmzVHzOA", + "25AtC5WI", + "hiQYMzv2", + "dSiFNTsO", + "JA0mwg9h", + "2ubCoFng", + "39iAuvix", + "l8GgAR4E", + "mbMklOw5", + "saKpQOBe", + "kSyQxS41", + "X3DAWP1I", + "MjvElQAh", + "TThlc5MZ", + "opG3j70F", + "PjDM0HvM", + "a1dWxOIG", + "XEMr2V1s", + "NVuQhfP5", + "k3W3h9cO", + "R66lZwmk", + "Z1a7T8w7", + "p3M3zmfX", + "9HFanffl", + "MZotuhKO", + "YqoqYWho", + "rJ7tY0Pe", + "3EDaZMKV", + "Fq2JkIID", + "dGZUi2bk", + "7XeozzXK", + "CPWL2YRh", + "AkM5kTHW", + "ZTmWKvWe", + "OwLzmRCT", + "nvOKQX9c", + "aZBGWVaf", + "5pH4bwbe", + "wkV8rbmX", + "R2uS5zEG", + "ZHr1PES7", + "5qV2HQVC", + "RD6kyOfZ", + "37xyrL48", + "y9uUdcsH", + "oTMwUxXi", + "774OF61H", + "tos7M6GH", + "yzBZNSoq", + "qwpdB05i", + "Vd4BObXb", + "whRvGOjh", + "zQma1DIp", + "HOsKluvO", + "Bu4KaYcI", + "cLgzOj3I", + "7K5aWy38", + "8ksVdKCZ", + "reWdyTow", + "3tEbNRwh", + "J5TcglXt", + "UztoqNbN", + "yvp3bGz8", + "EK3thIGW", + "oeMKGhJv", + "6x3i4iWT", + "1QQSXiX4", + "yB6suElf", + "3tf7rDl6", + "UK6dpXaR", + "okOmUagw", + "U3nhwLfY", + "CbRhGbwb", + "PruHo00z", + "zlPhGgXT", + "qfIyLbxx", + "Gns2Kx3v", + "m1IXgVhk", + "piKxGyzy", + "oANvaGke", + "K3VXH3xw", + "6CFibYwP", + "oZ6EipJG", + "n1kUlV5B", + "FVcrIQ3r", + "YrlVCBeR", + "blqthf7S", + "QXyKClNO", + "jbLJ1XHE", + "w9E83eHq", + "nWDSFh4h", + "IQfHtvjM", + "YF1W8gDG", + "Sd6qLoaW", + "jR1i2Nr4", + "DCOmkFkI", + "IOZbZgGX", + "G2oIhpEs", + "F8RIUFLt", + "cNizrVlx", + "yc8vxlPo", + "EsmoHhwj", + "HVQr8Jb6", + "aVZJ3vwP", + "mdt0gPHv", + "LtQU8iFW", + "sWTRf9vO", + "V15O8eRe", + "Xm2cDzcV", + "k28ssuCs", + "HcRMup33", + "9NQy7dDu", + "YSd5kTQH", + "zSZUp818", + "rI26q9Va", + "vCZt6b4g", + "cMkeQhEx", + "YnRrj5NP", + "X8DaKaKx", + "DN8UuG0u", + "VRuENfne", + "3PIHVGDl", + "a5YYKSBp", + "tAICPxzR", + "LWCraTDi", + "azIxUQzm", + "8nNvyvoj", + "cHK3f0ff", + "8y6r09NZ", + "YWrLRDfT", + "HtjsxDMk", + "fGcPFvGp", + "IzKw43Im", + "6GacpaRH", + "lmd52V0r", + "jJWgyPE4", + "VqQZ89xG", + "VITeVPRH", + "w1FFwG13", + "wo9XtX1D", + "5AzKjak0", + "qMHEoNl6", + "ADoHlnnw", + "6ImKQVtc", + "lIRFslED", + "HU1FUi8s", + "7Qec2BlS", + "aYLp1Bp3", + "Vu5mfvCP", + "ssmmI201", + "8TIYTjQN", + "pPQCLKGQ", + "QU3u4vO1", + "meMBLNgc", + "eUWeGTuF", + "QXbArBL5", + "eGPwrU1j", + "L9FMd02R", + "TRbWnVhc", + "DlFRpeHc", + "yxQKhQDB", + "LtEFQAwk", + "ggg6Fulq", + "BLkRg0vC", + "UacTtp2r", + "ihRxUtwc", + "jywKOnh4", + "f2vXJrmz", + "AQGFbay7", + "701IAZ45", + "f3QOVv77", + "rjKKL67z", + "FRHQX3WR", + "frV8BVSX", + "qFg3o76e", + "PaT0460b", + "qdbe84jS", + "szAkVHE2", + "p4mTj1Pg", + "hdSbXGVo", + "Xe4e914i", + "PA3GKuhX", + "gxN9Ok0N", + "bphMOlpu", + "RoJAVsBz", + "IPE4zLKa", + "NDvA57JB", + "Yb2D7fkj", + "LClLVVT7", + "ocs34IdD", + "zLpvqhj7", + "HXEwA3jG", + "FyVaLIOF", + "DxriaZTk", + "rmvjSQEU", + "2kW6nYrC", + "GSFpzfKq", + "oZtBGOK3", + "5IVVKR4k", + "ohnVW62C", + "ByEv8moB", + "dZFCkxC0", + "AxOIPIFk", + "MzrEaunt", + "gAqJplBc", + "wApjCep8", + "NsbSea5x", + "PeYsGsQy", + "Ak6HvJFC", + "WqGVuPbX", + "HPR5ThoH", + "ERboLFtV", + "RHAv6XOz", + "b5PNwHIo", + "Y1en3Fb4", + "6kdrT8Yz", + "GrAMmGZb", + "enLHWRtU", + "vY0mg7DR", + "VfpKVbdD", + "LlWMWH8b", + "xGApC30U", + "lRHeE5X1", + "Rytwu5pR", + "MvR7kkK2", + "Z39I6iJB", + "oMeCsnYd", + "qM3NW3bo", + "dVtSaBxz", + "YJUbK8W6", + "UWWKpPq4", + "Rz3j6b82", + "TpZcWMWz", + "DHrib8lX", + "N0CceHHh", + "lMRpjWkn", + "bnGpFwjs", + "URk4m5ci", + "dkQY3GyS", + "91xE3lEB", + "L1uCKC92", + "RqMCH4KZ", + "erRDZP5n", + "hDTYeRQG", + "P0zvdbRK", + "GE5LkM6l", + "YxQq3C3L", + "AT9JoqPu", + "LwNqEeke", + "fHjLrdhD", + "EVCwPEPx", + "cjMIz57b", + "Evp3L4Kw", + "oQfq0x4h", + "ze9kmkHL", + "2vJsVMlk", + "5KlG5UQg", + "dYFEBPGW", + "MtHhjBC2", + "C3OE8nXl", + "xP3G6EQS", + "MYHGHeHY", + "YCQ2Uxqx", + "e0itLVob", + "GMHHL54p", + "luHUsG6a", + "XSKr2MzP", + "KA9GKpYh", + "UHa2kpei", + "4U0XeLpL", + "EhsVSvW7", + "LMRswijd", + "TTpbPgLF", + "UiRwSGOZ", + "rSOWO0gl", + "A7871gzc", + "jaeqbpLr", + "dcGqEIWy", + "5XYHLvoA", + "VlOCSTca", + "pYN5zzPV", + "GVmGSPBi", + "heV8vLrF", + "yAycwKz8", + "UmlATcKm", + "M7XMEVtf", + "f9HXPmkO", + "uLDb7Up1", + "YefzhejZ", + "u0Y3l3vW", + "38TVRa03", + "HWzjdGNO", + "r5ipHLMx", + "6utO4dMa", + "ENnncZW9", + "Nt2EWsG4", + "oyAtY7ux", + "qkqz37bW", + "kKEhT7X5", + "rkyBzQSY", + "L3OHmPcg", + "3TBaKKFn", + "qcsoKnMS", + "5BG3Bjl3", + "PXKsnzZ0", + "dZRUQyvZ", + "jpQTvgvR", + "qdjeJ4Y9", + "koKPn8GC", + "n4B5eboD", + "edA6Uu4J", + "X6bLXkTH", + "9QnHOyxr", + "Lyb6RQGW", + "WGJWUhsl", + "8Wd1otVx", + "gMgExGG7", + "BnAz0b1v", + "Iq2pM6kL", + "cYONfBhJ", + "6TuMM8P8", + "uZe3Yaz2", + "NqQI3V2u", + "IYYNcs1X", + "eo85DYum", + "CghZuyvE", + "nMBiJueU", + "CspLtfX4", + "ahYwTKWJ", + "FMDMJxu3", + "PCQfk7no", + "PshnKzR0", + "8WUaW9A9", + "ouS8zAkZ", + "EfdN9x3D", + "gzVDUcp1", + "7mEZrjbe", + "JkHC9LC0", + "Vr09IQeh", + "EsHjGTD5", + "M7bdbb1F", + "Td3DTgB3", + "JhwfUy4s", + "GZ4lRj7l", + "FO41IcES", + "yo0rxjTk", + "dEYLLkxI", + "T9LOSGqp", + "rBFMbNKQ", + "5Lp9J3ww", + "7rsjbgRi", + "g0Sw5n60", + "IpQhZuIc", + "KW3CsQzz", + "aUrBL0ih", + "aV6LmhCQ", + "QbBER8mQ", + "6Z30xZyc", + "LFakTyC9", + "G4n5XEsB", + "8JrjT4dR", + "WJCJaJce", + "WZKhDi0Y", + "YdHU8QDT", + "kYJyqcaR", + "pVnWFIc8", + "onCJLLUY", + "tjpOdGA8", + "7Ez1wljv", + "1kopv7jo", + "q3HWJEOU", + "X8jbdvNH", + "tw7nH2oQ", + "LXaYKr2N", + "UonMelFR", + "Xgi2A9Ca", + "Z7DFEt7f", + "DgZUny29", + "IDU6TkpI", + "bD036P3j", + "nTOt7AhL", + "ARQGJiwX", + "l1meOpOg", + "a7P0GZtV", + "bvwOiEUq", + "IhzBsgYI", + "1KWYKhWZ", + "1LcIOslS", + "Tp7qe1N4", + "kScUAmJD", + "c5Kr3T43", + "oMiglngi", + "989dxydW", + "ivmxj2ZA", + "wvL7Yp5A", + "ThcXGdwC", + "4y8B1CCF", + "xFYZMiUA", + "8HIXqeHh", + "rPz1qh3B", + "M45ujsLI", + "A5h4Xeta", + "ScimhP1E", + "w0KOAWCk", + "3PRejHQE", + "9WeBKqnP", + "BqBoOggt", + "ItFV76Mm", + "Q4COjMD5", + "OAf1li3F", + "PYdsSbgp", + "nUxGgi0e", + "GIRsdGK8", + "mOxolmuR", + "ScmYiQOR", + "2HObaWG3", + "qEGkhkm5", + "Ra3cw2Yl", + "7QNp5WaA", + "jARbbXvV", + "OJ7dfMLh", + "AL9dVn6l", + "IjS72jrI", + "Ebp4fySm", + "lXvmxuAv", + "FWlyYcv9", + "s7J9Kjvp", + "6oayKgkD", + "sr7Y70eN", + "iik2ZowS", + "uL85Cimz", + "GmbB8B8b", + "HAg6VL7m", + "Nxc1hes6", + "n8SwzXia", + "q0SEg0uJ", + "NukFrOP9", + "5LADI2CZ", + "mYomSEja", + "GI9seaQ5", + "sBoyXzeQ", + "Tb6GUkiF", + "eYBlPKqZ", + "6dlgng1y", + "AirXhqzA", + "mUlxSukq", + "S0b850Ej", + "BHg0NPw6", + "8xb5lP6y", + "MLBW7m8L", + "tUU1cPXu", + "7gCqE8DA", + "szcs6agX", + "3tJaIDG9", + "7QIpc1UU", + "GtT2pJO9", + "EEA9sveU", + "RBLz8hnl", + "Ve1xwF5t", + "IdDtxocI", + "IxH1fhZR", + "5Xqmwbuq", + "6vpwYexq", + "LbcAKalz", + "S3hUR04I", + "jVHMIyoL", + "1B0rPMnh", + "g55mIBsI", + "W59qO0OE", + "6nZ76O4V", + "aVpkY78k", + "10Oc2RMP", + "gYNr5p4e", + "jxRLLZbl", + "wu8EUbj0", + "Y7TkzlLJ", + "aks8IcXC", + "uWzx3YrZ", + "9BHuIeop", + "I71VLqBy", + "cydTwKo8", + "LZLzhlDP", + "8NPceJmz", + "ZTyWu4Ob", + "BmT1uzA9", + "Cusxujd8", + "AxN2Yv6E", + "xL1po8hA", + "EjDuWpP4", + "vLhobLtv", + "3WXB6IzW", + "kNwK0LQu", + "C7nTY0fi", + "uR8ln2F5", + "nt24irzD", + "GjazeGKN", + "NSODJBHL", + "pFjSVQjG", + "WXTB97iZ", + "h7l1CnX3", + "acO5UVUf", + "sDRBF4kn", + "vewEZsdm", + "fKVvem6c", + "8FWw6cDm", + "sBRTxcas", + "1Md2Tqmq", + "rw6tdgsU", + "aQ75l5Ap", + "nthRGwXG", + "r1zA1l0V", + "EQ4zQGDW", + "ToJuPYzI", + "QITPcWOG", + "PKkH2AuG", + "Vxu0Fed3", + "RIJGKf67", + "VlMCIVpF", + "PDFxO9tv", + "eLuPidTH", + "uJnQmlOq", + "PI3gdluK", + "IhAWiGPY", + "TyDQqPIZ", + "Hr1Lis9G", + "E9yd5OOZ", + "RCC0aEZv", + "KUhrmZwy", + "ODC0Hj3k", + "VCAQduVS", + "hXcZJx70", + "V7ISlzzB", + "pVzFQx1j", + "36LyROY5", + "ImxJ7Q9X", + "sIpLLS84", + "U0ecwM4B", + "EP6KMxQT", + "kjVUjoA6", + "eqQXhmDe", + "ceNCjKCC", + "r4VxyVNu", + "BwgMNJpb", + "EKti9cPB", + "wkpd6AXr", + "E2CL3tb6", + "Fib6uk3y", + "PPcxOJUu", + "C1tVzcy8", + "fUCVZdeO", + "FwD31VNu", + "e36YcmjX", + "Q72LdtWj", + "bLKKmP5x", + "4mqMvDPL", + "cHryi4U9", + "vyvnU4a8", + "VNaNTEXn", + "sfUJDBFf", + "NDszFsiC", + "9Mnzh5ek", + "uNa8dYJR", + "HMQpe1Sc", + "LKCiBYkr", + "wgIV0bLl", + "dAcdcYgI", + "4fp03w2p", + "ev0nR76F", + "wDQKRVND", + "4GyeMvGn", + "tOaLFoEz", + "bM0PTmzz", + "g4VYLwct", + "ZI1HkXZx", + "FxR5NSh6", + "GZlzN1t6", + "MKdp2ISz", + "dtapuWtP", + "E1V5sdPY", + "f31xmzII", + "ofNrmcd5", + "UWF2CEwy", + "gCI9Sa0w", + "ZOTEvkPa", + "Bn3Dms32", + "xvnbu14k", + "eZIHJP0c", + "qOnV6xQE", + "kDyTBXrY", + "NefqEnck", + "d0OLLRm6", + "nff9nRuD", + "F5f7AFkI", + "J4lyfBjo", + "3HiZ3c7C", + "zDIRJq0x", + "6mqd47yl", + "8RqCyUNV", + "EUluc5wf", + "jPc4oZhV", + "ktTP1TLo", + "Be0yhzYk", + "Unqx5sUZ", + "XBnBvnHA", + "r2TkBZaR", + "iFpjIIJZ", + "Z1TsvZEX", + "3xyhL4aS", + "KcbXAJxI", + "Ioj7c71U", + "TgCKFoHv", + "8dCeZp4K", + "KgImTmwn", + "dqJVAfxt", + "vDcPRfvM", + "jYdJu6hT", + "OHbPYvaA", + "hKkw1JoQ", + "SR7MOWw2", + "jtsJtCc7", + "A4pFB31V", + "ubPZrmHu", + "l9TRGP6H", + "xvrEf6P9", + "y9d7Tprn", + "M5OB3MPL", + "QKdYQIab", + "2hJMDlYJ", + "JQJDUPMD", + "yDspTpuG", + "UV00gn3Q", + "zt0OUPcy", + "zQ9bPFYo", + "IzEhVmbH", + "mLiwQXb4", + "R6YdV1Gp", + "Z2u7Q2OD", + "6pWKkLUL", + "iBkohmcW", + "W0SHO1U5", + "Ph0ckvVF", + "gMZUvIPN", + "EhUdIrPW", + "dDK9Xc4S", + "z2LIukeQ", + "Vt0ov2jR", + "TSpiUQjy", + "r0FaqOvt", + "JvjsLZSy", + "UfprhmUH", + "ueUK5fTU", + "ajQrRGhJ" + ], + "icon_url": "https://cdn.modrinth.com/data/u6dRKJwZ/565c44deeac2a38cbb6c600b5e002fac59572b88.png", + "issues_url": "https://github.com/mezz/JustEnoughItems/issues?q=is%3Aissue", + "source_url": "https://github.com/mezz/JustEnoughItems", + "wiki_url": "https://github.com/mezz/JustEnoughItems/wiki", + "discord_url": "https://discord.gg/sCQcWU2", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/mezz" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/u6dRKJwZ/images/4ebe4cc9942c4bf0b07fdac67f93026b42f9a4d4.png", + "featured": false, + "title": "Recipe Completion", + "description": null, + "created": "2023-01-27T05:18:47.838148Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/u6dRKJwZ/images/ee0ea4051573264d2b4edb53f9d4e634faa11f21.png", + "featured": false, + "title": "JEI Recipe GUI", + "description": null, + "created": "2023-01-27T05:27:31.621057Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/u6dRKJwZ/images/f281af132332942e0739d557d6608e9263273fbb.jpeg", + "featured": true, + "title": "jei-header", + "description": "Zoomed image of JEI viewed on a high resolution CRT monitor", + "created": "2023-01-29T23:20:13.068911Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/u6dRKJwZ/images/156edbd1e04f86d64edc4f41a6d00e849bc7984b.png", + "featured": false, + "title": "Potions", + "description": null, + "created": "2023-01-27T05:18:47.838148Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/u6dRKJwZ/images/b9efa7c6ecb817461416e6a30d8dfc0cc01e8566.png", + "featured": false, + "title": "Itemlist Edit Mode", + "description": null, + "created": "2023-01-27T05:18:47.838148Z", + "ordering": 2 + }, + { + "url": "https://cdn.modrinth.com/data/u6dRKJwZ/images/b1d94b5957935666467e1b2073d5cf92993b4078.png", + "featured": false, + "title": "Big Screen Support", + "description": null, + "created": "2023-01-27T05:18:47.838148Z", + "ordering": 3 + } + ], + "color": 9934998, + "thread_id": "u6dRKJwZ", + "monetization_status": "monetized" + }, + "Jewelry-1.3.5+1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.20.1" + ], + "id": "sNJAIjUm", + "slug": "jewelry", + "project_type": "mod", + "team": "blhWC7D2", + "organization": null, + "title": "Jewelry (RPG Series)", + "description": "\ud83d\udc8d Find precious gems deep down, and craft them into powerful jewelry!", + "body": "![](https://cdn.modrinth.com/data/sNJAIjUm/images/5fc94a47c06617bd6a646be97241b287ecd3406e.png \"\")\n\n## \ud83d\udc8e Find precious gems deep down, and craft them into powerful jewelry!\n\n[![Modloader](https://img.shields.io/badge/Loader-Fabric-ecebe6?labelColor=263768&style=for-the-badge)](https://fabricmc.net)\n[![Connector](https://img.shields.io/badge/Forge-via_Sinytra_Connector-orange?style=for-the-badge)](https://modrinth.com/mod/connector)\n[![Discord](https://img.shields.io/discord/973561601519149057.svg?label=&logo=discord&logoColor=ffffff&color=7389D8&labelColor=6A7EC2&style=for-the-badge)](https://discord.gg/KN9b3pjFTM)\n\n### \u2728 Discover more of the RPG Series\n\n[![Archers](https://cdn.modrinth.com/data/XIpMGI6r/images/cd19a95a79f1157b33f31818aa615a280b206912.png \"Archers\")](https://modrinth.com/mod/archers \"\")\n[![Paladins](https://cdn.modrinth.com/data/XIpMGI6r/images/3f19359bfd7521ba17bec818f125e87e09ef277e.png \"Paladins\")](https://modrinth.com/mod/paladins-and-priests \"\")\n[![Wizards](https://cdn.modrinth.com/data/XIpMGI6r/images/a7da965aa108daf95c10448c01423be49ce2338d.png \"Wizards\")](https://modrinth.com/mod/wizards \"\")\n[![Rogues](https://cdn.modrinth.com/data/XIpMGI6r/images/278d8c941af6dc763cf714b9f36f8b8366a60eb9.png \"Rogues\")](https://modrinth.com/mod/rogues-and-warriors \"\")\n\n\n# \ud83d\udce6 Installation\n\n### Required\n\n- [Trinkets](https://modrinth.com/mod/trinkets \"\")\n- [Spell Power Attributes](https://modrinth.com/mod/spell-power \"\")\n- [Ranged Weapon API](https://modrinth.com/mod/ranged-weapon-api \"\")\n\n\n# \ud83d\udc8d Features\n\nCollect a total of 25+ new, different pieces of jewelry items!\n\nEach piece of jewelry grants different combat related bonus.\n \nFrom early-game to end-game materials, there is always a relevant piece to obtain.\n\n### Trade with Jewelers in villages\n\nJeweler villagers sell low to middle tier pieces.\n\n![](https://cdn.modrinth.com/data/sNJAIjUm/images/ea20b8984cf5bd5f8e036a9582b88239f357681b.jpeg \"\")\n\n### Mine precious gems deep down\n\nGem Veins are located at the same depths as Diamond Ores, but are half as common.\n\n![](https://cdn.modrinth.com/data/sNJAIjUm/images/80fd276fb72c6e08f64912ea8afb06a424d6ae92.jpeg \"\")\n\n### Craft the gems into powerful jewelry\n\nCraft rings and necklaces by combining gems with Gold and Netherite.\n\n![](https://cdn.modrinth.com/data/sNJAIjUm/images/5501edcaae21ed453fa1052e71585986dbe97356.jpeg \"\")\n\n### Find jewelry in dungeon chests\n\n![](https://cdn.modrinth.com/data/sNJAIjUm/images/37914a769b470f57ca7043364c477e63c0d5af2f.jpeg \"\")\n\n# \ud83d\udd27 Configuration\n\nVarious aspects of the mod can be changed, by editing the relevant json files in `minecraft-instance/config/jewelry` folder:\n- `world_gen` village structure occurence\n- `items` bonus attributes for each item individually\n- `loot` which loot tables jewelry items should be added to", + "body_url": null, + "published": "2023-09-06T18:52:59.271993Z", + "updated": "2024-08-10T11:30:22.647250Z", + "approved": "2023-09-09T05:18:39.368179Z", + "queued": "2023-09-08T21:44:03.771817Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 360115, + "followers": 344, + "categories": [ + "adventure", + "equipment", + "magic" + ], + "additional_categories": [ + "worldgen" + ], + "loaders": [ + "fabric" + ], + "versions": [ + "jyHbeYby", + "NcoVr2Jf", + "49JX0sH1", + "65Fd41kT", + "CwEN5pPv", + "4M8lcPaH", + "X9PIBtmi", + "ifadZx4z", + "LFfWOWJ2", + "mWQ4KSek", + "S6UgyPaP", + "S5kYH7fo", + "zwOZSKqu", + "3PO8CFiY", + "O2Qn5G9Z", + "O2WEGMsP", + "QGbrNeFd", + "DIvLFllq", + "Dhp5wgKk", + "nOwzxEZn", + "cAMpQ1jG" + ], + "icon_url": "https://cdn.modrinth.com/data/sNJAIjUm/7222c935fe80cdee63617b79427736e5616f2512.png", + "issues_url": "https://github.com/ZsoltMolnarrr/Jewelry/issues", + "source_url": "https://github.com/ZsoltMolnarrr/Jewelry", + "wiki_url": null, + "discord_url": "https://discord.com/invite/KN9b3pjFTM", + "donation_urls": [ + { + "id": "github", + "platform": "Github", + "url": "https://github.com/sponsors/ZsoltMolnarrr" + }, + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/daedelus" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/sNJAIjUm/images/37914a769b470f57ca7043364c477e63c0d5af2f.jpeg", + "featured": false, + "title": "dungeon", + "description": null, + "created": "2023-09-08T21:01:17.797215Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/sNJAIjUm/images/5501edcaae21ed453fa1052e71585986dbe97356.jpeg", + "featured": false, + "title": "crafting", + "description": null, + "created": "2023-09-08T21:00:50.235121Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/sNJAIjUm/images/5fc94a47c06617bd6a646be97241b287ecd3406e.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-10-29T17:58:54.610301Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/sNJAIjUm/images/80fd276fb72c6e08f64912ea8afb06a424d6ae92.jpeg", + "featured": false, + "title": "gem vein", + "description": null, + "created": "2023-09-08T21:01:03.354631Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/sNJAIjUm/images/92fd8566348e44fe9470b13026042246671bb42c.png", + "featured": true, + "title": "Jewelry palette", + "description": null, + "created": "2023-09-08T21:13:44.191415Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/sNJAIjUm/images/ea20b8984cf5bd5f8e036a9582b88239f357681b.jpeg", + "featured": false, + "title": "village", + "description": null, + "created": "2023-09-08T21:00:38.041019Z", + "ordering": 0 + } + ], + "color": 2239790, + "thread_id": "3GD6MuiN", + "monetization_status": "monetized" + }, + "Kev's TieredZ Modifiers": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20.1" + ], + "id": "Bb3Fi2JX", + "slug": "kevs-tieredz-modifiers", + "project_type": "mod", + "team": "2prF8DLF", + "organization": "OWAli2xv", + "title": "Kev's TieredZ Modifiers", + "description": "More Tieredz modifiers that support spell power and others!", + "body": "[![](https://www.bisecthosting.com/images/CF/Kev's_Modifiers/BH_KMTZ_header.webp)](https://pixeldreamstudios.net)\n![](https://www.bisecthosting.com/images/CF/Kev's_Modifiers/BH_KMTZ_about.webp)\nA magical mod originally crafted for Fantasy MC, a total of 95+ new modifiers! Ensure a seamless experience by having all the required mods installed. Exciting updates on the horizon! \ud83d\ude80\n\n## \u2728 Features Galore \u2728\nOverhauled almost all original Tieredz modifiers using attributes from different mods\n\nFrom v1.0.0: 47 new modifiers in total (wands/staves/ranged weapons/armour/swords) and 1 more tier to the modifiers!\n\n- 8 Unique modifiers (2 staves, 2 wands, 3 swords, 1 armour)\n- 8 Legendary modifiers(2 staves, 2 wands, 3 swords, 1 armour)\n- 8 Epic modifiers (2 staves, 2 wands, 3 swords, 1 armour)\n- 6 Rare modifiers (3 staves, 3 wands)\n- 6 Uncommon modifiers (3 staves, 3 wands)\n- 6 Common modifiers (3 staves, 3 wands)\n- 4 Chaotic modifiers (2 swords, 2 bows)\n\nFrom v1.5.0: (4 new dependency: Obscure API, Archers, Paladins & Priests, Mythic Metals)\n- Added 3 new modifiers for P&P armors (1 Epic, 1 Legendary, 1 Unique)\n- Added 14 new modifiers for claymore/great hammer/mace (3 Common, 3 Uncommon, 2 Rare, 2 Epic, 2 Legendary, 2 Unique)\n- Added 14 new modifiers for wands/staves (3 Common, 3 Uncommon, 2 Rare, 2 Epic, 2 Legendary, 2 Unique)\n- Added 12 new modifiers specifically for Archers' armors\n- Added 12 new modifiers for all armors\n\nFrom v2.0.0:\n- Added 24 new melee modifiers\n- Added Anti-Gravity, Aquatic, Swift to Boots\n- Added Guardian, Shadowguard to Chestplates\n\nThe weights of all the tiers are changed to fit in another; the Chaotic tier \ud83c\udf2a\ufe0f\n\n### \ud83d\udd27 Required Mods\n\n- [Spell Power Attributes](https://www.curseforge.com/minecraft/mc-mods/spell-power)\n- [Pufferfish's skills](https://www.curseforge.com/minecraft/mc-mods/puffish-skills)\n- [Tierify](https://www.curseforge.com/minecraft/mc-mods/tierify)\n- [Obscure API](https://www.curseforge.com/minecraft/mc-mods/obscure-api-fabric)\n\n\n### \ud83c\udf08 Recommended Optional Mods\n\n- [Spellblades and Such](https://www.curseforge.com/minecraft/mc-mods/spellblade-next)\n- [Simply Skills](https://www.curseforge.com/minecraft/mc-mods/simply-skills)\n- [Mythic Metals](https://www.curseforge.com/minecraft/mc-mods/mythicmetals)\n- [Archers](https://www.curseforge.com/minecraft/mc-mods/archers)\n- [Paladins & Priests](https://www.curseforge.com/minecraft/mc-mods/paladins-and-priests)\n- [Wizards](https://www.curseforge.com/minecraft/mc-mods/wizards)\n- [Reabsorption](https://www.curseforge.com/minecraft/mc-mods/reabsorption-energy-shield)\n\n[![alt text](https://www.bisecthosting.com/images/CF/Kev's_Modifiers/BH_KMTZ_discord.webp)](https://discord.gg/pixel-dream-studios-872788557553610802)\n[![](https://www.bisecthosting.com/images/CF/Kev's_Modifiers/BH_KMTZ_promo.webp)](https://bisecthosting.com/PixelDream)", + "body_url": null, + "published": "2024-02-10T16:16:14.586911Z", + "updated": "2024-04-22T22:36:48.870349Z", + "approved": "2024-02-20T07:32:06.346337Z", + "queued": "2024-02-10T16:51:21.370164Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 6257, + "followers": 10, + "categories": [ + "adventure", + "equipment" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "f2IDZBvU", + "qBQ0yCV1", + "l64x5Rwr", + "mT1viDiZ", + "OnHM7KAp", + "OvagV5Au" + ], + "icon_url": "https://cdn.modrinth.com/data/Bb3Fi2JX/388e12c90d0528fb9df4a41a6cf6e3806ec75f9b.png", + "issues_url": "https://github.com/kyber-6/kevstieredzmodifiers-mod/issues", + "source_url": "https://github.com/kyber-6/kevstieredzmodifiers-mod", + "wiki_url": null, + "discord_url": "https://discord.com/invite/pixel-dream-studios-872788557553610802", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/Bb3Fi2JX/images/3717cd7ff79167bfd9fd4b255b2583bd52462799.png", + "featured": false, + "title": "One of the spell modifier!", + "description": null, + "created": "2024-02-10T16:31:32.085913Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/Bb3Fi2JX/images/acd2b6062a1030776b5955a87fc3e6b149666314.png", + "featured": false, + "title": "Wands now have modifiers!", + "description": null, + "created": "2024-02-10T16:32:28.322562Z", + "ordering": 0 + } + ], + "color": 12299168, + "thread_id": "utYHllpq", + "monetization_status": "monetized" + }, + "kevsequipmentsets-1.0.5": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20.1" + ], + "id": "ZSeB6n9M", + "slug": "kevs-equipment-sets", + "project_type": "mod", + "team": "9hxIV75q", + "organization": "OWAli2xv", + "title": "Kev's Equipment Sets", + "description": "Equipment set bonuses!", + "body": "# \ud83e\uddd9 Kev's Equipment Sets \ud83c\udf1f\n\nA magical mod originally crafted for Fantasy MC, a total of 11 new modifiers! Ensure a seamless experience by having all the required mods installed. Exciting updates on the horizon! \ud83d\ude80\n\n## \u2728 Features Galore!\n\n- 5 Plenty of Armors mod armor sets\n- 1 Marium's Soulslike Weaponry armor set\n- Dualwield Bonuses for daggers and niche weapons!\n\n### \ud83d\udd27 Required Mods\n\n- [Gear Core](https://modrinth.com/mod/gear-core)\n- [MC Dungeon Weapons](https://modrinth.com/mod/mcdw)\n- [Simply Swords](https://modrinth.com/mod/simply-swords)\n- [Spell Power Attributes](https://modrinth.com/mod/spell-power)\n- [Basic Weapons](https://modrinth.com/mod/basic-weapons)\n- [Obscure API](https://modrinth.com/mod/obscure-api)\n- [Zenith Attributes](https://modrinth.com/mod/zenith-attributes)\n\n### \ud83c\udf08 Recommended Optional Mods\n\n- [Kev's Tierify Modifiers](https://legacy.curseforge.com/minecraft/mc-mods/kevs-tierify-modifiers) OR [Kev's TieredZ Modifiers](https://www.curseforge.com/minecraft/mc-mods/kevs-tieredz-modifiers)\n\n[![](https://i.imgur.com/l815YIN.png)](https://bisecthosting.com/PixelDream)", + "body_url": null, + "published": "2024-03-07T15:18:52.240126Z", + "updated": "2024-03-16T23:04:57.553925Z", + "approved": "2024-03-10T00:51:37.440162Z", + "queued": "2024-03-07T15:39:36.613312Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "GPL-3.0-only", + "name": "GNU General Public License v3.0 only", + "url": null + }, + "downloads": 522, + "followers": 2, + "categories": [ + "adventure", + "equipment", + "magic" + ], + "additional_categories": [ + "game-mechanics" + ], + "loaders": [ + "fabric" + ], + "versions": [ + "am9dchaB", + "HGvWNPM4" + ], + "icon_url": "https://cdn.modrinth.com/data/ZSeB6n9M/f78725b7f9f04961eef9dbf3e03881ed2f81b199.png", + "issues_url": "https://github.com/KevzCz/KevsEquipmentSets/issues", + "source_url": "https://github.com/KevzCz/KevsEquipmentSets", + "wiki_url": null, + "discord_url": "https://discord.com/invite/pixel-dream-studios-872788557553610802", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/ZSeB6n9M/images/f0d99cfa7345e1ea2b862a19f9bf6cbcba437422.png", + "featured": false, + "title": "Dualwield bonus!", + "description": null, + "created": "2024-03-07T15:35:57.025780Z", + "ordering": 0 + } + ], + "color": 2108462, + "thread_id": "n43sEKeC", + "monetization_status": "monetized" + }, + "kevslibrary-1.1.0": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20.1" + ], + "id": "jq6pHt0U", + "slug": "kevs-library", + "project_type": "mod", + "team": "5TrFaA5P", + "organization": "OWAli2xv", + "title": "Kev's Library", + "description": "A library for all Kev's mods", + "body": "# \ud83d\udcda Kev's Library \ud83d\udcda\u00a0\n\n## The foundational cornerstone for all of Kev's mods!\n\nThis\u00a0 library doesn't do much on its own, but once you integrate it with any of my mods, there will be changes made.\n\nWith plans to expand and enrich its features, Kev's Library aims to reduce hard dependencies across all my mods.", + "body_url": null, + "published": "2024-03-17T01:01:04.558927Z", + "updated": "2024-03-17T01:01:40.894046Z", + "approved": "2024-03-19T00:48:13.751473Z", + "queued": "2024-03-17T01:04:21.046012Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "GPL-3.0-or-later", + "name": "GNU General Public License v3.0 only", + "url": null + }, + "downloads": 5903, + "followers": 1, + "categories": [ + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "L6vTMKdJ" + ], + "icon_url": "https://cdn.modrinth.com/data/jq6pHt0U/97c6c23bb2c527667a47569301e7237be6cd03cf.png", + "issues_url": "https://github.com/KevzCz/KevsLibrary/issues", + "source_url": "https://github.com/KevzCz/KevsLibrary", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": 2105386, + "thread_id": "bBF0uM4p", + "monetization_status": "monetized" + }, + "kobold-outposts-2.0": { + "client_side": "optional", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.20.1" + ], + "id": "zxQ8fN7I", + "slug": "kobold-outposts", + "project_type": "mod", + "team": "CykbJaFi", + "organization": null, + "title": "Kobold Outposts", + "description": "A small datapack adding jungle outposts of Kobold Warriors from Mythic Mobs!", + "body": "A small datapack which adds three types of small outpost to jungle biomes containing Kobold Warriors and Kobolds from the [Mythic Mobs](https://modrinth.com/mod/mythic-mobs) mod.\nThe datapack was designed with fabric mods installed, so no guarantees of compatibility with forge.\n\n[Mythic Mobs](https://modrinth.com/mod/mythic-mobs) is required to get the mob spawns.\n\nOptional Decorations:\n\nJungle grapes will appear in one of the variants if [Let's Do: Vinery](https://modrinth.com/mod/vinery) is installed.\n\nCocoa Bean Crates will appear with [Crate Delight](https://modrinth.com/mod/crate-delight-fabric) installed.\n\nCooking pots and other minor decorations will only appear with [Farmer's Delight](https://modrinth.com/mod/farmers-delight-fabric) installed.", + "body_url": null, + "published": "2024-01-10T06:53:57.153242Z", + "updated": "2024-06-05T23:57:24.911602Z", + "approved": "2024-01-12T22:49:32.221238Z", + "queued": "2024-01-10T07:17:59.479442Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 4197, + "followers": 20, + "categories": [ + "adventure", + "worldgen" + ], + "additional_categories": [ + "decoration", + "mobs" + ], + "loaders": [ + "datapack", + "fabric", + "forge", + "quilt" + ], + "versions": [ + "6JHXDzPq", + "GLphsuzM", + "InaSMe3l", + "AokXq2yN", + "QgTa7HEt", + "B4nzmoMh" + ], + "icon_url": "https://cdn.modrinth.com/data/zxQ8fN7I/486b9dbd41474d3288b40ac315bc9acd8c109c82.png", + "issues_url": null, + "source_url": null, + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/zxQ8fN7I/images/202fed4f122b10f65bcf0e9e0410c935fdacbb75.png", + "featured": false, + "title": null, + "description": null, + "created": "2024-01-10T07:11:33.537753Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/zxQ8fN7I/images/7d9935a1ca6f35dbeafb71558ff9c1e5587f2cf3.png", + "featured": false, + "title": null, + "description": null, + "created": "2024-01-10T07:12:06.941767Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/zxQ8fN7I/images/9e184a16e113bfbb3db59f29f2b361ba2120c78d.png", + "featured": false, + "title": null, + "description": null, + "created": "2024-01-10T07:11:58.419519Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/zxQ8fN7I/images/ba33185ec9376a05e7d8b91871c070ab2c7bcf0c.png", + "featured": false, + "title": null, + "description": null, + "created": "2024-01-10T07:11:44.270393Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/zxQ8fN7I/images/c4c017bafb49af11ed44216384d7bca7238bf917.png", + "featured": false, + "title": null, + "description": null, + "created": "2024-01-10T07:11:27.463358Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/zxQ8fN7I/images/e7345ddb0a2863a73e658db94dba7e870299e5d1.png", + "featured": false, + "title": null, + "description": null, + "created": "2024-01-10T07:11:51.542734Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/zxQ8fN7I/images/faa2744a3c0c5ea4aced816117bd7295cfccd945.png", + "featured": true, + "title": null, + "description": null, + "created": "2024-01-10T07:11:15.120742Z", + "ordering": 0 + } + ], + "color": 3621424, + "thread_id": "q8srE47S", + "monetization_status": "monetized" + }, + "LegendaryTooltips-1.20.1-fabric-1.4.5": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.12.2", + "1.16.5", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "atHH8NyV", + "slug": "legendary-tooltips", + "project_type": "mod", + "team": "80MpFuhC", + "organization": null, + "title": "Legendary Tooltips", + "description": "Give your rare items a fancier tooltip! Also adds additional tooltip configuration options.", + "body": "

Ever feel like item tooltips are a little lackluster?  Legendary Tooltips is here to change that.

\n

\n

This mod will allow you to change the tooltips of a selection of items of your choice to embellished works of art.  It also adds a host of other tooltip options including centered item names, tooltip shadows, matching tooltip borders to item colors, separators under item names, 3d item previews, compact tooltips, and more!

\n

 

\n

This mod requires Iceberg, you can download it here.
Versions 1.3 and up require Prism, you can download it here.
 

\n

 

\n

Client / Server

\n

This mod is fully client-side.

\n

 

\n

Configuration

\n

Extensive configuration instructions can be found here.  Please read this first!

\n

 

\n
Players
\n
\n

The configuration file includes instructions for setting up tooltips however you feel fit, please read the configuration instructions first!  Supports up to sixteen custom borders, each of which can be set to apply to items by name, mod, tag, vanilla rarity, item name color, display name, tooltip text, or NBT tag.  By default, the mod includes the custom border seen above, and more can easily be added with a resource pack.  For an example resource pack that adds ten custom frames, check out Eclectic Trove!

\n
\n

 

\n
Mod authors
\n
\n

The following only applies to version 1.2 and later!

\n

If you are interested in adding custom borders to items in a mod you are coding, it is possible by adding Legendary Tooltips as a dependency.  (Use cursemaven.com for this.)

\n

Use the LegendaryTooltipsConfig.addFrameDefinition() method to specify a list of selectors for a given ResourceLocation / frame index (see configuration file documentation if you don't understand what this means).  This method is not widely supported, so if it isn't working, please try the preferred data-driven method below instead.

\n
\n

 

\n
Resource pack authors
\n
\n

Borders can be customized via resource packs.  The resource pack is capable of replacing the default border included in the mod with up to 16 custom borders that can be used by the mod.  Please see Eclectic Trove for an example--I recommend using this as a starting point when designing your own borders.  There is also a template image available to make drawing easier, which can be found here (this is a Photoshop project, so you will need Photoshop or an image editor that can read Photoshop files like Gimp).

\n

 

\n

The following only applies to version 1.2 and later!

\n

As of version 1.2, it is also possible for resource packs and mods to define custom borders using a .json file resource included in the pack/mod itself.  This file is loaded differently than normal resources, as they do not replace each other--all border definitions found in all active custom border resource files will be loaded and applied.  These files allow you to use any properly-formatted image resource and can specify all colors to match.  An example file that describes the file format can be found here.  Please read this file first, as it contains a lot of information.  You can also find an example in the noconfig variant of Eclectic Trove, which contains definitions for many vanilla items, here.  

\n
\n

 

\n

Compatibility

\n

Highly compatible, this mod doesn't change the underlying tooltip behavior, only adds on.  Also integrates with Equipment Compare to provide even fancier comparison tooltips! (See images for an example)

\n

If you find some sort of compatibility issue, please let me know!

\n

 

\n

You are free to use this mod in modpacks.

\n

 

\n

\n

Problems, feature request, something else?  Join us on Discord!

", + "body_url": null, + "published": "2022-11-15T19:38:33.355951Z", + "updated": "2024-08-02T22:47:21.612005Z", + "approved": "2022-11-15T21:35:38.643371Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "CC-BY-NC-ND-4.0", + "name": "Creative Commons Attribution Non Commercial No Derivatives 4.0 International", + "url": null + }, + "downloads": 1466135, + "followers": 1235, + "categories": [ + "adventure", + "equipment", + "utility" + ], + "additional_categories": [ + "decoration", + "game-mechanics" + ], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "FE9VHeSA", + "CjEZnKLB", + "Stq0nmhy", + "QqAHVnpI", + "qAjH3bHL", + "5P7LJDXQ", + "yiXNxlzi", + "WN77B9Es", + "U8v4WrrK", + "hMR5epDy", + "UOVPhZoi", + "cUoZ3rR0", + "msfSSDAn", + "43mOsya6", + "pKKg19XI", + "JhxD2e6J", + "qeYFVZQ1", + "y08hPXLb", + "fvJtXL6i", + "P7o2ppJw", + "YH6Zg5SV", + "N5MWkeNK", + "ATZor3BM", + "va5YC3jO", + "Hd3tuA2u", + "e1VWiU4Z", + "1y6jRPCS", + "Wb73Fntb", + "b3uUDJIJ", + "cmiVyupa", + "UTTS7kWE", + "JLVpPTBZ", + "mETd5tfg" + ], + "icon_url": "https://cdn.modrinth.com/data/atHH8NyV/be363570c1dd3e0954712949ecad2600893bf36f.png", + "issues_url": "https://github.com/AHilyard/LegendaryTooltips/issues", + "source_url": "https://github.com/AHilyard/LegendaryTooltips/", + "wiki_url": "https://github.com/AHilyard/LegendaryTooltips/wiki/Configuration-Instructions", + "discord_url": "https://discord.gg/S5NQjbXPnb", + "donation_urls": [ + { + "id": "paypal", + "platform": "Paypal", + "url": "https://www.paypal.com/donate/?business=NYKUAV883JKA2&no_recurring=0&item_name=Thank+you+for+considering+a+donation.+It+helps+to+support+me+by+allowing+me+to+spend+more+time+making+mods+and+games.¤cy_code=USD" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/atHH8NyV/images/2ec71690fa88977d699e984223c62d19a430718d.png", + "featured": false, + "title": "Before / After", + "description": "Bring those tooltips to life.", + "created": "2022-11-15T19:54:04.687862Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/atHH8NyV/images/7a8688ef134a9a4e34b12200f8a152e62534a7bb.png", + "featured": false, + "title": "Try out the matching border color option.", + "description": "Works with all modded item colors!", + "created": "2022-11-15T19:54:05.917969Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/atHH8NyV/images/9102ae8314c3ab5154b14b7c0ee713f98ba3b70e.png", + "featured": false, + "title": "Integrates with Equipment Compare!", + "description": "Make those comparison tooltips even fancier!", + "created": "2022-11-15T19:54:07.151509Z", + "ordering": 0 + } + ], + "color": 4538946, + "thread_id": "atHH8NyV", + "monetization_status": "monetized" + }, + "letsdo-camping-fabric-1.0.0": { + "client_side": "unknown", + "server_side": "unknown", + "game_versions": [ + "1.20.1" + ], + "id": "uJXTNuf0", + "slug": "lets-do-camping", + "project_type": "mod", + "team": "zospLU20", + "organization": null, + "title": "[Let's Do] Camping", + "description": "How about we sleep outside today? Grab your backpack, pack the tent, grill, and sleeping bag, and let's go!", + "body": "\u00a0![Logo](https://imgur.com/X8atspG.png)\n\n\n
\n
\n\u00a0
How about we sleep outside today? Grab your backpack, pack the tent, grill, and sleeping bag, and let's go!\n
\n
\n
\n\n\u00a0\n\u00a0\n__Key Features__\n
\n* 7 new Backpacks and giving 3 extra rows of storage. That's it! No additional gimmicks\n* Tents and Sleeping Bags in all colors\n* A grill for grilling meat - giving it some Nutrition and Saturation boost\n* You can now craft bundles\n
\n\u2026 and more\n
\n
\n

\n\u00a0
Have fun Outdoors! :)\u00a0\n
\n
\n
\n
\n
\n
Requires Architectury
\n
\n
\n
\n
\n\u00a0
Dedicated to MissLilitu
\n\u00a0\n\u00a0", + "body_url": null, + "published": "2024-07-27T18:38:15.493170Z", + "updated": "2024-08-14T09:59:15.124985Z", + "approved": "2024-07-28T07:14:14.760952Z", + "queued": "2024-07-27T18:44:18.921762Z", + "status": "approved", + "requested_status": "unlisted", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 2628, + "followers": 24, + "categories": [ + "storage" + ], + "additional_categories": [ + "decoration" + ], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "3pZWoULG", + "w4TC1HEK", + "76mqacKu", + "iSIrQiyW", + "ubY51oYF", + "7oj0JF2V" + ], + "icon_url": "https://cdn.modrinth.com/data/uJXTNuf0/227cd60faccde49bd71d6567096b1807be6eb11e.png", + "issues_url": "https://github.com/satisfyu/Let-s-Do-Hub/issues", + "source_url": "https://github.com/satisfyu/Camping", + "wiki_url": null, + "discord_url": "https://discord.gg/Vqu6wYZwdZ", + "donation_urls": [ + { + "id": "paypal", + "platform": "Paypal", + "url": "https://paypal.me/mrclbe" + }, + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/user?u=78595058" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/uJXTNuf0/images/255e6e6005c4028a0285aa3babe7fe62eda51b29.jpeg", + "featured": false, + "title": "Overwatch", + "description": "Taking overwatch with my new Backpack", + "created": "2024-07-27T18:42:22.022659Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/uJXTNuf0/images/468a09dcd1a8116cce8648b5c25ce3141777f028.jpeg", + "featured": false, + "title": "The End", + "description": "A Enderbag! Access your Enderchest from everywhere. ", + "created": "2024-07-27T18:43:11.881577Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/uJXTNuf0/images/730f51c034426b30b7bb239d7888fc081b6bd515.jpeg", + "featured": false, + "title": "A small Camp", + "description": "Some Tents, a Grill and me wearing one of the brand new Backpacks!", + "created": "2024-07-27T18:41:59.150755Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/uJXTNuf0/images/fb04f19452019a42c4ec987f50e5143079b92b7b.jpeg", + "featured": true, + "title": "Night Camp", + "description": "A blue Sleeping Bag, a Sheepbag and Tent", + "created": "2024-07-27T18:42:53.241616Z", + "ordering": 0 + } + ], + "color": 1515570, + "thread_id": "R3MkN8Ih", + "monetization_status": "monetized" + }, + "LibZ": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.20", + "1.20.1", + "1.21" + ], + "id": "yUBXc3AH", + "slug": "libz", + "project_type": "mod", + "team": "S7gDIPP8", + "organization": null, + "title": "LibZ", + "description": "Open source library for a couple of Globox_Z mods", + "body": "![Headline](https://i.imgur.com/xtuhDhy.png)\n\n
\n\n[](https://discord.gg/cV4cJyGXqF) \n[](https://globox1997.github.io/wiki/mods/LibZ/)\n[](https://github.com/Globox1997/LibZ/issues)\n
\n\n\u201cDescription\u201d\n

\n\nThis mod is a library mod for a couple of Globox_Z's mods. \nOne main feature it adds is the tab registry for visible screen tabs. \nHonestly, I never wanted to create a library mod and publish it here like others did but after modding for quite some time now, this makes sense.\n \n\n\u201cMisc\u201d\n

\n\n[](https://modrinth.com/mod/fabric-api)\n\n\n\nThis mod is developed for Fabric. \nThere are no plans to develop a Forge version. \n\n\nModpack Permission: \nFeel free to use it in any modpacks.\n\n\nBug Report: \nJust report bugs at the github page.", + "body_url": null, + "published": "2023-04-19T18:24:35.101851Z", + "updated": "2024-06-23T14:09:59.088337Z", + "approved": "2023-04-20T22:07:43.401902Z", + "queued": "2023-04-19T20:31:40.302170Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 597126, + "followers": 55, + "categories": [ + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "HbCwlPRA", + "HOECobmO", + "AMqL6VaC", + "soKX5h3N", + "yYR9jqw2", + "BEPAjfEE", + "wBIAaCvH" + ], + "icon_url": "https://cdn.modrinth.com/data/yUBXc3AH/3bbbb712213f6c74dbeb90ab6bad1c0a4798ce0f.png", + "issues_url": "https://github.com/Globox1997/LibZ/issues", + "source_url": "https://github.com/Globox1997/LibZ", + "wiki_url": "https://globox1997.github.io/wiki/mods/LibZ/", + "discord_url": "https://discord.gg/cV4cJyGXqF", + "donation_urls": [], + "gallery": [], + "color": 12369084, + "thread_id": "yUBXc3AH", + "monetization_status": "monetized" + }, + "lithium-fabric-mc1.20.1-0.11.2": { + "client_side": "optional", + "server_side": "optional", + "game_versions": [ + "1.16.2", + "1.16.3", + "1.16.4", + "1.16.5", + "1.17", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "gvQqBUqZ", + "slug": "lithium", + "project_type": "mod", + "team": "peSx5UYg", + "organization": null, + "title": "Lithium", + "description": "No-compromises game logic/server optimization mod", + "body": "Lithium is a modern, general-purpose optimization mod for Minecraft which works to improve a number of systems (game physics, mob AI, block ticking, etc) with the goal of **not changing any vanilla mechanics**. \n\n
\n\nThe mod works **on both the client and server**, and can be installed on servers **without requiring clients to also have the mod** (and vice versa.)\n\n
\n\nFor multiplayer servers, administrators can expect a sizeable improvement to tick times, allowing their hardware to support more loaded entities, chunks, and players. Even in single-player, Lithium helps to improve performance by optimizing the internal game server, which is used for \"ticking\" the world. This can free up your computer's processor to focus on other tasks, resulting in **improved frame rates and increased responsiveness**. \n\n\n
\n\n\nThe strict goal of maintaining exact behavior with vanilla makes Lithium suitable for almost any Minecraft server running Fabric, even for highly complex gameplay scenarios and creations. In fact, our continued insistence towards not changing vanilla gameplay has even led to the mod being officially allowed in [Minecraft speedrunning](https://www.speedrun.com/mc).\n\n
\n\n## Installation\n\nMake sure you have the latest version of Fabric Loader present and then simply drop the mod into your mods folder. No other mods or additional setup (not even Fabric API!) is required. You do not need to create new worlds in order to take advantage of the mod.\n\n
\n\n\nWhile you're at it, you may want to check out two of my other mods, [Phosphor](https://modrinth.com/mod/phosphor) and [Sodium](https://modrinth.com/mod/sodium), as they're both fully compatible and only help to further improve performance in different parts of the game.\n\n
\n\n## Configuration\n\nLithium makes use of an semi-unusual configuration system which allows you to enable or completely disable patches the mod applies. This system allows fine-grained control over what code in Minecraft is modified by Lithium, and as such, can be used to completely eliminate bugs or mod incompatibilities introduced by the mod.\n\n
\n\nFor more information, please read [the wiki entry](https://github.com/CaffeineMC/lithium-fabric/wiki/Configuration-File) on modifying your configuration file.\n\n
\n\nPlease note: An empty configuration file is *perfectly normal* and just means you want to use the default options, which are already set up out of the box for the best performance the mod can offer.\n\n
\n\n## Reporting Issues\n\nPlease use the issue tracker linked at the top of the page to report bugs, crashes, and other issues.\n\n", + "body_url": null, + "published": "2021-01-03T00:56:52.292581Z", + "updated": "2024-08-11T17:21:31.831246Z", + "approved": "2021-01-03T00:56:52.292581Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 10552592, + "followers": 10712, + "categories": [ + "optimization" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "EhG1mQzx", + "5fmGl08Y", + "ouTdXXWj", + "igqdFUYG", + "pGhOMdTm", + "Le0tKjFX", + "rvsW1zhb", + "7jxErppe", + "aZ0JFf08", + "cTZv31gu", + "nVR7Q63z", + "FHFKMKeu", + "2w527DB2", + "2CbyxeU0", + "2aoHIXuK", + "Ehsd7YUl", + "MoF1cn6g", + "pHl1Vi6k", + "pXdccFQf", + "sIKhU9s4", + "ZRR9yqHD", + "Zs3sdHjK", + "Nba2vozh", + "2ysRxhIL", + "ySBrfN8N", + "xVm1caOt", + "IQxlSIiw", + "FXG2XqRP", + "ALnv7Npy", + "OKrb9xMn", + "3Gq9H7R9", + "7scJ9RTg", + "XS6vJwop", + "sMWkk4VU", + "GYl3zwgt", + "m6sVgAi6", + "53cwYYb1", + "14hWYkog", + "2KMrj5c1", + "ZSNsJrPI", + "qdzL5Hkg", + "WzQmxYRa", + "nMhjKWVE", + "tDFVQpHO", + "bAbb09VF", + "g2qXxjsR", + "fsK2ycFx", + "OC4JOVBe", + "my7uONjU", + "p25IJhj0", + "5a3sPIH2", + "NTZCh7rb", + "5szYtenV" + ], + "icon_url": "https://cdn.modrinth.com/data/gvQqBUqZ/icon.png", + "issues_url": "https://github.com/caffeinemc/lithium-fabric/issues", + "source_url": "https://github.com/caffeinemc/lithium-fabric", + "wiki_url": null, + "discord_url": "https://caffeinemc.net/discord", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/2No2Name" + } + ], + "gallery": [], + "color": 15395571, + "thread_id": "gvQqBUqZ", + "monetization_status": "monetized" + }, + "lithostitched-fabric-1.20.1-1.1.8": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5-rc3", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "XaDC71GB", + "slug": "lithostitched", + "project_type": "mod", + "team": "V5sujL1J", + "organization": null, + "title": "Lithostitched", + "description": "Library mod with new configurability and compatibility enhancements for worldgen", + "body": "# Lithostitched\n\nLithostitched is a library mod for Fabric and Neoforge with new configurability and compatibility enhancements for worldgen.\n\n## Description\n\nThis mod introduces new tools for datapack and modded worldgen developers to utilize, with the aim of increasing inter-project compatibility and expanding configurability in general. Currently, there are features such as:\n- Biome modifiers\n- Template pool injectors\n- Surface rule modifiers\n- Guaranteed pieces in jigsaw structures\n\nAll of these new capabilities are **data-driven**! Take a look at the [Lithostitched Wiki](https://github.com/Apollounknowndev/lithostitched/wiki) for more information.", + "body_url": null, + "published": "2023-08-03T19:55:34.133706Z", + "updated": "2024-07-27T04:31:07.865614Z", + "approved": "2023-11-14T21:23:20.562747Z", + "queued": "2023-11-12T08:46:20.672463Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 494696, + "followers": 183, + "categories": [ + "library", + "utility", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "8fRJMUtj", + "2GhadkWw", + "nxR2QJq9", + "ffxUpKO9", + "nWGTsnuc", + "1d7slIuK", + "RpsFZIW7", + "fqTBv1lv", + "zENaprO1", + "lSEqJCDB", + "xoeYggd1", + "CGuNKKtx", + "ivdfbiyU", + "282AV7oN", + "GSpxeHSW", + "v6zMMJ19", + "XEx1V1hn", + "5QR5PAS6", + "y49el8x8", + "Da1jDBpW", + "4ac1XgMH", + "eF4QuuoD", + "sOHwiEW6", + "g01HKP5e", + "SKnmNMCM", + "THwW3NlU", + "ZXXJfwMx", + "hnvpI0hn", + "DruvQkF7", + "jfpvoA4O", + "FNkZqfSj", + "jEiKH0Fw", + "BqlZtg2R", + "fvEGd9yu", + "d0nhXKYJ", + "IB3ZwwFr", + "oq7IWIMY", + "EKDwshle", + "WzBvUWrI", + "1qkHiTdN", + "uU1zP8Xq", + "S4aRnNaS", + "41JvRcQ8", + "H8ayf2w5", + "Tr6EqtWX", + "P9uKfQS0", + "VyXuOP1c", + "aw2MztJz", + "PxgLRee5", + "gPw9w4zf", + "t46P71pQ", + "ZeoIH2iV", + "cRMmOPJV", + "yl71RvCO", + "WpqMDbHg", + "il99xVpN", + "qE7KvqIs", + "leDMJ3Pd", + "M9bgOO4Z", + "i8IfVyvr", + "Nrw8onG0", + "UlXj63sO", + "6jQmTIAp", + "3o9iOcAT", + "vhukthve", + "Mk3pndkm", + "wg3B3m4l", + "p7fnTdUT", + "IK5OY4kh", + "6PZ4jxK5", + "gLnnBHzT", + "DzU5aqhv", + "zRADi2S7", + "di7edPqY", + "waP0noCS", + "6fbZrlp1", + "Lhb8AZxY" + ], + "icon_url": "https://cdn.modrinth.com/data/XaDC71GB/bc3425bcb318176adc7da99b6eec48787eed98d3.png", + "issues_url": "https://github.com/Apollounknowndev/lithostitched/issues", + "source_url": "https://github.com/Apollounknowndev/lithostitched/", + "wiki_url": "https://github.com/Apollounknowndev/lithostitched/wiki", + "discord_url": null, + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/apollodev" + } + ], + "gallery": [], + "color": 14471077, + "thread_id": "XaDC71GB", + "monetization_status": "monetized" + }, + "lmft-1.0.2+1.20-fabric": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.21" + ], + "id": "67kVxsaO", + "slug": "lmft", + "project_type": "mod", + "team": "8ac4FeWA", + "organization": null, + "title": "Load My F***ing Tags", + "description": "Prevents Incorrect Tag Entries from breaking an entrie Tag", + "body": "![Title Image](https://cdn.modrinth.com/data/cached_images/2755f12b234e5834d2ad31ef93a6eb745f29ab10.png)\n\n
\n\nA Simple mod that prevents Minecraft from throwing out an entire tag of its contents if one or more entries within the tag are invalid. There will be a message found within the game if the tags are \"cooked\" and more info similar to the base game can be found within the Log of the Server/Client the mod is running.\n\nThe reason behind this mod is the issue that some mod or data pack may add an invalid entry to let's say \"minecraft:mineable/pickaxe\" leading to all pickaxe mineable blocks being unmineable which breaks the game.\n\n**TLDR:** This mod prevents Mod/Datapack mistakes from breaking entire portions of the game. For more Info involved in either **Understanding** or **Silencing** the Ingame Chat Message go to the [Github Link](https://github.com/Dragon-Seeker/LoadMyFingTags/blob/3961e898550c4d996199bea0fa408a61e87e8dba/info.md) for more info\n\n## Note about Versioning\n- **[MultiLoader Update]** Ver1.0.1: Fix issue involved with mixins only applying client side\n### Forge\n- **[47.1.44 - 47.2.5]** Ver1.0.3: Fix issues with forge reimplementing Singleplayer Modmenu \n- **[47.2.6 and Up]** Ver1.0.4: Fix issue with forge patch bug with TagGroup.Loader with HashSet instead of LinkedHashSet", + "body_url": null, + "published": "2022-08-05T22:00:34.765207Z", + "updated": "2024-06-13T23:26:33.495157Z", + "approved": null, + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "CC0-1.0", + "name": "Creative Commons Zero v1.0 Universal", + "url": null + }, + "downloads": 449677, + "followers": 70, + "categories": [ + "cursed", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "A5wEWxlR", + "rNZ0t6Uw", + "aZVAynWJ", + "jRzEDln8", + "hQ1oeWSY", + "kvmMQprz", + "JBfVAVN4", + "FFjTILwW", + "PLx01D8M", + "Thotlx8T", + "XCG151p5", + "NbrNT9lM", + "IWpydKCV", + "uNo4PuMq", + "D7tQvUmL", + "Eei63n9t", + "G3tcpqxZ", + "9xw7byXk", + "U330gCJM", + "FMTxW0ZB", + "wtPd74Rj", + "3lVpp3ss", + "XJdD8eB6", + "u5vsX04C", + "8bpAnmFd" + ], + "icon_url": "https://cdn.modrinth.com/data/67kVxsaO/icon.png", + "issues_url": "https://github.com/Dragon-Seeker/LoadMyFuckingTags/issues", + "source_url": "https://github.com/Dragon-Seeker/LoadMyFuckingTags", + "wiki_url": null, + "discord_url": "https://discord.com/invite/xrwHKktV2d", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/blodhgarm" + } + ], + "gallery": [], + "color": 15694974, + "thread_id": "67kVxsaO", + "monetization_status": "monetized" + }, + "loadmyresources_fabric_1.0.4-1_MC_1.20": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.12", + "1.12.1", + "1.12.2", + "1.16.2", + "1.16.3", + "1.16.4", + "1.16.5", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4" + ], + "id": "TqCKvqjC", + "slug": "load-my-resources", + "project_type": "mod", + "team": "MQVnLgFq", + "organization": null, + "title": "Load My Resources", + "description": "Load resources on game start, like a resource pack, but enabled by default.", + "body": "# There will be no more updates for LMR. This mod is not maintained anymore. Please use other resource loader mods instead.\n\n
\n
\n
\n
\n
\n
\n
\n
\n\n\n\n\n\n\n

\n\n\n## Dependencies\n\n### Fabric\n- [Fabric API](https://modrinth.com/mod/fabric-api) (Only for Fabric)\n\n## About\u00a0\n\n\"Load My Resources\" is a client-side mod to automatically load resources like images and sounds on game start.
\nIt's like using a resource pack, but it is enabled by default and can't be disabled by the user.
\nOn top of that, it's hidden from the resource pack menu, so you don't need to worry about a useless pack entry!\n\n### How to Load Resources\n\nLoading resources is not very difficult, but if you absolutely don't know how resource packs work, please watch a YouTube tutorial first or this will be a bit hard for you.\n\n1. To generate all important directories and files, start the game one time with the mod installed and close it again.\n2. Open the\u00a0newly generated folder named 'resources' in your '.minecraft' directory. This is the directory the mod will load your resources from.\n3. Copy all resources you want to load to the 'resources' folder. If you want to load resources from a resource pack, copy everything from inside the pack's 'assets' folder to this directory.\n4. Start the game and you will now be able to use the loaded resources in mods and resources from a resource pack will be visible in game.\n\n**Nice To Know:**\nThe `resources` folder is like the `assets` folder in a resource pack. So namespaces work exactly the same as for a normal resource pack.\nFor example: If you put a texture in `resources/mytextures`, the namespace of textures inside the `mytextures` folder will be \"mytextures\".\n\n## Bug Reports and Requests\n\nYou can report bugs and request features either on\u00a0[GitHub](https://github.com/Keksuccino/Load-My-Resources/issues)\u00a0or via\u00a0[Discord](https://discord.gg/UzmeWkD)!\n\n## Modpacks\n\n\"Load My Resources\" can be freely used in modpacks.\n\n## Special Thanks\n\nTo my patrons:
\n- Kreezxil
\n- q!!!
\n- Jolihan
\n\n## Copyright\n\n\"Load My Resources\" Copyright \u00a9 2021 Keksuccino.
\n\"Load My Resources\" is licensed under KML (Keksuccino Mod License).
\nSee \"Custom License\" in the \"About Project\" section for more informations about the license.\n\n## Server Needed?\n\nYou need a Minecraft server to play with your friends but it's just too much work to setup one on your own?
\nNo problem, just rent an ready-to-use server and start playing in a snap!\n\nJust click on the image below and use the code **keksuccino** to get **25% off** your first month!\n\n

", + "body_url": null, + "published": "2022-11-23T22:33:01.363745Z", + "updated": "2023-09-24T04:55:52.476727Z", + "approved": "2022-11-25T05:08:18.090422Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "GPL-3.0-only", + "name": "GNU General Public License v3.0 only", + "url": null + }, + "downloads": 997210, + "followers": 116, + "categories": [ + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "wYEBYtRc", + "LS7zFG0F", + "ZvOOKnBo", + "7wNkRxrR", + "BlnsvnLh", + "ncfcapSO", + "XS4A9Aoo", + "ErYeBTin", + "7WP876Jm", + "gXzSBMIG", + "EQeLLVsf", + "q8si2roM", + "VA60FWUa", + "lsBN5Uh2", + "8MDPsQ9J", + "vO7R2WNi", + "L7MIAeTT", + "r45QO9Cd" + ], + "icon_url": "https://cdn.modrinth.com/data/TqCKvqjC/52f56718a4367dbf009524348c325bd86a81aed4.png", + "issues_url": "https://github.com/Keksuccino/Load-My-Resources/issues", + "source_url": "https://github.com/Keksuccino/Load-My-Resources", + "wiki_url": null, + "discord_url": "https://discord.gg/UzmeWkD", + "donation_urls": [], + "gallery": [], + "color": 263172, + "thread_id": "TqCKvqjC", + "monetization_status": "monetized" + }, + "mcda-5.0.2": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20", + "1.20.1" + ], + "id": "oMitr7dU", + "slug": "mcda", + "project_type": "mod", + "team": "pmaQylHH", + "organization": "KpEDz87R", + "title": "MC Dungeons Armors", + "description": "Bringing the armors of Minecraft Dungeons to Minecraft", + "body": "[\"Button](https://modrinth.com/mod/emi)\n[\"Button](https://modrinth.com/mod/fabric-api)\n\n# Introduction\nHave you ever wanted to have the armors from Minecraft Dungeons in your Minecraft world? Well, now that's possible! MC Dungeons Armors, also known as MCDA, aims to bring all of these armors, and more, from Minecraft Dungeons to Minecraft.\n\n# Content\n![An image showcasing all of the armor from MC Dungeons Armor on armor stands](https://cdn.modrinth.com/data/oMitr7dU/images/2d96ab733184d43a577f41d017ece5d9cc4e4680.png)\nRight now, there are 74 new armor sets to the game ranging from the Evocation Robes to mysterious Curious Armor. Most of the non-unique versions have crafting recipes in the Vanilla Recipe Book and they show up in Recipe Viewers such as [Roughly Enough Items](https://modrinth.com/mod/rei) or [EMI](https://modrinth.com/mod/emi). Whilst Recipe Viewers are not necessary, they are HIGHLY recommended.\n\n## Related Mods\nWould you like weapons as well? Well, check out [MC Dungeons Weapons](https://modrinth.com/mod/mcdw)!\n\n[![Banner and link indicating sponsorship by Bisect Hosting](https://www.bisecthosting.com/partners/custom-banners/9deaa8f0-11c2-41f1-8f4f-32d2493b0912.png)](https://www.bisecthosting.com/Timefall)\n\nWould you like artifacts as well? Well, check out [MC Dungeons Artifacts](https://modrinth.com/mod/mcdar)!\n\nDo you like the enchanting style of Dungeons? Check out [MC Dungeons Enchanting](https://modrinth.com/mod/mc-dungeons-enchanting)!\n\n# Attributions/Special Thanks\nMC Dungeons Armor could not have ever existed without the amazing people mentioned below. They were instrumental to the inspiration and education needed to produce MC Dungeons Armor and the rest of MCDX (the MC Dungeons Suite).\n\n## SeaOfPixels\nThe continuing improvement to the visuals of this mod would not be possible without [Sea of Pixels](https://powerups4u.wixsite.com/seaofpixels). He has licensed his amazing art for MC Dungeons Armor and has worked with us to balance out some of the issues with MCDA as well. SeaOfPixels has allowed for his amazing models and textures from his resource pack [New Default+](https://www.curseforge.com/minecraft/texture-packs/newdefaultplus) to be used in MCDA. Please show him some support and check it out! If you like CIT texture packs, I'm sure that you'll have a blast!\n\n## SattesKrokodil\nSattes made the amazing drop art for the various mobs as well as the crafting art. Check him out at his [Patreon](https://www.patreon.com/sattes) or check out the [Adventure Pack](https://www.curseforge.com/minecraft/modpacks/fabric-adventure-pack)! We'd love to see you over there!\n\n## Fourmisain\nFourmisain has been amazing in helping me fix an untold number of errors in my code and being responsible for the major rework for 1.2.0. I have learnt a great deal from them and am greatly indebted to their kindness.\n\n## BackupCup\nCup is an amazing pixel artist and is a budding Kotlin programmer. Thanks to them, we have a new suite of icons for MCDX and the icon for MCDA is thanks to them! Please check out their projects [here](https://modrinth.com/user/BackupCup)!\n\n# Localisations/Translations\nWould you like to have MC Dungeon Armor translated into your language? Please submit your translation on the GitHub page and I'd be glad to add it!\n- English - `en_us` - [Chronos_Sacaria](https://modrinth.com/user/Chronos_Sacaria)\n- Korean - `ko_ko` - gyular\n- Simplified Chinese - `cn_zh` - Hastag233\n\n# Patrons\nWithout my patrons, I would not be able to devote as much time as I do to making these mods.\n\n## Special thanks to\n- Deona (Custom)\n- 7z99 (Claymore)\n- EmmyAllEars (Claymore)\n- purejosh (Sword)\n- OnlyANeko (Sword)\n\n# FAQ\n- Q: Why does MCDA not work with Optifine?\n - A: Optifine's code is closed source and extremely invasive. This is not a bad thing, in and of itself; but it makes it almost impossible to troubleshoot anything whilst still respecting the licencing that sp614x uses. So, out of respect for them so as to not have to explore their code without permission, we simply do not support it. Please consider the following alternatives:\n - FPS Enhancement and Optimisations -- [Sodium](https://modrinth.com/mod/sodium) (Fabric); [Rubidium](https://modrinth.com/mod/rubidium) (Forge)\n - Shaders -- [Iris](https://modrinth.com/mod/iris) (Fabric); [Oculus](https://modrinth.com/mod/oculus) (Forge)\n - Rendering Compatibility -- [Indium](https://modrinth.com/mod/indium) (Fabric); [Reforgium](https://modrinth.com/mod/reforgium) (Forge)\n- Q: Can I use your mod in my modpack?\n - A: Absolutely! I only ask that you provide a link back to this page.\n- Q: I've seen your mod on other sites. Did you post it and are they safe?\n - A: I have not, nor do I plan to, post my mod on any other sites than Modrinth, Curseforge or our GitHub page. If you have downloaded this mod from somewhere else: \n 1. It isn't from us \n 2. It may have some kind of malicious files or have been modified in some way. I urge you to delete the file, run a full virus and malware scan and, if you want to use MC Dungeons Artifacts, come and download it on Modrinth, CurseForge or from GitHub.\n- Q: 1.12.2?\n - A: Given the massive strides that have been made with Minecraft's code since 1.12 and the subsequent changes to the underlying code, a 1.12.x port is simply untenible. Please see this [link](https://howoldisminecraft1122.today/) for more information.\n- Q: Will the mod be ported to 1.x.x?\n - A: MC Dungeons Weapons, MC Dungeons Armors and MC Dungeons Artifacts are only developed for the latest version of Minecraft. Backports should not be expected.\n- Q. Forge?\n - A. MC Dungeons Artifacts is compatible with Forge by using the following mods: [Sinytra Connector](https://modrinth.com/mod/connector), [Connector Extras](https://modrinth.com/mod/connector-extras) and the [Forgified Fabric API](https://modrinth.com/mod/forgified-fabric-api) which are being developed by Su5eD. Please make sure to follow all of their instructions in order to have the best experience.\n - Note: If you wish to use [Clumps](https://modrinth.com/mod/clumps), please make sure to use the Fabric version as we rely on a method that is not present in the Forge version.\n - If you are looking for a mod that was specially built for Forge with similar content, please consider checking out [Dungeons Gear](https://www.curseforge.com/minecraft/mc-mods/dungeons-gear) by the_infamous_1.", + "body_url": null, + "published": "2023-11-13T05:35:15.060865Z", + "updated": "2024-04-21T00:50:35.088294Z", + "approved": "2023-11-15T02:08:58.040580Z", + "queued": "2023-11-13T05:46:45.409163Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-Timefall-Development-License-1.1", + "name": "", + "url": "https://github.com/Timefall-Development/Timefall-Development-Licence/blob/main/TimefallDevelopmentLicense1.1.txt" + }, + "downloads": 333693, + "followers": 125, + "categories": [ + "adventure", + "equipment", + "magic" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "NoLGJgGN", + "kOZVEfRn" + ], + "icon_url": "https://cdn.modrinth.com/data/oMitr7dU/066c6db2a97f7f7fb4806406b45c93a0a7f5ae79.png", + "issues_url": "https://github.com/chronosacaria/MCDungeonsArmors/issues", + "source_url": "https://github.com/chronosacaria/MCDungeonsArmors", + "wiki_url": "https://github.com/chronosacaria/MCDungeonsArmors/wiki", + "discord_url": "https://discord.gg/7RCRy2CuyC", + "donation_urls": [ + { + "id": "paypal", + "platform": "Paypal", + "url": "https://www.paypal.com/cgi-bin/webscr?return=https://www.curseforge.com/minecraft/mc-mods/mcdw&cn=Add+special+instructions+to+the+addon+author()&business=chronos.droid%40gmail.com&bn=PP-DonationsBF:btn_donateCC_LG.gif:NonHosted&cancel_return=https://www.curseforge.com/minecraft/mc-mods/mcdw&lc=US&item_name=MC+Dungeons+Weapons+(from+www.curseforge.com)&cmd=_donations&rm=1&no_shipping=1¤cy_code=USD" + }, + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/chronosacaria" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/oMitr7dU/images/2d96ab733184d43a577f41d017ece5d9cc4e4680.png", + "featured": true, + "title": "Armors Showcase", + "description": "This image shows all of the armors added by MC Dungeons Armors, totaling 74 armor sets.", + "created": "2023-11-13T05:42:45.919327Z", + "ordering": 0 + } + ], + "color": 4004636, + "thread_id": "IWwoXcQn", + "monetization_status": "monetized" + }, + "mcdw-9.0.4": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20", + "1.20.1" + ], + "id": "FZmGDE43", + "slug": "mcdw", + "project_type": "mod", + "team": "Rw4Hj7fl", + "organization": "KpEDz87R", + "title": "MC Dungeons Weapons", + "description": "Adds the weapons, tools and weapon enchantments from Minecraft Dungeons", + "body": "[\"Button](https://modrinth.com/mod/emi)\n[\"Button](https://modrinth.com/mod/fabric-api)\n\n# Introduction\nHave you ever wanted to have the weapons from Minecraft Dungeons in your Minecraft world? Well, now that's possible! MC Dungeons Weapons (MCDW) aims to bring all of these weapons, and more, from Minecraft Dungeons to Minecraft.\n\n# Content\n![An image of multiple rows and columns showcasing the weapons from MC Dungeons Weapons](https://cdn.modrinth.com/data/FZmGDE43/images/ce47b733d99279758a579a1da74a42228844cf14.png)\nRight now, there are about 150 weapons added to the game ranging from flails to katanas to crossbows and bows. They all have crafting recipes in the Vanilla Recipe Book and they show up in Recipe Viewers such as [Roughly Enough Items](https://modrinth.com/mod/rei) or [EMI](https://modrinth.com/mod/emi). Whilst Recipe Viewers are not necessary, they are HIGHLY recommended.\n\n## Related Mods\nWould you like weapons as well? Well, check out [MC Dungeons Armors](https://modrinth.com/mod/mcda)!\n\nWould you like artifacts as well? Well, check out [MC Dungeons Artifacts](https://modrinth.com/mod/mcdar)!\n\nDo you like the enchanting style of Dungeons? Check out [MC Dungeons Enchanting](https://modrinth.com/mod/mc-dungeons-enchanting)!\n\n[![Banner and link indicating sponsorship by Bisect Hosting](https://www.bisecthosting.com/partners/custom-banners/9deaa8f0-11c2-41f1-8f4f-32d2493b0912.png)](https://www.bisecthosting.com/Timefall)\n\n# Attributions/Special Thanks\nMC Dungeons Weapons could not have ever existed without the amazing people mentioned below. They were instrumental to the inspiration and education needed to produce MC Dungeons Weapons and the rest of MCDX (the MC Dungeons Suite).\n\n## SeaOfPixels\nThe continuing improvement to the visuals of this mod would not be possible without [Sea of Pixels](https://powerups4u.wixsite.com/seaofpixels). He has licensed his amazing art for MC Dungeons Weapons and has worked with us to balance out some of the issues with MCDW as well. SeaOfPixels has allowed for his amazing models and textures from his resource pack [New Default+](https://www.curseforge.com/minecraft/texture-packs/newdefaultplus) to be used in MCDW. Please show him some support and check it out! If you like CIT texture packs, I'm sure that you'll have a blast!\n\n## Kai1907\nThis mod was inspired by the amazing CIT texturepack by Kai1907, which allows you to have (at least visually) these weapons as well as a variety of other items. Kai1907 allowed for his art to be used in the earlier versions of this mod. Please show him some support and check out his [awesome texturepack](https://www.planetminecraft.com/texture-pack/minecraft-dungeons-textures-for-minecraft-java-edition/) and his [YouTube channel](https://www.youtube.com/channel/UCDWE3OLgQv5w8E0WcNrzWyA).\n\n## LordDeatHunter\nFor helping with a massive amount of aspects of MCDW including the configs and teaching Chronos many of the foundations of Java. LordDeatHunter is probably most well known for [Fabric Waystones](https://modrinth.com/mod/fwaystones), which is definitely worth checking out!\n\n## BackupCup\nCup is an amazing pixel artist and is a budding Kotlin programmer. Thanks to them, we have a new suite of icons for MCDX and the icon for MCDW is thanks to them! Please check out their projects [here](https://modrinth.com/user/BackupCup)!\n\n# Localisations/Translations\nWould you like to have MC Dungeon Weapons translated into your language? Please submit your translation on the GitHub page and I'd be glad to add it!\n- English - `en_us` - Chronos_Sacaria\n- English - `en_gb` - Chronos_Sacaria\n- German - `de_de` - Kai1907 & SattesKrokodil (Incomplete as of version 2.0.2)\n- Korean - `ko_ko` - Soochaehwa & gyular\n- Portuguese - `pt_pt` - Chronos_Sacaria (Incomplete as of version 2.0.2)\n- Simplified Chinese - `cn_zh` - Chronos_Sacaria & Kasualix\n- Spanish - `es_es` - Chronos_Sacaria (Incomplete as of version 2.0.2)\n- Russian - `ru_ru` - realpeterpet (Incomplete as of version 2.0.2)\n\n# Showcases\nWe are eternally grateful to those who took the time out of their schedules to cover our mods. These are a few of the showcases that we have found.\n\n
\nClick here to see showcase videos.\n\n## Bursty\n- Title: NEW WEAPONS MOD IN MINECRAFT (Mod Showcase | MC Dungeons Weapons 1.16.5) \n- Date: 24 Febrary, 2021\n> \n\n## thebluecrusader\n- Title: Top 10 Minecraft Weapons Mods \n- Date: 8 January, 2021\n- Timestamp: 6:32\n> \n\n## Mister Echo\n- Title: 10 New Mods For Minecraft 1.16.3 | Fabric\n- Date: 23 October, 2020\n- Timestamp: 4:39\n> \n\n## Boodlyneck\n- Title: Top 10 Minecraft Mods Of The Week | Risk of Rain Mod, MC Dungeons Weapons, Chat Heads, and More!\n- Date: 16 September, 2020\n- Timestamp: 2:17\n> \n\n
\n\n# Patrons\nWithout my patrons, I would not be able to devote as much time as I do to making these mods.\n\n## Special thanks to\n- Deona (Custom)\n- 7z99 (Claymore)\n- EmmyAllEars (Claymore)\n- purejosh (Sword)\n- OnlyANeko (Sword)\n\n# FAQ\n- Q: Why does MCDW not work with Optifine?\n - A: Optifine's code is closed source and extremely invasive. This is not a bad thing, in and of itself; but it makes it almost impossible to troubleshoot anything whilst still respecting the licencing that sp614x uses. So, out of respect for them so as to not have to explore their code without permission, we simply do not support it. Please consider the following alternatives:\n - FPS Enhancement and Optimisations -- [Sodium](https://modrinth.com/mod/sodium) (Fabric); [Rubidium](https://modrinth.com/mod/rubidium) (Forge)\n - Shaders -- [Iris](https://modrinth.com/mod/iris) (Fabric); [Oculus](https://modrinth.com/mod/oculus) (Forge)\n - Rendering Compatibility -- [Indium](https://modrinth.com/mod/indium) (Fabric); [Reforgium](https://modrinth.com/mod/reforgium) (Forge)\n- Q: Can I use your mod in my modpack?\n - A: Absolutely! I only ask that you provide a link back to this page.\n- Q: I've seen your mod on other sites. Did you post it and are they safe?\n - A: I have not, nor do I plan to, post my mod on any other sites than Modrinth, Curseforge or our GitHub page. If you have downloaded this mod from somewhere else: \n 1. It isn't from us \n 2. It may have some kind of malicious files or have been modified in some way. I urge you to delete the file, run a full virus and malware scan and, if you want to use MC Dungeons Weapons, come and download it on Modrinth, CurseForge or from GitHub.\n- Q: 1.12.2?\n - A: No, just no.

\n- Q. Forge?\n - A. MC Dungeons Weapons is compatible with Forge by using the following mods: [Sinytra Connector](https://modrinth.com/mod/connector), [Connector Extras](https://modrinth.com/mod/connector-extras) and the [Forgified Fabric API](https://modrinth.com/mod/forgified-fabric-api) which are being developed by Su5eD. Please make sure to follow all of their instructions in order to have the best experience. If you wish to use [Clumps](https://modrinth.com/mod/clumps), please make sure to use the Fabric version as we rely on a method that is not present in the Forge version.", + "body_url": null, + "published": "2023-11-12T22:32:16.148279Z", + "updated": "2024-04-21T16:41:28.330335Z", + "approved": "2023-11-15T02:09:57.646381Z", + "queued": "2023-11-13T05:12:45.317925Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-Timefall-Development-License-1.2", + "name": "", + "url": "https://github.com/Timefall-Development/Timefall-Development-Licence/blob/main/TimefallDevelopmentLicense1.2.txt" + }, + "downloads": 238805, + "followers": 164, + "categories": [ + "adventure", + "equipment", + "magic" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "F4Nb4xBv", + "NVyPECBw", + "AhyZP1zF", + "O8JgP5eC", + "yybXHLu2", + "S2yuB3CX" + ], + "icon_url": "https://cdn.modrinth.com/data/FZmGDE43/278575796297e7198422c51c8096ed7dba613bf1.png", + "issues_url": "https://github.com/chronosacaria/MCDungeonsWeapons/issues", + "source_url": "https://github.com/chronosacaria/MCDungeonsWeapons", + "wiki_url": "https://github.com/chronosacaria/MCDungeonsWeapons/wiki", + "discord_url": "https://discord.gg/7RCRy2CuyC", + "donation_urls": [ + { + "id": "paypal", + "platform": "Paypal", + "url": "https://www.paypal.com/cgi-bin/webscr?return=https://www.curseforge.com/minecraft/mc-mods/mcdw&cn=Add+special+instructions+to+the+addon+author()&business=chronos.droid%40gmail.com&bn=PP-DonationsBF:btn_donateCC_LG.gif:NonHosted&cancel_return=https://www.curseforge.com/minecraft/mc-mods/mcdw&lc=US&item_name=MC+Dungeons+Weapons+(from+www.curseforge.com)&cmd=_donations&rm=1&no_shipping=1¤cy_code=USD" + }, + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/chronosacaria" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/FZmGDE43/images/ce47b733d99279758a579a1da74a42228844cf14.png", + "featured": true, + "title": "Weapons Showcase", + "description": "This image shows all of the weapons (and shields) added by MC Dungeons Weapons, totaling 150 items.", + "created": "2023-11-13T05:11:15.774927Z", + "ordering": 0 + } + ], + "color": 4864050, + "thread_id": "MuY2sCPE", + "monetization_status": "monetized" + }, + "mcw-bridges-3.0.0-mc1.20.1fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.17.1", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.6", + "1.21" + ], + "id": "GURcjz8O", + "slug": "macaws-bridges", + "project_type": "mod", + "team": "w0R55u0J", + "organization": null, + "title": "Macaw's Bridges", + "description": "A simple mod that adds a lot of bridges!", + "body": "![Banner image](https://i.imgur.com/0c6CcpY.png)\n\n[![YouTube](https://img.shields.io/youtube/channel/subscribers/UCc_kqzt253fnG2RHW_CZL2A?label=Youtube&style=for-the-badge)](https://www.youtube.com/channel/UCc_kqzt253fnG2RHW_CZL2A)[![](https://img.shields.io/badge/-%20-ffffff)![Twitter](https://img.shields.io/twitter/follow/sketch_macaw?color=6eb7ec&label=Twitter&logo=twitter&style=for-the-badge)![](https://img.shields.io/badge/-%20-ffffff)](https://twitter.com/sketch_macaw)[![Discord](https://img.shields.io/discord/645360921673465857?color=a97db2&logo=discord&logoColor=f&style=for-the-badge)](https://discord.gg/RFQqDEb)[![Crafting Recipes](https://img.shields.io/badge/-Crafting%20Recipes-bc8f56?style=for-the-badge)](https://docs.google.com/spreadsheets/d/1dBcTfrt-MH91NuCmJzqbFDjrLftuKMc08fp4bjGJCD4/edit#gid=712741639)\n\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![About](https://i.imgur.com/A1pclRa.png)\n\nThis simple mod adds a variety of bridges. The newest version improves the in game models for Bridge Stairs. Bridges can be lighted with torches.\n\nEvery bridge model has been improved and changed to fit even better in vanila gameplay.\n\nWe recommend using the newest 2.1.0 since it improves performance and has lots of improvements.\n\nSuggest your ideas on our Macaw's discord.\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![Latest showcase](https://i.imgur.com/zQ7I8me.png)\n\nMacaw's Bridges Video Showcase\n\n\n\n[![Bisect Hosting](https://www.bisecthosting.com/images/CF/Macaw/BH_MxBH_PromoCard.webp)](https://bisecthosting.com/sketchmacaw)\n\nDo you need a server? Click on the picture above, use our code **sketchmacaw** to get **25%** off your first month and enjoy playing!\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![FAQ](https://i.imgur.com/EpKoS1L.png)\n\nQ: Do you have any plans on backporting to 1.15.2 and lower?\\\nA: Very unlikely, but a last 1.12.2 version could happen at some time..\n\nQ: Can I use your mods in my modpack?\\\nA: Yes, just credit us and with a reference to the modrinth page\n\nQ: I have a translation for you, where can I send it to you?\\\nA: Either on Github or on our discord server\n\n![Showcase of several bridges](https://i.imgur.com/XnQRzlz.jpg)", + "body_url": null, + "published": "2024-01-01T09:26:33.441504Z", + "updated": "2024-06-23T18:26:53.531530Z", + "approved": "2024-01-03T23:59:10.580627Z", + "queued": "2024-01-01T12:22:02.950104Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 249515, + "followers": 190, + "categories": [ + "decoration" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "zLtgy2rG", + "HI6WJGQE", + "eNX5u5aW", + "Qc9tzEck", + "mfN4yVTk", + "ougynOoY", + "hKTOYjx6", + "xDp8RWxu", + "2VOygDDG", + "mjFRISAW", + "K88QqM25", + "F8fZ34Sg", + "uYs0smB9", + "HBZGu5Qb", + "TyGDKtKH", + "ogkcvRLX", + "gQHOVrEM", + "x2MEucgu", + "BwMMYQtB", + "Gdf5KsHI", + "wStah53Z", + "zRRtK7LF", + "IbASu89q", + "aHNnBQoE", + "GWftaLXd", + "a1E8AqWH", + "rJ73u3oK", + "C8JESd7f", + "o54BbLGu", + "BIJCgFmW", + "6bhFbJb7", + "LIaILfCj", + "RmsMXs3r", + "VZGPrKPz", + "yPCnUgRo", + "Pn3oxtSu", + "NrpWKqxU", + "VfDLkh76", + "5uZ6Lxp0", + "1ZXAEtW7", + "CtlYxnDG", + "KE14arGU", + "WoCEg3Ld", + "HyMapCuB", + "bdEE2oTf", + "fkY7SoBJ", + "wJ0BHouQ", + "59xLRsEP", + "tkVsXdkR", + "15a5rGjy", + "oqtmg6Gh", + "FVMSgss6", + "FBpqFfP8", + "cIaEQf6S", + "TzxeT8AQ", + "rItsmpA6", + "sm02rWlg", + "xUDRH1iB", + "T0o3wej6", + "x5GG4Scv", + "FgJCDfWc", + "sQWHD7ii", + "z9hZ7nLC", + "nVePcMH1", + "cztsMcX7", + "AgDD7usi" + ], + "icon_url": "https://cdn.modrinth.com/data/GURcjz8O/87a58a540d2671e35ec28fb0e96fb5ae5f775bcb.jpeg", + "issues_url": "https://github.com/sketchmacaw/MacawsModsIssues/issues", + "source_url": "https://github.com/sketchmacaw/Bridges", + "wiki_url": null, + "discord_url": "https://discord.gg/RFQqDEb", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/GURcjz8O/images/4c9b410e710e6a3043e95558fb09f063d4cfab92.jpeg", + "featured": false, + "title": "Red Asian Bridges", + "description": null, + "created": "2024-04-06T14:42:51.489773Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/GURcjz8O/images/536f7d4be5cfd15a0e6596ce75ef8b29f85d4750.png", + "featured": false, + "title": "Iron Bridge", + "description": null, + "created": "2024-01-01T11:56:39.196743Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/GURcjz8O/images/5494b985d966a22cc9f3cede79001eb0b62dd83c.jpeg", + "featured": false, + "title": "Cherry Rope Bridge Stairs", + "description": null, + "created": "2024-04-06T14:45:16.555507Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/GURcjz8O/images/58dc9d274032cbdc9ed2a7af96a58974fca5185c.jpeg", + "featured": false, + "title": "Oak Rope Bridge", + "description": null, + "created": "2024-01-01T11:55:57.130859Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/GURcjz8O/images/7104bcf708e033480899a680eb1402f921f1148b.jpeg", + "featured": false, + "title": "Glass Bridge", + "description": null, + "created": "2024-04-06T14:43:31.946150Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/GURcjz8O/images/8a676dbe6ac4e5c84b4a122184058f3829463abf.jpeg", + "featured": false, + "title": "Rail Bridge", + "description": null, + "created": "2024-04-06T14:44:44.317876Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/GURcjz8O/images/c35c3eec6ec17c98b201d678dafec9a703307afe.jpeg", + "featured": false, + "title": "Stone Balustrade Bridges", + "description": null, + "created": "2024-04-06T14:44:27.168714Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/GURcjz8O/images/dc5340f2d06e2248129ac3e6bf806fd97ea71670.jpeg", + "featured": false, + "title": "Balcony made from Bridges", + "description": "Using Pliers/Shears", + "created": "2024-04-06T14:43:56.570413Z", + "ordering": 0 + } + ], + "color": 5130018, + "thread_id": "kqgFdRKO", + "monetization_status": "monetized" + }, + "mcw-doors-1.1.1fabric-mc1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.17.1", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.6", + "1.21" + ], + "id": "kNxa8z3e", + "slug": "macaws-doors", + "project_type": "mod", + "team": "ybsu7PSy", + "organization": null, + "title": "Macaw's Doors", + "description": "Adds vanilla doors with every wood color and new unique doors!\nSuch as western, garage, shoji and more...!", + "body": "![Banner image](https://i.imgur.com/AJLCOBN.png)\n\n[![YouTube](https://img.shields.io/youtube/channel/subscribers/UCc_kqzt253fnG2RHW_CZL2A?label=Youtube&style=for-the-badge)](https://www.youtube.com/channel/UCc_kqzt253fnG2RHW_CZL2A)[![](https://img.shields.io/badge/-%20-ffffff)![Twitter](https://img.shields.io/twitter/follow/sketch_macaw?color=6eb7ec&label=Twitter&logo=twitter&style=for-the-badge)![](https://img.shields.io/badge/-%20-ffffff)](https://twitter.com/sketch_macaw)[![Discord](https://img.shields.io/discord/645360921673465857?color=a97db2&logo=discord&logoColor=f&style=for-the-badge)](https://discord.gg/RFQqDEb)[![Crafting Recipes](https://img.shields.io/badge/-Crafting%20Recipes-bc8f56?style=for-the-badge)](https://docs.google.com/spreadsheets/d/1dBcTfrt-MH91NuCmJzqbFDjrLftuKMc08fp4bjGJCD4/edit#gid=1578096346)\n\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![About](https://i.imgur.com/A1pclRa.png)\n\nDo you ever wanted each vanilla door to have more wood variations? Or do you just want some new unique doors?\n\nWell, if so I present you Macaw's Doors. This mod gives you the opportunity to make vanila doors with every wood\n\ncolor. I includes new doors too, for example: Shoji Doors, Metal Doors, Jail Doors, Modern Doors and more!\n\nSuggest your ideas on our Macaw's discord.\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![Latest showcase](https://i.imgur.com/zQ7I8me.png)\n\nMacaw's Doors Video Showcase\n\n\n\n[![Bisect Hosting](https://www.bisecthosting.com/images/CF/Macaw/BH_MxBH_PromoCard.webp)](https://bisecthosting.com/sketchmacaw)\n\nDo you need a server? Click on the picture above, use our code **sketchmacaw** to get **25%** off your first month and enjoy playing!\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![FAQ](https://i.imgur.com/EpKoS1L.png)\n\nQ: Do you have any plans on backporting to 1.15.2 and lower?\\\nA: Very unlikely, but a last 1.12.2 version could happen at some time..\n\nQ: Can I use your mods in my modpack?\\\nA: Yes, just credit us and with a reference to the modrinth page\n\nQ: I have a translation for you, where can I send it to you?\\\nA: Either on Github or on our discord server\n\n![Showcase of several doors](https://i.imgur.com/tpZJ9zN.png)", + "body_url": null, + "published": "2024-01-01T09:25:19.983191Z", + "updated": "2024-06-17T21:04:05.105088Z", + "approved": "2024-01-03T23:59:02.513223Z", + "queued": "2024-01-01T13:27:50.238178Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 276165, + "followers": 190, + "categories": [ + "decoration" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "D0rTcPc8", + "AMfV6IAY", + "N9re4MxY", + "znZjiFjQ", + "k6PORD0F", + "GNClhm1H", + "jfOY2MKF", + "dPHheWCy", + "ZGiWmpnm", + "Qfal780Q", + "xpPDfH9N", + "59q2sUuL", + "XJeOGTB7", + "hGvEai87", + "KE2ENpbu", + "ksJe1gRJ", + "EuLEMCnZ", + "CA7hh3ol", + "XlQ9AgFb", + "T1hDL3hO", + "fyfgqcEY", + "1FZcvrDQ", + "tGEnJel7", + "67PzxbmS", + "ztoVVGpV", + "XXKpwS7b", + "8f02cb6I", + "OuPkqSip", + "Frke0PbW", + "2TnpPrKu", + "PocBUElt", + "m52BKTGA", + "HWM460ct", + "MxMc91xt", + "EIIW53pM", + "vkuwEpj0", + "sL9LzGyl", + "2LYKNIqr", + "Vk2YeeAA", + "LRi67f6j", + "dVNlylHy", + "DU4u5ygj", + "SQ9ViK34", + "1AKQpSne", + "5FkuhdCk", + "TVQhdG9M", + "2YV1aY1a", + "oao4zWhP", + "ARwEgUAh", + "mL5UQn4q", + "EEXUQSna", + "Osvj0z4A", + "mtchaDbr", + "E6jw3w8E", + "tc3S2JdB", + "VDLlSnZ4", + "gDfCSyIj" + ], + "icon_url": "https://cdn.modrinth.com/data/kNxa8z3e/c6fa012a03885a547e3c1bd7f0d4a56b2bed8105.jpeg", + "issues_url": "https://github.com/sketchmacaw/MacawsModsIssues/issues", + "source_url": "https://github.com/sketchmacaw/MacawsDoors", + "wiki_url": null, + "discord_url": "https://discord.gg/RFQqDEb", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/kNxa8z3e/images/5a869c7a3cb8c4f76c460c8af30e2abbf486598d.png", + "featured": false, + "title": "Metal Doors", + "description": null, + "created": "2024-01-01T13:11:50.912186Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/kNxa8z3e/images/6d79021f62ff70ad2ba5616f973bf60f00d79c8c.jpeg", + "featured": false, + "title": "Glass Stable Doors", + "description": null, + "created": "2024-01-01T13:11:30.123372Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/kNxa8z3e/images/785f8d436aceba95b32475cb8d19cdefbd532245.png", + "featured": false, + "title": "Wooden Glass Doors", + "description": null, + "created": "2024-01-01T13:11:06.351702Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/kNxa8z3e/images/7bfdbeeda4dc9155c332a697bdff0a6ef3e31149.png", + "featured": false, + "title": "Vanila doors in another color", + "description": null, + "created": "2024-01-01T13:12:20.244887Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/kNxa8z3e/images/aa69563528cde0cc276a927705bf40de40c87da4.png", + "featured": false, + "title": "Shoji Doors", + "description": null, + "created": "2024-01-01T13:09:20.834562Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/kNxa8z3e/images/e3106c0960fef2414bba7c9361f4ec988b5f4db9.png", + "featured": false, + "title": "Garage Doors", + "description": null, + "created": "2024-01-01T13:10:00.746639Z", + "ordering": 0 + } + ], + "color": 6394998, + "thread_id": "glJbXLH5", + "monetization_status": "monetized" + }, + "mcw-fences-1.1.2-mc1.20.1fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.17.1", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.6", + "1.21" + ], + "id": "GmwLse2I", + "slug": "macaws-fences-and-walls", + "project_type": "mod", + "team": "bjx1C3qM", + "organization": null, + "title": "Macaw's Fences and Walls", + "description": "Adds new vanilla styled fences, walls and gates!", + "body": "![Banner image](https://i.imgur.com/PPlc2JI.png)\n\n[![YouTube](https://img.shields.io/youtube/channel/subscribers/UCc_kqzt253fnG2RHW_CZL2A?label=Youtube&style=for-the-badge)](https://www.youtube.com/channel/UCc_kqzt253fnG2RHW_CZL2A)[![](https://img.shields.io/badge/-%20-ffffff)![Twitter](https://img.shields.io/twitter/follow/sketch_macaw?color=6eb7ec&label=Twitter&logo=twitter&style=for-the-badge)![](https://img.shields.io/badge/-%20-ffffff)](https://twitter.com/sketch_macaw)[![Discord](https://img.shields.io/discord/645360921673465857?color=a97db2&logo=discord&logoColor=f&style=for-the-badge)](https://discord.gg/RFQqDEb)[![Crafting Recipes](https://img.shields.io/badge/-Crafting%20Recipes-bc8f56?style=for-the-badge)](https://docs.google.com/spreadsheets/d/1dBcTfrt-MH91NuCmJzqbFDjrLftuKMc08fp4bjGJCD4/edit#gid=817991757)\n\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![About](https://i.imgur.com/A1pclRa.png)\n\nWe all know Minecraft could use more styled fences, walls and gates. Well I guess I've got good news for you! This mod adds new vanila styled fences, walls and gates.\n\nExpect more stuff to come with future updates, I read every suggestion.\n\nSuggest your ideas on our Macaw's discord.\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![Latest showcase](https://i.imgur.com/zQ7I8me.png)\n\nMacaw's Fences Video Showcases\n\n\n\n\n\n[![Bisect Hosting](https://www.bisecthosting.com/images/CF/Macaw/BH_MxBH_PromoCard.webp)](https://bisecthosting.com/sketchmacaw)\n\nDo you need a server? Click on the picture above, use our code **sketchmacaw** to get **25%** off your first month and enjoy playing!\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![FAQ](https://i.imgur.com/EpKoS1L.png)\n\nQ: Do you have any plans on backporting to 1.15.2 and lower?\\\nA: Very unlikely, but a last 1.12.2 version could happen at some time..\n\nQ: Can I use your mods in my modpack?\\\nA: Yes, just credit us and with a reference to the modrinth page\n\nQ: I have a translation for you, where can I send it to you?\\\nA: Either on Github or on our discord server\n\n![Showcase of several fences](https://i.imgur.com/AVkDUe1.jpg)", + "body_url": null, + "published": "2024-01-01T09:18:43.926504Z", + "updated": "2024-06-18T20:10:56.199508Z", + "approved": "2024-01-03T23:59:00.089318Z", + "queued": "2024-01-01T13:07:25.274144Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 411265, + "followers": 222, + "categories": [ + "decoration" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "BHh7EivA", + "5SA7u6MX", + "pGjTZ8JA", + "PQIvNOGA", + "bOg7F7Bj", + "3pr1kFax", + "CUHvTrx4", + "xK9ysbUG", + "4A2WUKU8", + "UdNXHYPs", + "oT5rCPY9", + "6eB7X02R", + "ygeaNwTP", + "xQoh1wbZ", + "WIVPaGr7", + "umtnlbVj", + "mQ7TM9QG", + "hZgvCcJC", + "YWcYsphS", + "ZNh9gLlJ", + "LXq9EJGw", + "MtQxn8wI", + "6LaRjQji", + "Qkpziwe7", + "PMpBNbFE", + "J2X0vMeF", + "Ia5efrbc", + "7NpufuVO", + "GcinzQRY", + "MV8ozLws", + "h3t6e9Yk", + "yA9QXRM6", + "2gsx7dVp", + "pm7OsY4i", + "qKlDTxlj", + "jrLMucQm", + "lRt0j7WU", + "7JkeRr9j", + "h47tIys1", + "aK6POPdw", + "a0v7Iz1Z", + "k6jigsPG", + "dOrhsrZK", + "DxnBRgcw", + "RrR8Pwu7", + "t8KnrxeQ", + "hO2zM4vF", + "lvHjqFEA", + "5cg6KZxV", + "jZ7OrjPp", + "92EUFgRu", + "FHpOhgrQ", + "q47SF4R7", + "rptf2Q8q", + "MmECeuph", + "lYhF5HZw", + "Xtva90Ai", + "HdCtpMlZ", + "AJiwAliw", + "Gz6E24f0", + "Pz0YJ2La", + "3HygFTr9", + "jIp785Yh", + "aYDMLE1f", + "NvgqUe3y", + "QYSzzTPO", + "doP9epBe", + "staUN0Wx", + "bLXHgpp9", + "3ne8U82X", + "C7fFRqFy", + "OgKY11IG", + "1wrqNArj", + "4XtIN9lN", + "crc0pE1c", + "a5zApdGh", + "BtSruCyL", + "XkmjgZ3D", + "QvxBVL4V", + "Xl771rOe", + "ZhW8ZV8t", + "IFnHZuRE", + "xFkjkjc8", + "4a5DsuCw", + "3rkRpeeC", + "NxAYnOkJ", + "1PgeUdfQ", + "d7ponc9m", + "ojJTJmhx", + "aSLh0uH8", + "wlBMRxdf" + ], + "icon_url": "https://cdn.modrinth.com/data/GmwLse2I/28e06d4ddbe6fbf5b8eb0ff7b64a9aad1af34e32.png", + "issues_url": "https://github.com/sketchmacaw/MacawsModsIssues/issues", + "source_url": "https://github.com/sketchmacaw/Fences", + "wiki_url": null, + "discord_url": "https://discord.gg/RFQqDEb", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/GmwLse2I/images/070f10c0e9e0cd09dea9e495ed09558c67e78f2f.jpeg", + "featured": false, + "title": "Railing Walls", + "description": null, + "created": "2024-01-01T12:54:18.991193Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/GmwLse2I/images/161b5491f62d75c84228a90876a32d244e404bba.jpeg", + "featured": false, + "title": "Picket Fence", + "description": null, + "created": "2024-01-01T12:52:12.281257Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/GmwLse2I/images/27b2af1fbffb3b1cda650a3e1c07b9158593df8b.jpeg", + "featured": false, + "title": "Fences and Walls", + "description": null, + "created": "2024-01-01T12:53:20.628166Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/GmwLse2I/images/36a71212e3235f146033150b64abd81cda8df663.jpeg", + "featured": false, + "title": "Stone Brick Railing Wall", + "description": null, + "created": "2024-01-01T12:51:10.973157Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/GmwLse2I/images/4b5eb0fe427143341287017506b060b16a429496.jpeg", + "featured": false, + "title": "Wall Modern", + "description": null, + "created": "2024-01-01T12:53:52.902737Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/GmwLse2I/images/5619f3b46d4239c2c48df04b199370a6b8003c7e.jpeg", + "featured": false, + "title": "Wired Fence, does damage on collision", + "description": null, + "created": "2024-01-01T12:51:45.352411Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/GmwLse2I/images/98c8bf797ba61d8a7b4663d86708c3831ddde391.jpeg", + "featured": false, + "title": "All wooden fence types", + "description": "Acacia variant", + "created": "2024-01-01T12:52:51.463374Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/GmwLse2I/images/edfa64d220511471ce2236d8df7bb440271d6373.jpeg", + "featured": false, + "title": "Horse Fence", + "description": null, + "created": "2024-01-01T12:50:49.773622Z", + "ordering": 0 + } + ], + "color": 5680635, + "thread_id": "7IUeZg1S", + "monetization_status": "monetized" + }, + "mcw-furniture-3.3.0-mc1.20.1fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.17.1", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.6", + "1.21" + ], + "id": "dtWC90iB", + "slug": "macaws-furniture", + "project_type": "mod", + "team": "hrFceJR2", + "organization": null, + "title": "Macaw's Furniture", + "description": "Decorate your world with wardrobes, drawers, chairs, desks, tables and more...!", + "body": "![Banner image](https://i.imgur.com/CBCiD7W.png)\n\n\n\n\n[![YouTube](https://img.shields.io/youtube/channel/subscribers/UCc_kqzt253fnG2RHW_CZL2A?label=Youtube&style=for-the-badge)](https://www.youtube.com/channel/UCc_kqzt253fnG2RHW_CZL2A)[![](https://img.shields.io/badge/-%20-ffffff)![Twitter](https://img.shields.io/twitter/follow/sketch_macaw?color=6eb7ec&label=Twitter&logo=twitter&style=for-the-badge)![](https://img.shields.io/badge/-%20-ffffff)](https://twitter.com/sketch_macaw)[![Discord](https://img.shields.io/discord/645360921673465857?color=a97db2&logo=discord&logoColor=f&style=for-the-badge)](https://discord.gg/RFQqDEb)[![Crafting Recipes](https://img.shields.io/badge/-Crafting%20Recipes-bc8f56?style=for-the-badge)](https://docs.google.com/spreadsheets/d/1dBcTfrt-MH91NuCmJzqbFDjrLftuKMc08fp4bjGJCD4/edit#gid=1674715761)\n\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![About](https://i.imgur.com/A1pclRa.png)\n\nEver wanted to have lots and lots of furniture for your Minecraft houses?\n\nOr just release your inner creative beast to create different combinations of furniture? If yes, then you came to the right place my friend!\n\nMacaw's Furniture focuses on different styles of furniture and customization. You can place them on top of each other to create different combinations, merge them to make them wider or taller as much as you want. Store your stuff in various types of furniture, or just sit down on a chair and relax.\n\nSuggest your ideas on our Macaw's discord.\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![Latest showcase](https://i.imgur.com/zQ7I8me.png)\n\nMacaw's Furniture Video Showcase\n\n\n\n[![Bisect Hosting](https://www.bisecthosting.com/images/CF/Macaw/BH_MxBH_PromoCard.webp)](https://bisecthosting.com/sketchmacaw)\n\nDo you need a server? Click on the picture above, use our code **sketchmacaw** to get **25%** off your first month and enjoy playing!\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![FAQ](https://i.imgur.com/EpKoS1L.png)\n\nQ: Do you have any plans on backporting to 1.15.2 and lower?\\\nA: Very unlikely, but a last 1.12.2 version could happen at some time..\n\nQ: Can I use your mods in my modpack?\\\nA: Yes, just credit us and with a reference to the modrinth page\n\nQ: I have a translation for you, where can I send it to you?\\\nA: Either on Github or on our discord server\n\n![Showcase of several furniture](https://i.imgur.com/AP8OAgO.png)", + "body_url": null, + "published": "2023-11-07T15:20:47.989269Z", + "updated": "2024-08-02T15:54:17.689175Z", + "approved": "2023-11-08T02:32:53.845702Z", + "queued": "2023-11-07T16:12:17.037091Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 359950, + "followers": 229, + "categories": [ + "decoration", + "storage" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "5ahMUdR3", + "r6NzPonX", + "1paUXS3Q", + "Qj7qk3hj", + "6Ox6xuBY", + "ASibLFtP", + "x7vKuADT", + "s4dYbqQt", + "cK0OVG7a", + "TnHai9Dz", + "ECzK3kjZ", + "XwW88wVP", + "zxkH1H7B", + "6XhkSJFn", + "QhaydR8P", + "AVowL55G", + "EOxRR7Ql", + "8yI02NO6", + "VpRk58GO", + "DolX5DWs", + "5AWaMwU0", + "9NBW1Mwe", + "zUZZ71g6", + "COxqBiZm", + "d5kFP5eV", + "5GFq8M9V", + "EnwS6oxL", + "E1uRrVYv", + "c1fzczFD", + "3XETDsDP", + "PcwgnYZi", + "RmHtILCh", + "y44D8maa", + "1W9RyumK", + "ouCkNZUe", + "nDed9b5x", + "381WFbHs", + "2m7YBaZy", + "sCIPR9lv", + "6dIO8PaO", + "7gb8Lxv8", + "F6uqtfsX", + "oj2le2W6", + "1guDznfr", + "JC3b94Zc", + "WmJGTCry", + "9nEoSURF", + "F5VkMtSl", + "rgDWLWu5", + "QfOSFoP6", + "EBhrKXLS", + "O3Ee7Q8R", + "tNnS6hrd", + "Z4Nk575o", + "RVVnZ9ga", + "8dS8vB1P", + "40crxR10", + "h49rq4iz", + "sfLNwwju", + "PRXY9k9s", + "7aTbV3Sq", + "ZbcJKpfp", + "sfKRrbD7", + "CGUR9uYG", + "tKWYVdFX", + "HgnDSa0d", + "9ZDNj2o2", + "mJtIlyY6", + "zIeURw1m", + "BTgjw9Ns", + "DlbzeulO", + "dmwjtuO1", + "2VZzm5xO", + "HDhywPko", + "QE9LN7m0", + "lMavbx0k", + "jQcvCX79", + "Y6dQfev4", + "Z6b8bL3i", + "DJ7SPSJu", + "fENM4Dgv", + "TU96z0Zg" + ], + "icon_url": "https://cdn.modrinth.com/data/dtWC90iB/6525f70ea4cc06b8c2ff8a6eec75b0dd73aa5acc.jpeg", + "issues_url": "https://github.com/sketchmacaw/MacawsModsIssues/issues", + "source_url": null, + "wiki_url": null, + "discord_url": "https://discord.gg/RFQqDEb", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/dtWC90iB/images/02a9e3b462ff5f1079bd46c02de80d9158f11916.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-07T15:43:12.510375Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/dtWC90iB/images/0edfb1a5ff8ef4790f580489c4ca21768273688f.jpeg", + "featured": false, + "title": "Furniture", + "description": null, + "created": "2024-08-02T15:41:29.178269Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/dtWC90iB/images/2eac960833bb52916419b7ea8f71eae0881a1462.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-07T15:40:08.662498Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/dtWC90iB/images/30bcae7d4af5e57ef381eb1caeb1e949a2f2c364.jpeg", + "featured": false, + "title": "Any Width/Height", + "description": null, + "created": "2024-08-02T15:41:49.625468Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/dtWC90iB/images/4bdb2f989fb9b8ac6f8fb6cfc3f73e974c36f2c0.jpeg", + "featured": false, + "title": "Tables", + "description": null, + "created": "2024-08-02T15:42:08.081325Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/dtWC90iB/images/61141e235d8f59c7ed64a8ea2078104367eb91bd.jpeg", + "featured": false, + "title": "Wardrobes", + "description": null, + "created": "2024-08-02T15:42:15.653510Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/dtWC90iB/images/78625e9433538d32c7e10520cd1fb9ac44f12a93.jpeg", + "featured": false, + "title": "All Wooden Variations", + "description": null, + "created": "2024-08-02T15:41:39.125759Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/dtWC90iB/images/7a395e1b88ff2181bcabd60f08bf3c3509f369b2.jpeg", + "featured": false, + "title": "Kitchen Cabinets / Counters", + "description": null, + "created": "2024-08-02T15:41:59.843438Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/dtWC90iB/images/9c24c24678c25308d9028b93f68a0539d58801b8.jpeg", + "featured": false, + "title": "Nightstands", + "description": null, + "created": "2024-08-02T15:42:23.972499Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/dtWC90iB/images/fb4c22be02259bfa8d26c1e9d2b32fa2da694b70.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-07T15:40:51.399872Z", + "ordering": 0 + } + ], + "color": 11173182, + "thread_id": "qm7BptL3", + "monetization_status": "monetized" + }, + "mcw-lights-1.1.1-mc1.20.1fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.12.2", + "1.16.5", + "1.17.1", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.6", + "1.21" + ], + "id": "w4an97C2", + "slug": "macaws-lights-and-lamps", + "project_type": "mod", + "team": "wSlnsXRn", + "organization": null, + "title": "Macaw's Lights and Lamps", + "description": "Adds vanilla styled lamps, torches, street lamps, paper lamps, wall lamps, slabs... Make your world brighter!", + "body": "![Banner image](https://i.imgur.com/6BVWu61.png)\n\n[![YouTube](https://img.shields.io/youtube/channel/subscribers/UCc_kqzt253fnG2RHW_CZL2A?label=Youtube&style=for-the-badge)](https://www.youtube.com/channel/UCc_kqzt253fnG2RHW_CZL2A)[![](https://img.shields.io/badge/-%20-ffffff)![Twitter](https://img.shields.io/twitter/follow/sketch_macaw?color=6eb7ec&label=Twitter&logo=twitter&style=for-the-badge)![](https://img.shields.io/badge/-%20-ffffff)](https://twitter.com/sketch_macaw)[![Discord](https://img.shields.io/discord/645360921673465857?color=a97db2&logo=discord&logoColor=f&style=for-the-badge)](https://discord.gg/RFQqDEb)[![Crafting Recipes](https://img.shields.io/badge/-Crafting%20Recipes-bc8f56?style=for-the-badge)](https://docs.google.com/spreadsheets/d/1dBcTfrt-MH91NuCmJzqbFDjrLftuKMc08fp4bjGJCD4/edit#gid=230606720)\n\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![About](https://i.imgur.com/A1pclRa.png)\n\nHave you ever wanted to have other light sources than the vanilla ones? If that's the case, then you are at the right place!\n\nThis very simple mod adds new light sources like: Tiki Torches, Street Lamp Posts, Ceiling Lights,\nLamps, Paper Lamps, Wall Lanterns, New Torches, Light Slabs, Lanterns, Ceiling Fan Lights, Candle Holders, Chandeliers..\n\nLamps, Street Lights, Tiki Torches, Ceiling Lights can be made as tall as you want! Do you need a 1 block tall lamp or 54 block tall lamp? Your choice.\n\nEverything can be turned off and on, with right click.\n\nSuggest your ideas on our Macaw's discord.\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![Latest showcase](https://i.imgur.com/zQ7I8me.png)\n\nMacaw's Lights & Lamps Video Showcase\n\n\n\n[![Bisect Hosting](https://www.bisecthosting.com/images/CF/Macaw/BH_MxBH_PromoCard.webp)](https://bisecthosting.com/sketchmacaw)\n\nDo you need a server? Click on the picture above, use our code **sketchmacaw** to get **25%** off your first month and enjoy playing!\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![FAQ](https://i.imgur.com/EpKoS1L.png)\n\nQ: Do you have any plans on backporting to 1.15.2 and lower?\\\nA: Very unlikely, but a last 1.12.2 version could happen at some time..\n\nQ: Can I use your mods in my modpack?\\\nA: Yes, just credit us and with a reference to the modrinth page\n\nQ: I have a translation for you, where can I send it to you?\\\nA: Either on Github or on our discord server\n\n![Showcase of several lights](https://i.imgur.com/bYxsnQ1.png)", + "body_url": null, + "published": "2024-01-01T09:03:31.526376Z", + "updated": "2024-06-25T16:47:15.679241Z", + "approved": "2024-01-03T23:59:05.327460Z", + "queued": "2024-01-01T11:31:01.304666Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 203943, + "followers": 159, + "categories": [ + "decoration" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "DS9UIbXZ", + "aKHUk2FD", + "Odedvcfk", + "UXgZxdEX", + "dkrANx9H", + "QgDfvRcN", + "jZe65eV9", + "8TyuwqlN", + "7rId4ICI", + "yWAVc0f5", + "g9UMq3kc", + "Tn5Kci4f", + "lhCLQSKh", + "PNqIBIrx", + "d9gFrhcO", + "havnqdD0", + "z4G4CsCu", + "Sb5r5nAZ", + "edpyppQn", + "WhFNkmt8", + "slkql9Uv", + "xIkVriWg", + "TWfAQV4s", + "VrId0pRM", + "j8zEcR7A", + "NBHD1EfY", + "N10z6p2w", + "bDQxf6rl", + "tAQmNQDz", + "zp0G8RpH", + "jRZXPCcy", + "JhoToCgX", + "5C9b8o32", + "qswCZFLu", + "kMPYG5wS", + "I1WvFOOw", + "Q3k1gJJx", + "vK8j0Zfz", + "2Bm2GKmq", + "zedTvpc3", + "NzBJfFWx", + "E2FpDtB2", + "J5dbIcA0", + "UAgtYsl2", + "cBZrjpz7", + "XneuqD0K", + "xVDBFEfr", + "H8a27htJ", + "Cq085Dnf", + "MfXXxLPb", + "AQLWpEcL", + "3b53jxXX", + "NAOBNy4Z", + "RRKlmlS3", + "trErX6xj", + "ChWZZLFW", + "C4KxiWz9", + "KtSqtqqC", + "odCYtngF", + "cUyndgUh", + "AFZLvgU3", + "ncrTgxeH", + "DIA5xz9F", + "qY2IBqQY", + "XBntbnJH", + "UPwtAPqu", + "Rkwp6qmX", + "D8iZj41A", + "Ay9NhzWk", + "s8WyM5kd", + "cOGO5RfZ", + "zVP1nHvU", + "nll6VUqB" + ], + "icon_url": "https://cdn.modrinth.com/data/w4an97C2/6e2e029cccbed98f5152c69bd03f01ba25d636ec.png", + "issues_url": "https://github.com/sketchmacaw/MacawsModsIssues/issues", + "source_url": null, + "wiki_url": null, + "discord_url": "https://discord.gg/RFQqDEb", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/w4an97C2/images/03232d60c8f002859ec07e364757ce0d1e4cba0c.jpeg", + "featured": false, + "title": "Tiki Torches - stackable height", + "description": null, + "created": "2024-01-01T11:15:58.392360Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/w4an97C2/images/079c6ebaac98cda8c0f2c4c631ab04764d092f5d.jpeg", + "featured": false, + "title": "Lamp - Stackable height", + "description": null, + "created": "2024-01-01T11:14:20.044500Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/w4an97C2/images/0dd49c38cf9fd016fcd29bd699f94b931fbcc890.jpeg", + "featured": false, + "title": "Street Lamps - stackable height", + "description": null, + "created": "2024-01-01T11:14:46.020899Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/w4an97C2/images/22f3dc44e540c7365523ff4127f216c9827e462a.png", + "featured": false, + "title": "Wall Lamps - Two variants", + "description": "They can be dyed right clicking with dye", + "created": "2024-01-01T11:18:59.287127Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/w4an97C2/images/48390ec2f4a70d116c3ca58dfcb8e12f35be2607.jpeg", + "featured": false, + "title": "Garden Light", + "description": null, + "created": "2024-01-01T11:16:16.334622Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/w4an97C2/images/66a924c62ee09aaa8844fed7780744e977b118a6.jpeg", + "featured": false, + "title": "Lamps in all colors", + "description": null, + "created": "2024-01-01T11:15:11.351137Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/w4an97C2/images/9f5841f86b40b62a07684a56b2537c6b4533b8b7.jpeg", + "featured": false, + "title": "Ceiling Lights - stackable height", + "description": null, + "created": "2024-01-01T11:16:38.444694Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/w4an97C2/images/a9996e56733911beaa33b4cb55dd88d9621e3b14.jpeg", + "featured": false, + "title": "Paper Lamps", + "description": null, + "created": "2024-01-01T11:15:38.292279Z", + "ordering": 0 + } + ], + "color": 14516045, + "thread_id": "W2nnakMM", + "monetization_status": "monetized" + }, + "mcw-paintings-1.0.5-1.20.1fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.12.2", + "1.16.5", + "1.17.1", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.6" + ], + "id": "okE6QVAY", + "slug": "macaws-paintings", + "project_type": "mod", + "team": "vlN9WzE8", + "organization": null, + "title": "Macaw's Paintings", + "description": "Adds custom drawn paintings to fit in your world!", + "body": "![Banner image](https://i.imgur.com/MD3qlTu.png)\n\n[![YouTube](https://img.shields.io/youtube/channel/subscribers/UCc_kqzt253fnG2RHW_CZL2A?label=Youtube&style=for-the-badge)](https://www.youtube.com/channel/UCc_kqzt253fnG2RHW_CZL2A)[![](https://img.shields.io/badge/-%20-ffffff)![Twitter](https://img.shields.io/twitter/follow/sketch_macaw?color=6eb7ec&label=Twitter&logo=twitter&style=for-the-badge)![](https://img.shields.io/badge/-%20-ffffff)](https://twitter.com/sketch_macaw)[![Discord](https://img.shields.io/discord/645360921673465857?color=a97db2&logo=discord&logoColor=f&style=for-the-badge)](https://discord.gg/RFQqDEb)\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![About](https://i.imgur.com/A1pclRa.png)\n\nSo since so many like our decoration mods, I decided to give paintings a shot. It is a completely new direction where we are heading, so expect a lot of updates for this mod.\n\nThe art was made by Peachy. This 1.0.5 version adds 56 paintings, with a vanila fitting style. If you have any suggestions for some painting we could make, let us know!\n\nThis mod is compatible with [CyclePaintings](https://modrinth.com/mod/cycle-paintings) from Serillum!\n\nSuggest your ideas on our Macaw's discord.\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![Latest showcase](https://i.imgur.com/zQ7I8me.png)\n\nMacaw's Paintings Video Showcase\n\n\n\n\n\n[![Bisect Hosting](https://www.bisecthosting.com/images/CF/Macaw/BH_MxBH_PromoCard.webp)](https://bisecthosting.com/sketchmacaw)\n\nDo you need a server? Click on the picture above, use our code **sketchmacaw** to get **25%** off your first month and enjoy playing!\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![FAQ](https://i.imgur.com/EpKoS1L.png)\n\nQ: Do you have any plans on backporting to 1.15.2 and lower?\\\nA: Very unlikely..\n\nQ: How do I craft the paintings?\\\nA: Just make a regular painting, and find the one you want ( or use CyclePaintings )\n\nQ: Can I use your mods in my modpack?\\\nA: Yes, just credit us and with a reference to the modrinth page\n\nQ: I have a translation for you, where can I send it to you?\\\nA: Either on Github or on our discord server\n\n![Showcase of several paintings](https://i.imgur.com/luNZ9Ut.png)", + "body_url": null, + "published": "2023-07-19T15:20:54.792247Z", + "updated": "2024-05-13T16:49:51.761474Z", + "approved": "2023-09-17T22:43:48.043536Z", + "queued": "2023-09-17T01:22:08.624261Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 198128, + "followers": 152, + "categories": [ + "decoration" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "PVYArInS", + "6f8uM2j5", + "lCWtc6Dn", + "i2xob2Kk", + "S0rw5CCc", + "W7nVxFUx", + "BOSwZ8DZ", + "TGUJRwwI", + "dQYMUu4Q", + "e9AJLhq3", + "SyC8yVv6", + "PhbYzGFt", + "36zIw5xI", + "aSwSLjZX", + "5M2MglO3", + "QcO0bMap", + "rll7Pzp6", + "5vWa2fwW", + "Du9jRkwZ", + "UCdbTbk2", + "6HmjUsbz", + "h39WWltF", + "DMnaLxBN", + "oUDJsYfv", + "yXGCGzPU", + "2vSQjWpJ", + "CwHvP3Pz", + "WTW87iMF", + "2Ae8gzln", + "tIaZ14oC", + "kobhGXu1", + "v7CIAILB", + "9jURVFkT", + "MLi3CCLU", + "PIrX9bYP", + "OWt4pZug", + "bBAmVHBG", + "t0psNq0G", + "qRYe6hsk", + "yaSdsps0", + "anqS9MLT", + "TiU71mDw", + "U43240Bl", + "CHP6QICC", + "hcYQUI7U", + "l8z5afEW", + "k1vgg6Ur", + "hJrgM8IW", + "8fqFzEhz" + ], + "icon_url": "https://cdn.modrinth.com/data/okE6QVAY/445a85d8d37cee75a9aa76b9849037cf47ec3fa8.png", + "issues_url": "https://github.com/sketchmacaw/MacawsModsIssues/issues", + "source_url": "https://github.com/sketchmacaw/Paintings", + "wiki_url": null, + "discord_url": "https://discord.gg/RFQqDEb", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/okE6QVAY/images/037e632a6ba67b11ff7c064c679c2cde53c881fb.jpeg", + "featured": false, + "title": "32x16", + "description": "Some of them 1.0.2", + "created": "2023-09-17T00:56:12.589305Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/okE6QVAY/images/61eec8ce7c846deca31406641c61c3e9dc4e45b0.jpeg", + "featured": false, + "title": "48x48", + "description": "Some of them 1.0.2", + "created": "2023-09-17T00:57:07.738720Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/okE6QVAY/images/8cd5416fbeff2ed56221fc8e2804f6d2b94e415b.jpeg", + "featured": false, + "title": "16x16", + "description": "Some of them from 1.0.2", + "created": "2023-09-17T00:55:16.391208Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/okE6QVAY/images/98ff0f472a870aa622fd386aae66c7bb2c0a2c3f.jpeg", + "featured": true, + "title": "Panda and Spruce forest", + "description": "1.0.2", + "created": "2023-09-17T00:56:37.708229Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/okE6QVAY/images/c93575d6dd17512b505a2b24bf9fe825849f8092.jpeg", + "featured": false, + "title": "16x32", + "description": "Some of them 1.0.2", + "created": "2023-09-17T00:55:39.499018Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/okE6QVAY/images/d5119ea61be8a6d8489fb42b2e5829570737d5b2.png", + "featured": false, + "title": "1.0.5 Update", + "description": "new paintings ", + "created": "2023-11-07T17:10:35.242167Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/okE6QVAY/images/f32e199f7d56437a38dbbca30a740fa1f07a90d8.jpeg", + "featured": false, + "title": "16x48", + "description": "Newest addition in 1.0.2", + "created": "2023-09-17T00:55:58.772026Z", + "ordering": 0 + } + ], + "color": 8028058, + "thread_id": "okE6QVAY", + "monetization_status": "monetized" + }, + "mcw-paths-1.0.5-1.20.1fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.17.1", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.6", + "1.21" + ], + "id": "VRLhWB91", + "slug": "macaws-paths-and-pavings", + "project_type": "mod", + "team": "5TOwI1Xk", + "organization": null, + "title": "Macaw's Paths and Pavings", + "description": "Adds vanila styled paths and pavings!", + "body": "![Banner image](https://i.imgur.com/emRipp7.png)\n\n[![YouTube](https://img.shields.io/youtube/channel/subscribers/UCc_kqzt253fnG2RHW_CZL2A?label=Youtube&style=for-the-badge)](https://www.youtube.com/channel/UCc_kqzt253fnG2RHW_CZL2A)[![](https://img.shields.io/badge/-%20-ffffff)![Twitter](https://img.shields.io/twitter/follow/sketch_macaw?color=6eb7ec&label=Twitter&logo=twitter&style=for-the-badge)![](https://img.shields.io/badge/-%20-ffffff)](https://twitter.com/sketch_macaw)[![Discord](https://img.shields.io/discord/645360921673465857?color=a97db2&logo=discord&logoColor=f&style=for-the-badge)](https://discord.gg/RFQqDEb)[![Crafting Recipes](https://img.shields.io/badge/-Crafting%20Recipes-bc8f56?style=for-the-badge)](https://docs.google.com/spreadsheets/d/1dBcTfrt-MH91NuCmJzqbFDjrLftuKMc08fp4bjGJCD4/edit#gid=1578096346)\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![About](https://i.imgur.com/A1pclRa.png)\n\nThis Macaw's mod is another addition to the Macaw's Mod series, the first version adds wooden paths (all wooden variations) and 6 pavings (with 11 texture variations).\n\nThis mod is our newest and, we heavily rely on community feedback, suggestions etc..\n\nIn the latest 1.0.3 update we added new Running Bond paths, and even slabs/blocks, because they look goof for building too!\n\nSuggest your ideas on our Macaw's discord.\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![Latest showcase](https://i.imgur.com/zQ7I8me.png)\n\nMacaw's Paths and Pavings Video Showcase\n\n\n\n\n[![Bisect Hosting](https://www.bisecthosting.com/images/CF/Macaw/BH_MxBH_PromoCard.webp)](https://bisecthosting.com/sketchmacaw)\n\nDo you need a server? Click on the picture above, use our code **sketchmacaw** to get **25%** off your first month and enjoy playing!\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![FAQ](https://i.imgur.com/EpKoS1L.png)\n\nQ: Do you have any plans on backporting to 1.15.2 and lower?\\\nA: Very unlikely, but a last 1.12.2 version could happen at some time..\n\nQ: How do I craft the paths or pavings?\\\nA: Here are the crafting recipes [Crafting Recipes](https://docs.google.com/spreadsheets/d/1dBcTfrt-MH91NuCmJzqbFDjrLftuKMc08fp4bjGJCD4/edit#gid=1578096346) \n\nQ: Can I use your mods in my modpack?\\\nA: Yes, just credit us and with a reference to the modrinth page\n\nQ: I have a translation for you, where can I send it to you?\\\nA: Either on Github or on our discord server\n\n![Showcase of several paths](https://i.imgur.com/IfjRY57.jpeg)", + "body_url": null, + "published": "2023-09-18T18:25:05.108669Z", + "updated": "2024-06-15T10:39:26.265473Z", + "approved": "2023-09-20T21:57:39.669773Z", + "queued": "2023-09-18T18:56:30.945244Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 260502, + "followers": 180, + "categories": [ + "decoration" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "xIOeFajv", + "dwu2U0sX", + "CKUpxiUC", + "MMhed1UG", + "2DSqAQCr", + "uFbi96H9", + "mPv7JBrQ", + "GNuP2dJD", + "sm9i6s6X", + "fyQSfHl0", + "Cjh5Td4D", + "tdlD8a5c", + "DcgNMWXp", + "OPcR7lXw", + "1BIm5F14", + "k88O9vd6", + "1djjZQVB", + "EYYbFOtt", + "HG3jFdXg", + "uCzzbinJ", + "GV5Y3frh", + "HUVSBgRB", + "qFJttoaF", + "DXb9DX0v", + "bL2SAte2", + "bbjEhrC1", + "pTZtGI7I", + "d0DgkWCZ", + "OrFO7Fnk", + "lnA5fSqt", + "HSgp9Av9", + "ASu44ghF", + "DXplmVbD", + "LbNlOVKk", + "iWwW6kNk", + "HBrj1Sie", + "kYbG9Wcn", + "9P6Gg3eZ", + "eXz5Bc0b", + "HZpzy8Uu", + "MdBGw4E7", + "MhuknbP4", + "C0usfEIb", + "EmPjaFjr", + "YS7SH7kz", + "6uHJlKLK", + "KEJu01Lr", + "d8CDNQry", + "koNOWQZi", + "UBbmwW5C", + "ZL5QbYfC", + "y6zCbuWr", + "SHk75Wei", + "TLyXlWFM", + "JulqKz1g", + "X1NQ1vl4", + "MaEdVWDH", + "FTDkuSbO", + "bBmAuBlI", + "kU5rqYwj", + "fznFN68i", + "SdkddV0s", + "7opRqhnH", + "bU7y5Yyf", + "VNLuK9nn", + "s47vrwjO", + "lCAsQGxU", + "93l3e1RG", + "7l8FpxB3", + "QGpxXPOd", + "Xwt75zXt", + "GZ9xex2k", + "ju2TsC3T", + "Hy1CGqYE", + "DnVncJ4B", + "vusBu5Up", + "XJGQZvlU", + "72JzSY5w", + "gkQMXtrw", + "VbfUoZhC", + "e5ZH3ht4", + "m5c5ZeLC", + "cM2jANku" + ], + "icon_url": "https://cdn.modrinth.com/data/VRLhWB91/4f546c995cfff596217af12bd51c7d4fe19a02bc.png", + "issues_url": "https://github.com/sketchmacaw/MacawsModsIssues/issues", + "source_url": "https://github.com/sketchmacaw/Paths-Pavings", + "wiki_url": null, + "discord_url": "https://discord.gg/RFQqDEb", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/VRLhWB91/images/090f654926c17e22becaa3e15196ee36800b6e65.jpeg", + "featured": false, + "title": "Diamond Path", + "description": null, + "created": "2024-01-23T18:53:56.468547Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/VRLhWB91/images/19a691ad230f409ed1a80a48f16703715e8ae778.jpeg", + "featured": false, + "title": "All Paths Stone", + "description": null, + "created": "2024-01-23T18:55:28.969439Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/VRLhWB91/images/2e83b09ffaa5dae415677ee70ed737cbca631bf4.png", + "featured": false, + "title": "Planks Path", + "description": null, + "created": "2023-09-18T18:29:26.167647Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/VRLhWB91/images/3fe265c3e153e835670cf5d7819bc801ddb8d923.jpeg", + "featured": false, + "title": "Basket Weave Path", + "description": null, + "created": "2024-01-23T18:55:08.082699Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/VRLhWB91/images/946cfdff4ab2179cb1aefc86d11ec907ead62014.jpeg", + "featured": false, + "title": "Square path", + "description": null, + "created": "2024-01-23T18:54:40.380757Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/VRLhWB91/images/958976f3846dfdf3f081adee64f2e3e16be00247.jpeg", + "featured": false, + "title": "Windmill Weave", + "description": null, + "created": "2024-01-23T18:52:47.081623Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/VRLhWB91/images/aa39c0253a3bcaca21a59dcb592db8dc7d5c14de.jpeg", + "featured": false, + "title": "Honeycomb and Clover Path", + "description": null, + "created": "2024-01-23T18:54:21.839270Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/VRLhWB91/images/ab446702f5ae6c4989594566b430d08b72294a85.jpeg", + "featured": false, + "title": "Rocky Strewn Path", + "description": null, + "created": "2024-01-23T18:53:09.731810Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/VRLhWB91/images/b338697b93da880ef5896e27c276d28bd8c6e3c7.jpeg", + "featured": false, + "title": "Crystal Floor Path", + "description": null, + "created": "2024-01-23T18:52:23.020715Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/VRLhWB91/images/ba0435995e129269a4cbb1d39f0112b005cb5730.jpeg", + "featured": false, + "title": "Dumble Paving", + "description": null, + "created": "2024-01-23T18:53:30.258515Z", + "ordering": 0 + } + ], + "color": 7892822, + "thread_id": "1km1lrEG", + "monetization_status": "monetized" + }, + "mcw-roofs-2.3.1-mc1.20.1fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.17.1", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.6", + "1.21" + ], + "id": "B8jaH3P1", + "slug": "macaws-roofs", + "project_type": "mod", + "team": "J3b3mvAW", + "organization": null, + "title": "Macaw's Roofs", + "description": "Build roofs with actual roofs instead of stairs!", + "body": "![Banner image](https://i.imgur.com/XXkP95c.png)\n\n[![YouTube](https://img.shields.io/youtube/channel/subscribers/UCc_kqzt253fnG2RHW_CZL2A?label=Youtube&style=for-the-badge)](https://www.youtube.com/channel/UCc_kqzt253fnG2RHW_CZL2A)[![](https://img.shields.io/badge/-%20-ffffff)![Twitter](https://img.shields.io/twitter/follow/sketch_macaw?color=6eb7ec&label=Twitter&logo=twitter&style=for-the-badge)![](https://img.shields.io/badge/-%20-ffffff)](https://twitter.com/sketch_macaw)[![Discord](https://img.shields.io/discord/645360921673465857?color=a97db2&logo=discord&logoColor=f&style=for-the-badge)](https://discord.gg/RFQqDEb)[![Crafting Recipes](https://img.shields.io/badge/-Crafting%20Recipes-bc8f56?style=for-the-badge)](https://docs.google.com/spreadsheets/d/1dBcTfrt-MH91NuCmJzqbFDjrLftuKMc08fp4bjGJCD4/edit#gid=1578096346)\n\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![About](https://i.imgur.com/A1pclRa.png)\n\nDo you ever wanted to build a roof with actual roofs instead of stair blocks? Well if yes then you came to the right place!\n\nMacaw's Roofs mod includes many types of new stuff : Roofs, Steep Roofs, Lower Roofs, Awnings, Top Roofs, Rain Gutters and a lot more!\n\nStriped Awnings come in each color, just as Rain Gutters! Rain Gutters are now filling up when it is raining.\n\nSuggest your ideas on our Macaw's discord.\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![Latest showcase](https://i.imgur.com/zQ7I8me.png)\n\nMacaw's Roofs Video Showcase\n\n\n\n[![Bisect Hosting](https://www.bisecthosting.com/images/CF/Macaw/BH_MxBH_PromoCard.webp)](https://bisecthosting.com/sketchmacaw)\n\nDo you need a server? Click on the picture above, use our code **sketchmacaw** to get **25%** off your first month and enjoy playing!\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![FAQ](https://i.imgur.com/EpKoS1L.png)\n\nQ: Do you have any plans on backporting to 1.15.2 and lower?\\\nA: Very unlikely, but a last 1.12.2 version could happen at some time..\n\nQ: Can I use your mods in my modpack?\\\nA: Yes, just credit us and with a reference to the modrinth page\n\nQ: I have a translation for you, where can I send it to you?\\\nA: Either on Github or on our discord server\n\n![Showcase of several roofs](https://i.imgur.com/ssfvOno.jpg)", + "body_url": null, + "published": "2024-01-01T09:14:57.923035Z", + "updated": "2024-07-22T17:29:50.692116Z", + "approved": "2024-01-03T23:59:07.940723Z", + "queued": "2024-01-01T12:48:52.187611Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 318366, + "followers": 142, + "categories": [ + "decoration" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "V3wQgjB8", + "r1D4KGAK", + "hFdyZvpR", + "WxyUbifW", + "gPFpAbfm", + "kJL6QJMU", + "gh4PRYmO", + "b9FLGRkZ", + "j7l7xP2e", + "Gk2y2Atm", + "hvUECTLX", + "2HHBKqV6", + "UlgOq1wK", + "H8ZPcEDL", + "1lFjfQmV", + "880rshqh", + "G8oImVJG", + "UENyrxBf", + "YolEZes0", + "31NuZsqq", + "UxqQQgSF", + "DgG8jrTo", + "YWQ4OtK0", + "x7FtxqvC", + "oftyo1bU", + "K0355xl9", + "USSTCe8M", + "eBo9fuSU", + "UN0cUNCm", + "bLae6Eh6", + "Knqv9eWM", + "JQJh9gvG", + "1pifUOpQ", + "1wJnkD6H", + "6DfmnrN7", + "qXgkW0p6", + "wbRQB4Ut", + "N4KFznxY", + "wZMqtw5W", + "Guimsj7U", + "RSy6vJB6", + "NaMoar40", + "OUcZtWQ0", + "5cDpqX2V", + "bRj7tC1W", + "ji1egZ1i", + "zkkzyEgT", + "hTW0xEw9", + "fQpM7qix", + "QkkWyPgl", + "xoxARk0I", + "4nGqIccr", + "j8RpzQtn", + "yQrRCK9N", + "SiOLXFAY", + "FWjeLfCW", + "pGLyFCJc", + "HIQdbN09", + "IxjMQ4oz", + "ziNUHW2p", + "EOjhPmTj", + "apwM77V3", + "hMoXo7dv", + "WxLikYQM", + "kc02RCUl", + "F1TPd6cl", + "htc4u2M7", + "ax3NzjO2", + "84JvOrma", + "6mPnaSYj", + "dN9r88iB", + "T5uG3IbI", + "O2fkWZsi", + "vwwJUKSr", + "mmW2TfPl", + "LFihpDiK", + "9Q45nZes", + "Y0TPu4CF", + "Jw4pheKz", + "Fpo5FxUR", + "Gh34DnVZ", + "Stoj8FLk" + ], + "icon_url": "https://cdn.modrinth.com/data/B8jaH3P1/119c92966e8bd0c1278bd09c582d93112edcf38b.jpeg", + "issues_url": "https://github.com/sketchmacaw/MacawsModsIssues/issues", + "source_url": null, + "wiki_url": null, + "discord_url": "https://discord.gg/RFQqDEb", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/B8jaH3P1/images/12db13d5a19640fad386950442bb3e45b2fdb17b.jpeg", + "featured": false, + "title": "Spruce Plank Roof with Rain Gutter and Awnings", + "description": null, + "created": "2024-01-01T12:30:28.593198Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/B8jaH3P1/images/7774dfaa318f1f530c43a37e1fba1573b646d824.png", + "featured": false, + "title": "Awnings", + "description": null, + "created": "2024-01-01T12:29:17.349273Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/B8jaH3P1/images/8b0a0f1db7879638ecdaf25073f774f7a86faa9c.jpeg", + "featured": false, + "title": "Mud Brick Roof", + "description": null, + "created": "2024-01-01T12:29:48.860936Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/B8jaH3P1/images/ccb718b8a2e815a29bc4673e84ef5c8b8081e14f.jpeg", + "featured": false, + "title": "Roofs Acacia Planks", + "description": null, + "created": "2024-01-01T12:28:31.282324Z", + "ordering": 0 + } + ], + "color": 8737567, + "thread_id": "oUyqjR27", + "monetization_status": "monetized" + }, + "mcw-trapdoors-1.1.3-mc1.20.1fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.17.1", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.6", + "1.21" + ], + "id": "n2fvCDlM", + "slug": "macaws-trapdoors", + "project_type": "mod", + "team": "skWgO2J2", + "organization": null, + "title": "Macaw's Trapdoors", + "description": "Adds vanila trapdoors in every plank variation, and some new trapdoors too!", + "body": "![Banner image](https://i.imgur.com/5soWQJH.png)\n\n[![YouTube](https://img.shields.io/youtube/channel/subscribers/UCc_kqzt253fnG2RHW_CZL2A?label=Youtube&style=for-the-badge)](https://www.youtube.com/channel/UCc_kqzt253fnG2RHW_CZL2A)[![](https://img.shields.io/badge/-%20-ffffff)![Twitter](https://img.shields.io/twitter/follow/sketch_macaw?color=6eb7ec&label=Twitter&logo=twitter&style=for-the-badge)![](https://img.shields.io/badge/-%20-ffffff)](https://twitter.com/sketch_macaw)[![Discord](https://img.shields.io/discord/645360921673465857?color=a97db2&logo=discord&logoColor=f&style=for-the-badge)](https://discord.gg/RFQqDEb)[![Crafting Recipes](https://img.shields.io/badge/-Crafting%20Recipes-bc8f56?style=for-the-badge)](https://docs.google.com/spreadsheets/d/1dBcTfrt-MH91NuCmJzqbFDjrLftuKMc08fp4bjGJCD4/edit#gid=472963468)\n\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![About](https://i.imgur.com/A1pclRa.png)\n\nHave you ever thought, how great would it be, when Minecraft had the basic vanila trapdoors in each plank variation?\n\nIf so then you have come to the right place! Macaw's Trapdoor adds vanila trapdoors in every plank variation and it\n\nadds new trapdoors too. The latest version adds new Ranch Trapdoors, Bamboo Trapdoors and more..!\n\nSuggest your ideas on our Macaw's discord.\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![Latest showcase](https://i.imgur.com/zQ7I8me.png)\n\nMacaw's Trapdoors Video Showcase\n\n\n\n\n[![Bisect Hosting](https://www.bisecthosting.com/images/CF/Macaw/BH_MxBH_PromoCard.webp)](https://bisecthosting.com/sketchmacaw)\n\nDo you need a server? Click on the picture above, use our code **sketchmacaw** to get **25%** off your first month and enjoy playing!\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![FAQ](https://i.imgur.com/EpKoS1L.png)\n\nQ: Do you have any plans on backporting to 1.15.2 and lower?\\\nA: Very unlikely, but a last 1.12.2 version could happen at some time..\n\nQ: Can I use your mods in my modpack?\\\nA: Yes, just credit us and with a reference to the modrinth page\n\nQ: I have a translation for you, where can I send it to you?\\\nA: Either on Github or on our discord server\n\n![Showcase of several trapdoors](https://i.imgur.com/Je5qUvD.jpg)", + "body_url": null, + "published": "2023-11-05T02:38:21.872944Z", + "updated": "2024-06-15T13:26:46.298543Z", + "approved": "2023-11-07T02:10:56.134990Z", + "queued": "2023-11-05T03:04:58.318446Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 251898, + "followers": 171, + "categories": [ + "decoration" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "T3Z2kmHE", + "2suS3Irb", + "eJwlNSDC", + "eYw4MsTq", + "KuTJ3RfF", + "7G7c8Mwj", + "TQYhHt7a", + "I2oWy6RR", + "e2nO6dwL", + "LL2jmTMU", + "OFMI3jui", + "XukVJCLM", + "zelGKqrT", + "vEWLTBxU", + "YOBwOUjv", + "GblrFyeU", + "vIAtBzvk", + "7kUGlFW5", + "frYYYTvW", + "4qeFtdJe", + "R8hDlKEp", + "6qZS9x6s", + "wJZviNWG", + "ns2BPSTJ", + "i61yE5ap", + "jYYVEiN4", + "nIyoMA3l", + "QY74NlAi", + "99Bp2kpl", + "pbFivueg", + "pSeZ2M6z", + "hW5jyRpw", + "c1tfVMfb", + "wYzfyw8P", + "1UfQwdWq", + "HRNU3g5X", + "s6sZykV8", + "HLRro2Es", + "P9QHpMaf", + "mZELYGfA", + "g9hHIUOG", + "CVU6IfZb", + "56TqPdy6", + "l9P4NtTI", + "3xJLWaMB", + "rMGScX31", + "a6FUTM5M", + "9w8jhJSo", + "zkAI52kQ", + "DnP8EvCb", + "ziDHHIPU", + "mRYCU4jN", + "LFg4YaxF", + "u9gUET1V", + "gbFmWSAV", + "xn7fZd7d", + "NYJJ4xDj" + ], + "icon_url": "https://cdn.modrinth.com/data/n2fvCDlM/7d017bafd429219fc5613b6c2610b2426836325a.jpeg", + "issues_url": "https://github.com/sketchmacaw/MacawsModsIssues/issues", + "source_url": "https://github.com/sketchmacaw/Trapdoors", + "wiki_url": null, + "discord_url": "https://discord.gg/RFQqDEb", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/n2fvCDlM/images/9d7bfe3ab3f93f1e97feb50d46e6b22e7d46ebf7.jpeg", + "featured": true, + "title": null, + "description": null, + "created": "2023-11-05T02:51:02.715789Z", + "ordering": -1 + }, + { + "url": "https://cdn.modrinth.com/data/n2fvCDlM/images/15f1c348fd3ee66f34f439c4899655b3e3493d69.jpeg", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-05T02:51:25.557141Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/n2fvCDlM/images/7578d15269d917bc4da3b055db30e01d56531554.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-05T02:52:24.189315Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/n2fvCDlM/images/76213bb04f2005bbaab5106cd0e8fe070901fd93.jpeg", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-05T02:51:11.655758Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/n2fvCDlM/images/852f12c77d9c3241c761db4f68a99d9f10b23712.jpeg", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-05T02:51:45.156271Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/n2fvCDlM/images/9002ccbc1bf60fe51db65a3e0bde3d4728b4c934.jpeg", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-05T02:51:55.199918Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/n2fvCDlM/images/9173865b346d75736a2b2c343e13358b86a60e19.jpeg", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-05T02:51:34.325987Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/n2fvCDlM/images/9373ada4db747a120aa43700d3f22d53934f6fee.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-05T02:50:46.667649Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/n2fvCDlM/images/e3cae3931dff3b5dd721ae88104a9ff6ee7c8d48.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-05T02:52:05.423999Z", + "ordering": 0 + } + ], + "color": 9790512, + "thread_id": "70uAuhJn", + "monetization_status": "monetized" + }, + "mcw-windows-2.3.0-mc1.20.1fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.17.1", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.6", + "1.21" + ], + "id": "C7I0BCni", + "slug": "macaws-windows", + "project_type": "mod", + "team": "uiyGvzyr", + "organization": null, + "title": "Macaw's Windows", + "description": "Adds lots of Windows, Mosaic Glass, Blinds, Shutters, Curtains and more...!", + "body": "![Banner image](https://i.imgur.com/bS2AfUU.png)\n\n[![YouTube](https://img.shields.io/youtube/channel/subscribers/UCc_kqzt253fnG2RHW_CZL2A?label=Youtube&style=for-the-badge)](https://www.youtube.com/channel/UCc_kqzt253fnG2RHW_CZL2A)[![](https://img.shields.io/badge/-%20-ffffff)![Twitter](https://img.shields.io/twitter/follow/sketch_macaw?color=6eb7ec&label=Twitter&logo=twitter&style=for-the-badge)![](https://img.shields.io/badge/-%20-ffffff)](https://twitter.com/sketch_macaw)[![Discord](https://img.shields.io/discord/645360921673465857?color=a97db2&logo=discord&logoColor=f&style=for-the-badge)](https://discord.gg/RFQqDEb)[![Crafting Recipes](https://img.shields.io/badge/-Crafting%20Recipes-bc8f56?style=for-the-badge)](https://docs.google.com/spreadsheets/d/1dBcTfrt-MH91NuCmJzqbFDjrLftuKMc08fp4bjGJCD4/edit#gid=960803673)\n\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![About](https://i.imgur.com/A1pclRa.png)\n\nDo you ever wanted Windows in Minecraft? With parapets/sills, shutter, blinds or curtains?\nWell we got you covered, this mod could suit your decorative needs for that!\n\nThis Window mod is all about windows, it adds lots of windows which can be opened/closed or locked.\nThe mod also includes blinds, mosaic glass, mosaic glass panes, one way glass, parapets/sills, gothic windows, shutters, curtains, arrow slits and more..!\n\nSuggest your ideas on our Macaw's discord.\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![Latest showcase](https://i.imgur.com/zQ7I8me.png)\n\nMacaw's Windows Video Showcase\n\n\n\n[![Bisect Hosting](https://www.bisecthosting.com/images/CF/Macaw/BH_MxBH_PromoCard.webp)](https://bisecthosting.com/sketchmacaw)\n\nDo you need a server? Click on the picture above, use our code **sketchmacaw** to get **25%** off your first month and enjoy playing!\n\n![](https://i.imgur.com/GUtHhCc.png)\n\n![FAQ](https://i.imgur.com/EpKoS1L.png)\n\nQ: Do you have any plans on backporting to 1.15.2 and lower?\\\nA: Very unlikely, but a last 1.12.2 version could happen at some time..\n\nQ: Can I use your mods in my modpack?\\\nA: Yes, just credit us and with a reference to the modrinth page\n\nQ: I have a translation for you, where can I send it to you?\\\nA: Either on Github or on our discord server\n\n![Showcase of several windows](https://i.imgur.com/jjgZ3D0.png)", + "body_url": null, + "published": "2024-01-01T08:46:50.266895Z", + "updated": "2024-08-03T09:53:52.829274Z", + "approved": "2024-01-03T23:59:13.475579Z", + "queued": "2024-01-01T11:12:56.928488Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 326584, + "followers": 204, + "categories": [ + "decoration" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "FBGQ902p", + "dqdUAyfT", + "Eb3I1j1T", + "xwYhl4oY", + "qfD1I3R7", + "kJxvTCJe", + "weKlzuXq", + "ItnpRIiB", + "n7SUq0gD", + "P1BD9OyE", + "i9OGAt3e", + "exnpK4oC", + "EH6X9BEa", + "BPiIjOI8", + "MuyW8Yno", + "CROTKkWW", + "ZQDScsZj", + "urRmfmHw", + "8lHwjkOe", + "jDrbUUcf", + "84Xjr6fs", + "KYvAkIDY", + "4PhZzRzL", + "cJHm3kwe", + "UJC32tF8", + "8XT0TUPv", + "nlkX1qyi", + "rUZYXJ7z", + "np6okIw0", + "dXvwm4Cv", + "X8ngoNI8", + "F0ddwWQ0", + "jlPWEmMc", + "3C5fIphB", + "88sYNcv4", + "nQ0KJAuw", + "EWlSzDeK", + "IG2ljS2i", + "XPrYUluW", + "OztIx1nr", + "hN1xJuNK", + "aIs9jPSX", + "GV7S4Eob", + "8FnydlZL", + "EepKIZzP", + "94ZETC7q", + "vi3R8RwL", + "zND5Xe2j", + "Ix9DlImK", + "uNVQnUjf", + "GhYHduKi", + "ZhfiOKjQ", + "QM3RyJgV", + "1awFUYuW", + "yWjnK8oc", + "3zgCKbrR", + "MPOPGLD0", + "LOBe8bBb", + "iitkb8Xf", + "tP6ekX0o", + "wZUnPxRg", + "9B4aftaB", + "KPM9uPpy" + ], + "icon_url": "https://cdn.modrinth.com/data/C7I0BCni/da003f3c9283ce37f3f82d83ec76e51e381300c2.png", + "issues_url": "https://github.com/sketchmacaw/MacawsModsIssues/issues", + "source_url": null, + "wiki_url": null, + "discord_url": "https://discord.gg/RFQqDEb", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/C7I0BCni/images/129867acece8b89a3a6fe87e17bc7fdc0f3c4170.png", + "featured": false, + "title": "Resizeable Window with Shutters and Parapet", + "description": null, + "created": "2024-01-01T08:54:46.522389Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/C7I0BCni/images/24b7ccb59d689da505d2500561b3e0136b7068e9.png", + "featured": false, + "title": "All Shutters Styles", + "description": null, + "created": "2024-01-01T08:55:43.767796Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/C7I0BCni/images/9f5582c68a0af04d1963d48154b5705218f8885b.png", + "featured": false, + "title": "Arrow Slits", + "description": null, + "created": "2024-01-01T09:00:19.278502Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/C7I0BCni/images/aa630a2374b2b94eda0dee51b63415f27e843cfe.png", + "featured": false, + "title": "Openable Windows", + "description": null, + "created": "2024-01-01T08:56:47.773516Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/C7I0BCni/images/dbb6d033f97a09d2024b6b6d0288b62371e89d9a.png", + "featured": false, + "title": "Blinds and Curtains", + "description": null, + "created": "2024-01-01T10:58:15.788471Z", + "ordering": 0 + } + ], + "color": 14408399, + "thread_id": "dJWFDWAk", + "monetization_status": "monetized" + }, + "memoryleakfix-fabric-1.17+-1.1.5": { + "client_side": "optional", + "server_side": "optional", + "game_versions": [ + "1.14.4", + "1.15", + "1.15.1", + "1.15.2", + "1.16", + "1.16.1", + "1.16.2", + "1.16.3", + "1.16.4", + "1.16.5", + "1.17", + "1.17.1", + "21w37a", + "21w38a", + "21w39a", + "21w40a", + "21w41a", + "21w42a", + "21w43a", + "21w44a", + "1.18-pre1", + "1.18-pre2", + "1.18-pre3", + "1.18-pre4", + "1.18-pre5", + "1.18-pre6", + "1.18-pre7", + "1.18-pre8", + "1.18-rc1", + "1.18-rc2", + "1.18-rc3", + "1.18-rc4", + "1.18", + "1.18.1-pre1", + "1.18.1-rc1", + "1.18.1-rc2", + "1.18.1-rc3", + "1.18.1", + "22w03a", + "22w05a", + "22w06a", + "22w07a", + "1.18.2-pre1", + "1.18.2-pre2", + "1.18.2-pre3", + "1.18.2-rc1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4" + ], + "id": "NRjRiSSD", + "slug": "memoryleakfix", + "project_type": "mod", + "team": "PxfoVTFT", + "organization": null, + "title": "Memory Leak Fix", + "description": "A mod that fixes random memory leaks for both the client and server", + "body": "# Memory Leak Fix\n\n\n\n### A mod that fixes multiple memory leaks in Minecraft. Both server-side & client-side\n\nFor the best performance & memory usage, I recommend using this mod with:\n\n- [lithium-fabric](https://github.com/CaffeineMC/lithium-fabric) - The best general performance mod\n- [FerriteCore](https://github.com/malte0811/FerriteCore) - Memory usage optimizations \n\n## My other optimizations/fixes\n* [MoreCulling](https://modrinth.com/mod/moreculling) - Changes how blockstate culling is handled to improve performance\n* [Carpet-Fixes](https://modrinth.com/mod/carpet-fixes) - Largest Server-Side bug fixing mod\n* [Blanket](https://modrinth.com/mod/blanket) - Client-side tweaks/fixes\n* [RailOptimization](https://modrinth.com/mod/rail-optimization) - Make powered rails less laggy\n\n## More Info \n \nFeel free to contribute to the project! \nI'm also fine if you use this mod in your modpacks, just make sure to mention it. \n\nHowever I don't allow clients or other projects to merge this mod without permission, if you would like to use this mod in your client or another project please contact me. \n\n---\n\nThis is an advert v\n\n\n---", + "body_url": null, + "published": "2022-05-25T14:57:06.172838Z", + "updated": "2024-01-06T15:23:18.434002Z", + "approved": "2022-05-25T14:57:06.172838Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-2.1-only", + "name": "GNU Lesser General Public License v2.1 only", + "url": null + }, + "downloads": 6304901, + "followers": 3994, + "categories": [ + "optimization" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "quilt" + ], + "versions": [ + "XPnqFCe0", + "db1Qa6iF", + "NK8mmASH", + "uxqIlBiR", + "op83jsPA", + "bEzJ3d9Y", + "y1Kvwhgo", + "gPH2ZLuR", + "6WxBG7Wn", + "tXDxRppV", + "RZJVmohY", + "zmzNcLjP", + "Yw3hrc43", + "8vFow3y0", + "ju6d51G0", + "oZ1QFlkk", + "uvitUbpR", + "R4CYPhDX", + "S6zlvHPT", + "tlLtHh1w", + "fDYPSGrC", + "f12YQRLF", + "YtNQP5gX", + "UWqVNxls", + "xn2d7ltf", + "fn7KiVkh", + "PtXTwQt6", + "OiV4duYN", + "9UDEn8ja", + "lTJY9iYT", + "ES2a9WYG", + "gAsQptUE", + "nXoHagjH", + "FeW7TYVZ", + "7Pzm6RM2", + "s7Ked9u1", + "kQl1KJI6", + "kLyFtyv2", + "dGlflhb6", + "ojDQq9qm", + "AK7fR5Ja", + "IRQCDoh9", + "r62Eyd0k", + "MQLUUmbx", + "O5eLXvxa", + "PPpK82xV", + "i3LESZB2", + "UA5M7c5Y", + "zrOTRVmL", + "wgonbjM5", + "5eYju5dK", + "5xvCCRjJ", + "xYL9nIiR", + "X5MN9zOr", + "3w0IxNtk" + ], + "icon_url": "https://cdn.modrinth.com/data/NRjRiSSD/icon.png", + "issues_url": "https://github.com/fxmorin/memoryLeakFix/issues", + "source_url": "https://github.com/fxmorin/memoryLeakFix", + "wiki_url": null, + "discord_url": "https://discord.gg/rcTjvxq", + "donation_urls": [ + { + "id": "github", + "platform": "Github", + "url": "https://github.com/sponsors/fxmorin" + } + ], + "gallery": [], + "color": 4948563, + "thread_id": "NRjRiSSD", + "monetization_status": "monetized" + }, + "minecells-1.8.3": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.2", + "1.20", + "1.20.1" + ], + "id": "9Qdvz1OV", + "slug": "minecells", + "project_type": "mod", + "team": "StcGJ5kY", + "organization": null, + "title": "Mine Cells - Dead Cells Mod", + "description": "Dead Cells content in Minecraft", + "body": "
\n\n![Mine Cells - based on Dead Cells by Motion Twin](https://raw.githubusercontent.com/mim1q/MineCells/1.20.x/projectPageAssets/hero.png)\n\n[![Requires Fabric API](https://img.shields.io/badge/Requires_Fabric_API-white?style=for-the-badge&logo=modrinth&logoColor=black)](https://modrinth.com/mod/fabric-api)\n[![Requires owo-lib](https://img.shields.io/badge/Requires_owo--lib-white?style=for-the-badge&logo=modrinth&logoColor=black)](https://modrinth.com/mod/owo-lib)\n[![Donate on ko-fi](https://img.shields.io/badge/Donate_on_ko--fi-red?style=for-the-badge&logo=ko-fi&logoColor=white)](https://ko-fi.com/mim1q)\n[![Join my Community](https://img.shields.io/badge/Join_my_Community-blue?style=for-the-badge&logo=discord&logoColor=white)](https://discord.gg/6TjQbSjbuB)\n\n[![Patchouli recommended for an in-game wiki](https://img.shields.io/badge/Patchouli_recommended_for_an_in--game_wiki-white?style=for-the-badge&logo=curseforge&logoColor=black)](https://modrinth.com/mod/patchouli)\n\n---\n\nMine Cells is a Minecraft mod that adds content\nfrom [Dead Cells by Motion Twin](https://store.steampowered.com/app/588650/Dead_Cells/). \nVisit [the wiki](https://mim1q.dev/minecells) for a guide on how to get started and all the info you need!\n\n### If you need help with the mod, join the `#mim1qs-projects` channel on the Luna Pixels Discord Server\n\n[![Get support on Luna Pixel Discord](https://img.shields.io/badge/Get_support_on_The_Luna_Pixel_Discord-blue?style=for-the-badge&logo=discord&logoColor=white)](https://discord.gg/LunaPixel)\n\n
\n\n## What does this mod add?\n\nCurrently, this mod adds:\n\n- 5 new dimension-dungeons, two of which house new bosses\n- many new mobs\n- lots of new decorative blocks\n- new weapons and spells\n\nSome upcoming features include:\n\n- more weapons, including bows and shields\n- an in-game guidebook\n\n## FAQ\n\n
\n How do I do ... in Mine Cells?\n\nQuestions for older versions should be answered in [the wiki](https://mim1q.dev/minecells)! There's a search bar if you\nneed\nto look something up.\n\nIf you have trouble finding the answers, join\nthe [Luna Pixel Studios Discord](https://discord.gg/LunaPixel) and leave a message in `#mim1qs-projects` so we can help\nyou out.\n\nAll existing crafting recipes are available through mods such as REI.\n
\n\n
\n Forge? Port to old version?\n\nNo, **I will not make mods for Forge**. I am fully commited to being a Fabric mod developer.\nIf you wish to play my mods on Forge, you should check out [Sinytra Connector](https://modrinth.com/mod/connector),\nwhich should work nearly flawlessly in survival.\nI probably won't port any of my mods to outdated Minecraft versions, either.\n
\n\n
\n I got lost in one of Mine Cells's dimensions, what can I do?\n\nUse a compass to guide you back to the entrance. Compasses sometimes spawn in chests in the Promenade.\n
\n\n
\n Can I use this mod in my modpack / showcase video / blog?\n\nYou can use this mod in your videos, blogs, etc.! If you do, provide a download link to this page. \n**Do not** reupload the mod's files to any other hostings for people to download. \n\nFeel free to use the mod in your modpacks, as long as they are either:\n- Used in private with your friends \nor\n- Publicly available on CurseForge or Modrinth and you're not making money by selling them.\n\nIf you have any questions about this, feel free to contact me on the Discord server linked at the top of this page.\n\n
\n\n
\n Will you add ... to this mod?\n\nThis mod aims to add most of the content from Dead Cells (except the Castlevania DLC) to Minecraft. If it is present in\nDead\nCells, it'll probably be added to this mod, sooner or later. Some unique tweaks and additions were made in order to make\nthe\ncontent work in the environment of Minecraft without straying too far from the source material.\n
\n\n
\n Is this mod compatible with ...?\n\nThis mod should be compatible with most other mods. There might be some bugs that make it crash when other mods are\npresent, but I'm trying to remove them as soon as they're known. If you encounter such a bug make sure\nto [create an issue on Github](https://github.com/mim1q/MineCells/issues) or ask for help on the Discord server linked\nabove!\n
\n\n
\n\n[![Bisect hosting - use code LUNAPIXEL](https://raw.githubusercontent.com/mim1q/MineCells/1.20.x/projectPageAssets/hosting-code.png)](https://www.bisecthosting.com/p/lunapixel)\n", + "body_url": null, + "published": "2022-05-02T17:07:04.542447Z", + "updated": "2024-06-14T20:55:44.202181Z", + "approved": "2022-05-02T17:07:04.542447Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 328966, + "followers": 294, + "categories": [ + "adventure", + "mobs", + "worldgen" + ], + "additional_categories": [ + "decoration" + ], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "oQOdGiSi", + "4O4b5z1l", + "ciJPiSrg", + "erczZaeW", + "HCE3ITXZ", + "hO6L8UQn", + "osYkmOEl", + "lxiTIjCW", + "YmPg6kmp", + "dDXRv652", + "S5Fq9oyf", + "ZyLuFySJ", + "JBlSffrg", + "kSON9TGh", + "mONxyXkY", + "IrgDscS5", + "Hnza6gec", + "inZWAGRB", + "StmhJsHu", + "fyMoxQQ4", + "UNitjVmB", + "h24wvKrs", + "GgKAj06i", + "ZHxeyPF6", + "7YHN71bi", + "8f8IpMXH", + "VWbCUfvw", + "roqzASz9", + "hgpfupbt", + "7zL2D6c2", + "sFScE2c8", + "uzuDpb4W", + "3p3YbCg4", + "Tu4BZWDX", + "MPeoUkHE", + "oJdtIycL", + "NI9yC4B8", + "qPhXhLWr", + "NqVYUyoE", + "cdxZ0SbM", + "FxJdLogW", + "udqXCjf5", + "8UU0XZyH", + "1Vbpo4ux" + ], + "icon_url": "https://cdn.modrinth.com/data/9Qdvz1OV/6995132866962a61b21427d6fc1b74ce682a8446.png", + "issues_url": "https://github.com/mim1q/MineCells/issues", + "source_url": "https://github.com/mim1q/MineCells", + "wiki_url": "https://mim1q.dev/minecells", + "discord_url": null, + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/mim1q" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/9Qdvz1OV/images/eb08e9222684f821ea7ca7d569cf3bbc22556373.webp", + "featured": false, + "title": "Elevator", + "description": "How to assemble the elevator and use it", + "created": "2022-05-28T16:54:48.124670Z", + "ordering": 0 + } + ], + "color": 3616027, + "thread_id": "9Qdvz1OV", + "monetization_status": "monetized" + }, + "MobPlaques-v8.0.1-1.20.1-Fabric": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4", + "1.21" + ], + "id": "3b1CFIR5", + "slug": "mob-plaques", + "project_type": "mod", + "team": "5xWJ7qNj", + "organization": null, + "title": "Mob Plaques", + "description": "Neat, tiny attribute displays for all mobs with great customization!", + "body": "

\n

\n

\n

\n

\n

\n

\ud83d\udcd6 About:

\n

Mob Plaques adds very tiny displays above a mob's name tag to show it's current health. Armor points, armor toughness points and air supply are also shown when relevant. The mod has a bunch of config options to customize the plaques as you wish.

\n

\n

\ud83d\udcf7 Media:

\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n
  
See the health of all mobs around you  Also shows other stats such as armor points
 
  
Text color adapts; positions nicely above or below name tag  Bigger plaques for mobs further away
 
\n

\n

\ud83d\udca1 FAQ:

\n

Q: Can plaques show more mob attributes like food/potion effects/etc.?
A: No, unfortunately not. Most information about such things is never sent to clients, and is therefore not accessible.

\n

Q: How do I configure this mod?
A: Mods can have three different kinds of configs depending on the kind of settings they provide: Client, Common, and Server.

\n

Client and Common configs are found in /.minecraft/config/, named as <modId>-client.toml and <modId>-common.toml, respectively.

\n

Server configs though are applied per world, therefore you'll find those in /.minecraft/saves/<world>/serverconfig/<modId>-server.toml for local singeplayer worlds, and in /<world>/serverconfig/<modId>-server.toml for you Minecraft server. Changes made to a server config only apply to that one world. Setting default values in server configs for all newly created worlds is possible by copying the modified server config to /.minecraft/defaultconfigs/.

\n

In a local singleplayer world you can quickly find config files by running the /config showfile <modid> command and by choosing CLIENT, COMMON or SERVER. Then click the file name (ending with .toml) that appears in chat to open the file in a text editor. After saving the file, the config will automatically reload in-game after a couple of seconds, so no game restart required.

\n

On some mod loaders editing configs is also supported in-game via the Mods menu option. On some Minecraft versions you can also install my Config Menus for Forge mod for editing configs directly in-game.

\n

\n

\ud83c\udfc6 Credits:

\n

Developing Mob Plaques was helped and inspired by:

\n\n

\n

\n

\n

\"Reddit\"

\n

\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n
  
 
  
 
  
 
  
 
  
 
\n

", + "body_url": null, + "published": "2022-10-06T11:00:31.633399Z", + "updated": "2024-07-12T13:53:09.369341Z", + "approved": "2022-10-06T13:44:04.212978Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MPL-2.0", + "name": "Mozilla Public License 2.0", + "url": null + }, + "downloads": 73956, + "followers": 253, + "categories": [ + "mobs", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "v5DKY8Wa", + "VyiEPoIo", + "n3Ce9mNi", + "yFqwXOBH", + "ZQXrGR4h", + "waiGuWuT", + "oNSjCgFP", + "blGPZUFI", + "1OXoCSZr", + "Bv7jisDa", + "aS7oAK0A", + "J9SNqgoP", + "UQWgKqWP", + "bcQFG4g7", + "2maA6qra", + "wFW7OJCI", + "AIhxJG98", + "8ClJd5BS", + "18g31FS1" + ], + "icon_url": "https://cdn.modrinth.com/data/3b1CFIR5/3e15d8531b0a12ad9a97e98b08a9ab11c159edac.png", + "issues_url": "https://github.com/Fuzss/mobplaques/issues", + "source_url": "https://github.com/Fuzss/mobplaques", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/3b1CFIR5/images/1e330c2ec39ea5f71e17932d537a24c460b08e97.png", + "featured": true, + "title": null, + "description": null, + "created": "2023-01-09T11:28:48.423943Z", + "ordering": 0 + } + ], + "color": 2242132, + "thread_id": "3b1CFIR5", + "monetization_status": "monetized" + }, + "mobs_of_mythology-fabric-1.20.1-2.0.2": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.20.1", + "1.21" + ], + "id": "avrKhvsK", + "slug": "mobs-of-mythology", + "project_type": "mod", + "team": "6oe8tHgv", + "organization": "OWAli2xv", + "title": "Mobs of Mythology", + "description": "Discover a World of Mythological Creatures in Minecraft!", + "body": "[![Header Card](https://www.bisecthosting.com/images/CF/Mobs_of_Mythology/BH_MOM_header_new.webp)](https://pixeldreamstudios.net)\n\n[![BisectHosting Card](https://www.bisecthosting.com/images/CF/Mobs_of_Mythology/BH_MOM_promo.webp)](https://bisecthosting.com/PixelDream)\n\n![Description Card](https://www.bisecthosting.com/images/CF/Mobs_of_Mythology/BH_MOM_description.webp)\n\nMobs of Mythology brings mythological mobs into your Minecraft world! This mod introduces a whole new level of challenge and adventure, allowing you to encounter unique and formidable creatures during your exploration.\n\n## Automatons\n- **Crafting**: Automatons are crafted similarly to Iron Golems, but with Bronze Blocks instead of Iron Blocks.\n - **Bronze Blocks**: Crafted using Bronze Ingots.\n- **Generated Structures**: Ready-to-spawn Automatons can be found in specific generated structures.\n- **Taming**: Automatons can be tamed by right-clicking them with Gears immediately after they spawn.\n - **Gears**: Crafted from Bronze Ingots.\n\n\n\n## Kobolds\n- **Description**: Kobolds are mischievous creatures that steal items from players.\n- **Kobold Warriors**: These are more aggressive Kobolds willing to sacrifice themselves to eliminate players.\n- **Habitats**: Kobolds are typically found in wet biomes, such as jungles and swamps.\n\n\n\n\n## Drakes\n- **Description**: Drakes are gentle monsters.\n- **Taming**: They can be tamed using Cooked Chupacabra Meat.\n- **Habitats**: Drakes are found in Badlands biomes.\n\n\n\n## Chupacabra\n- **Description**: The Chupacabra is a hostile creature that targets livestock.\n- **Drops**: Its meat is not ideal for consumption but may be liked by certain mobs.\n- **Habitats**: The Chupacabra spawns in temperate biomes.\n\n\n\n## Sporelings\n- **Description**: Sporelings are cute creatures that always have something to say.\n- **Interaction**: Right-click Sporelings to read their messages.\n- **Habitats**: They spawn in mushroom biomes.\n\n\n\n[![Discord Card](https://www.bisecthosting.com/images/CF/Mobs_of_Mythology/BH_MOM_discord.webp)](https://discord.gg/pixel-dream-studios-872788557553610802)", + "body_url": null, + "published": "2023-06-14T22:35:53.744909Z", + "updated": "2024-08-06T12:22:47.110442Z", + "approved": "2023-06-17T01:25:32.438821Z", + "queued": "2023-06-14T22:46:32.069114Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-", + "name": "", + "url": "https://github.com/kyber-6/mobs-of-mythology-mod/blob/mobs-of-mythology-1.21/LICENSE" + }, + "downloads": 314559, + "followers": 376, + "categories": [ + "adventure", + "mobs", + "worldgen" + ], + "additional_categories": [ + "equipment" + ], + "loaders": [ + "fabric", + "neoforge" + ], + "versions": [ + "wWo8Qcvc", + "EYJzG6I2", + "mLNAXaMK", + "pbR0vzm8", + "VlpMdqVl", + "5QXboXqj", + "IlXyqVcA", + "oSJicyN7", + "7otcv4Po", + "WUtCPoeq", + "X0DONNp8", + "hFmkeYob", + "ZUGQbihl", + "ozjv91bL", + "cQ54eaZX" + ], + "icon_url": "https://cdn.modrinth.com/data/avrKhvsK/f357b52d26272fba2ec3211a66a98c6063e1de8f.webp", + "issues_url": "https://github.com/kyber-6/mythicmobs/issues", + "source_url": "https://github.com/kyber-6/mythicmobs", + "wiki_url": "https://github.com/kyber-6/mythicmobs-mod/wiki", + "discord_url": "https://discord.com/invite/4A9SEahH4U", + "donation_urls": [ + { + "id": "paypal", + "platform": "Paypal", + "url": "https://www.paypal.com/paypalme/pixeldreamstudios" + }, + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/pixeldreamstudios" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/avrKhvsK/images/2dc656bc098db6b8812ff78e08f64af6ee589a83.png", + "featured": false, + "title": "Sporeling", + "description": null, + "created": "2023-07-03T08:42:23.839067Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/avrKhvsK/images/300b82b8c64fa1d6ca2df7879f75940b4b36c052.png", + "featured": false, + "title": "Drake", + "description": null, + "created": "2023-07-03T08:47:02.465371Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/avrKhvsK/images/442f4ced7276c63d30e0b2e7062db436e2386ad4.png", + "featured": false, + "title": "Automaton", + "description": null, + "created": "2023-07-03T08:37:26.811601Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/avrKhvsK/images/ab70aa5db531ea1ebf6fb3eceef5c86ce78ea172.png", + "featured": false, + "title": "Kobold Warrior", + "description": null, + "created": "2023-06-15T19:35:31.349123Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/avrKhvsK/images/d0d0d47874e85205ae30dc1b5dd48ba17e5b6586.png", + "featured": false, + "title": "Kobold", + "description": null, + "created": "2023-06-15T19:35:20.105731Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/avrKhvsK/images/9b9a32d5e6b5884ff02d06a9dcf7e7c324b7468f.png", + "featured": false, + "title": "Chupacabra", + "description": null, + "created": "2023-06-15T19:36:07.104410Z", + "ordering": 2 + } + ], + "color": 13219727, + "thread_id": "avrKhvsK", + "monetization_status": "monetized" + }, + "modernfix-fabric-5.19.0+mc1.20.1": { + "client_side": "optional", + "server_side": "optional", + "game_versions": [ + "1.16.4", + "1.16.5", + "1.18.2", + "1.19.2", + "1.19.4", + "1.20", + "1.20.1", + "23w31a", + "23w32a", + "23w33a", + "1.20.2-pre3", + "1.20.2-pre4", + "1.20.2-rc1", + "1.20.2-rc2", + "1.20.2", + "23w42a", + "23w43a", + "23w45a", + "1.20.3", + "1.20.4", + "24w04a", + "24w09a", + "24w14a", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "nmDcB62a", + "slug": "modernfix", + "project_type": "mod", + "team": "xw684WUq", + "organization": null, + "title": "ModernFix", + "description": "All-in-one mod that improves performance, reduces memory usage, and fixes many bugs. Compatible with all your favorite performance mods!", + "body": "![Banner image](https://cdn-raw.modrinth.com/data/nmDcB62a/images/3c7be090404ebfed497b04aec8b4cd7cc1aac7ca.png)\n\n[![Donate](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy/donate/kofi-singular_vector.svg)](https://ko-fi.com/embeddedt)\n[![Available for Fabric](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy/supported/fabric_vector.svg)](https://modrinth.com/mod/modernfix/versions?l=fabric)\n[![Available for Forge](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy/supported/forge_vector.svg)](https://modrinth.com/mod/modernfix/versions?l=forge)\n[![Join the Discord](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy/social/discord-plural_vector.svg)](https://discord.gg/rN9Y7caguP)\n\nModernFix is an all-in-one mod that **improves performance, reduces memory usage, and fixes many bugs** in modern Minecraft versions (most versions including and above 1.16 are supported)\nwithout majorly compromising the game experience. Most Forge 1.16-1.19.2 modpacks will launch **roughly twice as fast** with ModernFix installed.\nIf some non-default options are enabled, it can even allow large modpacks like All The Mods 8 to run with **3GB or less of allocated memory**.\n\nModernFix is free, open-source software. All of the code is available on [the GitHub repository](https://github.com/embeddedt/ModernFix).\n\n## \u2699\ufe0f Technical summary\n\nWhat exactly does ModernFix do for your game? There are a lot of tweaks being made - too many to summarize here. However, here is a\nbrief summary of the general types of improvements being made:\n\n* Backports of bugfixes from newer versions of Minecraft and/or Forge, e.g. fixing\n[worlds breaking when you remove a dimension mod in 1.18](https://github.com/MinecraftForge/MinecraftForge/issues/8800).\n* Patches to mods that are no longer supported on a given Minecraft version, to improve the gameplay experience instead of requiring\nplayers to update.\n* Many optimizations & improvements to the game's launch process to significantly improve speed and reduce random concurrency crashes.\n* Additional debug tools to help modders and players determine the cause of some rare game crashes/freezes, instead of relying on a painful\nmod bisection process.\n* It's not enabled by default due to compatibility issues, but ModernFix includes functionality to [completely redesign the game's model loading system](https://github.com/embeddedt/ModernFix/wiki/Dynamic-Resources-FAQ), replacing it with a new,\ndynamic version that loads models on the fly. Model loading is one of the major performance regressions to modded Minecraft that\nhas been present since 1.8, and this new system alleviates nearly all of the downsides, bringing memory usage and loading times\nmore in line with how they were in 1.7.10.\n* Need to play the game with very little RAM allocated (e.g. 512MB or less)? [Now you can do that.](https://github.com/embeddedt/ModernFix/wiki/Ultra%E2%80%90Low-Memory-Footprint)\n\nIf you are technically savvy and looking for more details on each patch, I recommend reading the [Summary of Patches](https://github.com/embeddedt/ModernFix/wiki/Summary-of-Patches) wiki page.\n\n## \ud83d\udc1b Where to go when something doesn't work\n\nPlease either report an issue on [GitHub](https://github.com/embeddedt/ModernFix), or join the [Discord](https://discord.gg/rN9Y7caguP) and ask in the `#modernfix-discussion` channel.\nBe sure to mention the Minecraft version, modloader, and ModernFix version you are using, as well as what other mods you have installed.\n\n## \ud83c\udf81 How can I support this project?\n\nThere are two main ways you can help support the development of ModernFix:\n\n* Spread the word! Test ModernFix in modpacks and encourage them to include it.\n* If you feel generous, I do accept donations via [Ko-fi](https://ko-fi.com/embeddedt). Donating is not required (as ModernFix is free),\nbut every little bit helps. I work on ModernFix in my spare time, so any compensation I receive helps to sustain development.\n\n## \u2753 What other mods should I use?\n\nThere are many performance mods available for Minecraft and I can't list them all here, but here are some essential mods, in my opinion:\n\n- On any version before 1.19.4 you should always have LazyDFU installed, as it eliminates the incredible lag caused by the DFU system.\n- On any version before 1.20 you should generally use Starlight unless it has a compatibility issue with your mods (which is quite rare).\nIt offers vastly improved lighting performance and can also fix FPS stutters when moving between chunks.\n- Always have FerriteCore installed, as Mojang's implementation of blockstates/models is laughably inefficient, and quickly\nconsumes RAM as soon as more content is added beyond what vanilla offers.\n- Install a mod like Shutup Experimental settings (before 1.19) or Yeetus Experimentus (1.19+). These mods will suppress the\npop-up screen about experimental game features, which otherwise causes the game to reload its resources twice.\n\nOn a related note: I do **not** recommend use of OptiFine in any modded scenario. It is closed-source, patches the game in a way that easily breaks\nForge and other mods, and significantly slows down game launching, often on the order of minutes. Please try Sodium (on Fabric) or Embeddium (on Forge) instead!\nUsing OptiFine with ModernFix is not officially supported, and may cause issues.\n\n## \ud83d\udda5\ufe0f Need a server? Check out BisectHosting!\n\n\n[![Bisect Hosting banner](https://www.bisecthosting.com/partners/custom-banners/6b02ce11-5cf6-4e67-9a75-06474a46308a.webp)](https://bisecthosting.com/embeddedt)", + "body_url": null, + "published": "2023-04-16T20:56:18.092938Z", + "updated": "2024-08-11T00:06:05.776345Z", + "approved": "2023-04-18T00:08:34.429392Z", + "queued": "2023-04-16T21:06:11.482278Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 6346904, + "followers": 2067, + "categories": [ + "optimization", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "YmKitGGB", + "bakWifEu", + "lesun1xH", + "TLWpxXmE", + "tiJtC3Oq", + "RhqFUhKl", + "cRc8mTYR", + "tF5MXC99", + "YxjVHp6F", + "JoZVElr5", + "4D2n0P0v", + "yvUZHRTF", + "JC0k0BLU", + "aG83F2oq", + "wdlIqJM9", + "YvfHwxb6", + "DkR6UGcX", + "ovFOToAu", + "j79FcbOV", + "fPhurjKv", + "WNYg8TPD", + "8v4CKHNp", + "AR3lYRXy", + "V5JUXqmy", + "vHjPr4v0", + "yMD6AsFA", + "JofM3ehE", + "jTnRrN6H", + "ZD8n3OeB", + "XWyZT7uo", + "AvZe17Tl", + "5cOhMOWI", + "kGN22Ber", + "t4ArpHYs", + "JXUd23wE", + "qVu4O77q", + "McrIpooS", + "42k2MtHD", + "Qkwj2yjS", + "z5NtPX4A", + "Fn6lcgy4", + "pgncb4h9", + "GhEe98X3", + "kFuRlbS1", + "I24pbFOk", + "HfJUDwN3", + "90vs2FzN", + "T1YKIVCh", + "Qo4bxua4", + "HgJiOAQn", + "FfgHSOEU", + "uMIQRvh7", + "lF2pqrO8", + "CxL2MT5m", + "KuHaMmH1", + "SmZNSwfL", + "f7G7ygPr", + "3LgRU8Ie", + "1Mffj87M", + "2KYa5aqD", + "fqLJ9uB4", + "pKlyKViU", + "tr7cCUCK", + "CTaP4kW5", + "P6rbJql2", + "JVeaC9TI", + "Cs5lOKhd", + "p9S1UnOj", + "VbB4VqCo", + "qbRB2wZ2", + "fX8QihJW", + "ZopebhEU", + "hd1JuF4v", + "BTaK8vvw", + "euvIjfw2", + "WENf7fmL", + "RFtlfOIV", + "30XnUo00", + "e2wI0Dzg", + "KvbeSuS1", + "D2athySH", + "1gWqXFaX", + "AMJ0B4Bp", + "iO9FlOIm", + "G1VHm2Bd", + "DHw0yfjn", + "eff9HvKh", + "9MmJorda", + "k4BkxAU7", + "NtsxXDeZ", + "PKKqdqS8", + "DUroUjL7", + "CS1MpLrX", + "lJnMKe8e", + "TsXMK3TX", + "uzk1oBWH", + "blMuB0D8", + "JqdfKm8N", + "D1gtdBXw", + "WV8pFhUO", + "gRSAAIUU", + "NQFTTsi6", + "y4X4GM0C", + "jqteDlfX", + "buGrwsKZ", + "G5B0BoGA", + "oZJClBYn", + "QVSzLhRT", + "R7Eu2Fxe", + "btaNfyRK", + "z6cki1Hr", + "H7mnYOML", + "FDJCtlbz", + "e4ytl9KT", + "TsDx3td2", + "RMzc2zgT", + "zf548Phd", + "linysjCw", + "VaRd7XJ6", + "jiSgqiXH", + "V1smspgn", + "41RDuPe2", + "EZjY458j", + "cwTG6hyQ", + "I7WQ2bG5", + "wYFiI0CR", + "ad7TwMbL", + "1QLOTz4V", + "vXwiklcD", + "OFdWh7vx", + "uBReEWbz", + "zaaC7slX", + "9RlPyiaK", + "nVsxUgHx", + "p9vVa5yl", + "qlVWBKgU", + "v9uT5wj5", + "4ZIvpHca", + "PT1kduV3", + "gBP4wtrN", + "gMj6NTPn", + "lYUa4fZk", + "rJvkWL2n", + "c0IRQDNy", + "ZAuuntw4", + "eUxKumbO", + "F7WIWFs8", + "uOTQ9aSd", + "r1M11yfD", + "97pLchRn", + "gXrLEidK", + "kdOkBzuD", + "DybtrvoI", + "ZqhmgF0E", + "Drr9QiOX", + "WJnAag75", + "YMq1FhHc", + "51N1kQ5P", + "at0BBqZ8", + "Lbh7ndyf", + "T1T1ryiy", + "A7VJZ2sj", + "GJHB6P6y", + "GOlEdlgS", + "IMHeD2GV", + "XjunZE7n", + "6gM4GFBm", + "BmneBBYa", + "YvOjtot0", + "okrRsbRZ", + "owXH7FqO", + "PV5hrdhD", + "1NhyR6t8", + "sk9kFgqw", + "MqJb4736", + "Ixz7TNCN", + "cQ0TCwKQ", + "pZkNGdFz", + "jdCqC43M", + "3otSD6Ai", + "yviR2zX6", + "yRHXqAyS", + "xiu6MBJc", + "sZJM5bCM", + "ZCHErBQZ", + "9uRdxCNg", + "TE74NXUO", + "sBZ9FlQW", + "LMfdftzT", + "S2KHHn3O", + "XZZJ27Mx", + "9HGXIyEe", + "GANc4eZR", + "afRRm0EA", + "sWajyf3d", + "zDXxoYbt", + "5wGMan5g", + "ud3vvnM2", + "x3K80mPd", + "DDGA4vbS", + "BKutfSDf", + "WqyujHIn", + "synysXtc", + "xYsH89XA", + "5RzoQnZl", + "GPUrRuDK", + "HfUWwFQ6", + "Jw8xBmGc", + "NZQwlLgZ", + "YufYRxqH", + "GaLxviO2", + "orPjIEAx", + "R0xJ0sx8", + "FGNCOJKF", + "UxFGc28X", + "YDyqtNIH", + "ZdOokN06", + "gpXn0fGj", + "lCU44mLr", + "RPmoiZHT", + "pWraKWFy", + "jHaVrcbU", + "F35FyEva", + "WYn556RC", + "qomlktsB", + "Ggtcd6Lc", + "D8qeBfgE", + "uW4Lb1JW", + "RIRMMnjp", + "Ve0iT3SL", + "PtYPJcwF", + "4GPZ0uWs", + "PutKck7D", + "GLv15259", + "wYHO5U66", + "fJoMxOnN", + "nemKhyeF", + "8RyDnURg", + "Z9Nf1tw4", + "W2wYO1hK", + "CzIOJZ7D", + "YWxJmxJY", + "IDCtf2Pk", + "DZ7o2FaT", + "Sp3Y3R1p", + "YzYQ1W8W", + "tI8jU427", + "WmXK2piP", + "vQEyMOe0", + "edDrlUuk", + "70e4PROK", + "B26rDrrz", + "WNErDoy0", + "QlqkSEup", + "LeHETH9A", + "YRcPOXZH", + "cQh6zioW", + "PJlRMp4v", + "LJrDWFEH", + "nhQNNUHs", + "rigrXobp", + "jMVGsL8p", + "TJqCeI1u", + "xJbpSSiw", + "6GPongoq", + "ohh21bah", + "f1dYaEYt", + "TyzpVbn0", + "wz12hVLM", + "3NFLTjo5", + "2Gz3u7pY", + "qhD8hz8A", + "wS8BEj1H", + "lBQ3o7cT", + "9ca4pizA", + "zNxPnVZT", + "oqeQjBRP", + "Ypf2M9ta", + "XDyibw2U", + "RXtwG3lX", + "tNwzW4Bd", + "88ksqzbj", + "TtNOTwgu", + "NufUMuUS", + "LXlsO4Vo", + "5SKZ5Y5s", + "zny6etkd", + "YS6WlthK", + "GaKeTHbJ", + "oYMb8L0w", + "9R9LPE4L", + "16qY2NJU", + "SbLn3VXX", + "xedGgIRE", + "QpVWtj3q", + "v9acGUOX", + "7wRCZYa1", + "tlTrDouz", + "v2HWaHmC", + "RtHWz3X8", + "OxmgvWdr", + "ADyFF3WV", + "NZfBUD1x", + "GREykag1", + "iFQICDdq", + "SHRLUukI", + "6cUAWrqk", + "HZze6q1Z", + "hhpzMwx0", + "ziFdyRZU", + "bCqKORCZ", + "5YONh7M3", + "iMK8fcT3", + "qqf2pVIf", + "8bcOcx2u", + "StT6fUPe", + "gDr0pa5m", + "mnS5cWZA", + "h06WI6hI", + "lmCEiM2x", + "I019kuJ8", + "vQ1eqwUT", + "6jU8mhig", + "DDQyvO7M", + "b1FKKAz8", + "p3IGhtdO", + "qNrVNwfw", + "6caqQhyN", + "FDGaMHFj", + "jUXzFIgk", + "hIcEK3Ks", + "FgynMuhC", + "9e1ulwtU", + "hV2WSfLx", + "LZJryrWA", + "AW2Wv8MN", + "v7RwGjGf", + "ge00Oz2v", + "LADYq9h9", + "19lQhQ2Q", + "OMUhFXfR", + "r62BNWkZ", + "aIrZFfMA", + "pTldUfVl", + "5vWEqiOB", + "jJVhEy8G", + "g2qIraQ1", + "hymPZqLe", + "8cRA5hIs", + "1niVYLe4", + "WrH5h6hR", + "cuMfXHwk", + "nYh2qee4", + "SEKTVPwa", + "2ewMnB7e", + "m0WsH8Pp", + "5TGI84hb", + "QTtrC1Mj", + "WzGrDsBM", + "G55gynqz", + "ZNaGDoHa", + "anWzGpyT", + "9GyqQvmB", + "AIejFbqQ", + "IC7LBv4d", + "bT6gZuTb", + "6wupFeDa", + "wdSwq9ke", + "P8w71zv8", + "IScTO5kT", + "vxDb5tOq", + "qgFq0dU0", + "T3un6Ool", + "CDiUztEN", + "8hPIV7NS", + "7c9U7JHU", + "rRcwOsPa", + "6IhNexn2", + "pAWJdjPp", + "7fJivtJU", + "XmsWashv", + "6YtCmcgN", + "MypV6XBd", + "gkUP299q", + "d6XtsgBG", + "DAzGqP8u", + "RXaOdpBL", + "usNAzp2p", + "npSYUF6U", + "b5yVw0pL", + "giQyDXGo", + "nksMSrEt", + "oylrfPkW", + "UKHyXfho", + "2FN93J80", + "IJWNOJEe", + "gJzUanvd", + "Ohe8OvYJ", + "1FrMon6Q", + "gepXNUac", + "6Tz5Moit", + "D74K2SYQ", + "bBOj6OEk", + "oOnGhdHG", + "SjO7r0li", + "2HMvqcxJ", + "A7mqqvc5", + "LQU2U5mx", + "MAghxxfz", + "rf0fSXa5", + "s3eeVFK8", + "24VdLGlD", + "9rqtpYwE", + "r9eMwecP", + "4BFceRG4", + "bsTG5IKj", + "fktvkFSD", + "uUQmiRzm", + "OOAMFEGB", + "JeFLzIkV", + "IWsQb2tD", + "Btq1HFzk", + "T8GvLNSz", + "oJUG6agJ", + "u5R7SNlj", + "vHzDHEDN", + "YPwzjK2W", + "Id3z4wMh", + "P0Gj6bhf", + "xgdNEjjn", + "o6bFEv8x", + "f6WrRlmX", + "oRGm8e3F", + "uazja51B", + "JEenvxf5", + "XWMKGS0l", + "J3SmQdYi", + "yx7Ty06C", + "b9EwaQ8h", + "9eACxgCp", + "zlah1a6M", + "5LHKYBfs", + "jZcXXRiU", + "u1FOqNCn", + "wMmG6Z2w", + "PmGpKiME", + "lQs9avbD", + "IMUijlCk", + "jXMYPayd", + "8IOJKzmV", + "OS3nKgb9", + "peqGje5u", + "cGTUis9q", + "nQTU8UXe", + "69cUr8FY", + "8fdApWNK", + "YtxEBvsf", + "rYozV85S", + "TI6DbX58", + "VABjk2B2", + "xsOOBMvd", + "qFKeDWer", + "TwtE3QUV", + "caijz5kw", + "Nez10x5y", + "2Rr52SPW", + "ruxa7tmt", + "EL78UqrQ", + "WnvIT2k4", + "zVCpSwRk", + "CV2Vtn5m", + "dWBNYmKr", + "fh7tdNlS", + "Kf6nINYI", + "tmmvhxCF", + "BpXImv5B", + "QXdjmNRb", + "KNI1HSwE", + "kGQbFg0p", + "OLsQcRB4", + "Enb5QBS3", + "mX9P5IWG", + "AV7XOtET", + "xlt4bcjj", + "xrfAu1uz", + "mDqpjmKe", + "Cc0b1kXl", + "3rl50He4", + "dUdr6D7I", + "g8YTb1tk", + "o1xUnPS2", + "LJ5N4YSl", + "QA8FnfC2", + "Vlkqd178", + "i0vWRI7P", + "kawuAd17", + "FMcuOGSQ", + "CB2UOpt3", + "JCb26GJk", + "f3UzsGPb", + "9pYr3f79", + "AFvoBfkx", + "Z6zUeVzl", + "R8Z329pv", + "Ot0Gu4EP", + "Tx3ph266", + "kVsoDxr7", + "wZo2xGP6", + "QroNBg6X", + "NUPJxyji", + "QTSxkl1e", + "omk9tj4N", + "A6zzCptF", + "Ujn5wrXH", + "TXrV8DtO", + "CVCY5mv4", + "2U36f0dT", + "nHo5y93M", + "j5VhGcov", + "ZYnwHpym", + "MKrkLMqg", + "KCOwQkKi", + "vNbpPeOM", + "i8GSONFm", + "HFaBErrM", + "nJmQaEws", + "HdKHe8QA" + ], + "icon_url": "https://cdn.modrinth.com/data/nmDcB62a/e1d2433476995be1b1a94ff1afaf6167752274ae.png", + "issues_url": "https://github.com/embeddedt/ModernFix/issues", + "source_url": "https://github.com/embeddedt/ModernFix", + "wiki_url": "https://github.com/embeddedt/ModernFix/wiki", + "discord_url": "https://discord.gg/rN9Y7caguP", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/embeddedt" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/nmDcB62a/images/3c7be090404ebfed497b04aec8b4cd7cc1aac7ca.png", + "featured": true, + "title": null, + "description": null, + "created": "2023-07-14T02:11:55.058630Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/nmDcB62a/images/e9e46236d19c109f147bee72cededf4176c8a657.png", + "featured": false, + "title": "Lower memory usage", + "description": "Forge 1.16.5 running (just!) with only 200MB of RAM allocated", + "created": "2023-04-16T21:01:34.623057Z", + "ordering": 0 + } + ], + "color": 263172, + "thread_id": "nmDcB62a", + "monetization_status": "monetized" + }, + "modmenu-7.2.2": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.14.4", + "1.15.2", + "1.16.1", + "1.16.4", + "1.16.5", + "21w06a", + "21w14a", + "1.17-pre1", + "1.17", + "1.17.1", + "21w37a", + "21w38a", + "1.18", + "1.18.1-pre1", + "1.18.1-rc1", + "1.18.1-rc2", + "1.18.1-rc3", + "1.18.1", + "22w03a", + "22w05a", + "22w06a", + "22w07a", + "1.18.2-pre1", + "1.18.2-pre2", + "1.18.2-pre3", + "1.18.2-rc1", + "1.18.2", + "22w15a", + "22w16b", + "22w17a", + "22w18a", + "22w19a", + "1.19-pre1", + "1.19-pre2", + "1.19-pre3", + "1.19-pre4", + "1.19", + "22w24a", + "1.19.1-rc1", + "1.19.1-pre2", + "1.19.1", + "1.19.2", + "22w43a", + "1.19.3", + "23w03a", + "23w05a", + "23w07a", + "1.19.4-pre1", + "1.19.4-pre2", + "1.19.4-pre3", + "1.19.4-pre4", + "1.19.4-rc1", + "1.19.4-rc2", + "1.19.4-rc3", + "1.19.4", + "23w12a", + "23w13a", + "23w13a_or_b", + "23w14a", + "23w16a", + "23w17a", + "23w18a", + "1.20-pre1", + "1.20-pre2", + "1.20-pre3", + "1.20-pre4", + "1.20-pre5", + "1.20-pre6", + "1.20-pre7", + "1.20-rc1", + "1.20", + "1.20.1-rc1", + "1.20.1", + "23w31a", + "23w32a", + "23w33a", + "23w35a", + "1.20.2-pre1", + "1.20.2-pre2", + "1.20.2-pre3", + "1.20.2-pre4", + "1.20.2-rc1", + "1.20.2-rc2", + "1.20.2", + "23w40a", + "23w42a", + "23w44a", + "23w45a", + "23w46a", + "1.20.3-pre1", + "1.20.3-pre2", + "1.20.3-pre3", + "1.20.3-pre4", + "1.20.3-rc1", + "1.20.3", + "1.20.4-rc1", + "1.20.4", + "23w51a", + "23w51b", + "24w03a", + "24w03b", + "24w04a", + "24w05a", + "24w05b", + "24w06a", + "24w07a", + "24w09a", + "24w10a", + "24w11a", + "24w12a", + "24w13a", + "24w14potato", + "24w14a", + "1.20.5-pre1", + "1.20.5-rc3", + "1.20.5", + "1.20.6-rc1", + "1.20.6", + "24w18a", + "1.21-pre2", + "1.21-pre3", + "1.21-pre4", + "1.21-rc1", + "1.21", + "1.21.1-rc1", + "1.21.1" + ], + "id": "mOgUt4GM", + "slug": "modmenu", + "project_type": "mod", + "team": "VMz4FpgB", + "organization": "ASjenmjH", + "title": "Mod Menu", + "description": "Adds a mod menu to view the list of mods you have installed.", + "body": "# Mod Menu\n![Screenshot of the Mods screen, showing a list of a few mods on the left side below a search bar and filters button, where Mod Menu is selected. On the right side of the screen, it shows more details about the mod, such as authors, a description, links, credits, and a button to configure the mod.](https://cdn.modrinth.com/data/mOgUt4GM/images/155dd2b006883b168b1279ec0ff21e753946518b.png)\n\nMod Menu lets you view the mods you have installed and, if supported by the mod, enables quick and easy access to the mod's config screens.\n\nMod Menu also supports some more advanced features, such as translatable mod names and descriptions, support for [QuickText formatting](https://placeholders.pb4.eu/user/quicktext/) in mod descriptions thanks to [Patbox](https://ko-fi.com/patbox)'s [Text Placeholder API](https://modrinth.com/mod/placeholder-api), filters library mods out from regular mods, a mod update checker for mods hosted on Modrinth or that provide their own update sources, and deep configuration for all the features we provide.\n\n### Supported Platforms\nMod Menu is currently available for Fabric or Quilt on Minecraft: Java Edition 1.14 or newer.\n\n## Developers\nMod Menu includes a number of APIs for developers to improve how their mod appears in Mod Menu. These come in the form of language keys, JSON metadata, and even a Java API.\n\n### Translation API\nYou can translate your mod's name, summary, and description all without touching any Java code. Simply add translation keys in the supported format to any language you'd like.\n\n
\nTranslation API Documentation\n\nHere's an example of Mod Menu's translations into Pirate Speak. To create your own, simply replace `modmenu` at the end (***NOT*** the one in the beginning) of the translation key with your own mod ID, for example `modmenu.descriptionTranslation.traverse`.\n\n`en_pt.json`\n```json\n\"modmenu.nameTranslation.modmenu\": \"Menu o' mods!\",\n\"modmenu.descriptionTranslation.modmenu\": \"Menu o' mods ye installed matey!\",\n\"modmenu.summaryTranslation.modmenu\": \"Menu o' mods ye installed matey!\"\n```\n\n> The summary translation is redundant here and does not need to be included because it's the same as the description, but it was included to show that you may translate the summary (a short, one-sentence description of the mod) separately from the description, even in English!\n\n
\n\n\n\n### Fabric Metadata API\nThere's a number of things you can add just with metadata in your `fabric.mod.json`.\n\nAll of these are added to a custom block in your `fabric.mod.json` for Mod Menu's metadata. Here's an example usage of many of the features this API provides:\n\n`fabric.mod.json`\n```json5\n{\n ...\n \"custom\": {\n \"modmenu\": {\n \"links\": {\n \"modmenu.discord\": \"https://discord.gg/jEGF5fb\"\n },\n \"badges\": [ \"library\", \"deprecated\" ],\n \"parent\": {\n \"id\": \"example-api\",\n \"name\": \"Example API\",\n \"description\": \"Modular example library\",\n \"icon\": \"assets/example-api-module-v1/parent_icon.png\",\n \"badges\": [ \"library\" ]\n },\n \"update_checker\": true\n }\n }\n}\n```\n\n
\nFabric Metadata API Documentation\n\n#### Badges (`\"badges\": [ ]`)\nWhile the `Client` badge is added automatically to mods set as client-side only (set `\"environment\": \"client\"` in `fabric.mod.json` to do this.), other badges such as the `Library` and `Deprecated` badges require definition here.\n\nSupported values:\n- `library` - should be assigned to mods that are purely dependencies for other mods that should not be shown to the user by default unless they toggle them on.\n- `deprecated` - should be assigned to mods that exist purely for legacy reasons, such as an old API module or such.\n\nAny others will be ignored, and Mod Menu does not support adding your own badges. You may open an issue [here](https://github.com/TerraformersMC/ModMenu/issues) if you have a compelling use case for a new badge.\n\n#### Links (`\"links\": { }`)\nThe `links` object allows mod authors to add custom hyperlinks to the end of their description. If you specify a `sources` contact in the official `fabric.mod.json` metadata, it will also be included in the links section.\n\nAny key in the `links` object will be included in the links section, with the key being used as a translation key. For example, this:\n\n`fabric.mod.json`\n```json\n\"custom\": {\n \"modmenu\": {\n \"links\": {\n \"modmenu.discord\": \"https://discord.gg/jEGF5fb\"\n }\n }\n}\n```\nwill show as a link with the text \"Discord\", since \"Discord\" is the English translation of \"modmenu.discord\" provided by Mod Menu.\n\nMod Menu provides several default translations that can be used for links. A full list can be seen in Mod Menu's language file [here](https://github.com/TerraformersMC/ModMenu/blob/-/src/main/resources/assets/modmenu/lang/en_us.json). All default link translation keys take the form `modmenu.`.\n\nYou can also provide your own translations if you would like to add custom links. Make sure to use ***your own namespace*** (as opposed to `modmenu`) for any custom keys.\n\n#### Parents (`\"parent\": \"mod_id\" or { }`)\n\n\nParents are used to display a mod as a child of another one. This is meant to be used for mods divided into different modules. The following element in a `fabric.mod.json` will define the mod as a child of the mod 'flamingo': \n\n`fabric.mod.json`\n```json\n\"custom\": {\n \"modmenu\": {\n \"parent\": \"flamingo\"\n }\n}\n```\n\nHowever, if you want to group mods under a parent, but the parent isn't an actual mod, you can do that too. In the example below, a mod is defining metadata for a parent. Make sure that this metadata is included in all of the children that use the fake/dummy parent. This can also be used as a fallback for an optional parent, it will be replace by the mod's real metadata if present.\n\n\n`fabric.mod.json`\n```json\n\"custom\": {\n \"modmenu\": {\n \"parent\": {\n \"id\": \"this-mod-isnt-real\",\n \"name\": \"Fake Mod\",\n \"description\": \"Do cool stuff with this fake mod\",\n \"icon\": \"assets/real-mod/fake-mod-icon.png\",\n \"badges\": [ \"library\" ]\n }\n }\n}\n```\n\nDummy parent mods only support the following metadata:\n- `id` (String)\n- `name` (String)\n- `description` (String)\n- `icon` (String)\n- `badges` (Array of Strings)\n\n\n#### Disable update checker (`\"update_checker\": false`)\nBy default, Mod Menu's update checker will use the hash of your mod's jar to lookup the latest version on Modrinth. If it finds a matching project, it will check for the latest version that supports your mod loader and Minecraft version, and if it has a different hash from your existing file, it will prompt the user that there is an update available.\n\nYou can disable the update checker by setting `update_checker` to false in your Mod Menu metadata like so:\n\n`fabric.mod.json`\n```json\n\"custom\": {\n \"modmenu\": {\n \"update_checker\": false\n }\n}\n```\n\n
\n\n### Quilt Metadata API\nSince Mod Menu supports Quilt as well, the same APIs in the Fabric Metadata API section are also available for Quilt mods, but the format for custom metadata is slightly different. \n\nInstead of a `\"modmenu\"` block inside of a `\"custom\"` block, you put the `\"modmenu\"` block as an element in the root object. So it should look like:\n\n`quilt.mod.json`\n```json5\n{\n ...\n \"modmenu\": {\n // Here's where your links, badges, etc. stuff goes\n }\n}\n```\n\n### Java API\nTo use the Java API, you'll need to add Mod Menu as a compile-time dependency in your gradle project. This won't make your mod require Mod Menu, but it'll be present in your environment for you to test with.\n\n`build.gradle`\n```gradle\n// Add the Terraformers maven repo to your repositories block\nrepositories {\n maven {\n name = \"Terraformers\"\n url = \"https://maven.terraformersmc.com/\"\n }\n}\n\n// Add Mod Menu as a dependency in your environment\ndependencies {\n modImplementation(\"com.terraformersmc:modmenu:${project.modmenu_version}\")\n}\n```\nThen, define the version of Mod Menu you're using in your `gradle.properties`. You can get the latest version number [here](https://modrinth.com/mod/modmenu/version/latest), but you may need a different version if you're not using the latest Minecraft version. See the [versions page](https://modrinth.com/mod/modmenu/versions) for a full list of versions.\n\n`gradle.properties`\n```properties\nmodmenu_version=VERSION_NUMBER_HERE\n```\n> If you don't want it in your environment for testing but still want to compile against Mod Menu for using the Java API, you can use `modCompileOnly` instead of `modImplementation` (this will work even if Mod Menu is not updated to the version of Minecraft you're running).\n\n
\nJava API Documentation\n\n### Getting Started\nTo use the API, implement the ModMenuApi interface on a class and add that as an entry point of type \"modmenu\" in your `fabric.mod.json` like this:\n\n`fabric.mod.json`\n```json\n\"entrypoints\": {\n \"modmenu\": [ \"com.example.mod.ExampleModMenuApiImpl\" ]\n}\n```\n\n### Mod Config Screens\nMods can provide a Screen factory to provide a custom config screen to open with the config button. Implement the `getModConfigScreenFactory` method in your API implementation to do this.\n\nThe intended use case for this is for mods to provide their own config screens. The mod id of the config screen is automagically determined by the source mod container that the entrypoint originated from.\n\n### Provided Config Screens\nMods can provide Screen factories to provide a custom config screens to open with the config buttons for other mods as well. Implement the `getProvidedConfigScreenFactories` method in your API implementation for this.\n\nThe intended use case for this is for a mod like Cloth Config to provide config screens for mods that use its API.\n\n### Modpack Badges\nMods can give other mods the `Modpack` badge by implementing the `attachModpackBadges` method, such as through the following:\n\n```java\n@Override\npublic void attachModpackBadges(Consumer consumer) {\n\tconsumer.accept(\"modmenu\"); // Indicates that 'modmenu' is part of the modpack\n}\n```\n\nNote that 'internal' mods such as Minecraft itself and the mod loader cannot be given the modpack badge, as they are not distributed within a typical modpack.\n\n### Static Helper Methods\n`ModMenuApi` also offers a few helper methods for mods that want to work with Mod Menu better, like making their own Mods buttons.\n\n#### Creating a Mods screen instance\nYou can call this method to get an instance of the Mods screen:\n```java\nScreen createModsScreen(Screen previous)\n```\n\n#### Creating a Mods button `Text`\nYou can call this method to get the Text that would be displayed on a Mod Menu Mods button:\n```java\nText createModsButtonText()\n```\n\n
", + "body_url": null, + "published": "2020-11-06T05:11:04.725058Z", + "updated": "2024-06-21T14:44:42.928177Z", + "approved": "2020-11-06T05:11:04.725058Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 10957641, + "followers": 10968, + "categories": [ + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "M3KFXLhq", + "DgzrfgAZ", + "O90fUm3q", + "zC13OZD9", + "7QWIhei3", + "79rtoAM6", + "kBofQyu4", + "TleLdS1A", + "PqgXyy3N", + "Mnl0OeFI", + "pxj9L3Vy", + "6YvLIUDN", + "wb5nbuL5", + "bPE0GIoY", + "pqlMITZQ", + "RIf7gcLA", + "Gz5wa6j2", + "EDbIonje", + "wRE7Emzz", + "mzVbb1XI", + "bHODZExo", + "a8bewBQT", + "NyFB1gry", + "oQr5VO7q", + "u955lyFM", + "E4QBMVtO", + "c6uDXZX8", + "bojzkt4w", + "4Ar2wg0k", + "G8sCBZ1X", + "JyL5b75a", + "GOPQZTVp", + "Wr4GfZdy", + "tlM0eBmY", + "DOitjZ89", + "XtL1i60M", + "VaZTuVan", + "FMqdptUn", + "aH8qgnVM", + "9xECQHnM", + "LVxVja5i", + "JOqf8AZn", + "WKj0jgYj", + "jZQ0G78K", + "PN4NcBa1", + "WkUCkcQA", + "3CD6YUw1", + "JPP6w2U1", + "eueI9czw", + "4JrWqhWw", + "Ui2loaCY", + "fw5MM4c4", + "6f25OJ7w", + "E4VKK6kQ", + "y8cYdaYa", + "GYRoFp1I", + "Tk7mCRX1", + "aShj7736", + "dP3zrFbp", + "cx9D94fU", + "pnFEFiHq", + "ybXxCvz4", + "NsD1IoUs", + "oU5qfeR6", + "2Ys0a7JE", + "8TOgNwQL", + "kQDE01D3", + "3umfHb6R", + "Gbkn1raO", + "d86kV6wd", + "NAs8eiQa", + "RxrqnH1z", + "GI1HTA1O", + "sI3kiPZE", + "4dReZoTJ", + "7mdkE3Od", + "qDXCbEz4", + "IPLgxPn7", + "V4hnfgRO", + "nVxObSbX", + "7kh2ofyR", + "eIrlBn1Z", + "yA8g3pEj", + "oqeCO757", + "4LXaG2xg", + "5qqTBb38", + "7E8dbVv0", + "5aw4r6fS", + "pyDmgV07", + "jRqFAHRH", + "4EOA40rU", + "gSoPJyVn", + "RtaGQNyd", + "sXVmzBDB", + "U31K6311", + "JYTmttex", + "pged5sGx", + "5e62j63G", + "nM5QaZNo", + "aMxXwo9x", + "3gwnUSKz", + "yjjsLqbS", + "RdCGzY7B", + "EuNUYds8", + "iZRiOnnj", + "M7LIgtWJ", + "RTFDnTKf", + "CtMNOUcV", + "zv46i3PW", + "VHzvWfY2", + "sLzitH81", + "id0aLmxO", + "eTCL1uh8", + "lMqXEzUw", + "jbNN4rAs", + "lEkperf6", + "sMAXpy0X", + "TwfjidT5", + "qpKaDJtd", + "Edgke5GX", + "tXEHCONL", + "4EYB2Bxx", + "fCQyI9Zj", + "sjtVVlsA", + "ua8KrvY4", + "mtTzRMV2", + "w3icASIi", + "VOHp29AO", + "ybV7vGT5", + "NgnZx44E", + "9FL4cmP7", + "KXx8jdVE", + "YLesFuAc", + "I7OSH8Gw", + "jnj30PDT", + "HLa8flfl", + "FawTQg29", + "lJ1xXMce", + "xhN1IvHi" + ], + "icon_url": "https://cdn.modrinth.com/data/mOgUt4GM/1b6bcdef5a3d92572f517122650716be7ec6458b.webp", + "issues_url": "https://github.com/TerraformersMC/ModMenu/issues", + "source_url": "https://github.com/TerraformersMC/ModMenu", + "wiki_url": "https://github.com/TerraformersMC/ModMenu/wiki", + "discord_url": "https://discord.gg/jEGF5fb", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/mOgUt4GM/images/155dd2b006883b168b1279ec0ff21e753946518b.png", + "featured": false, + "title": "Mod Menu v11 Screenshot", + "description": null, + "created": "2024-06-17T18:16:51.936311Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/mOgUt4GM/images/ec97a9f09bc750dd7895414eac14f6252ca47621.png", + "featured": true, + "title": "Mod Menu Banner", + "description": null, + "created": "2023-11-03T21:09:55.559800Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/mOgUt4GM/images/5726bbaf7d0ea53e55b6e666af5d3e1861758334.png", + "featured": false, + "title": "Mod Menu", + "description": null, + "created": "2022-02-28T02:33:37.984225Z", + "ordering": 1 + } + ], + "color": 1330428, + "thread_id": "mOgUt4GM", + "monetization_status": "monetized" + }, + "more-totems-mod-2.16.0": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.3", + "1.16.4", + "1.18.2", + "1.19", + "1.19.2", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "Xt0pMhSq", + "slug": "more-totems-of-undying", + "project_type": "mod", + "team": "mdNJr9Ns", + "organization": null, + "title": "More Totems of Undying", + "description": "A mod that adds seven mob-inspired totems to Minecraft.", + "body": "# More Totems of Undying\n\nThis mod adds new mob-inspired totems of undying to Minecraft. These new totems - infused with the life essence of mobs - save the player from an untimely demise like a regular totem of undying, and produce their own unique effects inspired by their associated mob upon use.\n\n[![](https://i3.ytimg.com/vi/RZXtAJum0mg/maxresdefault.jpg)](https://www.youtube.com/watch?v=RZXtAJum0mg)\n\n## Totems:\n\n\n**Exploding Totem of Undying**: Upon activation, it generates an explosion around the player. \n\n\n![Explosive totem of undying crafting recipe, 8 gunpowder around a totem](https://cdn.modrinth.com/data/cached_images/ba2bec0c3872a9b4db5d32cf875c9475d78a42b2.png)\n\n\n**Skeletal Totem of Undying** (Skeleton): Upon activation, gives the player a potion effect called Sniper that doubles their projectile damage.\n\n\n![Skeletal totem of undying crafting recipe, 8 bones around a totem](https://cdn.modrinth.com/data/cached_images/651774fafd5a3f30ebe668a05a561218d361372d.png)\n\n\n**Teleporting Totem of Undying** (Enderman): Upon activation, the player teleports back to their spawn point.\n \n\n![Teleporting Totem of Undying crafting recipe, 4 ender pearls and 4 eyes of ender around a totem](https://cdn.modrinth.com/data/cached_images/8c9a4b06d7f0cb8f285745e3a45294d66ca4c7f3.png)\n\n\n**Ghastly Totem of Undying** (Ghast): Upon activation, gives the player the potion effects of Levitation, Slow Falling, and Fire Resistance.\n \n\n![Ghastly totem of undying crafting recipe, 8 ghast tears around a totem](https://cdn.modrinth.com/data/cached_images/09535200751aecfb16e5789ddf2dbdd805c94880.png)\n\n\n**Stinging Totem of Undying** (Bee): Upon activation, the totem summons 5 bees that defend the player from enemies.\n \n\n![Stinging totem of undying crafting recipe, 8 honey blocks around a totem](https://cdn.modrinth.com/data/cached_images/a617db56afd83376fa4528a098f4df75f4879b67.png)\n\n\n**Tentacled Totem of Undying** (Squid): Upon activation, gives the player a custom potion effect called Cephalopod and the vanilla potion effect Conduit Power. Cephalopod afflicts any entity attacking the player with blindness and slowness, and afflicts any entity being attacked by the player with blindness. \n \n\n![Tentacled Totem of Undying crafting recipe, 8 ink sacs around a totem](https://cdn.modrinth.com/data/cached_images/eb5c477bb58390d268d5c147c2d0022c2dcdc83e.png)\n\n\n**Rotting Totem of Undying** (Zombie): Upon activation, the totem summons 3 allied zombies that defend the player from enemies and give the player a unique potion effect called Necrosis. Necrosis allows the player to regain health from damage and poison potions but makes them lose health when they use health and regeneration potions.\n \n\n![Rotting totem of undying crafting recipe, 8 rotten flesh around a totem](https://cdn.modrinth.com/data/cached_images/6c58b06132fddff1b7e150a825f2dfadf1f83aeb.png)\n\n## Credits\nTextures made by:\n
\n[Narynotnarold](https://x.com/Narynotnarold?t=2hClpsI8TWfZZpXgESL61Q&s=09)\n
\n[EvoliRavioli](https://x.com/EvoliRavioli?t=vf2uX3O1O8lnrFoo87xq6Q&s=09)\n\n
\n
Check out Kinetic Hosting for hassle-free, budget-friendly Minecraft servers!
\n
\n\n[![Kinetic Hosting Affliate Link for Cyborg Pigeon](https://i.imgur.com/OVfuXg1.png)](https://billing.kinetichosting.net/aff.php?aff=587)", + "body_url": null, + "published": "2020-11-02T20:09:50.383816Z", + "updated": "2024-07-23T20:20:46.965766Z", + "approved": "2020-11-02T20:09:50.383816Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 141628, + "followers": 59, + "categories": [ + "adventure", + "equipment", + "magic" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "fjFJlV3R", + "Litudib5", + "4K0TkE9t", + "OLQNtzMx", + "Gk907Pfr", + "vmdTwsJ6", + "E4umH5tK", + "vY7CME9Q", + "rOWXHX42", + "wuK1k4ic", + "yDpOjB5q", + "c6o14Yzb", + "A68awhoI", + "5IG8vLvH", + "pWXsGJO3", + "kNmEwnBg", + "R9YOi2ME", + "E8hOsLLd", + "dHVhJwth", + "VXOJ1hrh", + "q3Zo3SsK" + ], + "icon_url": "https://cdn.modrinth.com/data/Xt0pMhSq/b6ae7bd05e050222986ffabea6f89939766873da.png", + "issues_url": "https://github.com/HyperPigeon/MoreTotems/issues", + "source_url": "https://github.com/HyperPigeon/MoreTotemsOfUndying", + "wiki_url": null, + "discord_url": "https://discord.gg/uUF6Avf8vp", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/cyborgpigeon" + } + ], + "gallery": [], + "color": 13076806, + "thread_id": "Xt0pMhSq", + "monetization_status": "monetized" + }, + "moreculling-1.20.4-0.24.0": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "21w37a", + "21w38a", + "21w39a", + "21w40a", + "21w41a", + "21w42a", + "21w43a", + "21w44a", + "1.18-pre1", + "1.18-pre2", + "1.18-pre3", + "1.18-pre4", + "1.18-pre5", + "1.18-pre6", + "1.18-pre7", + "1.18-pre8", + "1.18-rc1", + "1.18-rc2", + "1.18-rc3", + "1.18-rc4", + "1.18", + "1.18.1-pre1", + "1.18.1-rc1", + "1.18.1-rc2", + "1.18.1-rc3", + "1.18.1", + "22w03a", + "22w05a", + "22w06a", + "22w07a", + "1.18.2-pre1", + "1.18.2-pre2", + "1.18.2-pre3", + "1.18.2-rc1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "51shyZVL", + "slug": "moreculling", + "project_type": "mod", + "team": "lt2h1d9p", + "organization": null, + "title": "More Culling", + "description": "A mod that changes how multiple types of culling are handled in order to improve performance", + "body": "# More Culling \n### A mod that changes how multiple types of culling are handled in order to improve performance\nCulling is when you don't render things that the player can't see, to improve performance\n\nRequires Cloth Config!\n \n**Make sure to report any bugs [here](https://github.com/fxmorin/moreculling/issues)!** \n\n**Discord Server:** [https://discord.gg/SGFDrvA](https://discord.gg/SGFDrvA) \n \n**Head over to the [wiki](https://github.com/fxmorin/MoreCulling/wiki) for information on:** \nWhat's Culled, Performance, Compatibility, Bug Fixes, and more! \n\nCheck out [MoreCullingExtra](https://modrinth.com/mod/morecullingextra) for extra culling features \n\n## My other optimizations/fixes\n* [MemoryLeakFix](https://modrinth.com/mod/memoryleakfix) - Fixes multiple memory leaks for both the client and server\n* [Carpet-Fixes](https://modrinth.com/mod/carpet-fixes) - Largest Server-Side bug fixing mod\n* [Blanket](https://modrinth.com/mod/blanket) - Client-side tweaks/fixes\n* [RailOptimization](https://modrinth.com/mod/rail-optimization) - Make powered rails less laggy\n\n## More Info \nFeel free to contribute to the project! \nI'm also fine if you use this mod in your modpacks, just make sure to mention it. \n\nHowever I don't allow clients or other mods to merge this mod without permission, if you would like to use this mod in your client or another mod please contact me. \n\n---\n\n\"Kinetic\n \n---", + "body_url": null, + "published": "2022-06-02T22:36:08.467225Z", + "updated": "2024-07-16T07:32:05.008840Z", + "approved": "2022-06-02T22:36:08.467225Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-2.1-only", + "name": "GNU Lesser General Public License v2.1 only", + "url": null + }, + "downloads": 5247075, + "followers": 2231, + "categories": [ + "optimization", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "bey0UTtY", + "kyoVWOaa", + "rk6iCKkw", + "uEub6pxk", + "BISqTb5V", + "jSOdwPjm", + "EUOCxrzr", + "1zTV5NFG", + "OyWEPEC1", + "4E7NgIC3", + "70vJPSHi", + "PIwVPkdg", + "wnoTuNqB", + "AjCb2RSK", + "ExS3Q7fZ", + "dwBNCszT", + "rfjlSVxg", + "2eqHJxYv", + "d2OS47y6", + "m8mZfvhU", + "8XHBUEiZ", + "xO1K8c7X", + "cUqay68d", + "dMVy7Ytv", + "g6mKthcL", + "BzBSulCD", + "KtW0ZvNB", + "zBfCFOON", + "KWDCdA85", + "dSbEt6xo", + "oOrYf7d8", + "6xlsq65Y", + "6XKdUnE1", + "95T8vcFd", + "NviTtila", + "kC2sSBvg", + "AbG6tNda", + "9BKFQcLq", + "UNJJKrgF", + "sOIFWpF5", + "ZVroNexd", + "ENUmMM2R", + "5hjaMcPN", + "tPdgUkgf", + "A9LKf67q", + "BbgZWSfa", + "Bu5pCvCn", + "qLO5kLrO", + "jv96n9er", + "JTsfNvX1", + "KpriJ15b", + "gZW2FlFT", + "3m5znPWm", + "dOy4u1kk", + "yduz8IZo", + "BUxgeDdf" + ], + "icon_url": "https://cdn.modrinth.com/data/51shyZVL/icon.png", + "issues_url": "https://github.com/fxmorin/moreculling/issues", + "source_url": "https://github.com/fxmorin/moreculling", + "wiki_url": "https://github.com/FxMorin/MoreCulling/wiki", + "discord_url": "https://discord.gg/SGFDrvA", + "donation_urls": [ + { + "id": "github", + "platform": "Github", + "url": "https://github.com/sponsors/fxmorin" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/51shyZVL/images/0bf9a362086fc489a48c89aa97ece4ba3000f53f.png", + "featured": false, + "title": "[Vanilla] Block Culling", + "description": "Minecraft does block culling in order to render as little as possible. Although they do a pretty bad job at it and lots of blocks render faces you can't see", + "created": "2022-12-19T17:36:59.130084Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/51shyZVL/images/de0105f432d0eafe919947cca1d2164e37f419dc.png", + "featured": true, + "title": "[MoreCulling] Block Culling", + "description": "MoreCulling removes most faces using aggressive block culling. It's able to get much higher frames in most areas of the game, without changing any visuals.", + "created": "2022-12-19T17:37:00.822052Z", + "ordering": 2 + }, + { + "url": "https://cdn.modrinth.com/data/51shyZVL/images/80416ac9e448a2294495ca7fb7a6c73a30da4fc8.png", + "featured": false, + "title": "[Vanilla] Map Culling", + "description": "Minecraft does not cull stuff like maps behind blocks, causing huge performance loss for no reason", + "created": "2022-12-19T17:28:50.648297Z", + "ordering": 3 + }, + { + "url": "https://cdn.modrinth.com/data/51shyZVL/images/42e59fb7f64f4d245ef51d7f0558d38181546681.png", + "featured": false, + "title": "[MoreCulling] Map Culling", + "description": "MoreCulling correctly culls there maps, and does the same for signs. Resulting in a much smoother and faster game", + "created": "2022-12-19T17:28:51.921456Z", + "ordering": 4 + }, + { + "url": "https://cdn.modrinth.com/data/51shyZVL/images/5b04f844772888ac9632e87871fb87df2f0cffa7.png", + "featured": false, + "title": "[Vanilla] Item Frames", + "description": "Item Frames are generally known as being really laggy in minecraft.\nAlso causes very unstable FPS resulting in frame freezing", + "created": "2022-12-19T17:33:26.331272Z", + "ordering": 5 + }, + { + "url": "https://cdn.modrinth.com/data/51shyZVL/images/e316e1e85fe19c21537b52a83c625633e5b8fda0.png", + "featured": false, + "title": "[MoreCulling] Item Frames", + "description": "MoreCulling handles item frames very aggressively. It's able to properly optimize the rendering to make sure your game stays smooth and consistent.\nFind out more at: https://github.com/fxmorin/MoreCulling/wiki/Item-Frame-Culling#comparing-performance", + "created": "2022-12-19T17:33:27.580945Z", + "ordering": 6 + }, + { + "url": "https://cdn.modrinth.com/data/51shyZVL/images/0a5458389b727e1dc63deaee4d05cdeb6fb6c8b1.png", + "featured": false, + "title": "[Vanilla] Beacon Beams", + "description": "The terrible beacon rendering performance in Vanilla", + "created": "2024-01-08T14:52:58.692617Z", + "ordering": 7 + }, + { + "url": "https://cdn.modrinth.com/data/51shyZVL/images/5f091062f41295ab85da2324357071c04cf57231.png", + "featured": false, + "title": "[MoreCulling] Beacon Beam Culling", + "description": "MoreCulling adds frustum culling to beacon beams.", + "created": "2024-01-08T14:53:31.438205Z", + "ordering": 8 + } + ], + "color": 263172, + "thread_id": "51shyZVL", + "monetization_status": "monetized" + }, + "moremobvariants-fabric+1.20.1-1.3.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4", + "1.21" + ], + "id": "JiEhJ3WG", + "slug": "more-mob-variants", + "project_type": "mod", + "team": "4my5r54F", + "organization": null, + "title": "More Mob Variants", + "description": "Adds new variants to existing mobs.", + "body": "# More Mob Variants\n---\n\n### \ud83d\udcd6 About\nRecent mobs that have been added to the game all have plenty of fun variants to look at, but what about the old ones?\n\nThis mod adds new variants to the older mobs that all look the same, to make them a little more fresh.\n\nVariants are added through NBT, meaning that they will be persistent across all players.\n\nAll variants and features are data-driven, allowing for full customization through datapacks.\n\n### \ud83d\udca1 Installation\n> **This mod is available for both Forge and Fabric!** Make sure you download the correct version.\n\n**The fabric version of this mod requires Fabric API!** Get it [here](https://modrinth.com/mod/fabric-api).\n\n\nThis mod has to be installed server-side and client-side, although clients without the mod can still join servers with the mod.\n\n### \ud83d\udcc1 Features\nIn addition to the default texture, the mod currently features the following new variants:\n\n- Cat\n - Gray Tabby\n - Doug\n - Handsome\n - Tortoiseshell\n- Chicken\n - Amber\n - Bronzed\n - Gold Crested\n - Midnight\n - Skewbald\n - Stormy\n - Skeleton (*if spawned in the nether*)\n - Duck (*rare*)\n- Cow\n - Ashen\n - Cream\n - Cookie\n - Dairy\n - pinto\n - Sunset\n - Umbra\n - Wooly\n - Albino (*rare, spawns in taigas*)\n- Pig (*all variants can be muddy*)\n - Mottled\n - Piebald\n - Pink Footed\n - Sooty\n - Spotted\n- Sheep (*all variants can have horns*)\n - Fuzzy\n - Patched\n - Rocky\n - Inky\n - Long-nosed\n- Skeletons\n - Dungeons-style\n - Weathered\n - Sandy (*more common in deserts*)\n - Mossy (*spawns in jungles, swamps, and lush caves*)\n- Spiders\n - Brown\n - Tarantula\n - Black Widow\n - Bone (*rare*)\n- Wolf\n - All default variants from 1.20.5\n - Basenji (jupiter + golden retriever, or rusty + ashen)\n - French Bulldog (husky + golden retriever, or rusty + golden retriever)\n - German Shepherd (jupiter + husky, or woods + chestnut)\n - Golden Retriever (jupiter + pale (default), or rusty + pale (default))\n - Husky (black + ashen, or snowy + ashen)\n - Jupiter (rusty + woods, or striped + woods)\n - Skeleton (breeding in nether)\n- Zombie\n - Alex\n - Ari\n - Efe\n - Kai\n - Makena\n - Noor\n - Sunny\n - Zuri", + "body_url": null, + "published": "2022-10-30T06:28:57.950247Z", + "updated": "2024-08-02T13:21:38.258484Z", + "approved": "2022-10-30T16:18:36.235020Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "CC0-1.0", + "name": "Creative Commons Zero v1.0 Universal", + "url": "https://github.com/nyuppo/MobVariants/blob/master/LICENSE" + }, + "downloads": 897961, + "followers": 989, + "categories": [ + "decoration", + "mobs", + "social" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "Z8wiv0hN", + "8G05nZbj", + "IUjbMuMK", + "Lj77UW6Q", + "hdljOza8", + "DHeuboQy", + "fRFefM94", + "88ce1zIS", + "oseZKrtl", + "7V0YFZwp", + "hM7RpKBq", + "qEelGhaP", + "j403kQd0", + "VxRA0Nwd", + "fTX6uAaF", + "1x4Y4NlQ", + "66XqxxPC", + "fbSdbMsu", + "hedWvjfK", + "uMKJZZE3", + "qtpseir7", + "aY8G34PW", + "dT5mLyrh", + "ILmwtNA8", + "o6yyhzgj", + "NifwSjfW", + "7mUHEpdy" + ], + "icon_url": "https://cdn.modrinth.com/data/JiEhJ3WG/b896267f5830756ae5425d7cb3fbe770f6c30964.png", + "issues_url": "https://github.com/nyuppo/MobVariants/issues", + "source_url": "https://github.com/nyuppo/MobVariants", + "wiki_url": null, + "discord_url": "https://discord.gg/CeTHcXUJJv", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/JiEhJ3WG/images/0423116a3e1532909f8df27b1b8aacd989f632cd.png", + "featured": false, + "title": "1.2.0 Update", + "description": null, + "created": "2023-06-10T04:58:18.309603Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/JiEhJ3WG/images/5f5d2a8060dff28e54067351785db82a2d046ae4.png", + "featured": false, + "title": "Cats", + "description": null, + "created": "2022-10-30T06:28:52.438542Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/JiEhJ3WG/images/67e7744d5dbb7376e30bad074f98ef053388d577.png", + "featured": false, + "title": "Sheep", + "description": null, + "created": "2022-10-30T06:28:52.438542Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/JiEhJ3WG/images/6be702b823cb1a4848a7d9674a1ede91d29f79d7.png", + "featured": false, + "title": "Chickens", + "description": null, + "created": "2022-10-30T06:28:52.438542Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/JiEhJ3WG/images/85f51bd5bbfa9874848ee1e742e36e0c6ab8bcd8.png", + "featured": false, + "title": "Pigs", + "description": null, + "created": "2022-10-30T06:28:52.438542Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/JiEhJ3WG/images/a25feaa016c22ecaff7d7c87b507317335a8eb86.png", + "featured": false, + "title": "Wolves", + "description": null, + "created": "2022-10-30T06:28:52.438542Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/JiEhJ3WG/images/ce1069df9d83a14086039df056413855cf7d3c98.png", + "featured": false, + "title": "Zombies", + "description": null, + "created": "2022-10-30T06:28:52.438542Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/JiEhJ3WG/images/ea606e7093184e78afd3f18deb89ba348ee7b93f.png", + "featured": false, + "title": "Cows", + "description": null, + "created": "2022-10-30T06:28:52.438542Z", + "ordering": 0 + } + ], + "color": 1974568, + "thread_id": "JiEhJ3WG", + "monetization_status": "monetized" + }, + "MutantMonsters-v8.0.7-1.20.1-Fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4" + ], + "id": "derP0ten", + "slug": "mutant-monsters", + "project_type": "mod", + "team": "AGIrY1gk", + "organization": null, + "title": "Mutant Monsters", + "description": "The mutants are back! Face scary creatures and powerful beasts like never before.", + "body": "

\n

\n

\n

\n

\n

The mutants are back! The original returns, be ready to fight mutated variants of a lot of the old Minecraft monsters. No longer will battles be quick and easy, now you'll be seriously challenged by those new foes.

\n

\n

\n

\u25b6\ufe0f Battle the Mutant Zombie, be careful of his smash attacks! And quickly burn the corpse, or it will awaken again. Your victory will be rewarded with a mystical hammer unleashing a unique power when used on the ground beneath you...

\n

\u25b6\ufe0f Fight the Mutant Skeleton, the most skilled archer you will ever encounter. If you manage to defeat this foe, you may be able to utilize its skeleton parts for your own protection...

\n

\u25b6\ufe0f The Mutant Creeper is a true nightmare, wreaking havoc whereever it goes. Just make sure to keep it away from anything you hold dear! But finally it leaves behind a mysterious egg. It won't hatch for a long time, but when it does, you'll be in for quite a surprise to be sure.

\n

\u25b6\ufe0f The Mutant Enderman is by far the most powerful mutant. It won't just fight by fair means, using ender-magic, the terrain and much more, anything is possible. What's in it for you then? Maybe you'll be able to cut off one of its hands, and the mutant's power to use the terrain will be yours.

\n

\u25b6\ufe0f Mutants are very strong, time to get some help: The Mutant Snowgolem is here to help. Throwing not just tiny snowballs, but entire chunks of ice it's a true ally.

\n

\u25b6\ufe0f And finally there is something odd: Pigs suddenly seem attracted to Fermented Spider Eyes... Feeding one, then splashing some Chemical X... Oh no, what abomination have I created!

\n

\u25b6\ufe0f Also check out the amazing Mutant More mod by alexandersfunandgames with even more and even scarier mutations.

\n

\n

\n

\n

\n

\n

\n

\n

\u23e9 INSTALLATION REQUIRED ON CLIENT & REQUIRED ON SERVER

\n

\u23e9 REQUIRES PUZZLES LIB TO BE INSTALLED (FORGE & FABRIC)

\n

\u23e9 REQUIRES FABRIC API TO BE INSTALLED (FABRIC)

\n

\u23e9 REQUIRES FORGE CONFIG API PORT TO BE INSTALLED (FABRIC)

\n

\n

\n

Configuration is easily possible directly from in-game using the mod menu (requires Mod Menu by Prospector to be installed on Fabric) by installing either Configured or Configured (Fabric) by MrCrayfish.

\n

When it comes to manual configuration all files are found at .minecraft/config, named as MOD_ID-client.toml, MOD_ID-common.toml, or MOD_ID-server.toml depending on the type of config. Not all types might exist for this mod if any.

\n

Note that on older mod versions server configuration files are found at .minecraft/saves/WORLD_NAME/serverconfigs, effecticely meaning they must be configured separately for each individual world.

\n

\n

\n

\ud83c\udf1f Huge thanks to Shcott21 who originally published this mod as the Mutant Creatures so many years ago. Most of the work and most of all the amazing models were all done by him.

\n

\ud83c\udf1f Thanks to Chumbanotz for being the first to bring the mutants to modern Minecraft in the form of their Mutant Beasts mod, laying the ground work for this final revival.

\n

\n

\n

\n

\n", + "body_url": null, + "published": "2022-08-03T12:30:41.031502Z", + "updated": "2024-03-24T21:46:50.211198Z", + "approved": "2023-04-21T00:39:09.239810Z", + "queued": "2023-04-20T21:40:17.308575Z", + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "AGPL-3.0-only", + "name": "GNU Affero General Public License v3.0", + "url": null + }, + "downloads": 347850, + "followers": 331, + "categories": [ + "mobs" + ], + "additional_categories": [ + "equipment", + "magic" + ], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "VOGopAdT", + "NaotWuPF", + "7JFsl0a5", + "2vdN6iAh", + "iCIpYnUw", + "YfdVjqL0", + "xXItC97v", + "MCMM5EhT", + "PhM1rRXq", + "M49xdlxN", + "NirsP8WW", + "fKkGBcyp", + "XchdLX69", + "6Er3wd2M", + "py2g1zNi", + "hKLgWqEG", + "ZniZrZ1k", + "OavH5GRU", + "FprAZZ4M", + "F3egnz5X", + "H8JkL8pa", + "3mv8HmTo", + "CkbS2PLp", + "E6MjVWsN", + "Cot0bkQN", + "O3GNtihs", + "lTrkkInS", + "jxVJddUv", + "BOXbMP8y", + "k1txQ3sx", + "55VYRSqD", + "dB4njHbu", + "kzXTQOdD", + "mh6ClLZz", + "GrfbD4Bv", + "oKXlnH0n", + "pFjiwunc", + "LDr4SOMU", + "zqm5z8Lh", + "2y05EwXr", + "Pp3ZK1tZ", + "GEdQkhpr", + "xl1tuF7z", + "xmnTYpsJ", + "eRnKdLSh", + "IAv83Mgr", + "qfOnBdxf", + "JldxXKol" + ], + "icon_url": "https://cdn.modrinth.com/data/derP0ten/56c47fb666da324d4c094465b6544fe970e0e064.png", + "issues_url": "https://github.com/Fuzss/mutantmonsters/issues", + "source_url": "https://github.com/Fuzss/mutantmonsters", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/derP0ten/images/0ac33c9c59d95bd8743de794c6b7ebe20ce9e1bc.png", + "featured": true, + "title": null, + "description": null, + "created": "2023-04-20T21:20:40.183784Z", + "ordering": 0 + } + ], + "color": 3289646, + "thread_id": "derP0ten", + "monetization_status": "monetized" + }, + "myLoot": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18-pre1", + "1.18-pre2", + "1.18-pre3", + "1.18-pre4", + "1.18-pre5", + "1.18-pre6", + "1.18-pre7", + "1.18-pre8", + "1.18-rc1", + "1.18-rc2", + "1.18-rc3", + "1.18-rc4", + "1.18", + "1.18.1-pre1", + "1.18.1-rc1", + "1.18.1-rc2", + "1.18.1-rc3", + "1.18.1", + "1.18.2-pre1", + "1.18.2-pre2", + "1.18.2-pre3", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.20", + "1.20.1" + ], + "id": "kHc6jKsv", + "slug": "myloot", + "project_type": "mod", + "team": "7rbPfkBu", + "organization": null, + "title": "myLoot", + "description": "Instanced loot per player for a better looting experience on Multiplayer servers", + "body": "

\"https://i.imgur.com/oGN5UNd.png\"\"https://i.imgur.com/svaGO8D.png\"

\n

\"https://i.imgur.com/2OI03Hl.png\"\"https://i.imgur.com/a3x6uOm.png\"\"https://i.imgur.com/tsdJHfs.png\"\"https://i.imgur.com/l5I8gAy.png\"

\n

\"https://i.imgur.com/dmNMnPm.png\"

\n

\"https://i.imgur.com/zSsH7X4.gif\"

\n

 

\n\n
\n

\n \"https://img.shields.io/static/v1?label=%20&message=other%20projects&color=4b5966&labelColor=658f79&logo=curseforge&logoColor=white&style=for-the-badge\" \n \"https://tinyurl.com/spoorndiscordbadge\" \n \"https://img.shields.io/github/stars/spoorn/SpoornPacks?color=4b5966&labelColor=658f79&label=github%20&logo=github&logoColor=white&style=for-the-badge\" \n \"https://img.shields.io/github/issues-raw/spoorn/SpoornPacks?color=4b5966&labelColor=658f79&label=issues%20&logo=github&logoColor=white&style=for-the-badge\"\n

\n
\n

Description

\n

myLoot replaces world-generated loot containers such as loot chests and barrels with a special myLoot container variant that has instanced loot per player.  This means each player can loot whatever they want out of any loot chest and other players will still have access to the original loot - providing a better looting experience!

\n

No more logging onto a multiplayer server to find chunks within a 5000 block radius have already been looted by your friends.  Loot for all

\n

myLoot is useful in singleplayer servers as well - you can visually see which loot chests you have already opened so you don't end up getting lost and re-looting areas

\n

 

\n

Features

\n

All replacement works in modded structures as well as vanilla (dungeons, villages, strongholds, dimensions, etc.)

\n
    \n
  • Replaces loot chests (works for double chests!)
  • \n
  • Replaces loot barrels
  • \n
  • Replaces chest Minecarts
  • \n
  • Replaces Shulker Boxes
  • \n
  • myLoot containers will change in appearance to the player if they have opened it.  This is client-side so other players will still see the unopened textures if they have not opened it.
  • \n
  • myLoot containers will warn the player that breaking it can affect other players.  A player can still break myLoot containers by holding Sneak while breaking.  Note: breaking a myLoot container by default will only drop the instanced loot of the player who broke it (plus the loot container item).  This can be changed via the \"dropBehavior\" config to instead drop ALL players' loot
  • \n
  • This should work with modded items in the myLoot containers as well and with modded loot containers
  • \n
  • myLoot Chest is craftable with a regular Minecraft chest surrounded by enchanted apples (see images above)
  • \n
  • myLoot Chest can be combined into a double chest
  • \n
  • myLoot Chest Minecart is craftable with a myLoot chest and minecart
  • \n
  • myLoot Shulker Box when broken will drop a special myLoot Shulker Box Item that persists instanced inventories, so players can still access their instanced loot from the shulker box when it is placed back down.  Essentially, it's a portable instanced shulker box!
  • \n
\n

 

\n

 

\n

Dependencies

\n

This mod requires:

\n\n

 

\n

\"requires

\n

 

\n

 

\n

FAQ

\n

1. How does inserters/extractors such as hoppers/pipes affect the myLoot containers?

\n

Modifying a myLoot container's inventory before player opening - such as using hoppers to add/remove items - should not affect the player's instanced inventory.  The original rolled loot will persist so any player opening a myLoot container for the first time will still get the original loot.

\n

Also, myLoot containers essentially have an invisible inventory that contains the original non-player instanced inventory.  Modifying that inventory via inserters/extractors such as hoppers/pipes will work, but when a player breaks the myLoot container, only additions to the original rolled loot will drop (plus the player's instanced inventory who broke the myLoot container if applicable).  This is to prevent mass duplication of loot (however duplication of the original loot one time is still possible... I haven't yet found a way to prevent this without being invasive i.e. I don't want to break any code, vanilla or modded, that has logic around a loot container's inventory so I can't just delete the original invisible inventory).

\n

 

\n

 

\n

Credits

\n

The mechanics of myLoot containers changing appearance when opened by a player, and the stylish glowing texture design are heavily inspired by the Forge Lootr mod - but everything else was originally made from scratch.  myLoot is not a direct port of Lootr, and features will be different.  An official port of Lootr to Fabric is in the works.  Please see https://github.com/spoorn/myLoot/issues/1

\n

 

\n

  

\n

Need a Server?

\n

\"https://bisecthosting.com/spoorn\"

", + "body_url": null, + "published": "2022-02-23T01:11:17.273653Z", + "updated": "2023-07-24T02:25:41.848731Z", + "approved": "2022-02-23T01:11:17.273653Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 19550, + "followers": 44, + "categories": [ + "adventure", + "utility", + "worldgen" + ], + "additional_categories": [ + "decoration", + "management", + "storage" + ], + "loaders": [ + "fabric" + ], + "versions": [ + "GAKAvspz", + "GEFpAg8S", + "YLXkX3IV", + "X0uJ6MvE", + "zF06kKnC", + "54rcSaGW", + "CvsuK0Ra", + "DdLXC7Bi", + "l74cjwnw" + ], + "icon_url": "https://cdn.modrinth.com/data/kHc6jKsv/62c6de58c314c2f0df2904da9f31110b1bc8239e.png", + "issues_url": "https://github.com/spoorn/myLoot/issues", + "source_url": "https://github.com/spoorn/myLoot", + "wiki_url": "https://github.com/spoorn/myLoot", + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": 2300432, + "thread_id": "kHc6jKsv", + "monetization_status": "monetized" + }, + "mythic-mounts-1.20.1-7.2": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.17.1", + "1.18.2", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20.1" + ], + "id": "xP7vOoRA", + "slug": "mythic-mounts", + "project_type": "mod", + "team": "4osgjoFY", + "organization": null, + "title": "Mythic Mounts", + "description": "Befriend legendary creatures to accompany you across the world!", + "body": "

\"Banner

\n

 

\n

News and Announcements!
May Updates!

\n
    \n
  • New Mob added, the legendary \u017bar-ptak! (Thanks @Le flémmard!)
  • \n
  • Added mini-mounts for inchlings!
           - A baby mount that is given a warped fungus before it matures will grow into a miniature mount
           - Mini-mounts can only carry very small players (like inchlings)
           - The mini effect can be cancelled by feeding a baby mount a crimson fungus before it grows up
  • \n
  • The config updater now automatically carries over players' custom settings when updating to a new version.

    \n

    April Updates:

    \n
      \n
    • New Mob added, the from the fabled mooshroom islands, Colelytras! (Thanks @Atlan!)
    • \n
    • Added a Summoning Staff item that can warp mounts to a player/flying mounts to the ground.
    • \n
    • Added the ability to give wander/follow/sit commands to mounts in-game using either the command item or a summoning staff.
    • \n
    • Added a Patchouli guidebook with lore, instructions, and info on each of the mounts! Get it by:
             - using a regular book on any mount, or by
             - using a summoning staff on a book (held in offhand)
    • \n
    \n
    Happy Modding ^_^
  • \n
\n

 
Mod Highlights:

\n
    \n
  • Adds 14 new tameable animals which can be found in various biomes across the world.
  • \n
  • Includes flying, aquatic, and terrestrial mounts.
  • \n
  • Each mount can be equipped with armor and additional inventory slots.
  • \n
  • Cute baby variants!
  • \n
  • Customizable config file to adjust spawn settings, mount stats, entity AI/behavior, and more.
  • \n
\n

 

\n

Important: This mod requires Geckolib and Patchouli for Fabric or Forge

\n

Supported Mod Loaders: Fabric/Forge

\n

 

\n

Mod Features:

\n

Interactions:

\n

Taming: Mounts may be tamed by left-clicking them with an empty hand to repeatedly ride them until the mount stops bucking the player off. Like horses, this may take a few attempts before the mount is successfully tamed. Careful! Some mounts are hostile and will fight back during the taming process!

\n

Riding Mounts: Tamed mounts can be ridden by left-clicking them with an empty hand and controlled with saddles. Flying mounts can be flown by repeatedly pressing the jump key to gain altitude, or by aiming via camera controls while flying. Aquatic mounts can similarly gain a “swim boost” by using the jump key underwater.

\n

Instruct a Mount to Stay/Sit: Tamed mounts will naturally wander near (and remain close to) the last place their owner dismounted. To have a mount remain in an exact location without wandering off, right-click them with a stick to have them sit down.

\n

Breeding Mounts: Two mounts of the same species can be bred if the following conditions are met: the mounts must both be tamed; the mounts must both have full health; and, the mounts must be each given the appropriate breeding item.

\n

Mini Mounts: If a baby mount is given a warped fungus before it matures, it will grow into a miniature mount. These mounts cannot be ridden by normal-size people, but otherwise are the same a their larger counterparts. The mini effect can be cancelled by feeding a baby mount a crimson fungus before it matures.

\n

Pet Mount: Right-click a tamed mount with an empty hand while sneaking to pet it.

\n

 

\n

Equipment:

\n

Add/Remove Inventory: Mounts may be equipped with chests to add additional inventory slots to their equipment screen, and can unequip chests with shears. Total inventory capacity varies between different types of mounts, and can be adjusted in the configuration file if needed.

\n

Open Mount Inventory: Double right-click a tamed mount with an empty hand while sneaking to open the mount inventory.

\n

Mount Armor: Tamed mounts can be equipped/unequipped with horse armor from the inventory screen.

\n

Summoning Staff: Can be used to teleport mounts a short distance. Link a mount by using the staff on them, and summon them by using it again. (Mounts must be in loaded chunks and there must be enough room for them to teleport in)

\n

\"Summoning

\n

 

\n

Other Behaviors:

\n

Battle Mounts: Battle mounts will come to their owner’s aid in combat. This behavior is can be enabled/disabled in the configuration file .

\n

Mount Aggression: Some mounts are naturally hostile to players and/or other mobs. Once tamed, these mounts will no longer attack other entities unless instructed to by their owner. Mount aggression/AI can be adjusted in the configuration file.

\n

 

\n
\n

 

\n

\"\u017bar-ptak

\n\n\n\n\n\n\n\n\n\n\n\n\n\n
\u017bar-ptak:  
\n

Rarity: Rare

Habitat:
can appear near inhabited villages;

Diet:
herbivore

\n
\n

Behavior:
- Non-hostile

Breeding Items:
golden_apple;
_

\n
\n

Default Stats:
  Health: 20
  Attack: 3
  Inventory: 9
  Will defend owner: yes

Thanks @Le flémmard!

\n
\n
\n

 

\n

\"Acencia

\n\n\n\n\n\n\n\n\n\n\n\n\n\n
Acencia:  
\n

Rarity: Unommon

Habitat:
Grove; Snowy Taiga;
Snowy Taiga Hills;
Snowy Taiga Mountains;

Diet: carnivore

\n
\n

Behavior:
- Non-hostile
- Can climb sheer surfaces
- Will hunt sheep, goats,
rabbits, and chicken


Breeding Items:
mutton; salmon;_

\n
\n

Default Stats:
  Health: 28
  Attack: 10
  Inventory: 12
  Will defend owner: yes

\n
\n
\n

 

\n

\"Archelon

\n\n\n\n\n\n\n\n\n\n\n\n\n\n
Archelon:  
\n

Rarity: Uncommon

Habitat:
Deep Lukewarm Ocean;

Diet: omnivore

\n
\n

Behavior:
- Non-hostile

Breeding Items:
tropical_fish; pufferfish;_

\n
\n

Default Stats:
  Health: 60
  Attack: 6
  Inventory: 54
  Will defend owner: no

\n
\n
\n

 

\n

\"Colelytra

\n\n\n\n\n\n\n\n\n\n\n\n\n\n
Colelytra:  
\n

Rarity: Uncommon

Habitat:
mushroom_fields;

Diet:
herbivore

\n
\n

Behavior:
- Non-hostile

Breeding Items:
red_mushroom;
brown_mushroom;
flower items; sugar;_

\n
\n

Default Stats:
  Health: 14
  Attack: 2
  Inventory: 15
  Will defend owner: no

Thanks @Atlan!

\n
\n
\n

 

\n

\"Courier

\n\n\n\n\n\n\n\n\n\n\n\n\n\n
Courier Birds:  
\n

Rarity: Common

Habitat:
jungle; jungle hills; jungle edge;

Diet: herbivore

\n
\n

Behavior:
- Non-hostile
- Will flee from player

Breeding Items:
sweet_berries; melon_slice;_

\n
\n

Default Stats:
  Health: 20
  Attack: 4
  Inventory: 9
  Will defend owner: yes

\n
\n
\n

\"Dire

\n\n\n\n\n\n\n\n\n\n\n\n\n\n
Dire Wolves:  
\n

Rarity: Uncommon

Habitat:
Snowy Taiga Mountains; Giant Spruce Taiga;
Giant Spruce Taiga Hills; Giant Tree Taiga;
Giant Tree Taiga Hills;

Diet: carnivore

\n
Behavior:
- Non-hostile
- Will hunt sheep and skeleton

Breeding Items:
rabbit; chicken; mutton; beef; porkchop;
\n

Default Stats:
  Health: 30
  Attack: 7
  Inventory: 12
  Will defend owner: yes

\n

 

\n
\n

 

\n
\n

\"Dragon

\n\n\n\n\n\n\n\n\n\n\n\n\n\n
Dragons:  
\n

Rarity: Rare

Habitat:
Deep underground in large caves (y < 40)

Diet: carnivore

\n
\n

Behavior:
- Hostile

Breeding Items:
golden_carrot; golden_apple;
glistering_melon_slice;

\n
Default Stats:
  Health: 40
  Attack: 10
  Inventory: 27
  Will defend owner: yes
\n

 

\n
\n

\"Griffon

\n\n\n\n\n\n\n\n\n\n\n\n\n\n
Griffons:  
\n

Rarity: Uncommon

Habitat:
Gravelly Mountains+; Snowy Taiga Mountains;
Taiga Mountains; Gravelly Mountains;
Wooded Mountains; Snowy Mountains;
Mountains;

Diet: carnivore

\n
Behavior:
- Non-hostile
- Will hunt sheep and rabbits

Breeding Items:
rabbit; mutton;
\n

Default Stats:
  Health: 35
  Attack: 7
  Inventory: 12
  Will defend owner: yes

\n

 

\n
\n

 

\n
\n

\"Geckotoa

\n\n\n\n\n\n\n\n\n\n\n\n\n\n
Geckotoa Lizards:  
\n

Rarity: Uncommon

Habitat:
Large caves near the surface and
in mountain caves (y > 60)

\n


Diet: omnivore

\n
Behavior:
- Non-hostile

Breeding Items:
melon; pumpkin; hay_block;
\n

Default Stats:
  Health: 35
  Attack: 4
  Inventory: 27
  Will defend owner: no

\n

 

\n
\n

 

\n
\n

\"Giant

\n\n\n\n\n\n\n\n\n\n\n\n\n\n
Giant Moths:  
\n

Rarity: Common

Habitat:
Dark Forest Hills; Dark Forest;

Diet: herbivore

\n
Behavior:
- Non-hostile

Breeding Items:
sugar; melon_slice; glistering_melon_slice;
\n

Default Stats:
  Health: 10
  Attack: 2
  Inventory: 6
  Will defend owner: no

\n

 

\n
\n

 

\n
\n

\"Nether

\n\n\n\n\n\n\n\n\n\n\n\n\n\n
Nether Bats:  
\n

Rarity: Uncommon

Habitat:
Crimson Forest; Warped Forest;

Diet: omnivore

\n
Behavior:
- Hostile

Breeding Items:
porkchop; apple; rotten_flesh;
\n

Default Stats:
  Health: 25
  Attack: 4
  Inventory: 9
  Will defend owner: yes

\n

 

\n
\n

 

\n
\n

\"Nightmare

\n\n\n\n\n\n\n\n\n\n\n\n\n\n
Nightmare:  
\n

Rarity: Common

Habitat:
Soul Sand Valley; Basalt Deltas

\n


Diet: omnivore

\n
Behavior:
- Non-hostile
- Will hunt skeletons
- Can walk on lava
Breeding Items:
blaze_rod; fire_charge;
\n

Default Stats:
  Health: 35
  Attack: 5
  Inventory: 12
  Will defend owner: yes

\n

 

\n
\n

 

\n
\n

\"Giant

\n\n\n\n\n\n\n\n\n\n\n\n\n\n
Giant Nudibranch:  
\n

Rarity: Common

Habitat:
Near Coral Reefs in Warm Ocean;

\n


Diet: herbivore

\n
Behavior:
- Non-hostile

Breeding Items:
kelp;
\n

Default Stats:
  Health: 25
  Attack: 3
  Inventory: 9
  Will defend owner: no

\n

 

\n
\n

 

\n
\n

\"Riding

\n\n\n\n\n\n\n\n\n\n\n\n\n\n
Riding Lizard:  
\n

Rarity: Common

Habitat:
Desert; Desert Lakes; Desert Hills;
Eroded Badlands;
Modified Wooded Badlands Plateau;
Modified Badlands Plateau;

Diet: carnivore

\n
Behavior:
- Hostile
- Will hunt rabbits and chicken

Breeding Items:
rabbit; chicken; pumpkin; rotten_flesh;
\n

Default Stats:
  Health: 20
  Attack: 4
  Inventory: 6
  Will defend owner: yes

\n

 

\n
\n

 

\n

\"Acknowledgements

\n

Many thanks to the project's patrons: Zura, Lavie, Kree, Atlan, Le flémmard, Eugene Nubberslaw, Azilea_Royalty, and Nil!

\n

Please consider supporting the developers on Patreon if you like the mods!

", + "body_url": null, + "published": "2023-08-08T00:30:08.366854Z", + "updated": "2023-09-21T16:55:30.159907Z", + "approved": "2023-08-11T05:57:36.653180Z", + "queued": "2023-08-08T04:55:23.228016Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 379080, + "followers": 281, + "categories": [ + "adventure", + "mobs", + "transportation" + ], + "additional_categories": [ + "storage", + "worldgen" + ], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "wam2BHZl", + "3UA4cUdy", + "zINDx6tM", + "4T9VDrA0", + "a9GfsY3e", + "uoWwdhb2", + "rUdDNAKe", + "CJFivEjG" + ], + "icon_url": "https://cdn.modrinth.com/data/xP7vOoRA/ddd765cbbbdc7bd88ee361fd3f8fed5dd0236165.png", + "issues_url": null, + "source_url": null, + "wiki_url": null, + "discord_url": "https://discord.gg/ZNMECpNpE9", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/chirpycricket" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/xP7vOoRA/images/063494f97f154733cb3033203e56d5ab9d3fa627.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-08-08T01:00:45.382241Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/xP7vOoRA/images/074458f410c20c285963e4278d411624ef66bb3d.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-08-08T01:02:16.084855Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/xP7vOoRA/images/389d9e3b9253deb52373c44c898b7897acf3ad88.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-08-08T01:05:09.553676Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/xP7vOoRA/images/3a08ded2a2a8f9bc1a1d7ec8916f9034d07b9479.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-09-19T16:23:11.741131Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/xP7vOoRA/images/456c60b6f22767d27cd27e8f5f67819b86b9ac8a.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-08-08T00:56:12.524306Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/xP7vOoRA/images/5150e8d7b20678e35c4a2d5a4c8ca4880128c8ff.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-08-08T00:39:51.148265Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/xP7vOoRA/images/620a7077eb436ac960031a204c428e6bcda9e393.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-08-08T00:53:42.858713Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/xP7vOoRA/images/882ee7957250cc7c803e70123560886072512398.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-08-08T00:52:23.472565Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/xP7vOoRA/images/92b11228b9917729454ba4ae0ddda78f689fe44f.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-08-08T00:55:05.249322Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/xP7vOoRA/images/ad6c981377caa414915baa0aaec62a48c8156943.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-08-08T00:47:10.730250Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/xP7vOoRA/images/b21d598cb83392d4c7579d132f0502fa170679fb.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-08-08T00:56:55.975205Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/xP7vOoRA/images/b3eedcc0548f6ecdcbc1bc6a643f74018189a22f.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-08-08T00:42:47.954515Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/xP7vOoRA/images/b42229045c872884940ef750e3a92bc7a6516c06.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-08-08T00:59:22.457754Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/xP7vOoRA/images/bf1b4c829b07646ee36bb3fc64c5cb5fed4b748a.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-08-08T01:03:29.408391Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/xP7vOoRA/images/c4f6c173807f6b4505021d6b182e24e7ff064bd4.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-08-08T00:57:41.744263Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/xP7vOoRA/images/c5fc06f71a2d9346b9acc0e7db094d2da8b85de9.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-08-08T00:46:05.510722Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/xP7vOoRA/images/db02fa1fb6b3c4d3a56b40c48f47602491ae3e18.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-08-08T01:04:34.988016Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/xP7vOoRA/images/ef678208f1a4175e98837e11f915a0b11a1677b2.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-08-08T00:41:56.231586Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/xP7vOoRA/images/5b261d90890a1ef73c9467d909f27045377f2f55.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-08-08T00:43:53.139922Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/xP7vOoRA/images/86f49f5780b459a6d438f6961120df318ee2c673.png", + "featured": true, + "title": "Mythic Mounts Banner Image", + "description": null, + "created": "2023-08-08T00:37:28.616249Z", + "ordering": 2 + } + ], + "color": 5376012, + "thread_id": "ChkKvbzo", + "monetization_status": "monetized" + }, + "mythicupgrades-4.1.3+mc1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.19.3", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.21", + "1.21.1" + ], + "id": "ERH7cFoy", + "slug": "mythic-upgrades", + "project_type": "mod", + "team": "zkoYVHfc", + "organization": null, + "title": "Mythic Upgrades", + "description": "Mythic Upgrades adds new mythic ways to upgrade Netherite gear with new ores.", + "body": "- ## TriQue API is hardly recommended in older versions (2.4.2 and older) for compatibility! [Click here to download!](https://modrinth.com/mod/trique-api)\n\n      

\n\n![Mythic Upgrades Title](https://i.imgur.com/jWd37fx.png)\n\n[![We're partnered with BisectHosting! Use code trique to get a 25% discount!](https://i.imgur.com/BeZMFYy.png)](https://www.bisecthosting.com/trique)\n\n![Mythic Upgrades adds six new ores to the game such as Jade, Topaz, Aquamarine, Sapphire, Ruby, Peridot, Zircon, Citrine, Necoium and Ametrine. All these can be used to craft their own ingots and upgrading netherite gear in different ways.](https://i.imgur.com/9Jegz8k.png)\n\n[![Join Kinetic Hosting with my code!](https://i.imgur.com/Ko1TqPG.png)](https://billing.kinetichosting.net/aff.php?aff=116)", + "body_url": null, + "published": "2022-11-13T10:32:32.777218Z", + "updated": "2024-08-12T16:52:40.004139Z", + "approved": "2022-11-15T22:44:17.855487Z", + "queued": "2023-06-20T16:50:04.591847Z", + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 283483, + "followers": 178, + "categories": [ + "equipment", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "xGAGPuFO", + "Ye8kBNTs", + "WkIXGKWr", + "BpnnQpkq", + "bvj5lBDH", + "NMJY8w8I", + "1Kmg8B4O", + "AR1Mzi9M", + "QnXd490v", + "ud2gPZEV", + "XM2ZIPwU", + "pChMoeMT", + "CGWUyUvR", + "BalMdVPs", + "6zxDjwBl", + "FUEOIEd8", + "fL5rYzR5", + "C0ybESos", + "qjvUU1PE", + "ExAfDbd9", + "VUoyw5kA", + "Dxb74rbH", + "RrFY1cXn", + "dD866aNy", + "I28LdQYe", + "6FUWTkE3", + "ZyCwS15W", + "dPnw1bkw", + "sdezMebk", + "XIAUSkCg", + "K0Oy8hqw", + "x81YGImc", + "rP4mfOrZ", + "qcBhj2qI", + "7upUIt84", + "iOcV6yET", + "tiUpiCAf", + "CVYBhY6J", + "QngIDLwP", + "A2AAH7Aq", + "zJAuidYK", + "KqpOSqHC", + "V9SpwRdB", + "eBTC7XZQ", + "4DNoHnyy", + "gqEBYiBJ", + "2oQwcou2", + "74Z2wptR", + "kco7fEej", + "KkROoKjO", + "ZIxxXgir", + "louNc9qE" + ], + "icon_url": "https://cdn.modrinth.com/data/ERH7cFoy/f5daf0cbb2b8b9094c1aca76bd7092d0aa0ecedf.gif", + "issues_url": "https://github.com/TriQue06/mythic-upgrades-1.20.x/issues", + "source_url": "https://github.com/TriQue06/mythic-upgrades-1.20.x", + "wiki_url": null, + "discord_url": "https://discord.gg/gT8864sMNQ", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/ERH7cFoy/images/5af0f716e3b808f90ffa85f7803c14afc7cae800.png", + "featured": false, + "title": "Blocks", + "description": null, + "created": "2024-07-26T11:44:51.973046Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ERH7cFoy/images/68189c229b04c64dce9ba3fc2a9d7a4790bbd084.png", + "featured": true, + "title": "General Look", + "description": null, + "created": "2024-07-26T11:40:08.198989Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/ERH7cFoy/images/1babd5f1a523e4965a8a2210f0de3355d72cb886.png", + "featured": false, + "title": "All Items (as possible)", + "description": null, + "created": "2024-07-26T11:40:43.016523Z", + "ordering": 2 + } + ], + "color": 6034207, + "thread_id": "ERH7cFoy", + "monetization_status": "monetized" + }, + "mythquest-1.2": { + "client_side": "optional", + "server_side": "required", + "game_versions": [ + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4" + ], + "id": "9daSQ9Yq", + "slug": "mythquest", + "project_type": "mod", + "team": "nE3BogJY", + "organization": null, + "title": "MythQuest ~ Weapons", + "description": "MythQuest is a thrilling Minecraft mod that introduces a fascinating twist to the game, incorporating the legendary realm of Greek mythology.", + "body": "![reaper update logo](https://cdn.modrinth.com/data/cached_images/8aef81c6337777ec50ba295ee70224d4cd151f93.png)\n## Important\n\n**On loading the datapack or mod onto a world, If the guidebook is not recieved, please run ``/reload``**\n\n### UPDATE NEWS \n\n> **MythQuest HAS BEEN UPDATED TO 1.2, WITH NEW MECHANICS LIKE SCROLLS, AND NEW ITEMS AND BOSSES**\n\n## MythQuest Description \n\nMythQuest is a thrilling Minecraft mod that introduces a fascinating twist to the game, incorporating the legendary realm of Greek mythology. This immersive mod unveils multiple powerful items inspired by mighty Greek gods, offering players a unique and challenging experience.\n\n## Download for yourself! to experience all the items!! NO SPOILERS!!\n\n> Items listed here are only the ones that have been added in the latest update\n\n> ### [UPDATED] Reaper Boss!\n\n> Reaper Boss ~ A part of the new Reapers Update, the Reaper Boss, He can be summoned with the floor crafting mechanism, adds a new level of progression to the game\n\n> Reaper Boss Papyrus ~ An unfakeable proof card that is only obtained on summoning the reaper boss.\n\n**MythQuest transforms the Minecraft experience by blending Greek mythology with the sandbox world, offering players the chance to become legends themselves as they wield the formidable artifacts of the Myths. Embark on an epic journey, face mythical challenges, and prove your worth in the divine realms of MythQuest.**", + "body_url": null, + "published": "2024-01-06T13:36:29.616142Z", + "updated": "2024-03-03T08:55:14.465494Z", + "approved": "2024-01-08T01:01:47.876618Z", + "queued": "2024-01-06T13:55:01.736196Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 3839, + "followers": 20, + "categories": [ + "adventure", + "equipment", + "magic" + ], + "additional_categories": [ + "game-mechanics", + "minigame", + "mobs", + "utility" + ], + "loaders": [ + "datapack", + "fabric", + "forge", + "quilt" + ], + "versions": [ + "B3ZZ7qGm", + "v0cQX9VW", + "a8K8vYow", + "y8estnTd", + "2QeNF5eA", + "AwRDUZl5" + ], + "icon_url": "https://cdn.modrinth.com/data/9daSQ9Yq/6d79d7a94b3f9ca4053726ba03d1695b03eef853.png", + "issues_url": null, + "source_url": null, + "wiki_url": null, + "discord_url": "https://discord.gg/waBZmsqREk", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/9daSQ9Yq/images/527de80703f3ca7e212790bdc7b2d522c60f246e.png", + "featured": true, + "title": "MythQuest ~ Final Feature", + "description": null, + "created": "2024-01-08T15:53:40.843633Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/9daSQ9Yq/images/bead6a07334637bf8ff7cbe4a4127d97d3382f71.png", + "featured": false, + "title": "MythQuest ~ Final Title", + "description": null, + "created": "2024-01-08T15:52:54.962821Z", + "ordering": 0 + } + ], + "color": 1315864, + "thread_id": "jdxD2OnB", + "monetization_status": "monetized" + }, + "naturalist-fabric-4.0.3-1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.20.1" + ], + "id": "F8BQNPWX", + "slug": "naturalist", + "project_type": "mod", + "team": "WDGPSOG3", + "organization": null, + "title": "Naturalist", + "description": "Adds new immersive wildlife with realistic behavior!", + "body": "

\"Starfish

\n

\"Static \"X \"Discord\" \"CurseForge

\n

\"enter

\n

Have you ever wanted a truly immersive animal mod, where animals interact with each other realistically? Naturalist adds more animals to the game that behave as they do in real life. There is a working food chain, sleep cycle, and tons of other fun behaviors, giving each animal a personality of its own. So, are you ready to venture out into the wild? 

\n
\n

Try out our other content!

\n\n
 
\n
 
\n
\"Partner
", + "body_url": null, + "published": "2023-02-18T00:01:30.282944Z", + "updated": "2023-11-07T07:13:38.768440Z", + "approved": "2023-02-18T01:07:24.056696Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-Custom", + "name": "", + "url": "https://github.com/starfish-studios/Naturalist/blob/1.19/LICENSE" + }, + "downloads": 1153402, + "followers": 1438, + "categories": [ + "adventure", + "mobs", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "bprTJ2C1", + "A4D0ssAc", + "XWezpMfV", + "TLrtGUZa", + "oWGKezhf", + "ILQ8BuMi", + "ZjjyXkT5", + "J96Y4WM3", + "ufJHqOw0", + "AeRDoid8", + "UV8Ogjj0", + "4PZMnbh1", + "3b08mljN", + "yX8BStTF", + "S0IjmekL", + "mvLVxtmI", + "vrjOD2Cp", + "MOfFjPnF", + "6OxA1pfG", + "sVtayqoK", + "dMGBsRgz", + "YjWRWE02", + "fapHaClR" + ], + "icon_url": "https://cdn.modrinth.com/data/F8BQNPWX/bbc2199861f44c2027abb411d53bfceb683fea92.gif", + "issues_url": "https://github.com/starfish-studios/Naturalist/issues", + "source_url": "https://github.com/starfish-studios/Naturalist", + "wiki_url": "https://starfish-studios.com/mods/naturalist", + "discord_url": "https://discord.gg/starfishstudios", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/F8BQNPWX/images/1a899f97042f063676187b8eaf16b04c04622559.png", + "featured": false, + "title": "Dragonflies", + "description": "Dragonflies flying around a swamp.", + "created": "2023-04-20T03:05:47.991774Z", + "ordering": -1 + }, + { + "url": "https://cdn.modrinth.com/data/F8BQNPWX/images/5c215c1b8986549b574c061407b1e412cf27292d.png", + "featured": false, + "title": "Ducks", + "description": "Ducks looking for a tasty fish!", + "created": "2023-04-20T03:03:30.579017Z", + "ordering": -1 + }, + { + "url": "https://cdn.modrinth.com/data/F8BQNPWX/images/cf6ae5da73f8f9f28b6c677705936b4fa67c6dbc.png", + "featured": false, + "title": "Tortoise", + "description": "Tortoise slowly walking. Where is he going?", + "created": "2023-04-20T03:03:55.549556Z", + "ordering": -1 + }, + { + "url": "https://cdn.modrinth.com/data/F8BQNPWX/images/1e880cc80e1303e3e574c993be6d01518bced7fe.png", + "featured": false, + "title": "Butterflies", + "description": "A Butterfly flies around a Flower Forest, dropping pollen as it moves. On a tree to the right of the image, Chrysalises can be seen on a large oak tree.", + "created": "2023-02-18T00:44:40.586738Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/F8BQNPWX/images/3ef84f79f4cd33fd973499a309766c3059a3fd53.png", + "featured": false, + "title": "Fireflies", + "description": "2-3 Fireflies are seen flying above trees in a swamp, some glowing and some not.", + "created": "2023-02-18T00:47:16.252593Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/F8BQNPWX/images/3fccf114e7d4d41e6413b8f597bdab3728b79d91.png", + "featured": false, + "title": "Lions", + "description": "A pack of Lions with two females, one male, and a cub relax on the grass during the evening.", + "created": "2023-02-18T00:42:55.258597Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/F8BQNPWX/images/57a55dab2adaaa311c8f794f68c7423783151825.png", + "featured": false, + "title": "Zebra", + "description": "A lone Zebra grazes on the grass below it.", + "created": "2023-02-18T00:41:37.583062Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/F8BQNPWX/images/5cf9a1c39d047fc844aa487e58dd15a503addecc.png", + "featured": false, + "title": "Giraffes", + "description": "A herd of Giraffes walks around, some standing still. A Village can be seen in the corner of the photo.", + "created": "2023-02-18T00:41:11.842735Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/F8BQNPWX/images/716f2b2ecfcfba764bbcb08a0cc3fab5e8702979.png", + "featured": false, + "title": "Rattlesnake", + "description": "A Rattlesnake slithers across the sand of a desert near a cactus, looking for its next meal.", + "created": "2023-02-18T00:45:14.526139Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/F8BQNPWX/images/8575b1eec5bf1efb9a33f32b81b88a3403fa98ff.png", + "featured": false, + "title": "Rhinos", + "description": "A Rhino and its calf explore the Savanna.", + "created": "2023-02-18T00:43:36.219701Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/F8BQNPWX/images/a415b7615a627cb4ad72da3f64c5066c3239b79d.png", + "featured": false, + "title": "Birds", + "description": "A variety of Birds litter the forest, some flying, some on the ground.", + "created": "2023-02-18T00:48:38.777243Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/F8BQNPWX/images/c8e4fc16921bc23fc29ad91a1e53d1e380d65760.png", + "featured": false, + "title": "Elephants", + "description": "A family of elephants with two adults and one calf stand around on the grass nearby a river.", + "created": "2023-02-18T00:42:11.650557Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/F8BQNPWX/images/d74f112309bacb94aa367b208ce9517991a95009.png", + "featured": false, + "title": "Deer", + "description": "A Deer and its fawn stand under the forest canopy during the evening - the fawn has eaten some of the grass beneath them, and the adult keeps an eye out for predators.", + "created": "2023-02-18T00:46:28.813316Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/F8BQNPWX/images/e6133e1f300771a7fac809db6f4153011f86a418.png", + "featured": false, + "title": "Vulture", + "description": "A single Vulture attacks a Husk, hungry for its Rotten Flesh.", + "created": "2023-02-18T00:45:35.965806Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/F8BQNPWX/images/e8dc428f8a9df17f22e43a5fc5dee629cbafbeb7.png", + "featured": false, + "title": "Snails", + "description": "Two Snails crawl alongside the deck of a Witch Hut, squelching with each movement of their body.", + "created": "2023-02-18T00:47:59.292811Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/F8BQNPWX/images/eaccc23fff361f85cfebd969b499fd76967c398c.png", + "featured": false, + "title": "Bears", + "description": "A mother Bear and her cub look around, surveying the forest.", + "created": "2023-02-18T00:40:37.841869Z", + "ordering": 0 + } + ], + "color": 7617042, + "thread_id": "F8BQNPWX", + "monetization_status": "monetized" + }, + "NaturesCompass-1.20.1-2.2.3-fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.7.10", + "1.12.2", + "1.16.5", + "1.17.1", + "1.18.2", + "1.19.2", + "1.19.4", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "fPetb5Kh", + "slug": "natures-compass", + "project_type": "mod", + "team": "NfRR1ohh", + "organization": null, + "title": "Nature's Compass", + "description": "Allows you to locate biomes anywhere in the world.", + "body": "![Natures's Compass](http://i.imgur.com/WeS8L88.png)\n\nNature's Compass\u00a0is an item that allows you\u00a0to search for a biome's location anywhere in the world and view information about it. If you're looking for a compass that can locate structures, check out [Explorer's Compass](https://modrinth.com/mod/explorers-compass).\n\n## Features\n\n- Right-clicking with\u00a0the Nature's\u00a0Compass will open the biome selection GUI, from which you can search for a biome or view information about it\n- Shift-right-clicking will reset the compass's\u00a0state\n- When the compass is not pointing at a biome, it will point at the world spawn\n- Supports\u00a0all registered biomes, both vanilla and modded\n- Things like blacklisted biomes and maximum search distance can be adjusted in the config file\n\n## Images\n\n![Information about a found biome is displayed\u00a0on the HUD](https://i.imgur.com/rhz4gLR.jpg)\n\n*Information about a found biome is displayed\u00a0on the HUD*\n\n![The biome selection GUI](https://i.imgur.com/GTSAfqv.png)\n\n*The biome selection GUI*\n\n![The biome information GUI](https://i.imgur.com/vjsdZZ4.png)\n\n*The biome information GUI*\n\n## Recipe\n\n![Recipe](http://i.imgur.com/175k4oE.png)\n\n*Saplings and logs use the ore dictionary*\n\n## Modpacks\n\nYes, you can use this mod in your modpack.\n\n## Support\n\nIf you enjoy the mod and would like to support the project, feel free to [leave\u00a0a donation on PayPal](https://www.paypal.com/donate/?business=46ZL2PNVP4XKE). Support is greatly\u00a0appreciated!\n\n## Sponsor\n\nThis project is sponsored by BisectHosting. If you're looking for a server, check out their hosting plans and [use promo code\u00a0*Chaos*\u00a0at checkout](https://www.bisecthosting.com/chaos) to get 25% off your first month!\n\n[![](https://www.bisecthosting.com/partners/custom-banners/0998de1c-6d3e-4370-a553-0da42e986c68.png)](https://bisecthosting.com/chaos)", + "body_url": null, + "published": "2023-09-10T20:54:36.018780Z", + "updated": "2024-06-25T23:29:13.531533Z", + "approved": "2023-09-17T08:05:14.174661Z", + "queued": "2023-09-15T23:56:29.564652Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "CC-BY-NC-SA-4.0", + "name": "Creative Commons Attribution Non Commercial Share Alike 4.0 International", + "url": null + }, + "downloads": 1633919, + "followers": 563, + "categories": [ + "adventure", + "equipment", + "utility" + ], + "additional_categories": [ + "game-mechanics", + "technology", + "worldgen" + ], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "Oq29B6p7", + "kMPLisZs", + "7Gu21rMe", + "o0SCfsMe", + "EiqUWpG9", + "IevyW0iW", + "fUU599ai", + "h9RH2quJ", + "mtJLgFgQ", + "N4ONofeB", + "4uJ33W15", + "lVeHfUiZ", + "NovIXDxY", + "Og40jCNX", + "IQefNHid", + "T9QM7yrP", + "BtFlcETU", + "rEEmi8E5", + "xyis9gOg", + "1auwKKIf", + "iaAgAAIT", + "AXaVQKzH", + "BkllKDjG", + "IznZXHBu", + "GfYWHTxk", + "i96v7o3k", + "1OwCLPtS", + "UtIbyrWH", + "TtWM9SPX", + "H29kZ8Rq", + "jte5ZZmb", + "QVKr4BEc", + "YLBedBAk", + "GYmZGD7e", + "g7OAoksp", + "hwcVd7cN", + "B8cOeTJ3", + "tBmAcdOX", + "OJXBDVY2" + ], + "icon_url": "https://cdn.modrinth.com/data/fPetb5Kh/9b0d54f2a8d9e49a10f5bcb8004bc757f55bb013.png", + "issues_url": "https://github.com/MattCzyr/NaturesCompass/issues", + "source_url": "https://github.com/MattCzyr/NaturesCompass", + "wiki_url": null, + "discord_url": null, + "donation_urls": [ + { + "id": "paypal", + "platform": "Paypal", + "url": "https://www.paypal.com/donate/?business=46ZL2PNVP4XKE" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/fPetb5Kh/images/3d06c58f2212b8cdd59d4717f642ae2a6272ac0b.jpeg", + "featured": false, + "title": "Found Biome", + "description": "Information about a found biome is displayed on the HUD", + "created": "2023-09-10T21:48:53.627162Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/fPetb5Kh/images/70122d266aaf4bd17bda6326187c962e910d938f.png", + "featured": false, + "title": "Select Biome", + "description": "The biome selection GUI", + "created": "2023-09-10T21:49:24.153317Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/fPetb5Kh/images/346cfffb4f6b340d1c7a6215966247fcdf4214ad.png", + "featured": false, + "title": "Biome Info", + "description": "The biome info GUI", + "created": "2023-09-10T21:49:55.033191Z", + "ordering": 2 + } + ], + "color": 11242580, + "thread_id": "rJlaTqAs", + "monetization_status": "monetized" + }, + "Necronomicon-Fabric-1.4.2": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.17", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21-pre1", + "1.21-pre2", + "1.21" + ], + "id": "P1Kv5EAO", + "slug": "necronomicon", + "project_type": "mod", + "team": "o6yR6zfS", + "organization": null, + "title": "Necronomicon API", + "description": "A personal utility library for my mods.", + "body": "# Necronomicon\nA utility API for my mods, such as Eldritch End.\n\nIt features utilities for datagen, worldgen, registries, multi-loader development, and other misc stuff.\nFeel free to use it in your projects, it has a bit of documentation.", + "body_url": null, + "published": "2023-11-22T02:33:00.772542Z", + "updated": "2024-02-08T23:40:22.114601Z", + "approved": "2023-11-23T19:33:23.537135Z", + "queued": "2023-11-22T02:36:22.710986Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 587071, + "followers": 51, + "categories": [], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "87UXs8dM", + "edD42FPx", + "1bVJrZqQ", + "BtAOWWkM", + "2CEi0S6e", + "QZadGyLs", + "twWimVNr", + "txeRRjSH" + ], + "icon_url": "https://cdn.modrinth.com/data/P1Kv5EAO/45ae65c167af03db946bbd0e84ba5d2dcbc91138.png", + "issues_url": null, + "source_url": null, + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": 3939099, + "thread_id": "ejDvPn3K", + "monetization_status": "monetized" + }, + "Neruina-2.1.1-fabric+1.20.1": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "1s5x833P", + "slug": "neruina", + "project_type": "mod", + "team": "Whmvk29e", + "organization": null, + "title": "Neruina - Ticking Entity Fixer", + "description": "A Mod that prevents ticking-related crashes from bricking worlds", + "body": "# Neruina\n\n### This is a mod that prevents ticking crashes from bricking worlds.\n\n[![Modrinth](https://img.shields.io/modrinth/dt/neruina?colour=00AF5C&label=downloads&logo=modrinth)](https://modrinth.com/mod/neruina)\n[![CurseForge](https://cf.way2muchnoise.eu/full_851046_downloads.svg)](https://curseforge.com/minecraft/mc-mods/neruina)\n\n### When an Entity, Block or Item causes a ticking crash:\n- That Entity will be suspended and no longer tick, you can still interact with the entity but cannot attack it.\n- That Block Entity / Tile Entity or Block State (for random ticks) will no longer tick, you can still access the block inventory if it has one.\n- That Item will stop ticking in the inventory but will still persist and function in recipes and most uses, nothing is lost.\n- If another mod causes the Player to crash on tick, the Player will be kicked instead.\n\n### Actions:\n- `What Is This?`: Opens the Neruina wiki page on what Neruina is and what it does\n- `Copy Crash`: Copies the cause of the ticking exception to your clipboard\n- `Teleport`: Teleports you to the location of the ticking entity\n- `Try Resume`: Attempts to resume the ticking of the ticking entity\n- `Kill`: Immediately kills and removes the ticking entity\n- `Report` (1.19+): Opens a new issue on the [NeruinaAutoReports](https://github.com/Bawnorton/NeruinaAutoReports)\n GitHub repository and any mods that opt-in to the reporting system\n\n### Persitance:\n- Ticking entity tracking will now persist across server restarts\n- When the world is first started Neruina will broadcast all tracked ticking entities that need addressing\n\n### Ticking Threshold:\n- When a certain number of ticking excpetions occur within a certain time frame, Neruina will deliberately crash in\n order to prevent the server from becoming unusable.\n- A comprehensive report will be generated with every ticking exception that occurred with instructions on what to do next.\n- The default threshold is 10 exceptions within 5 minutes, this can be changed in the config.\n\n### Config\n- `log_level`\n - `operators` (default) - Only operators will receive the broadcast\n - `everyone` - Everyone will receive the broadcast\n - `disabled` - No one will receive the broadcast\n- `ticking_exception_threshold`\n - The number of ticking exceptions that can occur within the specified time frame before Neruina will deliberately\n crash\n - Default is `10`\n - `-1` will disable the threshold\n- `auto_kill_ticking_entities`\n - If true, ticking entities will be immediately killed and removed rather than suspended\n - Default is `false`", + "body_url": null, + "published": "2023-04-16T02:48:09.083100Z", + "updated": "2024-07-31T14:10:07.212023Z", + "approved": "2023-04-17T03:53:29.404208Z", + "queued": "2023-04-16T03:26:18.069180Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 593151, + "followers": 133, + "categories": [ + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "gFDTlYva", + "t7QqU6GC", + "lY3XjoiG", + "1kvaSVPe", + "k2xYSHIO", + "s0Dw11BD", + "uCYnuRfV", + "9CUCVABQ", + "qiCyQnQb", + "cZQv6x9R", + "1cxZvFaD", + "6Wc1wySq", + "B9ZR87Ws", + "cLR5it0O", + "HG1IAWMf", + "1hAuyKqX", + "si9qadH8", + "oWCHNF3U", + "LVF6eEwy", + "pVycNpLT", + "UlxWjlxZ", + "WHuBFrVG", + "zjq512pk", + "tH3dA34q", + "Ks0iPnry", + "mBMOVCoi", + "bLF5Xi3z", + "Vf8rcrxB", + "En2AbIrY", + "Z7982UzL", + "QOVVS868", + "vpcFLDzA", + "zQviItAy", + "fez1lpaX", + "ZilPnAbb", + "IoOGXrZ1", + "AeXDMj50", + "wz6ptum5", + "7Y42VogK", + "RaP3sWWr", + "VKc0dQJ4", + "OURXSRYG", + "iytEhar2", + "R4xuuYah", + "q4kZgUJ0", + "S95lnn83", + "YvsVgtJ2", + "QZhmbGqz", + "NRaf078W", + "QRFMiKt8", + "sIshNzcx", + "wDRTyPHj", + "u8WsuGwJ", + "2nvplBOu", + "SrTIAwZQ", + "7lTmIUht", + "jijJTx3Z", + "Vq3e8M1S", + "wdRYHrJx", + "Q1ksFcMU", + "o4GrNXlp", + "cYY4Mj5d", + "I7Nhi02i", + "DqhEpQbv", + "urHANUlF", + "OVr2u4vF", + "JlUbqvDr", + "uuag56TA", + "AoIbdGit", + "3EFQyMRJ", + "lOcQOYFd", + "JgBVA5VC", + "NBOQHx8s", + "WQA5VnUe", + "4gwxcbJj", + "YuOZXPap", + "MZGqqctu", + "a1M6kWHX", + "tuBdaQtW", + "kr9Ex4Su", + "bcLz5Ull", + "dUDdC3we", + "8FZtemi0", + "3nPntExd", + "9ivXcJEH", + "a7u1jfbz", + "TN81ShVx", + "PUXRPbIv", + "wY9wiOGP", + "8VE2LlUq", + "9EeevciG", + "7wPr8hZu", + "fgDP4dFB", + "Jxl6RWC7", + "lqxsuFdN", + "TRHD8nMe", + "c5XrC7um", + "ZU4eAFB3", + "yga9Qdt4", + "RX1KzV2Y", + "4a1oclhK", + "WNFfMYlL", + "vtjsqmWw", + "5oomV8Xe", + "5TMS9aA7", + "KjoOQWXx", + "18KACa0v", + "wyX0svvD", + "RDIW1vEr", + "Rgw87vtu", + "QLfNYD5X", + "ovhFd4hV", + "ZnozYXy0", + "nT0BRNAK", + "ghtvpiib", + "eJ0cfUYZ", + "SOynRYj3", + "JaWa9t35", + "zub9vqIu", + "shEpXbrx", + "obFkianv", + "AXts8ZvP", + "urbxWRwe", + "HAY2a4EI", + "FGHbY6b0", + "YGUJof15", + "y9EQlZVy", + "DromPhtS", + "FeUBkub6", + "vLvFOyhZ", + "BPgF33f8", + "Y8SdXBLm", + "ltv3yt61", + "CzQWOO6H", + "RH7DozdT", + "wQnrezRp", + "9WB5CFtn", + "cGwAoULz", + "uriuhXDq", + "9qiHa4tW", + "DgrfPLB9", + "QwAghAXk", + "8R0ApLFn", + "hccpN17X", + "tTzfQXEY", + "9BTsibnM", + "e4XyJNad", + "fO2dWV9v", + "8ObnCvWx", + "OJCuV1A3", + "QlXHp3Wc", + "d7rGTH8w", + "D73sNN1n", + "85V5sG0e", + "PYAIZVdI", + "2pSIrUMv", + "bby6z0lc", + "at0qQd7p", + "DJn40g5e", + "TwrkXQRc", + "IrhpPXR5", + "R08s5q7o", + "3dEDxcSK", + "fJrtVaqS", + "7HM5BtMB", + "XqItQc0B", + "5yYJdq0D", + "xmeJROv1" + ], + "icon_url": "https://cdn.modrinth.com/data/1s5x833P/b7e3cf809f07d3cad88a60834c3e4e7248021744.png", + "issues_url": "https://github.com/Benjamin-Norton/Neruina/issues", + "source_url": "https://github.com/Benjamin-Norton/Neruina", + "wiki_url": null, + "discord_url": null, + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/bawnorton" + } + ], + "gallery": [], + "color": 3294781, + "thread_id": "1s5x833P", + "monetization_status": "monetized" + }, + "netherdepthsupgrade-fabric-3.1.6-1.20": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.20", + "1.20.1", + "1.21" + ], + "id": "vI1QKJro", + "slug": "nether-depths-upgrade", + "project_type": "mod", + "team": "aptcYWoq", + "organization": null, + "title": "Nether Depths Upgrade", + "description": "Nether Depths Upgrade is a small mod that adds some extra flora and fauna to the lava seas of the nether. A total of nine fish have been added, a new enchant and potion in order to explore the lava in the nether.", + "body": "Nether Depths Upgrade is a small mod that adds some extra flora and fauna to the lava seas of the nether. A total of nine fish have been added, a new enchant and a potion in order to explore the lava in the nether.\u00a0\n\n\u00a0\n\nDependencies\n\nGeckolib 3.0\u00a0\n\n\u00a0", + "body_url": null, + "published": "2023-11-23T15:00:42.685533Z", + "updated": "2024-06-22T15:49:51.475753Z", + "approved": "2023-11-25T23:05:35.103783Z", + "queued": "2023-11-23T20:11:24.748798Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 182042, + "followers": 73, + "categories": [ + "food", + "mobs", + "worldgen" + ], + "additional_categories": [ + "adventure", + "decoration" + ], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "loXsK6pI", + "ZWJgefUm", + "dDLEuc4q", + "4vBIcLl5", + "OjVDLhp8", + "cvV73NZf", + "OfDY0j6J", + "P2YDt9Vr", + "tx2xqxt4", + "j7pCRI2o", + "pQxWZBvX", + "uJyKtcLC", + "Khk9jNAc", + "yQebXZkw", + "nzxNHa9C", + "4BBCXAgd", + "BFX1CDJ6", + "CdgX1NKy", + "E87UdR7u", + "X90OBeWR", + "GaMdNhQQ", + "I8SCEtOo" + ], + "icon_url": "https://cdn.modrinth.com/data/vI1QKJro/2b3da73b35e1fa612fc14ffa7257d9a5b543484e.png", + "issues_url": null, + "source_url": "https://github.com/Scouter456/Nether_Depths_Upgrade", + "wiki_url": null, + "discord_url": "https://discord.gg/UVNmahySUH", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/vI1QKJro/images/1ec536fcfb19df8445b6bf8d26b46e84bfc25972.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-23T20:09:07.314723Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/vI1QKJro/images/2893603cb342cf0a4a67b428cee2de9c51bd64a6.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-23T20:09:38.629877Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/vI1QKJro/images/3e51dacb6b185fb796b3bfcf847611921655ba09.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-23T20:09:24.615138Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/vI1QKJro/images/5266a65d989c59757ad625d2cb2d038937da8662.jpeg", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-23T20:08:40.356501Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/vI1QKJro/images/78310f798194bae6f875d46e739a1a24f9b8c2b0.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-23T20:09:17.104863Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/vI1QKJro/images/7c1ced85ae8505ef0d730ef61bde7f79c2f7e01e.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-23T20:08:31.236706Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/vI1QKJro/images/c811a60c92f0bdc5c89009a23c85938baa49fc20.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-23T20:08:51.285396Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/vI1QKJro/images/db5293427f1dfcb70eea94484dcfd4eac0ff569c.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-23T20:09:00.120918Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/vI1QKJro/images/dda7016afaa17d77af5700c159f6601427a6b4eb.jpeg", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-23T20:09:44.569255Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/vI1QKJro/images/e06e316bf4b4ea5cfbea2f808642a7d32295c641.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-23T20:09:21.029983Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/vI1QKJro/images/ed07ac691a23bd2ffb8717877faf0dbba3548a67.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-23T20:09:29.199678Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/vI1QKJro/images/ff931ba8a5373657332eb84bf4fc2d84407179f9.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-11-23T20:09:10.437733Z", + "ordering": 0 + } + ], + "color": 4929327, + "thread_id": "y9C5GsAu", + "monetization_status": "monetized" + }, + "NetherPortalFix": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "nPZr02ET", + "slug": "netherportalfix", + "project_type": "mod", + "team": "wvv5zQj8", + "organization": null, + "title": "NetherPortalFix", + "description": "Ensures correct destinations when travelling back and forth through Nether Portals in Multiplayer.", + "body": "![](https://blay09.net/files/brand/netherportalfix.png)\n\n[![](https://mods.twelveiterations.com/img/sponsor.png)](https://mods.twelveiterations.com/sponsor)\n\nEver played on a multiplayer server, built near other players and when returning from the Nether, surprisingly found yourself in another player's base? It's because of the 8:1 block ratio between the Nether and the Overworld. It's really weird though that you enter a portal in the overworld, and then when going back through where you came, come out of a different portal in the overworld. This mod fixes that issue.\n\nIt keeps track of what portals a player went through in order to ensure correct destinations when the player is going back through the same portals. The 1:8 ratio remains, portals just get smarter and remember where you came from.\n\n

\n \n \"Requires \n \n \"\" \n \n \"Join\n \n

\n\n## Features\n\n- As long as players use the same portal to return to the overworld, they will end up where they came from\n- Only needs to be installed on the server (but works in singleplayer as well)\n\n\n

\n \"\" \n \"\"\n

", + "body_url": null, + "published": "2022-06-14T21:48:05.255247Z", + "updated": "2024-08-13T05:54:03.204448Z", + "approved": "2022-06-14T21:48:05.255247Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": "https://mods.twelveiterations.com/permissions" + }, + "downloads": 1782173, + "followers": 447, + "categories": [ + "game-mechanics", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "W2GQFVWF", + "KchVyZcY", + "lvjIpOkl", + "8Z8NExgb", + "ermlUjF9", + "Xgt8gsvh", + "3ABQuZux", + "mZoHwPFg", + "jlARFVYj", + "609MPxvC", + "fAtDIamf", + "kpXZdI4d", + "b11QoY35", + "Aa31SP8V", + "wX5DuGY9", + "FNyz19JT", + "nGNVabdg", + "HXKeuKnk", + "5UbTkcSQ", + "aeJtHUBZ", + "NANcEzKA", + "cWPAnu7u", + "5mUp7FiY", + "WJBCsJlq", + "CUncGC4R", + "sdRhw16z", + "QNaqDHXQ", + "Xma4SDMw", + "VU2uPLbX", + "DDMLN9aT", + "VtIpicaF", + "QWBZRKVi", + "6tDPIRKi", + "6ek10V7o", + "xx3LZGp9", + "jOJINp9l", + "DsfCfjv7", + "uxUqzZh2", + "zvvmCZw9", + "nSxqDibl", + "rXrUOY9t", + "s2l2gzHa", + "KtMN6zDF", + "MIhTEvQr", + "O09BGtgh" + ], + "icon_url": "https://cdn.modrinth.com/data/nPZr02ET/icon.png", + "issues_url": "https://github.com/TwelveIterationMods/NetherPortalFix/issues", + "source_url": "https://github.com/TwelveIterationMods/NetherPortalFix", + "wiki_url": "https://mods.twelveiterations.com/mc/netherportalfix", + "discord_url": "https://discord.gg/VAfZ2Nau6j", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/BlayTheNinth" + } + ], + "gallery": [], + "color": 7865862, + "thread_id": "nPZr02ET", + "monetization_status": "monetized" + }, + "nicer-skies-1.3.0+1.20.1": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.21", + "1.21.1" + ], + "id": "gsJ6q45e", + "slug": "nicer-skies", + "project_type": "mod", + "team": "bebuXBni", + "organization": null, + "title": "Nicer Skies", + "description": "A mod which adds nebulas and changes stars and light.", + "body": "# Nicer Skies\n\n### Nebulas \nThis mod renders a seed/server-dependent skybox that is 100% generated in runtime with cool shader-like nebulas.\n\n![2022-11-07_15 12 41](https://cdn.modrinth.com/data/gsJ6q45e/images/a5f425ae1e5a469dc5997f91b1f9f535cb4e3021.png)\n\n### Star rendering\nStars will twinkle and be of slightly different colours\n\n\n[Click here to see a video!](https://user-images.githubusercontent.com/57519662/195574727-11e11ce6-73b6-4786-b6cf-4e38d4b5cd26.mp4)\n\n### Lightmap changes\nThe lightmap has been a little tweaked to my personal preference to be a little more vibrant and dark, but it's 100% sure that these changes will be optional in the final product.\n\n\n\n![lightmap](https://user-images.githubusercontent.com/57519662/195578328-053f5d84-a9db-4e44-a4a7-4ecc4f25af37.gif)\n\n## Configuring\nConfiguring the mod requires Mod Menu, otherwise it's stuck at the default settings seen below. \n\nTo access the screen, go to the mod list and press on the settings button on Nicer Skies.\n\n![config](https://cdn.modrinth.com/data/gsJ6q45e/images/640a9e25093cae59465303193da25f51a1f26bc3.png)\n\n## Shaders\nThe mod does **not** work with most shaderpacks, but it does work with [Complementary Reimagined](https://modrinth.com/shader/complementary-reimagined).\n\n\n![Screenshit with comp reimagined](https://user-images.githubusercontent.com/57519662/207485708-534ad8fd-72eb-4204-a754-985edaaf2c24.png)\n\n![Screemshot with comp 2](https://cdn.modrinth.com/data/gsJ6q45e/images/e45c65407bd261ee22c5463a4c150c92b25ceed3.png)\n", + "body_url": null, + "published": "2022-12-14T02:05:34.952053Z", + "updated": "2024-08-10T22:40:21.645864Z", + "approved": "2022-12-14T02:40:12.167450Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 493229, + "followers": 258, + "categories": [ + "decoration" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "ZkaEucRs", + "io1rsYBu", + "H5Ele4qS", + "kb2tUglM", + "lXB1YslW", + "Uo4tUZp5", + "ROTwIP94", + "Idn769rZ", + "xT2o0hVR", + "tbPwOgs4", + "CJ15oCV4", + "rqUnNZqs", + "kVhUpOEJ", + "t3LWdUoC", + "yXeNzZP9", + "NcLxV3wa" + ], + "icon_url": "https://cdn.modrinth.com/data/gsJ6q45e/632d0495ffc026606f191768ec5d5fcf72f813ac.png", + "issues_url": "https://github.com/ZtereoHYPE/nicer-skies/issues", + "source_url": "https://github.com/ZtereoHYPE/nicer-skies", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/gsJ6q45e/images/65b3fc281c94c119b3f7a89e7fb27e2026c7ff10.png", + "featured": false, + "title": "Nebulas, vanilla", + "description": "Nebulas look really good even when no shader is running!", + "created": "2022-12-14T02:26:09.596200Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/gsJ6q45e/images/a1dafd84c90753a9a92ff1f2d0d01bc62c2f3a96.png", + "featured": false, + "title": "Rainbow sky", + "description": "A subtle, customizable rainbow effect is added as base to the sky.", + "created": "2022-12-14T02:27:04.003572Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/gsJ6q45e/images/a5f425ae1e5a469dc5997f91b1f9f535cb4e3021.png", + "featured": false, + "title": "Rainbow nebulas", + "description": "A nice coincidence", + "created": "2022-12-14T03:06:52.039627Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/gsJ6q45e/images/e45c65407bd261ee22c5463a4c150c92b25ceed3.png", + "featured": true, + "title": "Nicer Skies plus Complementary", + "description": "Complementary Reimagined's aurora borealis look amazing when combined with Nicer Skies' nebulas.", + "created": "2022-12-14T02:25:24.021308Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/gsJ6q45e/images/640a9e25093cae59465303193da25f51a1f26bc3.png", + "featured": false, + "title": "Config", + "description": "The configurability of the mod is quite high, and individual features are toggleable.", + "created": "2022-12-14T03:12:11.642917Z", + "ordering": 4 + } + ], + "color": 1381673, + "thread_id": "gsJ6q45e", + "monetization_status": "monetized" + }, + "NoChatReports-FABRIC-1.20.1-v2.2.2": { + "client_side": "optional", + "server_side": "optional", + "game_versions": [ + "1.19", + "1.19.1-pre2", + "1.19.1-pre3", + "1.19.1-rc2", + "1.19.1", + "1.19.2", + "22w44a", + "22w46a", + "1.19.3-pre2", + "1.19.3-pre3", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "qQyHxfxd", + "slug": "no-chat-reports", + "project_type": "mod", + "team": "x70byLOw", + "organization": null, + "title": "No Chat Reports", + "description": "Makes chat unreportable (where possible)", + "body": "# No Chat Reports\n\n\"curseforge\" \"modrinth\" \"github\" \"gitlab\"\n\nThis mod strips cryptographic signatures which are attached to every chat message sent from 1.19 and onwards. Removing them makes it impossible to track and associate your chat messages with your Minecraft client, and, by extension, Microsoft account.\n\n**As of 1.19.1, it also disables Player Chat Reporting**\n\nPlease notice that, while I am aware of [Guardian](https://github.com/nodusclient/guardian) and certain other exploits that allow you to counteract reporting systems on the client against the will of the server, I am consciously choosing to not integrate them as part of this mod. No Chat Reports will only remain effective on the client side if the server allows it to be. If you do not like servers that enforce chat signing and fully support chat reporting - I advise to simply not play on them.\n\nAlso, while there are many plugins out there that \"borrow\" the name and even icon of NoChatReports, please be aware that **I have not authored any of them** and cannot say how well they do their job.\n\n## Installation and Usage:\n\nNoChatReports supports both Fabric and Forge, just download the version for your respective modloader and game version. It can be installed on either the client, server, or on both sides, and will function differently depending on which sides it is present on:\n\n**1. Only Client:** The client will refuse to send the account's public key to the server, and signatures will be stripped from the messages that you send. This way it won't be useful to try and report your messages, as there will be no proof that they were actually sent from your account. The server will relay them unless the `enforce-secure-profile` option is set to `true` in the `server.properties` file (which it is by default since 1.19.1)\n\nIf the server does require you to sign messages and you are on either 1.19.1 or 1.19.2, you will not be able to join the server unless you agree to send signed messages (NoChatReports will supply a warning screen), if you are on 1.19.3 or higher, you will still be able to join the server, but will not be able to use chat-related commands (other commands do still work)\n\n**2. Only Server:** Clients will still attach signatures when sending messages to the server, but the server will strip them before relaying them to other players. This way chat reporting will not work for any players that join. You can enable the conversion of player to system messages in the config, to prevent players without the mod from seeing them as \"Not Secure\"\n\nAs of 1.20.2 the server cannot disable the \"unsigned messages\" warning on the client. It can only be disabled if the client has NoChatReports (or a similar mod) installed.\n\n**3. Both Client and Server:** Signatures will be stripped on the client side before sending messages to the server, which will not attempt to verify message signatures. Chat reporting and \"Only Show Secure Chat\" will not function, and players will be notified that those features are disabled by the mod when trying to use them.\n\nAlthough NoChatReports can function when it is only present on one of either sides, NoChatReports can be configured to demand itself to be installed on the respective other side in order to play. This way you can install it on the server and require all clients that join to have NoChatReports installed, but you can also leave it server-only if you prefer.\n\nAdditionally, if installed on the client, NoChatReports will disable Telemetry (similar to what [No Telemetry](https://modrinth.com/mod/no-telemetry) does).\n\nTo make sure that your server is compatible with NoChatReports, you can take a look at [this part of the wiki](https://github.com/Aizistral-Studios/No-Chat-Reports/wiki/Protecting-Server-Players).\n\n## Configuration\n\nThe configuration files are located in the `NoChatReports` subfolder of the default config folder.\n\n`NCR-Client.json` stores Client-Side settings\n\n`NCR-Common.json` stores Server-Side settings\n\n`NCR-Encryption.json` stores Chat Encryption settings (Only effective on the client)\n\n`NCR-ServerPreferences.json` stores Per-Server Signing Modes\n\nYou can find more information [here](https://github.com/Aizistral-Studios/No-Chat-Reports/wiki/Configuration-Files/).\n\n## Chat Encryption\nI have put together a video dedicated to Chat Encryption, watching it will help you to learn how it is used (and whether you should): https://www.youtube.com/watch?v=e7RzNP32k-s\n\n## Documentation:\nYou can find documentation and other information relevant to this mod on the [wiki](https://github.com/Aizistral-Studios/No-Chat-Reports/wiki/). It currently features the following articles:\n- [Configuration Files](https://github.com/Aizistral-Studios/No-Chat-Reports/wiki/Configuration-Files/)\n- [Protecting Server Players](https://github.com/Aizistral-Studios/No-Chat-Reports/wiki/Protecting-Server-Players/)\n- [How to Get Safe Server Status](https://github.com/Aizistral-Studios/No-Chat-Reports/wiki/How-to-Get-Safe-Server-Status)\n- [I Got Banned!](https://github.com/Aizistral-Studios/No-Chat-Reports/wiki/I-Got-Banned)\n- [To Encrypt or Not to Encrypt](https://github.com/Aizistral-Studios/No-Chat-Reports/wiki/To-Encrypt-or-Not-To-Encrypt)\n- [The Realms Question](https://github.com/Aizistral-Studios/No-Chat-Reports/wiki/The-Realms-Question)\n\n\n## For Developers:\nIf you develop your own mod, plugin or other server software that in some way prevents chat reports, you can make clients with No Chat Reports installed recognize servers running your software as safe. I wrote [a small article](https://github.com/Aizistral-Studios/No-Chat-Reports/wiki/How-to-Get-Safe-Server-Status) about this. For clarification or further inquiries - contact me via Discord, link in \"External resources\".\n\n## Reasoning:\nSee my videos for an explanation of how message signatures and chat reporting work in the game, their failures and the reasoning behind the creation of this mod:\n1. https://www.youtube.com/watch?v=hYAUEMlugyw\n2. https://www.youtube.com/watch?v=DobmW1ZUcbQ\n3. https://www.youtube.com/watch?v=gH_q7ZuCJs0\n\n![image](https://www.bisecthosting.com/partners/custom-banners/af63cb17-c373-4c82-aa1d-29beb7b045a9.png)\n", + "body_url": null, + "published": "2022-06-17T13:03:46.492544Z", + "updated": "2024-06-18T14:34:36.210085Z", + "approved": "2022-06-17T13:03:46.492544Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "WTFPL", + "name": "Do What The F*ck You Want To Public License", + "url": null + }, + "downloads": 5067574, + "followers": 1939, + "categories": [ + "social", + "utility" + ], + "additional_categories": [ + "management" + ], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "pRgCDYtw", + "s83qSm91", + "XGQE5ktC", + "16e8lk1A", + "DJNJAvHB", + "kodO6CeD", + "o3Zu7vcR", + "s3QkQ01m", + "K5sfN6kP", + "GC62LXpM", + "SDIvxcje", + "iGz16nLR", + "UMsMX5f7", + "vYYMSvvr", + "UjWkOEop", + "YP1Bvh5Q", + "ykNDJ4WP", + "9iRlnZpN", + "dfZAp75Y", + "zTkuPqOt", + "UkQiYhwR", + "zVlP4vdB", + "8ue01Exl", + "rOI1ANDq", + "uJhFe0Kq", + "BWAvwW90", + "rXxCyl6n", + "zIWbmhXX", + "B9SS9tTF", + "At4xtanF", + "9tXNucJ0", + "MGvwj3MP", + "Yyr5pYIN", + "USEfzIcD", + "oy4RFPoP", + "yA0P3rUR", + "1JWAJNwU", + "KXGjfvHh", + "sNRLZnRT", + "pF0TYyQC", + "IrGoPphV", + "OrXrGI5d", + "CrvlUGPx", + "StuWhjPJ", + "yS8NKenN", + "BU8QElye", + "ucC1vIsg", + "Wm1SFNqx", + "So65BYOD", + "66qMjbSN", + "Umu1VOxj", + "Q2AEYxBh", + "A7bdmpUO", + "KrZknjrr", + "cqoG4JIX", + "gJAwS64G", + "nrerhsQu", + "xpwVze9f", + "q0XDVXeR", + "JVDNDI82", + "C99rusYh", + "RNAG69Zu", + "YuX53PIA", + "cljC8222", + "B7O7rVEe", + "RXSZRYPW", + "LVpBaVhB", + "g2k50qYw", + "xHhqhG12", + "uVt4LKvF", + "mrRw7TK3", + "8Jd0cqU9", + "6yybObpX", + "UB0mRick", + "YmpISKQO", + "h1AaG3zP", + "uQKpLbmT", + "S6YbzrXY", + "9vFakLOL", + "qhuGllEs", + "nfxwmQJ5", + "RNWu4N8d", + "W0uZgLbW", + "RFhAU18Z", + "CK4psiMq", + "9jtKRSoF", + "REOULxph", + "1baGRS61", + "TbKB6mYU", + "HeZZR2kF", + "ksEG6N5E", + "OxA0julc", + "Gk4NusG9", + "xQyq2W5g", + "UU9nhfG5", + "wNxZxzWL", + "7MEdPNQb", + "tfv6A4l5", + "t4a6hnh0", + "qCjTB3QT", + "8in98lj4", + "HwNwwuel", + "Pjto4zdj", + "bPrydFzj", + "moDg7oc2", + "FMAZBsZw", + "qAhiKdLr", + "WUjGY2K1", + "MNkuIjea", + "1gaM0U2g", + "cvzZDpf1", + "riMhCAII", + "dh2iZIOd", + "erQc5yMt" + ], + "icon_url": "https://cdn.modrinth.com/data/qQyHxfxd/icon.png", + "issues_url": "https://github.com/Aizistral-Studios/No-Chat-Reports/issues", + "source_url": "https://github.com/Aizistral-Studios/No-Chat-Reports", + "wiki_url": "https://github.com/Aizistral-Studios/No-Chat-Reports/wiki", + "discord_url": "https://discord.gg/fuWK8ns", + "donation_urls": [ + { + "id": "bmac", + "platform": "Bmac", + "url": "https://www.buymeacoffee.com/aizistral" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/qQyHxfxd/images/d2fd2d053eebb07c6921a2024855906ea158085b.png", + "featured": true, + "title": "Icons on the chat view", + "description": null, + "created": "2022-12-16T18:24:22.776044Z", + "ordering": -20 + }, + { + "url": "https://cdn.modrinth.com/data/qQyHxfxd/images/39e25112fdf0a7d14556cda04c9865274cc0c03a.png", + "featured": false, + "title": "Chat Signing Requested", + "description": null, + "created": "2022-12-16T18:47:36.138982Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/qQyHxfxd/images/3fd824b6fa8bd0ea02bb05da1f6576f2ffcea8bd.png", + "featured": false, + "title": "Encryption", + "description": null, + "created": "2022-12-16T18:54:55.662918Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/qQyHxfxd/images/ccbc69a8f5cec0cd95c6bd9e6e3134782b86cea8.png", + "featured": false, + "title": "Unintrusive state", + "description": null, + "created": "2022-12-16T18:54:54.848387Z", + "ordering": 0 + } + ], + "color": 12250606, + "thread_id": "qQyHxfxd", + "monetization_status": "monetized" + }, + "Obscure-API-16": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.18.2", + "1.19.2", + "1.20.1" + ], + "id": "fU7jbFHc", + "slug": "obscure-api", + "project_type": "mod", + "team": "TbsfsJTA", + "organization": null, + "title": "Obscure API", + "description": "Auxiliary Library", + "body": "####
Obscure API is a core for other Obscuria Collection mods.
\n
\n\n##
Obscuria Collection Mods
\n\n
\n

\n

\n

\n

\n

 

\n
\n\n#
Sponsored by [NameHero](https://nhtrx.com/?a=1494&oc=54&c=209&p=r&s1=)
\n\n####
Need your own server to play with friends? NameHero provides amazing hosting services with automatic server setup for any game version and an easy-to-use control panel for advanced customization. Create your own server in 5 minutes without any technical knowledge!
\n\n
", + "body_url": null, + "published": "2023-04-21T11:42:19.100394Z", + "updated": "2024-07-17T11:50:56.068228Z", + "approved": "2023-04-22T17:26:35.115877Z", + "queued": "2023-04-21T12:04:32.170631Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 527923, + "followers": 83, + "categories": [ + "library", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "IEvVWdUR", + "1MoKZMi2", + "4HdrESYC", + "phjhLqIP", + "IWDYxZre", + "FizVdYUp" + ], + "icon_url": "https://cdn.modrinth.com/data/fU7jbFHc/f0a6e137f945eb676d46f6aec31681fe288d0ca9.png", + "issues_url": "https://discord.gg/By29HCKgPx", + "source_url": null, + "wiki_url": null, + "discord_url": "https://discord.gg/jSHHJSUWdY", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/Obscuria" + } + ], + "gallery": [], + "color": 10453460, + "thread_id": "fU7jbFHc", + "monetization_status": "monetized" + }, + "owo-lib-0.11.2+1.20": { + "client_side": "optional", + "server_side": "optional", + "game_versions": [ + "1.17", + "1.17.1", + "21w43a", + "1.18-pre8", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "ccKDOlHs", + "slug": "owo-lib", + "project_type": "mod", + "team": "SH3qQlP1", + "organization": "sirrPIOp", + "title": "o\u03c9o (owo-lib)", + "description": "A general utility, GUI and config library for modding on Fabric and Quilt", + "body": "![Header](https://i.imgur.com/dal6rrf.png)\nA general utility, GUI and config library for modding on Fabric and Quilt\n\u00a0\n***\n\nFeatures include:\n\n - [owo-ui](https://docs.wispforest.io/owo/ui/), a fully-featured declarative UI library for building dynamic, beautiful screens with blazingly fast development times\n\n - [owo-config](https://docs.wispforest.io/owo/config/), a built-in, customizable configuration system built on top of owo-ui. It provides many of the same features as [Cloth Config](https://modrinth.com/mod/cloth-config) while many new conveniences, like server-client config synchronization, added on top\n\n - A fully automatic [registration system](https://docs.wispforest.io/owo/registration/) that is designed to be as generic as possible. It is simple and non-verbose to use for basic registries, yet the underlying API tree is flexible and can also be used for many custom registration solutions\n\n - [Item Group extensions](https://docs.wispforest.io/owo/item-groups/) which allow for sub-tabs inside your mod's group as well as a host of other features like custom buttons, textures and item variant handling\n\n - A fully-featured [networking layer](https://docs.wispforest.io/owo/networking/) with fully automatic serialization, handshaking to ensure client compatibility and a built-in solution for triggering parametrized particle events in a side-agnostic manner\n\n - Client-sided particle helpers that allow for easily composing multi-particle effects\n\n - Rich text translations, allowing you to use Minecraft's text component format in your language files to provide styled text without any code\n\n***\n\nowo is documented in two main ways:\n\n - There is rich, detailed JavaDoc throughout the entire codebase\n - There is a wiki with in-depth explanations and tutorials for most of owo's features over at https://docs.wispforest.io/owo/features/", + "body_url": null, + "published": "2021-09-30T20:46:31.667429Z", + "updated": "2024-07-28T22:46:19.874250Z", + "approved": "2021-09-30T20:46:31.667429Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 2459751, + "followers": 787, + "categories": [ + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "HyvkCi1L", + "4NeTD3y0", + "ERFRuuW5", + "IPVeGmcd", + "LmWOyXVW", + "flVS3RS0", + "PptbPV7y", + "1WqSpJvo", + "F6DR79FV", + "1E69wiMJ", + "eAlYR8cf", + "Jfd8qbEF", + "3Qzf5TkU", + "lT5Mm5fS", + "6LkUrYRt", + "vnSwwEYV", + "2QnmkZKc", + "q3Sxg4SA", + "i8cpzMnQ", + "GqwSx15g", + "aWqxWaL7", + "zVhs4uLj", + "WJsP5KWE", + "F4LqV8lu", + "aXMVV7gj", + "uAXx21D1", + "C46ht027", + "HqAtE0un", + "NzQ8iAeC", + "RV8F1iab", + "Dmqb8GqA", + "bJtMgK25", + "lEVNuJ3B", + "fr6mJFIx", + "JX2OM2ED", + "2yMO9WGE", + "yGLYmVnT", + "gsbvHClE", + "LI7k719Y", + "KMwbSA7v", + "gmwB5dLB", + "ORA8RfoA", + "T8DsELMD", + "5QgPEzLH", + "beTZr7PG", + "DgIYuFEF", + "m23n3uIM", + "zyOBB7J4", + "oLoJCrky", + "DYgDdRtg", + "rGwQL6vN", + "9NFjhCIH", + "LWhxwhvI", + "HYGIKGSR", + "HEZ55HbJ", + "CJ29u2GJ", + "Her7Z3CG", + "ueejHgQH", + "cFeG2MJS", + "5qH0boef", + "gizS7nlP", + "1fKeD2p9", + "AVkXApBi" + ], + "icon_url": "https://cdn.modrinth.com/data/ccKDOlHs/icon.png", + "issues_url": "https://github.com/glisco03/owo-lib/issues", + "source_url": "https://github.com/glisco03/owo-lib", + "wiki_url": null, + "discord_url": "https://discord.gg/xrwHKktV2d", + "donation_urls": [], + "gallery": [], + "color": 263172, + "thread_id": "ccKDOlHs", + "monetization_status": "monetized" + }, + "oxidized-1.8.2": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.20.1" + ], + "id": "wOZRkmgG", + "slug": "oxidized", + "project_type": "mod", + "team": "V2irbGdB", + "organization": null, + "title": "Oxidized", + "description": "Adds more uses for vanilla copper", + "body": "*Oxidized aims to provide more uses for vanilla copper. Each feature is designed so that it could fit with or stay close to vanilla Minecraft.*\n\n\u00a0\n\nAbout:\n\n\u00a0\n\n**Copper Pulsar**: This item is an electromagnet-inspired tool. While in the player's inventory, the pulsar will allow you to pick up experience orbs and items from up to x10 farther than the normal pickup range. It can be toggled on and off using right-click.\n\n\u00a0\n\n**Copper Rail**: The Copper Rail functions almost identically to the Powered Rail. The difference is that a chain of connected copper rails can stay powered for up to 100 blocks as compared to 8 blocks with the Powered Rail.\u00a0\n\n\u00a0\n\n**Vertical Cut Copper**: Vertical cut copper is a building block that is designed like a copper block with a line through the middle. This is inspired off of the original cut copper design that was later changed in the full release. Vertical cut copper can oxidize like normal copper but waxing it with a honeycomb can stop this process.\n\n\u00a0\n\n**Copper Kiln**: The Copper Kiln is a new unique furnace type. This kiln can smelt cobblestone, clay, sand, and logs at extremely fast speeds. The kiln is meant for obtaining terracotta, bricks, stone, charcoal, and glass for building quickly. It functions like the smoker and blast furnace.\n\n\u00a0\n\n**Copper Lantern**: Copper Lanterns are a new lantern type that emits a green flame. They can be crafted with 8 copper nuggets around a single torch. Copper lanterns function the same as normal lanterns. (Copper nuggets are obtained by putting a copper ingot in a crafting table)\n\n\u00a0\n\n**Rose Gold Tools**: Rose Gold is a new tool material that can be made in a smithing table. Rose gold does not have an actual ingot as it is crafted with a gold tool and a copper ingot in a smithing table. Rose gold tools provide a similar durability and mining level to Iron tools but they are as fast and enchantable as gold tools.\u00a0\n\n\u00a0\n\n**Copper Pan**: The Copper Pan is a unique block that allows the player to passively pan for resources such as clay and iron nuggets. The pan will only work if it is placed in water and on a sand or gravel block. Over time the pan will sift and release items it finds. The current loot pool includes:\u00a0Iron Nugget (15%), Gold Nugget (15%), Sand (24%), Emerald (2%), Gravel (12%), Clay Ball (32%).\u00a0The speed at which the pan finds items is relative to the random tick speed.\n\n\u00a0\n\n**Copper Golem**: The Copper Golem is a mob based on the Minecraft Mob Vote 2021. It can be created by placing a copper/cut copper block on the bottom, a carved pumpkin in the middle, and a lightning rod on top. The golem will wander around and can press copper buttons nearby (Copper Buttons have been added but are not yet obtainable in survival). Copper Golems will oxidize over a long period of time, but will walk toward lightning rods in thunderstorms, and will unoxidize when struck.\u00a0\n\n\u00a0\n\n**Copper Trap**: The Copper Trap is a bear trap-like block that can be placed down. It is crafted with 6 copper ingots and 2 flint. When stepped on, the trap deals 5 damage and stops the victim from moving away. The trap will open back up after closing for 3 seconds. It can be toggled manually by right-clicking or with redstone (levers, buttons, etc).\n\n**[1.19.3+] Copper Barometer**: The Copper Barometer is a weather prediction tool crafted with copper ingots, redstone, and glass. When right-clicked, the barometer will provide you with information about the upcoming weather or when the current precipitation will end.\n\n![Block display](https://media.discordapp.net/attachments/886609056624672818/930592340509331576/2022-01-11_17.02.00.png)\n![Kiln and golem display](https://media.discordapp.net/attachments/886609056624672818/930592340094091354/2022-01-11_17.04.02.png)\n\nCredits:\n\nCredit to zacthornetv for the rose gold tool textures", + "body_url": null, + "published": "2022-11-13T02:21:06.505739Z", + "updated": "2023-09-29T01:02:15.487815Z", + "approved": "2022-11-13T02:39:53.209596Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "GPL-3.0-only", + "name": "GNU General Public License v3.0 only", + "url": null + }, + "downloads": 148732, + "followers": 55, + "categories": [ + "utility" + ], + "additional_categories": [ + "equipment", + "technology" + ], + "loaders": [ + "fabric" + ], + "versions": [ + "FCaRDY2q", + "dH4eImYJ" + ], + "icon_url": "https://cdn.modrinth.com/data/wOZRkmgG/c0680332bcc2b096321469338bb5aa171c12bc39.png", + "issues_url": "https://github.com/Safrodev/oxidized/issues", + "source_url": "https://github.com/Safrodev/oxidized", + "wiki_url": null, + "discord_url": "https://discord.gg/muAnYRGXrq", + "donation_urls": [], + "gallery": [], + "color": 680764, + "thread_id": "wOZRkmgG", + "monetization_status": "monetized" + }, + "packetfixer-fabric-1.4.2-1.19-to-1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.15", + "1.15.1", + "1.15.2", + "1.16.5", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "c7m1mi73", + "slug": "packet-fixer", + "project_type": "mod", + "team": "3h9GHUuw", + "organization": null, + "title": "Packet Fixer", + "description": "A simple mod to solve various problems with packets.", + "body": "# Packet Fixer\n#### Visit my discord server: [Link](https://discord.com/invite/vWBP4P4Yd8)\n\n## Description\nThis mod fixes various package erros. This mod could be used in mod packs for increasing the number of mods.\n\n### The mod is required in Client and Server sides.\n\n### Fix these problems:\n - Tried to read NBT tag that was too big; tried to allocate: X bytes where max allowed: 2097152\n - Badly compressed packet - size of X is larger than protocol maximum of 2097152\n - Attempted to send packet over maximum protocol size: 8388608\n - Packet too big (is X, should be less than 8388608)\n - Payload may not be larger than 1048576 bytes\n - Payload may not be larger than 32767 bytes\n- Unable to fit X into 3 [Delete Krypton and Pluto]\n\n### Other problems:\n - VarInt too long [Try deleting Krypton and Pluto in both sides]\n\n### Feel free to use this mod on your modpack", + "body_url": null, + "published": "2022-11-02T15:48:56.445113Z", + "updated": "2024-08-08T19:50:55.816242Z", + "approved": "2022-11-02T22:51:52.100958Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 1256948, + "followers": 229, + "categories": [ + "optimization", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "KrYK51hs", + "rumABPUL", + "4kbhLeKH", + "ehfrmyzX", + "Xiglwlhe", + "TvFOPWRk", + "LCOVIXhr", + "5uCjJxMh", + "xKk4pRKH", + "3WsYJSnY", + "b7qBy1IR", + "5gW2Rjgi", + "4pE0HBuZ", + "Qd0SL5KE", + "y9mjVgll", + "qrnlinvD", + "mZ7svdbk", + "HQPp3gkT", + "HFx5pgji", + "ZmLSry2o", + "6DcnXIFl", + "Cf3ahUrH", + "P5mDWk1L", + "GnRymsbd", + "XzGs4vE4", + "AqIKFRPb", + "ujzfiX1N", + "ce9ACQ6A", + "ysAVqBEk", + "UyCVTPpp", + "ZMbV7iJx", + "6OPG3AV9", + "RRw3dwRY", + "20MjzfDT", + "F5jTIyvu", + "lMOrjT68", + "SxbVTgCQ", + "c3qAXNpi", + "AnLM61ML", + "9v7LQvXO", + "kN3zkQD6", + "i3HXV5Bt", + "QYg6igKu", + "duQrfKp7", + "Pki0CKke", + "cxOIWXLY", + "C4dtP6qQ", + "eRK91zA7", + "xhgHWQvk", + "rM3wr4Dy", + "Axmc9Mzp", + "oLepBk3r", + "lSGnX38P", + "yoI4Fdca", + "1gPZDLmO", + "yfRLCikG", + "xRGgbwJb", + "aenyVoF2", + "A5KrUVIq", + "dDOH3KWN", + "8bj40YXn", + "fTRkThTU", + "ttAeYO15", + "BxUoA0uh", + "RtQaisZb", + "bKBw65oL", + "f75PLfQx", + "HVWcALAD", + "AqnK2Diz", + "hBrpREnU", + "vlBViygw", + "jmDzKrKx", + "m7PLwvPj", + "rhFBFhqD", + "bnkstjYB", + "GhjTMy2P", + "n1eNOccz", + "G4fdq2jq", + "oSlYXwuf", + "c1cvvEIg", + "KhCHoSOq", + "IZNtQmoE", + "6NR5I5Et", + "snTbytxX", + "c3gzSHWz", + "9VX0pLkm", + "U21lEjPQ", + "oxCLPSOQ", + "P6FhtVP0", + "IYQiLpB2", + "JkJGuxMQ", + "PMtgPYvA", + "dMV10V8l", + "PH1R0KAU", + "ZMmv6adN", + "9xINmOHj", + "8wEyZTO7", + "nEQ35W8u", + "Ru0S7GxO", + "ag3s8giS", + "13HDOOrO", + "xnVyQhUu", + "XsVEn1q3", + "GVK9LmKE", + "jIp92PRV", + "UpGKfdB6", + "qX0tYFVi", + "uTJ5Z1eA", + "1NW4ifKP", + "B8zAj2y5", + "GvV0zGAn", + "CS5CtmiB", + "AoJLYcrr", + "lnjo3cnX", + "qDDRfx0Z", + "o1DqRVkZ", + "V7P4D29I", + "vxZXdQPK", + "1C71V7ox", + "eLvhoAZV", + "YSPhKnkW", + "qkMcaGC3", + "nLJfZb9u", + "6sjS8ir8", + "SFPTZwpj", + "JOVeMKn1", + "5hGYgb7h", + "yR8PqsYi", + "hG2vbFyB", + "Fo5tDN9U", + "8SP8RPCJ", + "y35unqMR", + "4OZagh4Q", + "4DxBAFyv", + "FTpvwP7Y", + "gp9Jhr10", + "4M9TryBf", + "bUA7F3FM", + "LsbcnO2r", + "jbdLdXl5", + "1v4d6y2E", + "K5NWN9z1", + "hTkMr34N", + "skM2Il9Z", + "fTvjsf3s", + "RmPqhNVt", + "FdhPha6V", + "ApOlD7Rb", + "HSJpJ79B", + "zGvwYXqf", + "qVZNFcmM", + "udYFv2Wr", + "cjtJ98PS", + "bCaE1IOH", + "GZ7OwUP6", + "Ls9lbDWJ", + "nLLbnxQK", + "pranUYed", + "J9XnTmJm", + "LB27JzEU", + "6J7yoXIo", + "n2sp3ViA", + "BkukMVPb", + "yIvRCphu", + "OQZ53gNy", + "S045Pr2H", + "WbQXm0Jk", + "m6ATzsgM", + "lUcsxCsq", + "ICuDdsvy", + "yEq7xXal", + "Z8XYKAPD", + "p9T9EHEI", + "gBrUedv3", + "9uC6CjRh", + "jFEwrg6p", + "DXjswlSN", + "UHy42Yj6", + "BE0Ob5r8", + "wxgjUM2S", + "R40LxokH", + "nJz9QYfN", + "UfBoKgpf", + "b8uecikq", + "RDDvZ4Nb", + "3SZJwIvQ", + "1qrGfoq0", + "GLQy5J5w", + "s7vQt2ds", + "D6g6pRom", + "So2Pt1Vd", + "dwqnywwC", + "8n4f1eS1", + "2Zq05aJL", + "4bmmbmbD", + "IhuirF4Y", + "QkFVCAHt", + "ZZUQORkl", + "ubMhQRfo", + "4o2LdJQ4", + "B0d52bMy", + "WfXOmIn7", + "82g0NeuH", + "Ero7kHKR", + "cevUbwSL", + "RauuTSsU", + "c9FrPdaF", + "1MkvOJt5", + "GNRSKPtC", + "VdbzOdOa", + "ke2p1rNE", + "RPeFHDpM", + "St3Atrdc", + "q7EMXbgp", + "WRC9LA4W", + "fXSABluO", + "uL0XmkIb", + "mI65iIpu", + "ilnXUGK4", + "ut9YVkeZ", + "GrNqDfmb", + "7WuRGQQE", + "jz6U5maR", + "r0F72hgb", + "djNw6g8u", + "AScUisZl", + "3XG0IkDO", + "zJj4G0EB", + "4qX7Fy1t", + "TYRWxAsC" + ], + "icon_url": "https://cdn.modrinth.com/data/c7m1mi73/388af00d61fa57e7e10612bcc099bf6ee0794e5e.png", + "issues_url": "https://github.com/TonimatasDEV/PacketSizeDoublerForge/issues", + "source_url": "https://github.com/TonimatasDEV/PacketSizeDoublerForge", + "wiki_url": null, + "discord_url": "https://discord.gg/vWBP4P4Yd8", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/tonimatasdev" + } + ], + "gallery": [], + "color": 5526612, + "thread_id": "c7m1mi73", + "monetization_status": "monetized" + }, + "paladins-1.3.1+1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.20.1" + ], + "id": "FxXkHaLe", + "slug": "paladins-and-priests", + "project_type": "mod", + "team": "x1kwxTGx", + "organization": null, + "title": "Paladins & Priests (RPG Series)", + "description": "\u2728 Protect and heal your friends as a Paladin or a Priest", + "body": "![](https://cdn.modrinth.com/data/FxXkHaLe/images/d165bd7ffd0926e16b2e3ef66ee1ef2dfb600438.png \"\")\n\n------------------\n[![Modloader](https://img.shields.io/badge/Loader-Fabric-ecebe6?labelColor=263768&style=for-the-badge)](https://fabricmc.net)\n[![Connector](https://img.shields.io/badge/Forge-via_Sinytra_Connector-orange?style=for-the-badge)](https://modrinth.com/mod/connector)\n[![Discord](https://img.shields.io/discord/973561601519149057.svg?label=&logo=discord&logoColor=ffffff&color=7389D8&labelColor=6A7EC2&style=for-the-badge)](https://discord.gg/KN9b3pjFTM)\n\n### \u2728 Discover more of the RPG Series\n\n[![Archers](https://cdn.modrinth.com/data/XIpMGI6r/images/cd19a95a79f1157b33f31818aa615a280b206912.png \"Archers\")](https://modrinth.com/mod/archers \"\")\n[![Wizards](https://cdn.modrinth.com/data/XIpMGI6r/images/a7da965aa108daf95c10448c01423be49ce2338d.png \"Wizards\")](https://modrinth.com/mod/wizards \"\")\n[![Rogues](https://cdn.modrinth.com/data/XIpMGI6r/images/278d8c941af6dc763cf714b9f36f8b8366a60eb9.png \"Rogues\")](https://modrinth.com/mod/rogues-and-warriors \"\")\n[![Jewelry](https://cdn.modrinth.com/data/XIpMGI6r/images/747102d582732b8defa50a2c925c7d5a6f87d009.png \"Jewelry\")](https://modrinth.com/mod/jewelry \"\")\n\n\n# \ud83d\udce6 Installation\n\n### Required\n\n- [AzureLib Armor](https://modrinth.com/mod/azurelib-armor \"\")\n- [Runes](https://modrinth.com/mod/runes \"\")\n- [Spell Engine](https://modrinth.com/mod/spell-engine \"\")\n\n### Strongly recommended\n- [Better Combat](https://modrinth.com/mod/better-combat \"\") for first person animations\n\n# \u2728\u00a0Features\n\n## Get started\n\nTo become a Paladin, pick up a Hammer, Mace (or any other melee weapon) to start your journey.\n\nTo become a Priest, obtain Holy **Wands** and **Staves**, these come with your first spell.\n\n**Runes** serve as ammunition for casted spells (much like arrows for bows).[More information about crafting runes.](https://modrinth.com/mod/runes \"\")\n\n![](https://cdn.modrinth.com/data/FxXkHaLe/images/1df567a32d618ede9c185731e6ef2dc14dcf9bc8.jpeg \"\")\n\n## Spell Books\n\nExpand your skillset with Spell Books, hosting additional spells.\n\nFind a Spell Binding Table in village [Gazebos](https://modrinth.com/mod/gazebos \"\"), or build your own (just don't forget bookshelves around the Spell Binding Table).\n\nTo unlock **Paladin** spells, create the **Paladin Libram** on the Spell Binding Table! (Use **any melee weapon** ot cast spells from the equipped Paladin Libram!)\n\nTo unlock **Priest** spells, create the **Holy Book** on the Spell Binding Table! (Use **Holy Staves** ot cast spells from the equipped Holy Book!)\n \n![](https://cdn.modrinth.com/data/FxXkHaLe/images/9ebdbf026495072ce076201c3531e7775963facf.png \"\")\n\n## Explore the armory\n\nExplore new, craftable, paladin and priest equipment, with bonuses to boost spell damage and healing.\n\nPaladins: new 2 armor sets, Claymores, Great Hammers, Maces.\n\nPriests: new 2 armor sets, Holy Staves and Wands.\n\nEquipment bonuses are configureable in `config/paladins/items.json`.\n\n![](https://cdn.modrinth.com/data/FxXkHaLe/images/8cd92ee279688162b0f80a4d0ccf8ae4732026f0.png \"\")\n\n\n## Extended dungeon loot\n\nFind paladin and priest equipment in dungeon loot chests!\n\nLoot table injections are configurable in `config/rpg_series/loot.json`.\n\n\n![](https://cdn.modrinth.com/data/FxXkHaLe/images/f5bf275a7b0b669f8848962da4a46777f86e6682.jpeg \"\")\n\n\n## New village structures\n\nFind Sanctuaries in villages, where Monk villagers sell magic equipment!\n\nThe spawn weight and limit are configureable in `config/paladins/villages.json`.\n\n\n![](https://cdn.modrinth.com/data/FxXkHaLe/images/4355c5cb23d019a91965325dd17ae58cd23952ae.jpeg \"\")\n\n\n# \ud83d\udd27 Configuration\nSpell casting mechanics and HUD can be configured under **Mod Menu / Spell Engine / Settings**.\n\u00a0\n# \ud83e\udd1d Integrations\n- \u2705 Better Combat\n- \u2705 BetterEnd - mod specific weapon\n- \u2705 BetterNether - mod specific weapons\n- \u2705 Merchant Markers\n- \ud83c\udfd7\ufe0f Graveyard - loot tables\n- \ud83c\udfd7\ufe0f Terralith - world gen", + "body_url": null, + "published": "2023-05-01T10:04:31.304046Z", + "updated": "2024-07-24T21:44:38.914985Z", + "approved": "2023-05-03T03:10:15.003522Z", + "queued": "2023-05-01T15:57:09.471772Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": { + "message": "Very cool! ", + "body": null + }, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 445079, + "followers": 399, + "categories": [ + "adventure", + "equipment", + "magic" + ], + "additional_categories": [ + "game-mechanics", + "worldgen" + ], + "loaders": [ + "fabric" + ], + "versions": [ + "LcbTxwgN", + "TkKUxGxG", + "PWgaDlXk", + "lhD9HRTX", + "AXqCaqsw", + "o1PnMrIN", + "HEWsdEap", + "oBiF9Q7J", + "qePeuSz8", + "cDkH9PyA", + "vPOIKUug", + "1YmpeDaT", + "uqsa542h", + "OL7gRLMQ", + "pUiX493b", + "zCnhTp58", + "U0NVFI7E", + "FXxePdAs", + "4VqFqNaz", + "vlhPTPNo", + "Kk8X9z55", + "JJbsnIhi", + "Yre7Qv03", + "r64hEfek", + "pfmb6sqN", + "MFqlocQN", + "C1rl8sGU", + "9FbzwRpY" + ], + "icon_url": "https://cdn.modrinth.com/data/FxXkHaLe/158f5452de05883ff8ded4f8ea1af2bb45284b4b.png", + "issues_url": "https://github.com/ZsoltMolnarrr/Paladins/issues", + "source_url": "https://github.com/ZsoltMolnarrr/Paladins", + "wiki_url": null, + "discord_url": "https://discord.gg/KN9b3pjFTM", + "donation_urls": [ + { + "id": "github", + "platform": "Github", + "url": "https://github.com/sponsors/ZsoltMolnarrr" + }, + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/daedelus" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/FxXkHaLe/images/1df567a32d618ede9c185731e6ef2dc14dcf9bc8.jpeg", + "featured": false, + "title": "Crafting", + "description": null, + "created": "2023-05-01T15:18:44.472956Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/FxXkHaLe/images/4355c5cb23d019a91965325dd17ae58cd23952ae.jpeg", + "featured": false, + "title": "Structures", + "description": null, + "created": "2023-05-10T20:21:31.059015Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/FxXkHaLe/images/8cd92ee279688162b0f80a4d0ccf8ae4732026f0.png", + "featured": false, + "title": null, + "description": null, + "created": "2024-07-08T17:44:52.476624Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/FxXkHaLe/images/9ebdbf026495072ce076201c3531e7775963facf.png", + "featured": false, + "title": "Spell Books", + "description": null, + "created": "2024-04-04T09:46:47.884241Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/FxXkHaLe/images/d165bd7ffd0926e16b2e3ef66ee1ef2dfb600438.png", + "featured": false, + "title": "new_logo", + "description": null, + "created": "2023-10-29T18:14:22.173350Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/FxXkHaLe/images/f5bf275a7b0b669f8848962da4a46777f86e6682.jpeg", + "featured": false, + "title": "Dungeon chests", + "description": null, + "created": "2023-05-01T15:18:57.790547Z", + "ordering": 0 + } + ], + "color": 7499619, + "thread_id": "FxXkHaLe", + "monetization_status": "monetized" + }, + "Patchouli-1.20.1-84-FABRIC": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.12.2", + "1.14.4", + "1.15.2", + "1.16.4", + "1.16.5", + "1.17.1", + "1.18.1", + "1.18.2", + "1.19", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20.1", + "1.20.4", + "1.20.6" + ], + "id": "nU0bVIaL", + "slug": "patchouli", + "project_type": "mod", + "team": "72JcM90m", + "organization": null, + "title": "Patchouli", + "description": "Accessible, Data-Driven, Dependency-Free Documentation for Minecraft Modders and Pack Makers", + "body": "[![](https://violetmoon.org/branding/vm0.png)](https://violetmoon.org)[![](https://violetmoon.org/branding/vm1.png)](https://patreon.com/vazkii)[![](https://violetmoon.org/branding/vm2.png)](https://twitter.com/vazkiimods)[![](https://violetmoon.org/branding/vm3.png)](https://discord.gg/vm)\n![](https://violetmoon.org/branding/hero/patchouli.png)\n\n---\n\n# About\n\n**Patchouli** is a mod that aims to provide easy to implement, data-driven documentation for minecraft modders and modpack makers alike.\n\nPatchouli's systems allow any modder or modpack maker to quickly create beautiful books full of user experience enhancing features. The user-facing feature set of the mod is designed in function of research done on what features people liked from Botania's Lexica Botania.\n\n---\n\n# Features\n\n* Data-driven content creation, no code required, you don't even need patchouli's code to build\n* In-game text preview\n* Rich text formatting system that supports macros\n* Advancement-driven content unlocking\n* Nested categories and bookmarkable entries for quick and easy navigation\n* Several ready-to-use page types like text, crafting and image pages\n* Multiblock visualization for easy building\n* Template system to create custom page types\n* Seamless integration with mods, with creative tab and pretending the book is from your mod\n* Custom visuals and sounds\n* Easily localizable for other languages\n* Tons of other user friendly features!\n\n---\n\n# Learn more about Patchouli today\n### Visit the **[Wiki](https://vazkiimods.github.io/Patchouli/)** to learn about how to use this in your mod or modpack\n\n---\n\n# Credits\n\nMassive shout out to the following people who helped this become a reality:\n\n* Drullkus for testing, providing some code, and the logo\n* Ellpeck for extensive testing and tons of help with fixing bugs\n* StanHebben, for extensive testing, lots of good feature requests, and also providing fair amount of code\n* wiiv, for creating the art I used \n\n---\n\n\n\n![](https://violetmoon.org/branding/support.png)\n[![](https://violetmoon.org/branding/patreon.png)](https://patreon.com/vazkii)[![](https://violetmoon.org/branding/store.png)](https://store.vazkii.net)\n[![](https://violetmoon.org/branding/ch.png)](https://violetmoon.org/creeperhost)", + "body_url": null, + "published": "2021-12-23T21:23:57.938115Z", + "updated": "2024-07-05T16:19:37.026032Z", + "approved": "2021-12-23T21:23:57.938115Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "CC-BY-NC-SA-3.0", + "name": "Creative Commons Attribution Non Commercial Share Alike 3.0 Unported", + "url": null + }, + "downloads": 2317411, + "followers": 647, + "categories": [ + "library", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "clOhZpKV", + "Bc62letg", + "YELVQSgP", + "I49wahSA", + "hOeuGyBc", + "AIocSIUP", + "7lEuKMXY", + "y5Iv4bvx", + "LLQZJV1E", + "bdOMmClI", + "OUi0L7mI", + "OfTGI9k6", + "lnWBMA5s", + "NfGlUTEX", + "YBbCmQdE", + "e8OPjNDT", + "b6yJCZbc", + "rgxH3b9S", + "pwPPKYN3", + "3nYm6JyE", + "oFXdEP6M", + "owlMYTOU", + "WZ0HMKHN", + "7hfShY6i", + "m3VnSBR9", + "9ocdD9Uo", + "OgM9g0zW", + "x2hqKA51", + "rJhsHi7U", + "expKhdK0", + "Dyqz3qo7", + "vCTStWON", + "VReLlKMv", + "yLlzynQ5", + "swxCEODj", + "4pBSxxGQ", + "8cbrvZZN", + "Ust5yPbd", + "1Cbhbli9", + "canbiioP", + "62ztr7HA", + "NorgAU8F", + "vU0HeQTe", + "uLqYYIHD", + "ajMDgDNM", + "VbKVW3Bi", + "PKvFvHeb", + "scPQNgN5", + "tzz6fEoj", + "YodpuIBJ", + "qXopWA1k", + "bxlh2STX", + "Up1ZGZ1f", + "73JPyBPI", + "ORmcsfvl", + "WLoCqsiV", + "Y6tuH1cn", + "JMtc0mTS", + "RRjoMz5N", + "f1ECC2xk", + "vdu73DZ0", + "ZHpyaRGe" + ], + "icon_url": "https://cdn.modrinth.com/data/nU0bVIaL/130922464c30a3a61eb493ce71d2502b23f29905.png", + "issues_url": "https://github.com/VazkiiMods/Patchouli/issues", + "source_url": "https://github.com/VazkiiMods/Patchouli/", + "wiki_url": "https://vazkiimods.github.io/Patchouli/", + "discord_url": "https://discord.gg/vm", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/Vazkii" + } + ], + "gallery": [], + "color": 4996647, + "thread_id": "nU0bVIaL", + "monetization_status": "monetized" + }, + "player-animation-lib-fabric-1.0.2-rc1+1.20": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.4", + "1.16.5", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3-rc3", + "1.19.3", + "1.19.4-rc2", + "1.19.4", + "23w13a_or_b", + "1.20", + "1.20.1", + "1.20.4" + ], + "id": "gedNE4y2", + "slug": "playeranimator", + "project_type": "mod", + "team": "f913Xl1r", + "organization": null, + "title": "playerAnimator", + "description": "animate the player", + "body": "# Player animation library, \n## animate the player using keyframes.\n\n\nFor users/modpack devs, just put the jar into the mods folder. \n\nFor mod developers, you may find more details [here - KosmX/PlayerAnimator](https://github.com/KosmX/fabricPlayerAnimation) \n\nIt might use [bendy-lib](https://modrinth.com/mod/bendy-lib) for extra good animations. \n\n", + "body_url": null, + "published": "2022-08-11T21:42:36.070921Z", + "updated": "2024-01-13T16:55:42.890816Z", + "approved": null, + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 2089697, + "followers": 468, + "categories": [ + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "THOZNRoE", + "YU7uPmWH", + "F02Nxp0g", + "UDV0nxPw", + "9OlNd8ki", + "5WK3RhA3", + "R4N5ypa8", + "eOvttFV4", + "pOowsj5K", + "Hpo6Zg71", + "9oJv3LkS", + "nOiIFWTh", + "osHH9s8H", + "76BApM7H", + "Czzt9eKT", + "TdeQTpS0", + "jJe1lq0j", + "CSbuU2Gq", + "pUKhhKMt", + "GJMlTjP2", + "wTKnVu2g", + "Cq1UTXSp", + "pY9pqJiM", + "6iF3Ls0k", + "pRXTNKwW", + "fPXFzjec", + "bwPxeXJu", + "cQT9frKV", + "pMH5RdCh", + "cEAuVfqv", + "J6QSvhtw", + "WbrEEJ3N", + "cdx0himd", + "U09iTtvu", + "3mSZprpI", + "WAX5DL1e", + "aesl8Jxi", + "32VUPjib", + "18n5aQLY", + "CIiQhJn2", + "qCZpilj8", + "Qd4FjY04", + "AH5brgNg", + "aacwsKxg", + "u2YZN5qk", + "RYYvz0bV", + "J5RIGaS3", + "9iFJBTMG", + "2gqws5Cn", + "76L16qTG", + "ncM3Ynss", + "J9WIErYr", + "HJVnaNVl", + "4zF2vOhz", + "80yvONMg", + "JnvSnbAn", + "aaz6UsqG", + "s1Gs1RRk", + "w2N1QNQH", + "YMQRB7Wh", + "U34MtBQJ", + "lofdWspI", + "AgTWc5Fa", + "E1zFlrZp", + "tBibpiwv", + "gjfICiaj", + "lOeO23c3", + "4N2FD8jo", + "jHIScPki", + "jzuEXFAI", + "PLDhaAs8", + "mQLnpnUD", + "4PpXiiks", + "T6IJcbh3", + "4FDGNCQU", + "OgndJbvZ", + "TPE7Y670", + "le78RhEJ", + "blp8J65W", + "NDPOdXWf", + "CHf7i67V", + "izY0Y4nM", + "x2m0VuvZ", + "AhfSG8AT", + "ub6CQyxN", + "PXXGDgQV", + "B9uH7rGh", + "k4EG452i", + "M9QPnfvs", + "bAqk5kkx", + "pznztjvB", + "jN83StNY", + "THm9a5TR", + "QKP7hs3o", + "JEB8v3vz", + "Nk6YKTdI", + "F1B0DPoK", + "PujZb3yL", + "OFVSYSus", + "R3iXDOmt", + "JMBcrkdj", + "LnRVY9EZ", + "wVLE9C3w", + "B3FAWqzv", + "dmnguAHR", + "leZVErPu", + "zYLNRVUQ", + "sqgkbmQD", + "CPJiW7pf", + "VaUxPIjt", + "wKI7GwLC", + "3tNyGwmk", + "9rKZXwwG", + "Gy1IkfP0", + "cfkAgcOh", + "xe2EVE6q", + "yDqYTUaf", + "5NNC7aNZ", + "pimBqcCZ" + ], + "icon_url": null, + "issues_url": "https://github.com/KosmX/fabricPlayerAnimation/issues", + "source_url": "https://github.com/KosmX/fabricPlayerAnimation", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": null, + "thread_id": "gedNE4y2", + "monetization_status": "monetized" + }, + "polymorph-fabric-0.49.5+1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.15.2", + "1.16.5", + "1.17.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.20.6", + "1.21" + ], + "id": "tagwiZkJ", + "slug": "polymorph", + "project_type": "mod", + "team": "IyMJnv3l", + "organization": null, + "title": "Polymorph", + "description": "No more recipe conflicts! Adds an option to choose the crafting result if more than one is available.", + "body": "Polymorph is a mod that solves recipe conflicts by letting players choose between all potential\noutputs shared by the same ingredients.\n\nWith a sufficiently large amount of mods, recipe conflicts are a common occurrence and the\nresponsibility for resolving these usually falls on the user or modpack developer, using datapacks\nor other tools to ensure that each recipe is unique.\n\nPolymorph offers an alternative solution, allowing all possible crafting and smelting recipes to\nco-exist regardless of conflicts.\n\n## Features\n\n### Crafting\n\n![](https://i.ibb.co/TkWswkG/polymorph.gif)\n\nWhen a group of ingredients matches more than one recipe, a button will appear above the output\nslot. Pushing this button will show a list of all possible results and selecting one will change the\ncrafting output to match. Polymorph will also remember the last selection as long as the ingredients\ndon't change, so repeated crafting actions are possible on the same selection.\n\n### Smelting\n\n![](https://i.ibb.co/QX9MNYM/polymorph-furnacedemo.gif)\n\nWhen a valid input matches more than one output, a button will appear above the output slot. Pushing\nthis button will show a list of all possible results with the currently selected result highlighted\nin green. Selecting one of the listed results will change the smelting output to match. This\nselection will be saved to the block itself and persist across world loading and unloading.\n\n### Smithing\n\n![](https://i.ibb.co/GTCgL3S/smithingconflicts.png)\n\nExactly like the crafting screen, a button will appear above the output slot when a valid input matches more than one\noutput. Upon selection, the output will change to match.\n\n### Commands\n\nTo assist identifying potential conflicts, there's a command `/polymorph conflicts` that will try to identify recipes\nthat conflict with each other and outputs a list of them to your logs folder. Currently, the command will scan crafting,\nsmelting, blasting, smoking, and smithing recipes.\n\n## Affiliates\n\n[![BisectHosting](https://i.ibb.co/1G4QPdc/bh-illusive.png)](https://bisecthosting.com/illusive)\n", + "body_url": null, + "published": "2023-02-03T20:08:37.444573Z", + "updated": "2024-07-21T02:03:36.448315Z", + "approved": "2023-02-03T22:57:44.906156Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LGPL-3.0-or-later", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 1553078, + "followers": 507, + "categories": [ + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "diy4s2XO", + "66Bkdq05", + "68l9BR3j", + "bT9w3gh5", + "hR8YtS8a", + "gxwQtnsA", + "vAv92Cl4", + "vuRsKlbz", + "cnPRpn78", + "tLFw14o5", + "haoNzeyv", + "750iJ3hO", + "rect6WEh", + "aYxyXMzJ", + "ChHxCoAb", + "STYYlkp8", + "wN8G3kAN", + "skUakdXR", + "uAleZkbS", + "SNlci35k", + "GKZ6KVfs", + "6Nyu412V", + "VQtXcHcR", + "bIDSNOm5", + "UlRasi89", + "l15iQHMn", + "AWwJD7yS", + "7L5hC81R", + "zncS6GGa", + "pJZr4yc3", + "8zhVFKEL", + "Sj0OPjRM", + "2BAp032A", + "FBfg7una", + "E4b6m0sQ", + "GcFD377O", + "km82tZAr", + "gXWxJGsW", + "Y8yR5ZhZ", + "qA4syOxx", + "akZJjqpV", + "iaqnjwBU", + "6tFcWl5d", + "Mq4la1Hv", + "W3ii0PIQ", + "N1NUMRCn", + "89IAarqG", + "ByjYK8ay", + "EYWxtHOI", + "V6TZ8mE6", + "OQP0nLJU", + "R9HsHDwY", + "GTEspIbt", + "wZ1N91Ci", + "yPIvYQkJ", + "QoURX3fY", + "3RJxqsNz", + "p4JIL4TF", + "3XAwKo9y", + "HpXWxhc2", + "WNLgny3d", + "9XFy7cdd", + "xGn4rwXN", + "USDMEIVG", + "xaTRylMN", + "XnckJfxp", + "CJo9qCQT", + "7HrMDnJs", + "lvXLiyLU", + "pT1H26Vj", + "p7pF15m3", + "9dCd6h4k", + "JJzyheLt", + "e9bcrAwa", + "Uxso6lX6", + "6kZfluud", + "q2Fuq2OB", + "PwXImdZm", + "qm2ho2dd", + "vS0MDXGK" + ], + "icon_url": "https://cdn.modrinth.com/data/tagwiZkJ/ed244c5829bde539763c7fffb55cb3194a349d66.png", + "issues_url": "https://github.com/illusivesoulworks/polymorph/issues", + "source_url": "https://github.com/illusivesoulworks/polymorph", + "wiki_url": null, + "discord_url": "https://discord.gg/JWgrdwt", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/theillusivec4" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/tagwiZkJ/images/d6122b7dd0dc7283795513be933a544aa49c3c8d.gif", + "featured": true, + "title": "Crafting Select", + "description": null, + "created": "2023-02-03T20:15:39.087950Z", + "ordering": 0 + } + ], + "color": 12895428, + "thread_id": "tagwiZkJ", + "monetization_status": "monetized" + }, + "Presence Footsteps": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.7.10", + "1.8.9", + "1.9.4", + "1.10", + "1.16.1", + "1.16.2-pre1", + "1.16.2-pre2", + "1.16.2-pre3", + "1.16.2-rc1", + "1.16.2-rc2", + "1.16.2", + "1.16.3-rc1", + "1.16.3", + "1.16.4-pre1", + "1.16.4-pre2", + "1.16.4-rc1", + "1.16.4", + "1.16.5", + "1.17-rc1", + "1.17", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "23w12a", + "23w13a", + "23w13a_or_b", + "1.20-pre6", + "1.20-pre7", + "1.20-rc1", + "1.20", + "1.20.1-rc1", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "23w51a", + "23w51b", + "1.20.5", + "1.20.6", + "1.21-rc1", + "1.21", + "1.21.1" + ], + "id": "rcTfTZr3", + "slug": "presence-footsteps", + "project_type": "mod", + "team": "GvrerX1T", + "organization": null, + "title": "Presence Footsteps", + "description": "..An Overly complicated Sound Mod...", + "body": "# Presence-Footsteps\n[![Build Status](https://github.com/Sollace/Presence-Footsteps/actions/workflows/gradle-build.yml/badge.svg)](https://github.com/MineLittlePony/Kirin/actions/workflows/gradle-build.yml)\n[![Version](https://img.shields.io/github/v/release/Sollace/Presence-Footsteps)](https://github.com/Sollace/Presence-Footsteps/releases/latest)\n![License](https://img.shields.io/github/license/Sollace/Presence-Footsteps)\n![](https://img.shields.io/badge/api-fabric-orange.svg)\n\n_..An Overly complicated Sound Mod..._\n\n---\n\nThis is the continuation of Huricaaan (Ha3)'s original mod, maintained and updated to the latest version of Minecraft. All previous features have been restored and some new ones added, with new development promised for the future on the opensource github profile!\n\n---\n\nExpect to see a more rich and immersive Minecraft world, one where Presence Footsteps adds new and more dynamic sounds for every block the player walks on. Every block has its own material assigned to it, and can make their own, customized sounds to better match what they're made of.\n\n---\n\n- Wooden chests are creaky and old,\n- stone is dusty and rough.\n- Piston heads sound like wood, whilst their bodies are stone,\n- even cake sounds like you might destroy if you step in the frosting!\n- Tall grass and bristles make a dry, rustling sound as you step through them,\n- Magma sounds like it's literally cooking your souls!\n\n---\n\nNot only that, but the latest version includes step sounds for certain non-block entities:\n\n---\n\nShulkers make the same creaky box noises as Shulker boxes, boats sound like wood, and armour stands creak and produce a stone stepping sound as you walk on their stone slab base.\n\n ---\n\n## Sound Packs\n\nPresence Footsteps is **fully customisable** with resource packs. The mod by default includes a pack with its own sounds\nand material mappings for the vanilla blocks, however if you don't like those sounds or want to use your own, this pack can be turned off\nor used together with packs from the community.\n\nNote that you need **at least one** sounds pack enabled for the mod to function.\n\n![image](https://github.com/Sollace/Presence-Footsteps/assets/6429283/9c50aa59-0f59-4324-aab7-cb360acac2ad)\n\n## Mod Support\n\nPresence Footsteps will attempt to figure out the sounds of modded blocks by looking at the vanilla material/sound types they use.\nIf your mod is using very unique sounds though, you can add mappings to your mod to directly control what sounds presence footsteps uses for your block by\nfollowing the [guide on our wiki](https://github.com/Sollace/Presence-Footsteps/wiki/Information-for-Resourcepack-Creators)\n", + "body_url": null, + "published": "2020-12-30T13:18:36.966588Z", + "updated": "2024-06-10T21:24:56.880523Z", + "approved": "2020-12-30T13:18:36.966588Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 3806734, + "followers": 3021, + "categories": [ + "decoration" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "liteloader", + "quilt" + ], + "versions": [ + "BEtLdX9C", + "wl2DCPmO", + "iu4qJBKh", + "U0g0vHwf", + "r0Hz3hFo", + "3R7j6E4Z", + "20NGWQNM", + "2Dcs7kJq", + "cXdGDBED", + "HSI3wnPT", + "31QS6G6Z", + "gLDVmoRt", + "IUc6dyrf", + "9ZPyiU8N", + "3fEb2K4u", + "GExGOzbi", + "M7mmrOFn", + "M7xLhDyx", + "jxsFtML2", + "FMF3yzCR", + "KrTss88l", + "pOCYcZUF", + "giebTOyU", + "teGodXxG", + "Vt7ls0pO", + "3JQQCViD", + "douonZQK", + "WswrXhsm", + "LIWEWgbC", + "KAmTaDGR", + "EvZkNyaK", + "ji7wRvVK", + "HwGHderf", + "LjDXTyEn", + "skZ5rNJe", + "HcfMgmXT", + "378nQU71", + "4CjXUG8M" + ], + "icon_url": "https://cdn.modrinth.com/data/rcTfTZr3/icon.png", + "issues_url": "https://github.com/Sollace/Presence-Footsteps/issues", + "source_url": "https://github.com/Sollace/Presence-Footsteps", + "wiki_url": "https://github.com/Sollace/Presence-Footsteps/wiki", + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/rcTfTZr3/images/76de1af1150df6e5adec16599c01c08ffe2b167f.jpeg", + "featured": true, + "title": "Presence Footsteps :: July 2013 Introduction video", + "description": "Watch it here: https://www.youtube.com/watch?v=uSZvsO3fyMg", + "created": "2023-04-17T18:29:38.916165Z", + "ordering": 0 + } + ], + "color": 4871715, + "thread_id": "rcTfTZr3", + "monetization_status": "monetized" + }, + "PresenceFootsteps-1.9.4+1.20.1": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.7.10", + "1.8.9", + "1.9.4", + "1.10", + "1.16.1", + "1.16.2-pre1", + "1.16.2-pre2", + "1.16.2-pre3", + "1.16.2-rc1", + "1.16.2-rc2", + "1.16.2", + "1.16.3-rc1", + "1.16.3", + "1.16.4-pre1", + "1.16.4-pre2", + "1.16.4-rc1", + "1.16.4", + "1.16.5", + "1.17-rc1", + "1.17", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "23w12a", + "23w13a", + "23w13a_or_b", + "1.20-pre6", + "1.20-pre7", + "1.20-rc1", + "1.20", + "1.20.1-rc1", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "23w51a", + "23w51b", + "1.20.5", + "1.20.6", + "1.21-rc1", + "1.21", + "1.21.1" + ], + "id": "rcTfTZr3", + "slug": "presence-footsteps", + "project_type": "mod", + "team": "GvrerX1T", + "organization": null, + "title": "Presence Footsteps", + "description": "..An Overly complicated Sound Mod...", + "body": "# Presence-Footsteps\n[![Build Status](https://github.com/Sollace/Presence-Footsteps/actions/workflows/gradle-build.yml/badge.svg)](https://github.com/MineLittlePony/Kirin/actions/workflows/gradle-build.yml)\n[![Version](https://img.shields.io/github/v/release/Sollace/Presence-Footsteps)](https://github.com/Sollace/Presence-Footsteps/releases/latest)\n![License](https://img.shields.io/github/license/Sollace/Presence-Footsteps)\n![](https://img.shields.io/badge/api-fabric-orange.svg)\n\n_..An Overly complicated Sound Mod..._\n\n---\n\nThis is the continuation of Huricaaan (Ha3)'s original mod, maintained and updated to the latest version of Minecraft. All previous features have been restored and some new ones added, with new development promised for the future on the opensource github profile!\n\n---\n\nExpect to see a more rich and immersive Minecraft world, one where Presence Footsteps adds new and more dynamic sounds for every block the player walks on. Every block has its own material assigned to it, and can make their own, customized sounds to better match what they're made of.\n\n---\n\n- Wooden chests are creaky and old,\n- stone is dusty and rough.\n- Piston heads sound like wood, whilst their bodies are stone,\n- even cake sounds like you might destroy if you step in the frosting!\n- Tall grass and bristles make a dry, rustling sound as you step through them,\n- Magma sounds like it's literally cooking your souls!\n\n---\n\nNot only that, but the latest version includes step sounds for certain non-block entities:\n\n---\n\nShulkers make the same creaky box noises as Shulker boxes, boats sound like wood, and armour stands creak and produce a stone stepping sound as you walk on their stone slab base.\n\n ---\n\n## Sound Packs\n\nPresence Footsteps is **fully customisable** with resource packs. The mod by default includes a pack with its own sounds\nand material mappings for the vanilla blocks, however if you don't like those sounds or want to use your own, this pack can be turned off\nor used together with packs from the community.\n\nNote that you need **at least one** sounds pack enabled for the mod to function.\n\n![image](https://github.com/Sollace/Presence-Footsteps/assets/6429283/9c50aa59-0f59-4324-aab7-cb360acac2ad)\n\n## Mod Support\n\nPresence Footsteps will attempt to figure out the sounds of modded blocks by looking at the vanilla material/sound types they use.\nIf your mod is using very unique sounds though, you can add mappings to your mod to directly control what sounds presence footsteps uses for your block by\nfollowing the [guide on our wiki](https://github.com/Sollace/Presence-Footsteps/wiki/Information-for-Resourcepack-Creators)\n", + "body_url": null, + "published": "2020-12-30T13:18:36.966588Z", + "updated": "2024-06-10T21:24:56.880523Z", + "approved": "2020-12-30T13:18:36.966588Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 3806734, + "followers": 3021, + "categories": [ + "decoration" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "liteloader", + "quilt" + ], + "versions": [ + "BEtLdX9C", + "wl2DCPmO", + "iu4qJBKh", + "U0g0vHwf", + "r0Hz3hFo", + "3R7j6E4Z", + "20NGWQNM", + "2Dcs7kJq", + "cXdGDBED", + "HSI3wnPT", + "31QS6G6Z", + "gLDVmoRt", + "IUc6dyrf", + "9ZPyiU8N", + "3fEb2K4u", + "GExGOzbi", + "M7mmrOFn", + "M7xLhDyx", + "jxsFtML2", + "FMF3yzCR", + "KrTss88l", + "pOCYcZUF", + "giebTOyU", + "teGodXxG", + "Vt7ls0pO", + "3JQQCViD", + "douonZQK", + "WswrXhsm", + "LIWEWgbC", + "KAmTaDGR", + "EvZkNyaK", + "ji7wRvVK", + "HwGHderf", + "LjDXTyEn", + "skZ5rNJe", + "HcfMgmXT", + "378nQU71", + "4CjXUG8M" + ], + "icon_url": "https://cdn.modrinth.com/data/rcTfTZr3/icon.png", + "issues_url": "https://github.com/Sollace/Presence-Footsteps/issues", + "source_url": "https://github.com/Sollace/Presence-Footsteps", + "wiki_url": "https://github.com/Sollace/Presence-Footsteps/wiki", + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/rcTfTZr3/images/76de1af1150df6e5adec16599c01c08ffe2b167f.jpeg", + "featured": true, + "title": "Presence Footsteps :: July 2013 Introduction video", + "description": "Watch it here: https://www.youtube.com/watch?v=uSZvsO3fyMg", + "created": "2023-04-17T18:29:38.916165Z", + "ordering": 0 + } + ], + "color": 4871715, + "thread_id": "rcTfTZr3", + "monetization_status": "monetized" + }, + "Prism-1.20.1-fabric-1.0.5": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.16.5", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "1OE8wbN0", + "slug": "prism-lib", + "project_type": "mod", + "team": "PyFeuZCL", + "organization": null, + "title": "Prism", + "description": "A library all about color! Provides lots of color-related functionality for dependent mods.", + "body": "

Prism is a library all about color!

\n

This library contains a powerful set of utilities to easily add color-related functionality to your mods.

\n

For example, just installing the library allows any mod that uses Minecraft's built-in TextColor (the basic color functionality) to automatically support animated colors, web colors, easy HSV manipulation, and more.

\n

For full documentation, please see the wiki.

\n

 

\n

You are free to use this library in the development of your mods or in modpacks!

\n

 

\n

\n

Problems, feature request, something else?  Join us on Discord!

", + "body_url": null, + "published": "2022-11-15T08:29:04.506238Z", + "updated": "2024-08-13T17:06:44.235549Z", + "approved": "2022-11-15T12:13:51.040502Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "CC-BY-NC-ND-4.0", + "name": "Creative Commons Attribution Non Commercial No Derivatives 4.0 International", + "url": null + }, + "downloads": 1747707, + "followers": 553, + "categories": [ + "decoration", + "library", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "IZHmnX6H", + "YOv7J3EX", + "gxx31aWN", + "MTjTc9TO", + "2cZ5aR4W", + "5jS9gaCZ", + "LLzsjiCn", + "eXlUYTX6", + "MMoP5rHI", + "Fmetb8IP", + "FFyss87M", + "1t6OseRF", + "4PcfwwpA", + "8JYabc0K", + "cVVJM1uL", + "F1FRXaIf", + "10q8xkyr", + "Ldd9l0k2", + "hIejSxjq", + "oIAIn2Ww", + "NYnrLePp" + ], + "icon_url": "https://cdn.modrinth.com/data/1OE8wbN0/fdaf0d78392ef6838c0fc05a6928f65394d31982.png", + "issues_url": "https://github.com/AHilyard/Prism/issues", + "source_url": "https://github.com/AHilyard/Prism/", + "wiki_url": "https://github.com/AHilyard/Prism/wiki/Prism-Documentation", + "discord_url": "https://discord.gg/S5NQjbXPnb", + "donation_urls": [ + { + "id": "paypal", + "platform": "Paypal", + "url": "https://www.paypal.com/donate/?business=NYKUAV883JKA2&no_recurring=0&item_name=Thank+you+for+considering+a+donation.+It+helps+to+support+me+by+allowing+me+to+spend+more+time+making+mods+and+games.¤cy_code=USD" + } + ], + "gallery": [], + "color": 328965, + "thread_id": "1OE8wbN0", + "monetization_status": "monetized" + }, + "projectile_damage-fabric-3.2.3+1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2" + ], + "id": "AOyJhFvl", + "slug": "projectile-damage-attribute", + "project_type": "mod", + "team": "tF6xACnP", + "organization": null, + "title": "Projectile Damage Attribute", + "description": "\ud83c\udff9 Range weapon damage becomes configurable.", + "body": "![Projectile Damage Attribute](https://cdn.modrinth.com/data/AOyJhFvl/images/0374af44e36e8c884733186b577c3b98356b7486.png \"\")\n\n[![Modloader](https://img.shields.io/badge/Loader-Fabric%20|%20Forge-ecebe6?labelColor=263768&style=for-the-badge)](https://fabricmc.net)\n![Availability](https://img.shields.io/badge/Available-1.18.2%20|%201.19%20|%201.19.1%20|%201.19.2%20|%201.19.3-ecebe6?labelColor=263768&style=for-the-badge)\n[![Fabric API required](https://img.shields.io/badge/Fabric%20API-REQUIRED-ecebe6?labelColor=263768&style=for-the-badge)](https://www.curseforge.com/minecraft/mc-mods/fabric-api)\n\n![Environment: Client](https://img.shields.io/badge/CLIENT%20SIDE%20INSTALLATION-REQUIRED-ecebe6?labelColor=263768&style=for-the-badge)\n![Environment: Server](https://img.shields.io/badge/SERVER%20SIDE%20INSTALLATION-REQUIRED-ecebe6?labelColor=263768&style=for-the-badge)\n[![Discord](https://img.shields.io/discord/973561601519149057.svg?label=&logo=discord&logoColor=ffffff&color=7389D8&labelColor=6A7EC2&style=for-the-badge)](https://discord.gg/tXb7cYhV)\n\n# \ud83c\udff9\ufe0f Features\n\nAdds new EntityAttribute to the game, with the following id: `projectile_damage:generic`. This allows customization of damage done by individual Bow and Crossbow items in the game. \n\n![](https://cdn.modrinth.com/data/AOyJhFvl/images/f5b143ef24af1a115dd7bb31972defbc89819cc2.png)\n\n![](https://cdn.modrinth.com/data/AOyJhFvl/images/2ac5e92d0ea51d488b42aa0c480df215217b4621.png)\n\nAdds *Impact* status effect, increasing the projectile damage done by the entity.\n\n![](https://cdn.modrinth.com/data/AOyJhFvl/images/494882a8e3ae1107477d1b09692de087f068b5d8.png)\n\nExample command: `/effect give @p projectile_damage:impact 30 4`\n\nYou can also use the API provided by this mod, to set the damage of your custom ranged weapons. \n\n# \ud83d\udd27 Configuration\n\n**Server side** configuration can be found in the `config` directory, after running the game with the mod installed.\n\n# \ud83d\udd28 Using it as a modder\n\nCheck out the project [readme](https://github.com/ZsoltMolnarrr/ProjectileDamage \"\") for more details.", + "body_url": null, + "published": "2022-07-12T17:17:25.654307Z", + "updated": "2024-04-10T09:45:18.238773Z", + "approved": "2022-07-12T17:17:25.654307Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "GPL-3.0-only", + "name": "GNU General Public License v3.0 only", + "url": null + }, + "downloads": 490831, + "followers": 151, + "categories": [ + "adventure", + "equipment", + "library" + ], + "additional_categories": [ + "game-mechanics" + ], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "wVMSsM2R", + "xsL1BQ3J", + "cJBUxZjo", + "W42P4APg", + "PIWHF1pL", + "dToAdDS8", + "BTZacATQ", + "RmsKiWBG", + "YzoO9Rp5", + "Lxo73pkB", + "isrcBlxN", + "V4cBjSNf", + "Kmx4fYwJ", + "X4aCxNak", + "JCxZlhYZ", + "OqfciHlH", + "1oUQWCR2", + "ZkDIrPKU", + "9AwQEbEW", + "vfrSBMkK", + "SFBgp0Np", + "l8S0vwMu", + "895AGGqE", + "XZUTTWrM", + "3Qa5LtB7", + "verg9LZP", + "lk9hRF5m", + "YgghDwPO", + "ioWRFrpH", + "APOsJrk6", + "Use2Wc8w", + "wkCDeHuV", + "ty5sfnFd", + "wgt5TX38", + "KmOINMgZ", + "90WiDH7U", + "li8jFAS6", + "ixuj3BQo", + "9tbiPKHo", + "KLdFqP9j", + "qdfM9zqu", + "l6ZX9VlU", + "nUSz2Ow2", + "mXIgIV5d", + "BbLEDLVx", + "kJonytow", + "K9g8WAlv", + "IJYozS89", + "KgTLAkfq", + "FitdvaJ7", + "V4AfQVrE", + "Xk19d9L4", + "TPkj1ZDs" + ], + "icon_url": "https://cdn.modrinth.com/data/AOyJhFvl/c28de9e969cab71d086e66b89a104ee019f0a6fb.png", + "issues_url": "https://github.com/ZsoltMolnarrr/ProjectileDamage/issues", + "source_url": "https://github.com/ZsoltMolnarrr/ProjectileDamage", + "wiki_url": "https://github.com/ZsoltMolnarrr/ProjectileDamage", + "discord_url": "https://discord.gg/KN9b3pjFTM", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/AOyJhFvl/images/0374af44e36e8c884733186b577c3b98356b7486.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-09-20T22:07:27.126833Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/AOyJhFvl/images/2ac5e92d0ea51d488b42aa0c480df215217b4621.png", + "featured": true, + "title": null, + "description": null, + "created": "2022-07-19T12:09:17.454124Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/AOyJhFvl/images/494882a8e3ae1107477d1b09692de087f068b5d8.png", + "featured": false, + "title": "impact", + "description": null, + "created": "2022-09-12T20:23:05.996904Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/AOyJhFvl/images/f5b143ef24af1a115dd7bb31972defbc89819cc2.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-07-19T12:09:16.899577Z", + "ordering": 0 + } + ], + "color": 16516100, + "thread_id": "AOyJhFvl", + "monetization_status": "monetized" + }, + "promenade-4.1.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.2", + "1.16.3", + "1.16.4", + "1.16.5", + "1.17", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2" + ], + "id": "GuE5FpvB", + "slug": "promenade", + "project_type": "mod", + "team": "FDc8Q01m", + "organization": null, + "title": "Promenade", + "description": "Fancy and simplistic biomes and structures!", + "body": "[![Promenade](https://dawnteammc.github.io/promenade/images/header.png)](https://hugman.gitbook.io/promenade/)\n\n[![Discord user count](https://img.shields.io/discord/504608980799062036?label=&color=424549&labelColor=7289da&style=for-the-badge&logo=Discord&logoColor=DDE4EF)](https://discord.gg/8ksTVJu)\n[![Twitter followers](https://img.shields.io/twitter/follow/DawnTeamMC?label=&color=424549&labelColor=1DA1F2&style=for-the-badge&logo=Twitter&logoColor=DDE4EF)](https://twitter.com/DawnTeamMC)\n\nPromenade is a mod for the latest version of Minecraft that adds a ton of features to the game related to exploration,\ndiversity and will improve the beauty of you world.\n\n**You can visit the [official wiki for Promenade for more information](https://hugman.gitbook.io/promenade/).**\n\n## \ud83d\udc7e Features\nDue to a missing Fabric API module, versions from v2.5.0 to v4.0.0 require [TerraBlender](https://www.curseforge.com/minecraft/mc-mods/terrablender-fabric) to be installed for overworld biomes to appear in your world.\n\n### Biomes\n\n* **Sakura Groves** (japanese cherry blossoms)\n* **Carnelian Treeway** (maple trees)\n* **Glacarian Taiga**\n* **Dark Amaranth Forests**\n* **Palms** in deserts\n\n\n### Animals\n\n* **Capybaras** in swamps and rivers\n* **Ducks** in plains and rivers\n\n\n### Monsters\n\n* **Sunken Skeleton** in oceans\n* **Lush Creepers** in caves\n\n\n### Structures\n\n* **Witch Huts** in dark forests\n\n\n### Other\n\n* Moai \ud83d\uddff (use tuff in a stonecutter)\n* New rocks: asphalt and blunite\n* Piles of flowers and leaves\n* Blueberries\n\n## \ud83c\udfb6 Soundtrack\nSakura Groves feature a new track composed by [**LudoCrypt**](https://ludocrypt.crd.co/): **Brise couleur pastel**! \nListen to **Brise couleur pastel** on [Bandcamp](https://ludocrypt.bandcamp.com/track/brise-couleur-pastel) or YouTube:\n\n[![Brise couleur pastel](https://img.youtube.com/vi/NUTTAB_-uY0/0.jpg)](https://www.youtube.com/watch?v=NUTTAB_-uY0)\n\n## \ud83d\udce6 Download\n### Required mods\n\u26a0 Promenade **needs** the following mods to be installed:\n\n- Fabric API: [GitHub](https://github.com/FabricMC/fabric) / [CurseForge](https://www.curseforge.com/minecraft/mc-mods/fabric-api) / [Modrinth](https://modrinth.com/mod/fabric-api)\n- Dawn API: [GitHub](https://github.com/DawnTeamMC/DawnAPI) / [CurseForge](https://www.curseforge.com/minecraft/mc-mods/dawn) / [Modrinth](https://modrinth.com/mod/dawn)\n\n### Compatible mods\nPromenade is compatible with the following mods:\n\n- Columns: [GitHub](https://github.com/haykam821/Columns) / [CurseForge](https://www.curseforge.com/minecraft/mc-mods/columns)\n- Farming for Blockheads: [GitHub](https://github.com/ModdingForBlockheads/FarmingForBlockheads) / [CurseForge](https://www.curseforge.com/minecraft/mc-mods/farming-for-blockheads-fabric)\n\n## \u2764\ufe0f Support\n[![Patreon supporters](https://img.shields.io/endpoint.svg?url=https%3A%2F%2Fshieldsio-patreon.vercel.app%2Fapi%3Fusername%3DHugman%26type%3Dpatrons&style=flat-square)](https://patreon.com/Hugman)\n\nYou can support Promenade on the [Patreon page of the founder, main developer and maintainer of the Dawn Team mods (Hugman)](https://patreon.com/Hugman).\n\nBy supporting Hugman, you can get access to the following:\n\n- Vote for the next features to be added to the Dawn Team mods\n- Get exclusive screenshots of the next features to be added to Dawn Team mods\n- Get early access to the latest beta versions of Dawn Team mods with new features\n- Get early access to new mods from the Dawn Team mods\n\n**We do not want to lock any in-game feature of the Dawn Team mods behind a paywall, because we believe that any Minecraft mod should forever remain free to download and fully exploit/use.** \nSupporting via Patreon is a more of way to help Hugman to continue to improve the mods and show the gratitude you might have towards Hugman's work.\nSome money you donate may be used to pay for new features, such as music or art, but not all of it.\n", + "body_url": null, + "published": "2020-12-06T11:25:52.623494Z", + "updated": "2023-10-12T07:18:22.008761Z", + "approved": "2020-12-06T11:25:52.623494Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 715374, + "followers": 468, + "categories": [ + "adventure", + "mobs", + "worldgen" + ], + "additional_categories": [ + "decoration" + ], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "FW8Jsy6b", + "AnQZPALY", + "WP8At0cA", + "J3w72Yuv", + "kjUioGhJ", + "Q9K8W0g7", + "nAjODWgn", + "sbnugVPH", + "HEsCyy9Y", + "2Q2TY7VB", + "hPETOKUD", + "z3XHgyMg", + "s2r6UFMr", + "aTBxN7qz", + "kZEtxN2J", + "yrt9Oxhk", + "6tKTgY0S", + "Vq0PJiim", + "uZy48sdY", + "WdDbZItz", + "NyKgq32w", + "obpRw4SX", + "yzCPompk", + "LuXqUsc6", + "F17sFUaS", + "A5YD9uS3" + ], + "icon_url": "https://cdn.modrinth.com/data/GuE5FpvB/0d1c302a542d389e029b5b6a33ccaa5719f06d11.png", + "issues_url": "https://github.com/DawnTeamMC/Promenade/issues", + "source_url": "https://github.com/DawnTeamMC/Promenade", + "wiki_url": "https://hugman.gitbook.io/promenade/", + "discord_url": "https://discord.gg/8ksTVJu", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/Hugman" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/GuE5FpvB/images/0208c3237cb7bccb8e0b03b022438c3bf8d7c1ee.png", + "featured": true, + "title": "Maple Wood", + "description": null, + "created": "2022-12-29T17:08:31.042332Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/GuE5FpvB/images/2a8835ed0941fb67b2f7aa75340e216a271983ea.png", + "featured": false, + "title": "Capybaras", + "description": null, + "created": "2022-12-29T17:08:28.467252Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/GuE5FpvB/images/4ca6287ad88ef03adfa2bd98342e623746c1335b.png", + "featured": false, + "title": "Sunken Skeletons", + "description": null, + "created": "2022-12-29T17:08:38.559031Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/GuE5FpvB/images/547c6fd7aa0e1a5198c377f61e8eb721e8999495.png", + "featured": false, + "title": "Palm Wood", + "description": null, + "created": "2022-12-29T17:08:32.437048Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/GuE5FpvB/images/be12e3bf59dd7306a9867b286fbc7b0166dc921e.png", + "featured": false, + "title": "Sakura Wood", + "description": null, + "created": "2022-12-29T17:08:35.118315Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/GuE5FpvB/images/c2a4fbbf909fce2aa7ef915e946b15d248021e76.png", + "featured": false, + "title": "Dark Amaranth Wood", + "description": null, + "created": "2022-12-29T17:08:33.473270Z", + "ordering": 0 + } + ], + "color": 4468512, + "thread_id": "GuE5FpvB", + "monetization_status": "monetized" + }, + "ProtectionBalancer-FABRIC-1.1.0": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.17", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4" + ], + "id": "Udc4ShgP", + "slug": "protection-balancer", + "project_type": "mod", + "team": "5UOLQVNJ", + "organization": null, + "title": "Protection Balancer", + "description": "Allows to change the armor & protection mitigation formulas", + "body": "# Protection Balancer\n\n**For Minecraft 1.17-1.20.4**\n\n**Requires [Necronomicon API](https://modrinth.com/mod/necronomicon) and [Fabric API](https://modrinth.com/mod/fabric-api).**\n\n\u00a0\n\nLightweight, serverside mod that allows to define custom formulas to calculate damage reduction from armor and the protection enchantment.\n\n\n\n\n\n\n\n\u00a0\n\n**The reason behind this?**\n\nProtection is busted, both in vanilla and modded. 88% damage reduction? No thanks.\n\n\u00a0\n\nWell, this mod by default changes the values to be up to 15% for armor (at 60), and 10% for protection (on a full prot V set).\n\n- It is highly suggested to change, as it will not count armor toughness (due to it not using damage as a reference), so if you don't have anything that uses toughness for anything else, it makes the attribute useless.\n\n\u00a0\n\n\u00a0\n\n## Configuration File\n\n\u00a0\n![The configuration file of the mod, showing options to enable custom formulas, and to change them](https://cdn.modrinth.com/data/cached_images/36fb69a901b89d63ceee30b06d56f5cadfb818d8.png)\n", + "body_url": null, + "published": "2024-03-16T02:02:29.107973Z", + "updated": "2024-03-17T15:16:12.045639Z", + "approved": "2024-03-18T08:43:05.515459Z", + "queued": "2024-03-16T02:15:54.446510Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 76259, + "followers": 15, + "categories": [], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "3oZx45MA", + "RUSThuct" + ], + "icon_url": "https://cdn.modrinth.com/data/Udc4ShgP/7178d9a5913a3b010683d9839174c65667f7cdd7.png", + "issues_url": "https://github.com/nvb-uy/Protection-Balancer/issues", + "source_url": "https://github.com/nvb-uy/Protection-Balancer", + "wiki_url": null, + "discord_url": "https://discord.gg/lunapixel", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/Udc4ShgP/images/36fb69a901b89d63ceee30b06d56f5cadfb818d8.png", + "featured": true, + "title": "Config File", + "description": "The configuration file of the mod", + "created": "2024-03-16T02:19:24.070446Z", + "ordering": 0 + } + ], + "color": 12281174, + "thread_id": "fzxYNCcA", + "monetization_status": "monetized" + }, + "puffish_attributes-0.5.0-1.20-fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19.2", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.21" + ], + "id": "FCFcFw09", + "slug": "attributes", + "project_type": "mod", + "team": "L04V2Tpb", + "organization": null, + "title": "Pufferfish's Attributes", + "description": "A Minecraft mod that adds more attributes to the game.", + "body": "# Pufferfish's Attributes\n\n## About\n\nThis mod adds new attributes to the game. Originally it was a part of [Pufferfish's Skills](https://modrinth.com/mod/skills) mod, but was split and now can be used independently.\n\n## Attributes\n\nSome attributes work different from vanilla ones. Instead of providing a value they modify dynamic values using addition or multiplication. For example damage dealt by attacking using various weapons. They work like normal attributes, but their base value is internally set to the dynamic value. Changing base value of these attributes is not possible, because it is permanently set to [NaN](https://en.wikipedia.org/wiki/NaN). These attributes are marked as dynamic in their description below.\n\n- Stamina\n- Melee Damage\n- Ranged damage\n- Fortune\n- Healing\n- Jump\n- Resistance\n- Mining Speed\n- Sprinting Speed\n- Knockback\n\n### Stamina\n\nAttribute `puffish_attributes:player.stamina` allows to change hard coded stamina value, which is 4 by default. Stamina determines how much exhaustion player must collect to decrease food/saturation points.\n\n### Melee Damage\n\nDynamic attribute `puffish_attributes:player.melee_damage` modifies damage dealt using melee weapons.\n\n### Ranged damage\n\nDynamic attribute `puffish_attributes:player.ranged_damage` modifies damage dealt using ranged weapons.\n\n### Fortune\n\nDynamic attribute `puffish_attributes:player.fortune` modifies fortune when mining a block, also applies without having fortune enchant on the item.\n\n### Healing\n\nDynamic attribute `puffish_attributes:player.healing` modifies how much health is restored by natural regeneration.\n\n### Jump\n\nDynamic attribute `puffish_attributes:player.jump` modifies how high player can jump.\n\n### Resistance\n\nDynamic attribute `puffish_attributes:player.resistance` modifies resistance of the player\n\n### Mining Speed\n\nDynamic attribute `puffish_attributes:player.mining_speed` modifies mining speed of the player.\n\n### Sprinting Speed\n\nDynamic attribute `puffish_attributes:player.sprinting_speed` modifies sprinting speed of the player.\n\n### Knockback\n\nDynamic attribute `puffish_attributes:player.knockback` modifies knockback power of the player.\n\n## Compatibility\n\nThis mod supports both Forge and Fabric. It may conflict with other mods that add similar attributes. Please report an issue if you find an incompatibility.\n\n**It is incompatibility with every version below 0.12.0 of Pufferfish's Skills, because that versions includes everything that Pufferfish's Attributes adds. However, version 0.12.0 of Pufferfish's Skills, when released, will no longer contain Pufferfish's Attributes, therefore these mods will be compatible.**\n\n## Versions\n\nVersions that are maintained and will receive future updates are: 1.18.2, 1.19.2, 1.19.4, 1.20, 1.20.2, 1.20.4.\n\n## Modpacks\n\nYou can use this mod in your modpack as long as you do not redistribute this mod.", + "body_url": null, + "published": "2024-03-28T19:41:07.521172Z", + "updated": "2024-07-15T18:23:26.023630Z", + "approved": "2024-03-31T00:28:06.532980Z", + "queued": "2024-03-28T21:01:15.448876Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 45420, + "followers": 38, + "categories": [ + "game-mechanics", + "library", + "utility" + ], + "additional_categories": [ + "management" + ], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "vjyrgZ4t", + "aEXrd6Gk", + "akYwrf2x", + "OwpspM8j", + "q1YNYX46", + "HtTHEvn5", + "2jVaBWQQ", + "KiBBrgIr", + "aowYX1Ng", + "w8DsSlyJ", + "kLlwnjhn", + "OMRHNS0p", + "eOzlYeYS", + "jZ6clufT", + "2mtm3wlX", + "7ZCWortj", + "1RMeTDan", + "RYphekww", + "TouzHJRA", + "89goX9JR", + "Zs11lNLI", + "mRqyVmZg", + "Hv1gf4f7", + "FWcjGg1K", + "tgtUFpm3", + "LfFhx9Iy", + "fQadECPH", + "uIfUdSKo", + "i8zbWbtl", + "AeGH5WvW", + "BeCYfSDL", + "rbSeaiMN", + "JTMpdyQL", + "i5RJQ4KL", + "XvyMjwGh", + "wS98cOW9", + "uYa19y6F", + "GGPDbtfc", + "VeNlFUPT", + "yDurNEZZ", + "IyVw84nf", + "m6tw8M96", + "Xj6OvPmH", + "O9a9qheZ", + "zvZ4858D", + "vcNrgpMr", + "BE60sAoj", + "VEQOxNHY", + "l9MXTh4H", + "hr3p1PcK", + "7ZjlMzSb", + "t8194x8c", + "QCTAjVHS", + "3icQnXzL", + "rVNER54H", + "YmIULcdw", + "we7sH1yd", + "UxdqdpM3", + "Ym6H3wD5" + ], + "icon_url": "https://cdn.modrinth.com/data/FCFcFw09/f25e0000aca9f043997af84f44d33099f7c6b8ef.png", + "issues_url": "https://github.com/pufmat/attributesmod/issues", + "source_url": "https://github.com/pufmat/attributesmod", + "wiki_url": "https://puffish.net/skillsmod/docs/creators/added-content/attributes", + "discord_url": "https://discord.gg/F4EKxzW4hf", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/FCFcFw09/images/9d0c7eb14896aaee5c21245f0bf810863225db74.png", + "featured": true, + "title": "Item with new attributes.", + "description": null, + "created": "2024-03-28T20:55:34.599680Z", + "ordering": 0 + } + ], + "color": 5526780, + "thread_id": "SIz3CDyI", + "monetization_status": "monetized" + }, + "puffish_skills-0.12.2-1.20-fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.21" + ], + "id": "hqQqvaa4", + "slug": "skills", + "project_type": "mod", + "team": "hhdIvQJ6", + "organization": null, + "title": "Pufferfish's Skills", + "description": "Adds a fully configurable skill system to the game.", + "body": "# Pufferfish's Skills\n\n![Banner](https://cdn-raw.modrinth.com/data/hqQqvaa4/images/0c83e356742665cdbdbee07cab069868fffa0797.png)\n\n[![Discord](https://puffish.net/badges/discord.png)](https://discord.gg/F4EKxzW4hf)\n\n## About\n\nPufferfish's Skills is a mod that adds a framework to create fully configurable skill systems. It has a dedicated [online editor](https://puffish.net/skillsmod/editor/) to help building skills layout. There is also an API which allows extending the functionality and managing skills.\n\n## Latest changes (Important)\n\nIn the recent update the mod was split, the core part is [Pufferfish's Skills](https://www.curseforge.com/minecraft/mc-mods/puffish-skills). Attributes are a separate mod [Pufferfish's Attributes](https://www.curseforge.com/minecraft/mc-mods/puffish-attributes). The default skill trees were also removed, but can still be downloaded as a data pack [Default Skill Trees](https://www.curseforge.com/minecraft/data-packs/default-skill-trees).\n\n## Getting started\n\nThe easiest way is to download [Default Skill Trees](https://www.curseforge.com/minecraft/data-packs/default-skill-trees) data pack. You can modify it according to your needs. Most skills in that trees increase player attributes. In the game there isn't many of them and that's why there is a [Pufferfish's Attributes](https://www.curseforge.com/minecraft/mc-mods/puffish-skills) mod which used to be a part of the mod.\n\n## Commands\n\n`/puffish_skills points add ` - Adds points.\n\n`/puffish_skills points set ` - Sets points.\n\n`/puffish_skills experience add ` - Adds experience.\n\n`/puffish_skills experience set ` - Sets experience.\n\n`/puffish_skills skills unlock ` - Unlocks skill.\n\n`/puffish_skills skills reset ` - Locks all skills, points are refunded.\n\n`/puffish_skills category lock ` - Locks category.\n\n`/puffish_skills category unlock ` - Unlocks category.\n\n`/puffish_skills category erase ` - Resets points, experience, skills.\n\n## Default keybindings\n\n`k` - Opens skills screen.\n\n## Configuration\n\nConfiguration is JSON driven. It is possible to reload in without restarting game using `/reload` command.\n\nTo easily edit skills you can use [online editor](https://puffish.net/skillsmod/editor/).\n\nYou can read more about configuration in the [documentation](https://puffish.net/skillsmod/docs/).\n\n## Compatibility\n\nThis mod supports both Forge and Fabric. What's more it is cross-compatible, so the client can use different loader than the server.\n\nThis mod should not conflict with other mods. Please report an issue if you find an incompatibility.\n\n## Versions\n\nVersions that are maintained and will receive future updates: 1.18.2, 1.19.2, 1.19.4, 1.20, 1.20.2 1.20.4.\n\n## Modpacks\n\nYou can use this mod in your modpack as long as you do not redistribute this mod.\n\n## Community-made tutorials\n\n
\n\tVideos\n\t\n\t\n
", + "body_url": null, + "published": "2023-03-02T17:29:10.825438Z", + "updated": "2024-07-21T16:09:27.347763Z", + "approved": "2023-03-10T00:24:17.422001Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-Custom", + "name": "", + "url": "https://github.com/pufmat/skillsmod/wiki/License" + }, + "downloads": 357073, + "followers": 418, + "categories": [ + "adventure", + "game-mechanics", + "utility" + ], + "additional_categories": [ + "management" + ], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "XrSWHv6k", + "iJl5I6Iv", + "QVJckfEf", + "VgYs0lYq", + "wD58hVEg", + "5MmH5UYU", + "bUstC8BU", + "gc3tr52W", + "pSX5apXa", + "exI1NlCI", + "dypHT1hp", + "z0rzqQO8", + "t3LvDTZF", + "sUSwUI6x", + "rqCO5wtJ", + "JUUhR9By", + "Quts69BT", + "imA5YGUG", + "EION0hTb", + "dec1CC3s", + "sBngmOHc", + "t12CwJMO", + "PgCc0Mj2", + "YYi3XM29", + "1YH2kFOX", + "MNrO1h7i", + "dps8iv1W", + "FtnflkYs", + "PjYe5HFb", + "dy9Z93c0", + "Weetapo3", + "vZjFW1ys", + "HsyvZ2ug", + "SOWc1QQw", + "MqcrNL0Z", + "WQd7CkBH", + "WGazi4Db", + "hp06DmMs", + "o8OvlKDP", + "sa9qS8tr", + "4n2mygBI", + "bAulJc02", + "T9lMguY1", + "rbqgXJkq", + "gupYwLXB", + "Ozn4WmEJ", + "tS0D1tgP", + "qD9XyQgj", + "O9N8GGdc", + "HaunBNqr", + "ucju3XGR", + "dLo3OMXK", + "7VVmbMiX", + "TWwIup5M", + "1Mg1toxs", + "VwEQfSf8", + "CEwZlWaH", + "ZpUBQydw", + "kx400ESr", + "mh48cvZA", + "tJFzpCiA", + "FZv94RR4", + "nE1JgApP", + "2EvkKMq4", + "MIb7Tq6c", + "mfA2XKJZ", + "ZfE4m8PC", + "GSNgjODX", + "5euWpzjq", + "YduGH9Sa", + "Ol0H9TRl", + "m9NAuWqw", + "pOOpfis7", + "5QzouTgi", + "KInH6iCV", + "2amZIV8M", + "IwAC94FZ", + "G4FPPLKR", + "2nfVonjE", + "mPFu3NLi", + "MfwmmQtN", + "EOuPAxbn", + "6Ifx6okD", + "PYy9afVf", + "qaA3a5lz", + "VzxkQnCd", + "m9flv6aD", + "2PfOUsXJ", + "djYyI9Le", + "MoISFSPJ", + "IRTU4TvB", + "AkJwi3eW", + "Fx5MbhxI", + "ubivVQm3", + "bGPAx4OK", + "VkznwDUF", + "FvbLhMtM", + "S4Ut6J8I", + "RpZcmCa1", + "g6ILDIk5", + "PtSyvZac", + "LnPUe8jC", + "WXiI01bx", + "OXYga1CZ", + "c7D4XV9V", + "DgiWcCju", + "BLUweVgj", + "RmGPDksN", + "YrjGq8Sk", + "oe2aHLrc", + "SE3d14cx", + "f7O8dT0T", + "g3xrYsxM", + "NoSXoO4M", + "g5FUuHKJ", + "sJvEKO49", + "P1wvw0rO", + "bBkRA7dL", + "LxIwHNv5", + "bUvBmMR7", + "Zk70e1cO", + "7ECe07Re", + "mZVfBFg9", + "hGmWia23", + "GPdj2lE8", + "t05Wx8rp", + "Cbn51DiE", + "MGfsPVS6", + "Ya27aICs", + "1nhew46s", + "4GV5Uddf", + "5NbBdVzD", + "iybO4Jq3", + "iNBBnSRp", + "RZMqcKR4", + "7SLwAlJU", + "8zfFLb2t", + "4RBRdWrk", + "9u4XwTag", + "HgIUPUNP", + "rqq2M2au", + "D8qXJKVS", + "zfZF9pex", + "kTpbRB4G", + "ENiNYp64", + "EUZ9Fi7d", + "AKdoCbSh", + "loViLANh", + "kDKqlmO0", + "suJqRhEh", + "XffZOSrD", + "IYAnatnf", + "YCZHudGs", + "92Tt7Od3", + "AosoU2d1", + "mMrdwA22", + "jsVU0ujc", + "H8wxHZ1L", + "X4Tv2mwv", + "RK0qoJDM", + "gxus8gHi" + ], + "icon_url": "https://cdn.modrinth.com/data/hqQqvaa4/03ee8cc78c05ab021cfc96664741dd66fc69e515.png", + "issues_url": "https://github.com/pufmat/skillsmod/issues", + "source_url": "https://github.com/pufmat/skillsmod", + "wiki_url": "https://puffish.net/skillsmod/docs", + "discord_url": "https://discord.gg/F4EKxzW4hf", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/hqQqvaa4/images/0c83e356742665cdbdbee07cab069868fffa0797.png", + "featured": true, + "title": null, + "description": null, + "created": "2023-03-02T18:12:58.873664Z", + "ordering": 0 + } + ], + "color": 8421504, + "thread_id": "hqQqvaa4", + "monetization_status": "monetized" + }, + "PuzzlesLib-v8.1.21-1.20.1-Fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4", + "1.21" + ], + "id": "QAGBst4M", + "slug": "puzzles-lib", + "project_type": "mod", + "team": "ubZOU9rM", + "organization": null, + "title": "Puzzles Lib", + "description": "Why's it called Puzzles you ask? That's the puzzle!", + "body": "

\n

\n

\n

\n

\n

\n

\ud83d\udcd6 About:

\n

Puzzles Lib is a rather light-weight library consisting of multiple frameworks and utility classes. But most of all, it offers an abstraction layer for developing mods on both the Forge and Fabric mod loader, making ports and maintaining mods rather simple without having to rewrite a bunch of logic.

\n

This mod doesn't do anything on its own, so install it only when you also use another one of my mods.

\n

The Fabric version of this project additionally depends on the Forge Config API Port library. This is required for mod configuration, as it allows for using the exact same system as on the Forge mod loader.

\n

\n

\"Reddit\"

\n

", + "body_url": null, + "published": "2022-07-06T18:55:14.270853Z", + "updated": "2024-08-14T09:38:13.581032Z", + "approved": "2022-07-06T18:55:14.270853Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MPL-2.0", + "name": "Mozilla Public License 2.0", + "url": null + }, + "downloads": 4032212, + "followers": 1054, + "categories": [ + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "n3g4OsEQ", + "4bHK0bos", + "Z3scKqNL", + "4T4HZk3f", + "jrxiZIJg", + "ggK4alzB", + "3FVGVSRL", + "3R2noZBz", + "GEaTK1To", + "MORtFjT7", + "SRIg4iQn", + "1osO35Q5", + "vy6Bovd4", + "wQvOrCfA", + "ZwirJqdf", + "O8agM1Hz", + "vi5hw79t", + "8ae5TjLO", + "yDmfcIc3", + "V7IXjDfj", + "o5YLPKfR", + "U7RPCAL4", + "w1IA6pkN", + "1PvxPgTS", + "Dfk6Kdpk", + "R9uwqQnV", + "mH2iiwlr", + "Pg6wh6Id", + "48jeSKzO", + "E9Qlol2T", + "V5LBscZ6", + "s6sGKfbx", + "bRZ6AoTv", + "9VA381uD", + "ZxiflfQp", + "1DmyxKmi", + "jA529ngn", + "JSEHdamZ", + "BpOQ6Lqg", + "SJGSFBMc", + "iYV1Feh5", + "gd0G2hhz", + "Ez5gkdlU", + "45edveqj", + "oQsbSTy3", + "6NuJBhyA", + "Dp7R36Xs", + "jgMObcuM", + "2bEMzr1L", + "6GQc3co6", + "BP33eOxU", + "D9vM6NoG", + "b4lBddf3", + "wZcJ8cWK", + "y4nUf0PC", + "XWUp4icb", + "i21HIDqx", + "h6zwrOXh", + "mC47wVQz", + "FCWQcWnv", + "8CR0bnID", + "HwzoFHC1", + "VGj1zGrn", + "FkILlZd7", + "p1tTNyCv", + "fL77THCh", + "Lm5gebmK", + "LGbvfJUd", + "2ztHmiwc", + "YoJzLFN6", + "VPPkHE7i", + "z7svCBW6", + "kwepeOdS", + "xDxHThlp", + "FHljGbgZ", + "WtjnkHmQ", + "5uHrsodn", + "ObWocDjJ", + "Gx40SdoU", + "m2m1WsQC", + "NjsLQCQh", + "LSUMYLnt", + "NRIoCBh3", + "iKGK4NBG", + "QpkkVVyn", + "4DEcuUZZ", + "fgZrY52r", + "8QmUx5Fl", + "mPEMMhvN", + "2kp8bKQO", + "rD8mGLPb", + "L5GPGt7F", + "DFhQb5uf", + "JrupytDU", + "GwsJMvCw", + "hP9hXoCe", + "1lSk5VZh", + "rO6E3jGm", + "LZOEQVQC", + "i2xTbv7Y", + "a8ZgypYg", + "h1ns5GaM", + "rKfjKi33", + "yeHvhYOD", + "ns69L8dI", + "sv1iPMzi", + "OXRJbrn6", + "PxXJo3k4", + "KFG50Qhy", + "6As7amla", + "op5e6xRq", + "7ABrOIgA", + "zizb6yD6", + "KCA6vQD5", + "UCiKAgMn", + "zBzpSBKZ", + "KoZGuWml", + "QiVyRzQB", + "690IIFFZ", + "TkxPgn47", + "R1uJEZ31", + "7yxa655A", + "P6S26sSD", + "7fAHr6w5", + "IEXOIGVL", + "wCK8ij3a", + "lf6PGWwe", + "OKZ6mA1W", + "pvuBqFqb", + "DHk61kCu", + "SuhOII0F", + "cPGoonJT", + "yP5oQ3Ak", + "Fnlslono", + "Bp8RvlYw", + "bEmPd1vO", + "9Q6cCSz6", + "UUEjLtmS", + "GpusdAdv", + "gd7iDa09", + "UbCrBSit", + "hYKHLRZ3", + "qdNeRisk", + "Q1j5L2yM", + "KmQylKLN", + "lSd7CXvO", + "g8d307PL", + "TwMB98sM", + "31TqmnJN", + "a5MLEWK6", + "WyvOkbnG", + "e0aWlelt", + "WjRzXRln", + "Noj6vMtz", + "5r3BfjAc", + "H9EbhiH7", + "hPp2iJwv", + "RUsPffnS", + "Y5Kjea08", + "51n2dMFU", + "gAz4ZDBl", + "RayW5xBY", + "V4g0yKzo", + "wfZ1WUlB", + "Lr1pamFx", + "rNieKbmF", + "RDV4dG9C", + "1UwAgU9l", + "paSPjnHb", + "ItncP8dX", + "8BIig8L5", + "HEzEuCRw", + "UMRz9cBy", + "tcY2bo8S", + "LTuYPgiM", + "8mMvpXiC", + "cJqMmNyP", + "qiuZsD4R", + "RVGrKpDw", + "gJPobzvP", + "d3flGMAv", + "ZwbaWApq", + "83sS3ngW", + "jLn169xV", + "RYhkOF7A", + "3aTpS1mg", + "ZtDMfIUN", + "dXLl9uWi", + "Sk64RP7y", + "KGAO1rK6", + "nEMiPLZ0", + "bKkfr7ay", + "oPr3RcvY", + "oFX0OV3d", + "WKcrcW20", + "5nBTQI8o", + "ltzRj1Al", + "XqZXczYQ", + "XcEPni7L", + "mnz2Hm7Z", + "TXMzWrbS", + "gGsQ0pWm", + "lOhe38BY", + "xShIH08f", + "V1MfC0Mw", + "57xICvxd", + "OGBBlBRy", + "MCFpJ1Oq", + "Wb6w0J7U", + "cCopyIlz", + "5ADGGlfq", + "LTVbnixz", + "nBWJys7K", + "6VIgAUJL", + "xiHYPU0O", + "ZUVLIzWs", + "SW4ids1s", + "Txoaqdfx", + "EFyslVOo", + "HANk7S8Y", + "8gv1l93Y", + "vWlFyCm4", + "SWQ2ahqO", + "tfARtYYn", + "9nJxieAS", + "v423n2Pm", + "DIhm8o76", + "SgNgKci7", + "6Pjd6OaZ", + "iKy6nFZL", + "e4lzFDZS", + "jkphsaH8", + "O4VA1IJL", + "pVdAf92x", + "3wteGlwJ", + "L30yzNuL", + "k8mU0QlS", + "Ab5KUgTb", + "nmSD44fp", + "kQgkv5iT", + "yv0STfcl", + "wyqkVBR6", + "62Td8gAV", + "gfFhZGIK", + "t21ZaLpl", + "dGKTOxmu", + "NZat9O7c", + "SNpPIaBe", + "VWijWTpQ", + "QPlKuTc3", + "2MTgLRdA", + "EuOcMDkX", + "UmSXV9Rq", + "Hd24Sjqn", + "qTyUOUnm", + "lWxIr4jA", + "ztwxN6az", + "heTs4xwy", + "fRs9GSN9", + "4pPSXzLY", + "RXjYpwik", + "hAnXRGE6", + "mi9Mryhy", + "VX10tpqr", + "TbC3Jf6X", + "EnIz7EYT", + "qdBCO6ts", + "8DBzZOGj", + "iwDQtahk", + "FTMya93H", + "4MxDan2p", + "tDJF06pn", + "DxOr6NRG", + "9MMQnG3c", + "WzEMd08l", + "I0w9FYVT", + "8biFI7PT", + "2W0fLYmI", + "XrQEeA3j", + "DD87WPm0", + "6lsMD0wH", + "GHuvKmu8", + "EpSfQOOy", + "hs4gH8fg", + "9SKeDQfZ", + "KI13IqvB", + "8TeiPNFS", + "8H0WEHWb", + "YV5fPHDv", + "aYUxnbFX", + "8ENMTJuS", + "Kzujt3Wg", + "h49wtUmr", + "UevkyHdQ", + "1radnytC", + "5AajzfKh", + "dg6ziRn7", + "3FxP0dZE", + "tXRgMC8h", + "L3apApXu", + "juwmigdj", + "G9liaLgv", + "ZHG4YWEj", + "5EdhqiJS", + "dn3USeHA", + "mgFflJ2j", + "FWuIR2cX", + "R9M0uem6", + "GeTxzirf", + "5IOFWbWY", + "JH9UaBnb", + "z0kHAGDv", + "xjQF8bha", + "vGTq0Oye", + "xkn7hkSC", + "smpYKI3H", + "hzqpfUyq", + "qxsoKMgp", + "bO46WSgf", + "yRKzQH0Y", + "umed6mI7", + "ZX11O3AP", + "v5xtZkKN", + "iaUdZflF", + "pNxX74mc", + "FjvlNKLa", + "VTkKjHAE", + "vBUQ7u2A", + "r2YdKG6L", + "rutUEgUD", + "NPwuTRlv", + "1KI644C2", + "1rbMiEHY", + "FBiKXkKa", + "BmlBHZrC", + "vOobFb4y", + "OSy4cscJ", + "tAdUNfuF", + "YU1mI7Kd", + "oj9qLzJM", + "YSIFLimp", + "ZYDbSmpi", + "H27pFMsx", + "Rzc9NmZd" + ], + "icon_url": "https://cdn.modrinth.com/data/QAGBst4M/icon.png", + "issues_url": "https://github.com/Fuzss/puzzleslib/issues", + "source_url": "https://github.com/Fuzss/puzzleslib", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/QAGBst4M/images/f57930a615a4c67e94387efeb6016c3e2d3e8ff9.png", + "featured": true, + "title": null, + "description": null, + "created": "2023-01-09T11:26:08.420283Z", + "ordering": 0 + } + ], + "color": 3617580, + "thread_id": "QAGBst4M", + "monetization_status": "monetized" + }, + "ranged_weapon_api-1.1.2+1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20.1", + "1.21" + ], + "id": "AqaIIO6D", + "slug": "ranged-weapon-api", + "project_type": "mod", + "team": "O5jDpEBx", + "organization": null, + "title": "Ranged Weapon API", + "description": "\ud83c\udff9 Create fully functional bows and crossbows, with ease", + "body": "# Ranged Weapon API\n\nThis mod is an API for developers, relying on Fabric API, to allow easy bow and crossbow creation.\n\nFeatures:\n- Bows and Crossbow construction\n- Customizable weapon properties: damage, pull time, projectile velocity (optional)\n- Automatic item model predicate registration (matching vanilla model predicates)\n- Correct rendering first and third person rendering\n- Correct pull FOV\n\nRead all technical details in the GitHub readme.", + "body_url": null, + "published": "2024-01-14T21:32:38.145079Z", + "updated": "2024-08-11T20:17:04.777771Z", + "approved": "2024-01-16T20:49:02.099287Z", + "queued": "2024-01-14T23:28:07.311647Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 95038, + "followers": 34, + "categories": [ + "equipment", + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "RzWpA7xD", + "Mj5snp7k", + "oEjSAqNj", + "R1YG5awX", + "hEspq9ew", + "wTfV05DN" + ], + "icon_url": "https://cdn.modrinth.com/data/AqaIIO6D/659d1ad81b30e0b9da56a64ba2c5c85645ad5fff.png", + "issues_url": "https://github.com/FabricExtras/RangedWeaponAPI/issues", + "source_url": "https://github.com/FabricExtras/RangedWeaponAPI", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": 1576988, + "thread_id": "rDHMrOML", + "monetization_status": "monetized" + }, + "reacharound+1.20-1.3.0": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "r3VgI4QN", + "slug": "reacharound", + "project_type": "mod", + "team": "8R87uVaX", + "organization": null, + "title": "Reacharound", + "description": "Reacharound block placement.", + "body": "![Minecraft Versions](https://img.shields.io/badge/Minecraft-v1.18--v1.21-brightgreen?style=flat&labelColor=%23000&color=%235b8731)\n\n[![Modrinth Downloads](https://img.shields.io/modrinth/dt/r3VgI4QN?style=flat&logo=modrinth&logoColor=%231bd96a&label=%20&labelColor=%2316181c&color=%2317b85a)\n](https://modrinth.com/mod/reacharound) [![Curseforge Downloads](https://cf.way2muchnoise.eu/short_reacharound.svg)](https://www.curseforge.com/minecraft/mc-mods/reacharound)\n\nA simple bedrock block placement mod with added support for placing blocks downwards and upwards.\n\nThe core functionality was ported [Quark (Forge)]. The Quark [\ud83d\udd17 License can be found here].\n\n[Quark (Forge)]: https://github.com/VazkiiMods/Quark\n\n[\ud83d\udd17 License can be found here]: https://github.com/VazkiiMods/Quark/blob/master/LICENSE.md\n\n### Added Functionality compared to other similar mods:\n\nThere is three indicator types (Default, Quark, Custom) that are configurable with mod menu support.\n\nSlabs will attempt to be placed smart. If you are bridging to upper slabs with more slabs they will continue to be upper slabs.\n\nSlabs placed vertically will stack without skipping properly.\n\nThis can now also be used to build upwards as well as downwards now.", + "body_url": null, + "published": "2022-07-21T21:19:54.465671Z", + "updated": "2024-06-20T21:39:11.735962Z", + "approved": "2022-07-21T21:19:54.465671Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LicenseRef-Custom", + "name": "", + "url": "https://github.com/spAnser/reacharound/blob/master/LICENSE.md" + }, + "downloads": 652771, + "followers": 306, + "categories": [ + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "oTJh3hyu", + "cBbhYoW2", + "E5rcVIcp", + "CGv8fJaH", + "Qpk954yq", + "6rOqbn5i", + "E8z7QNV3", + "ZI0GVbG1", + "JCIGmDdY", + "uk6tRHW7", + "l1gl19d9", + "oGckCaGt", + "Qj1H3oAT", + "OKLSq7uF", + "S7HhnI2O", + "EU7KmhuK", + "tntSuZwL", + "A9qyDAcG", + "kp7jJV8G", + "29DyXaiq", + "VJ6Sc59U", + "R35XZKUZ" + ], + "icon_url": "https://cdn.modrinth.com/data/r3VgI4QN/icon.png", + "issues_url": "https://github.com/spAnser/reacharound/issues", + "source_url": "https://github.com/spAnser/reacharound", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/r3VgI4QN/images/e522f12891d25b1845287b008c13e570d512fda6.gif", + "featured": true, + "title": "3D Indicator", + "description": null, + "created": "2024-06-20T21:20:45.867234Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/r3VgI4QN/images/9af9310fc34d1dc43d1231fcd25a9d8339e21251.gif", + "featured": false, + "title": "2D Indicator", + "description": null, + "created": "2022-07-28T12:03:16.460737Z", + "ordering": 1 + } + ], + "color": 2368548, + "thread_id": "r3VgI4QN", + "monetization_status": "monetized" + }, + "ReBalance-FABRIC-1.1.0": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.20.1" + ], + "id": "uZQipe0a", + "slug": "rebalance", + "project_type": "mod", + "team": "CfhAOyIX", + "organization": null, + "title": "ReBalance", + "description": "Modpack utility mod that allows to balance out damage dealt by players.", + "body": "

ReBalance

\n

 

\n

Adds damage balancing mechanics, including dynamic rebalancing, pvp and global multipliers.

\n

Everything configurable under config/rebalance.json

\n

 

\n

\"\"

", + "body_url": null, + "published": "2023-11-23T21:05:58.212032Z", + "updated": "2023-12-06T23:10:30.564131Z", + "approved": "2023-11-26T04:20:08.687229Z", + "queued": "2023-11-23T21:07:47.776558Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 124620, + "followers": 5, + "categories": [], + "additional_categories": [], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "5pc1JoYm", + "sCTvFBYJ", + "pAXbnwiG" + ], + "icon_url": "https://cdn.modrinth.com/data/uZQipe0a/00d9562491fe2b5e149ce4986342df1ee282c4c8.png", + "issues_url": null, + "source_url": null, + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": 2773065, + "thread_id": "EOHVdGbJ", + "monetization_status": "monetized" + }, + "remove-terralith-intro-message-1.0": { + "client_side": "optional", + "server_side": "required", + "game_versions": [ + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "sk4iFZGy", + "slug": "remove-terralith-intro-message", + "project_type": "mod", + "team": "9DC3WeOt", + "organization": "xdGr4sFb", + "title": "Remove Terralith Intro Message", + "description": "A datapack/mod to remove the intro message that appears with Terralith.", + "body": "This is a simple datapack/mod that removes Terralith's introduction message when creating a world.\n\nModpack devs are free to use this if they so desire; just stick it in your modpack and it should effectively prevent Terralith from making any chat messages on first world load. This is especially useful for modpack devs that don't want a ton of chat spam on first load, or don't want users confusingly joining the wrong Discord server.", + "body_url": null, + "published": "2023-02-22T20:53:35.948190Z", + "updated": "2024-08-12T20:19:40.010657Z", + "approved": "2023-02-23T01:02:49.237328Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-Stardust-Labs-License", + "name": "", + "url": "https://github.com/Stardust-Labs-MC/license/blob/main/license.txt" + }, + "downloads": 111406, + "followers": 91, + "categories": [ + "utility" + ], + "additional_categories": [], + "loaders": [ + "datapack", + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "NI1eSGiS", + "2jAppOW4", + "L5lkBuqD", + "Ad77N3iX" + ], + "icon_url": "https://cdn.modrinth.com/data/sk4iFZGy/d0e13cdf0cfafe8f206a4187ebc4666c25f6ab54.png", + "issues_url": "https://github.com/Stardust-Labs-MC/Terralith/issues", + "source_url": "https://github.com/Stardust-Labs-MC/Terralith", + "wiki_url": "https://stardustlabs.miraheze.org/", + "discord_url": "https://discord.gg/stardustlabs", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://patreon.com/stardustlabs" + }, + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/stardustlabs" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/sk4iFZGy/images/5221718fb9735b732ec1e8fc6fe65d357ad0845f.png", + "featured": true, + "title": "The Intro Message", + "description": null, + "created": "2023-02-22T21:21:47.279253Z", + "ordering": 0 + } + ], + "color": 4536883, + "thread_id": "sk4iFZGy", + "monetization_status": "monetized" + }, + "repurposed_structures-7.1.15+1.20.1-fabric": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.17", + "1.17.1", + "1.18-pre7", + "1.18-rc1", + "1.18-rc2", + "1.18-rc3", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "muf0XoRe", + "slug": "repurposed-structures-fabric", + "project_type": "mod", + "team": "BOIR6paN", + "organization": null, + "title": "Repurposed Structures - Quilt/Fabric", + "description": "Adds more variations of vanilla structures and features such as a Jungle Fortress!", + "body": "\"Picture\n#### Works serverside too so vanilla clients can connect!\n###### CLICK HERE FOR NEOFORGE/FORGE MC PORT: https://modrinth.com/mod/repurposed-structures-forge\n\n
\n____________________________________________________________________________\n\n# WHAT IS REPURPOSED STRUCTURES?\n
\n\nRepurposed Structures is a mod about taking existing vanilla features and structures and creating new variants or modifications to them! Originally, most of the structures and features in this mod was actually made for my Ultra Amplified Dimension mod. but then I realized these features and structures would look great in the Overworld as well so I decided to take those structures and features and split them into their own mod and continue to add MORE biome variants of vanilla structures! And over time, some other people even help contribute more vanilla styled structures!\n\n
\n\nCheck out the wiki below for all the info! It is kept up to date on latest Repurposed Structures releases.\n\n**[https://github.com/TelepathicGrunt/RepurposedStructures/wiki](https://github.com/TelepathicGrunt/RepurposedStructures/wiki)**\n\n
\n\n\n
\nFrequently Asked Questions:\n\n- **Q: Can this mod work serverside and let vanilla clients connect?**\n\n - A: Yep! This mod does not add any new blocks or mobs so it can be ran entirely serverside and is safe for vanilla clients.\n\n- **Q: How do I turn off RS structures in 1.18.2 or newer MC?**\n\n - A: 1.18.2 did a lot of changes and as a result, all of RS's structures are now in datapack form. Click here for more info and leads you to the config datapack that lets you turn off structures or changing spawnrates. Don't be afraid to ask me questions if you get stuck!

\n \n- **Q: Does this mod work with YUNG's Better Strongholds, YUNG's Better Mineshafts, and other Yungs mods mod?**\n\n - A: Yes all of Yung's mods will work with Repurposed Structures. Both mod's structures will continue to spawn. Note: RS’s structures will remain the same and will not be in the same style as yung’s structures unless you put on special datapacks. See the Pre-Datapack section for changing RS's strongholds, dungeons, and other structures to be in the style of Yung's structures! (Mineshafts does not have a datapack because Yung's Better Mineshafts already have biome variants)\n \n- **Q: Does this mod conflict with ___ mod?**\n\n - A: Highly unlikely. My mod adds structures to biomes directly so any conflict would be extremely rare. Best way to know is to just try my mod with the other mod. If you find they do conflict somehow, PLEASE let me know so I can investigate and release a fix! :) In fact, some mods like Signpost may have direct compatibility with Repurposed Structures's structures!\n \n- **Q: I heard this mod has banners in chests but none show up for me. Why?**\n\n - A: You'll have to use the latest version of Repurposed Structures and have the Luck status effect or attribute. Luck is not able to be obtained in vanilla so you'll have to use another mod or datapack. The banners are more like a cool Easter Egg collectable so check out what mods or datapacks can give you some Luck! Good luck and have fun collecting banners!\n \n- **Q: The advancements are annoying! I want to turn them off!**\n\n - A: There are datapacks to turn off the advancements. Click here for the datapack to use to make all RS advancements disabled. You can delete the files of the structures you do want advancements for from that datapack.\n\n- **Q: How can I change the language that this mod uses?**\n\n - A: You can use a Resourcepack to add new languages and help contribute! You can grab this datapack, delete the data folder from it, and use it as a resourcepack and add new languages you want!\n \n- **Q: Can I use this mod in a modpack?**\n\n - A: Yep! You can use this mod in a modpack :)\n \n- **Q: Can I modify the source code of this mod to make changes?**\n\n - A: You can but just make sure you respect my license which is LGPL. That means, if you plan on distributing a modified Repurposed Structures jar, you should open source it by making the modified source code visible and licensed under an open source license. But truthfully, if you want to make a change, ask me first or make a PR into my mod as I might actually add it to the base mod itself!\n
\n\n\n***\n\n## **\ud83c\udfe0 HOW CAN I CONFIGURE THIS MOD? \ud83c\udfe0**\n\n
\n1.18.2 and newer info:\n\n    **As of 1.18.2 and newer, most of Repurposed Structures can be changed by datapack now. Including turning off or on structures or changing spawnrates. Click the below link to get an example datapack to edit and some pointers for what to edit to turn off structures. There's a huge amount of stuff you can change by datapack though such as changing what height RS Mineshafts spawn at or how large RS villages are and much more that was not configurable in 1.18.1 and below. Enjoy!**\n\n    **Click here to go to config datapack download page**\n\n \n\n*Note: Be sure to read the instructions in the above link's page to make it easier to know what to edit*\n\nBy default, RS will do its best to import modded loot into its structures's loot. If this is not desired behavior, you can disable this in the normal RS config file in config folder above mods folder.\n\n    Furthermore, you can make datapacks to modify or change how RS structures look! Here's a flat world of all the pieces of my structures. Use this to make editing and overriding structure pieces easier with datapacks: Repurposed Structures - pieces world (click here)**\n\n    For the expert datapackers, there's actually a hidden neat way to add new pieces to any Jigsaw Structure without overriding their pool file! (Villages, outposts, all of RS's structures minus mansions, etc) For example, instead of overriding `data\\repurposed_structures\\worldgen\\template_pool\\village\\birch\\houses.json` to add new houses to my Birch Village, replace `worldgen\\template` in the datapack with `pool_additions` and have the template pool file only have the entries you want merged into the main pool file. Repurposed Structures will detect these files from ALL datapacks and merge the pool_additions pool entries into the actual template pool file that the path points to. Yes, Repurposed Structures will read all pool_additions files from all datapacks that even have the same path so that the datapacks do not override each other's pool_additions! Neat stuff! And it works with other pools too! Just make sure the piece you are adding has a Jigsaw Block with the right name so the actual structure can connect and spawn the piece.\n\n    To help you with this cool pool_additions feature, this 18 minute tutorial should help walk you through creating a building, saving it, and adding it to RS's structures with a datapack! **https://youtu.be/kzRQrQqlYjw**\n
\n\n
\n1.18.1 and older info:\n\n    **To reach this mod's config file, go into the config folder that is above the mods folder and go into the repurposed_structures-forge folder to change the configs. The config is split up into many files for better organization and ease of editing. Then exit/restart Minecraft for all changes to take effect. Do note that the config will affect all worlds so keep that in mind**\n\n    Right now, there are lots of config options. The big one that you may be interested in is the spawnrate config for every structure and yes, you can even fully turn off the structures too. The config comments will help walk you through on how to adjust the rates. Furthermore, you can even blacklist dimensions or biomes as well! For some structures, you can change the maximum and minimum y value that they can start their generation at and far more! Check out the config for everything you can do!\n\n    Furthermore, you can make datapacks to modify or change a huge amount of stuff in my mod including modifying how structures look! Here's a flat world of all the pieces of my nbt-based structures. Use this to make editing and overriding structure pieces easier with datapacks: **Repurposed Structures - pieces world (click here)**\n\n    If you want to change the loot tables that the structures in this mod uses, you can override my loot tables with a data pack! Here's a datapack with the default loot tables: **Repurposed_Structures-Loottables (click here) **\n\n    The mob spawner for all none-nbt based structures can be changed with datapacks as well! You can download the spawner datapack here and change the entries inside the json files to add, remove, or change mob chances in spawners!: **Repurposed_Structures-Mob_Spawners (click here)**\n\n    And all structure pieces such as Wells, Villages, Outposts, Shipwrecks, Pyramids, and Igloos can also be overridden with datapacks. Furthermore, the template pools that holds structure pieces for Villages and other structures can also be overridden with datapacks to add your own pieces to the villages or other structures! You can find what pieces or pools can be replaced and their filenames here but be sure to switch the branch to the MC version you are on: Overridable structure nbt files (click here)Overridable structure pool files (click here)\n\n    For the expert datapackers, there's actually a hidden neat way to add new pieces to any Jigsaw Structure without overriding their pool file! (Villages, outposts, all of RS's structures minus mansions, etc) For example, instead of overriding `data\\repurposed_structures\\worldgen\\template_pool\\village\\birch\\houses.json` to add new houses to my Birch Village, replace `worldgen\\template` in the datapack with `pool_additions` and have the template pool file only have the entries you want merged into the main pool file. Repurposed Structures will detect these files from ALL datapacks and merge the pool_additions pool entries into the actual template pool file that the path points to. Yes, Repurposed Structures will read all pool_additions files from all datapacks that even have the same path so that the datapacks do not override each other's pool_additions! Neat stuff! And it works with other pools too! Just make sure the piece you are adding has a Jigsaw Block with the right name so the actual structure can connect and spawn the piece.\n\n    To help you with this cool pool_additions feature, this 18 minute tutorial should help walk you through creating a building, saving it, and adding it to RS's structures with a datapack! **https://youtu.be/kzRQrQqlYjw**\n
\n\n**If you get stuck or confused on how to configure something, just ask and I'll try and help out!**\n\n
\n\n***\n\n## **\ud83c\udfe0 PRE-MADE DATAPACKS \ud83c\udfe0**\n\n    Since the overwhelming majority of my structures uses nbt files, template pools, and/or processors, you can override all of this with datapacks! That means you can customize the blocks in those structures with other mod's blocks or add pieces of other mod's villages into RS's villages! If you decide to use the datapacks below, download it, go into your world's save folder, and put the zipped folder into the datapack folder. Now when you load the game, the datapack should take effect! (Also, you can share mod-compat datapacks you made to me and I'll add it below after I check it out and like it!)\n\nCheck out the wiki below for some links to premade datapacks!\n\n**[https://github.com/TelepathicGrunt/RepurposedStructures/wiki#-pre-made-datapacks-](https://github.com/TelepathicGrunt/RepurposedStructures/wiki#-pre-made-datapacks-)**\n\n
\n\n***\n\n### Special thanks to:\n\n/r/l-ll-ll-l_IsDisLoss from Reddit for allowing me to use his Nether Pyramid and Nether Crimson Outpost design! \n\n
\n\ncannon_foddr for allowing me to use his Nether Brick Outpost and End/Nether Bricks Shipwreck design!\n\n
\n\nmiguelforge for allowing me to use his Crimson and Warped Shipwreck, End Ruined Portal, Nether Ruins, and other designs!\n
\n\n*If you find an issue, glitch, or have a suggestion about my mod, let me know! But if you don't have a GitHub account to report in the Issue tab above, just comment what the problem is below and I'll try and get back to you ASAP! Or you can contact me on Discord :) \n", + "body_url": null, + "published": "2021-05-13T00:04:15.296146Z", + "updated": "2024-08-08T21:38:19.785472Z", + "approved": "2021-05-13T00:04:15.296146Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 1013374, + "followers": 645, + "categories": [ + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "35dtx51R", + "E2iWqSXl", + "A4ZSc9XN", + "Dmax49Od", + "IgAGOh1h", + "VKVkP6Jk", + "WA7qPIfe", + "JzePUPKQ", + "zFb4dghk", + "Jn08ZT9H", + "5yP9SNTr", + "Q15ewCnG", + "Y4qPd6fm", + "WTB6X40T", + "uEWSNo9z", + "dAeJw0gz", + "E8m8cdYN", + "WnumpTbU", + "6Y73dMng", + "NHQMkHAX", + "xYQx55rz", + "ZXPbIXqU", + "dO8zzp76", + "7HyMKcOR", + "pXKdT8J1", + "Hp3zNCHi", + "uYLxUo0w", + "9rYhtURC", + "ijhsyQJW", + "WY511Xye", + "LibbrlRA", + "VkcvApwP", + "Q9t95S6K", + "GL4KREuI", + "BqQeZnPd", + "uxrWPrNq", + "gbTOjIDW", + "DaoliEUQ", + "aXWYK9dm", + "6n0YfMae", + "4y7pLbWm", + "hE83o7o6", + "GTMNoD82", + "Ce3JdkUu", + "9BTPaJCb", + "woCUEPa1", + "Kv8zCPAI", + "ycPWa5oa", + "KKc3hcdc", + "FLbpPTUH", + "F70cRVpm", + "w2G6eO96", + "HsKRhKTh", + "E250qFte", + "5ncbxBYc", + "F85q1GQ4", + "KwloMBmF", + "yQbS2tXT", + "p1poxtij", + "BT2jwX10", + "NXiDjUFA", + "UfYhlKLS", + "mjRrGqsz", + "PCG3bWAW", + "jwEScio6", + "oWQa6nV0", + "Lje82pJ7", + "VrGXigty", + "9BWcZtDI", + "ADfl8WUh", + "7UyHjyWS", + "FJZWpP4F", + "A40ugBKj", + "kRDeyLfM", + "CybQv2Yj", + "DPhbA3zv", + "hfIaM0WR", + "MpfWG418", + "bknOqCHj", + "4sr6Y94P", + "AOVK4K8u", + "urVr7RhM", + "Mab8p0XV", + "t2HVy9DA", + "UBaLE7SF", + "2FM7n3oR", + "AxQxycpQ", + "K1Bb1c83", + "hK7BolYG", + "XoF5k3mY", + "CGkSggJi", + "vviXPWRq", + "yYSCrgcw", + "YIwaalDX", + "Vf829t9B", + "N5NgHkyr", + "9oGWR6M4", + "IztniRej", + "AjWLUPV8", + "dPCFR7yN", + "sVGk3bX5", + "OGvotiqt", + "coQA1v6u", + "RKDqqU4O", + "9h2HQRvi", + "mIzgHryB", + "PLDOCP6C", + "mGlMoc9F", + "dgE3oMcH", + "Q6AL8SxV", + "dHt4hw7n", + "XVakHClu", + "tYzItxkG", + "31HRd1iE", + "gZH9qDLd", + "ZZrAajq6", + "N1wHVfRv", + "tMCPTDng", + "iG8Ypcsp", + "zsbFcYgy", + "DzFkGeO0", + "IgOLXw7Q", + "sbBNqh1o", + "VBiVXMKq", + "sMKowScu", + "hkMpGFdt", + "2T96DP3p", + "EjcBNcsi", + "Sq3mPEVJ", + "mfzzEY2V", + "RxLs3qRz", + "ZhheiZx4", + "vtYHuYkJ", + "DUlHZpb5", + "i3gosD9I", + "pFzKEBz5", + "QJyCKg8Q", + "As9fMq7o", + "RSxremwp", + "dzjtahRW", + "eecVZkni", + "am2gm5sk", + "ez14wVbu", + "ThqtNnYb", + "wmGyaJVE", + "CPe9o7CM", + "YdEqRckm", + "n23dmp2J", + "4uB2m0JP", + "GN2vsPet", + "MbKRdxX5", + "y0husUen", + "tsCcRryd", + "kt9tyd8y", + "TTOfssVq", + "3GviBkmG", + "Fpb1Npbq", + "o1aokaUw", + "4bqHFTpt", + "LpuYRZ8i", + "p01ZgFXM", + "7m7Hx7K3", + "efCY7VWf", + "NVzCh0BE", + "yj1DIllP", + "2fZKLqRM", + "Wv3yQoAh", + "3vxgVHLo", + "nWriSpKm", + "idYNIP8G", + "lkpc06Uc", + "vD0XVIce", + "axQ7XPoZ", + "6PRi8DLN", + "gwmCJFDP", + "juNYXHbs", + "grW3F5dO", + "BmjEG72r", + "hWifdziK", + "Yp9S1Yia", + "Kqm0nSMW", + "iCDtxUaP", + "CrHwNAud", + "HSnVVOGG", + "UUsn75P9", + "xwLyuBKM", + "VdQAzykP", + "71vfmZQS", + "SFLj7mfN", + "zx21s0f2", + "SHHipthG", + "3vUlZOkO", + "ncjaCbrl", + "OJpvRn6p", + "k9hRe80t", + "WnrZpxNg", + "K4HlreX3", + "bxc0tyY5", + "2jNzsnfc", + "UlOoMXRb", + "VxJqyOqo", + "gWyMS104", + "Trguc5g0", + "VQUSPq2M", + "piuKopqq", + "N13lemXR", + "wfu27gZE", + "D7B8ZYMc", + "uoUZYtkl", + "XPHE3BcK", + "E9ISQLuh", + "ixCPaHf0", + "k2A5VTDF", + "FBZX2g2v", + "tRkofIO1", + "WqmnFKp9", + "ZMocJ0mc", + "qMa85PfD", + "MuqUgLqO", + "k5hMtMM5", + "GqKmSBFV", + "qrzdVdPK", + "5a8QNDiP", + "yiBZwcBJ", + "SCBq1LMb", + "ayr5NDIc", + "HOszq7Us" + ], + "icon_url": "https://cdn.modrinth.com/data/muf0XoRe/icon.png", + "issues_url": "https://github.com/TelepathicGrunt/RepurposedStructures/issues", + "source_url": null, + "wiki_url": "https://github.com/TelepathicGrunt/RepurposedStructures/wiki", + "discord_url": "https://discord.gg/K8qRev3yKZ", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/telepathicgrunt" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/muf0XoRe/images/120e195fdb88c293989e4476481ac307fe2f7e75.png", + "featured": true, + "title": "Jungle Fortress", + "description": null, + "created": "2023-01-08T18:29:57.357881Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/muf0XoRe/images/1145b19e538cb83535ba4b48c8a7b1b1382f94ec.png", + "featured": false, + "title": "Some Pyramids added!", + "description": null, + "created": "2023-01-08T18:30:38.988461Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/muf0XoRe/images/9267c82d4a770909a78cd3e705ed2bbf39a61f3b.png", + "featured": false, + "title": "Ancient Cities variants added", + "description": null, + "created": "2023-01-08T18:33:05.101622Z", + "ordering": 2 + }, + { + "url": "https://cdn.modrinth.com/data/muf0XoRe/images/5af979778e3265d7d26dc8901ced62f261809244.png", + "featured": false, + "title": "Bamboo and Cherry Villages!", + "description": "Cherry Villages and Cherry Wells can be found in dense flower biomes!", + "created": "2023-08-16T03:17:18.633497Z", + "ordering": 4 + }, + { + "url": "https://cdn.modrinth.com/data/muf0XoRe/images/809b9b29606478583c69e0f20bf2e19f2de5756b.png", + "featured": false, + "title": "Mangrove structures", + "description": null, + "created": "2023-01-08T18:34:29.339448Z", + "ordering": 4 + }, + { + "url": "https://cdn.modrinth.com/data/muf0XoRe/images/6b3defb5a88021ba0bd351b2b3605d6d53960116.png", + "featured": false, + "title": "Nether villages", + "description": null, + "created": "2023-01-08T18:35:10.199133Z", + "ordering": 5 + }, + { + "url": "https://cdn.modrinth.com/data/muf0XoRe/images/bfa547766d227834dddf5d0e005c1e09838a877c.png", + "featured": false, + "title": "Some newer structures added", + "description": null, + "created": "2023-01-08T18:35:26.162112Z", + "ordering": 6 + }, + { + "url": "https://cdn.modrinth.com/data/muf0XoRe/images/a8bb224ecb302893710eddc444705dd91eaf0843.png", + "featured": false, + "title": "Overworld City", + "description": null, + "created": "2023-01-08T18:36:33.341633Z", + "ordering": 7 + }, + { + "url": "https://cdn.modrinth.com/data/muf0XoRe/images/73be5568e64df9d10a14904a2684e936eb999b59.png", + "featured": false, + "title": "End Portal in End Stronghold in End", + "description": null, + "created": "2023-01-08T18:37:22.101427Z", + "ordering": 8 + }, + { + "url": "https://cdn.modrinth.com/data/muf0XoRe/images/1ed3ff6c3d19ef6ae59d4b4d9649987b51106d34.png", + "featured": false, + "title": "Banners added when you open chests with Luck status on!", + "description": null, + "created": "2023-01-08T18:34:38.469332Z", + "ordering": 9 + } + ], + "color": 4737859, + "thread_id": "muf0XoRe", + "monetization_status": "monetized" + }, + "Resourceful Lib": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.19.3", + "1.19.4", + "1.20-pre6", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "G1hIVOrD", + "slug": "resourceful-lib", + "project_type": "mod", + "team": "sbhau9BZ", + "organization": "DIqu7jos", + "title": "Resourceful Lib", + "description": "Resourceful Lib", + "body": "\n\n
Resourceful Lib is a modding library that contains valuable utilities and APIs developed by Team Resourceful.
\n
At the time of writing this, there are a few mods using this library, they include Resourceful Bees, Highlight, Ad Astra!, Vitalize, and many more!
\n\n
    \n
  • \ud83d\udcfa GL Scissor API
  • \n
  • \ud83d\udcdd Stateful and History Screen Manager
  • \n
  • \ud83d\udce0 Codecs for predicates, tags, recipes, sets, and random collections
  • \n
  • \ud83c\udfa8 Color API
  • \n
  • \ud83c\udf10 Cross Platform Networking
  • \n
  • \ud83d\udcf2 Codec Recipes
  • \n
  • \ud83d\udcc1 Json File Utils
  • \n
  • \ud83d\udcbe Memory Resource and Data Packs
  • \n
  • \ud83c\udfb2 Random Collection/List
  • \n
  • \u231b Scheduling API
  • \n
  • \ud83c\udf0e Web Utilities
  • \n
  • \ud83d\udcd1 YABN (Yet Another Binary Notation) is a compressed binary format of JSON to allow for small transfer sizes of JSON objects
  • \n
  • \ud83d\udcd0 Highlight API (Custom Selection boxes that are not bound to cubes)
  • \n
\n\n", + "body_url": null, + "published": "2022-09-02T15:50:16.129999Z", + "updated": "2024-07-26T15:38:32.999341Z", + "approved": "2022-11-17T00:56:41.383965Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 2659227, + "followers": 458, + "categories": [ + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "G3lV8OVP", + "jLKGuA57", + "RGM87ZcE", + "3NarDN4b", + "311DNGtu", + "Dg7CZBnx", + "6XSBA0uT", + "7sMDujih", + "OeRBpKmZ", + "6mp5KYqE", + "Kt1uwyB9", + "CR3s1Q9E", + "7bt4Sfbf", + "Tm7cdAK9", + "SO6H8hCU", + "mHc7yjij", + "xLDDsRYc", + "M8d4atFa", + "pGZM1u27", + "WoJVEX8A", + "DtRLheCF", + "9bpCfetJ", + "TnolgSJP", + "l33ODpNh", + "oq4kr2ex", + "RIdAGTWP", + "rj4oIJ3c", + "we15ILm4", + "2uoDWVVu", + "zOnmzwki", + "VdgtVVWP", + "mxiPijSw", + "tNPUniqQ", + "7wv4Al4f", + "A1zeEXXD", + "KX0scagm", + "DGKrjwc2", + "fE4lranp", + "NbjC25Oq", + "1oI6soZD", + "46J1q5G9", + "CwKjCizK", + "76HAQLRn", + "gePIBNWu", + "l8HjPc29", + "kZXnyZkD", + "ow7IIdXY", + "KK93aN9X", + "k94OHkZD", + "tIBkUaKa", + "5gAcCZfI", + "K1JcKyP0", + "2ejFhzAD", + "3vR0JfHW", + "9Tqxu7BJ", + "vT6jM3KI", + "5MMm9Jcy", + "K25DsBQf", + "detwJ5tL", + "cP8TrTlq", + "9ttMchjr", + "pJVkjEuy", + "Osgglpas", + "lcqayFqh", + "S6iVht7K", + "9lVbDpOY", + "lmvJ0Hcp", + "T1LHD2MS", + "Km7wGxHM", + "BSonoRxL", + "xeUwwWis", + "dwUHyfYl", + "yQuGcqsD", + "XU16B6bG", + "5Ty6o9ND", + "nJrxjvxF", + "i07uoZmf", + "vWXIZDFO", + "lofPmr0y", + "Q8QbsplY", + "Qz28Npy5", + "pOAGAc1v", + "b3gW4kbR", + "SVkB0vWc", + "igcr8TjM", + "9H2q8txN", + "wXviWIDs", + "6wLvFcWf", + "qSGMFVYs", + "kxLEneHh", + "srouhWgf", + "r6xq08Kf", + "Zg1Jvqa9", + "FqMUaczZ", + "ihzjCwEV", + "jiOlc39u", + "2UP6QpGK", + "V4IW7RSL", + "tPEZCfIn", + "5coQdKPg", + "ktQZ5WRd", + "IJBIHU6K", + "P0GVeAtv", + "HGTwQLNx", + "55PmkZcB", + "568eKEET", + "MEf5LEmw", + "eNp5yaPv", + "nt1MZ9t0", + "IfRjDUur", + "CeK6JlbU", + "CIJvARA3", + "WTX24M1H", + "nwvfgqo4", + "33A9t9FH", + "FbFPK02O", + "C3UGbOz0", + "ErVfNk93", + "eriValHw", + "YtQ5szJN", + "7xEmewjh", + "jm9L6kBc", + "aX03sPL3", + "1RiwRltA", + "fW68amEN", + "ww1p2cUg", + "81wSAkrn", + "alEddyWb", + "Zd4Vp0ff", + "oRyi7tka", + "nJc7XSSx", + "D1moud7k", + "6ITzrUzY", + "YzWNEutS", + "yNJsNSJE", + "SJYf5ADd", + "niLlHvaI", + "Lk81jNLe", + "FdcHxyOr", + "y7uh90sp", + "h9m28I2i", + "fEbWd9vt", + "TiIWVg2u", + "l4YYn2wS", + "eHrhVCDK", + "ifZ7EdXy", + "91NsF6Ir", + "cSgK1kI8", + "We1iSqwr", + "qaNQcF45", + "RtESsg6c", + "OoSsNrMZ", + "aohlCfb8", + "VxWgc6g1", + "HE5vIZWO", + "KWy8ghR9", + "qCuHU37e", + "XO3P1hbK", + "NR6mwIdz", + "TAq2omy6", + "udU2UGiv", + "lruji6Ab", + "3Ro6PROx", + "mRKHsuhB", + "Gwc50o5U", + "t2JfBos8", + "JePNBpbY", + "M8ZqBmqg", + "TKI3QwqC", + "ofZNNOlr", + "BZQJVDH6", + "BEDBbfUW", + "LQpfnlYR", + "aFZ2neF6", + "r38KdzOf", + "DEtn47se", + "QCSb1H9Q", + "eotpB1CQ", + "agK8ADLZ", + "13n9Gw3Q", + "GVoDzGSq", + "HhoeLNNj", + "dwRK3K0w", + "e8oxp0Cl", + "4u04iwUx" + ], + "icon_url": "https://cdn.modrinth.com/data/G1hIVOrD/a4023bf3e8a1e5d10b714b2dbb5e01873568f8c9.png", + "issues_url": "https://github.com/Team-Resourceful/ResourcefulLib/issues", + "source_url": "https://github.com/Team-Resourceful/ResourcefulLib", + "wiki_url": "https://team-resourceful.gitbook.io/resourceful-lib/highlights", + "discord_url": "https://discord.gg/resourcefulbees", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/resourcefulbees" + } + ], + "gallery": [], + "color": 7029835, + "thread_id": "G1hIVOrD", + "monetization_status": "monetized" + }, + "resourcefulconfig-fabric-1.20.1-2.1.2": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "M1953qlQ", + "slug": "resourceful-config", + "project_type": "mod", + "team": "HZyf49is", + "organization": "DIqu7jos", + "title": "Resourceful Config", + "description": "Resourceful Config is a mod that allows for developers to make cross-platform configs", + "body": "\n\n
We make cross-platform configuration easy peezy!
\n
On forge, we use the official forge config system to make hot reloading possible.
\n
and on Fabric we use JSONC because they don't have a system.
\n
As of 1.20 we no longer use Forge's official system as it breaks quite easily.
\n
We also have a cool lit UI for the youngsters to enjoy because they lazy and stuff.
We also have a web interface for servers or clients if they want to use, more info here
\n\"This\n\n", + "body_url": null, + "published": "2022-11-28T01:11:50.632330Z", + "updated": "2024-07-20T15:05:43.019962Z", + "approved": "2022-11-28T01:15:17.710323Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 1519934, + "followers": 280, + "categories": [ + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "1sMRhcfE", + "CJ1EQWAX", + "AmKXTTvt", + "HLTIErHD", + "CC4DR9Ew", + "AT8w6BOY", + "ey867PKW", + "yaKkGeBn", + "geCYkuUf", + "uyEnPWwc", + "EbmW7KYO", + "ImsXyeAn", + "bodqKeZo", + "Jz5eewAo", + "hGInwt7S", + "OHgqw2cM", + "bpexXO5r", + "EDFKAsEd", + "SSywkHD2", + "QUCEXsuZ", + "JrjaKFMB", + "eQYA6EPm", + "vQZXd8C8", + "Mk4JvsHk", + "qKRFSQCB", + "Z9VrRna2", + "Gv8qpOL7", + "CDqoVuzU", + "yEcynctB", + "zrSzjHIt", + "6k0hdREk", + "TIzyR4bY", + "n3yQ9KKD", + "JXU6RJAv", + "iktUkXe8", + "nVDWZ9N7", + "RWBTLDls", + "EFajw54I", + "HaBv9PTz", + "vQPGCfih", + "JBxXTqOr", + "9jltWR8L", + "vDvFwHAq", + "pZINfkWf", + "C3vAAE9x", + "2qMl5afY", + "5NnWZvd6", + "30wspqZe", + "tRs8WNph", + "nFlSpFWY", + "irREd1ZJ", + "PlEObkl9", + "AEjcN8G2", + "YKChBq8o", + "qpaBKKtA", + "JpRMedNr", + "UNSYgT5m", + "LTivPqAB", + "rEhLowE3", + "wkxW5K1t", + "Uqp2T1FX", + "mREDowcJ", + "y6VWSwg4", + "WuHokYiB", + "2eqslKBS", + "r8C9UHfr", + "5DDRLs1v", + "cKooWmav", + "p5YdFE5o", + "LrfrfR1J", + "o6HkmYGU", + "mImM4qkZ", + "s7xLIWh3", + "YV2odnU3", + "QxYi29TJ", + "1Q4eLZCR", + "PkHTcGx5", + "ptpZRXNt", + "PfDhIaBR" + ], + "icon_url": "https://cdn.modrinth.com/data/M1953qlQ/2e0da928f67bd804ee4ef8205b747439f713f5bd.png", + "issues_url": "https://github.com/Team-Resourceful/Resourceful-Config/issues", + "source_url": "https://github.com/Team-Resourceful/Resourceful-Config", + "wiki_url": null, + "discord_url": "https://discord.gg/resourcefulbees", + "donation_urls": [], + "gallery": [], + "color": 1185045, + "thread_id": "M1953qlQ", + "monetization_status": "monetized" + }, + "Revive": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.20", + "1.20.1", + "1.21" + ], + "id": "MGRhpQYp", + "slug": "revive", + "project_type": "mod", + "team": "1FdxHzHo", + "organization": null, + "title": "Revive", + "description": "Revive your friends when they have died", + "body": "![Headline](https://i.imgur.com/eXQxKIM.png)\n\n
\n\n[](https://discord.gg/cV4cJyGXqF) \n[](https://globox1997.github.io/wiki/mods/Revive/)\n[](https://github.com/Globox1997/Revive/issues)\n
\n\n\u201cDescription\u201d\n

\n\nRevive adds two potions to revive players. A good version of the potion is brewed by adding a revival star, which can be traded from a cleric villager, into regeneration lvl2 potions. \nThe bad version of the potion can be brewed with mundane potions and a golden apple. \nIt works in hardcore mode too! \nCheck out the config settings if you want to customize anything.\n\n![Showcase](https://i.imgur.com/zotECfH.png)\n\n![Showcase](https://i.imgur.com/OqMvwgt.png)\n\n\u201cMisc\u201d\n

\n\n[](https://modrinth.com/mod/fabric-api)\n[](https://modrinth.com/mod/cloth-config)\n\n\n\nThis mod is developed for Fabric. \nThere are no plans to develop a Forge version. \n\n\nModpack Permission: \nFeel free to use it in any modpacks.\n\n\nBug Report: \nJust report bugs at the github page.", + "body_url": null, + "published": "2023-04-19T18:46:50.160791Z", + "updated": "2024-06-22T09:45:23.961941Z", + "approved": "2023-04-20T22:07:22.193879Z", + "queued": "2023-04-19T20:35:33.241834Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 204068, + "followers": 81, + "categories": [ + "game-mechanics" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "XbfG13NP", + "FAbCgDn8", + "eW6ZYUVj", + "gLP9gI6N" + ], + "icon_url": "https://cdn.modrinth.com/data/MGRhpQYp/32277c6359fcb66786a2e54abf7386159a38de4c.png", + "issues_url": "https://github.com/Globox1997/Revive/issues", + "source_url": "https://github.com/Globox1997/Revive", + "wiki_url": "https://globox1997.github.io/wiki/mods/Revive/", + "discord_url": "https://discord.gg/cV4cJyGXqF", + "donation_urls": [], + "gallery": [], + "color": 8726313, + "thread_id": "MGRhpQYp", + "monetization_status": "monetized" + }, + "rogues-1.1.0+1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20.1" + ], + "id": "3MKqoGuP", + "slug": "rogues-and-warriors", + "project_type": "mod", + "team": "ziE81I4i", + "organization": null, + "title": "Rogues & Warriors (RPG Series)", + "description": "\ud83d\udde1\ufe0f Silent Blades, Mighty Blows - Dominate with martial skills!", + "body": "![](https://cdn.modrinth.com/data/3MKqoGuP/images/fd4a9b21b12c18e1b4754fc8d106b9367877e3ce.png \"\")\n\n## \ud83d\udde1\ufe0f Silent Blades, Mighty Blows - Dominate with martial skills\n\n[![Modloader](https://img.shields.io/badge/Loader-Fabric-ecebe6?labelColor=263768&style=for-the-badge)](https://fabricmc.net)\n[![Connector](https://img.shields.io/badge/Forge-via_Sinytra_Connector-orange?style=for-the-badge)](https://modrinth.com/mod/connector)\n[![Discord](https://img.shields.io/discord/973561601519149057.svg?label=&logo=discord&logoColor=ffffff&color=7389D8&labelColor=6A7EC2&style=for-the-badge)](https://discord.gg/KN9b3pjFTM)\n\n### \u2728 Discover more of the RPG Series\n\n[![Archers](https://cdn.modrinth.com/data/XIpMGI6r/images/cd19a95a79f1157b33f31818aa615a280b206912.png \"Archers\")](https://modrinth.com/mod/archers \"\")\n[![Paladins](https://cdn.modrinth.com/data/XIpMGI6r/images/3f19359bfd7521ba17bec818f125e87e09ef277e.png \"Paladins\")](https://modrinth.com/mod/paladins-and-priests \"\")\n[![Wizards](https://cdn.modrinth.com/data/XIpMGI6r/images/a7da965aa108daf95c10448c01423be49ce2338d.png \"Wizards\")](https://modrinth.com/mod/wizards \"\")\n[![Jewelry](https://cdn.modrinth.com/data/XIpMGI6r/images/747102d582732b8defa50a2c925c7d5a6f87d009.png \"Jewelry\")](https://modrinth.com/mod/jewelry \"\")\n\n# \ud83d\udce6 Installation\n\n### Required\n\n- [AzureLib Armor](https://modrinth.com/mod/azurelib-armor \"\")\n- [Spell Engine](https://modrinth.com/mod/spell-engine \"\")\n\n### Strongly recommended\n- [Better Combat](https://modrinth.com/mod/better-combat \"\") attack moves, dual wielding, and much more!\n\n# \ud83d\udde1\ufe0f Features\n\n## Martial skills\n\nFind a Spell Binding Table in village [Gazebos](https://modrinth.com/mod/gazebos \"\"), or build your own.\n\nTo play as a Rogue, create the Rogue Handbook.\n\nTo play as a Warrior, create the Warriors' Codex.\n\nMaster your class by unlock all the martial skills, to dominate dungeons and battlefields.\n\nMartial skills can be used with any melee weapon (vanilla, or even third party mods).\n\n![](https://cdn.modrinth.com/data/3MKqoGuP/images/3769e223c326c42bf8aa09b1358432f9688f190e.png \"\")\n\n## Arsenal\n\nExplore a whole arsenal of entirely new weapons, with varying characteristics and attack moves.\n\nSome weapons are exclusively available when BetterEnd and BetterNether mods are installed.\n\nEquipment bonuses are configureable in `config/rogues/items.json`.\n\n![](https://cdn.modrinth.com/data/3MKqoGuP/images/6b79d839b9a8912476e5ec965ee1ad0c42e1adf2.png \"\")\n\n## Armory\n\nExplore new armor sets, designed to sinergize with different combat playstyles.\n\n![](https://cdn.modrinth.com/data/3MKqoGuP/images/498afeceae17b8a48e2ec957466b7581d5cd20bc.png \"\")\n\n## Rebalanced enchantments\n\nRebalanced vanilla damage enchantments, so they scale equally for fast and slow weapons.\n\n**Sharpness** grants +8% damage per level.\n\n**Smite** grants +12% damage per level.\n\n**Bane of Arthropods** grants +12% damage per level.\n\nThese changes are configurable in `config/rogues/tweaks.json`.\n\n![](https://cdn.modrinth.com/data/3MKqoGuP/images/a2addaf1556fc85198fe4dcbf4c5a6f69e8b49ab.png \"\")\n\n## Extended dungeon loot\n\nFind powerful weapons and armors in dungeon loot chests!\n\nLoot table injections are configurable in `config/rpg_series/loot.json`.\n\n![](https://cdn.modrinth.com/data/3MKqoGuP/images/e593d89d67e90f18bedabe74b3fae288530efbb3.png \"\")\n\n## New village structures\n\nFind Barracks in villages, where rogue and warrior equipment are being sold!\n\nThe spawn weight and limit are configureable in `config/rogues/villages.json`.\n\n![](https://cdn.modrinth.com/data/3MKqoGuP/images/54911337554bc5f99d67904ab193671e0e0494c1.png \"\")\n\n# \ud83d\udd27 Configuration\n\nSkill use mechanics and HUD can be configured under **Mod Menu / Spell Engine / Settings**.", + "body_url": null, + "published": "2024-06-19T19:24:04.440771Z", + "updated": "2024-07-24T21:41:56.552935Z", + "approved": "2024-06-27T02:22:45.444125Z", + "queued": "2024-06-24T12:42:32.851969Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 22341, + "followers": 79, + "categories": [ + "adventure", + "equipment", + "magic" + ], + "additional_categories": [ + "game-mechanics", + "worldgen" + ], + "loaders": [ + "fabric" + ], + "versions": [ + "WmBvyqwC", + "vCLSiBVJ", + "4vOLHGGR", + "jXP1teJy", + "r3W2ltdb", + "7Nf408na", + "nR5fpBFj", + "NwGoBPZx", + "Zv9heBzC" + ], + "icon_url": "https://cdn.modrinth.com/data/3MKqoGuP/00d33793ce35cee0bb65a642ba9a54f6539975f5.png", + "issues_url": "https://github.com/ZsoltMolnarrr/Rogues/issues", + "source_url": "https://github.com/ZsoltMolnarrr/Rogues", + "wiki_url": null, + "discord_url": "https://discord.gg/KN9b3pjFTM", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/3MKqoGuP/images/3769e223c326c42bf8aa09b1358432f9688f190e.png", + "featured": false, + "title": "Gazebo", + "description": null, + "created": "2024-06-24T10:36:20.135746Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/3MKqoGuP/images/498afeceae17b8a48e2ec957466b7581d5cd20bc.png", + "featured": false, + "title": "Armors", + "description": null, + "created": "2024-06-24T10:35:59.028183Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/3MKqoGuP/images/54911337554bc5f99d67904ab193671e0e0494c1.png", + "featured": false, + "title": "Structures", + "description": null, + "created": "2024-06-24T10:36:40.699932Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/3MKqoGuP/images/6b79d839b9a8912476e5ec965ee1ad0c42e1adf2.png", + "featured": false, + "title": "Weapons", + "description": null, + "created": "2024-06-24T10:36:49.005988Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/3MKqoGuP/images/a2addaf1556fc85198fe4dcbf4c5a6f69e8b49ab.png", + "featured": false, + "title": "Enchanting", + "description": null, + "created": "2024-06-24T10:36:09.865923Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/3MKqoGuP/images/e593d89d67e90f18bedabe74b3fae288530efbb3.png", + "featured": false, + "title": "Loot", + "description": null, + "created": "2024-06-24T10:36:29.631776Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/3MKqoGuP/images/fd4a9b21b12c18e1b4754fc8d106b9367877e3ce.png", + "featured": false, + "title": "Rogues Logo Aspected", + "description": null, + "created": "2024-06-20T20:41:38.827863Z", + "ordering": 0 + } + ], + "color": 2235421, + "thread_id": "8pFHJfzO", + "monetization_status": "monetized" + }, + "runes-0.9.13+1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19", + "1.19.1", + "1.19.2", + "1.20.1" + ], + "id": "lP9Yrr1E", + "slug": "runes", + "project_type": "mod", + "team": "cDpH4P0Z", + "organization": null, + "title": "Runes", + "description": "\ud83e\udea8 Craft runes to serve as ammo for spells", + "body": "![Runes](https://cdn.modrinth.com/data/lP9Yrr1E/images/ff2a36a071003f9e0a3d1a877f0a4c937c5dd4e8.png \"\")\n------------------\n[![Modloader](https://img.shields.io/badge/Loader-Fabric-ecebe6?labelColor=263768&style=for-the-badge)](https://fabricmc.net)\n[![Fabric API required](https://img.shields.io/badge/Fabric%20API-REQUIRED-ecebe6?labelColor=263768&style=for-the-badge)](https://www.curseforge.com/minecraft/mc-mods/fabric-api)\n![Availability](https://img.shields.io/badge/Available-1.19.2-ecebe6?labelColor=263768&style=for-the-badge)\n\n![Environment: Client](https://img.shields.io/badge/CLIENT%20SIDE%20INSTALLATION-REQUIRED-ecebe6?labelColor=263768&style=for-the-badge)\n![Environment: Server](https://img.shields.io/badge/SERVER%20SIDE%20INSTALLATION-REQUIRED-ecebe6?labelColor=263768&style=for-the-badge)\n[![Discord](https://img.shields.io/discord/973561601519149057.svg?label=&logo=discord&logoColor=ffffff&color=7389D8&labelColor=6A7EC2&style=for-the-badge)](https://discord.gg/KN9b3pjFTM)\n### \u2615\ufe0f Support me on [Ko-Fi](https://ko-fi.com/daedelus \"\"), if you like my project\n\n‌\n\n# \u26a1\ufe0f Getting started\n\nRunes are typically crafted out of Cobblestone and a some material that is relevant to the specific rune.\n\nRunes have shapeless recipes, can be crafted in hand or at a regular crafting table.\n\n![Crafting in hand](https://cdn.modrinth.com/data/lP9Yrr1E/images/a8b67ce423d5d7e4c5a7afe9543516cf7aa71118.png)\n\nThe most efficient way to craft runes, is to use a Rune Crafting Altar.\n\n![Rune crafting altar recipe](https://cdn.modrinth.com/data/lP9Yrr1E/images/e5227e3f641ed26a2e681bb2a17b8462ed6b2146.png)\n\nAll runes have the same recipe on the Rune Crafting Altar, but provide more runes for the same amount of ingredients.\n\n![Crafting runes at altar](https://cdn.modrinth.com/data/lP9Yrr1E/images/5774b38167096ed8ff84c3c8198665c9452008b2.png)\n\n## Runes\n\n![Runes](https://cdn.modrinth.com/data/lP9Yrr1E/images/d7a6306a13b913e29792ded52ab49d7222345bb7.png)\n\nRunes can be crafted using the following ingredients\n- \ud83d\udd2e Arcane - Amethyst\n- \ud83d\udd25 Fire - Coal\n- \u2744\ufe0f Frost - Snowball\n- \ud83d\udc9a Healing (not available yet)\n- \u26a1\ufe0f Lightning (not available yet)\n- \ud83d\udc7b Soul (not available yet)", + "body_url": null, + "published": "2022-12-23T16:36:57.789730Z", + "updated": "2024-06-19T18:07:54.856725Z", + "approved": "2022-12-23T22:52:50.683771Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 491531, + "followers": 177, + "categories": [ + "magic" + ], + "additional_categories": [ + "adventure" + ], + "loaders": [ + "fabric" + ], + "versions": [ + "GccABJXw", + "wuTjM8Bj", + "E3Kis28m", + "bBtYbqvd", + "nrfgbVmW", + "Ri6wVePT", + "VDec3KMz", + "E6myX7Vd", + "16kMBd2f", + "tBZ8XKQz", + "VytcY0JM", + "Z915LCkR" + ], + "icon_url": "https://cdn.modrinth.com/data/lP9Yrr1E/cfe4491b8f0353d278dbfef95d4cd55874ebc5c5.png", + "issues_url": "https://github.com/ZsoltMolnarrr/Runes/issues", + "source_url": "https://github.com/ZsoltMolnarrr/Runes", + "wiki_url": null, + "discord_url": "https://discord.gg/KN9b3pjFTM", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/lP9Yrr1E/images/5774b38167096ed8ff84c3c8198665c9452008b2.png", + "featured": false, + "title": "Altar crafting", + "description": null, + "created": "2022-12-23T22:13:27.232354Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/lP9Yrr1E/images/a8b67ce423d5d7e4c5a7afe9543516cf7aa71118.png", + "featured": false, + "title": "Hand crafting", + "description": null, + "created": "2022-12-23T22:13:29.035966Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/lP9Yrr1E/images/d7a6306a13b913e29792ded52ab49d7222345bb7.png", + "featured": false, + "title": "Rune List", + "description": null, + "created": "2022-12-23T22:13:29.996660Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/lP9Yrr1E/images/e5227e3f641ed26a2e681bb2a17b8462ed6b2146.png", + "featured": false, + "title": "Altar recipe", + "description": null, + "created": "2022-12-23T22:13:28.139806Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/lP9Yrr1E/images/ff2a36a071003f9e0a3d1a877f0a4c937c5dd4e8.png", + "featured": false, + "title": "Icon and title", + "description": null, + "created": "2022-12-23T22:13:31.179782Z", + "ordering": 0 + } + ], + "color": 9275782, + "thread_id": "lP9Yrr1E", + "monetization_status": "monetized" + }, + "simplyskills-1.5.0+1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20", + "1.20.1" + ], + "id": "lyvwxqAy", + "slug": "simply-skills", + "project_type": "mod", + "team": "IbeQpuaJ", + "organization": "KpEDz87R", + "title": "Simply Skills", + "description": "A comprehensive skill tree mod with a focus on combat specialisations (classes)", + "body": "\n![Simply Skills - A comprehensive skill tree mod](https://imgur.com/GT9W3MZ.png)\n[![Watch the video](https://img.youtube.com/vi/Pro04cpU9a4/maxresdefault.jpg)](https://youtu.be/Pro04cpU9a4)\n\n**REQUIRED:** - [Pufferfish's Skills](https://www.curseforge.com/minecraft/mc-mods/puffish-skills) - [Cloth Config](https://www.curseforge.com/minecraft/mc-mods/cloth-config) - [Spell Engine](https://www.curseforge.com/minecraft/mc-mods/spell-engine) - [Spell Power Attributes](https://www.curseforge.com/minecraft/mc-mods/spell-power) -\n\n \nAdditional specialisation requirements: \nCrusader - [Paladins and Priests](https://www.curseforge.com/minecraft/mc-mods/paladins-and-priests)\n\nTranslation Datapacks\n\n[Chinese](https://modrinth.com/datapack/simply-skills-chinese-localizaion) (By WhiteBiggy)\n\n**When installing for Minecraft 1.19.2, backup and delete the 'puffish_skills' config folder. This is required for Simply Skills to generate files. (Not needed for 1.20+ versions)**\n\n### **Features**\n\nSimply Skills provides a combat oriented skill tree for Fabric, complete with unique passive skills, specialisations, and signature abilities.\n\nDriven by a vision to enrich combat encounters within Minecraft, Simply Skills harnesses the power of the [Spell Engine](https://www.curseforge.com/minecraft/mc-mods/spell-engine) & [Spell Power Attributes](https://www.curseforge.com/minecraft/mc-mods/spell-power) framework (created by Daedelus). By adopting this framework, players are empowered with distinctive skill sets that enable them to stand out among their peers and fully immerse themselves in the class fantasy they desire.\n\n#### **- Passive Skills -**\n\nUnlike the typical stat increase nodes on the tree, Passive Skills provide you with unique passive abilities that alter game mechanics in unique and meaningful ways.\n\n#### **- Specialisations -**\n\nSpecialisations can be unlocked by working your way through the base skill tree, until you reach a specialisation path. Once a specialisation path has been chosen, you will unlock an additional seperate skill tree that contains abilities and skills unique to your chosen specialisation. You may only have one specialisation unlocked at a time.\n\n#### **- Signature Abilities -**\n\nSignature Abilities, unlocked by advancing to a specialisation path, provide you with unique active abilities that can help to turn the tide of battle. These abilities can often be further enhanced and customised via passive nodes in the relevant specialisation skill tree. Due to their power, these abilities have an internal cooldown. (default keybind 'V')\n\n#### **- Respecialisation -**\n\nYour base skill tree can be reset by using a Malevolent Manuscript. This will refund all points spent in the tree. \nIf you have a specialisation unlocked at the time of use, this will also erase all points spent within the specialisation tree. The points lost will be gone forever, so choose carefully.\n\n### **Roadmap**\nSubject to change\n\nQ4 2023: Ascendancy Tree\n- Additional late-game player progression\n\nQ1 2024: Additional Specialisations\n- Necromancer & Shaman\n \n\n \n\n \n\n \n\nWant to play with Simply Skills on a server with friends? How about considering a server from BisectHosting? They're already set up and ready to go!\n\n[![Sponsor Banner with link](https://www.bisecthosting.com/partners/custom-banners/9deaa8f0-11c2-41f1-8f4f-32d2493b0912.png)](https://www.curseforge.com/linkout?remoteUrl=https://www.bisecthosting.com/Timefall)\n\n## Other Timefall Projects\n\n[![MC Dungeons: Weapons Icon and Link](https://media.forgecdn.net/avatars/thumbnails/308/444/64/64/637391793275773439.png)](https://www.curseforge.com/minecraft/mc-mods/mcdw) [![MC Dungeons: Armor Icon and Link](https://media.forgecdn.net/avatars/thumbnails/338/757/64/64/637478036163612181.png)](https://www.curseforge.com/minecraft/mc-mods/mcda) [![MC Dungeons: Artifacts Icon and Link](https://media.forgecdn.net/avatars/thumbnails/376/214/64/64/637552306860876392.png)](https://www.curseforge.com/minecraft/mc-mods/mcdar) [![MC Story Mode Armors [Forge/Fabric] Icon and Link](https://media.forgecdn.net/avatars/thumbnails/338/758/64/64/637478036255285039.png)](https://www.curseforge.com/minecraft/mc-mods/mcsa) [![Golden Steak [Forge/Fabric] Icon and Link](https://media.forgecdn.net/avatars/thumbnails/327/835/64/64/637450546891244840.png)](https://www.curseforge.com/minecraft/mc-mods/golden-steak) [![Headshot [Forge] Icon and Link](https://media.forgecdn.net/avatars/thumbnails/445/725/64/64/637701988173482863.png)](https://www.curseforge.com/minecraft/mc-mods/headshot-forge) [![Save Gear on Death Icon and Link](https://media.forgecdn.net/avatars/thumbnails/314/883/64/64/637413896008638214.png)](https://www.curseforge.com/minecraft/mc-mods/save-gear-on-death) [![Mob Summoning Icon and Link](https://media.forgecdn.net/avatars/thumbnails/403/477/64/64/637612669859111051.png)](https://www.curseforge.com/minecraft/mc-mods/mob-summoning) [![Diamond Shards (Fabric) Icon and Link](https://media.forgecdn.net/avatars/thumbnails/285/765/64/64/637302148280645235.png)](https://www.curseforge.com/minecraft/mc-mods/diamond-shards-fabric) \n \n[![Interchangeable Icon and Link](https://media.forgecdn.net/avatars/thumbnails/610/959/64/64/637994077463228576.png)](https://www.curseforge.com/minecraft/mc-mods/interchangeable) [![Loot Config Icon and Link](https://media.forgecdn.net/avatars/thumbnails/608/296/64/64/637987375628720297.png)](https://www.curseforge.com/minecraft/mc-mods/loot-config)\n\nMod Icon drawn by Dream Studio AI art with prompt: Pixel art Treasure chest. \nThe icons for MCDW, MCDA, MCDAR, and MCSA were all made by [SeaOfPixels](https://www.curseforge.com/linkout?remoteUrl=https%253a%252f%252fpowerups4u.wixsite.com%252fseaofpixels), maker of the [New Default+ Resource Pack](https://www.curseforge.com/minecraft/texture-packs/newdefaultplus).\n", + "body_url": null, + "published": "2023-10-21T11:14:07.438380Z", + "updated": "2024-06-30T07:36:59.724558Z", + "approved": "2023-10-22T02:27:35.554747Z", + "queued": "2023-10-21T11:33:31.689016Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-Timefall-Development-License-1.2", + "name": "", + "url": "https://legacy.curseforge.com/project/890301/license" + }, + "downloads": 91860, + "followers": 272, + "categories": [ + "magic" + ], + "additional_categories": [ + "adventure", + "game-mechanics" + ], + "loaders": [ + "fabric" + ], + "versions": [ + "H0DKonQV", + "VSQBIAmB", + "umO0ZDJS", + "oyyb7bmU", + "p5JkGazW", + "D7KQabYc", + "YZtNaXW7", + "aEHjKGnS", + "JysWbSrp", + "DAeNrgv2", + "B0uYOxSc", + "pux7L5vF", + "vygLlV3L", + "osE0u01b", + "Z3Ry7z6n", + "AfkYOsPb", + "oWdYf42D" + ], + "icon_url": "https://cdn.modrinth.com/data/lyvwxqAy/58c7f6aacbd9efce7c98480b1169a692a8282dc7.png", + "issues_url": "https://github.com/Sweenus/SimplySkills/issues", + "source_url": "https://github.com/Sweenus/SimplySkills", + "wiki_url": null, + "discord_url": "https://discord.gg/tRUdaHx7gG", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://legacy.curseforge.com/linkout?remoteUrl=https%253a%252f%252fko-fi.com%252fsweenus" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/lyvwxqAy/images/0f0ce8c87dd9257a6156f02d4ef95acb39660749.png", + "featured": true, + "title": "Skill Tree Preview", + "description": null, + "created": "2023-10-21T11:31:10.259457Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/lyvwxqAy/images/b903178775bbfb5e5ed8e887d309dfd8a2f0f853.png", + "featured": false, + "title": "Skill Tree Preview #2", + "description": null, + "created": "2023-10-21T11:31:26.106729Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/lyvwxqAy/images/e7512ee9a7b7de3f54112c586029b6eb2efa1451.png", + "featured": false, + "title": "Skill Tree Preview #3", + "description": null, + "created": "2023-10-21T11:31:39.299823Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/lyvwxqAy/images/f9227ca4f634564875f4461f864976ceb4db2a66.png", + "featured": false, + "title": "Skill Tree Preview #4", + "description": null, + "created": "2023-10-21T11:31:55.435751Z", + "ordering": 0 + } + ], + "color": 526086, + "thread_id": "FmTLGqEK", + "monetization_status": "monetized" + }, + "simplyswords-fabric-1.55.0-1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.20", + "1.20.1" + ], + "id": "bK3Ubu9p", + "slug": "simply-swords", + "project_type": "mod", + "team": "G0gE0pDJ", + "organization": "KpEDz87R", + "title": "Simply Swords", + "description": "Adds Spears, Glaives, Chakrams, Katanas, Greathammer/axes, Rapiers, and many more weapons!", + "body": "![enter image description here](https://img.shields.io/badge/ENVIRONMENT-CLIENT%20&%20SERVER-orange?style=for-the-badge&logo=)\n![enter image description here](https://img.shields.io/badge/ARCHITECTURY-REQUIRED-orange?style=for-the-badge&logo=)\n![Discord](https://img.shields.io/discord/1020119045925773382?color=5865f2&label=%20&logo=Discord&logoColor=ffffff&style=for-the-badge)\n

\n\n![Simply Swords](https://imgur.com/7FSLYtk.gif)\n![Weapon Variants: Simply Swords adds 14 unique weapon variants, each with differing playstyles and attack animations when paired with Better Combat. Throwable chakrams, blazing fast twinblades, cleaving greataxes, and much more!](https://imgur.com/eOWyCv6.gif)\n![Unique Weapons: Opening any chest throughout your adventures yields a chance to obtain unique weaponry with powerful abilities. These weapons cannot be crafted.](https://imgur.com/iduZbq5.gif)\n![Mod Support: Support for Mythic Metals and Gobber, with more than 200 individual weapons.](https://imgur.com/wNQ0qRk.gif)\n![Recommend Better Combat - for unique weapon animations.](https://imgur.com/H8BUkyQ.png)\n![Recommend Patchouli - for in-game documentation.](https://imgur.com/WfWziAG.png)\n![Additional mod support for LevelZ, Gobber, and Mythic Metals.](https://imgur.com/hHoFbQt.png)\n![Requires Architectury - Required dependency.](https://imgur.com/I2coWxr.png)\n\n\nPrefer an alternate look? Try the [Yourscraft resourcepack + Simply Swords addon](https://www.curseforge.com/minecraft/texture-packs/yourscraft/files/all)\n\nWant to play with Simply Swords on a server with friends? How about considering a server from BisectHosting? They're already set up and ready to go!\n\n[![Sponsor Banner with link](https://www.bisecthosting.com/partners/custom-banners/9deaa8f0-11c2-41f1-8f4f-32d2493b0912.png)](https://www.curseforge.com/linkout?remoteUrl=https://www.bisecthosting.com/Timefall)\n\n## Other Timefall Projects\n\n[![MC Dungeons: Weapons Icon and Link](https://media.forgecdn.net/avatars/thumbnails/308/444/64/64/637391793275773439.png)](https://www.curseforge.com/minecraft/mc-mods/mcdw) [![MC Dungeons: Armor Icon and Link](https://media.forgecdn.net/avatars/thumbnails/338/757/64/64/637478036163612181.png)](https://www.curseforge.com/minecraft/mc-mods/mcda) [![MC Dungeons: Artifacts Icon and Link](https://media.forgecdn.net/avatars/thumbnails/376/214/64/64/637552306860876392.png)](https://www.curseforge.com/minecraft/mc-mods/mcdar) [![MC Story Mode Armors [Forge/Fabric] Icon and Link](https://media.forgecdn.net/avatars/thumbnails/338/758/64/64/637478036255285039.png)](https://www.curseforge.com/minecraft/mc-mods/mcsa) [![Golden Steak [Forge/Fabric] Icon and Link](https://media.forgecdn.net/avatars/thumbnails/327/835/64/64/637450546891244840.png)](https://www.curseforge.com/minecraft/mc-mods/golden-steak) [![Headshot [Forge] Icon and Link](https://media.forgecdn.net/avatars/thumbnails/445/725/64/64/637701988173482863.png)](https://www.curseforge.com/minecraft/mc-mods/headshot-forge) [![Save Gear on Death Icon and Link](https://media.forgecdn.net/avatars/thumbnails/314/883/64/64/637413896008638214.png)](https://www.curseforge.com/minecraft/mc-mods/save-gear-on-death) [![Mob Summoning Icon and Link](https://media.forgecdn.net/avatars/thumbnails/403/477/64/64/637612669859111051.png)](https://www.curseforge.com/minecraft/mc-mods/mob-summoning) [![Diamond Shards (Fabric) Icon and Link](https://media.forgecdn.net/avatars/thumbnails/285/765/64/64/637302148280645235.png)](https://www.curseforge.com/minecraft/mc-mods/diamond-shards-fabric) \n \n[![Interchangeable Icon and Link](https://media.forgecdn.net/avatars/thumbnails/610/959/64/64/637994077463228576.png)](https://www.curseforge.com/minecraft/mc-mods/interchangeable) [![Loot Config Icon and Link](https://media.forgecdn.net/avatars/thumbnails/608/296/64/64/637987375628720297.png)](https://www.curseforge.com/minecraft/mc-mods/loot-config)\n\nMod Icon drawn by Dream Studio AI art with prompt: Pixel art Treasure chest. \nThe icons for MCDW, MCDA, MCDAR, and MCSA were all made by [SeaOfPixels](https://www.curseforge.com/linkout?remoteUrl=https%253a%252f%252fpowerups4u.wixsite.com%252fseaofpixels), maker of the [New Default+ Resource Pack](https://www.curseforge.com/minecraft/texture-packs/newdefaultplus).\n\n
\nTranscription\n\n## Simply Swords\n\n- Weapon Variants: Simply Swords adds 14 unique weapon variants, each with differing playstyles and attack animations when paired with Better Combat. Throwable chakrams, blazing fast twinblades, cleaving greataxes, and much more!\n- Unique Weapons: Opening any chest throughout your adventures yields a chance to obtain unique weaponry with powerful abilities. These weapons cannot be crafted.\n- Mod Support: Support for Mythic Metals and Gobber, with more than 200 individual weapons.\n- Recommend Better Combat - for unique weapon animations.\n- Recommend Patchouli - for in-game documentation.\n- Additional mod support for LevelZ, Gobber, and Mythic Metals.\n- Requires Architectury - Required dependency.\n
", + "body_url": null, + "published": "2022-08-15T11:16:24.811878Z", + "updated": "2024-04-12T11:01:12.898452Z", + "approved": "2023-04-13T22:37:52.700211Z", + "queued": "2023-04-06T10:49:58.384320Z", + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LicenseRef-Custom", + "name": "", + "url": "https://legacy.curseforge.com/project/659887/license" + }, + "downloads": 859457, + "followers": 745, + "categories": [ + "equipment", + "magic" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "2sgmQo2H", + "GUzv5CZa", + "2yn4Hek4", + "QrjlVoF9", + "4vB1cBxm", + "XWc726wT", + "DLWQeOnM", + "TYObJjpB", + "cpCt2If8", + "4Hew8TDl", + "bTYWivnX", + "kCq99dpS", + "wE4zlYZ9", + "nrM6qbPA", + "QHdhXOjc", + "oT5Sz7Kh", + "TRPVNsot", + "D5bJ0TEN", + "MYypU4FF", + "hPdFeLKk", + "7yCUmPOx", + "uYi9DbA9", + "EacHZNZy", + "rps4uVSE", + "L6rQaqot", + "RY01w43m", + "y40azpbG", + "G1Qc85sK", + "O5z47j3o", + "9wGYJxJ6", + "DVJDBIZI", + "kBPw7G3T", + "U5L2dDzf", + "gWAEJxe2", + "98W9mj8s", + "NOcc28w6", + "g5d0XoQx", + "J2IfRmGU", + "rPGfJpTu", + "3A9Wtnbk", + "PqbnWTpi", + "BC6DjWuW", + "UL4GAutE", + "3iVwwkbX", + "jxcDwi6L", + "49zrERp3", + "PcvdlGE4", + "nFgSY6xJ", + "FFYZCeYi", + "XfM8u6C0", + "FkeIJVDU", + "1a861q8F", + "AgLeIoxa", + "NDVND57O", + "9VStH3JK", + "fLxXk17R", + "YFP681PN", + "vkH2m9RV", + "R7Hoe0ec", + "Cafw96kx", + "98dA86yB", + "r4QspsTf", + "AY99tna8", + "kPfyoZ6S", + "zweFPP5X", + "HuTqnrx2", + "iBt9TSyg", + "uybRSo1W", + "p9jedZay", + "YIScsMtq", + "QPvXn46d", + "EvFZh7u0", + "bRyxkjAA", + "g5xXt2WB", + "HGnYA3u2", + "tjD92joH", + "8S5n6bjW", + "18gL8I3z", + "8BwbVzq2", + "mmKCOuVT", + "r5QBtUE9", + "XmUCc1mp" + ], + "icon_url": "https://cdn.modrinth.com/data/bK3Ubu9p/02acc4786eb1695f6496aff5403b331a4784bf65.png", + "issues_url": "https://github.com/Sweenus/SimplySwords/issues", + "source_url": "https://github.com/Sweenus/SimplySwords", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/bK3Ubu9p/images/01bcec1ea6fc975e6ca31a2e04de3bf5e9ff2339.jpeg", + "featured": false, + "title": "Soulrender", + "description": null, + "created": "2022-09-19T01:29:31.969099Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/bK3Ubu9p/images/085e6143d0749caf803b3cca794aea54f80fea0c.jpeg", + "featured": false, + "title": "Emberblade", + "description": null, + "created": "2022-09-19T01:29:29.631928Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/bK3Ubu9p/images/0a2baa5a28d35a9e18deda8cc1a04420ff08d509.gif", + "featured": false, + "title": "Soulstealer", + "description": null, + "created": "2022-09-24T08:11:44.176681Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/bK3Ubu9p/images/0cd2879cd81ba30ae95076b243a75d973c7e36d8.png", + "featured": false, + "title": "Sword Variants", + "description": null, + "created": "2022-08-15T11:16:21.776977Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/bK3Ubu9p/images/0dd3d1284fa65eace85ee94c69306b6ce2d70437.png", + "featured": false, + "title": "Banner", + "description": null, + "created": "2022-08-15T11:16:21.776977Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/bK3Ubu9p/images/15fd24f913da9bac5e408a3b1c8e56456f0864e6.gif", + "featured": false, + "title": "Bramblethorn", + "description": null, + "created": "2022-09-19T01:29:28.667083Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/bK3Ubu9p/images/3ed8044bfa0a13391dc61fe38ec5fee86e10d666.gif", + "featured": false, + "title": "Brimstone Claymore", + "description": null, + "created": "2022-08-15T11:16:21.776977Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/bK3Ubu9p/images/4bb94554715980e0facbff1bc12be4b3ceef8129.gif", + "featured": false, + "title": "Longsword of the Plague", + "description": null, + "created": "2022-08-15T11:16:21.776977Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/bK3Ubu9p/images/4c6012de8437af9056e7b9921cb6452ce045de82.gif", + "featured": false, + "title": "Storm's Edge", + "description": null, + "created": "2022-09-19T01:29:34.388761Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/bK3Ubu9p/images/5bef27477683de3b0957ebb1b02ca0d12a58973b.png", + "featured": false, + "title": "Runic Weapons", + "description": null, + "created": "2022-09-19T01:29:22.221280Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/bK3Ubu9p/images/7f8412146b3b5792c9c9aaecb0d43849a04ef977.jpeg", + "featured": false, + "title": "Mjolnir", + "description": null, + "created": "2022-09-19T01:29:30.673211Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/bK3Ubu9p/images/81a6fb78cbddd92d45c67885ea258e907f369b4a.png", + "featured": false, + "title": "Unique Weapons Header", + "description": null, + "created": "2022-08-15T11:19:59.423520Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/bK3Ubu9p/images/89c7cd515b834a0dcd6bcfd1d25a02bd7397ea12.png", + "featured": false, + "title": "Unique Weapons", + "description": null, + "created": "2022-09-19T01:29:23.974618Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/bK3Ubu9p/images/951bb95b13a991bc45cc3fe39ec814d107cbc27c.gif", + "featured": false, + "title": "The Watcher", + "description": null, + "created": "2022-08-15T11:16:21.776977Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/bK3Ubu9p/images/a8c87d1ed72fa4f7e802f7a393be2a77ddb891a5.gif", + "featured": false, + "title": "Runic Variants", + "description": null, + "created": "2022-08-15T11:16:21.776977Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/bK3Ubu9p/images/d9f344204e1decfad13b08a11101636ac55cb3a5.png", + "featured": false, + "title": "Uniques", + "description": null, + "created": "2022-09-24T08:11:39.175581Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/bK3Ubu9p/images/fe3bcc2e75c3addfb586dda284caf3d761ca5867.png", + "featured": false, + "title": "Weapon Types", + "description": null, + "created": "2022-09-19T01:29:20.509417Z", + "ordering": 0 + } + ], + "color": 394245, + "thread_id": "bK3Ubu9p", + "monetization_status": "monetized" + }, + "smallships-fabric-1.20.1-2.0.0-b1.4": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19.2", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "rGWEHQrP", + "slug": "small-ships", + "project_type": "mod", + "team": "9XduuTDC", + "organization": null, + "title": "Small Ships", + "description": "Vanilla friendly Ships for Minecraft. Now with cannons!", + "body": "\"\"\n\n

Showcase

\n

\"\"

\n

\"\"

\n

\"\"

\n

Want to host a server to play Small Ships with your friends?

\n

\"\"

\n

Rent your own minecraft server here

\n

More information on how to set it up here

\n

Join my Discord!

\n

\"\"

\n

check out my other mods:

\n

\"\"

\n

Hire Villager Workers and let them farm, mine or even fish for you!

\n

\"\"

\n

Recruit Villagers and command them into war!

\n

Explanation

\n

Place the ship far away from you, into water. They need space to spawn.

\n

Use Right Click to sit in the ship.

\n

Whilesitting in the Ship:   

\n

Press \"R\" to open/close the Ships Sail. 

\n

Or Press \"W\" to increase and \"S\" to decrease the Sail.

\n

In Thrid Person View with F5 , scroll with you Mousewheel to change the distance of the View.

\n

To dismount a entity from the ship, right-click the entity.

\n

To open the Inventory outside of the ship,  use crouch+right-click on the ship.

\n

Cannons:

\n

To add a cannon on your ship you need to right click the ship with a cannon in your hand.

\n

To shoot the cannon, you need to look in the direction of the cannon and press \"space\", while sitting in the ship. Note that you need to have a round shot in the ships inventory.

\n

The Key-Bind can be changed in the options. To remove a cannon, right-click the ship with a pickaxe.

\n\n

Detailed Features

\n

Ship performance:
In terms of ship performance, cold-water ships will be 10% faster in cold water biomes but 10% slower in warm water biomes. Conversely, warm-water ships will be 10% faster in warm water biomes but 10% slower in cold water biomes. It's important to note that the speed of the ships will also be affected by the number of cannons on board, reducing speed by 2.5% per cannon. Additionally, cargo on board can decrease the ship's speed by up to 10%.
 
Sail coloring: You can customize sails by coloring them with dye items. Simply right-click the ship with the dye in your hand.

\n

Ship repairing: You can repair your ship with iron nuggets and planks. Simply right-click the ship with the iron nuggets in your hand, you need to have a good supply of planks in your inventory.

\n

Ship naming: You can name your ship with a name-tag. Simply right-click the ship with the name-tag in your hand.

\n

\n Leashing: (1.18.2 to 1.20.6) Leashing allows players to tether ships. Leashed ships cannot be directly controlled, and only ships without a player on the controller seat can be leashed.\n
\n \"\"\n

\n\n

Cog:

\n

The Cog is a medieval trade ship used in cold water biomes. It offers 108 item slots and can mount up to 4 cannons for defense. It can accommodate up to 5 passengers, including the captain. Although its maneuverability may not be the best, it is an excellent trading vessel with a top speed of 40 km/h and a sturdy hull strength of 300 hp.

\n

\"\"

\n\n

Brigg:

\n

The Brigg is another medieval two-masted trade ship designed for cold water biomes. It provides 162 item slots and can mount up to 6 cannons for defense. With space for up to 11 passengers, including the captain, it excels in both trading and naval battles. The Brig has a top speed of 45 km/h, good maneuverability, and a hull strength of 400 hp.

\n

\"\"

\n\n

Galley:

\n

The Galley is specifically designed for warm water environments and naval warfare. It has 54 slots for items, exceptional maneuverability, and a top speed of 40 km/h. With seating for 9 passengers, including the captain and hull strength of 200 hp, it proves to be a promising vessel in various situations.

\n

\"\"

\n\n

Drakkar:

\n

The Drakkar is specifically designed for cold water environments. It has 54 slots for items, exceptional maneuverability, and a top speed of 30 km/h. With seating for 11 passengers, including the captain and hull strength of 200 hp. Shields, also with banner patterns, can be attatched to grand additional defense. With its ice breaker abbility, it proves to be a promising vessel in cold and icy oceans.

\n

\"\"  

\n\n

Crafting

\n

Sail:

\n

\"\"

\n

Cannon:

\n

\"\"

\n

Cannon Ball:

\n

\"\"

\n

Cog:

\n

\"\"

\n

Brigg:
\"\"

\n

Galley:
\"\"

\n

Drakkar:
\"\"

\n\n

Small Ships Wiki

\n\n

Visit the wiki to get a better overview!

\n
\n\n

Modpack permissions

\n

You are allowed to use the Small Ships Mod in any kind of modpack, as long as you link back to this page and don’t make any money of the modpack. undefined

", + "body_url": null, + "published": "2023-05-30T18:12:58.265976Z", + "updated": "2024-08-10T04:28:23.018480Z", + "approved": "2023-06-02T02:01:08.570223Z", + "queued": "2023-05-30T20:02:44.623179Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": "https://github.com/talhanation/smallships/blob/main/LICENSE.txt" + }, + "downloads": 620695, + "followers": 502, + "categories": [ + "adventure", + "game-mechanics", + "transportation" + ], + "additional_categories": [ + "storage" + ], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "lY6aTLex", + "ifdiiK5n", + "tgaNromu", + "8GADuXmF", + "yCMVmXA8", + "FfCQnlFv", + "7NC5jxi7", + "4FgK5kET", + "tBV6jETy", + "gdgLKgoE", + "7AynLTao", + "G0NxmCny", + "wIDaIEOx", + "MbPllJaI", + "eDiGUtv0", + "vimEHEaS", + "Y0MpyQRj", + "LOS5yzwp", + "oiFxhvO6", + "TW4wKw9R", + "w3ezhI33", + "YXoZH7b3", + "m6BFeC5S", + "H3Tkf5ua", + "RNtq70mF", + "9jjSnNle", + "UqfofiAm", + "1io804V6", + "32F5WDhx", + "IcmW8gsG", + "Y8u25WPx", + "CjQNcFP6", + "mrOuzDMg", + "AIuGGBBL", + "kD2YRqOW", + "G4wTMcUo", + "k16vITNY", + "PNDvbB0C", + "b5XQPKtI", + "dZZPGGZK", + "WoIYSm5h", + "gfnpAA1f", + "JjOceonv", + "VeF58TU9", + "dstBXIc6", + "WfYT53tr", + "glbP2RKV", + "evWrvZ6S", + "BMsGmSnW", + "IvVuuRDe", + "IVW11hBz", + "mfS5J1UN", + "kr52vTkg", + "bDJ9Hnpq", + "D5UZlu1q", + "h3HwyUfN", + "Xn9phSUY", + "xZcRn9eT", + "p1cdZ3mX", + "qsGJiimF", + "nVCiQ22z", + "nbT75YQq", + "Zahz9kAG", + "ayIrJjkX", + "nlqKKhuW", + "2OL3Ocru", + "iMJe3dXY", + "YhtW9Cfm", + "mkPF575j", + "xDH8EFcu", + "VFRUjSOM", + "wc4EC2t5", + "nxKntNLQ", + "x6w8l1U9", + "D8Faff3D", + "PVp3yvZq", + "58DKgNnY", + "gpbYUuEr", + "9SEso03a", + "9EGMSTSk", + "t0EDT8xV", + "jUw6tCOe", + "wm6kEM2Z", + "xfLg33LC", + "h35NEhqr", + "odeLf1Nd", + "BGd1zSFi", + "IUbLi1h9", + "vvLPNSk4", + "FuTAIwWT", + "Wa1yug8t", + "RHIfmfnH", + "YLqDP58k", + "TM8G3LMd", + "uhrjWDUT", + "YKGJLvID" + ], + "icon_url": "https://cdn.modrinth.com/data/rGWEHQrP/c558c0c537914ca7b14b9b877ca4d24d1d103153.png", + "issues_url": "https://discord.gg/nGDC7FEUfR", + "source_url": null, + "wiki_url": "https://github.com/talhanation/wiki/wiki/Small-Ships-Wiki", + "discord_url": "https://discord.gg/NG8vuDekTT", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/rGWEHQrP/images/907c9a9d7518a855ebf09605b35f2d39f4abc3b0.jpeg", + "featured": false, + "title": "sunset", + "description": "brigg sailing towards the horizon", + "created": "2023-05-30T20:02:37.796625Z", + "ordering": 0 + } + ], + "color": 3890586, + "thread_id": "rGWEHQrP", + "monetization_status": "monetized" + }, + "SmartBrainLib-fabric-1.20.1-1.14.2": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "PuyPazRT", + "slug": "smartbrainlib", + "project_type": "mod", + "team": "DSfXxkQM", + "organization": null, + "title": "SmartBrainLib", + "description": "A brain library for Minecraft, making the brain system easier to use and manage", + "body": "A brain library for Minecraft, making the brain system easier to use and manage.\n\n

What is this?

\n\nThe brain system in Minecraft is an almost cryptic new entity AI system that Mojang introduced to handle more complex mobs, and allow for more advanced entity handling.\n\nUnfortunately Mojang's implementation is lacking, and overly complex.\n\nAdditionally, it's also done in a rather inefficient way, which means that overall the system is not worth using in place of the existing goals system.\n\nThis library aims to overhaul the brain system, making it actually usable, and configurable.\n\nNote however, that the existing goal system will still be simpler at face value - the brain system is intended for more complex interactions, but it can also be fun to experiment with.\n\n

So what does SmartBrainLib do?

\n\nSBL is a multi-facet approach to the brain system, and will continue to expand and improve as I use it.\n\nHere are its main features:\n\n

Auto-handles memory types

\n\nDon't worry about having to work out which memory modules to register for your entity.\n\n

Dynamic sensors

\n\nSensors can now be dynamically configured and handled. This allows for much more advanced and flexible sensors\n\n

Advanced behaviours

\n\nUtilise built-in, or create new behaviours based on an extensible behaviour class, which builds in callbacks, predication, cooldowns, and more.\n\n

Runtime-safe behaviour modification

\n\nAdd, remove, and modify behaviours dynamically from an existing entity.\n\n

Optimisation

\n\nSBL replaces almost the entirety of the vanilla brain system's functions, using high-efficiency functions to remove the inefficiencies in as many areas as possible of the brain. Done right, an SBL entity could be even more efficient than one using goals!\n\n

Additional sensors, behaviours, and memory types

\n\nSBL builds in additional modules for use in any entity, with more to come over time.\n\n

Added utility functions

\n\nAs well as the expected brain functionality, SBL additionally adds additional helpers, such as:\n
    \n
  • Optimised level entity-getter functions
  • \n
  • Developer-friendly Random library
  • \n
  • Brain interface utility for adding/removing brain content from non-SBL entities
  • \n
\n\n

How do I use it?

\n\nThe library is documented on its
Wiki Page\n\n
\n
\n
\n\nIf you have issues or want to contribute, please jump on the Github Page and make your voice heard", + "body_url": null, + "published": "2022-12-17T12:17:52.593792Z", + "updated": "2024-07-08T11:20:36.002639Z", + "approved": "2022-12-18T04:07:43.279968Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MPL-2.0", + "name": "Mozilla Public License 2.0", + "url": null + }, + "downloads": 442663, + "followers": 119, + "categories": [ + "library", + "mobs", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "exjazZDg", + "71op6HqT", + "ysll7HpR", + "eO2xepQK", + "yg06oOBL", + "uvicGZEz", + "M7ktWGYQ", + "edbi1MqI", + "dwBqdXTr", + "mVxYjt2C", + "UV85Isda", + "TPUuRqId", + "7N07DeJa", + "5fHkAtan", + "a8k5dfeM", + "YtIoSE8Z", + "kIHNFgnN", + "LEkLts9l", + "nKzUoyO8", + "eyTnm1To", + "YuXSOitO", + "bLpKjCaQ", + "iKI7O10v", + "5cfIbMqV", + "j5XWlgk3", + "ItbW1raD", + "JI1HW5g1", + "l1gfkZbZ", + "Okj48Ibk", + "61jQHgGB", + "R8SV4kEf", + "diQfXwzz", + "TQ4ys3Av", + "rAWSa9XC", + "AzORYDU1", + "FH1MNWFQ", + "RC9fgR3J", + "mAriNnAC", + "EB0jfrC5", + "4XxIY1BG", + "F112BW8M", + "YJrpYN13", + "blvJQFdb", + "hww2X4x4", + "VgKI4whr", + "pcIY8pUw", + "QmXwJzyR", + "FGnzv2Lk", + "IBB8LO6M", + "Sf934AXj", + "6m8aUEBx", + "Wiuu8JU7", + "qNnjjZzo", + "QvPn3aLF", + "oLNiEUfG", + "KAMi0Ept", + "4p96t8Yd", + "zhZ3UUw6", + "aLYIaCqo", + "JJ4nopDF", + "rMDWa1ai", + "RLMA7zfB", + "9OZ7OJ3s", + "d5rNlXJS", + "vUPsJnRv", + "KtPqX3wy", + "mY9xu8va", + "oxXdjo3N", + "GPn70ZjT", + "A9OMmXN4", + "YcFmK3E8", + "Ki2pVyn2", + "Z4JV31SC", + "WPExnI9I", + "ZVT3Ovi9", + "MlmfuNAV", + "ZLWE52gx", + "a40zhjmt", + "4r56AcMw", + "j5TLOZUR", + "jnjeZofb", + "oBH3gOjh", + "HsBvnqEk", + "ghHJdLd3", + "XsqXgUo1" + ], + "icon_url": "https://cdn.modrinth.com/data/PuyPazRT/622163918cf3b62f4f0172962ac4205030e7074a.png", + "issues_url": "https://github.com/Tslat/SmartBrainLib/issues", + "source_url": "https://github.com/Tslat/SmartBrainLib", + "wiki_url": "https://github.com/Tslat/SmartBrainLib/wiki", + "discord_url": "https://discord.gg/Wk37XXgJN3", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/Tslat" + } + ], + "gallery": [], + "color": 693026, + "thread_id": "PuyPazRT", + "monetization_status": "monetized" + }, + "Sniffer+-fabric-1.20.1-0.3.0": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20", + "1.20.1", + "1.20.4" + ], + "id": "BVgHoKxg", + "slug": "hellions-sniffer+", + "project_type": "mod", + "team": "gLMGvR34", + "organization": null, + "title": "Hellion's Sniffer+", + "description": "A Sniffer expansion, adding new behaviors to the Sniffer, an ancient cave biome, and several new Sniffer-related plants.", + "body": "\n

\nWelcome to Hellion's Sniffer+! This is a 1.20 Expansion mod building on features surrounding the Sniffer. This includes new behaviors for the Sniffer itself; several new plants for it to dig up, including a new woodset; and an entirely new cave biome, housing all these wonders! Hop in and explore!\n

\n\n

\n\n- Sniffers now can be saddled and ridden\n- Sniffers can now have chests equipped\n- Sniffers with equipped chests will place dug up seeds in their chest\n- Sniffers can be given an Ominous Banner to carry you to the nearest Outpost\n- Several new plants including Ivy, Stone Pine Trees, and Fiddleferns\n- Torchflowers now emit light, earning themselves their name\n- And an entirely new cave biome, the Timeless Grotto\n\nI am developing this project completely on my own in my free time. If you would like to help support the work I do and get special benefits like early betas, special previews in the Discord, and a cosmetic in a future mod project I have planned, please consider becoming a Patron!\n\n\n\n

\nUse code \"hellion\" for 30% off your order with Nodecraft!\n\n\n\n\n\n", + "body_url": null, + "published": "2023-06-08T01:01:30.430221Z", + "updated": "2024-04-20T21:46:22.379002Z", + "approved": "2023-06-09T16:27:09.131666Z", + "queued": "2023-06-08T01:59:18.368599Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "Apache-2.0", + "name": "Apache License 2.0", + "url": null + }, + "downloads": 314701, + "followers": 235, + "categories": [ + "decoration", + "mobs", + "worldgen" + ], + "additional_categories": [ + "storage", + "transportation" + ], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "LqdPhvan", + "9m1J5pBy", + "G9D6trZd", + "DLjYM0KE", + "DYGKdYS4", + "v58Ox5MU", + "UJ29y5am", + "pJlIaMGq", + "V7DEKC4v" + ], + "icon_url": "https://cdn.modrinth.com/data/BVgHoKxg/0189c3ba37d9604218eb051e7d85dd098943d67f.png", + "issues_url": "https://github.com/Dariensg/Hellions-Sniffer-Plus/issues", + "source_url": "https://github.com/Dariensg/Hellions-Sniffer-Plus", + "wiki_url": null, + "discord_url": "https://discord.gg/xz4DXQ4exK", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/HellionGames" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/BVgHoKxg/images/434d70db24aa5a1d617e8c7c5377a4879fa56f3a.png", + "featured": true, + "title": "Timeless Grotto", + "description": "The Timeless Grotto, a new cave biome featuring all the ancient plants the Sniffer can dig up", + "created": "2023-06-08T01:58:37.245116Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/BVgHoKxg/images/e77e12d57cd7a3036e0c236bd85bb431046acb7e.png", + "featured": false, + "title": "New Plants", + "description": "The new plants are able to be found either in the Timeless Grotto or dug up by the Sniffer", + "created": "2023-06-08T16:28:14.546133Z", + "ordering": 0 + } + ], + "color": 798497, + "thread_id": "BVgHoKxg", + "monetization_status": "monetized" + }, + "sodium-extra-0.5.4+mc1.20.1-build.115": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.16.2", + "1.16.3", + "1.16.4", + "1.16.5", + "1.17", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "PtjYWJkn", + "slug": "sodium-extra", + "project_type": "mod", + "team": "EfhDgRdO", + "organization": null, + "title": "Sodium Extra", + "description": "A Sodium addon that adds features that shouldn't be in Sodium.", + "body": "# What is Sodium Extra?\nSodium Extra aims to bring most of OptiFine's eye-candy options to Sodium; in addition to providing some features such as visual bug fixes and other performance options that are not yet available on Sodium.\n\n# Features\nHere is a basic rundown of what this mod does.\n\n- Animations Settings (Control fire, water, lava, block animations and etc...)\n- Particles Settings (Control all types of particles, including ones from other mods)\n- Details Settings (Control sky, stars, sun/moon, weather, and much more)\n- Render Settings (Control fog, static entities, and other miscellaneous renderings)\n- Extra Settings (Display FPS, coordinates, toast notifications, clouds, and much more)\n\nSee a more detailed explanation of what features are included in Sodium Extra [here](https://github.com/FlashyReese/sodium-extra-fabric/wiki/Features).\n\n# Modpack Permissions\nThis is a free and open-source project; you can include it in your mod pack as long as you provide attribution!\n\n# Common Questions\n- **Do I need Sodium installed for this mod to work?** You will need to download Sodium for this mod to work.\n- **Can I re-host/upload this mod somewhere else?** Yes, as long as you provide the mod source code. Preferably if you message/ask me for permission about it first.\n- **Will you add x features to this mod?** No, unless I explicitly state that I will.\n- **I have more questions!** Join our [Discord](https://flashyreese.me/discord)!\n\n# Support the project\n[![Support me Ko-fi](https://i.imgur.com/FSNi7zk.png)](https://ko-fi.com/flashyreese)", + "body_url": null, + "published": "2021-02-17T04:37:04.928784Z", + "updated": "2024-06-14T02:35:57.892491Z", + "approved": "2021-02-17T04:37:04.928784Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 7919645, + "followers": 5696, + "categories": [ + "cursed", + "optimization", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "uFWdXpRc", + "fQlbGqah", + "E1Chj4yH", + "dA5kUtCN", + "qBwrXVDm", + "NDv7VmNM", + "L460MTe0", + "4RzKa4mY", + "NjwlXlbU", + "2X32poLf", + "K9lmo9hu", + "qGLCzjA2", + "9t9pgzTc", + "H7MDUukG", + "iChhfRqr", + "xph98Tt6", + "mskRjVNX", + "In6mnyuN", + "SlKhm70V", + "8aOUTxhP", + "gPzjZZuj", + "F8hFUYl1", + "ttrO1VBz", + "Rm4R3w92", + "sz9gF7BV", + "VN2ZNh3U", + "ayM5uEC0", + "PJ4CMlHv", + "sbn6gcHk", + "94EgQDeg", + "i2Nmjt90", + "CTXE2AKs", + "PnPHBaVy", + "9LvKUEYM", + "IBHsiw9F", + "7R4bmDHx", + "pKxxvfqr", + "THhTlwlR", + "fCTkvX2E", + "C4Ah6iqO", + "4hASygiF", + "tA6TDKYR", + "vYMuk2fC", + "yLv38Kes", + "DIcY6vej", + "C705535I", + "xYkvKUSC", + "9GqAP74m", + "nQ4I7m5V", + "n6VFgnC4", + "Epqrq6OM", + "xRv53DSs", + "CHnZwuLy", + "upfJqxrg", + "tXEG62IN", + "HqNshD3l", + "CFf3OHWs", + "uCddykP4", + "uy3WEIvn", + "i1IXAPlQ", + "xBm1fnBi", + "lyZvsCAT", + "xJ8SShUa", + "VkoIIaJU", + "GlEfyf5R", + "fvj3bKb0", + "yL4dOxzM", + "NKTWKANh", + "7bIiOq5p", + "Ihk94xIe", + "Z9F12IDt", + "3FVJYJsq", + "EROX4u0x", + "2mn0qHfs", + "1ha6EuaV", + "dGDpjLtu", + "o1MVdBA0", + "7Qpm7TfK", + "XVg96BXq", + "Bua36tz2", + "r5w0P2Aa", + "nLSk51d5", + "Qwl9yhs4", + "WtfLjBKR", + "MTxUvPFz", + "8DeIhGTv", + "mNSJsLuw", + "f0Pua8c0", + "X61cCJdB", + "wA35IJw8", + "Et3PybAh", + "1OzghAbl", + "DwCPxThW", + "Fo9beybz", + "YknbqkHe", + "O3qmYo1o", + "tmOX3d3q", + "kTxAMqAj", + "jeT8mcQT", + "KFJPGpgu", + "Tf56kC8G", + "dno0PvHr", + "jy7D3eLo", + "GGGuNLtT", + "UwpTYr4K", + "5KCYvoSI", + "80a0J5Cn", + "zgaajBnP", + "e8Jw5Pey", + "I7ggF6B5", + "M0ndiav7", + "5c9xAlhY", + "TJDWVdsb", + "6ethXWmk", + "YIMd9YPH", + "uuhVlRGv" + ], + "icon_url": "https://cdn.modrinth.com/data/PtjYWJkn/icon.png", + "issues_url": "https://github.com/FlashyReese/sodium-extra-fabric/issues", + "source_url": "https://github.com/FlashyReese/sodium-extra-fabric", + "wiki_url": "https://github.com/FlashyReese/sodium-extra-fabric/wiki", + "discord_url": "https://flashyreese.me/discord", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/flashyreese" + } + ], + "gallery": [], + "color": 16577485, + "thread_id": "PtjYWJkn", + "monetization_status": "monetized" + }, + "sodium-fabric-0.5.11+mc1.20.1": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.16.3", + "1.16.4", + "1.16.5", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "AANobbMI", + "slug": "sodium", + "project_type": "mod", + "team": "4reLOAKe", + "organization": null, + "title": "Sodium", + "description": "The fastest and most compatible rendering optimization mod for Minecraft", + "body": "**This mod is the result of thousands of hours of development, and is made possible thanks to players like you.** If you would like to show a token of your appreciation for my work, and help support the development of Sodium in the process, then consider [buying me a coffee](https://jellysquid.me/donate).\n\n\n\n---\n\n
\n \"Sodium\n

\n \n

\n
\n\nSodium is a powerful rendering engine and optimization mod for Minecraft 1.16+ which greatly improves performance and graphical quality. It boasts wide compatibility with the Fabric mod ecosystem when compared to other rendering-focused mods, and it does so without compromising on how the game looks, giving you that authentic block game feel.\n

\ud83d\udce5 Installation Guide

\n\n**Please make sure you read the Driver Compatibility section on our wiki before you install Sodium. It contains important instructions on how to prevent crashes and other performance problems.**\n\nSodium is a Fabric mod, which means it requires the [Fabric Loader](https://fabricmc.net/use). If you are using a third-party launcher, it probably has built-in functionality to automatically install mod loaders. Once you have installed Fabric Loader, you can simply place Sodium into your _mods folder_ like anything else.\n\nSome other mods (notably those which require Fabric API) may also require that [Indium](https://modrinth.com/mod/indium) is installed alongside Sodium.\n\n**Not sure if you installed the mod correctly?** Check your _Video Settings_ screen in Minecraft, which should show our new and improved user interface for changing settings.\n\n**Not sure how to configure the mod?** Don't worry, you probably don't need to. By default, Sodium will enable all optimizations which are supported on your system, giving you the best experience possible. You should generally only change video settings related to performance and other advanced features if you are experiencing issues.\n\n**Need even more performance?** By design, Sodium only optimizes the rendering code of Minecraft. You should also install our other mods, such as [Lithium](https://modrinth.com/mod/lithium) (for MC 1.15+) and [Phosphor](https://modrinth.com/mod/phosphor) (for MC <1.19), to optimize the other parts of your game. This is done so that players can pick and choose which mods they want to use, but we generally recommend using [our entire collection](https://modrinth.com/user/jellysquid3).\n\n

\u2705 Hardware Compatibility

\n\nWe only support graphics cards which have up-to-date drivers that are compatible with OpenGL 4.6. Most graphics cards released in the past 12 years are compatible. This includes the following hardware:\n\n- INTEL HD Graphics 500 Series (Skylake) or newer\n- NVIDIA GeForce 400 Series (Fermi) or newer\n- AMD Radeon HD 7000 Series (GCN 1) or newer\n \nIn some cases, older graphics cards may also work (so long as they have up-to-date drivers which have support for OpenGL 3.3), but they are not officially supported, and may not be compatible with future versions of Sodium.\n\nAndroid devices which use OpenGL translation layers (such as GL4ES, ANGLE, etc) are not supported and will very likely not work with Sodium. These translation layers do not implement required functionality and they suffer from underlying driver bugs which cannot be worked around.\n\nIf you are running into problems, you should make sure that your graphics drivers are up-to-date. Out-of-date graphics drivers are often the reason for most crashes, rendering bugs, and performance issues.\n\n# \ud83d\udc1b How to Report Issues\n\nPlease use the [issue tracker](https://github.com/CaffeineMC/sodium-fabric/issues) linked at the top of the page to report bugs, crashes, and other issues. Make sure you include information about the mods you are using, and attach any crash/log files you have.\n\n# \u2753 Frequently Asked Questions\n\nWe have a short wiki with some of the most frequently asked questions [here](https://github.com/CaffeineMC/caffeine-meta/wiki/FAQ). More likely than not, your question already has an answer here.\n\n# \u2699\ufe0f Technical details\n\nSo, how exactly does Sodium work? We obviously cannot just say that the game is magically faster without providing some kind of explanation. The following list tries to cover some of the most significant changes which are responsible for our performance improvements, but it's not complete or exhaustive of everything Sodium does.\n\n- We replace all of Minecraft's world rendering code with our own implementation that is built upon modern rendering techniques. For chunk rendering, we make use of _geometry batching_ and _draw pass consolidation_, which greatly reduces the amount of CPU overhead involved in rendering the world. Sodium isn't just an optimization mod... it's more like a rendering engine.\n\n- We use a much more compact format for world geometry, which allows for up to a ~40% reduction in the amount of video memory used by chunks. Additionally, we make use of a second culling pass to eliminate geometry which is facing away from the camera (but still within the camera's view) so that the GPU does not need to process hidden geometry. Together, these optimizations reduce video memory bandwidth requirements significantly, which is one of the game's biggest bottlenecks.\n\n- We use a fully-rewritten system for generating chunk geometry, including the biome colorization, lighting, and shading passes. This is often much faster than the vanilla code, which helps to make chunk loading faster and less CPU-intensive. ([before](https://streamable.com/3taw22), [after](https://streamable.com/4pesh2))\n\n- We use a custom threading implementation which ensures chunk updates are better able to take advantage of multi-core CPUs, which greatly reduces the lag spikes that are caused by placing/breaking blocks. ([before](https://streamable.com/lm5sp5), [after](https://streamable.com/nsdl0r))\n\n- We've written many optimizations for vertex building and transformation, which helps to speed up immediate-mode rendering. This noticeably improves performance in heavy scenes, such as when many entities are visible.\n\n- We've made numerous improvements to how the game manages memory and allocates objects, which in turn reduces memory consumption and lag spikes caused by garbage collector activity.\n\n- Animated textures which are not visible in the world are not updated, speeding up texture updating on most hardware (especially AMD cards.)\n\nMany people are used to performance optimization meaning that the game will look worse, but in our case, we actually improve the graphical fidelity of Minecraft in most situations.\n\n- Biome colors for blocks and fluids are smoothed across block faces, providing greatly improved graphical quality that is significantly less computationally intensive. ([comparison](https://cdn.modrinth.com/data/AANobbMI/images/6b0e58705156ba67a6d97a74b9f9ac05da69f502.webp))\n\n- Smooth lighting now works correctly on fluids and other special blocks ([comparison](https://cdn.modrinth.com/data/AANobbMI/images/d84313e6f57dc9e7896961dbd2dfc2689d482758.webp)) We also fix a number of graphical issues with block shading ([comparison](https://cdn.modrinth.com/data/AANobbMI/images/56c4599efcb529a19aed0e118caad4178d7fd540.webp)) which helps to make everything look smoother.", + "body_url": null, + "published": "2021-01-03T00:53:34.185936Z", + "updated": "2024-06-29T13:45:48.189812Z", + "approved": "2021-01-03T00:53:34.185936Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LicenseRef-Polyform-Shield-1.0.0", + "name": "", + "url": "https://github.com/CaffeineMC/sodium-fabric/blob/dev/LICENSE.md" + }, + "downloads": 17614423, + "followers": 15623, + "categories": [ + "optimization" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "yaoBL9D9", + "YAGZ1cCS", + "1b0GhKHj", + "80jYkEVr", + "xuWxRZPd", + "3JJvf9Kn", + "6YGRDUVT", + "Fz37KqRh", + "5JyduDNN", + "74Y5Z8fo", + "Yp8wLY1P", + "F79MzDJD", + "rAfhHfow", + "mnEhtGuH", + "Nr39FOaS", + "ObtU68vj", + "oYfJQ6lR", + "idtcaIVT", + "b4hTi3mo", + "vgceLbdH", + "hiO9bwqc", + "OkwCNtFH", + "6SSPmLc9", + "4OZL6q9h", + "bbP1qBMr", + "lhZYeXLf", + "zPwAvKCF", + "InGKdfel", + "pmgeU5yX", + "rUXIwGKA", + "xNJ0Mpbx", + "umKbm1Rp", + "Wzzjm5lQ", + "mhZtY2lR", + "4GyXKCLd", + "hLV8Q8uu", + "IZskON6d", + "qhg37WBD", + "dNHeFokL", + "QHGZ9XSU", + "dEpHs0Hg", + "ygf8cVZg", + "OwLQelEI", + "RncWhTxD" + ], + "icon_url": "https://cdn.modrinth.com/data/AANobbMI/icon.png", + "issues_url": "https://github.com/CaffeineMC/sodium-fabric/issues", + "source_url": "https://github.com/CaffeineMC/sodium-fabric", + "wiki_url": "https://github.com/CaffeineMC/sodium-fabric/wiki", + "discord_url": "https://caffeinemc.net/discord", + "donation_urls": [ + { + "id": "other", + "platform": "Other", + "url": "https://caffeinemc.net/donate" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/AANobbMI/images/d84313e6f57dc9e7896961dbd2dfc2689d482758.webp", + "featured": false, + "title": "Underwater Lighting Improvements", + "description": "Sodium fixes many graphical issues with smooth lighting while underwater.", + "created": "2023-06-25T21:35:39.891789Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/AANobbMI/images/6b0e58705156ba67a6d97a74b9f9ac05da69f502.webp", + "featured": false, + "title": "Biome Blending Improvements", + "description": "Sodium improves biome blending to use gradients across each block, making the effect look much smoother.", + "created": "2023-06-25T21:32:36.805733Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/AANobbMI/images/b681a9e87daa53a0e85336a894db70427007149b.webp", + "featured": false, + "title": "Fluid Rendering Improvements", + "description": "Sodium implements smooth lighting for all fluids, fixing a long-standing issue in Minecraft.", + "created": "2023-06-25T21:34:46.764479Z", + "ordering": 10 + }, + { + "url": "https://cdn.modrinth.com/data/AANobbMI/images/56c4599efcb529a19aed0e118caad4178d7fd540.webp", + "featured": false, + "title": "Block Shading Improvements", + "description": "Sodium greatly improves the shading of blocks, fixing a number of bugs while making block shadows look more smooth and consistent.", + "created": "2023-06-25T21:36:48.985787Z", + "ordering": 30 + }, + { + "url": "https://cdn.modrinth.com/data/AANobbMI/images/5ca2e8f6c72f3d543dd3dc95b706964c5678d80e.png", + "featured": false, + "title": "Sodium 0.5.2", + "description": "Sodium greatly optimizes the game's renderer to be faster and more efficient, which can often result in FPS improvements of 300% or more.", + "created": "2023-08-19T17:00:08.788447Z", + "ordering": 999 + }, + { + "url": "https://cdn.modrinth.com/data/AANobbMI/images/c39debea7fc623306e9c45148084585399fc59ee.webp", + "featured": false, + "title": "Sodium 0.4.1", + "description": "Sodium greatly optimizes the game's renderer to be faster and more efficient, which can often result in FPS improvements of 300% or more.", + "created": "2023-06-25T21:30:34.663388Z", + "ordering": 1000 + } + ], + "color": 8703084, + "thread_id": "AANobbMI", + "monetization_status": "monetized" + }, + "soulslike-weaponry-1.1.4.1-1.20.1-fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4" + ], + "id": "oX6SohLj", + "slug": "mariums-soulslike-weaponry", + "project_type": "mod", + "team": "bXjGYdNw", + "organization": null, + "title": "Marium's Soulslike Weaponry", + "description": "A minecraft mod that adds new bosses and legendary weapons", + "body": "![background](https://cdn.modrinth.com/data/cached_images/2bd1e5716ac8b0fa670286c50e301c828c52834a.png)\n

Features

\nWelcome to Soulslike Weaponry, a mod that adds over 40+ legendary weapons and multiple bosses to fight.\nThis mod aims to add more endgame content to Minecraft, namely legendary weapons with unique effects and challenging boss fights. When you kill bosses in this mod adds or the vanilla ones, namely the Wither or Ender Dragon, they will now drop a Lord Soul item, which you can use to craft most of the legendary weapons this mod adds. The mod is highly configurable through the config file. You can change everything from boss health, damage to weapon damage and ability cooldowns.\n\nThe weapons come from many different places, ranging from Norse mythology, the imagination, or other game titles. A list of all the weapons added can be found in the wiki, some of them include:\n- Bloodthirster, Comet Spear and the Darkin Blade from League of Legends\n- Moonlight Short/Greatsword, Dragonslayer Swordspear and Forlorn Scythe from Dark Souls\n- Blunderbuss, Gatling Gun, Whirligig Sawblade and Hunter Cannon from Bloodborne\n- Sword of Freyr, Mj\u00f6lnir and Skofnung from Norse Mythology\n- and more!\n\nThe mod also includes a parry mechanic with the shields and a posture meter that applies Posture Break effect on the target when filled. Guns and the Stagger enchant applies posture loss that fills this meter.\n\n

Dependencies

\nFabric API, Geckolib and AttributeFix are needed.\n\n

Bosses:

\n\n- The Decaying King\n - The Decaying King lives in the throne room of the demon city, the last remains of the ancient civilization from the nether after the entire civilization collapsed into the lava sea. This cursed monstrosity wields The Darkin Blade, and has many deadly attacks to look out for. Killing it makes it drop the Darkin Blade, a Lord Soul and the Withered Demon Heart.\n- Old Champion's Remains\n - A boss living in the Old Champion's Graves, this skeleton figure has been possessed by another being, namely The Frenzied Shade. The Old Champion will switch between a defensive state behind his shield and an aggressive state by relentlessly swinging at you with his sword. After killing the Old Champion, it will drop the Draugr sword, and the Frenzied Shade will emerge. This creature is the one possessing the Lord Soul, so make sure to stay alert when killing the Old Champion!\n- The Returning Knight\n - The Returning Knight is a slow, but hard hitting boss with a few attacks up his sleeve. First of all, all projectiles around him will have no effect on him, and will rather be reflected back in the direction they came from, so be careful with that Hunter Cannon! At half health, he will use his last forces of moonlight to be Unbreakable, slamming his arm on his chest, gaining Resistance. After killing The Returning Knight, he will drop moonstone, Nightfall, a Lord Soul and the Arkenstone.\n- Fallen Icon\n - By using the Essence of Eventide on the Old Moon Altar, you will return the true essence back to it's original body. This will result in the summoning of the Fallen Icon, a fierce empowered version of the Returning Knight with a fast and dangerous second phase. When summoned, Unbreakable will be used right away, affecting all nearby players with Weakness, Nausea and Slowness. The boss does not get any bonus Resistance unlike Returning Knight, and since the true soul has been returned to the vessel, some of the dark power has been slightly suppressed, making the boss unable to reflect projectiles, but it is still immune to them! Upon it's death, the Arkenstone will shatter, and it will instead drop the Essence of Luminescence, the crafting recipe for creating the Pure Moonlight Greatsword.\n- Monarch of Chaos\n - The Monarch of Chaos is a powerful mage wielding the accursed wand, the Withered Wabbajack. Additionally, it wears both the Crown of Chaos and the Cape of Chaos, two items that that will be dropped upon it's death with the Withered Wabbajack. It can be summoned by using the Shard of Uncertainty (which is dropped by the Wither) on the Blackstone Pedestal block. The Monarch of Chaos is a fast attacking and chaotic boss, hence it's name, having it's attack cooldown reduced lower and lower based on it's missing health. Thanks to the Cape of Chaos, it turns all Grass Blocks around it into Withered Grass Blocks, which will continuously inflict the Decay status effect on all entities standing on them. On non-player entities, they will also take high Wither damage, while players will have their armor quickly deteriorate and fall apart, meanwhile thanks to the Crown of Chaos, the boss itself will heal small amounts on this zone.\n- Day Stalker & Night Prowler\n - A fierce duo boss representing day and night. They are both empowered based on whether it is daytime or nighttime, and will each switch between flying above the target and being on the ground. Upon killing one of them, the other will become empowered, entering a challenging phase two.", + "body_url": null, + "published": "2023-03-24T19:00:03.759253Z", + "updated": "2024-08-10T00:01:00.643244Z", + "approved": "2023-03-27T01:24:08.034572Z", + "queued": "2023-03-26T13:43:34.499832Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "CC0-1.0", + "name": "Creative Commons Zero v1.0 Universal", + "url": null + }, + "downloads": 332658, + "followers": 207, + "categories": [ + "adventure", + "equipment", + "mobs" + ], + "additional_categories": [ + "worldgen" + ], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "kC0tqpza", + "PfIuVgK8", + "BE8X9qmS", + "4KUFg6ED", + "7AA16Ilh", + "fF2upsNN", + "WpYbwBb7", + "bbvZDVhF", + "hb3CIc58", + "3hYuwbTT", + "RMoYysfr", + "i352JlgK", + "hOVG4wCW", + "yu7EMHuy", + "R9PriATS", + "NHZIP93n", + "eHwZmtHq", + "a07x6LCo", + "7h8LRaKG", + "GGvxee8c", + "LzOSLCC2", + "gSZ3DFYM", + "EBQSEiFA", + "kYBGrRfI", + "EeDvXKwi", + "Ya3uMd8M", + "rjgmOoJ4", + "80vueSBC", + "CvpRzV5E", + "GSA2446w", + "th0s6LiY", + "SZZ3uToc", + "1KCOAajo", + "eAHkv8iF", + "xlHTxWSJ", + "rx9xYc2D", + "5j3bf1T2", + "8NbsppBy", + "7oI40RjR", + "S2m04eQN" + ], + "icon_url": "https://cdn.modrinth.com/data/oX6SohLj/273f845965c0aaa9a67a01803914facdd42d5bbb.png", + "issues_url": "https://github.com/mariumbacchus/Soulslike-Weaponry/issues", + "source_url": "https://github.com/mariumbacchus/Soulslike-Weaponry", + "wiki_url": "https://github.com/mariumbacchus/Soulslike-Weaponry/wiki", + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/oX6SohLj/images/29f9a81bef0e207bae0a5f8f9441b2d6e2861cb3.png", + "featured": false, + "title": "Monarch of Chaos", + "description": "One of the bosses", + "created": "2023-03-24T19:09:28.828022Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/oX6SohLj/images/a6e3ffcb348bc052501d5c35cc6286775581ee31.png", + "featured": false, + "title": "Fallen Icon", + "description": "One of the bosses", + "created": "2023-03-24T19:08:26.528815Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/oX6SohLj/images/be178069a66cbb1a6538ba9c9d3b7581446ffee3.png", + "featured": false, + "title": "The Decaying King", + "description": "One of the bosses", + "created": "2023-03-24T19:09:09.704632Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/oX6SohLj/images/c8aab4db839b4f8051e5557747b9f62989257507.png", + "featured": false, + "title": "Old Champion's Remains", + "description": "One of the bosses", + "created": "2023-03-24T19:08:52.710142Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/oX6SohLj/images/d37c581e324caff67261d9b7ca3439611105b46b.png", + "featured": false, + "title": "Weapons", + "description": "A gallery of some of the weapons", + "created": "2023-03-24T19:10:48.015846Z", + "ordering": 0 + } + ], + "color": 2566702, + "thread_id": "oX6SohLj", + "monetization_status": "monetized" + }, + "sound-physics-remastered-fabric-1.20.1-1.4.5": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "qyVF9oeo", + "slug": "sound-physics-remastered", + "project_type": "mod", + "team": "qdzNnAmS", + "organization": null, + "title": "Sound Physics Remastered", + "description": "A Minecraft mod that provides realistic sound attenuation, reverberation, and absorption through blocks.", + "body": "# Sound Physics Remastered\n\n> This is a fork of [Sound Physics Fabric](https://github.com/vlad2305m/Sound-Physics-Fabric) by [vlad2305m](https://github.com/vlad2305m) which is a fork of [Sound Physics](https://github.com/sonicether/Sound-Physics) by [Sonic Ether](https://github.com/sonicether).\n\nA Minecraft mod that provides realistic sound attenuation, reverberation, and absorption through blocks.\n\nOptimized for the use with [Simple Voice Chat](https://www.curseforge.com/minecraft/mc-mods/simple-voice-chat) 2.X.X.\n\n\n### Requirements\nThis mod does not require any dependencies, but it is recommended to use the following:\n\n**Fabric**\n\n- [ModMenu](https://www.curseforge.com/minecraft/mc-mods/modmenu)\n- [ClothConfig](https://www.curseforge.com/minecraft/mc-mods/cloth-config)\n\n**Forge**\n\n- [ClothConfig](https://www.curseforge.com/minecraft/mc-mods/cloth-config-forge)\n\n---\n\n### Changes to the Original Mod\n\n**Improvements**\n\n- Improved sound processing performance by a factor of 10\n- Optimized for [Simple Voice Chat](https://www.curseforge.com/minecraft/mc-mods/simple-voice-chat)\n- Ported the mod to Forge\n- Improved configuration UI\n- Made Cloth Config optional\n- Tweaked default config values\n- Added reflectivity to the config GUI\n- Added occlusion variation\n- Added block occlusion factor config\n- Added debug sound bounce rendering\n- Added debug sound occlusion rendering\n\n**Bugfixes**\n\n- Fixed sounds not bouncing more than once\n- Fixed sound bouncing using an excessive amount of performance, despite not working at all\n- Fixed direction evaluation not taking sound source and primary bounces into account\n- Fixed sound allowance not working for `/playsound` command\n- Fixed unmapped field names in the reflectivity config\n- Fixed sound processing using player position instead of camera position", + "body_url": null, + "published": "2022-06-23T14:36:52.813391Z", + "updated": "2024-08-09T10:05:00.570513Z", + "approved": "2022-06-23T14:36:52.813391Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "GPL-3.0-only", + "name": "GNU General Public License v3.0 only", + "url": null + }, + "downloads": 3948259, + "followers": 3309, + "categories": [ + "adventure", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "tbyD9fqo", + "CK4lQQ9O", + "x9IWXNJ1", + "SYSMCMTq", + "kZQoJLcW", + "ExqJDhfb", + "MBlFcMKc", + "xZ9UodxE", + "jRobOtd6", + "eZELi5uU", + "dKCe780W", + "6XE3ynnM", + "TuOjqGZ4", + "xVwTOdDC", + "qZS1UvUq", + "NxBIvRrx", + "btiLehDH", + "7IdNS4GK", + "TVhi1tt5", + "kDnIIyrT", + "weUdAUDs", + "a37ONsXw", + "X5StGhDe", + "5cW4koqn", + "14Ps1Jzh", + "MAkKuumS", + "znriWuAi", + "RWvuXxi3", + "ccEQbQJ3", + "JHXFUvDT", + "mFMJ9c9z", + "GBrc5892", + "swW70Uzh", + "ej3KHCh4", + "74oofD7s", + "34AzinYF", + "ZQ358klw", + "8DVONifo", + "MsRCg9vD", + "M8HvAuai", + "nBLV4bCJ", + "UlywtXTw", + "dGldKfFi", + "ouJkPcmR", + "tA2eeq37", + "5kLP4E16", + "L9IFjX01", + "xXUcyQrd", + "lNfifytA", + "op41PVog", + "ImG6hq12", + "vugO7mNF", + "qj6Fhfgl", + "b6C2l51o", + "MZG4uxm4", + "vCR4KOzC", + "BiJaNUOc", + "jFi9wAm9", + "wSSDI9Rg", + "gAP9590c", + "e0jDon7B", + "tFcSgMDe", + "piYsWHSx", + "TEiP8U4g", + "oVxOW2yg", + "qnzq20sO", + "tw5iAjtN", + "ZEMrXhx7", + "ouODHxQ8", + "7P98uY0M", + "bKhTczPg", + "I2nXZGRy", + "OOw4wyHN", + "67Uq017p", + "bujm33cE", + "cBy6ZK3G", + "WLNfa7ku", + "JPBZW9Vf", + "ITaPOJ9r", + "sSV5WT7s", + "CWAfu9W5", + "eMG0BbRq", + "97XHldOK", + "ZiMnDFg6", + "nLopGrFf", + "nSYaAtGV", + "w17wrgYv", + "DBPAu9gh", + "BMZ7TDzQ", + "CmxXa8uE", + "GdHd0uVw", + "i9vcidyG", + "F8triwQi", + "RtbuP43K", + "U74mJrlB", + "LkAxlKRj", + "th5AIucC", + "LlnzkNS9", + "GZpOvsk2", + "Vyrz7QQ2", + "KK8s1GO6", + "LSLnEJbQ", + "x59lJ2xc", + "VJwdOuqA", + "ahFNUMMQ", + "EfBxPGaK", + "veANUV9l", + "WyTB3RFm", + "L6oPowRU", + "QSvkGLBf", + "nAzJ7GlL", + "o7NVGpjL", + "7Aji5QaG", + "emDPG9Uq", + "mxbQTk6W", + "oo6WesiS", + "2SX5mbvk", + "McfCXCmf", + "3HhMsZ0w", + "sOYL3ARx", + "YG8JVSin", + "eY1CBtiC", + "Boy7PUiT", + "j2uf4Rqu", + "WC9KAg08", + "qcWiQYte", + "EZCMvWJo", + "a9mFvVtk", + "v82u5BX1", + "pG8odFUO", + "SZoH54wW", + "WiNNhm4M", + "qzeuRX2k", + "R08tbAhr", + "LDy1fR4w", + "vkj3OYhV", + "3TB8hRco", + "S5qjcOcU", + "MW5MPwpE", + "vc4XGsIG", + "5gC41Itp", + "1ecXPX5o", + "TsHpz1nS", + "DZclhMyL", + "cT0aLJ8N", + "D7fOLtmp", + "AGRkYn5p", + "MmKSrFU9", + "mKQcogVn", + "eQg3x7U0", + "Yh3XWCNn", + "MgbZRiG5", + "BwDWoRgh", + "s5PSGIl7", + "rRjQmiWc", + "Tbtajy1X", + "8w6T0wDj", + "ifR8SEdY", + "mzJYir2h", + "nzrrHnMa", + "8S2j9Ddt", + "N3uoEoK5", + "wP25tEBe" + ], + "icon_url": "https://cdn.modrinth.com/data/qyVF9oeo/798fbfae58ec95ad51f3e1d522b43227306c326c.png", + "issues_url": "https://github.com/henkelmax/sound-physics-remastered/issues", + "source_url": "https://github.com/henkelmax/sound-physics-remastered", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": 263172, + "thread_id": "qyVF9oeo", + "monetization_status": "monetized" + }, + "spark": { + "client_side": "optional", + "server_side": "optional", + "game_versions": [ + "1.16.5", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "l6YH9Als", + "slug": "spark", + "project_type": "mod", + "team": "xI8OXSR4", + "organization": null, + "title": "spark", + "description": "spark is a performance profiler for Minecraft clients, servers and proxies.", + "body": "![spark](https://i.imgur.com/ykHn9vx.png)\n\n#### spark is a performance profiler for Minecraft clients, servers and proxies.\n\n#### Useful Links\n* [**Website**](https://spark.lucko.me/) - browse the project homepage\n* [**Documentation**](https://spark.lucko.me/docs) - read documentation and usage guides\n* [**Downloads**](https://spark.lucko.me/download) - latest plugin/mod downloads\n\n___\n\n[![](https://www.bisecthosting.com/partners/custom-banners/337246b0-c68e-400f-a40e-427b9a2fc516.png)](https://bisecthosting.com/spark)\n\nspark is proudly sponsored by [BisectHosting](https://bisecthosting.com/spark).\u200b\n\nBisectHosting are Minecraft server hosting experts, ready to help you create and host your very own server! They are a trusted and well-established hosting provider in the community, and provide an outstanding level of service that we are happy to recommend. There is a special 25% off discount available for spark users - click the link above to create your server today.\n\n## What does spark do?\n\nspark is made up of three separate components:\n\n* **CPU Profiler**: Diagnose performance issues.\n* **Memory Inspection**: Diagnose memory issues.\n* **Server Health Reporting**: Keep track of overall server health.\n\n### \u26a1 CPU Profiler\n\nspark's profiler can be used to diagnose performance issues: \"lag\", low tick rate, high CPU usage, etc.\n\nIt is:\n\n* **Lightweight** - can be ran in production with minimal impact.\n* **Easy to use** - no configuration or setup necessary, just install the plugin.\n* **Quick to produce results** - running for just ~30 seconds is enough to produce useful insights into problematic areas for performance.\n* **Customisable** - can be tuned to target specific threads, sample at a specific interval, record only \"laggy\" periods, etc\n* **Highly readable** - simple tree structure lends itself to easy analysis and interpretation. The viewer can also apply deobfuscation mappings.\n\nIt works by sampling statistical data about the systems activity, and constructing a call graph based on this data. The call graph is then displayed in an online viewer for further analysis by the user.\n\nThere are two different profiler engines:\n* Native `AsyncGetCallTrace` + `perf_events` - uses [async-profiler](https://github.com/jvm-profiling-tools/async-profiler) (*only available on Linux x86_64 systems*)\n* Built-in Java `ThreadMXBean` - an improved version of the popular [WarmRoast profiler](https://github.com/sk89q/WarmRoast) by sk89q.\n\n### \u26a1 Memory Inspection\n\nspark includes a number of tools which are useful for diagnosing memory issues with a server.\n\n* **Heap Summary** - take & analyse a basic snapshot of the servers memory\n * A simple view of the JVM's heap, see memory usage and instance counts for each class\n * Not intended to be a full replacement of proper memory analysis tools. (see below)\n* **Heap Dump** - take a full (HPROF) snapshot of the servers memory\n * Dumps (& optionally compresses) a full snapshot of JVM's heap.\n * This snapshot can then be inspected using conventional analysis tools.\n* **GC Monitoring** - monitor garbage collection activity on the server\n * Allows the user to relate GC activity to game server hangs, and easily see how long they are taking & how much memory is being free'd.\n * Observe frequency/duration of young/old generation garbage collections to inform which GC tuning flags to use\n\n### \u26a1 Server Health Reporting\n\nspark can report a number of metrics summarising the servers overall health.\n\nThese metrics include:\n\n* **TPS** - ticks per second, to a more accurate degree indicated by the /tps command\n* **Tick Durations** - how long each tick is taking (min, max and average)\n* **CPU Usage** - how much of the CPU is being used by the server process, and by the overall system\n* **Memory Usage** - how much memory is being used by the process\n* **Disk Usage** - how much disk space is free/being used by the system\n\nAs well as providing tick rate averages, spark can also **monitor individual ticks** - sending a report whenever a single tick's duration exceeds a certain threshold. This can be used to identify trends and the nature of performance issues, relative to other system or game events.\n\n## Usage\nTo install, just add the **.jar** file to your mods directory.\n\nInformation about [how to use commands](https://spark.lucko.me/docs/Command-Usage) can be found in the docs.\n\nIf you\u2019d like help analysing a profiling report, or just want to chat, feel free to join us on [Discord](https://discord.gg/PAGT2fu).\n\n\n## Guides\nThere are a few small \"guides\" available in the docs, covering the following topics.\n* [The tick loop](https://spark.lucko.me/docs/guides/The-tick-loop)\n* [Finding the cause of lag spikes](https://spark.lucko.me/docs/guides/Finding-lag-spikes)", + "body_url": null, + "published": "2021-06-04T13:36:54.735179Z", + "updated": "2024-08-12T18:54:49.346864Z", + "approved": "2021-06-04T13:36:54.735179Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "GPL-3.0-only", + "name": "GNU General Public License v3.0 only", + "url": "https://github.com/lucko/spark/blob/master/LICENSE.txt" + }, + "downloads": 1831269, + "followers": 951, + "categories": [ + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "JdNt7oGW", + "liwd7pvc", + "D6L5yWtJ", + "huGeKmwp", + "sf2nOVoP", + "DhT8Y7bB", + "b3zKGLTS", + "yysWZODg", + "eEAJpQea", + "VkKsarbC", + "qBdtA5uj", + "6BEDTXhR", + "9NSIbttL", + "JjikdHMk", + "sYlxF6IX", + "CWiQ0oM4", + "xvqXC3WU", + "X9SnVAPS", + "jg0K11We", + "Biivc7P1", + "g60nhl1v", + "LVujS26K", + "6hatB19T", + "FnKxsd40", + "mMSAkTm6", + "3opVno4q", + "EWTsXhFU", + "RhyaY2vw", + "XXMFHMBO", + "OT1CD9Qj", + "E5XaSI1N", + "1K3xO8TS", + "23U6xkbl", + "g5rM8xSA", + "pjW9S4dI", + "N7JzEApO", + "1dlOe6ez", + "XhFbpH8f", + "VhY9p1RU", + "GygIHGfW", + "qyMNf4Pn", + "oCK984FP", + "dVHkMOHv", + "Yp6s4wsw", + "BeIg1bik", + "4FXHDE9F", + "XGW2fviP", + "h0Z2ObM0", + "tCU9VuzX", + "8ZQqfeXy", + "3FEq2lT7", + "FeV5OquF", + "iKVUNCME", + "i3FZxFQO", + "h0hKeaRD", + "85t1ZpLC", + "vl2NraaO", + "TsIZU7vG", + "KYGTUMOq", + "iYliEQKf", + "pxV5WOiQ", + "qTSaozEL", + "mHuABI9W" + ], + "icon_url": "https://cdn.modrinth.com/data/l6YH9Als/13676ddae142a85998c1c0086cafc30ce2efde80.png", + "issues_url": "https://github.com/lucko/spark/issues", + "source_url": "https://github.com/lucko/spark", + "wiki_url": "https://spark.lucko.me/docs", + "discord_url": "https://discord.gg/PAGT2fu", + "donation_urls": [], + "gallery": [], + "color": 16567356, + "thread_id": "l6YH9Als", + "monetization_status": "monetized" + }, + "spell_engine-0.15.8+1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19", + "1.19.1", + "1.19.2", + "1.20", + "1.20.1" + ], + "id": "XvoWJaA2", + "slug": "spell-engine", + "project_type": "mod", + "team": "5yVzRQ7h", + "organization": null, + "title": "Spell Engine", + "description": "\ud83e\ude84 Data driven magic library", + "body": "![](https://cdn.modrinth.com/data/XvoWJaA2/images/28a14b6cf2aef9e3d5528e1c1a98f91f4633c5dc.png \"\")\n------------------\n[![Modloader](https://img.shields.io/badge/Loader-Fabric-ecebe6?labelColor=263768&style=for-the-badge)](https://fabricmc.net)\n[![Fabric API required](https://img.shields.io/badge/Fabric%20API-REQUIRED-ecebe6?labelColor=263768&style=for-the-badge)](https://www.curseforge.com/minecraft/mc-mods/fabric-api)\n![Availability](https://img.shields.io/badge/Available-1.19.2-ecebe6?labelColor=263768&style=for-the-badge)\n\n![Environment: Client](https://img.shields.io/badge/CLIENT%20SIDE%20INSTALLATION-REQUIRED-ecebe6?labelColor=263768&style=for-the-badge)\n![Environment: Server](https://img.shields.io/badge/SERVER%20SIDE%20INSTALLATION-REQUIRED-ecebe6?labelColor=263768&style=for-the-badge)\n[![Discord](https://img.shields.io/discord/973561601519149057.svg?label=&logo=discord&logoColor=ffffff&color=7389D8&labelColor=6A7EC2&style=for-the-badge)](https://discord.gg/KN9b3pjFTM)\n\n# \ud83d\udce6 Installation\n\n### Required\n\n- [Cloth Config](https://modrinth.com/mod/cloth-config \"\")\n- [Fabric API](https://modrinth.com/mod/fabric-api \"\")\n- [Player Animator](https://modrinth.com/mod/playeranimator \"\")\n- [Spell Power Attributes](https://modrinth.com/mod/spell-power \"\")\n\n### Strongly recommended\n\n- [Adaptive Tooltips](https://modrinth.com/mod/adaptive-tooltips \"\") for spell tooltips\n\n# \ud83e\ude84\ufe0f Features\n\nData driven API\n\n- \ud83d\udde1\ufe0f Spells can be assigned to any weapon (data driven)\n- \ud83d\udd2e Spells deal damage based on [Spell Power](https://github.com/ZsoltMolnarrr/SpellPower) entity attributes\n- \u270d\ufe0f Spells defined in JSON format\n- \u2699\ufe0f Spells have a set of different mechanical behaviours:\n - Cast options: duration, mode of release (charged or channeled)\n - Targeting mode: Area, Beam, Cursor, Projectile\n - Impact actions: Damage, Heal, StatusEffect\n - Cost: exhaust (hunger), item (runes), cooldown (time), durability, consume effects\n\nFancy audio and visuals\n\n- \ud83d\udd08 Spells have sound effects: at the start of casting, while casting, at release, at impact\n- \u2728 Spells have particle effects (any particle can be referenced by id), and the engine offers its custom set magical of particles\n- \ud83c\udfa8 Custom Item/Block models can be used for Spell Projectiles and Status Effects\n- \ud83e\udd38 Custom player animations can be played at different stages of spell casting\n\nIn game features\n\n- \ud83d\udd27 Spell selection and casting is visible on the HUD (fully player configurable)\n- \ud83d\ude0c QoL features included (such as automatic spell cast release)\n- \u26d3\ufe0f Add spells to eligible weapons using the Spell Binding Table", + "body_url": null, + "published": "2023-01-12T15:13:27.221390Z", + "updated": "2024-08-13T17:54:12.989847Z", + "approved": "2023-01-17T00:30:57.969252Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "GPL-3.0-only", + "name": "GNU General Public License v3.0 only", + "url": null + }, + "downloads": 676371, + "followers": 211, + "categories": [ + "game-mechanics", + "library", + "magic" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "j7x0nnQY", + "ysvTRYTw", + "mWiBP5Pv", + "CXcP4unv", + "klgu6ViH", + "X2TtLs8V", + "htf90GdH", + "AZShwLaW", + "NaxIZUvR", + "CVXnaSfs", + "Q8cJ5uAI", + "sjs1bgms", + "kufaZ2Fi", + "8uboCQ5D", + "VW49K0aa", + "QfqnyDqt", + "Y4gGQTG2", + "PhZQ7oV3", + "eDRpv7Gq", + "dR5zgelV", + "z8tCOAtj", + "GbEzmkEd", + "Z3exwp7X", + "7vXbmNlo", + "4hnzypKn", + "bypy79hn", + "EM2qnzzH", + "zmkGvUFy", + "eqFj8Yg4", + "eCu7PzVC", + "uw1SoMLW", + "xGmYuuPh", + "HF1C2mQm", + "Mz6VoVgb", + "9lXwv07z", + "zUFilmBl", + "Qe7IbN4T", + "T6jWApoV", + "yMzYM2pb", + "dGiLjDYs", + "j457OKwj", + "ZPFbGKwF", + "UJUSQFXT", + "sbx3ZGCG", + "2vz75xvT", + "wXntgIJi", + "DB1s06bk", + "IQ3VkdyH", + "E42wF2VB", + "2q6avbJi", + "jCC4AQty", + "IZFnIGe9", + "EsN9o530", + "oZJ30MzD", + "YchHSzSU", + "doKPvXpt", + "5qhQxhiU", + "qkL60F6g", + "eX4YqiVK", + "Vp8e1nX3" + ], + "icon_url": "https://cdn.modrinth.com/data/XvoWJaA2/9f3d222d82aebadd5325ae53a927463f1e20abd0.png", + "issues_url": "https://github.com/ZsoltMolnarrr/SpellEngine/issues", + "source_url": "https://github.com/ZsoltMolnarrr/SpellEngine", + "wiki_url": "https://github.com/ZsoltMolnarrr/SpellEngine", + "discord_url": "https://discord.gg/KN9b3pjFTM", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/XvoWJaA2/images/28a14b6cf2aef9e3d5528e1c1a98f91f4633c5dc.png", + "featured": false, + "title": "title", + "description": null, + "created": "2023-01-12T15:17:36.198280Z", + "ordering": 0 + } + ], + "color": 10762276, + "thread_id": "XvoWJaA2", + "monetization_status": "monetized" + }, + "spell_power-0.11.1+1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19", + "1.19.1", + "1.19.2", + "1.20.1" + ], + "id": "8ooWzSQP", + "slug": "spell-power", + "project_type": "mod", + "team": "X228bzUD", + "organization": null, + "title": "Spell Power Attributes", + "description": "\ud83d\udd2e Spell Power entity attributes with related status effects and enchantments", + "body": "![Spell Power Attributes](https://cdn.modrinth.com/data/8ooWzSQP/images/b78543865976288a17f2815927bb3e3ac1835819.png \"\")\n------------------\n[![Modloader](https://img.shields.io/badge/Loader-Fabric-ecebe6?labelColor=263768&style=for-the-badge)](https://fabricmc.net)\n[![Fabric API required](https://img.shields.io/badge/Fabric%20API-REQUIRED-ecebe6?labelColor=263768&style=for-the-badge)](https://www.curseforge.com/minecraft/mc-mods/fabric-api)\n![Availability](https://img.shields.io/badge/Available-1.19.2-ecebe6?labelColor=263768&style=for-the-badge)\n\n![Environment: Client](https://img.shields.io/badge/CLIENT%20SIDE%20INSTALLATION-REQUIRED-ecebe6?labelColor=263768&style=for-the-badge)\n![Environment: Server](https://img.shields.io/badge/SERVER%20SIDE%20INSTALLATION-REQUIRED-ecebe6?labelColor=263768&style=for-the-badge)\n[![Discord](https://img.shields.io/discord/973561601519149057.svg?label=&logo=discord&logoColor=ffffff&color=7389D8&labelColor=6A7EC2&style=for-the-badge)](https://discord.gg/KN9b3pjFTM)\n### \u2615\ufe0f Support me on [Ko-Fi](https://ko-fi.com/daedelus \"\"), if you like my project\n\n# \ud83d\udd2e\ufe0f Features\n\nThis library introduces new Entity Attributes for powering magical abilities, for the following magic types (schools):\n\n- \ud83d\udd2e Arcane\n- \ud83d\udd25 Fire\n- \u2744\ufe0f Frost\n- \ud83d\udc9a Healing\n- \u26a1\ufe0f Lightning\n- \ud83d\udc7b Soul\n\n(Note: the design intent is to stay native to Minecraft, but establish Warcraft like magic schools. So no classic 4 element schools are implemented, besides fire.)\n\nThe library offers an API to query spell damage of an entity (based on its attributes, status effects, enchantments), and provides critical strike chance and multiplier. Critical striking is completely rng based, powered by secondary attributes.\n\n## \ud83d\udce6 Content\n\n### Entity Attributes:\n\n- Spell Power, one for each specific magic school (for example: `spell_power:fire`)\n- Spell critical chance (id: `spell_power:critical_chance`)\n- Spell critical damage (id: `spell_power:critical_damage`)\n- Spell haste (id: `spell_power:haste`), can be used to quicken spell casting or cooldowns\n\n### Status Effects:\n\n- One specifically for each introduced attribute, with a matching id (for example: `spell_power:fire`, `spell_power:critical_chance`)\n\n(All status effects come with fancy icons \ud83d\ude0d)\n\n### Enchantments:\n\n- Universal Spell Power (named: \"Spell Power\"), increasing all spell damage\n- School limited Spell Power (for example: \"Sunfire\", increasing arcane and fire damage) \n- Secondary attribute enchantments (for example: \"Spell Critical Chance\")\n- \"Magic Protection\" (totally symmetric to Projectile Protection, but for magic)\n\n(All enchantments are fully configurable, and come with descriptions)\n\n# \ud83d\udd27 Configuration\n\n**Server side** configuration can be found in the `config` directory, after running the game with the mod installed.\n", + "body_url": null, + "published": "2022-12-23T13:31:08.411187Z", + "updated": "2024-07-24T21:27:43.411177Z", + "approved": "2022-12-23T20:32:07.600961Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 669711, + "followers": 189, + "categories": [ + "library", + "magic" + ], + "additional_categories": [ + "adventure", + "game-mechanics" + ], + "loaders": [ + "fabric" + ], + "versions": [ + "OZt33z9y", + "8JZtHM36", + "FOc76ayi", + "ZIFDdYy8", + "Wzpqt33L", + "bE2Cpn06", + "wBSzMSuf", + "QMJuz1zi", + "7SbZEqA5", + "tuww90Eu", + "o5zzsgPA", + "6ffjOgGW", + "71FZTu9s", + "e2ggpysz", + "3e4ctFvH", + "aSo9SZuM", + "lME8r1AD", + "4b3xYbpW", + "LVyrxDzP", + "jHaKmMkR", + "wjkzk05R", + "uKb21LI4", + "2bpCsLfe", + "nT0Hl1AE" + ], + "icon_url": "https://cdn.modrinth.com/data/8ooWzSQP/eac53d793cb13193c3860d90c5e19e680fbc7cb5.png", + "issues_url": "https://github.com/ZsoltMolnarrr/SpellPower/issues", + "source_url": "https://github.com/ZsoltMolnarrr/SpellPower", + "wiki_url": "https://github.com/ZsoltMolnarrr/SpellPower", + "discord_url": "https://discord.gg/KN9b3pjFTM", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/8ooWzSQP/images/b78543865976288a17f2815927bb3e3ac1835819.png", + "featured": false, + "title": "icon_and_title", + "description": null, + "created": "2022-12-23T13:36:19.715908Z", + "ordering": 0 + } + ], + "color": 12904182, + "thread_id": "8ooWzSQP", + "monetization_status": "monetized" + }, + "SpoornPacks": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18-pre1", + "1.18-pre2", + "1.18-pre3", + "1.18-pre4", + "1.18-pre5", + "1.18-pre6", + "1.18-pre7", + "1.18-pre8", + "1.18-rc1", + "1.18-rc2", + "1.18-rc3", + "1.18-rc4", + "1.18", + "1.18.1-pre1", + "1.18.1-rc1", + "1.18.1-rc2", + "1.18.1-rc3", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1" + ], + "id": "40ytxGF2", + "slug": "spoornpacks", + "project_type": "mod", + "team": "7C06qMQq", + "organization": null, + "title": "SpoornPacks", + "description": "API Library for automagically generating Resource files and injecting them as a Resource Pack", + "body": "

\"https://media.forgecdn.net/avatars/thumbnails/522/685/64/64/637844029316522114.png\"\"https://media.forgecdn.net/avatars/thumbnails/482/657/64/64/637781533186272139.png\"\"https://media.forgecdn.net/avatars/thumbnails/357/686/64/64/637517355068764931.png\"

\n

 

\n\n
\n

\n \"https://img.shields.io/static/v1?label=%20&message=other%20projects&color=4b5966&labelColor=658f79&logo=curseforge&logoColor=white&style=for-the-badge\" \n \"https://tinyurl.com/spoorndiscordbadge\" \n \"https://img.shields.io/github/stars/spoorn/SpoornPacks?color=4b5966&labelColor=658f79&label=github%20&logo=github&logoColor=white&style=for-the-badge\" \n \"https://img.shields.io/github/issues-raw/spoorn/SpoornPacks?color=4b5966&labelColor=658f79&label=issues%20&logo=github&logoColor=white&style=for-the-badge\"\n

\n
\n\n

Description

\n

 

\n

SpoornPacks is an API Library mod for the Minecraft Fabric mod loader that adds simple-to-use APIs for automagically generating resource asset and data files, and injects them into the game as a mock Resource Pack. This allows mod creators to create their resources entirely in code with very succinct APIs, while still allowing overriding via your own Resource files.

\n

 

\n

The goal of this mod is to simplify resource creation (i.e. blocks, items, structures, features, etc.) as much as possible for the majority of use cases, while being extensible to more complex ones.  The typical process for adding a block or item involves several Json files with oftentimes rather cryptic contents, and injecting into various Minecraft registries, methods, classes, etc.  This API Library removes all that overhead for the mod creator and turns it into a single one-line Java call, simple datagen

\n

 

\n

I'm using this library myself for my own mod! https://www.curseforge.com/minecraft/mc-mods/pink

\n

 

\n

For more details, please see the Wiki

\n

 

\n

Dependencies

\n

This mod requires:

\n\n

 

\n

\"requires

\n

 

\n

Need a Server?

\n

\"https://bisecthosting.com/spoorn\"

", + "body_url": null, + "published": "2022-02-08T19:40:11.921628Z", + "updated": "2023-07-17T05:17:07.017505Z", + "approved": "2022-02-08T19:40:11.921628Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 16435, + "followers": 5, + "categories": [ + "library", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "huqnXo38", + "nhHHoxzD", + "Ots2Jujj", + "kzk22sjc", + "U4SgnNZ3", + "NSN0Yoyz" + ], + "icon_url": "https://cdn.modrinth.com/data/40ytxGF2/icon.png", + "issues_url": "https://github.com/spoorn/SpoornPacks/issues", + "source_url": "https://github.com/spoorn/SpoornPacks", + "wiki_url": "https://github.com/spoorn/SpoornPacks/wiki", + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": 12158573, + "thread_id": "40ytxGF2", + "monetization_status": "monetized" + }, + "starlight-1.1.2+fabric.dbc156f": { + "client_side": "optional", + "server_side": "optional", + "game_versions": [ + "1.17", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4" + ], + "id": "H8CaAYZC", + "slug": "starlight", + "project_type": "mod", + "team": "DXoc0ko3", + "organization": null, + "title": "Starlight (Fabric)", + "description": "Rewrites the light engine to fix lighting performance and lighting errors", + "body": "Starlight\n==================\nFabric mod for rewriting the light engine to fix lighting performance and lighting errors.\n\nFuture updates past 1.20\n------------------\nPlease see: https://gist.github.com/Spottedleaf/6cc1acdd03a9b7ac34699bf5e8f1b85c\nThis project will not receive further updates for the foreseeable future.\n\nCompatibility\n------------------\nStarlight can be installed either on the dedicated server or client. It is _not_ required to be installed on both sides.\nIf you have Starlight on the server, clients can use Vanilla/Phosphor/Starlight to connect. Likewise, if you have Starlight on \nthe client, you can connect to Vanilla/Phosphor/Starlight servers.\n\nStarlight cannot be installed _with_ Phosphor, they are completely incompatible. \nBrowsing through [Starlight's Issue Tracker](https://github.com/PaperMC/Starlight/issues \"Starlight's Issue Tracker\") will show\nfurther mod incompatibilities. Starlight is a rather destructive light engine rewrite, so it should be \nexpected to break mods more often.\n\nPurpose\n------------------\nStarlight was developed for higher scale dedicated servers, as they suffered performance problems due to how ungodly slow the\nlight engine was. The only solution was to create an extremely invasive mod which rewrote the entire light engine.\nI ported the mod to fabric so that I can update it during snapshots, and decided that publishing it for \nall users, especially client users, would be beneficial. However, it does have the downside of being an invasive mod:\nBeing invasive didn't affect higher scale servers because they run on Bukkit.\n\nFurther reading on the technical details of how Starlight achieves its performance \ncan be read here: [TECHNICAL_DETAILS.md](https://github.com/PaperMC/Starlight/blob/fabric/TECHNICAL_DETAILS.md \"TECHNICAL_DETAILS.md\")\n\nPerformance for 1.20:\n------------------\nHere are a few graphs showing performance in 2 areas on: Block editing at high y-levels, and normal block light updates:\n\n~~Light engine time chunk generation Graph~~ has been removed as a benchmark as it is invalid for 1.20. Starlight and Vanilla are close enough on 1.20 that\nthis test is also useless.\n![Block update at height graph](https://i.imgur.com/ZQx7Ek0.png \"Block update at height graph\")\n![Simple glowstone block update](https://i.imgur.com/MrA2PQk.png \"Simple glowstone block update\")\n\nPerformance for 1.19.4 and below:\n------------------\nHere are a few graphs showing performance in 3 critical areas: Chunk generation, Block editing at high y-levels, and normal block light updates:\n\n![Light engine time chunk generation Graph](https://i.imgur.com/5aI8Eaf.png \"Light engine time chunk generation Graph\")\n![Block update at height graph](https://i.imgur.com/kKtbe9y.png \"Block update at height graph\")\n![Simple glowstone block update](https://i.imgur.com/yCNK602.png \"Simple glowstone block update\")", + "body_url": null, + "published": "2021-08-29T14:08:31.790201Z", + "updated": "2023-12-10T20:26:57.476791Z", + "approved": "2021-08-29T14:08:31.790201Z", + "queued": null, + "status": "archived", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 4323154, + "followers": 4283, + "categories": [ + "optimization" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "nc7qGadJ", + "p26lbcyI", + "4ew9whL8", + "zFqBnsxO", + "qH1xCwoC", + "XGIsoVGT", + "98VOoYPX", + "PLbxwptm", + "1QrtjfDy", + "HZYU0kdg" + ], + "icon_url": "https://cdn.modrinth.com/data/H8CaAYZC/icon.png", + "issues_url": "https://github.com/PaperMC/Starlight/issues", + "source_url": "https://github.com/PaperMC/Starlight", + "wiki_url": null, + "discord_url": "https://discord.gg/tuinity", + "donation_urls": [], + "gallery": [], + "color": 16577540, + "thread_id": "H8CaAYZC", + "monetization_status": "monetized" + }, + "starterkit-1.20.1-7.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.18.2", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "6L3ydNi8", + "slug": "starter-kit", + "project_type": "mod", + "team": "VSsGXtt0", + "organization": null, + "title": "Starter Kit", + "description": "\ud83d\udce6 Give all new players joining the world configurable starter gear, items and/or potion effects. It can overwrite the initial inventory, or add the items after. Compatible with FTB Team Islands.", + "body": "

\"\"

Requires the library mod Collective.

   This mod is part of The Vanilla Experience modpack and Serilum's Customization Bundle mod.
Starter Kit is a mod which allows players who join a world for the first time to receive items set in a config file. It's possible to set items to any specific slot in the inventory, to the offhand and to the armour slots. The mod can detect which players have never joined before. If another mod adds items, such as guide books, they can either be removed completely or added after the kit has been set. This is configurable via the addExistingItemsAfterKitSet config option.

Can be used in a server for all new players or in singleplayer to start off with a default inventory of your choosing. There is also optional support for FTB's Team Island mod after the create island command.

The mod can be used server-side only. If you want players to be able to use the \"Choose Kit GUI\", it has to be installed on the client as well. Alternatively, they can choose kits via server commands.

Features:
 •  A guide here in the description. Difficulty ranging from Simple, Intermediate and Advanced.
 •  Give players joining the world for the first time custom starter items and/or potion effects.
 •  Support for multiple kits. Can be given randomly or chosen by the player.
 •  There is custom tracking to determine who are new players, compatible with existing worlds.
 •  Lots of commands! For creating, adding, managing and choosing starter kits.
 •  If installed on the client, kits can be chosen via a custom GUI screen. If not, commands can be used.
 •  Add descriptions to your kits. RPG modpack, anyone?
 •  Remove other modded starter items, such as guide books. Or add them after the starter kit.

\r\n

Configurable: ( how do I configure? )
randomizeMultipleKitsToggle (default = true): When multiple starter kits are added via /starterkit add, there are two ways to distribute them. With this enabled, one is chosen at random. When disabled, players can choose one on first join.
addExistingItemsAfterKitSet (default = true): Whether items that existed in the inventory, such as books added by other mods, should be added back to the inventory after the kit was set. If disabled, they'll be removed. You can still manually set them via the kit.
usePotionEffectsInStarterKit (default = true): If potion/mob effect functionality should be enabled. This means that when creating a kit via /sk (add/set), it also saves the active effects the player has. And when handing out the starter kits, it adds the effects to new players.
formatKitNames (default = true): If kit names should be formatted. Each word will be capitalized.

chooseKitScreenHeader (default = \"%s, you can choose a starter kit!\"): The text used above the kit choice screen, or if the mod is not installed in the chat. %s will be replaced with the player's name.

announcePlayerKitChoiceInDedicatedServer (default = true): Whether an announcement should be broadcasted to the server whenever a new player makes a kit choice. 'randomizeMultipleKitsToggle' must be disabled, and there must be at least 2 starter kits available.
enableFTBIslandCreateCompatibility (default = true): Whether the starter kit should be re-set after the '/ftbteamislands create' command from FTB Team Islands. Does nothing when it's not installed.

\r\n


Commands:
Both '/starterkit' and '/sk' can be used.


Admin Commands:

/sk add (kit_name) - Adds your current inventory to the active kits.
/sk set (kit_name) - Sets your current inventory as the only active kit.

\r\n

/sk give <player> (kit_name) - Give a player a random (or specific) starter kit.

\r\n

/sk activate <kit_name>/_all - Moves kit_name or all kits from inactive to active.
/sk deactivate <kit_name>/_all - Moves kit_name or all kits from active to inactive.

\r\n

/sk list (inactive) - Lists all active (or inactive) kits.
/sk reset - Resets all tracking. Players receive another kit on join.
/sk reload - Reloads starter kit changes from the config folder.

\r\n

User Commands:
/sk choose <kit_name> - Allows players to choose a starter kit via commands. This is only needed when Starter Kit is not installed on the client and the server enabled kit choices.
/sk info <kit_name> - Shows the description and items of kit_name.
/sk help - Shows the Starter Kit commands in-game.

\r\n



Usage Guide:
The mod can be configured in many different ways. To keep a better overview, I've divided the difficulty into three different sections. Simple, Intermediate and Advanced.

Simple:
Set a custom starter kit. Add/Remove starter items from other mods. And giving players a starter kit via commands.

Intermediate:
Add an extra starter kit. Deactivate a kit via commands. Add a starter kit with potion effects, and setting the level and duration.

Advanced:
Make players choose a kit on first join. Move the inactive default kits to active. Show the choose kit GUI screen. Create a starter kit with a custom description.


Section 1: Simple
This is the default starter kit, which will be given when the mod is installed without any configuration:


You can set your own starter kit by using the '/starterkit set (kit_name)' (or '/sk set (kit_name)') command. The kit name is optional.
After using this command, all other active starter kits are moved to the inactive folder.


Here you can see the new starter kit data file that was created with the previous command. It's located in './config/starterkit/kits/':


That's it! All new players will now receive the \"Upgraded\" kit when they first join the world:


Inside the config file, located at './config/starterkit.json5', you can choose whether or not other modded starter items should be removed or given after the kit.
Examples of these modded starter items are guide books.


To give other players (or yourself) a starter kit manually, you can use the '/starterkit give <player> (kit_name)' command.
The kit_name argument is optional, if left out:
If the mod is configured via intermediate, a kit may be given randomly.
If the mod is configured via advanced, the kit choice screen may be shown.




Section 2: Intermediate
You can add another active kit by using the '/starterkit add (kit_name)' command.
With the default configuration, this means that new players will now randomly receive the \"Default\" or \"No Bread\" starter kit.


To see all active starter kits, use the '/starterkit list' command. To see inactive starter kits, use '/starterkit list inactive':


To disable an active kit, use '/starterkit deactivate <kit_name>'. This moves it to the './config/starterkit/kits/inactive/' folder.


The mod can also give potion effects alongside the starter kit! Make sure 'usePotionEffectsInStarterKit' is enabled in the config.
Then, just make sure to have the potion effect enabled, and use the '/starterkit set' or '/starterkit add' command.
The effect duration will be set to what the player has exactly now, but we will round that up in a later step.


For this example, I've given the player the speed potion effect. This was active when using the previous command:


Locate and open the kit we've just created. The path is './config/starterkit/kits/Speed_Kit.txt':


This is the data file for the \"Speed Kit\" kit. It contains the items the player will receive and at the bottom what effects will be given to the player.
When a kit is created without active effects, that line will be empty. Otherwise it copies the exact level and duration.
In case of this example, it contains a reference to the Speed effect. It's lvl 1 with a duration of 3341 ticks, which equals 167 seconds. 20 ticks = 1 second.


I'm going to change the effect a player will receive to Speed level 5, with a duration of 5 minutes. 6000 ticks = 300 seconds = 5 minutes:


You can reload any changes you've made to files inside './config/starterkit/' via the '/starterkit reload' command:


That's it! Whenever a player first joins a world, they will now receive the \"Speed Kit\" kit. Which contains a few standard items and the Speed V effect, with a duration of 5 minutes:

\r\n
Show Spoiler\r\n

\r\n
\r\n

 


Section 3: Advanced
Starter Kit also contains a custom kit choosing screen! Here's an example of what it looks like with the \"Default\" kit.
In this section we'll enable this, create a kit and add a description for it.


Disable the \"Randomize Multiple Kits Toggle\" inside the config. Remember, it's located inside './config/starterkit.json5'. You can also use the in-game config editor for this:


There are some default kits located inside the './config/starterkit/kits/inactive/' folder. Let's enable those for this example.
Use the '/starterkit activate _all' command to activate all inactive kits.



You can use the '/starterkit list' command to see which kits are currently active:


Since everything contains default values, you can immediately see it working! Load a new world, and you'll be shown the choose kit screen:

\r\n
Show Spoiler\r\n

\r\n
\r\n

 
Let's add our own custom kit, and see how the descriptions work.
Start off with an inventory of your choosing, and use the '/starterkit add' command.
I'm calling it \"Pumpkin\".



All kit descriptions are saved inside './config/descriptions/'. These are automatically created whenever you create or add a kit.
Open the description file with the kit name you've just set. In my case, the file is './config/descriptions/Pumpkin.txt'.


This is the default description content for any newly created kit.
The description is used for the choose kit screen, and the '/starterkit info <kit_name>' command.



Change the description to whatever you'd like! There isn't a size limit, but any overflow will be hidden. So make sure it's not too long:


To reload the changes we've made to the description file, use the '/starterkit reload' command:


That's it! The description will now be visible on the choose kit screen:


Click on the \"Choose Starter Kit\" button, and receive the selected kit:


Starter Kit can automatically detect if the mod has been installed on the client.
There is support for server-side only use. In that case, players can choose a kit via commands.
Whenever the server doesn't get a response from the client, meaning the mod isn't installed, the following message is sent on first join:


Players can use the '/starterkit info <kit_name>' command to see which items are included in the starter kit:


A kit can be chosen with the '/starterkit choose <kit_name>' command:


------------------

You may freely use this mod in any modpack, as long as the download remains hosted within the Modrinth ecosystem.

Serilum.com contains an overview and more information on all mods available.

Comments are disabled as I'm unable to keep track of all the separate pages on each mod.
For issues, ideas, suggestions or anything else there is the Github repo. Thanks!


\"\"

", + "body_url": null, + "published": "2022-08-31T18:56:28.424726Z", + "updated": "2024-08-08T22:42:38.058410Z", + "approved": null, + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 467565, + "followers": 157, + "categories": [ + "adventure", + "management", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "UExnPFd0", + "PyPD7H89", + "1uskVkb1", + "bWyBvAm1", + "tXhpLTE2", + "4YoJxdA9", + "vv4mCF5J", + "Xtzm6BAS", + "CQHnmuYg", + "ilY5AmX1", + "Mid2h9eJ", + "LkoWb7wY", + "WSYtNOZ7", + "fZ2idBc9", + "82p0hfzC", + "LbCUN94Y", + "yoTqC7M5", + "omJXB9H5", + "Rqj5tZki", + "UoeOKtMK", + "lkZ4MFsc", + "sj5Vzzub", + "GCakQH66", + "692fmdzk", + "fuk9KbDs", + "waAD0WBJ", + "VNFRYSf3", + "6ERWj8CM", + "8iQzF9Xw", + "Jxksba7W", + "XDyaFAdA", + "1iljwxux", + "oeFVfjlS", + "8ysl4dK1", + "CyUzvPin", + "13CMI21O", + "pLNsi6nl", + "GPiBeSyc", + "cLmpkvul", + "Gccqwaju", + "PUQyueKW", + "PmrWrfiI", + "g2acc8mi", + "1OyWsesA", + "Vtg4DQyL", + "kBIWEqgF", + "gYVA0ZB6", + "MVnIGVY3", + "5I6aYPnW", + "6HnyBbns", + "ACauENHf", + "FJtjQWb6", + "zToANVwf", + "CWcB1Trq", + "PMkbV2dY", + "xwuYfQEV", + "dwmReMQ2", + "JdI3NrcY", + "7BD3dh3n", + "k8gBfBkU", + "PFJiNgPp", + "BLxqJ9tp", + "VZ1IcT1v", + "8KFsMuyQ", + "E2Mxvf1j", + "ctEwjzYH", + "I8HoSR4u", + "n1vEcey0", + "VVPJWVKk", + "mZf90ShY", + "p86xgczm", + "vfHW3ty6", + "Ijk5ownz", + "UOwzT7Jm", + "NrTul6JY", + "JwSShdeH", + "kwRz8bUf", + "ON6Y5Ydt", + "OD40UAl0", + "HM4ElLcI", + "aXwDMFto", + "YehkzHk5", + "zgCOxV4R", + "h9WNHjqr", + "mgtq9mKs", + "WI7f7CzZ", + "4gYC6M8q", + "HeCWkb9d", + "w4J9ylrE", + "xLfZpcT1", + "EmxmlDMD", + "nDDhwn2h", + "pb3dtXM1", + "vqZZ1MXc", + "RYlydA2n", + "mVYtJdmn", + "nGVvCsgb", + "ktRQf2UR", + "vtQmO7sw", + "wR0XqBMW" + ], + "icon_url": "https://cdn.modrinth.com/data/6L3ydNi8/icon.jpg", + "issues_url": "https://github.com/Serilum/.issue-tracker/labels/Mod: Starter Kit", + "source_url": "https://github.com/Serilum/Starter-Kit", + "wiki_url": null, + "discord_url": null, + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://patreon.com/serilum" + } + ], + "gallery": [], + "color": 2498063, + "thread_id": "6L3ydNi8", + "monetization_status": "monetized" + }, + "TerraBlender-fabric-1.20.1-3.0.1.7": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "kkmrDlKT", + "slug": "terrablender", + "project_type": "mod", + "team": "bf2Fdtqq", + "organization": null, + "title": "TerraBlender", + "description": "A library mod for adding biomes in a simple and compatible manner!", + "body": "
\n\n![TerraBlender Logo](https://cdn.modrinth.com/data/kkmrDlKT/images/43d5fa44d31368b5fb4ae76b51d5231879c6a510.png)\n\n[![Support on Patreon](https://i.imgur.com/ai6ZV95.png)](https://www.patreon.com/Adubbz) [![Donate via PayPal](https://i.imgur.com/rEoNmyV.png)](https://www.paypal.com/donate/?business=AdubbzG@gmail.com&cy_code=USD) [![Follow on X](https://i.imgur.com/WNmQOhb.png)](https://twitter.com/TheAdubbz) [![Join our Discord](https://i.imgur.com/N7eZOt0.png)](https://discord.gg/GyyzU6T)\n\n
\n\nTerraBlender is a library mod for adding biomes in a simple and compatible manner with Minecraft's new biome/terrain system.\n\n**TerraBlender is available for [Forge](https://files.minecraftforge.net/net/minecraftforge/forge/), [NeoForge](https://neoforged.net/) and [Fabric](https://fabricmc.net/use/installer/).**\n- **[View all Forge versions](https://modrinth.com/mod/terrablender/versions?l=forge)**\n- **[View all NeoForge versions](https://modrinth.com/mod/terrablender/versions?l=neoforge)**\n- **[View all Fabric versions](https://modrinth.com/mod/terrablender/versions?l=fabric)**\n\n## Developers\nDocumentation for how to use TerraBlender's API can be found on the **[TerraBlender wiki](https://github.com/Glitchfiend/TerraBlender/wiki/Getting-started)**", + "body_url": null, + "published": "2023-03-01T10:32:34.314130Z", + "updated": "2024-06-15T01:51:06.016872Z", + "approved": "2023-03-04T07:46:44.901915Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": "https://github.com/Glitchfiend/TerraBlender/blob/TB-1.19.3-2.1.x/LICENSE" + }, + "downloads": 2564518, + "followers": 614, + "categories": [ + "library", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "n4oVcavy", + "omhliU1A", + "kqq4rR5H", + "aScyaaLb", + "bj1hHkPZ", + "mF9UAJ1u", + "FXVmoBuE", + "gigcHzac", + "CQFCiNyY", + "KF0tW8QK", + "olt09M6U", + "PEdujLvH", + "iNh81NtW", + "yJwRxdEG", + "kegRBLZC", + "SQStOj5x", + "W09SWEA8", + "HyNEwQTj", + "qMwURRKF", + "WsIbQnSi", + "GTLQgaw7", + "LXbKkKG8", + "9ljoLhMy", + "Eeh7VNSN", + "gbu6KHQD", + "RmgIaUfn", + "j2DNltG9", + "b4Z1PxTI", + "kUkrnuK4", + "jxTBtKlC", + "WRazOwBG", + "5I5zYWye", + "pVtyDAOX", + "lfup7ewg", + "tRpU7nNd", + "fjg37hue", + "o9VVCJOh", + "mo6B7Y0v", + "NHuJfL2d", + "lyo0XdSi", + "452yrTJ9", + "ED3YI6fO", + "z6TZqcOY", + "dg9bvQOq", + "fyNmyvJZ", + "SaH8fB6d", + "cUbL08DX", + "7867fntz", + "QydonUnK", + "swXUWyTf", + "QTHLdP61", + "gQy8Vdnw", + "82ByN52l", + "3zxwZDRg", + "TPb9rEa0", + "KAIfNXqm", + "4QBtuvfy", + "BVG2UYc8", + "BIZ1SFAu", + "ROK3TiE7", + "SgtU1JtB", + "A1OONB1L", + "pHok2xtd", + "6iD0KtFw", + "MsQcbWSi", + "LKifikRd", + "rKyY8bMF", + "pNu6zO95", + "GpiWTRWI", + "wvav3wp2", + "RDDdLeNk", + "e5sZSSCv", + "PQD4cuW0", + "uzLAALgX", + "M5qJyhuy", + "qlK8P4Zy", + "E09IKBqt", + "k17TeJtT", + "DXPYduoZ", + "bxjE3d5M", + "4dek5TNV", + "HOhOipZX", + "c1EwfsIg", + "VdS5hUbB", + "59hVdVtO", + "yfdhz9bk", + "Y2NkH7i0", + "lDn62Uhg", + "tucxIn7D", + "8AVRrwsL", + "saTbzcCT", + "3OLLGaRd", + "Fq3AzLHW", + "zACPI7Rn", + "dH8dFULh", + "ayMBPzTR", + "9XGH99Q5", + "zO4Wq863", + "AVtwrfgu", + "ifgGkddC", + "CpMIkJE9", + "RmzdRG1e", + "A4sHU55f", + "r12UQ4eX", + "3M8Ei90D", + "I1qVHjbO", + "6Bw9ZMwe", + "v0V951Ah", + "F8wLNLEE", + "KUudludY", + "1X45bIh6", + "CYO9LVmT", + "Ol8uNODa", + "mN2WguBY", + "VyCeijL6", + "fyG9xni5", + "WjZcJl8o", + "CBu5QS6B", + "DRBPMUBV", + "OTf7pBak", + "FR5mvdMH", + "wLnfaWUz", + "dHrdmYai", + "W98INPub", + "OuDODdbW", + "jFgqc7VY", + "MdtfhF56", + "l7kuXRU2", + "VVNBuXzH", + "wHvBeW2E", + "GQm2HSTs", + "XtVuvbmQ", + "pTI1MLSA", + "EFg6bMVd", + "sI3lGvqG", + "PFDKDY6T", + "hJ9OAyhI", + "59NLmD8h", + "hjIPbA3l", + "YpBcsAD7", + "sQtspQn4", + "nXbC3bi9", + "hVGadld9", + "m8Qb8dGG", + "r8NjV7Qj", + "wkEhdDz0", + "iiGtfFce", + "UcRtHLmf", + "WAzQUZ1A", + "MfY1c0QZ", + "QsTQiTVc", + "Gq0MqmOl", + "LcgBIvC6", + "tashH8sv", + "Bawyxiss", + "BsKjbTBv", + "C0Jypg2m", + "xUYdZQ7t", + "t59WOLu9", + "AdXlu0CA", + "FcS0iYh3", + "bjtRZUxw", + "mcpmpMGw", + "ZbpOnSVr", + "DgXfKyKD", + "yV08RLMF", + "kIq25rmI", + "hNzU35iS", + "prICYTwg", + "C9lnWgOg", + "zCLKwgqI", + "VPXM1H0w", + "sBXQQlUV", + "b15PC6xJ", + "NvfrZQFv", + "LEShZYdW", + "W2FL9kpt", + "YH99nabV", + "vxNBwfRj", + "ATMo6RM4", + "qBqPXZ7o", + "ErMgVqlI", + "UpJEL4yB", + "2usds9Ky", + "7fO9yhfn", + "Cnwlsdvf", + "CAd3rMDR", + "xigWyXa8", + "baK4eX3b", + "YIUL3PEn", + "VRjBM77b", + "iteCKoP9", + "Rj98OiYR", + "ywiJhcuG", + "O47xVod1", + "3nPeLY1p", + "5xw3P2qN", + "jGx3iN5F", + "nZwFn2MJ", + "UcEhlQra", + "XXnWoSih", + "hDr2nn7q", + "VhKVPw92", + "2WuUmLZ1", + "s3Jtdl0Z", + "26maC79e", + "gISWvUyU", + "alUPTpIC", + "FMGacTN8", + "CR9rGBvb", + "y5GDkHL9", + "2NOgeyWL", + "a3PqS5R0", + "mZ41EnfG", + "s2moVkPr", + "C9vVmqMI", + "lBJ7gMbw", + "KLz9dQtt", + "e5jLxVeX", + "LDj6JRk9", + "SuHC69aM", + "znCGEN4K", + "DhgbZytK", + "MWBWLGTG", + "Ru5DuboB", + "LxnQ8tFk", + "vk7kjaO7", + "iCdIqcFv", + "3sBxYcYs", + "YlwVJumN", + "silo0xJT", + "qpCqqA93", + "VoKzhK7k", + "OsRvalxg", + "9U0OQEDz", + "BSKkuhsh", + "CMDA8IcP", + "f0r1SsWG", + "HibKOt9j", + "WoEvuFC4", + "aDuBswaU", + "FsEnag6P", + "drRriqY5", + "HdFY06Z7", + "kHP1UkET", + "1BMJMxlx", + "h6cClRTW", + "Cmt9jpg5", + "isQtCAct", + "xyaCkIUL", + "vATy6PWW", + "qQWxMxU7", + "TOkIPRbD", + "twVZvhB5", + "fCaaCuTy", + "XNoACRNE", + "NC75R0GT", + "M9KCFWno", + "6hu29DCI", + "mujuZkFb", + "V0r5LAQh", + "MUsx35Ry", + "8NKvb4Rf", + "HEPVhvwM", + "Tc1j6lFr", + "tt61FVEL", + "OTamV6SO", + "34tFWc8B", + "beTUFJxK", + "TD7W2cLM", + "C8VWoUNH", + "evmyZKEe", + "quob9xco", + "idY2A9mB", + "Ek11H9pa", + "s0s2MCHE", + "jdqvBG5g", + "jVWd6Qvj", + "6xeo7obi", + "6SXQ0Tbm", + "HSjv2yp3", + "Tl8jcsiu", + "wlWWiBPJ", + "IyeI0uRd", + "IM4hwwGH", + "pvIKzIxE", + "e0JUI1OX", + "T1FKe1B4", + "DaOQrif1", + "3j9ON2qd", + "44D3Fpj9", + "cCNxb9bl", + "ADHJnwVA", + "TlMYO5kT", + "AjV3GtqV", + "ifr7FJnd", + "gxNSsje2", + "CS6GzVhA", + "KF97dJcF", + "XvYHyQcG", + "zzgNcnwe", + "uAEwqIGY", + "yeeVvd3D", + "P2C11Z4o", + "UAWC0hRA", + "bKEV2dgO", + "3orAWPg1", + "UQTQTV72", + "rk8WntLM", + "234Gi0p1", + "WUXei5mp", + "YgB5WB3Q", + "xtBdyFtA", + "NDKrFoA1", + "ORx8JLf9", + "6xuhVFC9", + "rfFkiSDR", + "htFwnGWu", + "jbRHa5Hy", + "xezfbkog", + "IPdVGfJl", + "BfQI5cZO", + "p54gG9xp", + "fni1sCoC", + "xcfa1biZ", + "XcsXn3fD", + "FTCsCRVl", + "aM2lt6Tu", + "xbNuzFJi", + "TBD7PU11", + "qHR52aCH", + "rGKbHaah", + "9FNlKfpD", + "OZV0Z5AE", + "Hmw9PMaH", + "Y1XWSxDs", + "FnfW1JJL", + "oCGyhKcY", + "3XLPwLnV", + "oALTVpBI", + "lY3u8Ors", + "rJjif5b1", + "46vDGedb", + "HiKDZdo0", + "wtCOTHGT", + "HI0iCUpi", + "FZV63yhg", + "syeuAvi3", + "D2wyURAU", + "h96HEGgV", + "ohMfOkHG", + "EpEoPPwp", + "NPjNlIK9", + "b3ecJhTw", + "CkOfSAT1", + "XLPAoSOd", + "sujhCFnt", + "lN4iXEkx", + "xBeonLfL" + ], + "icon_url": "https://cdn.modrinth.com/data/kkmrDlKT/ffe690c604b123c63ee77a5baf76cf008cb73663.png", + "issues_url": "https://github.com/Glitchfiend/TerraBlender/", + "source_url": "https://github.com/Glitchfiend/TerraBlender/", + "wiki_url": "https://github.com/Glitchfiend/TerraBlender/wiki", + "discord_url": "https://discord.gg/GyyzU6T", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/Adubbz" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/kkmrDlKT/images/43d5fa44d31368b5fb4ae76b51d5231879c6a510.png", + "featured": false, + "title": "TerraBlender Logo", + "description": null, + "created": "2023-03-01T10:36:00.345278Z", + "ordering": 0 + } + ], + "color": 10130574, + "thread_id": "kkmrDlKT", + "monetization_status": "monetized" + }, + "Terralith_1.20.x_v2.5.4": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "8oi3bsk5", + "slug": "terralith", + "project_type": "mod", + "team": "L2q5L80c", + "organization": "xdGr4sFb", + "title": "Terralith", + "description": "Explore almost 100 new biomes consisting of both realism and light fantasy, using just Vanilla blocks. Complete with several immersive structures to compliment the overhauled terrain.", + "body": "\n# Terralith\n\n[![Latest Version](https://img.shields.io/github/v/release/Stardust-Labs-MC/Terralith?color=blueviolet&logo=github \"View latest release\")](https://github.com/Stardust-Labs-MC/Terralith/releases) [![Discord Badge](https://img.shields.io/discord/738046951236567162?color=blue&logo=discord \"Join our Discord Server\")](https://discord.gg/stardustlabs) [![Modrinth Badge](https://img.shields.io/modrinth/dt/terralith?label=Modrinth&logo=modrinth \"View our Modrinth page\")](https://modrinth.com/mod/terralith) [![License Badge](https://img.shields.io/badge/license-Stardust_Labs-green \"View the Stardust Labs License\")](https://github.com/Stardust-Labs-MC/license) [![Wiki Badge](https://img.shields.io/badge/wiki-Miraheze-yellow \"View our Wiki\")](https://stardustlabs.miraheze.org/) [![Issues Badge](https://img.shields.io/github/issues/Stardust-Labs-MC/Terralith?color=orange&logo=github \"View or open an issue\")](https://github.com/Stardust-Labs-MC/Terralith/issues) [![Weblate Badge](https://img.shields.io/weblate/progress/stardust-labs?server=https%3A%2F%2Fweblate.catter.dev&logo=weblate \"Translate here\")](https://weblate.catter.dev/projects/stardust-labs)\n\nTerralith takes Minecraft's 1.18 massive world generation overhaul, and turns it up to eleven.\n\n![terralith_banner_squashed](https://user-images.githubusercontent.com/63272345/224816673-7f074733-da85-4673-a7b0-3362651c4dbd.png)\n\n## Notes\n- Terralith is *technically* compatible with William Wyther's Overhauled Overworld, Biomes O' Plenty, and Oh The Biomes You'll Go; but it requires Terrablender, which screws with the biome distribution\n- Terralith is compatible with Tectonic, if you use [Apollo](https://github.com/Apollounknowndev)'s [Terratonic](https://www.planetminecraft.com/data-pack/terratonic/)\n- Do not add this to an existing world - reset yours first, or use a new world\n- View the structures and biomes per seed using [jacobsjo](https://github.com/jacobsjo)'s [Minecraft Datapack Map](https://map.jacobsjo.eu/)\n\n## Description\n### Biomes\nTerralith adds over 95 brand new biomes, as well as updating almost every vanilla biome with new and improved features. There are also new terrain types: canyons, shattered biomes, floating islands, deep ocean trenches, and much, much more.\n\n**Yellowstone** is one of Terralith's staple biomes - a simple and beautiful landscape, based on the real life US National Park. Among the list of realistic biomes are **Yosemite Cliffs**, **Shield**, and many more depending on what you're looking for in a biome. **Highlands** and its variants offer a flat surface to create on - builders can imagine anything from huge mega cities to small simple cottages. Adventurers can explore the breath-taking **Volcanic Peaks** and discover the beautiful **Desert Oases**.\n\nWhile realistic biomes can remind us of the beautiful planet we live on, Terralith offers a plunge into the world of fantasy as well. Adventurers can wander through the purple and mystical **Moonlight Grove** and **Amethyst Rainforest**, or climb the unforgiving cliffs of the **Scarlet Mountains**. If determined, sailers can find the mysterious **Mirage Isles**, or even the elusive and nostalgic **Alpha Islands**. Terralith encourages imagination to run wild here.\n\nIf you feel the surface is too face, have no fear - custom caves lurk beneath your feet! Similar to Minecraft's Lush Cave, the **Underground Jungle** is full of foliage, and rarely some old abandoned houses. Other caves, like **Infested** and **Fungal Caves** are overgrown with spiders and fungi! If you dig super deep, you could stumble upon a sister to the Deep Dark: the **Frostfire Caves** are dangerous and menacing. Beware!\n\n### Structures\nTo tie all of Terralith's magnificent biomes together are it's structures. The ominous tall **Spire** pierces the sky in the iciest biomes. Rarely, you can find **Fortified Villages** in the plains and desert - the villagers have progressed quite far as a society! Finally, if you find yourself lost at night, cold and hungry, you might stumble into the warm protection of the simple Glacial Hut.\n__ __\n\n[![Patron Ad](https://user-images.githubusercontent.com/63272345/224786738-7baefaf8-267f-41b6-8ac5-53cc4bd5707e.png \"Join our Patreon!\")](https://www.patreon.com/stardustlabs)\n\n[![Bisect Hosting Ad](https://user-images.githubusercontent.com/63272345/224786219-f87f21d2-fb51-4d78-82df-a16e83fe25c9.png \"Use code STARDUST\")](https://www.bisecthosting.com/stardust)\n ", + "body_url": null, + "published": "2022-11-13T21:48:54.507121Z", + "updated": "2024-07-07T22:16:46.219799Z", + "approved": "2022-11-23T01:21:11.804610Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LicenseRef-Custom", + "name": "", + "url": "https://github.com/Stardust-Labs-MC/license/blob/main/license.txt" + }, + "downloads": 1762049, + "followers": 2262, + "categories": [ + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "Q9qUUqA7", + "Wd3Co0mZ", + "81tshMIZ", + "Xf5mFGCS", + "jUK1mCz3", + "1latp88m", + "pNFzTzQd", + "mLdNNka6", + "K3S6BASh", + "aYOzrVFZ", + "Y4i2gvLB", + "D0hKeWDQ", + "JT2esX5R", + "8N8lLvTW", + "34PhE3zd", + "2w1uZoRC", + "PNByHzei", + "WZvndtxX", + "UJtMNPNx", + "Rq2BBA8A", + "hYoo0DKV", + "CDrDiFNK", + "qFd4s3fV", + "FOe2l0tx", + "IWVbiEbl", + "1hOeraaL", + "4KrRTVvQ", + "WgDuoe1K", + "xm11wemG", + "FgvUosFH", + "zA1qYB0L", + "6DoFR4md", + "owDSctxm", + "rWmFwtGy", + "IA4tbVrS", + "5k90Bexh", + "WeYhEb5d", + "Mm6TmSwo" + ], + "icon_url": "https://cdn.modrinth.com/data/8oi3bsk5/34c751cc804839ed3c1d9f21dfd53d98368fedfc.png", + "issues_url": "https://github.com/Stardust-Labs-MC/Terralith/issues", + "source_url": "https://github.com/Stardust-Labs-MC/Terralith", + "wiki_url": "https://stardustlabs.miraheze.org/wiki/Terralith", + "discord_url": "https://discord.gg/stardustlabs", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://patreon.com/stardustlabs" + }, + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/stardustlabs" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/8oi3bsk5/images/8eb1319d93336ca3ac29578e029459c3c0ec5132.jpeg", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-13T21:53:32.559416Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/8oi3bsk5/images/be7daf4d0023204165ab00cfa7815f8068bc951b.jpeg", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-13T21:53:29.371658Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/8oi3bsk5/images/e66c54081b2abbdeb6dfdb0bde26123f8641176c.jpeg", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-13T21:53:31.044672Z", + "ordering": 0 + } + ], + "color": 4996660, + "thread_id": "8oi3bsk5", + "monetization_status": "monetized" + }, + "The_Graveyard_3.1_(FABRIC)_for_1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4" + ], + "id": "QivVPB8W", + "slug": "the-graveyard-fabric", + "project_type": "mod", + "team": "kKhUZuLa", + "organization": null, + "title": "The Graveyard (FABRIC)", + "description": "A mod that adds structures, mobs, bosses and blocks themed aroung the graveyard.", + "body": "\n\n

\n\n

\n

The Graveyard adds new spooky biomes, structures, mobs and blocks to make your minecraft adventure more thrilling and challenging.
\nEvery structure, mob and biome was built with a lot of attention to detail to create an immersive experience for you.

\n\n

Structures

\n
    \n
  • Haunted House: uncover the secrets of this run down house.
  • \n
  • Small Grave: a final resting place encountered frequently while exploring.
  • \n
  • Small Graveyard: a cemetery that comes in multiple variants.
  • \n
  • Medium Graveyard: a quite large cemetery in the woods surrounding a minecraft temple. It holds a lot to explore and to gather, but nothing comes without a risk. Especially at night.
  • \n
  • Mushroom Grave: an overgrown grave, spawning in swamps, jungles and mushroom islands.
  • \n
  • Memorial Birch Tree: an imposing tree found in birch forests.
  • \n
  • Large Graveyard: an immense jigsaw structure generating in forests. But be warned - it is full of dangers.
  • \n
  • Crypt: an expansive labyrinth, full of traps, loot and dangers, hidden in the depths.
  • \n
\n\n

Boss - Corrupted Champion

\n
    \n
  • The Corrupted Champion is the entombed remnant of an unknown hero, fallen into corruption. Its power arise from its bone staff, which was crafted from the bones of its innocent victims. With its power, the lich can controll the minds of its enemies and turn peaceful beings into abominations fighting along its side. But beware. Even if you manage to drain the staff's corruption, the fight isn't over.
  • \n\n \n
  • Phases:
  • \n\nSpell phase abilities: Bone Vortex Attack, Skull Cast Attack, Levitation Spell, Falling Corpses Spell, Summon Minions Spell, Labyrinth Heal Attack.
    \nHunt phase abilities: Darkness encases the player while the Lich hunts its prey. Don't let it come to close.
    \nDeformation phase.\n\n\n
  • How to summon the Corrupted Champion:
  • \n\nCollect the three bone staff pieces (Ominous Bone Staff Fragment) from the Ruins structure. Every Ruin has a unique fragment (upper, middle and lower bone staff fragment).
    \nObtain a bone dagger from an Acolyte, or craft it yourself.
    \nHold a glass bottle in your offhand and start killing villager with the bone dagger. You'll get a Vial of Blood. Fill the vial to the limit.
    \nFind the Lich Prison structure, a large floating island above the oceans.
    \nWait until it is night, place the bone staff pieces (from upper to lower) on the dark corrupted deepslate blocks in front of the altar (they should fairly stand out).
    \nPour the Vial of Blood into the altar.
    \n\nVoil\u00e0, you unleashed pure evil into the world, probably causing the death of thousands of innocent people and very likely your own.\n
\n\n

Mobs

\n
    \n
  • Skeleton Creeper: a faster undead variant of the creeper. It may has lost his destructive powers, but its haunting appearance will blind you.
  • \n
  • Acolyte: a darker representative of the illager family. If he'll find you, your bones will serve him as a new weapon.
  • \n
  • Reaper: Ghosts? Here, in a spooky graveyard mod? No... The reaper takes this place.
  • \n
  • Ghoul: a deformed revenant, hold together only by his rage on the living.
  • \n
  • Revenant: the animated remains of a once human being.
  • \n
  • Nightmare: a deformed creature that moves quicker than it seems. Better stay away and never look at it.
  • \n
  • Wraith: haunting those who dare to desecrate its coffin.
  • \n
  • Corrupted Illager: a fast undead version of the illagers.
  • \n
\n\n

Blocks and Items

\n
    \n
  • Corruption: \u21b8\u1511\u2237\ua58c \u1511\u30ea\u21b8 \u14b7\u234a\u254e\ua58e \u14b2\u1511\u2138 \u0323 \u2138 \u0323 \u14b7\u2237
  • \n
  • Sarcophagus: a final resting place now turned into storage space.
  • \n
  • Coffin: a final wooden resting place in all wood variants.
  • \n
  • Glazed Urn: a beautiful ornated urn, that serves as storage.
  • \n
  • Small Urn: a simple urn, that serves as storage.
  • \n
  • Fire Brazier: a dark cryptic iron bowl, displaying soul flames or flames when ignited.
  • \n
  • Dark Iron Ingot: an ashen version of iron
  • \n
  • Dark Iron Block: decorative steel-like block
  • \n
  • Dark Iron Door/Trapdoor: dark version of the iron door and trapdoor, but no need for redstone to open them.
  • \n
  • Dark Iron Bars: like vanilla iron bars, but dark and matching the theme.
  • \n
  • Skeletons: a fragile decoration block in many different forms that can be found in graveyard structures.
  • \n
  • Gravestone: edit the gravestone to create a memorial for your lost minecraft dog or horse.
  • \n
  • Ceramics: vases to decorate the graveyards (not craftable).
  • \n
  • Bone Dagger: crafted with bones, this weapon is used in dark rituals. It may also be useful for breaking glass.
  • \n
\n

\n\n

Join my Discord for help, request or ideas!

\n\n

\n\n
\n\n

\n

Bugs and Source code

\n

\nGithub issue tracker\n\n\n

\n

Dependencies

\n

\nGeckolib for Fabric\n

\nFabric API", + "body_url": null, + "published": "2022-06-05T13:49:22.346565Z", + "updated": "2024-02-24T10:31:37.430453Z", + "approved": "2022-06-05T13:49:22.346565Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 542908, + "followers": 359, + "categories": [ + "adventure", + "mobs", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "T2v9Zocf", + "ADGfi5tR", + "DFoxFE8s", + "miNsHtVW", + "BHHoEJ2S", + "F2KWIGBI", + "iVynlDtc", + "wFRPOsoI", + "eAAKbtBg", + "OXDcBMyv", + "PWLzRlBv", + "4pakbmo2", + "Hpn2GMza" + ], + "icon_url": "https://cdn.modrinth.com/data/QivVPB8W/icon.png", + "issues_url": "https://github.com/finallion/The_Grayeyard_-FABRIC-/issues", + "source_url": "https://github.com/finallion/The_Grayeyard_-FABRIC-", + "wiki_url": null, + "discord_url": "https://discord.gg/8JgHeQ9eeQ", + "donation_urls": [ + { + "id": "bmac", + "platform": "Bmac", + "url": "https://buymeacoffee.com/Finallion" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/QivVPB8W/images/256fafe35ecd47e7f1464a7efed4d72382db315c.png", + "featured": false, + "title": "Large Graveyard", + "description": null, + "created": "2022-06-05T13:49:12.712149Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/QivVPB8W/images/4e74f4554d4cedddaec49d0330a42d5e2c68b137.png", + "featured": false, + "title": "Medium Graveyard", + "description": null, + "created": "2022-06-05T13:49:12.712149Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/QivVPB8W/images/8e42ffb95e9173e4e6073ec084b1b329454590c7.png", + "featured": false, + "title": "Revenants", + "description": null, + "created": "2022-06-05T13:49:12.712149Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/QivVPB8W/images/c8084bab1fd23147fe2714b2a4824ef1f0a33922.png", + "featured": false, + "title": "Haunted House", + "description": null, + "created": "2022-06-05T13:49:12.712149Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/QivVPB8W/images/d5bdfaa6d838e60fee85857ecb3cf40ee4a2bc85.png", + "featured": false, + "title": "Desert Graveyard", + "description": null, + "created": "2022-06-05T13:49:12.712149Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/QivVPB8W/images/e4a0db97552fae9884312816812ad3936d720b2b.png", + "featured": false, + "title": "Custom Blocks", + "description": null, + "created": "2022-06-05T13:49:12.712149Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/QivVPB8W/images/f64f83a412b38d042524957ccfaed35c4816a2a4.png", + "featured": false, + "title": "Mushroom Grave", + "description": null, + "created": "2022-06-05T13:49:12.712149Z", + "ordering": 0 + } + ], + "color": 2498849, + "thread_id": "QivVPB8W", + "monetization_status": "monetized" + }, + "TieredZ": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.20.1" + ], + "id": "z6sMEexp", + "slug": "tieredz", + "project_type": "mod", + "team": "IkGpiU4D", + "organization": null, + "title": "TieredZ", + "description": "Adds tiers/modifiers to tools", + "body": "![Headline](https://i.imgur.com/gb6pPeJ.png)\n\n
\n\n[](https://discord.gg/cV4cJyGXqF) \n[](https://globox1997.github.io/wiki/mods/TieredZ/)\n[](https://github.com/Globox1997/tiered/issues)\n
\n\n\u201cDescription\u201d\n

\n\nTiered is a Fabric mod inspired by Quality Tools. Every tool and armor piece you make will have a special modifier, which provides additional stat bonuses and abilities. \nThis mod is originally made by Draylar and this is a fork with additions with permissions to publish it.\n\n![Showcase](https://i.imgur.com/AlasyBr.png)\n\n
\nReforge Gear\nReforge your gear at the anvil for a better item tier. Reforging increases the luck for getting better item tiers. \n\nLeft Slot: Tiering Item Material (if non exist, default flint (Tag: tiered:reforge_base_item)) \n\nMiddle Slot: Tiering Item \nRight Slot: Amethyst Shard (Tag: tiered:reforge_addition)\n
\n\n\u201cMisc\u201d\n

\n\n[](https://modrinth.com/mod/fabric-api)\n[](https://modrinth.com/mod/cloth-config)\n\n\n\nThis mod is developed for Fabric. \nThere are no plans to develop a Forge version. \n\n\nModpack Permission: \nFeel free to use it in any modpacks.\n\n\nBug Report: \nJust report bugs at the github page.", + "body_url": null, + "published": "2023-04-19T18:59:34.338631Z", + "updated": "2024-04-03T18:47:33.588714Z", + "approved": "2023-04-22T17:40:06.304667Z", + "queued": "2023-04-21T14:05:49.368115Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 277687, + "followers": 137, + "categories": [ + "equipment" + ], + "additional_categories": [ + "game-mechanics" + ], + "loaders": [ + "fabric" + ], + "versions": [ + "ks3NpqRt", + "p6O5T5sE", + "frMnqIvd", + "urtWlfIb", + "SfQYvgGK", + "EAm93xBv", + "ZF0HKlbd", + "GFUW7N2P" + ], + "icon_url": "https://cdn.modrinth.com/data/z6sMEexp/f779f39300d45cbb4067f5c0f6016402748a412c.png", + "issues_url": "https://github.com/Globox1997/tiered/issues", + "source_url": "https://github.com/Globox1997/tiered", + "wiki_url": "https://globox1997.github.io/wiki/mods/TieredZ/", + "discord_url": "https://discord.gg/cV4cJyGXqF", + "donation_urls": [], + "gallery": [], + "color": 4054477, + "thread_id": "z6sMEexp", + "monetization_status": "monetized" + }, + "tlc-fabric-1.0.1-1.20.X": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.4", + "1.20", + "1.20.1" + ], + "id": "FGlHZl7X", + "slug": "the-lost-castle", + "project_type": "mod", + "team": "hDadDc7q", + "organization": null, + "title": "The Lost Castle", + "description": "Former structure of End Remastered, The Lost Castle introduces an enormous castle. Inside resides infinite fortune and mysteries from a long forgotten civilization that disappeared a long time ago...", + "body": "![Lost Castle Banner](https://i.imgur.com/2hvM43r.png)\u00a0\n\n[![Discord](https://img.shields.io/discord/781617369285263400?label=Discord&logo=Discord&logoColor=ffffff&style=for-the-badge)](https://discord.com/invite/D9cxayDNSP) [![PayPal](https://img.shields.io/badge/PayPal-Donations-009ADC?style=for-the-badge&logo=PayPal)](https://www.paypal.com/donate/?hosted_button_id=G7P6FV26SRGS2 \"PayPal\")\n[![Youtube Trailer](https://img.shields.io/badge/YouTube-Trailer-FF2020?style=for-the-badge&logo=YouTube&logoColor=FF2020)](https://www.youtube.com/watch?v=FMwke39lZu8 \"Trailer\")\n\nFormer structure of End Remastered, The Lost Castle introduces an enormous castle that you'll be able to find with the help of a map given by a journeyman cartographer. Inside resides infinite fortune and mysteries from a long forgotten civilization that disappeared a long time ago and is now eagerly guarded by illagers that won't give up on their fortune even if it means the end of them, or the end of you... \n\n\n**\\*Note that the castle is pretty rare and can spawn multiple thousands of blocks away from spawn.**\n\nSupported Versions Forge: 1.18.2, 1.19, 1.19.1, 1.19.2, 1.20, 1.20.1\n\nSupported Versions Fabric: 1.19.2, 1.20, 1.20.1\n\n![](https://i.imgur.com/BwHHtEH.png)\n\n![](https://i.imgur.com/iU2lZ7Y.png)\n\n![](https://i.imgur.com/TzxTamO.png)\n\n![](https://i.imgur.com/lVNj6ZH.png)\n\n![](https://i.imgur.com/vQa39Gy.png)\n\n![](https://i.imgur.com/gkMuTuB.png)\n\n![](https://i.imgur.com/y8cEs4F.png)\n\n![](https://i.imgur.com/uIGZuYH.png)\n\n## Support\n\nWe always try to be aware of issues in our mods, if you experience a bug while playing, please report it in the comments or the \"Issues\" section to help us keep the experience fun and enjoyable for all players.\n\n**[CLICK HERE](https://discord.gg/D9cxayDNSP) to join our discord server to speak, chat, report problems or talk with us :)**", + "body_url": null, + "published": "2023-03-17T20:39:18.115932Z", + "updated": "2023-06-28T22:17:05.367922Z", + "approved": "2023-03-18T18:25:32.850660Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 480636, + "followers": 212, + "categories": [ + "adventure", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "e2Fwxwh5", + "eiyqt0cv", + "aeqlOfcv", + "9xZK8c7e", + "sseIovAz", + "ga1pPro8", + "fycU9tvw", + "hbZaVz0H", + "r1kI9nMD" + ], + "icon_url": "https://cdn.modrinth.com/data/FGlHZl7X/e97cc6b20ddc0411f23ce5ac243475a594c1e755.png", + "issues_url": "https://github.com/Team-Remastered/The-Lost-Castle-Forge/issues", + "source_url": "https://github.com/Team-Remastered/The-Lost-Castle-Forge", + "wiki_url": null, + "discord_url": "https://discord.com/invite/D9cxayDNSP", + "donation_urls": [], + "gallery": [], + "color": 2498843, + "thread_id": "FGlHZl7X", + "monetization_status": "monetized" + }, + "toofast-fabric-1.20-1.2.0": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.20", + "1.20.1" + ], + "id": "w6JSkKSH", + "slug": "too-fast", + "project_type": "mod", + "team": "1Sh9IjSH", + "organization": null, + "title": "Too Fast", + "description": "Removes the \"moved too quickly\" warning and rubber-banding.", + "body": "***Only required on the sever side.***\u00a0Removes the server-side limitations on player speed that result in \"player XYZ moved too fast\" messages in the console and rubber-banding.\u00a0\n\nCode primarily derived from Random Patches's speed limits, which is MIT licensed and thus license-compatible. However, there is practically no other way to do this: [Source](https://github.com/TheRandomLabs/RandomPatches/blob/1.16-forge/src/main/java/com/therandomlabs/randompatches/mixin/ServerPlayNetHandlerPlayerSpeedLimitsMixin.java)\n\nConflicts with Random Patches. Do not bother installing this if you've installed Random Patches.\n\nPatreon & Discord\n\nYou can support me [on Patreon](https://www.patreon.com/noobanidus)!\n\nAll support for this mod is available on\u00a0[my Discord]((https://discord.gg/9YVkaee)). You\u00a0can also keep up with what I'm doing and get notifications streams!", + "body_url": null, + "published": "2024-05-25T08:34:37.104270Z", + "updated": "2024-05-25T08:38:08.334054Z", + "approved": "2024-05-26T20:44:31.173732Z", + "queued": "2024-05-25T08:41:42.765214Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 59461, + "followers": 10, + "categories": [ + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "Jzgp9VID", + "2KncMR8q", + "ZyY2Xraw", + "2pix3xrW", + "UZVGWIjM" + ], + "icon_url": "https://cdn.modrinth.com/data/w6JSkKSH/66c04bbaa895b488af2b711deca45d28e20a2fa2.png", + "issues_url": null, + "source_url": null, + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": 6300705, + "thread_id": "gzt8XP6y", + "monetization_status": "monetized" + }, + "trinkets-3.7.2": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.17-rc2", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "5aaWibi9", + "slug": "trinkets", + "project_type": "mod", + "team": "F0xlmrbH", + "organization": null, + "title": "Trinkets", + "description": "A data-driven accessory mod", + "body": "# Trinkets\nA data-driven accessory mod for Minecraft using Fabric.\n\n![Image of the Trinkets UI](https://cdn-raw.modrinth.com/data/5aaWibi9/images/56224f13887cdd914a9624a18eb845dae0bcdfc0.png)\n\n## About\nTrinkets adds a slot group and slot system to Minecraft. Slot groups are collections of slots for a certain body part or more vague area. By default there are 6 slot groups (head, chest, legs, feet, offhand, hand) that can have slots added to them, but more groups can be added if desired. Trinkets' UI is intuitive to use, accessible, and attempts to do away with clutter. Its system means that you'll never have a slot that's not used for anything, as mods request the slots they want.\n\nFor basic tutorials and comprehensive documentation, visit this project's [wiki](https://github.com/emilyploszaj/trinkets/wiki/Home).\n", + "body_url": null, + "published": "2021-06-08T00:05:32.472592Z", + "updated": "2024-07-15T11:03:13.629144Z", + "approved": "2021-06-08T00:05:32.472592Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 2103816, + "followers": 1268, + "categories": [ + "equipment", + "library", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "quilt" + ], + "versions": [ + "70Ajg5iP", + "dRgbv7A2", + "29Jd2Dm4", + "qpiOPBB9", + "R2UW6ejS", + "FdJA5sbK", + "DtvgyMK2", + "vOuy3Z5S", + "XqLNMi9J", + "WiXqMygm", + "oLUBJhyv", + "9qrmAiwv", + "OLwsMJv4", + "5zEAvqnX", + "A5kxdEY3", + "z8ProfKL", + "e563ycts", + "tJ23Vcff", + "AHxQGtuC", + "7aQD4OG8", + "SGjPO8H9", + "JagCscwi" + ], + "icon_url": "https://cdn.modrinth.com/data/5aaWibi9/icon.png", + "issues_url": "https://github.com/emilyalexandra/trinkets/issues", + "source_url": "https://github.com/emilyalexandra/trinkets", + "wiki_url": "https://github.com/emilyalexandra/trinkets/wiki", + "discord_url": "https://discord.gg/T2PuD9RTWV", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/5aaWibi9/images/56224f13887cdd914a9624a18eb845dae0bcdfc0.png", + "featured": false, + "title": "Trinkets UI", + "description": null, + "created": "2023-02-24T23:54:31.401757Z", + "ordering": 0 + } + ], + "color": 9211020, + "thread_id": "5aaWibi9", + "monetization_status": "monetized" + }, + "True Darkness Refabricated": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "Pf8PJBb5", + "slug": "true-darkness-fabric", + "project_type": "mod", + "team": "tLY0DdMg", + "organization": null, + "title": "True Darkness Refabricated", + "description": "A maintained fork of the 'True Darkness' mod for Fabric", + "body": "![Moonphases](https://github.com/CrismPack/CDN/blob/main/desc/darkness/True%20Darkness%20Moonphases.png?raw=true)\n\n# True Darkness Refabricated\n\nThis is a fork of the [True Darkness](https://modrinth.com/mod/true-darkness) mod by [GrondagTheBarbarian](https://modrinth.com/user/grondag), maintaining it for Fabric 1.20.1 and beyond.\n\n*GrondagTheBarbarian is the original author and all credit belongs to him.*\n\n![fabric](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy/supported/fabric_vector.svg)\n\n## **Description:**\n\nMoody brightness not dark enough? Do you want moonless nights and unlit caverns to be pitch black? This mod is for you!\n\nIn addition to maintaining the mod for newer versions, this version also fixes compatibility issues with [Distant Horizons](https://modrinth.com/mod/distanthorizons).\n\n## **Dependencies:**\n\n[![cloth-config-api](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy/requires/cloth-config-api_vector.svg)](https://modrinth.com/mod/cloth-config) [![fabric-api](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy/requires/fabric-api_vector.svg)](https://modrinth.com/mod/fabric-api)\n\nOptional: [Mod Menu](https://modrinth.com/mod/modmenu)\n\n*Note that the mod itself is only required client-side and does not have any functionality when installed on a server.*\n\n## **Need help?**\n\n[![discord-singular](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy/social/discord-singular_vector.svg)](https://discord.gg/Kss5gBgeDA)\n\n## **Mod trailer:**\n\n\n", + "body_url": null, + "published": "2024-06-25T00:53:07.914834Z", + "updated": "2024-07-28T20:49:59.374467Z", + "approved": "2024-06-29T02:45:30.040097Z", + "queued": "2024-06-25T01:34:02.250566Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "GPL-3.0-only", + "name": "GNU General Public License v3.0 only", + "url": null + }, + "downloads": 8032, + "followers": 47, + "categories": [ + "adventure", + "game-mechanics", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "4RhD5HYh", + "f3TvMiET", + "xkMHlJ30", + "13Qx6Cc4", + "fWf5FuJp", + "iFMgw12a", + "fH6YSSxd", + "DtGlrEDz", + "1f4EnDOA", + "853SRGc8", + "corFx0is" + ], + "icon_url": "https://cdn.modrinth.com/data/Pf8PJBb5/73658cdf85da7acf3e0b6e96a1d5330f5308454c.png", + "issues_url": "https://github.com/HaXrBOT/True-Darkness-Refabricated/issues", + "source_url": "https://github.com/HaXrBOT/True-Darkness-Refabricated", + "wiki_url": null, + "discord_url": "https://discord.gg/Kss5gBgeDA", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/Pf8PJBb5/images/386f9ebcf3898e11a7616c2d8691b32449b097ad.png", + "featured": true, + "title": null, + "description": null, + "created": "2024-06-25T01:32:08.955195Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/Pf8PJBb5/images/4a662d7f1514c60d3a1bedde4ef592d0496cc8dd.png", + "featured": false, + "title": null, + "description": null, + "created": "2024-06-25T01:31:54.515451Z", + "ordering": 0 + } + ], + "color": 7899303, + "thread_id": "ZpYhCpdw", + "monetization_status": "monetized" + }, + "valentinesblessing 1.5.0 1.20.1 fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.18.2", + "1.19.2", + "1.19.4", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4" + ], + "id": "1imrOvDk", + "slug": "valentines-blessing-lilypads-roses", + "project_type": "mod", + "team": "2WMD9sMD", + "organization": null, + "title": "Valentine's Blessing(Lilypads, Roses, Cakes)", + "description": "Mod enhancing empty looking waters with colorful blooming lilypads and adds Valentine's day thematic decorations.", + "body": "

\"Valentine's

\n

Use JEI for compatiblity
requires fabric API for fabric versions 

\n\n

About: 
Mod enhancing empty looking waters with colorful blooming lilypads and adds Valentine's day thematic decorations.
Lilypads spawn in certain waters according to colors. Light colored lilypads (pink, lilac) spawn in rivers,
bright colored lilypads (blue, magenta, tropical red) enhance swampy waters and white lilypads enrich icy frozen rivers.
All other blocks and items included are craftable using vanilla resources in the game.\nMore informations and performance tips, as well as all recipes are avaiable here:VALENTINE'S BLESSING


\n\n*If your world map was already generated, lilypads will spawn in newly generated chunks, simply generate new places by exploring your world.
*When placing a lilypad, make sure there is no sea grass right underneath it.


Few examples of models included:
Large wedding style cakes
Roses wall decorations in multiple colors
Enchanted love cookie with healing properties

\"Valentine's


*Tip1: if you'd like to build decorative fence around your base from roses, use random blocks to form your desired shape,
place your wall decorations and then destroy the blocks. Putting roses on leaves to create garden shrubs or shrubfence also looks decent.
*Tip 2: Collect roses.

\n\n

You can also check out my other mods:

\n

\n

\n

\n

\n

\n

\n\n

 

\nEnjoy!
Common topics:

\n

Please DO NOT DISTRIBUTE, re-uploading this to other websites is NOT ALLOWED

Avaiable on: CURSEFORGE and MODRINTH \n

\"\"

", + "body_url": null, + "published": "2023-12-30T19:31:36.175855Z", + "updated": "2024-03-31T14:35:17.247663Z", + "approved": "2024-01-03T21:47:49.964751Z", + "queued": "2023-12-30T19:50:04.868031Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 2611, + "followers": 16, + "categories": [ + "decoration", + "food", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "9tO0IWyE", + "yHfoBXbG", + "86MnXHIg", + "KoTpm8no", + "zSI9q8I2", + "gFWULXkY", + "xrCmdIv8", + "k2V9MpR2", + "GmYnsp1Q" + ], + "icon_url": "https://cdn.modrinth.com/data/1imrOvDk/bbed59e916e9d51778e8e0f538c341c6c5929fe0.png", + "issues_url": null, + "source_url": null, + "wiki_url": "https://drive.google.com/file/d/1axU0a9bnuPWEeSuIcWWaCtB8aL9ogAjE/view?usp=sharing", + "discord_url": null, + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/lillouarts?fbclid=IwAR3RQ3hhThRS52o0G3FBuBYTXCq9emIjG-qYoAdVIpvwKqfrB63en31fsBM" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/1imrOvDk/images/5397a3db663cda3b8a3af3397a70f5d48fd2a79e.jpeg", + "featured": false, + "title": "showcase", + "description": null, + "created": "2023-12-30T19:58:23.480825Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/1imrOvDk/images/c6e26e4a14de5c9b965f2b5b9c0ab0d25c227d2d.jpeg", + "featured": true, + "title": "Blooming lilypads", + "description": null, + "created": "2023-12-30T19:49:37.598514Z", + "ordering": 0 + } + ], + "color": 10037040, + "thread_id": "BilsDIjl", + "monetization_status": "monetized" + }, + "vc_gliders-fabric-1.1.5": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.20.1" + ], + "id": "XiC6HzoU", + "slug": "gliders", + "project_type": "mod", + "team": "rWEz8MvD", + "organization": null, + "title": "Gliders", + "description": "Gliders: essential for traversing terrain and preventing falls", + "body": "# Gliders\n\nWelcome to the world of Gliders!\n\nGliders are the first mod in a vanilla-friendly mod pack designed to enhance the adventure and exploration aspect of Minecraft. These gliders can be crafted from basic materials like wood, iron, and gold, as well as more advanced materials like diamond and netherite. They were introduced to prevent players from rushing to The End to get Elytra.\n\nA good player/server experience was the main focus while designing these Gliders. They were created to be a balanced item, not feeling as overpowered as elytra but with several upgrades to stop the need to rush to go get wings. These gliders will help you navigate the world, explore caves, and prevent falling off cliffs. \n\nWith countless hours of development, this excellent early to mid-game alternative to the Elytra offers an immersive single and multiplayer experience, including first and third-person animations designed to enhance the player's Minecraft experience. Try it out and glide through the skies of Minecraft!\n\n## Features\n\n### Tiers\n\nWhen it comes to Gliders, you have a variety of options to choose from. You can opt for a wooden glider, which is perfect if you're just starting out and want to get a feel for gliding. If you're looking for something that's more durable, you might want to consider an Iron or Gold Glider. If you're willing to splurge, then Diamond Gliders are a great choice as they are very durable and offer a significant increase in flight time. And for those who want the ultimate gliding experience, Netherite Gliders are the way to go. These gliders are incredibly durable and offer the longest flight time of all the Glider tiers.\n\nTo craft a Glider, you'll need to start by creating reinforced paper, a new type of paper that is used in the construction of these amazing flying machines. Reinforced paper is a unique material that is made by combining conventional paper with other materials such as leather, iron, gold, diamond, or netherite scrap depending on the desired strength of the glider. The crafting process is relatively straightforward and involves combining standard paper with the appropriate materials in a crafting table. Once you have the reinforced paper, you can then use it to craft the glider of your choice.\n\n### Updrafts\n\nWhen utilizing gliders in Minecraft, it's important to note that fire and magma are not typically friendly elements. However, there is a way to utilize these elements to your advantage. By using a Glider, you'll notice wind particles emanating from heat sources. These updrafts of heat can provide you with a substantial boost in height, allowing you to glide over treacherous terrain with ease. However, it's essential to exercise caution when using gliders in other HOT dimensions, as the conditions may be too intense for the glider to handle without the proper upgrades.\n\n### The Right Kind Of Charge\n\nWhen using Glider, it is important to keep a few things in mind. Gliders are made using metal components, and unfortunately, when flying in an open space in the rain, it means you are a prime target for lightning. Therefore, it is not advised to fly in the rain or during a storm. If you want to risk it, you may hear the glider start tingling with a static charge until you are inevitably struck by lighting, dropping you out of the sky and probably breaking your glider. Thankfully, you may be able to replace the metal on your Glider and pared with curtain crystals there may be a modification that can turn the lightning into a useful upgrade instead of a pesky nuisance.\n\n### Glider Repair\n\nWhen using a glider, it's important to be cautious and aware of its delicate structure and using the Glider incorrectly may break it. But don't worry, there is still hope for your beloved Glider. To repair it, you can use a new piece of reinforced paper that matches the material of the original Glider. \n\nTo start the repair process, use a smithing table and use the damaged Glider along with the newly crafted reinforced paper to repair it. But be careful and use the Glider in moderation, as even with upgrades, if its durability eventually reaches zero, it will be lost forever.\n\n### Upgrades\n\nGlider technology has come a long way, with many upgrades available to extend the life of this amazing invention before moving on to the Elytra. These upgrades are designed to allow glider users to explore new environments and terrains that were once impossible to navigate. With these upgrades, the glider becomes a more versatile tool for everyday adventuring. In addition, you can enchant your glider with Mending and Unbreaking enchantments to ensure it lasts as long as possible. With all these upgrades and enchantments, your glider will become an indispensable companion on all your adventures.\n\n### Perspective Changes\n\nIf you're using gliders in Minecraft, you may find that certain situations are easier to navigate in F5 mode. With this in mind, we've added a new feature that allows you to toggle your camera to switch to F5 mode when using a glider.\n\nThis feature is especially useful when you're trying to explore new environments. Gliding with a glider can be a lot of fun and very cinematic, but it can also be challenging to get the right perspective when you're trying to dodge obstacles or maneuver through tight spaces. By switching to F5 mode, you'll be able to see everything around you more clearly, which will make it easier to avoid obstacles and stay on course.\n\nTo activate this feature, simply go to the Controls panel within the Minecraft pause menu and look for the Glider Perspective option. Once you've found it, you can toggle it on or off depending on your preferences. This feature is currently turned off by default, but it worth trying to see what you prefer, If you're new to gliding, you may want to leave this feature turned off until you get more comfortable with the basics of gliding. However, if you're an experienced glider pilot, you may find that this feature is a must-have for your adventures.\n\nPause > Options > Controls > Glider Perspective \n\n### Compatibility\n\nOne of the best things about these gliders is their compatibility with other mods like Create and Curios. Gliders are stylized to work well with the Create Mod . Create is a mod that allows players to build complex contraptions and machinery using gears, belts, and other components. The Glider mod is designed to work seamlessly with Create, allowing players to incorporate gliders into their machinery and contraptions. This means that players can use their gliders in a variety of ways, such as creating glider launchers or incorporating them into their transportation systems.\n\nIn addition, Gliders are designed to work with Curios. Curios is a mod that allows players to equip items in their inventory as accessories. This means that players can equip their Glider as an accessory, allowing them to glide through the skies without having to worry about taking up valuable inventory space like a chest pieces slot.\n\nOverall, gliders are an excellent addition to Minecraft, providing players with a unique and exciting means of transportation. With their impressive durability and a variety of tier options available, players can customize their glider to suit their specific needs. So why not give gliders a try and soar through the skies of Minecraft today?\n", + "body_url": null, + "published": "2023-01-19T19:21:49.300441Z", + "updated": "2024-02-07T14:25:17.505032Z", + "approved": "2023-02-18T17:51:54.394099Z", + "queued": null, + "status": "approved", + "requested_status": "unlisted", + "moderator_message": null, + "license": { + "id": "GPL-3.0-or-later", + "name": "GNU General Public License v3.0 only", + "url": null + }, + "downloads": 78862, + "followers": 241, + "categories": [ + "equipment", + "transportation" + ], + "additional_categories": [ + "adventure", + "game-mechanics" + ], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "ujLo0GsH", + "9XToMMUs", + "YVmZpyBd", + "zHj4eYPM", + "o6ZKZUy4", + "Ag4fqAxX", + "ZpxnuiTS", + "wukCCm6S", + "3wSBmBHu", + "IQaWYxks", + "khjB5qLh", + "tlHT9WKt", + "ScaPoovu", + "klPNnsOe", + "WLcGHp5D", + "a5CG1HeS", + "WrYjZTyl", + "PoAjBiBD", + "CjFIpNvl", + "UKYjvjnD", + "Y2kfKvXr", + "9Qu0MGnH", + "nVCZVT0i" + ], + "icon_url": "https://cdn.modrinth.com/data/XiC6HzoU/cfb76ca2b6b3963084c78bd4ef12cc707eef9964.png", + "issues_url": "https://github.com/Suff99/MC-Gliders/issues", + "source_url": "https://github.com/Suff99/MC-Gliders", + "wiki_url": null, + "discord_url": "https://mc.craig.software/api/skin/discord", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/XiC6HzoU/images/2f81155aa2820df6bf2b8429ed4c60065f126c23.png", + "featured": false, + "title": "Glider with Friends!", + "description": null, + "created": "2023-02-22T23:19:38.187786Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/XiC6HzoU/images/bf2a7540b8624ab7a3fcf0fe84df835a03f7e8bc.gif", + "featured": true, + "title": null, + "description": null, + "created": "2023-01-19T19:43:24.037471Z", + "ordering": 0 + } + ], + "color": 7574740, + "thread_id": "XiC6HzoU", + "monetization_status": "monetized" + }, + "veinmining-fabric-1.5.0+1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.4", + "1.16.5", + "1.17", + "1.17.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.4", + "1.20.6", + "1.21" + ], + "id": "bRAPbNyF", + "slug": "vein-mining", + "project_type": "mod", + "team": "BUVLb1SC", + "organization": null, + "title": "Vein Mining", + "description": "A lightweight, highly configurable Vein Mining enchantment for tools.", + "body": "Vein Mining is a mod that adds the titular Vein Mining enchantment, which allows the enchanted tool to break matching connected blocks. The enchantment and mining logic are highly configurable, letting players and modpack developers find their preferred method of balance.\n\nConfiguration options can be found in the `config` folder as `veinmining-client.toml`, `veinmining-server.toml`, and `veinmining-common.toml`.\n\nPlease see the [wiki page](https://github.com/TheIllusiveC4/VeinMining/wiki/Configuration) for more configuration information.\n\n## Features\n### Enchantment\n![](https://i.ibb.co/q7g1qRd/veinminingenchantment.png)\n\n**Configuration Options**\n\n- Rarity\n- Max Level\n- Treasure\n- Randomly Enchantable\n- Available on Books\n- Base Enchanting Power\n- Enchanting Power per Level\n- Villager Trade\n- Lootable\n\n### Vein Mining\n\n**Configuration Options**\n\n- Max Blocks Base (without enchantment)\n- Max Distance Base (without enchantment)\n- Max Blocks per Enchantment Level\n- Max Distance per Enchantment Level\n- Diagonal Mining\n- Relocate Drops\n- Limit Mining by Tool Durability\n- Prevent Tool Breaking\n- Tool Damage\n- Tool Damage Multiplier\n- Player Exhaustion\n- Player Exhaustion Multiplier\n- Activation Method (sneak, stand, or keybinding)\n- Blocks Whitelist/Blacklist\n- Custom Block Groups (Tags + IDs)\n\n## Affiliates\n\n[![BisectHosting](https://i.ibb.co/5Tw6mh2/bisect-illusive.webp)](https://illusivesoulworks.com/affiliate)\n", + "body_url": null, + "published": "2023-02-09T01:58:51.890627Z", + "updated": "2024-07-30T06:53:16.055115Z", + "approved": "2023-02-09T02:35:55.075126Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LGPL-3.0-or-later", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 922132, + "followers": 319, + "categories": [ + "equipment", + "magic" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "BrMpCBNC", + "q1lv56ew", + "m6K3JZ8D", + "6zTXe9LF", + "9EMgNTe8", + "6wGskIc8", + "7AYOnLGG", + "YyX4GVre", + "DXf5edVj", + "GmWAUUrL", + "ELbtaxd9", + "PPrt1ixa", + "odywyf63", + "Qiqya4ED", + "xiJIoiNi", + "PShUa7uc", + "GLJ2iakB", + "exXogAjv", + "COTleI1i", + "KFoV5jhk", + "zCBxaE3m", + "4iKF7qr7", + "oMdS2fwU", + "xRF2crdC", + "oiLUfwIF", + "WXJCXEhi", + "gWk679bq", + "aIIaGagz", + "daF6eTE3", + "cqlYt3pD", + "NtPRwokN", + "TJYVzaOn", + "HEvvLmzo", + "xVKVsHPn", + "uRkDx9Q1", + "2vcKEEmb", + "qFZjgLV4", + "eAD1q2bm", + "T3DAcaMS", + "NlaXDuMK", + "wH4KcpKq", + "zuGqegIj", + "tT9VNH4K", + "8INuFLmL", + "6GBUpH2g", + "T8eAD4Zd", + "C8j3UrWK", + "6WgGpLLs", + "zaYn7rT3", + "aGEVSD2C", + "UyJNFsPS", + "e0foGgxh", + "h2MoBbyJ", + "uGlsyTng", + "DDS4HvX9", + "t067wrLA", + "cAIscC8p", + "GdMFjD7X", + "DNF8bRBU", + "QKCaSOAs", + "S1Nzq3Ir", + "UYB5j0Qd", + "9s0xRsio", + "YzxtCFLa", + "ZLKwz1tU", + "bv24X5Mj", + "Wxs1rOyC", + "5K35bFey", + "lQ5wdfZH", + "BhhZeS8p", + "qnnBQdM0", + "frfZCNwD", + "9MERtMpg", + "pemZkVG1", + "VYCbHtEr", + "jE0K56xs", + "cfNYgiVm", + "GYNTF6GN", + "5WmV5AbM", + "FlR6u8ic", + "PFFXEfYV", + "qV4B4EMI", + "4HyAkZHj", + "5pbJBcoH", + "wE6N5Cc2", + "bAYRag9u" + ], + "icon_url": "https://cdn.modrinth.com/data/bRAPbNyF/35aee97b92478e08c3fd96ceed2d16c4f8d036b3.png", + "issues_url": "https://github.com/illusivesoulworks/veinmining/issues", + "source_url": "https://github.com/illusivesoulworks/veinmining", + "wiki_url": null, + "discord_url": "https://discord.gg/JWgrdwt", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/theillusivec4" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/bRAPbNyF/images/5a1d6e1b34d6bd7818c2d8675e3b389866292fa1.gif", + "featured": true, + "title": "Vein Mining on Gold Ores", + "description": null, + "created": "2023-02-09T02:00:41.729367Z", + "ordering": 0 + } + ], + "color": 11623455, + "thread_id": "bRAPbNyF", + "monetization_status": "monetized" + }, + "VillagersPlus_3.1_(FABRIC)_for_1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1" + ], + "id": "oHGMwNDR", + "slug": "villagersplus", + "project_type": "mod", + "team": "hNdvqHH9", + "organization": null, + "title": "VillagersPlus", + "description": "A villager extension mod, adding new villager types, trades and beautiful workstations.", + "body": "\n

\n

VillagersPlus adds new villagers, trades and unique and beautiful workstations.
\nEvery villager outfit, house and workstation was designed with a lot of attention to detail to create an immersive experience for you.

\n\n\n

Datapack Support (since 1.20.1):

\n
    \n
  • Add new trades to every villager profession!
  • \n
  • Delete trades from every villager profession!
  • \n
  • Customize trades: change the currency, the amount, the max usages or the experience gained from the!
  • \n
\n\n

\nPredefined datapacks to add new trades to VillagersPlus from other mods

\n\n \n\n\n

Trades

\n
    \n
  • Horticulturist - Level 1:
  • \n
      \n
    • Oxyeye Daisy, Poppy, Allium, Azure Bluet, Cornflower, Lily of the Vally, Dandelion - Buy 1 for 2 Emeralds
    • \n
    • Wheat Seeds, Beetroot Seeds, Melon Seeds, Pumpkin Seeds - Sell 1 for 1 Emerald
    • \n
    \n
  • Horticulturist - Level 2:
  • \n
      \n
    • All leaves block - Buy 2 for 4 Emeralds
    • \n
    • Dead Bush - Buy 1 for 3 Sticks, 1 Emerald
    • \n
    • Grass - Sell 4 for 1 Emerald
    • \n
    • Fern - Sell 2 for 1 Emerald
    • \n
    \n
  • Horticulturist - Level 3:
  • \n
      \n
    • All tulips - Buy 1 for 4 Emeralds
    • \n
    • All saplings - Sell 2 for 1 Emerald
    • \n
    \n
  • Horticulturist - Level 4:
  • \n
      \n
    • Sunflower, Rose Bush, Lilac, Peony - Buy 1 for 5 Emeralds
    • \n
    • Rooted Dirt, Podzol - Sell 2 for 1 Emerald
    • \n
    \n
  • Horticulturist - Level 5:
  • \n
      \n
    • Blue Orchid - Buy 1 for 4 Emeralds
    • \n
    • Wither Rose - Buy 1 for 8 Emeralds
    • \n
    • Spore Blossom - Buy 1 for 12 Emeralds
    • \n
    • Flowering Azelea Leaves - Buy 2 for 4 Emeralds
    • \n
    • Moss Block - Sell 2 for 1 Emerald
    • \n
    • Bone Meal - Sell 4 for 1 Emerald

    • \n
    \n
  • Occultist - Level 1:
  • \n
      \n
    • All Amethyst Buds - Buy 1 for 1, 2, 3 or 5 Emeralds
    • \n
    • Tinted Glass - Buy 4 for 8 Emeralds
    • \n
    • Glow Ink Sac - Sell 1 for 1 Emerald
    • \n
    • Amethyst Shard - Sell 1 for 1 Emerald
    • \n
    \n
  • Occultist - Level 2:
  • \n
      \n
    • Soul Lantern - Buy 1 for 4 Emeralds
    • \n
    • Soul Torch - Buy 1 for 2 Emeralds
    • \n
    • Glowstone Dust - Buy 2 for 4 Emeralds
    • \n
    • Soul Sand, Soul Soil - Sell 2 for 1 Emerald
    • \n
    \n
  • Occultist - Level 3:
  • \n
      \n
    • All colored candles - Buy 2 for 4 Emeralds
    • \n
    \n
  • Occultist - Level 4:
  • \n
      \n
    • Quartz - Buy 2 for 4 Emeralds
    • \n
    • Spectral Arrow - Buy 2 for 2 Emeralds
    • \n
    • Candle - Buy 2 for 4 Emeralds
    • \n
    \n
  • Occultist - Level 5:
  • \n
      \n
    • Experience Bottle - Buy 1 for 3 Emeralds
    • \n
    • Poisonous Potato - Sell 1 for 1 Emerald

    • \n
    \n
  • Oceanographer - Level 1:
  • \n
      \n
    • Sea Pickle - Buy 1 for 3 Emeralds
    • \n
    • Water Bucket - Buy 1 for 5 Emeralds
    • \n
    • Seagrass - Sell 4 for 1 Emerald
    • \n
    • Kelp - Sell 6 for 1 Emerald
    • \n
    \n
  • Oceanographer - Level 2:
  • \n
      \n
    • All corals - Buy 1 for 3 Emeralds
    • \n
    • All dead corals - Exchange for living coral + 1 Emerald
    • \n
    \n
  • Oceanographer - Level 3:
  • \n
      \n
    • All coral fans - Buy 1 for 3 Emeralds
    • \n
    • All dead coral fans - Exchange for living coral fan + 1 Emerald
    • \n
    \n
  • Oceanographer - Level 4:
  • \n
      \n
    • All coral blocks - Buy 1 for 5 Emeralds
    • \n
    • All dead coral blocks - Exchange for living coral block + 1 Emerald
    • \n
    \n
  • Oceanographer - Level 5:
  • \n
      \n
    • Nautilus Shell - Buy 1 for 6 Emeralds
    • \n
    • Sponge - Buy 1 for 8 Emeralds
    • \n
    • Scute - Sell 2 for 1 Emerald
    • \n
    • Tropical Fish Bucket, Axototl Bucket, Pufferfish Bucket - Sell 1 for 1 Emerald

    • \n
    \n
  • Alchemist - Level 1:
  • \n
      \n
    • Sugar, Brown Mushroom, Red Mushroom - Buy 1 for 3 Emeralds
    • \n
    • Nether Wart - Buy 1 for 5 Emeralds
    • \n
    • Glass Bottle - Sell 3 for 1 Emerald
    • \n
    \n
  • Alchemist - Level 2:
  • \n
      \n
    • Magma Cream - Buy 1 for 4 Emeralds
    • \n
    • Pufferfish, Fermented Spider Eye - Buy 1 for 5 Emeralds
    • \n
    • All potions - Buy 1 for 5 Emeralds
    • \n
    \n
  • Alchemist - Level 3:
  • \n
      \n
    • Blaze Powder, Ghast Tear, Phantom Membrane - Buy 1 for 5 Emeralds
    • \n
    • Gunpowder - Buy 1 for 3 Emeralds
    • \n
    • Ender Pearl, Blaze Rod - Sell 1 for 1 Emerald
    • \n
    \n
  • Alchemist - Level 4:
  • \n
      \n
    • All splash potions - Buy 1 for 8 Emeralds
    • \n
    \n
  • Alchemist - Level 5:
  • \n
      \n
    • Dragon Breath - Buy 1 for 8 Emeralds
    • \n
    • Glistering Melon Slice - Buy 1 for 4 Emeralds
    • \n
    • Rabbit Foot - Buy 1 for 4 Emeralds
    • \n
    \n
\n\n

Workstations

\n
    \n
  • Flower Tub: holds up to 4 plants.
  • \n
  • Aquarium: holds up to 4 sea plants and 1 entity in a bucket.
  • \n
  • Enchanted Basin: sneak right-click to store experience, right-click to release it.
  • \n
  • Alchemist Table: insert gunpowder, three empty bottles and one potion. With 1/3 chance the potion will convert the three bottles to random potions. With 2/3 the table explodes, destroying its content.
  • \n
\n\n\n

Join my Discord for help, requests or ideas!

\n\n

\n\n
\n\n

\n

Bugs and Source code

\n

\nGithub issue tracker FABRIC
\nGithub issue tracker FORGE\n\n", + "body_url": null, + "published": "2023-01-28T13:45:31.823579Z", + "updated": "2023-12-31T15:20:33.566546Z", + "approved": "2023-01-29T00:32:08.398856Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "GPL-3.0-only", + "name": "GNU General Public License v3.0 only", + "url": null + }, + "downloads": 777531, + "followers": 380, + "categories": [ + "adventure", + "mobs", + "worldgen" + ], + "additional_categories": [ + "decoration", + "economy", + "utility" + ], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "YWHjSrla", + "j4PexQy7", + "OrIkIeo2", + "AQTAuPPD", + "sivJwV6t", + "dr91rSyC", + "hrISoAgr", + "WBzelfJn", + "CzCEYB32", + "QtzrqUgt", + "w5NZmENJ", + "Tl5Kx50I", + "Oc5T4c7q" + ], + "icon_url": "https://cdn.modrinth.com/data/oHGMwNDR/2ee4a4cda576347613ca8343357e211fe90516e9.png", + "issues_url": "https://github.com/finallion/VillagersPlus_-FABRIC-/issues", + "source_url": "https://github.com/finallion/VillagersPlus_-FABRIC-", + "wiki_url": "https://github.com/finallion/VillagersPlus_-FABRIC-/wiki", + "discord_url": "https://discord.gg/MsMXN9aSCd", + "donation_urls": [ + { + "id": "bmac", + "platform": "Bmac", + "url": "https://buymeacoffee.com/Finallion" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/oHGMwNDR/images/4c3a10b455efaa91d28d8758b04c91804a3683a9.png", + "featured": false, + "title": "Enchanted Basin", + "description": null, + "created": "2023-01-28T14:16:11.611786Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/oHGMwNDR/images/6d48a0085380eb1da9d56ad7f2f5786f41a27626.png", + "featured": false, + "title": "Aquariums", + "description": null, + "created": "2023-01-28T14:15:25.989854Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/oHGMwNDR/images/91ee9c12b0ee8b071baedb0eb81574cc536439ea.png", + "featured": false, + "title": "Savanna Horticulturist", + "description": null, + "created": "2023-01-28T14:14:48.024382Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/oHGMwNDR/images/9b3f99bcd41256078ecaa8e78c15c614c6347c65.png", + "featured": true, + "title": "Alchemist with Workstation", + "description": null, + "created": "2023-01-28T14:13:38.721800Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/oHGMwNDR/images/9f1dd0eef12a2a8fae198f047b54abda121f910a.png", + "featured": false, + "title": "Desert Occultist", + "description": null, + "created": "2023-01-28T14:15:07.059673Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/oHGMwNDR/images/bc0ff98d13c545f3d569644b61edee1351752afb.png", + "featured": false, + "title": "Oceanographer with Aquarium", + "description": null, + "created": "2023-01-28T14:14:02.439033Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/oHGMwNDR/images/d2fbb1ff9c7c1031ca89f9aa31009388cc05adcb.png", + "featured": false, + "title": "Alchemist Table", + "description": null, + "created": "2023-01-28T14:15:40.631436Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/oHGMwNDR/images/d626ebf77d85461d8d8299b2065fe30210d17dc0.png", + "featured": false, + "title": "Flower Tubs", + "description": null, + "created": "2023-01-28T14:15:55.883895Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/oHGMwNDR/images/ec3c8e041a42632cea439fd5f5128fd96ad68a52.png", + "featured": false, + "title": "Greenhouse and Alchemist House", + "description": null, + "created": "2023-01-28T14:14:30.302839Z", + "ordering": 0 + } + ], + "color": 6767407, + "thread_id": "oHGMwNDR", + "monetization_status": "monetized" + }, + "villagesandpillages-fabric-mc1.20.1-1.0.0": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.3", + "1.20.4", + "1.21", + "1.21.1" + ], + "id": "klXONLDA", + "slug": "villages-and-pillages", + "project_type": "mod", + "team": "E3xHYoLn", + "organization": null, + "title": "Villages & Pillages", + "description": "Structure mod that brings an exciting twist to Minecraft by introducing hostile and unfriendly pillages, providing a thrilling contrast to the peaceful villages.", + "body": "

\ud83d\uded6 Villages & Pillages

\n\n

\n\t\n\t\t\n\t\n\t\n\t\t\n\t\n\t\n\t\t\n\t\n\t\n\t\t\n\t\n\t\n\t\t\n\t\n

\n\n
\n\n

Villages&Pillages is a structure mod that brings an exciting twist to Minecraft by introducing hostile and unfriendly pillages, providing a thrilling contrast to the peaceful villages.

\n\n

The mod will receive seasonal updates, with the first season featuring the addition of Witch Villages!

\n\n
\n\n

\ud83e\uddf9 Season 1: Witch Village

\n\nExplore the spine-chilling Witch Village hidden deep within swamps and mangrove biomes. Wander through mossy houses and bubbling cauldrons, navigate treacherous bogs to reveal the village's dark secrets.\n\n

\n\t\n

\n\n
\n\n

\u2699\ufe0f Compatibility

\n\n

Villages&Pillages is designed to be fully compatible with all world generation mods, and it currently offers enhanced compatibility with the Waystones mod.

\n\n
\n\n

\ud83d\udcac Community

\n\n

Feel free to join our community at the discord server to chat, share your creations, ask any question or to simply be updated about the latest development of the mod and notified when the new release is out. Also don't hesitate to report any crash or bug via GitHub issues.

\n\n
\n\n

\ud83d\udc4b Support

\n\n

I will continue developing my mods as a hobby because I truly enjoy it. If you'd like to support me, you can do so on Patreon or Ko-fi. Your support is greatly appreciated.

\n\n
\n\n

\ud83d\udcdc License

\n\n

\n\tThe mod is licensed with CC BY-NC-ND 4.0 license.\n

\n

\n\tPlease feel free to explore my code for examples of how I've tackled and solved various challenges while developing this mod. You're welcome to incorporate code snippets into your own projects. Also feel free to use this mod in any modpack (although credit/link back to this page will be greatly appreciated).\n

", + "body_url": null, + "published": "2023-09-23T14:57:12.291681Z", + "updated": "2024-08-10T14:29:06.416991Z", + "approved": "2023-09-25T21:46:57.895245Z", + "queued": "2023-09-24T19:25:58.832115Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-CC-BY-NC-ND-4.0", + "name": "", + "url": "https://github.com/Faboslav/villages-and-pillages/blob/master/LICENSE.txt" + }, + "downloads": 476680, + "followers": 192, + "categories": [ + "adventure", + "decoration", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "rBahb4Fh", + "EbqIYJrD", + "y11dTUNH", + "oq333WXj", + "N9euBPPO", + "5NUVMrZ6", + "cdVEKiw8", + "up7Vnyar", + "emWkyeQg", + "JPXYNAvZ", + "ebiXZ5uu", + "NxVJXozS", + "jBDV6BJL", + "KFZYzMdD", + "e7CNTKYQ", + "q86uxwrE", + "SqrgJPv7", + "m3D7ThBq", + "TUZGdN2S", + "RKtQx6gq", + "FQrJz3KA", + "ol8Sk5Qh" + ], + "icon_url": "https://cdn.modrinth.com/data/klXONLDA/9454c53558ee06335b2eb15ac7a0c631ae59af44.jpeg", + "issues_url": "https://github.com/Faboslav/villages-and-pillages/issues", + "source_url": "https://github.com/Faboslav/villages-and-pillages", + "wiki_url": null, + "discord_url": "https://discord.com/invite/QGwFvvMQCn", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/Faboslav" + }, + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/faboslav" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/klXONLDA/images/d8a82324f5eaad0135b92257ca60dce8f4d80f5d.png", + "featured": false, + "title": "Witch Village at night", + "description": "Swamp", + "created": "2023-09-25T07:44:42.056881Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/klXONLDA/images/6810c17042bb269efbf39028650fa3ba4d8113a8.png", + "featured": true, + "title": "Witch Village at day", + "description": "Swamp", + "created": "2023-09-25T07:44:58.876595Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/klXONLDA/images/37b5ac603bd94948e353249a5789a190b3ad02d8.png", + "featured": false, + "title": "Witch Village at night", + "description": "Swamp", + "created": "2023-09-25T07:45:13.572835Z", + "ordering": 3 + }, + { + "url": "https://cdn.modrinth.com/data/klXONLDA/images/5d48cb70dc64b6459d9230a938c0fdcadf002738.png", + "featured": false, + "title": "Witch Village at day", + "description": "Swamp", + "created": "2023-09-25T07:45:42.834910Z", + "ordering": 4 + }, + { + "url": "https://cdn.modrinth.com/data/klXONLDA/images/cf1b7dcc780408cbc6a55c12c79acb13da381f7f.png", + "featured": false, + "title": "Witch Village at night", + "description": "Mangrove swamp", + "created": "2023-09-25T07:46:08.329199Z", + "ordering": 5 + }, + { + "url": "https://cdn.modrinth.com/data/klXONLDA/images/d9154fdcecebb593706a0fd4fdcc9e86727f713a.png", + "featured": false, + "title": "Witch Village at day", + "description": "Mangrove swamp", + "created": "2023-09-25T07:46:29.039120Z", + "ordering": 6 + }, + { + "url": "https://cdn.modrinth.com/data/klXONLDA/images/90060fde717d8799bfeec65819ec3ad1e67b8306.png", + "featured": false, + "title": "Witch Village house interior", + "description": "Dark ritual", + "created": "2023-09-25T07:56:30.023453Z", + "ordering": 7 + }, + { + "url": "https://cdn.modrinth.com/data/klXONLDA/images/815a6d42e458722a1c281adc7464b89d9ffcbe08.png", + "featured": false, + "title": "Witch Village house interior", + "description": "Brewing room", + "created": "2023-09-25T07:57:12.225889Z", + "ordering": 8 + }, + { + "url": "https://cdn.modrinth.com/data/klXONLDA/images/60f2544215e1778ae78c0517659d80896654c33a.png", + "featured": false, + "title": "Witch Village house interior", + "description": "Attic", + "created": "2023-09-25T07:57:58.465877Z", + "ordering": 9 + } + ], + "color": 2368805, + "thread_id": "XWEIdISV", + "monetization_status": "monetized" + }, + "villagespawnpoint-1.20.1-4.4": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.18.2", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "KplTt9Ku", + "slug": "village-spawn-point", + "project_type": "mod", + "team": "xjn76h83", + "organization": null, + "title": "Village Spawn Point", + "description": "\ud83c\udfd9 Sets the spawn point in a new world to the center of a village.", + "body": "

\"\"

Requires the library mod Collective.

   This mod is part of The Vanilla Experience modpack and Serilum's RPG Bundle mod.
Village Spawn Point is a minimalistic mod which sets the spawn point of a new world to always be in the center of a village. The village chosen will be the one closest to x=0, z=0.

The bonus chest world generation feature is compatible. If enabled, another bonus chest will be placed around the village spawn position.

This mod is compatible with Biome Spawn Point.

\r\n


------------------

You may freely use this mod in any modpack, as long as the download remains hosted within the Modrinth ecosystem.

Serilum.com contains an overview and more information on all mods available.

Comments are disabled as I'm unable to keep track of all the separate pages on each mod.
For issues, ideas, suggestions or anything else there is the Github repo. Thanks!


\"\"

", + "body_url": null, + "published": "2022-08-31T17:55:42.602557Z", + "updated": "2024-08-08T22:29:48.363408Z", + "approved": null, + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 342562, + "followers": 198, + "categories": [ + "adventure", + "game-mechanics", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "WHzZSLKD", + "8QEXEhTX", + "N0LXLVGI", + "OzQTZCtX", + "ETRIfBbo", + "1IFSJP8h", + "7v5fGbpf", + "KLglvs1C", + "swO4RXXU", + "m0CD24Rh", + "7SXkp3YO", + "sMimH4IZ", + "sQlhuE3x", + "wbfO3PgS", + "NGN8Wr0Z", + "RMgpoxcB", + "ianuLvQ5", + "wfSdFPfN", + "HVDv199h", + "bqlOMowv", + "uz6kDzlX", + "diXdQb8P", + "BXXev1Sv", + "uWmFxaGF", + "BcsRwMq7", + "5hkJe1Sq", + "2orB0Qo5", + "pvqQ0iaa", + "LYLsMVCc", + "ljynbeAG", + "oZz3D98i", + "NPYG35Ur", + "w3jqtMxt", + "dpemVPW1", + "fA8UJDWI", + "YB7TafJ6", + "O3aJ4TG4", + "QTJDhTKc", + "fgu4fNqx", + "aJ2VCyjt", + "4Tzb8ngB", + "UE9lBWoG", + "Ueetajqa", + "NcFXnaT6", + "QBD7Mt8H", + "aY5HlgAw", + "xfyEepHb", + "pmuo4Sz9", + "7erNgNWY", + "nVCjk1UD", + "Vl3DreYU" + ], + "icon_url": "https://cdn.modrinth.com/data/KplTt9Ku/icon.jpg", + "issues_url": "https://github.com/Serilum/.issue-tracker/labels/Mod: Village Spawn Point", + "source_url": "https://github.com/Serilum/Village-Spawn-Point", + "wiki_url": null, + "discord_url": null, + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://patreon.com/serilum" + } + ], + "gallery": [], + "color": 2833191, + "thread_id": "KplTt9Ku", + "monetization_status": "monetized" + }, + "vivecraft-1.20.1-1.1.11-fabric": { + "client_side": "optional", + "server_side": "optional", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.2", + "1.19.3", + "1.19.4", + "23w13a_or_b", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3-pre1", + "1.20.3-pre2", + "1.20.3-pre3", + "1.20.3-pre4", + "1.20.3-rc1", + "1.20.3", + "1.20.4", + "24w14potato", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "wGoQDPN5", + "slug": "vivecraft", + "project_type": "mod", + "team": "2AFOHfyr", + "organization": null, + "title": "Vivecraft", + "description": "A Minecraft VR mod on a loader of your choice!", + "body": "# Vivecraft\nVivecraft is the mod that transforms Minecraft into an exceptional VR experience in room-scale or seated play!\nMore info [https://www.vivecraft.org/](https://www.vivecraft.org/ \"https://www.vivecraft.org/\").\n\nVivecraft is a well-known VR mod that goes way back. Due to this it has some code practices that are no longer used and makes development and collaboration harder. In respons we've started to recode it using more modern methods, to stay up to date and more compatible with other mods. The result is being able to play Vivecraft on Forge, Fabric and Quilt!\n\nNeed help or have any questions? Feel free to come to our Discord server [https://discord.gg/jYyyv7zhSW](https://discord.gg/jYyyv7zhSW)\n\n## FAQ\n\n### Isn't Vivecraft for Forge?\nIn the past Vivecraft was only available on Forge. However, we have rewritten it so it can run on Fabric and Quilt as well.\n\n### Can other players see my hands/What about NONVR, VSE and VFE?\nThis mod also has **NONVR included** in the jar. VR Is disabled by default, and can be enabled in the Main menu.\n\nFor other players to see you hands you will need to have this mod and a serverside mod. The serverside extensions (VSE and VFE) *work* as well as fabric works with them, however you **do not need to use them**. This mod will run in NONVR mode on the server allowing you to see other peoples hands. Since 1.0.0 it is also customizable like the standalone server mods.\n\n### Does it work with MCXR?\nNo this is a separate mod, and does not interface with MCXR\n\n### Does it run natively on the Quest?\nNo, but maybe in the future. \nIn the meantime, there is [Questcraft](https://questcraft.org/ \"https://questcraft.org/\") which uses a modified version of this, to make it compatible with the Oculus/Meta Quest.\n\n### What about Sodium/Iris ... Will it work?\nSodium does work.\nIris works.\nAny other mod is untested. Mod compatibility is an important thing to us, however, it is not simple. For now we focus on getting it to be stable, after which, we will work on compatibility.\n\n### What about Optifine?\nSince 1.0.0 Optifine is compatible with the mod, but not required\n\n### What about 1.19.0?\nThere is one version available for it, but it will not get any further updates.", + "body_url": null, + "published": "2022-09-05T18:56:09.045191Z", + "updated": "2024-08-09T17:32:23.580298Z", + "approved": "2022-09-06T20:31:33.173067Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 578268, + "followers": 440, + "categories": [ + "game-mechanics", + "library" + ], + "additional_categories": [ + "utility" + ], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "rPsuSvmr", + "OpkjsSWH", + "aB0rF95L", + "eLJm9dQD", + "m3mtHRE7", + "3cs5bbKS", + "1fybWUMG", + "zQikY8nx", + "zm1kQhh2", + "A9UwaVJH", + "XtgCncAy", + "oG2wzMMs", + "zFMrHqFl", + "A4Qp4FNH", + "V3kwZYnq", + "EUxQkAau", + "XNMd5A8s", + "vxgPBH9t", + "9ClAyVkk", + "ylotc9XA", + "c4GVVDt9", + "7DoAhT6I", + "hH2WREzi", + "oJ0VxFIg", + "WBwBdTX1", + "GJCsuaN9", + "XJoINSsa", + "4hA4xhWQ", + "Su6fgfmB", + "Q9CH9xrP", + "nrXZX9to", + "oUXhhWmY", + "JHzvX05b", + "2a4thqoQ", + "zyWe7Stu", + "oz3ekfuS", + "dOEvFwko", + "L6RNCTmc", + "qgPPCQd8", + "PlC5FH4q", + "734yK5dP", + "kZxYYjJL", + "gUmcLmSU", + "nCDZVWMR", + "KtOSPp6N", + "hVkMOY1N", + "PeIYFrho", + "ocB2DmA0", + "vgEChuPI", + "Tf6d0imJ", + "CEYZSmz6", + "rweHuR9Q", + "FShXrtq1", + "TFANY1Cg", + "eIni94Pv", + "eXCDAKT9", + "7IpbBPkT", + "ObIsEBMg", + "k7kRkE5X", + "VDDW0akX", + "BRfGFMNk", + "UcRi43sa", + "7nxCHV22", + "l8DN6Hs7", + "8Tyjgyyp", + "uE8vnQjs", + "5HCJmiRu", + "84ZbnWde", + "KNZGPnrx", + "dg8l9Q15", + "8affVTqp", + "D1NT0xDw", + "mvIlT1Gz", + "SEZd5kZQ", + "TMNCSxke", + "8jLianEh", + "rO2eZO1C", + "FrDBGxJ8", + "NQAJ0s7J", + "YMfB6v9c", + "yy2xhuIS", + "wWg2MFT3", + "UF532GJx", + "ea1xoeZb", + "zrHrjDZj", + "KYdSjSta", + "lTNrm51W", + "6YfpbAnH", + "6I25aIZo", + "ZiPZ1r2G", + "KMJ9xbnK", + "IS0Nbc2W", + "VwoIhheR", + "kSyOGxGr", + "yUiMftcF", + "Ykkdiy8Y", + "Z6wNZU7L", + "PbhGuiy6", + "qRgMlY0m", + "a1s4ufzI", + "Rg65HdRK", + "4Cr6rBjG", + "UGv8qYF0", + "pt0Jb93A", + "5emKCjg8", + "Me05D9G0", + "ooIa4JWO", + "vrh0E2re", + "FlblNmM6", + "9DpL9ihi", + "xmfdymW6", + "eSYvUEuS", + "rFIGUiX8", + "6o3NyzUc", + "l5a8eIgu", + "RxwcBgIy", + "tc3tHRSS", + "YAo2t4LG", + "gcyRQl5v", + "iGkrlHqs", + "767lrhy2", + "TBMk8jLa", + "9ejQYjPi", + "yIC9FXco", + "9Fx0n3wx", + "EJrq4mkH", + "6N9vn0vL", + "kb3ua7q1", + "YYnU0sX2", + "6eE7Hkfv", + "nUUqfpyT", + "6cKwivrJ", + "uS7wtsgb", + "Tawakp4o", + "UEvW6N0W", + "RbSvzkfJ", + "RaKhz8aR", + "qJNY8qzv", + "EF4y2n45", + "OfxGnUt2", + "uIpbfFvX", + "I1nvuFhE", + "iXamTiIn", + "TGkdRIwQ", + "OELX8ifH", + "GRKk4avh", + "GX0Gmpra", + "vzHXVKRP", + "w2AOYKDp", + "4NmmVOuV", + "c1FDoTSa", + "oDVUKSjg", + "tBefECvx", + "oHG2CPZr", + "TtGtyWF9", + "aS8kFqDN", + "LUqZ64nD", + "YJeLwI98", + "IHEaPBkL", + "k3bv6md5", + "OBr6y1NS", + "Foimp4iG", + "9FFy2x2K", + "Bh1n5144", + "ZzRtgJ7q", + "lz137ryY", + "l8GV8nGA", + "L7Lg1jHL", + "FU15kjhK", + "f049hMOm", + "J5LlogXl", + "iKTL6CKL", + "ITSxOiQT", + "sPFTEOvV", + "kIiwNa2y", + "wXLhLSYC", + "lvZsHT0Z", + "LFCWJtdW", + "TlmOiMds", + "6lguq2w3", + "UMsmsclZ", + "uUE3Jx0f", + "fSXHVbvi", + "Z06leBgS", + "SvDYHIF6", + "Jzdw2xdB", + "Q1pDMmyX", + "Bl3aJUeJ", + "yNvTV0lx", + "HNIS7a20", + "SjXcAQ03", + "r9ggLqnM", + "m60rvxkf", + "zlPLbFWx", + "7XwtgvYz", + "KWBbtJxy", + "6Sh89IDb", + "5ZVzT5NJ", + "xC0Vh8WO", + "pFQDyd0F", + "TamQSKTn", + "sAb7IaAF", + "Dh7ZdPaU", + "zNFkTQJM", + "gpCrdyRv", + "vcX6E3oY", + "YNJPtEbN", + "ZmODG6dv", + "YJn1CGtg", + "I0mEXotH", + "ZJxF5i4V", + "mBApMZXk", + "DgOVNJ7A", + "8r3OJST3", + "frQq27I6", + "Xl6ZTKKu", + "K1wJnaFZ", + "xPEVd8mD", + "iymhxNEO", + "KBkLGGL5", + "xioULS8e", + "Lu5A5Wbq", + "zoaT41Gq", + "UEKjHME9", + "YymEey0H" + ], + "icon_url": "https://cdn.modrinth.com/data/wGoQDPN5/f55ecb94626ba1e51977b217d6a58f500cd86ca1.png", + "issues_url": "https://github.com/Vivecraft/VivecraftMod/issues", + "source_url": "https://github.com/Vivecraft/VivecraftMod", + "wiki_url": null, + "discord_url": "https://discord.gg/jYyyv7zhSW", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/vivecraft" + } + ], + "gallery": [], + "color": 12612684, + "thread_id": "wGoQDPN5", + "monetization_status": "monetized" + }, + "voicechat-fabric-1.20.1-2.5.19": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.8.8", + "1.12", + "1.12.1", + "1.12.2", + "1.16", + "1.16.1", + "1.16.2", + "1.16.3", + "1.16.4", + "1.16.5", + "1.17", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "22w42a", + "22w43a", + "22w44a", + "22w45a", + "22w46a", + "1.19.3-pre1", + "1.19.3-pre2", + "1.19.3-pre3", + "1.19.3-rc1", + "1.19.3-rc2", + "1.19.3-rc3", + "1.19.3", + "23w03a", + "23w04a", + "23w05a", + "23w06a", + "23w07a", + "1.19.4-pre1", + "1.19.4-pre2", + "1.19.4-pre3", + "1.19.4-pre4", + "1.19.4-rc1", + "1.19.4-rc2", + "1.19.4-rc3", + "1.19.4", + "23w12a", + "23w13a", + "23w13a_or_b", + "23w14a", + "23w16a", + "23w17a", + "23w18a", + "1.20-pre1", + "1.20-pre2", + "1.20-pre4", + "1.20-pre5", + "1.20-pre6", + "1.20-pre7", + "1.20-rc1", + "1.20", + "1.20.1-rc1", + "1.20.1", + "23w31a", + "23w32a", + "23w33a", + "23w35a", + "1.20.2-pre1", + "1.20.2-pre2", + "1.20.2-pre3", + "1.20.2-pre4", + "1.20.2-rc1", + "1.20.2-rc2", + "1.20.2", + "23w40a", + "23w41a", + "23w42a", + "23w43a", + "23w43b", + "23w44a", + "23w45a", + "23w46a", + "1.20.3-pre1", + "1.20.3-pre2", + "1.20.3-pre3", + "1.20.3-pre4", + "1.20.3-rc1", + "1.20.3", + "1.20.4-rc1", + "1.20.4", + "23w51a", + "23w51b", + "24w03b", + "24w04a", + "24w05a", + "24w05b", + "24w06a", + "24w07a", + "24w09a", + "24w10a", + "24w11a", + "24w12a", + "24w13a", + "24w14potato", + "24w14a", + "1.20.5-pre1", + "1.20.5-pre2", + "1.20.5-pre3", + "1.20.5-pre4", + "1.20.5-rc1", + "1.20.5-rc2", + "1.20.5-rc3", + "1.20.5", + "1.20.6", + "24w18a", + "24w19b", + "24w20a", + "24w21b", + "1.21-pre1", + "1.21-pre2", + "1.21-pre3", + "1.21-pre4", + "1.21-rc1", + "1.21", + "1.21.1-rc1", + "1.21.1" + ], + "id": "9eGKb6K1", + "slug": "simple-voice-chat", + "project_type": "mod", + "team": "O9wOHL2n", + "organization": null, + "title": "Simple Voice Chat", + "description": "A working voice chat in Minecraft!", + "body": "[Modrinth](https://modrinth.com/mod/simple-voice-chat)\n|\n[CurseForge](https://legacy.curseforge.com/minecraft/mc-mods/simple-voice-chat)\n|\n[Discord](https://discord.gg/4dH2zwTmyX)\n|\n[Wiki](https://modrepo.de/minecraft/voicechat/wiki)\n|\n[FAQ](https://modrepo.de/minecraft/voicechat/faq)\n|\n[Credits](https://modrepo.de/minecraft/voicechat/credits)\n|\n[API](https://modrepo.de/minecraft/voicechat/api)\n\n# Simple Voice Chat\n\nA proximity voice chat for Minecraft with a variety of [addons](https://modrepo.de/minecraft/voicechat/addons) that offer additional features and functionalities.\n\n\u26a0\ufe0f **NOTE** This mod requires special setup on the server in order to work.\nPlease read the [wiki](https://modrepo.de/minecraft/voicechat/wiki/setup) for more information.\n\n

\n \n \n \n
\n Please join the Discord if you have questions!\n

\n\n## Downloads\n\n- [Fabric](https://modrinth.com/mod/simple-voice-chat/versions?l=fabric)\n- [NeoForge](https://modrinth.com/mod/simple-voice-chat/versions?l=neoforge)\n- [Forge](https://modrinth.com/mod/simple-voice-chat/versions?l=forge)\n- [Bukkit/Spigot/Paper](https://modrinth.com/plugin/simple-voice-chat/versions?l=bukkit)\n- [Quilt](https://modrinth.com/mod/simple-voice-chat/versions?l=quilt)\n- [Velocity](https://modrinth.com/mod/simple-voice-chat/versions?l=velocity)\n- [BungeeCord/Waterfall](https://modrinth.com/mod/simple-voice-chat/versions?l=bungeecord)\n\n## Features\n\n- Push to talk\n- Voice activation\n- Proximity voice chat\n- Password protected group chats\n- [Opus codec](https://opus-codec.org/)\n- [RNNoise](https://jmvalin.ca/demo/rnnoise/) recurrent neural network noise suppression\n- OpenAL audio\n- Cross compatibility between Fabric, NeoForge, Forge, Quilt, Bukkit, Spigot and Paper\n- Support for Velocity, BungeeCord and Waterfall\n- Compatibility with [ModMenu](https://modrinth.com/mod/modmenu) (Use [ClothConfig](https://modrinth.com/mod/cloth-config) for a better configuration UI)\n- Configurable push to talk key\n- Microphone test playback\n- Configurable voice distance\n- Whispering\n- Individual player volume adjustment\n- Microphone amplification\n- 3D sound\n- AES encryption\n- Audio recording with separate audio tracks\n- A powerful [API](https://modrepo.de/minecraft/voicechat/api)\n- Many [addons](https://modrepo.de/minecraft/voicechat/addons)\n\n## Icons\n\n| Icon | Description |\n|:------------------------------------:|-------------------------------------------------------|\n| ![](https://i.imgur.com/FZD3ohs.png) | You are talking |\n| ![](https://i.imgur.com/BJt2YAL.png) | You are whispering |\n| ![](https://i.imgur.com/lmN6ydy.png) | Player is talking |\n| ![](https://i.imgur.com/Felj73b.png) | Player is whispering |\n| ![](https://i.imgur.com/dI3pfmA.png) | Microphone muted |\n| ![](https://i.imgur.com/MZRBqra.png) | Voice chat disabled |\n| ![](https://i.imgur.com/Lv3K6tC.png) | Voice chat not connected
Voice chat not installed |\n\n## The GUI\n\nYou can open the voice chat GUI by pressing the `V` key.\nThis allows you to open the settings, group chats, mute yourself, disable the voice chat, start/stop a recording and hide all icons.\n\n![](https://i.imgur.com/TCCHTl8.png)\n\n### Group Chats\n\nGroup chats allow you to talk to players that are not in your vicinity.\nTo open the group chat interface, either press the group button in the voice chat GUI or just press the `G` key.\n\nTo create a new group, just type a name in the text field and press the button next to it.\n\n![](https://i.imgur.com/FihRdNd.png)\n\nCreating or joining a group will bring you into the group chat interface.\nYou will also see the heads of the group members in the top left corner of your screen.\nTalking players will be outlined.\nYou can disable these icons by pressing the third button from the left.\n\n![](https://i.imgur.com/ZVSfBms.png)\n\nPlayers that are not in a group will see a group icon next to your head, indicating that they can't talk to you.\n\nYou can invite players to your group chat by entering the command `/voicechat invite `.\n\n### Settings\n\nYou can access the voice chat GUI by pressing the `V` key and pressing the settings button.\n\nThis menu offers the ability to change the general voice chat volume and your microphone amplification.\nIn addition, there is the possibility to specify the recording and playback device.\n\nBy clicking the 'Enable microphone testing' button, you can hear your own voice and adjust the activation level of the voice activation.\n\n![](https://i.imgur.com/TMyfSYU.png)\n\n## Important Notes\n\nYou need to open a port on the server. This is port `24454` `UDP` by default.\nWithout opening this port, the voice chat will not work.\nThis port can be changed in the server config.\nMore information [here](https://modrepo.de/minecraft/voicechat/wiki/setup).\n\nThe voice chat is encrypted, but we don't guarantee the security of it. Use at your own risk!\n", + "body_url": null, + "published": "2021-11-15T12:29:48.239701Z", + "updated": "2024-08-09T12:08:24.146572Z", + "approved": "2021-11-15T12:29:48.239701Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 5762691, + "followers": 3667, + "categories": [ + "adventure", + "social", + "utility" + ], + "additional_categories": [], + "loaders": [ + "bukkit", + "bungeecord", + "fabric", + "folia", + "forge", + "neoforge", + "paper", + "purpur", + "quilt", + "spigot", + "velocity", + "waterfall" + ], + "versions": [ + "a68GgwWQ", + "qInLVpvP", + "2zfnzZPY", + "wVje7BCE", + "MMUXNTu0", + "kTM5W4Ag", + "fZkeN3KH", + "1WB7OGks", + "Cm5WTwqx", + "XP3Bvpzv", + "tlFeShEJ", + "jOlCnu4M", + "TMkd5WzZ", + "odFQGz4w", + "T8l1OaYB", + "FZfL7ig6", + "fXmAp76W", + "hh4g4mKY", + "jmNzVeLO", + "U7Scsh27", + "PhXefJEH", + "gRQxhLvr", + "pannDqQc", + "tDZ6gDdx", + "rrAtbsCT", + "Brx8x8sM", + "X2lcpNhr", + "CLl9TgUB", + "4rJygbyA", + "Wxj02pl9", + "9ikmZlYA", + "gV5TIXIa", + "CpvbTOtM", + "PvkbYcIF", + "d7T14Tld", + "1yG5JvAW", + "MaMD1XsY", + "rK8oQ5DH", + "5h38xx72", + "y3larVdV", + "ehZIh1Ur", + "d6SM3x61", + "Ny6LsenR", + "qGcqJoZi", + "i69mQMFt", + "JVlRIMll", + "dKesVxbi", + "xelIljay", + "KLTwj7j5", + "j7zdEFNs", + "Tc13aa1k", + "lAcRGOqp", + "Ebl40ByV", + "gLcdThmV", + "4FSXoNdw", + "kNjVFvrc", + "1zh1c83J", + "IIkTgEDQ", + "QrUaxZbx", + "zoVkz695", + "5YGB8EXl", + "Dx9saNOi", + "a1JfCFeZ", + "WgC0RZyi", + "tJs1pCAe", + "PFWwJYb4", + "4vhaRbZY", + "CWARkdoN", + "EsaU9qNJ", + "CKAUyFW8", + "ulDJfFjs", + "E5I4SEkB", + "eki3bjBL", + "1taN8mtn", + "L8YMHkDF", + "hqYkJouV", + "lUupmzCM", + "pEAtFXcF", + "fG2bd9n4", + "NHvskD59", + "bvn32K93", + "8FnHIJFC", + "dLiDM0lJ", + "yvk07Bon", + "pXnrstYm", + "sGgXhfj1", + "84ZAgGYc", + "6pB886Fc", + "M9oAh7Eb", + "Qml1Pazg", + "ONqhNvFV", + "wAmpZM9i", + "K9L3zI9Q", + "DvXMvWl5", + "cyxUtFO0", + "v3VN5xUF", + "Kopnu9rV", + "HBcg3TCO", + "ro1EsDdu", + "oB6gIWFK", + "GV71RAeH", + "SQYWxG4C", + "CJbhWcNb", + "JM0Yoxf1", + "PxV3LYWO", + "Zxg01Ntl", + "yK5wjxta", + "6btNfccz", + "HqjP2Bbn", + "gZbmZByU", + "AM5URYtk", + "YaXUNzvW", + "6WN5Da3b", + "2xj30YIy", + "EE0zCb5T", + "p2R6ZqGr", + "Kcy8yEI4", + "n1gKBKPO", + "Te3uIlqL", + "60B3AcxF", + "ZP6qiEjn", + "lDHYuM3N", + "aexvigxs", + "k9r73UWv", + "A17UahWn", + "BEvTrY9e", + "LLie01CD", + "kgqcsEsP", + "3WnJrRnM", + "a9unuqCm", + "RfnrBZZv", + "jwuLS0Qo", + "oMfVwdpJ", + "Fpd7DvhG", + "jzGURoFS", + "KJH1Kopc", + "xauunnuc", + "4PPUe1g4", + "FH5q9OOA", + "yZKwB9Uk", + "OXquKrKw", + "jf2a6Do2", + "rChHxkYz", + "ZNrhuMhy", + "o2YbI7Eh", + "RLROdgHH", + "BMU3cVKu", + "ehaQfYVq", + "5eBdTWg0", + "cc3pVY3v", + "yS8N6ZXU", + "Sl3Qxmgq", + "7sh4S67C", + "dSvLJfDB", + "V8LgaSMa", + "D7EUjCLk", + "XbjoKXZL", + "uPYkQjz6", + "f0P4bZqy", + "6XM36i44", + "rzn7VSfZ", + "FfNNbqQl", + "OMvgIpOW", + "W2SOQdSE", + "vImdshfE", + "n3yumyfQ", + "qTJMu1nO", + "OCVs4QEi", + "it0IwF9X", + "8UVLLM3j", + "o6xb6x8K", + "uclNuaZW", + "WhXaFAsr", + "JPqNJyqX", + "AughfLs8", + "SODKaewA", + "G2n2Uh26", + "76qKtyVc", + "tI9r1Feb", + "zNkLYq77", + "gIrTvVIN", + "iMZws6dS", + "wZAOmVzE", + "mKtQOwNx", + "t8Zd0mB7", + "3xQLT4qs", + "TKuQl5lC", + "YYvdKo5g", + "WIdr8BMZ", + "LWhUMA80", + "UWBnMOdJ", + "73TONy6p", + "z2pdbeXj", + "DgCmCcR2", + "r0bEB9bH", + "YDyvBSgX", + "Z0zw6DbV", + "q8RCkspv", + "axEYT5yb", + "yrPoNnzk", + "wdoJlCs9", + "YDtVeNJa", + "t2zgo1BQ", + "sUW93e6W", + "CTkQBuJA", + "MumXv4My", + "6ka7bwQl", + "70xt82Cg", + "msTfI0hl", + "vxfPIHfK", + "YylpTIB0", + "bnjunHiE", + "b1WfQy20", + "5H7d0zQx", + "zpNigQfT", + "7qrrec4L", + "MHNf6pCB", + "ArZv6rfj", + "AlWuf8dT", + "lTip8vnK", + "9tklldDR", + "UfgzEmws", + "Gq2vvxEQ", + "nuX9d6FG", + "zYmxGCnD", + "NHK9sHfg", + "gYNo1tNg", + "Ah35LEGu", + "pOkzmGFM", + "U1Vescrh", + "biMq6xQS", + "kv8wz0jF", + "iUyOJeE8", + "WP9iegfO", + "4GhVHo5T", + "DNa7kVop", + "7LRIPiMa", + "viCJCqZv", + "MX7Yn79q", + "29hpXpbb", + "n9Ao3xPL", + "XMEDNUPv", + "siIJbE1D", + "b6S00j1H", + "UB5iCt2X", + "LUlnMGpJ", + "E01R5OUv", + "6JRNpY4e", + "sT5w7chq", + "ZcfjF5uv", + "2ph1vecE", + "w7dOBEZE", + "KaRM88jt", + "1KKOEm9o", + "6bzpUJBu", + "vYvRzHN5", + "dMQdzlOS", + "fTEOY9VF", + "otwl7qXB", + "lVSbBjMi", + "ox285ZhT", + "SF82yFVY", + "U83jm5A8", + "KjLXBqA1", + "lQ4N6SsU", + "6NQfDOZD", + "dg9OwkXs", + "brgbbuit", + "UUAbOrCd", + "skCygDOW", + "CFGhmFHL", + "wdtUgD3K", + "rdGdxpQY", + "tHZnuSqg", + "IO0J0SyU", + "60r69pVR", + "aQuivvbY", + "kgY7bUhW", + "1rSOa2Gv", + "tbjFoMlx", + "7wGDl2Nx", + "scXfSMOr", + "qwotpGek", + "5cpjIAIR", + "pL5dJUeC", + "ptROztOk", + "C5D3EkJ3", + "tiRhnaPg", + "3SPazklI", + "CcFrXpuc", + "BKhaMSiT", + "WbnJljlf", + "zeQI28Jn", + "MACFDfHW", + "EQQ3Ph49", + "tKTondTV", + "SZoow7rI", + "gzHxTKVj", + "zkU37cwD", + "oSEJKnkf", + "AQsy0EUP", + "RoW4tOsW", + "pckcaIc7", + "Abxhdnho", + "8qH8zrW4", + "DKEL9dyW", + "pC5s0RWz", + "3VWKOSFu", + "iAvubgWc", + "ls6ocxEY", + "QLSIXo6R", + "fivMY7Af", + "Mxrmv1Xk", + "JHjRBhoO", + "DzGQQDGK", + "vATBDANH", + "xxJgE8BO", + "6QJ2Scod", + "xaRcck19", + "uP9DiSyf", + "FfcvJn55", + "Yu92rO6C", + "HrYAgigy", + "qykDrhK5", + "GZy8xHZ3", + "UuVA043m", + "MDCC4LZk", + "S2GYwyxz", + "b0IrtlnW", + "1LACBzUs", + "UYbbcDF6", + "JQk4ao6v", + "HAm24DLp", + "gO5PQY6T", + "rgVUDkxC", + "xFPpmf5h", + "rGRvflN5", + "Qmkb5A4H", + "WQ88Rmwr", + "ySYmTWo3", + "I6mI6OeN", + "dmhT5CQ9", + "hYbqAX4q", + "az1VwwY3", + "Ph4M8vVr", + "YRYYChqz", + "IkSiL6sa", + "TV7wMBxT", + "2toRsysM", + "wPPCSxad", + "OyZEX5US", + "WKqADSbi", + "i69klTVZ", + "IixaA11c", + "GtXbv3fS", + "tm5PfK02", + "3HsSGC4Z", + "MOk6hMMV", + "Xjx8vmTA", + "jkq7IAd0", + "7ZStwdm3", + "XnDKmly0", + "eaRwKftF", + "KJqSzy6C", + "b8NlnipH", + "lRjwWNrZ", + "CkDZXpT5", + "qhzHCrFC", + "xTvjbKVQ", + "sXVAHHIX", + "rlzo7cSj", + "p42wypXT", + "JJreUQxb", + "bMLoS5Mo", + "owhezF5z", + "3goOBS45", + "IoPPwlWY", + "ZS9OpzpA", + "3jJ8TP32", + "qEbbgFv7", + "wRg0zbnj", + "TYN8vsX7", + "RiTcqFq1", + "9ywUTZCY", + "OwrHEVME", + "oPag3cau", + "VWj4mtlX", + "TZO9lzmQ", + "B7yp7Poi", + "3822Azin", + "uXSXSZ1x", + "HiK9NLR3", + "mWTCEsku", + "mwmOj2QM", + "ombkAocf", + "OUSOhED6", + "T5CAxN79", + "zVAME2Wi", + "Z7NcKuzh", + "54K52aKi", + "YVel1eJv", + "mefkGHbh", + "Nuy8uAoD", + "rqueStfn", + "c56FcBhh", + "SxY1yz0e", + "y86mBB9Q", + "5flypNDx", + "QnLA4Mth", + "vtdjcCIU", + "KSTZBh0m", + "UhOSj8YO", + "cG4us59N", + "DrQb2Dfe", + "BMvJ5Qij", + "OHcPJLxx", + "3kEZgjSi", + "GzAyrZXM", + "iTWGNq1f", + "cfDknKIG", + "yh5f4ab6", + "Gb3oogZ1", + "WZhhHrS2", + "Uz7xdv91", + "QYiX4ujO", + "lEbdoWzs", + "QyUqET2M", + "LeXgP9NY", + "Oens5iLT", + "vlChJdYK", + "4QjOprSY", + "mMLThJB4", + "jUmV6CUo", + "t3KSz0GR", + "4AkwmP43", + "Jptf1ShM", + "BwOgEOYb", + "J1yrmPaY", + "S8jxARyk", + "gJec6R5o", + "FOfLz4Ep", + "cYjYpKGC", + "gK22RPE7", + "l4XYwRVE", + "NgQGSkFK", + "rl7n26wi", + "r4ywm48l", + "yPATojcE", + "TdHOL96o", + "xxt6H6KG", + "kQbP3Ntm", + "zVYTKHob", + "hAzS4wts", + "cJ9WIFrs", + "YEck4uvP", + "RjLBB4W0", + "xWmSU7Cb", + "jb6aYgp4", + "SWoX2OjP", + "7ZESpDhQ", + "GtqlRNA6", + "uodzVP0q", + "qJfOuVGT", + "5a7i8QEr", + "KVaxwhTC", + "W7NBwWf5", + "xWcncKQz", + "eiJUDzAN", + "vF8PaXo7", + "26YAuFPw", + "AoZlvvq9", + "xziqzVYu", + "f3rnMOAy", + "amTR8cRa", + "W7pHC6Tv", + "rFULgZ7N", + "sOptr2y7", + "Pi2VjFQ5", + "7ehAhBvg", + "BwM77UUZ", + "qEuAqWJ1", + "Y4NYu36X", + "jphEzHkO", + "WtKXrhHF", + "DCgHdBA4", + "jU3Pdjxu", + "ClJ8ePwh", + "RrQPT8BM", + "k9Ul3POY", + "B5mLEftb", + "JBDfN50k", + "TcZ1PseK", + "8qYOTxSB", + "VBMJO9nu", + "j4GVfwQJ", + "nXp0c0sg", + "HO06NfqM", + "ySymCfib", + "euRdXW5s", + "8TlfrkMW", + "STRb9oNt", + "oKF5f5d0", + "yMrqIxSf", + "TsqprTYm", + "mXxzQU0R", + "EsVMkcwf", + "irPymVPG", + "udz7t3g8", + "ujSd5u2t", + "CiQgNe77", + "8O1ND9Jp", + "bsmAtyO5", + "5rA3zbip", + "4tPcxHOz", + "yaVPRjpO", + "XYlD8SRa", + "Le59p93E", + "8p57zcI1", + "R5zXJCs0", + "qcUaOg8o", + "8N08H5xj", + "76xU6eJC", + "rvrqlnYk", + "dEK382Rd", + "FtVXuDsk", + "d8QNQ2Vp", + "FVNRwn9x", + "pcCWPjsP", + "AZEjdMNf", + "wptu1MGi", + "MvyfJGkJ", + "hwrEwyqz", + "DDIPxnvp", + "t9SnWp3c", + "FDlFuUB3", + "KfLUPw8c", + "rhyi0Cjc", + "BbRUumLF", + "WrFgEpcp", + "zXJMBiOx", + "Qchb21r1", + "kwQsd5VZ", + "3gecV8fy", + "pIRkCOfp", + "Ihkr0yY5", + "tafpUkms", + "ywSc3s7d", + "ebnUNEuh", + "naJ4vlr8", + "QJcM3LM5", + "25SsDyKn", + "MgnttvBl", + "lCmSWcb0", + "woqyZ58j", + "3jtpOfqw", + "u3pVBlpU", + "vxnXPyv3", + "58Q1qKSL", + "Wx0Y2Wnu", + "3qoYyqsH", + "vK65MH8C", + "XRqD00T7", + "F0fr1NK5", + "wRnC4Uns", + "mAt2QkGd", + "fr9VIjNd", + "TVPv3vP8", + "FsFSudAc", + "T6i3YrNP", + "RDAzGbOa", + "QOsWvofn", + "jYO3nm3f", + "iT77zmK1", + "dHPXG5gw", + "bh8xHlmx", + "mnPw5bVV", + "qvF3bePa", + "PTdXZ57S", + "6PS1DeZj", + "6c5KrUSy", + "gmmCP0pN", + "Ui1sbJws", + "5B8Z7NsA", + "EviEHIbm", + "sfpdoozI", + "qkyAwUvq", + "OJZ2B2bD", + "EzFdvYsm", + "7KZTu3M9", + "psqUqr7v", + "qFnXTNzp", + "iHJvsreb", + "OqIy8fbF", + "HBiYMFjK", + "Cg4gISvx", + "OrMldSxN", + "5h6GRvG8", + "yupsEpOA", + "KwXPXlKI", + "CK4RVIdK", + "THndFk3u", + "2RUDX4l4", + "7KHZT0R3", + "64z2lZ3l", + "iY819UAN", + "dO9m00za", + "VsmjwBJV", + "IgIPdC3s", + "UFMaQn3E", + "s0hyOBK4", + "J5wijpnf", + "lK15nYA1", + "7v1XcYPa", + "TSFNdLC8", + "rfrxsAs7", + "iSLcTOCF", + "tZjNePSI", + "QTST0vVl", + "A1gphHYM", + "m8XUTn3b", + "iDfWQ0RL", + "5ju0QwkS", + "F6C1eSce", + "a5jrAzZU", + "D7lsb5A9", + "sISiDZrg", + "IKy08zNO", + "Uvz4QEyH", + "7BULlG3T", + "ySvcLNyJ", + "meGDAtS4", + "7tmySRgX", + "e7SAI8ft", + "YE8ZYXzn", + "ANMmd67g", + "bt4jIuhK", + "mdlBwGRT", + "1GwCydAY", + "A4upJcrb", + "UoKokQ0M", + "tDrJWkR0", + "gdb9hVFn", + "w6WCaPXi", + "6xlIIRmD", + "zdrGcCqo", + "D2J7dxIg", + "Tp7S2xoX", + "tYfD3g3o", + "rQYbR55Y", + "PI9EDhw6", + "p2rNDpgX", + "We4peEIE", + "4uJpormM", + "en9vUl48", + "Rk8nVCvN", + "9fnBn5IS", + "Fs99wEBs", + "YOw7LkVY", + "i6lTNpQ1", + "RHPocErC", + "qaycOrGH", + "lthaNSLn", + "CNcIm5Wr", + "HDbhxCmD", + "ucPZ0Zlk", + "iUJ8oxVy", + "jN03ENCf", + "G8Bv6OzK", + "dapDQlTE", + "J3KRgkVf", + "knsfNNIv", + "8irIYM7N", + "ikZuGWq0", + "3ROXtbhz", + "H008xHjt", + "DSCLNFj2", + "K8KbB4RV", + "PO7Rxyzv", + "FKGoeLU7", + "q4kyt2ar", + "wEYnMTdq", + "AhiFqewG", + "64MFHaO0", + "yoeKmXgR", + "MqeOVVBh", + "Oii0nmW7", + "KkvQ0hT9", + "Am7Afd8l", + "RTqTi9PB", + "3mhxktnw", + "2HcUazLU", + "drVzG6Y7", + "DL9zt8gd", + "aP9bMoEp", + "x5FBiwpj", + "NeHultSS", + "MdwR0Apf", + "dswLMQFh", + "MfYQHsh5", + "USwSNzvD", + "S0yCxhX1", + "TXUmE6ZX", + "FpmzQfDe", + "9orHeOej", + "AM14i2i2", + "CfpYmP4m", + "TjqDTzEK", + "ey8TpeYB", + "bUK4wGH1", + "yLJuTvmb", + "jbogbvo0", + "DQJZgdiw", + "LebD31bM", + "qCGtO8JL", + "zzUou8ba", + "mV8egSe8", + "LdWVn5DX", + "GDBE959Y", + "K4anOZDD", + "NSBUNV8T", + "iLW9xtDt", + "weK40RkB", + "DGaZGpgQ", + "neTrprWE", + "gnDq69th", + "nvYdhgWh", + "e8QBwL9w", + "sl3abGMn", + "1YWIncP3", + "Cx3uX8pP", + "IDUCmhud", + "tZTt8hCb", + "qVwE54Aj", + "uuNvBToj", + "MVLWMmUC", + "5l1I2ZdM", + "tky50fgb", + "CFTGxpFO", + "LZtCLt9H", + "rnJBUTRy", + "EUUaZi0Q", + "KYOlfxQE", + "j8BAwBBZ", + "sqGXwxqX", + "j5PAbjOX", + "CIHjKfWf", + "kAK9E7QN", + "Uf3QfIZH", + "93LMTU4c", + "Uiuhm7sz", + "kkt7Uxwc", + "O8E9ZJBS", + "8UibxwNc", + "6wbks5k5", + "UfARzPwD", + "cHcysdnb", + "CfI06SBh", + "GjcXqUeQ", + "biMOGa64", + "VNVkvAKo", + "lLJKfb9A", + "rPNrdRQo", + "Ro5u8uo5", + "aWSzugT7", + "7LGuplN1", + "B9QRbi6Q", + "g1awVxcy", + "p5w6UGA4", + "ZFo0osSd", + "zBxORBK3", + "oyhmybAh", + "3WNKLSnn", + "qXreT2fw", + "2v4Uri99", + "mQQfBb0o", + "NrdrBFYe", + "i9NQz1UV", + "UvNS1o3v", + "WXbt8VVQ", + "YGyDrs0e", + "Aig2mCto", + "gVR6ZQ4f", + "PPychWbD", + "PoZjqqMr", + "CFMtkkBh", + "VcR6SbJV", + "mgOOw5zH", + "ab6bHZR8", + "m3ugvpRg", + "FjBN5sII", + "PGAUelxG", + "WUiHSEAH", + "zSmmBSbD", + "GvczqHHe", + "qbGHOSjZ", + "MiAYJiJt", + "TQtV2Hra", + "BCZ57c57", + "Do5N35jN", + "CcCBYmhs", + "TUgD9o7P", + "FjGaPqwu", + "zzlybUhh", + "18HpRSWL", + "Sb5dImaz", + "nvm1m4LA", + "oyRdxb5n", + "huNbvkqI", + "75zYsfAY", + "odbH5CFR", + "a9my0yXs", + "C3gxM8X5", + "FNTU3zAX", + "St1xia24", + "rylPu5v2", + "N4h1IGZi", + "NDzYNOfz", + "pB8Nl4qg", + "lkr6TMKJ", + "nU1g281T", + "fJ9KY0Tk", + "2kKtcihL", + "gpYetBhj", + "FNwUxKKk", + "gVzhpwQT", + "CoiHbVKg", + "DV40IhyY", + "Z476sQw8", + "l29Co1Hm", + "5IjR1VjG", + "YbSh78z5", + "RTxKgvdN", + "JPayrNdN", + "CAN09s9P", + "yzY9p5uF", + "hunCDvaY", + "fVWT82jY", + "745uSYQo", + "Mbd1E3E4", + "l9IZD4MC", + "hkfVkE6i", + "CgMj10S7", + "AS39IH8k", + "fLbilXcL", + "kAllSTb9", + "Ht3Mrttx", + "7QE4atCG", + "hN0G7nAd", + "PDw3aEDr", + "jWQBVSa9", + "oQFPIo9S", + "dt5G0wtV", + "6VI6RMTR", + "rpBFgFO1", + "5MrR3gHW", + "Kb55Hvro", + "dNRC0H37", + "4v00OeoB", + "v7g8Q49W", + "fLUfwENW", + "D3Y1LHUW", + "IkbruGCS", + "Cc42yGJW", + "bnWaNTxJ", + "f27HCJfc", + "z6cYGtZ8", + "Io5bEHIb", + "hqwxeAU3", + "6kP3jszz", + "pBGz0fqU", + "a0ysguQP", + "DBfQn0Oj", + "hPR4sv1C", + "Xyw6PHf6", + "iWH7JeNb", + "mJdiP8GK", + "HdikOXpS", + "uD5zqeKK", + "e2EgP3uU", + "j9Q3wDUN", + "jFOhuDpk", + "VdJ4Av3h", + "6eRD1b1Q", + "Jm3soSTV", + "66lsZXXX", + "9bFQBfVz", + "rfjl31Cj", + "8KveguYv", + "ZMnGTC7v", + "rlXXuf8h", + "x8GixcU6", + "W0lrQCZo", + "IKrqdUEr", + "r4EGh5Bi", + "johBN2Vm", + "Vu0JowCH", + "RXGM6dBM", + "KNawhkuj", + "llVXxYy6", + "HXunw52L", + "89FOc1th", + "q25Eqzhm", + "rS1kA1jm", + "FgOiUVzh", + "z9OFKGnW", + "Ssz634rO", + "CZ94DD0g", + "oDridzfo", + "tjMpfUw5", + "c4QUFiaC", + "gXdrsnMx", + "CxC7bmmO", + "6ywPA9w8", + "zgplU6Cs", + "WvHElfx1", + "gTPmzBpA", + "eIFr5DsE", + "tW5vWb3F", + "P2LpxINP", + "8U9mliwb", + "KShVfeIj", + "v2JDwI9x", + "Kb3Eh1Vr", + "GEEJMVal", + "16njRIqG", + "yye8LI8e", + "puAazJAw", + "9grwiEC0", + "gGuBemZd", + "psIKOtP4", + "8hVm9IdZ", + "XNFjCYms", + "a3lFY9O0", + "X0sRsHwa", + "TFeDdCUJ", + "2ZayNCih", + "EyCPoDxa", + "SdzjNq8X", + "fU9nVRZ1", + "V4oempyh", + "1Tg47pyQ", + "1jJLOiZo", + "iM9oebu1", + "WPO7zjtx", + "3nRnNUOS", + "cUVDeuGU", + "mjPRLrLD", + "NlfV5vp6", + "s23igyR8", + "m3n7XFzH", + "lFvcH4tY", + "wgegBogi", + "tXwhJeN3", + "LD6eqSjr", + "lXmfKcJK", + "3FIyp0gn", + "qDL8MSFE", + "fq7Hdwqb", + "9VTjPCrX", + "psxCAXkj", + "EFvZPNWu", + "WloCHo7S", + "k6h898TE", + "YsBCWxk7", + "E9rZgsW6", + "AJEN4laF", + "oTcMpI1F", + "n0I3acG5", + "wtbtoLhs", + "lmOGB7cb", + "OdVX12L2", + "MqhEFIaR", + "GcPWXYJq", + "qz3BVEUT", + "95rAIMBh", + "noUSyNmW", + "uMiLkRmf", + "tsjBnFaF", + "v31bq2O7", + "RObPBOyE", + "jhOHFVFZ", + "25HKRtBI", + "2MSQmYqW", + "LOHvKcvY", + "4D6BZo5m", + "VydlQQeV", + "orbqD2kh", + "YLxyHdWT", + "bkrJJrW3", + "ZHDPwzAe", + "QagkQI5X", + "8dIe7NyZ", + "1SmsqHW3", + "zLeWrjv8", + "Bw8GoX30", + "ayUVHd8o", + "KmJdeFgs", + "fMiI6qBM", + "E325Fv09", + "5yezR6pF", + "7g14XpHB", + "4zTbXdL0", + "41pJoAm3", + "E9DXnCT8", + "4rKGtleq", + "PHK1X3Xc", + "1Ta3sruj", + "pErOQ8zI", + "e2WaF9K8", + "CrJoAIg8", + "ynyJ5qq2", + "sckft84h", + "gZnjiRtQ", + "7ZW8m1a6", + "SB7O3BG5", + "OvhnD2bZ", + "3JiuAMvh", + "TLALmfny", + "kxcsWZCy", + "A6xTBa8c", + "jHTNBrq3", + "NxKOKNgH", + "xuDkR90d", + "qxXE1v3L", + "Ba0Z7JcX", + "5lcQH6Ox", + "lmONnbGl", + "sX9gItaD", + "iZzgLAFj", + "kMyYv1np", + "EDqQK2Bn", + "aMdkwahp", + "Dn1Ar4Um", + "vQpsjR7L", + "LMqUKE0H", + "WBCH04ad", + "RPApHaDy", + "EOgv8FZ1", + "AksP3yMy", + "KDmDQlQG", + "oruiCHvC", + "B6mDcgZ2", + "dkFdqBHH", + "OgQPLSvZ", + "h4W6V7ng", + "aGLy1gy5", + "JQMKdk9p", + "B80K1sK3", + "7HbFuEwV", + "QWOzJf9o", + "BNDuJR7G", + "WbxLYgSW", + "kpYr7akq", + "lnHzo18v", + "fL9zVA5k", + "jWwlS0Ae", + "GQHZbdj8", + "S9HEO7xa", + "lATOf68H", + "ucK1wjNV", + "MCFsM5VO", + "CTxElFLQ", + "OBeNsrg0", + "KUGGkxQe", + "BPLYpp8u", + "Nt2pzNuH", + "3IDlWyOe", + "RCwirlGx", + "O0tSM3cj", + "aIVDadRg", + "MjtI3KV4", + "DTSq8b11", + "SWlA9ZGy", + "ZwevDUVF", + "GDb7Z2mp", + "HfppZUUX", + "OEdMPnQz", + "QQ2pfidM", + "WcsL0jgz", + "TZiD4gbi", + "lKGyYu6S", + "RXxZHMAW", + "QOTzX0HV", + "CYwWgMiY", + "Vc8gzrS2", + "GAPgmEyP", + "10ygOlhl", + "XHWxM3fw", + "qPnBD99O", + "5Zjrtwhl", + "CFPoOzWW", + "D4coGZJq", + "jNEmhqH7", + "FJxglTu4", + "mhqkrfFa", + "hjzg6oiA", + "J30uUCaK", + "Sa4g788y", + "3PTVF1wd", + "DGcr0eOk", + "7pRUzAIK", + "sc2BBBoZ", + "FUEdZIPi", + "iO4m5PLU", + "fUb9N4ZI", + "9nCKKdft", + "pO0sk4z2", + "EAWNGmgG", + "hwNa4mFL", + "I92gJvt9", + "BGrsrYeA", + "9K63pYwA", + "b1LqbTTf", + "KdXov2Pb", + "HlqH3h2v", + "v9ZWmwso", + "h0edb0O5", + "hfemmEgs", + "WmmTP1kb", + "Pv469h8Z", + "3F6tiGg8", + "NOKiOW4q", + "hc2m1WQ6", + "haux9k7x", + "nT77HxXK", + "2j5ph3Pz", + "vkBZANSG", + "tKINhHsw", + "b6EbL1fA", + "jqbvEUBm", + "i11VsLvj", + "2446TGUZ", + "6JmHqUp9", + "oKKBLQfr", + "QSJyjpeG", + "RrjNtN7P", + "P6Np9f5M", + "kmTbM7Oj", + "6RT8dQdY", + "ia7HXWz1", + "59cemCjh", + "AMhZJa50", + "cpGsggtq", + "ZI8OBIBy", + "KoVdHCnf", + "E4EnO4Gs", + "rrp71BLc", + "FNESHgGq", + "h176XxBD", + "9x9tcJS4", + "4hE7XyBa", + "NT1uHlh4", + "Gs6m5jZd", + "uEYUVRo3", + "QKmqM5mV", + "2UKoLNUH", + "ASv4k3Br", + "vnCMHABF", + "QKFGOJUD", + "5w5NJzCx", + "7GWzu2ik", + "onVH7UO9", + "PJU7PUGE", + "9SotZNms", + "p3JAhQkS", + "IWLirCJ4", + "HpbGly1U", + "cgPK1BnP", + "FodMeJBb", + "uEvVLusv", + "onLhjj6q", + "krETAxFV", + "XXnKUaMw", + "svgkfGtz", + "K1v8xBfy", + "97E7LfoL", + "Q9HPHw6L", + "9g8UForQ", + "X4MaUU1U", + "bBJKsRrs", + "siN5Etnl", + "wuAPWWPA", + "DB81KuvO", + "LfGyOyJ5", + "2PSG3Ptd", + "RugUWN67", + "QaRAXasa", + "bcEqNDOG", + "a5HtJfzX", + "hwbpO0WZ", + "997ggVwm", + "svPPpbQ2", + "sYq079bm", + "BOM7GPGs", + "Xotohi09", + "9UTSA0xJ", + "ykUiGiXd", + "Cx0R0y5l", + "x3PT2flq", + "4h8IkH9T", + "snMK4mWV", + "WsNv27xH", + "dh8OHbHy", + "YagyycJq", + "Y6Lp4xPN", + "LLXEcoAV", + "tfDBpe85", + "vIqwbekb", + "LPe075dU", + "NkZguN8n", + "6NLGnqdb", + "y0kOOv3w", + "NHxxG1DC", + "UdGl7jqC", + "avAdpOhr", + "MUpjzK7t", + "rhiEm2Wc", + "vxqH7eU5", + "EX0d5uwR", + "dYnrrVyT", + "RzFHk0WW", + "LKXveeun", + "GQVfEepq", + "XldzO6mM", + "yFp8iIYz", + "pBoKyquO", + "JFu6SM7X", + "rcd2eEe9", + "mGVFrJAx", + "GZCpbcyL", + "SciXH9dB", + "IxTNImqb", + "bWVa6698", + "fT7I56F1", + "9iDVyHeO", + "nseoHIqe", + "Cwkd5wBU", + "bjiqAfUp", + "pnIGcZL5", + "qASNS3BJ", + "bvCjrdcB", + "ZO80xMG3", + "YADIoEZ8", + "cud7Dp0h", + "Nzq9hm0h", + "FXEC67Kf", + "1OCJWb2P", + "7LC2hpt1", + "FCmQV35I", + "hGHIRD8U", + "qGSDZYUu", + "7upudrLq", + "tndX4rxY", + "JBuELDZK", + "JLVwBfqi", + "mWWIM6j2", + "7aoFHeZK", + "JCIvqSzw", + "mAnLSJyl", + "VgL33dWp", + "artaImf9", + "uBJPw66b", + "aS3Vm5KV", + "PTnXEzwa", + "mZfta0kq", + "S2yFtAOp", + "R8TUCsZ7", + "I3t0998G", + "UIvURho8", + "DVrkeg0R", + "m6dLuagE", + "QYAPmZyH", + "VGpoF80L", + "2LUm2Kaa", + "EM9eC1Kp", + "K95RbSbU", + "euJJhoTs", + "cz56YIkx", + "osHean0g", + "miWStu4G", + "q3F5v1H3", + "Wq1967bc", + "ITZFwWkY", + "Ak6PxhpG", + "LeAYbpLY", + "w4N3jbW8", + "ZntqzMlZ", + "PbqLHgq4", + "OFLUu1Vk", + "hwkRmEEg", + "P7uRt7gB", + "jhgkhS8n", + "tSR3xUV2", + "bKxV67dC", + "krgjx3p1", + "jwE52Xf0", + "gqmtyrB2", + "H7gbaWdG", + "LRZcMYoL", + "Lsrm7sW1", + "eEexAAZf", + "JP18P49o", + "qEzrn3Pc", + "5Dl3MmWc", + "rPGUskmU", + "QMs0zUxl", + "sLTlTljP", + "amJPikc3", + "KDAdZwJh", + "eRZ0ENZR", + "GE397Cr9", + "sIjavVzz", + "emeMXunl", + "Mnk2EYTk", + "y6Za5pt9", + "iAiVKHh8", + "1ON0czTj", + "nQlNYJmQ", + "vNdZtn73", + "bH98pKVE", + "loSMVTwS", + "fK3wSsgG", + "T4za6MXl", + "SgmCfFme", + "QAPwm5rr", + "OmJwcG0z", + "vY6k7GI2", + "Y9wS4uFf", + "NW4LGxTy", + "z0SSEbL9", + "35gDG8zC", + "tQ176d8H", + "4V0kSwX9", + "tZq1GMpi", + "CH1jYu2U", + "zESHDhRM", + "vLqdAtXI", + "eRaq1KMf", + "2B8M6mXM", + "qQGt70lg", + "Yd7Eth2O", + "PDs2qJG1", + "XgylkKVL", + "mUlCYxGN", + "DhTnc2RT", + "euAtnGaR", + "ey99a2no", + "QAyAaK5h", + "pp7LQGPB", + "pHNfnwoE", + "RkNHWpEd", + "7mOyt3px", + "MhmOpLbi", + "fjDiImrD", + "99cJdybq", + "wpFA4oAg", + "WDLFDlJU", + "I0UEW6B0", + "pvFFpi0L", + "L0XWijmX", + "BmL6whvZ", + "t4U3OaJH", + "fLdbjW6H", + "dLY0sQr0", + "LSio64KU", + "1N7I9nAd", + "jttRj5Ud", + "jJ1on38m", + "wOV0dhIV", + "ONzzsgh9", + "FQ7VYFV6", + "w3De1D4Z", + "EMdKgXle", + "QdTpdJCJ", + "mWiCXxGO", + "6D9aAV8M", + "ilRhAQF6", + "MmKN6xyO", + "XPw1Pi7O", + "flY0vop0", + "VFit45xH", + "DCU9Zvdi", + "uRVWyfZe", + "YiRdLVIl", + "8c6nCoFx", + "bbgtX9q5", + "WQJpGbVb", + "GDuoJ9ZO", + "1PcC2vw4", + "QNbrbfu0", + "V8UvxUr5", + "PtLnSEgN", + "nuPjouXh", + "QDadlf45", + "BkoRXAs8", + "SGJhnOJI", + "5T8Ptkdi", + "4kxxKlSi", + "OgJeiBxw", + "J19as8zJ", + "HwWGr5KV", + "Pp4nlMap", + "HE98enGg", + "FrbZK2lQ", + "wVsdWkR1", + "UXs4sihV", + "rPh7s4pr", + "ZlrgTz87", + "sDrVxQQX", + "aqYkyKYT", + "s1QhVDIk", + "cgHFloaM", + "Nc9kJWyt", + "zujCP702", + "wGI0D9fk", + "wMbmiYWE", + "vZwHaHMz", + "AYzguATT", + "uEwx8qHX", + "1MMZMWd1", + "uoLRkZMU", + "CtR6D6ZY", + "qdU0n4ez", + "1qN4Fsha", + "yo7QZZxX", + "zMaUfGqd", + "pkVUXWw4", + "2qj4E4oX", + "uiOxQZGj", + "bgoyJA4k", + "Wp00WXKK", + "UQtABvTX", + "sim2dpjD", + "30naV1zz", + "i3LmCtmQ", + "y4rraJLN", + "lBtQcbt8", + "tll2jjMo", + "3DmQYAJL", + "ucxL6EqV", + "bYmIHdsG", + "8hlaFvMy", + "VeMaV9PT", + "7zIB5LVU", + "yYZm0VRD", + "OBqUyGnh", + "4i5NIyZm", + "AGeWkvxZ", + "cMzNMNXO", + "7SVNtIrO", + "1HzTag5U", + "bFVwqfgh", + "CXy95ePz", + "bkL89BRc", + "QzVpKpYJ", + "aBOo1EZN", + "JcLRFzg4", + "tzWm5Yge", + "Aiigft8m", + "dbkA6e2h", + "xqHXC5A8", + "q2L611FF", + "f1enbAVD", + "UCAWasbf", + "nR0YXZJu", + "HCbuaHZD", + "lLYWNKrm", + "Mi2DlQ4V", + "gkRhgmyQ", + "tQjx0hsw", + "vY8Kw4u1", + "Zo7YfNio", + "kkvPUA1p", + "BodzYw90", + "HpCihtAO", + "YWz9UKri", + "XuJOXXDH", + "6bsFEYho", + "eBgqOFLN", + "w6ttPDjb", + "GWHPHuKA", + "VQ43RK9t", + "BI9oItOZ", + "UPcBQ0Di", + "Vv1OWjwC", + "8sbc8kD8", + "swjpHzBa", + "5bFG77fl", + "pcfVH0ZT", + "eGKnnUD4", + "kXz0BKVV", + "YV4EGkM6", + "5GnDxhaf", + "Jf1JG3Ax", + "fjkJeUzT", + "28aJ4XRF", + "hP83mZqv", + "eOzUefH0", + "w9hiczLp", + "TWeAqU05", + "K3I32Wkq", + "hRleRoZt", + "71jT5H9T", + "PPebb4e1", + "VoUMKaog", + "N4XJC58C", + "3iT5WUrv", + "SDtXZKUE", + "sFx458V5", + "p8zEH7oT", + "b2fQucaC", + "1lfbvv7p", + "MFIKyqIP", + "5XcFdUYz", + "hmZwO1Mc", + "ypNkXUkZ", + "w5iaagez", + "GKybZIz6", + "TeXITA75", + "lxQXYTWl", + "npXTFnKI", + "6FGgqtQv", + "aZTTlZoP", + "xbnoMxjj", + "BxgGZpe9", + "Kk9UrEj9", + "QmGB1G7X", + "H0pRqJVd", + "brgN6VZv", + "X7DGzvmm", + "CFp05aXY", + "en7IJtcj", + "p2zZlRRa", + "Teo1MeBz", + "R8lntTHT", + "wkicVb66", + "Avq50tOb", + "Fn7hxDEJ", + "UMY5bBfj", + "9acId7S3", + "H5zIk6h5", + "zUIQEMX3", + "sC7dUVTs", + "jmIhCqSK", + "cCuuyck5", + "u0AIndld", + "I1tZTDqP", + "wcEAPH1l", + "CPb7xxUz", + "QPsreClG", + "fgubBhPA", + "JB8ShM7e", + "TJ2Ie0Eu", + "cIAXVWCj", + "RQ1usKms", + "HEk0nDnD", + "2zr2BwQv", + "y23QsW36", + "kxhVGVDs", + "KoZnsupE", + "kgayECQj", + "GXTOaPN2", + "DPSxBjhC", + "9RSLnVWG", + "iiAhhSXr", + "5Hjtrmx2", + "2or8Ofsc", + "iPjm4OR6", + "6fPfrRRM", + "bBozWUuG", + "IQgI9Q8E", + "h5bwPb8z", + "rdOvNB5E", + "kp8RtRlH", + "bisqMCcw", + "MnX2asnu", + "aATPYuSP", + "iHhVbHGr", + "ZLa4mG3m", + "xLHSv68T", + "TOuxxDSX", + "WEqCOjEG", + "HyQeCLYh", + "oFMvtq6s", + "OnRuqswg", + "KoeIWCLo", + "o5CENL5U", + "BxUNyM6e", + "6Vkm7PBq", + "uAOWWjEf", + "cHETMWRV", + "jWcCX6VG", + "umi84cDH", + "XvKyvHGh", + "Pg4mUaLB", + "khdw65s0", + "gKjwDQwP", + "FTDkcXHj", + "47jOIURX", + "WvTInnK6", + "sP4zQZvt", + "uc3itGbq", + "Prp2ghdq", + "D955PVMZ", + "I3kUInC7", + "eCVIIjgH", + "jgFEqJsC", + "IXQDNFpq", + "wLGBxUi5", + "ypvCDLGj", + "f5uxMrq6", + "gS1xoIK8", + "nHtyikTv", + "r5GmfR2B", + "HZGijdBf", + "UmvBU6WU", + "x1vPewGY", + "JkZC1vRl", + "Mwytd8Oi", + "UIZXn9t1", + "frFAJnA0", + "lK266Xsj", + "zDyJSB9T", + "KBMrxm4p", + "zXSAMxPd", + "dUDjdIUY", + "orgU7t7o", + "zInL7pan", + "uvJvu3RW", + "J42F6lSF", + "uSt0U5tr", + "JUrcT3mB", + "uRmLV7ei", + "ZuACMxXe", + "ZcBkpw48", + "JfehuZSZ", + "D8aX13PN", + "ioaGrnLp", + "h51RyRDp", + "uGwMLI1L", + "S2eewR7G", + "eiAKrYCb", + "XrWpRBXK", + "jUz9FZWv", + "XAPoRKNc", + "CWZa347n", + "tyIMeF8u", + "AHFEZvpc", + "VM7o66ZU", + "7FySgvMU", + "38fBs1f4", + "vspLgm88", + "VmOMUGVV", + "8Bzc8pzj", + "vM7C4Q44", + "r1Jr79TB", + "oz82VCKL", + "yissIn11", + "KSEokAPj", + "KfPEtgDQ", + "mPCz8bJc", + "QbGAFZOd", + "u7rKquVn", + "OPYvFMaQ", + "mxBQ9USR", + "ot113WbU", + "QqaG3SkF", + "uAwR9mXZ", + "Q02QgUrh", + "Pq4BryXi", + "usUl2PuZ", + "XfjibOud", + "8j9LbbG6", + "lobOF2Co", + "qPMJhe0Z", + "wkSFm3sD", + "4FcXhbLt", + "oKaysNua", + "hlrYuUAK", + "iFdDA24X", + "X9kYrbTz", + "OweKhEn8", + "mY3Z2Msn", + "vagJCI1t", + "XpuBzY4s", + "xQXin842", + "dQ2J2DNs", + "yfzyvKpD", + "Y6XblnxV", + "SQu0Wnb5", + "znA89K3R", + "Zp7Z3A16", + "PMMm7oJh", + "sAtyuZsQ", + "YvmwYkFI", + "aOwCJXXs", + "nh3KchrY", + "a7ogvvTj", + "JiDUyMfN", + "DVi8Wb1g", + "nb6ZG8cD", + "s3Ycl6Q5", + "LZEbiSAJ", + "8bEdRIje", + "t2oGLMA6", + "qynEpc10", + "sMaJdhbp", + "iJGzlGmV", + "XO54pIn3", + "nRGtl8ha", + "sMOKuZ0o", + "QLZNrhk0", + "RSR1BGWY", + "Nd6EdpNO", + "2LYezoR3", + "L1ixqebl", + "OLJzZocz", + "BtDqa4I8", + "JMZ3mdRY", + "h3ikDB9V", + "X7yGA3ZU", + "q2r3wWGU", + "rxajGcV9", + "35suitDH", + "rA1qQnC8", + "eTqi6eag", + "TO5GUnvu", + "f7jkBzqI", + "c7f2xtIj", + "wFEQaxMo", + "utm9BBk2", + "Cp48QNEI", + "g3KlnCd2", + "8wIVfL9P", + "ujeJHiuo", + "WmBNXYnX", + "JGwP44yc", + "WGY45q5A", + "MOKxy1WN", + "cdUM3aLp", + "2ZlQEy8r", + "QPwrIVfb", + "HVKJsPzM", + "rpCWJp42", + "SedsQqU0", + "kYrthfxq", + "yIlygZ3X", + "LVq43hgL", + "vGCghyJi", + "jOtxgKkl", + "EkBqxUvT", + "F8IqiMOG", + "5IxGbiOj", + "2OsfFUxE", + "IAQgAXEo", + "HJxqFti2", + "CDJzqTJQ", + "T4BzBnjj", + "Lr4jqDB3", + "KmorrHB7", + "MiIpiJbg", + "kzh4GOKq", + "q8Tj7jCI", + "x9fxdwQv", + "Wnv1betL", + "Cnn88Z3d", + "2oxP3qwB", + "mdZNQdkM", + "eyKonDQM", + "GFiWrpXu", + "Pp99iZBr", + "jHaKLEMs", + "BbEqHLd9", + "zpPuPNS5", + "Gx6Lxqkk", + "2ZXzKX8F", + "4X44SFHc", + "XD3HzrFL", + "r1spogCU", + "EK6FNoOZ", + "nGceI3sp", + "82pcpBwc", + "fZbsx3jy", + "51yQsw05", + "fnX7Fbue", + "qpV51WPa", + "rTXv2g3l", + "oxhc0c60", + "tuhA7vS8", + "9Ifdnjok", + "xvgoCmcq", + "tzJHvdCn", + "CvCjTxoc", + "pTxyIOw7", + "VJOPVMTO", + "QLK3GRsO", + "P8hovGnG", + "ZZXU4Qyg", + "rcfbQ8Rz", + "dPB856xz", + "G7ZtVNLI", + "p8sWYAFy", + "kCHaZlmI", + "huwWeIMT", + "WL98pBMl", + "nUBzAUl1", + "VDIEpDkL", + "sz557DLn", + "jn3MCW9T", + "7Ip2qTeD", + "T4LB6mbZ", + "vYzSW9GW", + "Ehrd5GzI", + "CtCut7QK", + "md2kvg6Y", + "VfTB4suB", + "nrjtk8PL", + "ctcdKHDs", + "Yb76cbAm", + "sQ7TDuuW", + "7QSDmYgD", + "8NclKFXx", + "CwiRxQZ4", + "wOMCVWVV", + "Q0UgFtjk", + "41xy5Jiz", + "9MtmMZEq", + "V7aX1FvN", + "sXhIqjtU", + "hTzq6x8F", + "vQBF1jUH", + "80UZy4EH", + "WB36Vtjp", + "dqsZXUnn", + "YCXlXq2p", + "OwdUP4tl", + "rFOFJfAw", + "PZ1GyKFf", + "LsJCpUUp", + "Lajy7nsX", + "f4sp18cT", + "7mTOCmpN", + "WMOXiQEQ", + "2fiP2F6Y", + "9rSzdfVU", + "2NkQwo4n", + "OXxPenMj", + "48VA9BL7", + "1PubX5bw", + "qNZoGxBb", + "wuHNEwyl", + "Q1ZvkANQ", + "CxKN2fQs", + "C1ubUYPD", + "9I7LIDgL", + "FXQp3nTT", + "DZRf1WBc", + "3xVYsX8K", + "bLTpuwCf", + "OVgX5RKL", + "rdDwZNt3", + "XYqLKB23", + "QyzNVRX7", + "YRNxPwD6", + "4YGiQ3q7", + "arwEQxdU", + "XKp0Egsi", + "f2pZxihV", + "kVDwIDaH", + "2ce2kmMb", + "Bx6REaWI", + "p75mhqQU", + "WE4WwvaO", + "zfjkEVvq", + "R2fVuIoD", + "wmXwpZ1F", + "gTtHakxy", + "blva78z9", + "35xesEij", + "fXiD3U4K", + "YTvyV0uh", + "CTsTZY4N", + "wvnuFaBl", + "PiiCjCEr", + "aiI5iPUK", + "lkiROS5B", + "ZXhg153o", + "aUuvK0aI", + "ttBk7rrh", + "Z7A2hLbK", + "CeqgfxqR", + "9W0xEKVz", + "dTs06wSY", + "fF0WbBgp", + "q7wohWlj", + "Lkk1PwCJ", + "rhLCkSPK", + "s3NmSTtg", + "3ejNKhOY", + "Kpy1vCQN", + "bgoRuRLH", + "AxjnaG0p", + "CFZLLKJY", + "Xv2c5UZa", + "F4eMTEoU", + "8hLfZeoJ", + "rUNzlQt3", + "jBgHMdOs", + "M7IK2SvC", + "drZ5EQkl", + "8j3RyR1n", + "WvPmSPnl", + "N5eBZkUY", + "U0xFUWTm", + "n4elNcgO", + "Ewia4uMe", + "qbPQm4v5", + "RyGNCHJ8", + "QnvitWtd", + "vD8xzaBS", + "HKbXOvmm", + "CvqzkHmh", + "YsiCzw5N", + "DrFbki79", + "ms0eV3NK", + "WK90b62n", + "vdp6NIe5", + "hONndIDH", + "3cqEYQVu", + "AvS1QJcJ", + "TdAVRDJJ", + "qiszaidz", + "iAgX8BlW", + "yGdXF0OW", + "r5ZSnzgf", + "hOOSr9CL", + "nrb0omLQ", + "9wxRNrsJ", + "H435e2Jp", + "DhQjSwFC", + "B2ZxYthd", + "r7e564VW", + "s6lYIXcO", + "GUR7Bc33", + "BOrjh7NT", + "EDnAL3GM", + "gsBESB0u", + "dYmDUJKp", + "oZJhu2w0", + "XxjQdVtd", + "Dl1VcZ05", + "jy7acfBX", + "NGhLpHtM", + "U6goTjdr", + "HThZIXJD", + "9VLgXa6O", + "DtsntVfB", + "nWBOFwMz", + "CUKg92Gx", + "R8RyV7A3", + "zf6Umad8", + "gEYXa8hg", + "FifT51Cd", + "7xx2JulD", + "oGND6aOw", + "zwnfweMB", + "2EaifQSs", + "XQFDPd0H", + "wupyLayA", + "5cOCOOqG", + "JCHhDjUi", + "B23zGLmw", + "U336NsLE", + "kc2ZXmyO", + "Q3ovdtAk", + "v8xIDPCb", + "dhQH5nEk", + "hBBJOu8y", + "lCbsEisc", + "Heqhryey", + "3hmRkXML", + "icTN3dw7", + "chucfyEL", + "qZTABTbH", + "e2W2al2G", + "EGmsMnGA", + "QSQL7g8z", + "AXvT7f8U", + "gnr9gNF5", + "y7WprBdw", + "rmCoLAWJ", + "zADvXHkI", + "q4F75WzL", + "4n5aSzs2", + "dMbjPA57", + "H0CUO77x", + "Qyqo4QGo", + "es78rsMC", + "XQgh3QKy", + "lXri0VHA", + "jynnxidg", + "PEOTH1Fg", + "je8CoE57", + "bqDashYU", + "NJqdsame", + "iR3YuKHo", + "BXErBPYA", + "68uky9qO", + "cjLkyBRV", + "thqT6S1c", + "nMnkv4TP", + "xQsu0k81", + "524kW3B1", + "H0bBBgCq", + "e04nS5Qz", + "14jCadXv", + "QVSN1zyp", + "4jlHn8n5", + "Rd9uvDER", + "fhl5Nena", + "eKplGya6", + "neXn3WnE", + "dfM3PsPw", + "wCybaJAv", + "DkFWMnTm", + "3DlfbtC3", + "2UNh1TzC", + "eKBZCDKz", + "pJRdoaX9", + "xZFtCXyK", + "9dSrSBES", + "qTSx4wjT", + "EmZVILiw", + "WPgbgO4Y", + "eKSDC3Tw", + "A0myxpQk", + "hp4dAYge", + "YRNUGQUo", + "IQuSRpRK", + "akzMlJ1h", + "nBaghNgP", + "fiQ4UUgz", + "cg2izahU", + "oXPscIBz", + "D6flU7di", + "K8xllwLN", + "l9zPpp3H", + "SW95br7b", + "nOJrmHpO", + "JGvJHtXk", + "m73ZTirr", + "4AHJHiOi", + "AyVUPPCX", + "odBZWFNd", + "GRaDSWvU", + "Ce7T2B4h", + "NAORpT2X", + "oRdsUSH7", + "95BK1U8I", + "9yRemfrE", + "SSHueDQM", + "cgbvyJgZ", + "NkALd5g8", + "mRLR0K2m", + "we4G0PZP", + "uzub91e7", + "A5EQNUj8", + "4npPud2F", + "AgFc9KMY", + "DFizldGg", + "l0EeoUSL", + "CQf1xDB1", + "RpnFbuLC", + "VcVtx0Zu", + "duzEBBjP", + "AOsOehCE", + "cuPvzHk4", + "ZI0hHcIx", + "SHmPKpmW", + "NCUYHH45", + "lZi2MZ3o", + "ciBGLj4L", + "TxBlUTbc", + "SvnPXNSs", + "dbJk54PE", + "C81tqgRp", + "RVR1dzLJ", + "ntLk15DJ", + "YpHR8Xbt", + "FUgSgJTB", + "guE7a198", + "BlWmADfX", + "w0X8tWQC", + "ie9TZVHJ", + "ysN9tXTh", + "GoRD2PbW", + "9mtufI1Q", + "UR1n7xnZ", + "PLiJLLYH", + "JF7i7cZI", + "SA0kuZin", + "O2A8Xh0W", + "Nyr1632r", + "IfOG5PWR", + "awk3S8oa", + "gz0q5n5K", + "Uzm0OcpI", + "StSsmkP1", + "BQXliKIF", + "cMX51eeK", + "4XJGJXVk", + "xrQEQKt3", + "JGcfd0ok", + "wHVUSEVF", + "h0KlRFkj", + "aYL1ESLk", + "X9gxIrVq", + "nvbm2NJv", + "qooGjrgu", + "UlyHGYWh", + "FPSiafzt", + "9DxCx2UX", + "kIhlKlNw", + "cdjzEyO6", + "CCbG02Ly", + "5fygYn1M", + "s4Mh0iUs", + "COYWChTc", + "QhFe5DRM", + "1jJkMsOr", + "MGIytRSu", + "ro20YGPE", + "1SbqxpNA", + "lTjgsvYJ", + "2RQpgqSA", + "fSS9w2vE", + "jgm6A1xT", + "VzkmodJN", + "ZSuzkriv", + "OIOFhV0j", + "7NLwPXC2", + "trzzvCft", + "xJJ9oYoD", + "W1S51qRo", + "YpSWUGoA", + "8yjFN7zt", + "C2VYJasz", + "RsqyNiSR", + "OWukRhA4", + "SSk6KqP7", + "XXNynOUr", + "L88Dbslt", + "UyV7YRVS", + "lRlesOMQ", + "G3XXt0Fx", + "jLa2yiRW", + "f23PmNhW", + "m7xXw2nv", + "HPp8FNWp", + "FybfvkVQ", + "YCkayLXA", + "BiZ9ejRE", + "I4JIbqEZ", + "z7OXdfpa", + "BYmLbLxl", + "mjtFDfWA", + "GxJolx3X", + "TK1NsUct", + "JUjalqEE", + "RfRez3bK", + "yb1rtk9P", + "68izPAqu", + "9CqJCuZ6", + "kUObPPK2", + "Q9wFEXgQ", + "lZkOuATd", + "cM3eDw1o", + "svvcJhgC", + "nS19YToN" + ], + "icon_url": "https://cdn.modrinth.com/data/9eGKb6K1/icon.png", + "issues_url": "https://github.com/henkelmax/simple-voice-chat/issues", + "source_url": "https://github.com/henkelmax/simple-voice-chat", + "wiki_url": "https://modrepo.de/minecraft/voicechat/wiki", + "discord_url": "https://discord.gg/4dH2zwTmyX", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/9eGKb6K1/images/124a01aed1e2ed70d85e3da3c3d8ad0aee3be261.png", + "featured": false, + "title": "Group menu", + "description": null, + "created": "2022-12-23T19:34:18.314489Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/9eGKb6K1/images/975131df603729941d6549a8e78fed1509bf0518.png", + "featured": true, + "title": null, + "description": null, + "created": "2023-01-12T13:22:17.934010Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/9eGKb6K1/images/b67e87100eb56b0095efdb80a14e43a7cce812da.png", + "featured": false, + "title": "Voice chat menu", + "description": null, + "created": "2022-12-23T19:34:14.856490Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/9eGKb6K1/images/d29a64a23694cd2346aabb94bea25245b7198553.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-01-12T13:24:04.701172Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/9eGKb6K1/images/defc06cc89b331d8282e9b5b51a693ede242cf40.png", + "featured": false, + "title": "Voice chat settings", + "description": null, + "created": "2022-12-23T19:34:19.508592Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/9eGKb6K1/images/e67d331d676f1bb04103c4c11dbc1a1d084f07d3.png", + "featured": false, + "title": "Creating a group", + "description": null, + "created": "2022-12-23T19:34:16.887291Z", + "ordering": 0 + } + ], + "color": 2368556, + "thread_id": "9eGKb6K1", + "monetization_status": "monetized" + }, + "VR-Combat_v1.0.2_Fabric_ALL": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1" + ], + "id": "XpGUobxt", + "slug": "vr-combat", + "project_type": "mod", + "team": "pLHcHuuv", + "organization": null, + "title": "VR Combat", + "description": "Compatibility between Vivecraft and Better Combat.", + "body": "![](https://cdn.discordapp.com/attachments/977751810922131456/1133436566744858644/vr_combat.png)\n\u00a0\n# ABOUT\nVR Combat adds compatibility between Vivecraft and Better Combat.\nAllowing VR & Non-VR players to play along without issues, by overriding the combat just for VR users.\n\n\nRequires Vivecraft and Better Combat", + "body_url": null, + "published": "2023-07-25T17:19:49.915909Z", + "updated": "2023-08-28T02:42:28.658826Z", + "approved": "2023-07-28T03:34:39.779520Z", + "queued": "2023-07-25T17:30:55.076052Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 204427, + "followers": 28, + "categories": [ + "game-mechanics", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "XhLbU83w", + "SNVHmbYk", + "mW4eHntZ" + ], + "icon_url": "https://cdn.modrinth.com/data/XpGUobxt/fe10f91e11cc6df49488739d849375358602ec90.png", + "issues_url": "https://github.com/nvb-uy/VRCombat/issues", + "source_url": "https://github.com/nvb-uy/VRCombat", + "wiki_url": null, + "discord_url": "https://discord.gg/lunapixel", + "donation_urls": [], + "gallery": [], + "color": 14382049, + "thread_id": "XpGUobxt", + "monetization_status": "monetized" + }, + "vrapi-3.0.9-1.20.1-fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.18.2", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20.1", + "1.20.2", + "1.20.4" + ], + "id": "B3INNxum", + "slug": "mc-vr-api", + "project_type": "mod", + "team": "xBZbUet5", + "organization": null, + "title": "MC VR API", + "description": "An API/Library mod that allows mods to inter-operate with Vivecraft.", + "body": "The MC VR API is an API/Library mod that allows mods to inter-operate with Vivecraft!\n\n\u00a0\n\n**NOTE**:\u00a0This mod does not turn Minecraft into a VR game on its own! You'll need\u00a0Vivecraft\u00a0to do that! This mod allows other mods to \"talk\" with Vivecraft instead!\n\n\u00a0\n\nFeel free to use this in any modpack you would like, as long as you aren't charging any money for it!\n\n\u00a0\n\nPlease do not redistribute this mod! If you would like someone to download it, please either link them here, or to the GitHub page for the mod.\n\n\u00a0\n\n**This mod requires Architectury\u00a0unless you're playing on a 1.16 version of MInecraft!**\n\n\u00a0\n\nLogo is a re-colored and re-arranged version of \"Gears vector clip art\" by OpenClipart.\n\n\u00a0", + "body_url": null, + "published": "2023-04-30T21:21:16.111386Z", + "updated": "2024-05-21T01:03:05.459628Z", + "approved": "2023-05-02T21:25:45.211801Z", + "queued": "2023-04-30T21:38:22.319366Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 56384, + "followers": 29, + "categories": [ + "library" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "RqKnRbhz", + "FsH6qQbo", + "nxD1xiYB", + "QxBKxNdH", + "xEuC9zeh", + "6KSx8LQK", + "zKG34Fbt", + "EPjZygaq", + "MeWvYRDd", + "sMaXoufk", + "oe8DuR94", + "weGt7fbj", + "uPPyiYTK", + "SZlRBHlg", + "9WKH6kME", + "UEs0CszN", + "Z7l3Tojw", + "2vIPQ9cD", + "nMSCrI3f", + "k9sRUbuw", + "jLJowr46", + "spSRHXBZ", + "UMiaNIqj", + "tIQlG47E", + "8JyxQgy9", + "RX8bVxEn", + "MSCbq9L6", + "URJnCEgV", + "W4uLdUQA", + "NPESFprJ", + "Wq1oO4jn", + "wLxZYTdg", + "hzjjmsbW", + "zVuqJEsC", + "Upg0rwXp", + "aN1oAf2e", + "89xUak6B", + "v0XV7tmD", + "9wMajmIK", + "WiBcRIG7", + "6dn8qMdF", + "pPTWcMVk", + "Y2DQs2D7", + "kDQURGlV", + "uIlafJxf", + "BJAJrGLl", + "qSBQxAQH", + "bhtA8fuy", + "5LkAUfkF", + "zz9t1BMy", + "qNaZ3ZRZ", + "PkuD8BZa", + "OnV5M4lI", + "kDYyxUZz", + "zthsw2y6", + "W8HuC7NX", + "ZbSVzKfI", + "stkP58Z1", + "iKGwIjHq", + "NX6XcTWs", + "EMaD7DRT", + "8LEFQDhr", + "3UEAC4Gs", + "WaiZCNjb", + "4Y5yE73O", + "DVtmHRV9", + "WHfbqxYm", + "9amOQTo4", + "pK1CM8eh", + "nw52nsmx", + "re2emX7E", + "nUw6G1jX", + "CNsOnqC2", + "eFT4vQFT", + "HR0Qm1KG", + "4tJF8iTk", + "IRq9ZGqJ", + "3Fu0aMZA", + "1Pnh6YJh", + "CGTxLwx8", + "CnkUVz73", + "vmyYBx1j", + "hs6pTuNk" + ], + "icon_url": "https://cdn.modrinth.com/data/B3INNxum/bb8d6b0014f28d5730e37a0564e6ee9655940f54.png", + "issues_url": "https://github.com/hammy275/mc-vr-api/issues", + "source_url": "https://github.com/hammy275/mc-vr-api", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": 310243, + "thread_id": "B3INNxum", + "monetization_status": "monetized" + }, + "Wabi-Sabi-Structures-2.0.0-1.20-Fabric": { + "client_side": "optional", + "server_side": "required", + "game_versions": [ + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "Vr3O6THr", + "slug": "wabi-sabi-structures", + "project_type": "mod", + "team": "lHiyh5fa", + "organization": null, + "title": "Wabi-Sabi Structures", + "description": "A collection of unique, quality structures based on the Japanese concept of \"Wabi-Sabi\"", + "body": "![Title card](https://cdn.modrinth.com/data/cached_images/8433f238c858868335300d337bbbbd08a7fba4c8.png)\n\n![Divider](https://cdn.modrinth.com/data/cached_images/db0cf71ed947892e256ab400a199c3bd9d13ac66.png)\n\n**Wabi-Sabi Structures** adds a plethora of new structures that generate throughout your Minecraft world, all designed with the Japanese philosophy of \"Wabi-Sabi\" in mind - embracing imperfection while still being aesthetically interesting.\n\nOur structures uniquely complement Minecraft's generation with little extra spices. Expect anything from patches of natural crops, to various cozy cabins, degraded stables, dangerous towers, ominous monoliths, underground eggs of mysterious creatures, and more. Our aim is to provide newfound excitement in exploring new terrain, in a way that allows each world, biome, and dimension to have enhanced variety.\n\n\n\n# Features\n\nCurrently, Wabi-Sabi Structures contains **over 70 new structures**, including several in the Nether and End. Variants, loot, and block randomization are present for many structures to increase variability in generation.\n\nIn addition, many of our structures utilize mechanics present in vanilla Minecraft in order to showcase these features to players or alleviate issues in the base game - a tower in the Forest that teaches lighting and extinguishing Campfires, factory ruins in the Nether with a Basalt generator, an orchard in the End featuring different Note Block instruments, to name just a few. The loot found in certain structures might also include items that cannot be obtained otherwise in survival Minecraft, but in a way that is not game-breaking.\n\n![Divider](https://cdn.modrinth.com/data/cached_images/db0cf71ed947892e256ab400a199c3bd9d13ac66.png)\n\n## Compatibility\n\nAs of the 1.1.1 update, Wabi-Sabi Structures supports the following biome mods:\n\n- [Terralith](https://modrinth.com/mod/terralith)\n- [Traverse](https://modrinth.com/mod/traverse)\n- [Terrestria](https://modrinth.com/mod/terrestria)\n- [Nyctophobia](https://modrinth.com/mod/nyctophobia)\n- [Incendium](https://modrinth.com/mod/incendium)\n- [Nullscape](https://modrinth.com/mod/nullscape)\n\nThe mod will work alongside other mods that add new biomes, but currently our new structures will not spawn in the modded biomes. We plan to add full support for more popular biome mods in the future.\n\n## Installation\n\n
\nFabric\n\n![Fabric logo](https://cdn.modrinth.com/data/cached_images/c41e753fa6df49fa9c28e392d365db2a3e24c33d.png)\n1. Download the [Fabric installer](https://fabricmc.net/use/installer/).\n2. Install a version of Fabric Loader compatible with the version of the mod you are using.\n3. Locate your .minecraft directory. If there is a \"mods\" folder inside open it, otherwise create one and open it.\n4. Download [Fabric API](https://modrinth.com/mod/fabric-api) and Wabi-Sabi Structures and place their .jar files inside the mods folder.\n5. Launch Minecraft with the newly created Fabric installation.\n\n
\n\n
\nForge\n\n![Forge logo small](https://cdn.modrinth.com/data/cached_images/b2de7ea98259126c71fe193892a89df271f7aa43.jpeg)\n1. Download and install a version of\u00a0[Forge](https://files.minecraftforge.net/net/minecraftforge/forge/)\u00a0compatible with the version of the mod you are using.\n2. Locate your .minecraft directory. If there is a \"mods\" folder inside open it, otherwise create one and open it.\n3. Download Wabi-Sabi Structures and place the .jar file inside the mods folder.\nLaunch Minecraft with the newly created Forge installation.\n\n
\n\n## Frequently Asked Questions\n
\nQ&A\n\n**Q**: When is the next update coming out???\n\n```A: We work at our own pace, so updates will come when we are ready! We don't give exact release dates until we are certain that the update will be released on a specific day.```\n\n**Q**: Will you port to version X.Y.Z??\n\n```A: We will attempt to port to newly released Minecraft versions that are compatible with the mod loaders we support. However, our schedules may not align exactly with the mod loader's releases, so be patient. We will not be backporting to older versions.```\n\n**Q**: Is the mod required on the client to join a server with it?\n\n```A: No! The mod can be installed on the server side and players can join the server without needing to install the mod themselves. You can even join other servers with the mod installed, without problems.```\n\n**Q**: Where can I report a bug?\n\n```A: You can report bugs on the Issues tracker on our GitHub. Alternatively, you can join our Discord and report bugs in the #support channel.```\n\n**Q**: I have a super awesome structure idea! Where can I put my suggestion?\n\n```A: We love suggestions, and we have a #suggestions channel on our Discord where you can put them! Note that we do not accept all suggestions and that we may take creative liberties to modify your idea if we do, but it is a huge help for inspiration!```\n\n**Q**: Can I put this in my modpack?\n\n```A: Yes, just make sure that the modpack is hosted on Modrinth or Curseforge and linked to this page.```\n\n**Q**: Can I make a video with this mod?\n\n```A: Absolutely, whether it's a mod showcase, let's play, etc. you are allowed. We would appreciate if you put a link to this page in the description. Let us know when you've uploaded your video and we may put it on the page!```\n\n**Q**: Can I upload this on another website?\n\n```A: If you do you give all bodily control of your Optic Nerves to Tonkis! (In case you are confused, the answer is no.)```\n
\n\n## Credits\n\n- **Wpgradford**: Project lead, Main builder, Pack scripter, Discord / X setup\n- **Wight of Shadows**: Main builder, Pack scripter / Mod compiler, Title card artist, GitHub / Modrinth setup\n- **Wilva**: Builder, Logo artist\n- **Nate Pinkston**: Composed music and helped with recording / editing for the trailers\n\nSpecial thanks to _mathgeniuszach_ for help with the Fabric mod\n\n![Divider](https://cdn.modrinth.com/data/cached_images/db0cf71ed947892e256ab400a199c3bd9d13ac66.png)\n\n### Check out our other projects!\n\n![Unwrecked Ships](https://cdn.modrinth.com/data/cached_images/222ee3a9b426b4cfaf8b967c0e02a730e5eb9294.png) [Unwrecked Ships](https://modrinth.com/datapack/unwrecked-ships)", + "body_url": null, + "published": "2024-04-19T04:49:28.530294Z", + "updated": "2024-06-13T21:42:44.640459Z", + "approved": "2024-04-21T05:43:56.583271Z", + "queued": "2024-04-19T07:25:54.675324Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-CC-BY-NC-SA-4.0", + "name": "", + "url": "https://creativecommons.org/licenses/by-nc-sa/4.0/legalcode" + }, + "downloads": 42328, + "followers": 43, + "categories": [ + "adventure", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "datapack", + "fabric", + "forge", + "quilt" + ], + "versions": [ + "tKcFhin5", + "2tNlaAHh", + "PSSSimgY", + "QaxpEa5y", + "tBQr7BBz", + "uquEmNAS", + "Jwtsd1uD", + "XKUi4W0q", + "ulYXQWPK", + "bmON7XyG", + "X0nL4vOk", + "k8WU3Bpj", + "HqEMDDCt", + "QwI47ngo" + ], + "icon_url": "https://cdn.modrinth.com/data/Vr3O6THr/ed3b1d8b3a08bf34fcaaa4c15657f5cfbc3643a7.png", + "issues_url": "https://github.com/WightofShadows/Wabi_Sabi_Structures/issues", + "source_url": "https://github.com/WightofShadows/Wabi_Sabi_Structures", + "wiki_url": "https://github.com/WightofShadows/Wabi_Sabi_Structures/wiki", + "discord_url": "https://discord.com/invite/xJZbkfPrxJ", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/Vr3O6THr/images/02745dbf5f940cf9c4fec0218ba0752992275174.png", + "featured": false, + "title": "Gallows", + "description": null, + "created": "2024-04-19T05:12:47.298155Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/Vr3O6THr/images/3b6a139340fae09b60d4c16324afc2d86f4647a7.png", + "featured": false, + "title": "Lumpy Tower", + "description": null, + "created": "2024-04-19T05:11:44.327331Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/Vr3O6THr/images/63647bf93c089560ad2f4e06707994712f73b8f1.png", + "featured": false, + "title": "Chorus Orchard", + "description": null, + "created": "2024-04-19T05:08:58.969937Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/Vr3O6THr/images/63d3885a4375fcdb6b11465d2935f1ccd9fe5437.png", + "featured": false, + "title": "Tree Cage", + "description": null, + "created": "2024-04-19T05:14:00.377356Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/Vr3O6THr/images/8262b2d890f7a6cd305d29c0b0b17412a1080eca.png", + "featured": false, + "title": "Basalt Factory Ruin", + "description": null, + "created": "2024-04-19T05:10:33.355402Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/Vr3O6THr/images/903e3f332dede871efafa479f1ab521b8c1fd977.png", + "featured": false, + "title": "Monster Egg Banquet", + "description": null, + "created": "2024-04-19T05:12:07.392981Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/Vr3O6THr/images/f93dfd4a2f76abad370aa9450620a91e053b9f51.png", + "featured": false, + "title": "River Boat", + "description": null, + "created": "2024-04-19T05:13:02.588524Z", + "ordering": 1 + }, + { + "url": "https://cdn.modrinth.com/data/Vr3O6THr/images/4e32ab693bcfab29dd66a1445b02731852c6d5e8.png", + "featured": false, + "title": "Wandering Trader Cart (Temperate)", + "description": null, + "created": "2024-04-19T05:07:37.185790Z", + "ordering": 2 + }, + { + "url": "https://cdn.modrinth.com/data/Vr3O6THr/images/68a7609258d0a76cddfcea4f31c0c49efbe8c0b1.png", + "featured": false, + "title": "Old Stable", + "description": null, + "created": "2024-04-19T05:06:43.379849Z", + "ordering": 2 + }, + { + "url": "https://cdn.modrinth.com/data/Vr3O6THr/images/9a40cb8e081348c7a4a92bfbc32524c61eb8daca.png", + "featured": false, + "title": "Infested Castle", + "description": null, + "created": "2024-04-19T05:05:47.949289Z", + "ordering": 2 + }, + { + "url": "https://cdn.modrinth.com/data/Vr3O6THr/images/a50831420ed5b7e95bd6a8bfdbaed9f085c8442f.png", + "featured": false, + "title": "Beetroot Patch", + "description": null, + "created": "2024-04-19T05:08:00.531615Z", + "ordering": 2 + }, + { + "url": "https://cdn.modrinth.com/data/Vr3O6THr/images/c5bc00407978fc3473088992b6aec56894999dde.png", + "featured": true, + "title": "Llama Sanctuary (Plateau)", + "description": ":O", + "created": "2024-04-19T05:05:18.489082Z", + "ordering": 2 + }, + { + "url": "https://cdn.modrinth.com/data/Vr3O6THr/images/884aa56d976eb3799cad742bb480132647129fa0.png", + "featured": false, + "title": "Effigy Patch (Forest)", + "description": null, + "created": "2024-04-19T05:11:27.674764Z", + "ordering": 3 + }, + { + "url": "https://cdn.modrinth.com/data/Vr3O6THr/images/aacd56c4c0ebb279be50ff07d938b6e72fef782e.png", + "featured": false, + "title": "Sphinx Hidey Hole (Sandy)", + "description": null, + "created": "2024-04-19T05:12:32.123377Z", + "ordering": 3 + }, + { + "url": "https://cdn.modrinth.com/data/Vr3O6THr/images/aaab333fb3e1fb4f443131241f1cf3975b400836.png", + "featured": false, + "title": "Marine Observation Hub", + "description": null, + "created": "2024-04-19T05:07:09.546202Z", + "ordering": 4 + }, + { + "url": "https://cdn.modrinth.com/data/Vr3O6THr/images/44acee31ce83c3ff0ae0db9bb7040d3801f10bc9.png", + "featured": false, + "title": "Totem Pole", + "description": null, + "created": "2024-04-19T05:11:00.202513Z", + "ordering": 5 + }, + { + "url": "https://cdn.modrinth.com/data/Vr3O6THr/images/4c484c4e3276ced57c9275013d7f33aa349094b4.png", + "featured": false, + "title": "Memorial of Tonkis", + "description": "Squidward", + "created": "2024-04-19T05:13:24.846160Z", + "ordering": 5 + }, + { + "url": "https://cdn.modrinth.com/data/Vr3O6THr/images/8511b82aa47868a34c3355bdf41495a991c8d3f3.png", + "featured": false, + "title": "Abandoned Small Castle", + "description": null, + "created": "2024-04-19T05:14:31.745700Z", + "ordering": 5 + } + ], + "color": 10249041, + "thread_id": "P6gnGxQK", + "monetization_status": "monetized" + }, + "walljump-1.20.1-1.2.1-fabric": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "oUoetxfR", + "slug": "wall-jump-txf", + "project_type": "mod", + "team": "gvfQkDbq", + "organization": null, + "title": "Wall-Jump TXF", + "description": "Wall jump, double jump, fence jump & more", + "body": "

Wall-Jump TXF mod

\n

\"CurseForge \"Modrinth

\n\nWall jump, double jump, fence jump & more\n\nThis mod adds:\n\nWall Cling: Jump towards a wall and hold the wall jump key (LSHIFT)\n\nWall Jump: While wall clinging, keep holding W and let go of LSHIFT to wall jump\n\nDouble Jump: Optional mid-air jump\n\nSpeed Boost: Boosts your speed while sprinting\n\nSteep Assist: Walk up steps even while airborne, also jump over fences\n\nFabric/Quilt dependencies:\n\n- Mod Menu mod (Optional)\n\n", + "body_url": null, + "published": "2023-09-02T04:01:28.285889Z", + "updated": "2024-08-09T17:16:59.544502Z", + "approved": "2023-09-05T19:30:36.990572Z", + "queued": "2023-09-02T04:28:09.382778Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "GPL-3.0-only", + "name": "GNU General Public License v3.0 only", + "url": null + }, + "downloads": 27891, + "followers": 47, + "categories": [ + "game-mechanics" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "h9ycsAAH", + "CgOhVbcz", + "BsM4a7pu", + "b0VWS7Nu", + "qYk1XECK", + "zvn4WTJl", + "qU3SWSKJ", + "nvIQs6TG", + "pwq6Fo4d", + "cZybp7Sf", + "1HOQgfn1", + "VJKS1Pwt", + "yFisW3zT", + "YcJ3N9ht", + "X184jdrK", + "I6on3m4w", + "BFnKzKba", + "alsHOQI4", + "PBd4M6Cy", + "XKCp697c", + "BJHkODJo", + "O7RNORJ5", + "WMTe1XHk", + "sszZWE9S", + "OPtGf3UT", + "3XpWSJF4", + "JnnfBy1q", + "DvBmZkhv", + "FkMdf43M", + "CVBa06hv", + "zMKBCONX", + "swZUT9DR", + "XSZclgLf", + "FhCQ6YaY", + "TEsqrB2b", + "U4ghNry5", + "2FkOUciy", + "s9HXNc3D", + "NzmPDfl3", + "NP9jE3Af", + "aSv7CW6V", + "hJojlTX8", + "5NnWfjEe", + "tyBSt7zv", + "Hkz7LthB", + "nJySr8ai", + "dDDCMvkH", + "80cTHtGl", + "oGl4hymS", + "UptsmZAX", + "numCVc6W", + "GxxgO1ZT", + "diNBukms", + "VoOugVRc", + "7a9JzVeK", + "df2W92j7", + "c6L82gQF", + "2PzQSCn8", + "kColIQE5", + "rV5xGaYG", + "qEyS2kv5", + "DRT8hsIv", + "6uJbltgN", + "1POKtqmQ", + "fEaTcFTd", + "jLj1gkkT", + "IPmQw7Go", + "7aQOPgio", + "1BqGsriT", + "wINq6KJ6", + "qosRKJih", + "RDdwUUTN", + "YGu2CBla", + "kk5mlwTr", + "YciSTq67", + "Z0VmJj1P", + "yOkgnEWQ", + "rTcifsOd", + "pUPTlEBD", + "M3jBQs8b", + "n1LjMi0k", + "fjKPzTRk", + "nfgs2twg", + "QY0Nxh4p", + "p9R9ZvnG", + "5BefdLYz", + "ftEeiCi8", + "mfqEh99X", + "LepIdIYl", + "ni29s83V", + "pDU2won9", + "EkgVT44n", + "lruvAZQb", + "yyR80CJs", + "dMZyXeGM", + "Ny0bHXoG", + "y5cJBDiR", + "pQSCzHue", + "qzrFrkDI", + "VzNeAXyT", + "oIqsgP7L", + "NYIHlnWo", + "qBCmtB2U", + "uL2noeYh", + "KY0XsPPK", + "xCmWdqxU", + "4raDNq4p", + "9aNRVuFa", + "KgVxkl2A", + "SiOgKcwD", + "9TmWgGzW", + "rZILUMSi", + "koDk2nHS", + "aEdJIm43", + "F2dy6mvs", + "PQSj4GII", + "Ac0rGkKN", + "Lwzxlzk3", + "8CKT4YzK", + "mke1mqJO", + "j7FwtQ3S", + "WCJHi7dc", + "3Rwjf8Ft" + ], + "icon_url": "https://cdn.modrinth.com/data/oUoetxfR/4b6b3d344aef426385cc3a3c19cd98bee8322ee8.png", + "issues_url": "https://github.com/jahirxtrap/walljump/issues", + "source_url": "https://github.com/jahirxtrap/walljump", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/oUoetxfR/images/ccab85538f124c14fc7b772ddaff7c4c4097593a.png", + "featured": true, + "title": "Wall Jump", + "description": null, + "created": "2023-09-02T04:24:27.248523Z", + "ordering": 0 + } + ], + "color": 15198183, + "thread_id": "5GbmFil2", + "monetization_status": "monetized" + }, + "way2wayfabric-0.0.6": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4" + ], + "id": "lO0vzQUy", + "slug": "way2wayfabric", + "project_type": "mod", + "team": "3OFF5lpU", + "organization": null, + "title": "way2wayfabric", + "description": "Waystone -> Xaero's Minimap Waypoint sync for fabric", + "body": "Since Xaero's Minimap doesn't have an official API,\nit's unlikely that the Waystones mod will support\nautomatic integration; so how do we get automatic\nwaypoints in Xaero's Minimap? Via a bridge mod like\nthis one. There are others for Forge (w2w and\nwaymaker), but none for Fabric, which is why I threw\nthis together.\n\n## Usage\n\nNo configuration needed! Once the mod is installed, it\nwill automatically create waypoints in your minimap\nfor all discovered waystones.\n\nIf you accidentally delete one or more auto-generated\nwaypoints, they will all reappear in the current\nwaypoint set when you disconnect and reconnect.\n\nFor those who use multiple waypoint sets:\n\n- Each newly discovered waystone is added to the\n currently active waypoint set.\n- If you use multiple waypoint sets, ensure the right\n one is active before you activate a waystone.\n- These waypoints can be moved to other waypoint sets\n after discovery, using the regular waypoint editing\n gui.\n\n## Requirements\n\nRequired mods:\n\n- [Xaero's Minimap](https://modrinth.com/mod/xaeros-minimap) (tested with 23.3.2)\n or [Xaero's Minimap fair-play](https://modrinth.com/mod/xaeros-minimap-fair)\n- [Fabric Language Kotlin](https://modrinth.com/mod/fabric-language-kotlin)\n\nSupported waystone mods:\n\n- [Waystones](https://modrinth.com/mod/waystones) (tested with 11.3.1)\n- [Fabric Waystones](https://modrinth.com/mod/fwaystones) (tested with 3.0.5)\n\nSupports both waystone mods simultaneously (each mod's\nwaypoints will have a unique minimap symbol)\n\n---\n\nInspired by:\n\n- [Waystones2Waypoints (curseforge)](https://www.curseforge.com/minecraft/mc-mods/waystones2waypoints) (Forge 1.16)\n- [Waystone Waypoint Maker](https://modrinth.com/mod/waymaker) (Forge 1.17+)\n\n", + "body_url": null, + "published": "2023-03-28T18:30:11.070054Z", + "updated": "2024-01-02T01:18:50.409242Z", + "approved": "2023-03-29T02:22:08.041364Z", + "queued": "2023-03-28T23:49:33.019710Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 237014, + "followers": 85, + "categories": [ + "library", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "y8Lg54zD", + "3hZwxDwY", + "VjYSnWNp", + "Ov9hKbmx", + "bgsdOTdR", + "IBsP5dyt" + ], + "icon_url": "https://cdn.modrinth.com/data/lO0vzQUy/6a2c749fc81979ce56a7a483391b527ed5e7fb76.png", + "issues_url": "https://github.com/lack/way2wayfabric/issues", + "source_url": "https://github.com/lack/way2wayfabric", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/lO0vzQUy/images/74aec4225f72f748f25d17417fdb24be7214829a.png", + "featured": false, + "title": "Waystone waypoints in Xaero's Minimap for fabric", + "description": "Waystones with automatically added Xaero waypoints in fabric! You can see a waystone near by, one in the distance, and the waypoints in the map... Yay!", + "created": "2023-03-28T23:46:44.684838Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/lO0vzQUy/images/88720d79fef66b887d9eecd0d89fac776be21079.png", + "featured": true, + "title": "v0.0.2", + "description": "Updated screenshot with the new waystone symbol in the minimap.", + "created": "2023-03-29T17:55:14.398612Z", + "ordering": 0 + } + ], + "color": 5464654, + "thread_id": "lO0vzQUy", + "monetization_status": "monetized" + }, + "When Dungeons Arise": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.16.5", + "1.17", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.21", + "1.21.1" + ], + "id": "8DfbfASn", + "slug": "when-dungeons-arise", + "project_type": "mod", + "team": "WWPHgngw", + "organization": null, + "title": "When Dungeons Arise", + "description": "Adds various elegant -and likely hostile- roguelike dungeons and structures that generate on your worlds!", + "body": "![enter image description here](https://i.postimg.cc/L5B71YXY/WDA0-Fabric.png)\n\n**When Dungeons Arise** is a massive dungeon generator which gathers plenty of dungeons and generates them randomly on your worlds to ensure glorious adventures and challenges. We have took a step away from standard vanilla structures, resulting in imposing dungeons to lose yourself into.\n\nHowever, be wary when you venture into a palace in search of precious loot, and don't forget to land safely after raiding a hostile airship. Dungeons will generate foes to keep you away from them... at least until you're ready to walk across countless, dangerous passages...\n\n___Currently generates 30+ unique structures.___\n\n**Requires both Cloth Config API and Fabric API (on Fabric versions)**\n\n## **Screenshots**\n\n![enter image description here](https://i.postimg.cc/7LkKgPFS/2021-08-05-22-47-36.png)![enter image description here](https://i.postimg.cc/VvP95ZwL/2021-07-20-19-50-37.png)![enter image description here](https://i.postimg.cc/bvxL5kWn/2021-07-07-04-17-46.png)![enter image description here](https://i.postimg.cc/qvxV0HHz/2021-07-11-17-10-09.png)![enter image description here](https://i.postimg.cc/zDbsvg1m/2021-07-11-17-13-41.png)\n\n\n", + "body_url": null, + "published": "2021-09-18T15:10:39.986884Z", + "updated": "2024-08-09T00:10:23.789181Z", + "approved": "2021-09-18T15:10:39.986884Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 989987, + "followers": 881, + "categories": [ + "adventure", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "88XWxvai", + "OGv8ukkd", + "eZNSKma4", + "xMeZujmc", + "isE2BUF0", + "QYXavI9s", + "ByhCzmMH", + "hdhQE5ld", + "Qtvjt3qS", + "jSukFXIg", + "TZo1nfwz", + "THcw6Yap", + "wtEUJaeq", + "uzVTTNfe", + "v9V9LIbE", + "tKxOjh70", + "5EJcAYwV", + "K99VHylj", + "SaXz7vvj", + "8URBsGlT", + "65GY9WAD", + "uFLIFUCI", + "hzihV1uA", + "GDuhbEYT", + "wiCQJUDT", + "Vd5XOXlj", + "4eH50FuY" + ], + "icon_url": "https://cdn.modrinth.com//data/8DfbfASn/icon.png", + "issues_url": null, + "source_url": null, + "wiki_url": null, + "discord_url": "https://discord.gg/lunapixel", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/8DfbfASn/images/135241bb799f37bc0c8c3fcce89e301d8481700c.png", + "featured": true, + "title": "Mechanical Nest", + "description": null, + "created": "2023-10-15T05:40:35.480905Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/8DfbfASn/images/4b0f2db6ccbc181fad6ade3e1d4bff043dc7807e.png", + "featured": false, + "title": "Mechanical Nest", + "description": null, + "created": "2023-10-15T05:42:16.605769Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/8DfbfASn/images/7f144957798934dd9b538cadf13fd91ce9da660a.png", + "featured": false, + "title": "Foundry Entrance", + "description": null, + "created": "2023-04-20T05:30:27.006217Z", + "ordering": 0 + } + ], + "color": 1249576, + "thread_id": "8DfbfASn", + "monetization_status": "monetized" + }, + "wizards-1.3.0+1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.19", + "1.19.1", + "1.19.2", + "1.20", + "1.20.1" + ], + "id": "NkGaQMDA", + "slug": "wizards", + "project_type": "mod", + "team": "bEgvyoJ8", + "organization": null, + "title": "Wizards (RPG Series)", + "description": "\ud83e\uddd9\ud83c\udffb\u200d\u2642\ufe0f Destroy your enemies with Arcane, Fire and Frost magic", + "body": "![](https://cdn.modrinth.com/data/NkGaQMDA/images/955cda4faf7fb077f095ed17905d95b07f24ed9c.png \"\")\n\n# \ud83e\uddd9\ud83c\udffb\u200d\u2642\ufe0f Destroy your enemies with Arcane, Fire and Frost magic\n\n[![Modloader](https://img.shields.io/badge/Loader-Fabric-ecebe6?labelColor=263768&style=for-the-badge)](https://fabricmc.net)\n[![Connector](https://img.shields.io/badge/Forge-via_Sinytra_Connector-orange?style=for-the-badge)](https://modrinth.com/mod/connector)\n[![Discord](https://img.shields.io/discord/973561601519149057.svg?label=&logo=discord&logoColor=ffffff&color=7389D8&labelColor=6A7EC2&style=for-the-badge)](https://discord.gg/KN9b3pjFTM)\n\n### \u2728 Discover more of the RPG Series\n\n[![Archers](https://cdn.modrinth.com/data/XIpMGI6r/images/cd19a95a79f1157b33f31818aa615a280b206912.png \"Archers\")](https://modrinth.com/mod/archers \"\")\n[![Paladins](https://cdn.modrinth.com/data/XIpMGI6r/images/3f19359bfd7521ba17bec818f125e87e09ef277e.png \"Paladins\")](https://modrinth.com/mod/paladins-and-priests \"\")\n[![Rogues](https://cdn.modrinth.com/data/XIpMGI6r/images/278d8c941af6dc763cf714b9f36f8b8366a60eb9.png \"Rogues\")](https://modrinth.com/mod/rogues-and-warriors \"\")\n[![Jewelry](https://cdn.modrinth.com/data/XIpMGI6r/images/747102d582732b8defa50a2c925c7d5a6f87d009.png \"Jewelry\")](https://modrinth.com/mod/jewelry \"\")\n\n# \ud83d\udce6 Installation\n\n### Required\n\n- [AzureLib Armor](https://modrinth.com/mod/azurelib-armor \"\")\n- [Runes](https://modrinth.com/mod/runes \"\")\n- [Spell Engine](https://modrinth.com/mod/spell-engine \"\")\n\n### Strongly recommended\n- [Better Combat](https://modrinth.com/mod/better-combat \"\") for first person animations\n- [Adaptive Tooltips](https://modrinth.com/mod/adaptive-tooltips \"\") for spell tooltips\n\n# \ud83e\uddd9\ud83c\udffb\u200d\u2642\ufe0f Features\n\n## Get started\n\nObtain magical weapons such as **Wands** and **Staves**, to shoot down your enemies. All of them have a basic attack spell.\n\n**Runes** serve as ammunition for casted spells (much like arrows for bows). [More information about crafting runes.](https://www.curseforge.com/minecraft/mc-mods/rune-crafting \"\")\n\n![](https://cdn.modrinth.com/data/NkGaQMDA/images/4ae79015e748a20d1b686fdd1f5654a105021507.png \"\")\n\n## Spell Books\n\nExpand your magical arsenal with Spell Books, hosting additional powerful spells.\n\nFind a Spell Binding Table in village [Gazebos](https://curseforge.com/minecraft/mc-mods/gazebos \"\"), or build your own (just don't forget bookshelves around the Spell Binding Table).\n\nUse it to create one of the **Wizard Spell Books**: Arcane Tome, Fire Tome, Frost Tome.\n\nEquip your spell book to use its content with a wand or staff.\n\n![](https://cdn.modrinth.com/data/NkGaQMDA/images/202e8f19c012668915f7cc4440e62e85d9d4ecb6.png \"\")\n\n## Magical equipment\n\nExplore new, craftable, various wizard robes, with different magical bonuses, to boost your spell damage.\n\nEquipment bonuses are configureable in `config/wizards/items.json`.\n\n![](https://cdn.modrinth.com/data/NkGaQMDA/images/bbb0595910fc54d6c4275c6a8a665830ccee38b2.png \"\")\n\n## Magical enchantments\n\nUnlock powerful enchantments for spell casting, for example:\n\n**Spell Infinity** to cast spells without Rune cost\n\n**Spell Power** to increase spell damage in general\n\n**Spell Haste** to increase spell casting speed\n\nDiscover even more in-game! Use [Enchantment Descriptions](https://modrinth.com/mod/enchantment-descriptions \"\")!\n\nEnchantments are configureable in `config/spell_power/enchantments.json`.\n\n![](https://cdn.modrinth.com/data/NkGaQMDA/images/692795588b8e74a99af0eeaafa655d60abe9e0a6.png \"\")\n\n## Extended dungeon loot\n\nFind magic equipment in dungeon loot chests!\n\nLoot table injections are configurable in `config/rpg_series/loot.json`.\n\n![](https://cdn.modrinth.com/data/NkGaQMDA/images/f03d0c07f3aaf28fdec416ae4cd567b006a04cfb.png \"\")\n\n## New village structures\n\nFind Wizard Towers in villages, where Wizard Merchant villagers sell magic equipment!\n\nThe spawn weight and limit are configureable in `config/wizards/villages.json`.\n\n![](https://cdn.modrinth.com/data/NkGaQMDA/images/8c032e4647000329b9b5a4270d5a23c3a2ba1e59.png \"\")\n\n# \ud83d\udd27 Configuration\n\nSpell casting mechanics and HUD can be configured under **Mod Menu / Spell Engine / Settings**.", + "body_url": null, + "published": "2023-01-12T15:43:13.857338Z", + "updated": "2024-07-24T21:44:13.730467Z", + "approved": "2023-01-17T19:36:18.957969Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 483860, + "followers": 597, + "categories": [ + "adventure", + "equipment", + "magic" + ], + "additional_categories": [ + "game-mechanics", + "worldgen" + ], + "loaders": [ + "fabric" + ], + "versions": [ + "FGiVQwIm", + "ro6BDYVf", + "oesEJob1", + "GJyu1hZI", + "py629JVd", + "ZUJ2f1CP", + "X3gIusnV", + "LpO6bTGZ", + "ZMr4ErRM", + "O2nhdZFf", + "6oPtnMZM", + "oxldoc7d", + "CE01pjnZ", + "1OWAbdJR", + "vdXkMTSU", + "Dln1uX6N", + "dSP812MG", + "q9ntmX5T", + "mWPYUhcL", + "hBnfelAX", + "IftBAnks", + "nsPh7ijG", + "Ltzv5JAH", + "vFBkqvEp", + "Jwz4XtL1", + "hO8TYUf6", + "TN07TW2k", + "CPqGQOCr", + "WMcQHozP", + "DJR0YHdi", + "9HCWJvum", + "2iD8SPHt", + "hMGphtUf" + ], + "icon_url": "https://cdn.modrinth.com/data/NkGaQMDA/affd534063e5388c759a9415988091e9804dce2a.png", + "issues_url": "https://github.com/ZsoltMolnarrr/Wizards/issues", + "source_url": "https://github.com/ZsoltMolnarrr/Wizards", + "wiki_url": null, + "discord_url": "https://discord.gg/KN9b3pjFTM", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/NkGaQMDA/images/202e8f19c012668915f7cc4440e62e85d9d4ecb6.png", + "featured": false, + "title": "Spell Books", + "description": null, + "created": "2024-04-04T09:31:02.895497Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/NkGaQMDA/images/4ae79015e748a20d1b686fdd1f5654a105021507.png", + "featured": false, + "title": "Wand creation", + "description": null, + "created": "2024-04-04T09:29:58.139556Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/NkGaQMDA/images/692795588b8e74a99af0eeaafa655d60abe9e0a6.png", + "featured": false, + "title": "Spell Power Enchantments", + "description": null, + "created": "2024-04-04T10:02:16.481226Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/NkGaQMDA/images/8c032e4647000329b9b5a4270d5a23c3a2ba1e59.png", + "featured": false, + "title": "Meet merchants", + "description": null, + "created": "2023-01-17T18:14:54.362653Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/NkGaQMDA/images/955cda4faf7fb077f095ed17905d95b07f24ed9c.png", + "featured": false, + "title": null, + "description": null, + "created": "2023-10-30T16:43:25.722211Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/NkGaQMDA/images/bbb0595910fc54d6c4275c6a8a665830ccee38b2.png", + "featured": false, + "title": "Crafting robes", + "description": null, + "created": "2023-01-18T18:43:48.405218Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/NkGaQMDA/images/f03d0c07f3aaf28fdec416ae4cd567b006a04cfb.png", + "featured": false, + "title": "Find loot", + "description": null, + "created": "2023-01-17T18:13:58.390372Z", + "ordering": 0 + } + ], + "color": 4488651, + "thread_id": "NkGaQMDA", + "monetization_status": "monetized" + }, + "wraith-waystones-3.3.2+mc1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.21" + ], + "id": "sTZr7NVo", + "slug": "fwaystones", + "project_type": "mod", + "team": "vZdByV5a", + "organization": null, + "title": "Wraith Waystones", + "description": "A better way of transport", + "body": "
\"A
\n\n

Adds a better way of transport.

\n

 For transferring pre-1.19 worlds to 1.19, please use version \"2.6.0 convert\".

\n

Accessing a Waystone marks it as \"discovered\", letting you teleport between other discovered (or global) waystones.

\n

\"Waystone

\n

If you place a waystone, or if you access a waystone without an owner, you become the \"owner\" of that waystone.

\n

Waystone owners can then change the name of the waystone and toggle its global visibility in the config interface, as well as re-claim all the items that get stored in the waystone when players teleport to it by shift-right-clicking the block. The option to take out items is disabled in the configs by default. Waystones also have the option to save all their data when broken (while sneaking), this option can also be toggled in the config file.

\n

 

\n

Waystones also spawn naturally in villages (one per village with default settings), this
includes the ones from Repurposed Structures.

\n

\"Village

\n

 

\n

\"\" Abyss Watcher 
Used for crafting the waystones, as well as teleporting to other waystones by right clicking it, consuming the item upon use.

\n

  
\"\" Empty Waystone Scroll 
 Used for storing all your discovered waystones in it. Using the filled waystone scroll will discover all the stored waystones to the player using it. There is also the Scroll of Infinite Knowledge, which is creative-only under normal circumstances and makes you discover all Waystones in a world when used.

\n

 

\n

\"\" Local Void
Right clicking on a waystone will bind it to that waystone. Right clicking anywhere else will teleport the player to the bound location, as long as it exists, free of charge (configurable), with the item disappearing on use (configurable). The item can be reset by shift-right clicking.

\n

 

\n

\"\" Pocket Wormhole
Similarly to the Abyss Watcher, it allows the players to open the teleportation interface from anywhere, except the item doesn't get destroyed on teleportation.
 

\n

 

\n

 

\n

 Void Totem
Just like the Local Void, the Void Totem can be bound to a Waystone. If you die with a bound one equipped, it will teleport you to the bound Waystone. Should it be unbound, it will choose a random one you have discovered. Otherwise, it simply acts like a normal Totem of Undying. 

\n

 

\n

 

\n

Crafting Recipes

\n

\n

\"\"

\n

 

\n

Cost type (item, health, xp, level, hunger, none), Cost Amount, Option to generate in villages, (on by default), as well as other settings can be found in the config which generates on launching the game with the mod for the first time inside of:

\n

{Minecraft install directory}/config/waystones/config.json

\n

 

\n

 

\n

Development Discord:

\n

", + "body_url": null, + "published": "2021-09-27T16:23:11.938525Z", + "updated": "2024-07-31T19:57:48.453239Z", + "approved": "2021-09-27T16:23:11.938525Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 732289, + "followers": 620, + "categories": [ + "adventure", + "magic", + "transportation" + ], + "additional_categories": [ + "utility", + "worldgen" + ], + "loaders": [ + "fabric" + ], + "versions": [ + "tDsYsu0B", + "mEfSprp6", + "hVOIPfus", + "yImWTjki", + "zFyqcit3", + "bO7lVDTY", + "YxqxZQTa", + "6jAinwnq", + "8ec15daB", + "SQTThMkF", + "7mG8zDqh", + "iFyo0sjK", + "FfIP51Fl", + "SkgCBIHN", + "xKWC5Po0", + "vTHlNQAW", + "WR8srhYy", + "L9dnBMRZ", + "nSGjaIru", + "a0iXGUV9", + "GPDjphA7", + "qN4yNsRz", + "QkFeyvMH", + "9BQHJGzs", + "7F9fsEmB", + "tJBTqc3E", + "qIwNTAsW", + "X8RYn5JW", + "thT8mzll", + "wNz9DqWv", + "CQteW8p2", + "By5S5qqr", + "XG7lkcVu", + "6qnJ50rN", + "oM5YWnHH", + "DZAntbmD", + "rSZrHkm9", + "gKHCwA66", + "Mjhs3Aqs" + ], + "icon_url": "https://cdn.modrinth.com/data/sTZr7NVo/icon.png", + "issues_url": "https://github.com/LordDeatHunter/FabricWaystones/issues", + "source_url": "https://github.com/LordDeatHunter/FabricWaystones/", + "wiki_url": "https://github.com/LordDeatHunter/FabricWaystones/wiki/", + "discord_url": "https://discord.ggvMjzgS4", + "donation_urls": [ + { + "id": "bmac", + "platform": "Bmac", + "url": "https://www.buymeacoffee.com/deathunter" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/sTZr7NVo/images/1854f501a6d520b50dc7a87a179e34cb7b3fc7d5.png", + "featured": true, + "title": "Village waystones", + "description": null, + "created": "2023-06-04T15:02:48.406841Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/sTZr7NVo/images/f436852038c435812a8f5acbb4c612f433f9a5ee.png", + "featured": false, + "title": "Waystone variants", + "description": null, + "created": "2023-06-04T15:02:05.253682Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/sTZr7NVo/images/fd591f931e9e17e9e882a8a9bce8d0921aabd3ee.png", + "featured": false, + "title": "Mossy & normal waystone variant", + "description": null, + "created": "2023-06-04T15:02:25.510582Z", + "ordering": 0 + } + ], + "color": 6248041, + "thread_id": "sTZr7NVo", + "monetization_status": "monetized" + }, + "XaerosWorldMap_1.38.8_Fabric_1.20": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.7.10", + "1.8.9", + "1.12.2", + "1.14.4", + "1.15.2", + "1.16.2", + "1.16.3", + "1.16.4", + "1.16.5", + "1.17", + "1.17.1", + "1.18.2", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20-rc1", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3-rc1", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "NcUtCpym", + "slug": "xaeros-world-map", + "project_type": "mod", + "team": "QWyiT27S", + "organization": null, + "title": "Xaero's World Map", + "description": "Adds a full screen world map which shows you what you have explored in the world. Works great together with Xaero's Minimap.", + "body": "

\n\n### Do not use XaeroPlus with this mod! It is not affiliated with me and causes critical untrackable bugs/crashes.\n\n

Xaero's World Map mod adds a self-writing fullscreen map to your Minecraft client. Works as a separate mod but is a lot better with Xaero's Minimap. The reason why it's available separately is to keep Xaero's Minimap as light-weight as possible. This mod is mostly client-sided. Installing it on the server side is optional for some additional features like world identification.

\n

The mod is still in development! Please report any bugs that you encounter or otherwise they probably won't get fixed. 

\n

Make sure your world is optimized (Singleplayer - Edit - Optimize World) for the Minecraft version you're playing (repeat after every Minecraft update). It takes A LOT longer to generate singleplayer maps from unoptimized world saves.

\n\n### Follow me on Mastodon (Twitter alternative)? mas.to/@xaero96\n\n### Support me on Patreon? patreon.com/xaero96\n\n

Thank you!

\n\n### Features\n\n
    \n
  • A self-writing world map (as opposed to manual paper maps). You can create multiple maps on the same server address and switch between them either manually or automatically.
  • \n
  • Works in Singleplayer, Multiplayer and on Realms.
  • \n
  • Intuitive interface. Open the map screen by pressing M. Move the map around with your mouse and zoom in/out using the mouse wheel, similar to Google Maps. All relevant controls are listed in a tooltip on the map screen and you can customize a lot of them.
  • \n
  • Optional automatic multiple world detection on servers.
  • \n
  • Displays chunk claims and ally players from the Open Parties and Claims mod. Lets you claim or forceload chunks directly from the map.
  • \n
  • Resource pack support. Changing the resource packs causes the whole world map to regenerate.
  • \n
  • Cave dimensions support (for example the Nether).
  • \n
  • Optional vanilla maps mode, which makes the world map look like the vanilla paper maps.
  • \n
  • Terrain shading customization.
  • \n
  • \"Footsteps\" that show you your most recent path taken.
  • \n
  • Settings that can help improve the performance of the mod when necessary. Although in most cases the mod should perform great by default.
  • \n
  • Xaero's Minimap integration. The minimap mod will display chunks provided by the world map. The world map mod will display waypoints from the Xaero's Minimap mod. Also works with the Better PVP mod. You can create, edit and teleport to the waypoints without leaving the map interface.
  • \n
  • Potion effects to control the usage of the world map for the players on your server/map. The following potion effects exist as of writing this: xaeroworldmap:no_world_map. The effects are of the neutral type by default, but you can also specify a harmful type by appending _harmful to the end of the effect ID, for example xaeroworldmap:no_world_map_harmful.
  • \n
  • Since version 1.14.0 of the mod, you can open an on-map waypoint menu by clicking the icon in the bottom right corner of the map screen. In the waypoint menu, you can see a list of all your map waypoints from the rendered sets, interact with them with the mouse cursor, filter them by name in a text field. The menu also lets you toggle the visibility of disabled waypoints, toggle rendering all sets and change the current waypoint set. Hovering over the waypoints in the menu also acts as hovering over them on the map: they are highlighted on the map and you can use the right-click or hover controls to interact with them.
  • \n
  • An option to export a map as a PNG image file. The mod tries to export the whole map, so it might not work, if the map is millions of blocks in length. I'm planning to give more options for exporting the map in the future!
  • \n
  • Option to limit your map access by binding it to an item required in your hotbar or to be equipped. For example, add mapItemId:minecraft:compass anywhere in the config file to bind it to the compass item. This way the map will not work unless you have the compass in your hotbar or equipped. 
  • \n
\n

Get Xaero's Minimap

\n\n## FAQ\n\n### How do I restore pre 1.30 update Nether maps in multiplayer to be displayed in the \"full\" cave mode type?\n\n

First, exit the server and locate the Minecraft game directory that you're using to play on the server. In the game directory, go into XaeroWorldMap/Multiplayer_[server_address]/DIM-1/[map_folder]. If such doesn't exist already, create a folder called \"caves\", without the quotation marks, and go into it. Inside the caves folder, create a folder called \"-2147483648\", without the quotation marks, if such doesn't exist already. Go back into the folder that contains the \"caves\" folder and move all \".zip\" files to the caves/-2147483648 folder. Feel free to delete the cache folders or also move them with the \".zip\" files.

\n\n### How do I set up cave mode to behave like it used to pre 1.30 before cave mode was introduced?\n\n

You can fully achieve this only when using the normal version of the minimap or no minimap at all. The fair-play version of the minimap now disables world map cave mode in the Nether and you can't toggle that, so it won't be exactly like it used to be.

\n

If you have Nether map data from before 1.30, please start by moving it in the correct folder as explained under \"How do I restore pre 1.30 update Nether maps in multiplayer to be displayed in the \"full\" cave mode type?\" on this page.
After you're done with that, join a world/server and open the world map settings. Locate \"Default Cave Mode Type\" and set it to OFF and then set \"Legible Cave Maps\" to ON. Next, open the world map screen and click the cave icon in the bottom left of the screen. In the menu that opens, set the \"Cave Mode Top Y\" to absolutely any number. If you are in the overworld, set the \"Cave Mode Type\" to OFF. When you are in the Nether later, set \"Cave Mode Type\" to Full. The cave mode type is stored per dimension, so you can set it to Full for any nether-like dimension and keep it on OFF for anything else. You can also switch between displaying below and above bedrock roof by toggling it.

\n\n### Why does right-click teleportation not work for me?\n\nThe mod sends a chat command to teleport you to specific coordinates, which is _/tp @s x y z_ by default, so appropriate permission is necessary. The vanilla /tp command requires OP status (cheats enabled) but it's possible to have separate permissions for commands on a non-vanilla server with certain plugins installed. The used command can be changed in the world map settings with \"Map Teleport Command\". Non-vanilla teleportation commands often don't support the selectors such as @s, so you might have to remove it from the configured command. There is also an option called \"Player Teleport Command\" which is used when you right click tracked players (e.g. your party from Open Parties and Claims). Teleportation to waypoints uses its own setting in the minimap mod. You can read about it on the minimap description page under FAQ.\n\n### How do I discover the map without manually walking?\n\n

In singleplayer, the map is loaded directly from the world save. This means that you can pregenerate the world using whatever tools you prefer, relog and use the \"Reload Regions\" option in the world map settings to fix any conflicts in the map cache. In multiplayer, it isn't as simple. However, if you can download the server world save and enter the world in singleplayer, then you can pregenerate the world using a method of your choice, relog and then use the \"Convert All Regions\" in the world map settings to convert the whole world save to a multiplayer-compatible map instance saved to XaeroWorldMap->World->null->cm$converted. You can copy/move that map instance folder to your server map instances in the XaeroWorldMap folder.

\n\n### Why are multiple worlds on the same server address/IP using and writing to the same map?\n\n

This mod lets you have multiple maps on the same server address. You can freely switch between maps and create new ones at any time. Map overwriting can be prevented by choosing the right \"Map Selection\" mode for the type of server that you are playing on. Map selection is done in a special menu by clicking the bottom left icon on the world map screen (if the menu isn't open by default). In the menu you can switch between Manual, World Spawn and Single modes and select/create maps by using the top-center dropdown menu. If you hover over the Map Selection option, you can read everything you need to know about each map selection mode, including Server mode. World Spawn mode is the equivalent of what was used by the world map pre 1.6. So you don't have to downgrade the mod to still use it. Server mode is the best option for most cases because the server automatically controls your map selection based on server-side level IDs. It requires the mod to be installed on the server side. If changing the map selection mode switches your map to an empty one, you can always rebind the map that you want to be used by selecting it from the dropdown menu and confirming. 

\n\n### Why does the world map ask for confirmation?\n\n

A single server address can have multiple overworlds, nethers etc. It can be due to multiple sub-servers or just multiple world saves, for example a \"Lobby\" world and a \"Game\" world. Different worlds don't have any unique identifiers on the client side, which makes it impossible to reliably differentiate between them. Because of this, the world map mod lets you have multiple world maps for each dimension on the same server address. In older mod versions, by default, map selection is Manual, which means that you are asked to confirm which map to use every time you switch dimensions/worlds/sub-servers. You can also choose one of the 2 automatic modes. Map selection is done in a special menu by clicking the bottom left icon on the world map screen (if the menu isn't open by default). In the menu you can switch between Manual, World Spawn and Single modes and select/create maps by using the top-center dropdown menu. If you hover over the Map Selection option, you can read everything you need to know about each map selection mode, including Server mode. World Spawn mode is the equivalent of what was used by the world map pre 1.6. So you don't have to downgrade the mod to still use it. Server mode is the best option for most cases because the server automatically controls your map selection based on server-side level IDs. It requires the mod to be installed on the server side. If changing the map selection mode switches your map to an empty one, you can always rebind the map that you want to be used by selecting it from the dropdown menu and confirming. 

\n\n### Why can't I see my minimap waypoints on a server after the installation of the world map?\n\n

Your currently confirmed map affects which waypoints sub-world in the minimap mod is considered automatic. This allows each created map to have separate waypoints data. At any point in time, you can select and view any non-automatic waypoints sub-world by going to the waypoints menu (press U) and selecting it from top-right dropdown menu. You can make any sub-world automatic for your currently confirmed map by selecting Options -> Make Sub-World Auto.

\n\n### Why has my world map \"reset\" for a specific server?\n\n

Do not panic. It's almost certainly not actually deleted. Old world map versions use a world spawn-based system to separate a server into multiple maps. This system often breaks because of servers adding custom functionality to the vanilla compass item by sending fake world spawn coordinates to your game client. Make sure you update the mod to the latest version. There are now multiple map selection modes you can choose between, Manual being the default one. You can now view any world map you have on the current server address. Click the bottom left icon on the world map to open the map selection menu, if it's not open by default. The top center dropdown menu allows you to select existing or create new world maps. You can hover over the map selection mode setting (bottom left) to read about how each mode works. Server mode is the best option for most cases because the server controls your map selection based on server-side level IDs. It requires the mod to be installed on the server side. Manual mode is the safest alternative and should work on every other server. There are also 2 additional automatic map selection modes when Server mode isn't an option. Read more about them in the tooltip of the setting.

\n

Old map is not in the map menu? This can mean 2 things: the server address has changed or the dimension IDs have changed.

\n

Let's start with the dimension ID change. Each dimension on the server has a separate directory in the game directory -> XaeroWorldMap directory. Please backup the XaeroWorldMap directory before you begin doing anything with it. In older mod versions, the dimension directory name contains the server address and the dimension key, for example XaeroWorldMap/Multiplayer_127.0.0.1_DIM1. In newer versions the dimension directory is a sub-directory, so something like XaeroWorldMap/Multiplayer_127.0.0.1/DIM1. For compatibility reasons, default overworld, nether and the end dimensions are named null, DIM-1 and DIM1. Other dimensions should have their name be based on the original dimension ID, for example Multiplayer_127.0.0.1/minecraft$overworld_creative. In 1.16+, you can see your current dimension ID on the F3 screen ingame to figure out which directory is meant for which dimension (for example \"minecraft:overworld\"). Please exit to the game title screen or close the game before editing files/directories.
Each dimension directory contains sub-directories, one for each map that you have in the dimension (for example mw$default or mw-4,0,-4) as well as a file named dimension_config.txt that contains the actual display names of the maps. You can use the file to help you find a specific map directory that you want. Moving/copying a map directory between dimension directories should move/copy it between dimensions. You can give it a name later ingame. The most common case would be something like moving a map from /null to /minecraft$overworld_survival. It is needed when a 1.16+ server starts using a unique dimension ID for each sub-world.

\n

For server address changes, you would first have to remove all directories inside game directory -> XaeroWorldMap that contain the new server address. There is usually only 1 such directory if you are using the latest mod version. Please backup the whole XaeroWorldMap directory before you do that. Also, exit the game at least to the title screen. Then you would have to rename each old server address directory (in XaeroWorldMap) to the new address, replacing ONLY the address part.

\n

Message me or leave a comment if you have questions!

\n

Here's the old explanation if you can't update the mod to 1.6.1 or newer:

\n
\n

Do not panic. It's almost certainly not actually deleted (this has never happened as far as I know). It's likely caused by a server plugin changing the behavior of the vanilla compass item and interfering with the mod's \"multiworld\" detection. In most such cases the compass item points to your bed instead of the global spawn point. Sleeping in the right bed again should bring everything back for you if sleeping in another one was the cause of the map \"resetting\".
If the map \"reset\" because of a new plugin being added (and if removing it is not an option for you), then here's how you can restore your map (and hope the plugin doesn't do it again):

\n

Make sure Minecraft is NOT RUNNING.

\n

1. Go to the game directory

\n

2. Go to the XaeroWorldMap directory

\n

3. Find directories that represent the dimensions you have visited on the server. These directories contain the address of the server in their name. The one that ends with _null is the overworld, _dim-1 is Nether etc.

\n

4. Open the overworld directory (_null).

\n

5. You should see multiple directories that start with mw.

\n

6. Find the one that is the biggest in file size. Copy the name of it somewhere so you don't lose it.

\n

7. Now find the newest mw directory (likely the emptiest or just check the creation date). Move this directory somewhere else. Don't delete it just yet.

\n

8. Rename the directory from step 6 to the name of the backed up directory from step 7.

\n

9. Open Minecraft and test if the overworld world map is back.

\n

10. If it's not, exit Minecraft and restore the old name of the directory that you have renamed + restore the backed up folder. Reread all the steps to make sure you're doing everything right.
If overworld is now fixed, proceed to step 11.

\n

11. Rename and backup the directories with the same names as overworld for every other dimension that you'd like to restore.

\n

Contact me if you have questions!

\n
\n\n### Why have my waypoints not restored after restoring the map?\n\n

Please read the \"Why are my waypoints no longer shown for a specific server?\" section on the minimap description page. It should cover most cases. Contact me, if it doesn't help.

\n\n### How do I prohibit the use of cave mode on my server?\n\n

To do that, please install the mod on the server side (requires a Forge/Fabric/Quilt server as of writing this). When you start your server, a new \"common\" config file will be created directly in the server directory (not the world folder). In the config file, you get multiple options that let you disable certain mod features for your players. Changes require a server restart.

\n

Alternatively, if you have the minimap installed, you can include the following strings in a server/system message sent to players (on login), which do the following:

\n

(requires minimap to work) §f§a§i§r§x§a§e§r§o - causes the minimap to disable cave mode (including world map) and entity radar (fair-play mode)

\n

§x§a§e§r§o§w§m§n§e§t§h§e§r§i§s§f§a§i§r - causes world map cave mode to work in the nether despite the minimap being fair-play

\n

§r§e§s§e§t§x§a§e§r§o - reset all the system message flags

\n\n### How do I let vanilla client players join my server that has the mod installed?\n\n

Look for a \"common\" config file directly in your server directory (not the world folder). In the config file, you get multiple options that let you disable certain mod features for your players. One of the options lets you disable the registration of status effects, which is what prevents players from joining. Changes require a server restart. Do the same for the minimap mod.

\n

You are allowed to make videos using this mod.

\n

Using it in your modpacks is allowed with the following conditions:

\n
    \n
  • Only monetization of the modpack through CurseForge or Modrinth is allowed (which includes sponsored links/banners in your modpack description), unless I have given you written permission to monetize it elsewhere. Feel free to private message me about it. I'm more likely to give you permission than not.
  • \n
  • If the modpack is distributed outside of CurseForge and Modrinth, then you must credit me by providing an easily accessible link to one of my official pages for the mod, to the users outside of CurseForge and Modrinth. 
  • \n
  • The name and/or description of the modpack must not be easily confused with the names/descriptions of my mods.
  • \n
  • If I have given you written permission to monetize the modpack outside of CurseForge and Modrinth, then, if I request you to, you must remove monetization outside of CurseForge and Modrinth. 
  • \n
", + "body_url": null, + "published": "2023-04-22T09:32:10.659737Z", + "updated": "2024-07-31T12:03:57.140585Z", + "approved": "2023-04-22T18:06:37.599573Z", + "queued": "2023-04-22T11:30:47.623643Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 5902203, + "followers": 3543, + "categories": [ + "adventure", + "transportation", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "sjR1qU6w", + "5uRQHkZl", + "WxlvhTaW", + "XVjzdnhG", + "rvZ5A3tX", + "8jDTpHjY", + "SEkYCdVo", + "XAQBPZpW", + "EDmj5NvH", + "wSGK3o4I", + "xTm3FQw4", + "gyPsXrJn", + "p3dZW7fr", + "zjxfdYdF", + "g3VW8AT2", + "PrBF6EyY", + "gkVIeUFw", + "tfnnfyhI", + "wVJY9O6J", + "j8XCNctd", + "WHjpeO1f", + "KK99goJD", + "eIXI4OHk", + "qYCKTHyZ", + "6YRIXrfW", + "iRRYeaXC", + "OWbYG8pN", + "vhY17uSv", + "Tfe1ecMx", + "Hwoxn6jb", + "YSvtDiDJ", + "F5Gr1zAz", + "UsAkUS2z", + "nTYOCaJr", + "GnQS252L", + "UWmPDmNV", + "9eIlzDjA", + "f4lwNpJy", + "jugM0Ovw", + "qPxvfkdp", + "JPclNzVu", + "tsUJqXDi", + "lobkeTkB", + "lSgnePcA", + "vaunHDVN", + "yTrargyD", + "4tuhFGgl", + "kIscoBGn", + "U63RC8MZ", + "pMIMCf1G", + "UuHzKSkv", + "maJOw1H4", + "zmckWzCk", + "tgCUTXi6", + "vhVUuszi", + "YuRNFnq7", + "IYdHD4ew", + "E41Rgx07", + "2CLZEyLl", + "JVLFrAlD", + "xrQzeBh0", + "AuVUfdfe", + "LKz8LFts", + "pt74IfTL", + "16lBdJRZ", + "tpVsp7bd", + "oOy5ndJf", + "S9UoAZsm", + "rCAbt1s2", + "uB3mOur8", + "S8ykUljl", + "7jQ7gDOY", + "yCMEGaHO", + "ulDBKKjw", + "owGOq3Vv", + "qSeRup3d", + "k2nQBeEG", + "ka6W06WC", + "ZmnidKjr", + "9YZGdfjd", + "L7CkxPe9", + "wFjQVyYW", + "dkhcYs7u", + "SgTgAga6", + "L388v7RA", + "KWRX7go3", + "tCkajzyq", + "jZqjpEV5", + "l7jJ8edR", + "3nAnz7eN", + "u81MmI6X", + "ZZRvmbyH", + "ikX4JmdG", + "mIAzcHM5", + "jSmDzqpB", + "tT8MXEmG", + "WGbmlzYS", + "J5hmblFo", + "QWYwBuvt", + "WiGXwduw", + "3fqf56PV", + "lKakfRVC", + "rIiXRyJC", + "KWSdBt0q", + "bkG41Vbj", + "yQ4ly7jG", + "st6Yi8FJ", + "TKPBR9FG", + "zWRFHFoD", + "8THHR0Ih", + "IbQ6bv6m", + "UmvLwPCn", + "hZzMR1av", + "5VvnuOEf", + "BEDFycdT", + "FKfWhnDZ", + "1CrVR9hT", + "JGA2cBTv", + "ZRTN6l4r", + "4uIcYzMT", + "X8DXecL3", + "lxyt26N7", + "F8rp5v60", + "svlAeqb1", + "DaJpdk7q", + "FX41W6zb", + "G0OJfwAN", + "m1xFZhrl", + "rdajsfZG", + "d44dMHzw", + "YdjlQoKs", + "RBZYvZJ4", + "zQO1LQVm", + "h3VxD6Wb", + "wgv5h06j", + "haB4dNPc", + "rxl7TQQN", + "VSR9iCm0", + "cHNqHQ7K", + "H401c3Kn", + "o5C0YrDg", + "vyF7iBYu", + "4qJUjLux", + "ky1LwLZC", + "nWD5LilR", + "UK6zITLD", + "GnVgI8Tc", + "x3Hz1Rw3", + "IO0epD4H", + "6fAtl7y7", + "VTlrn9zn", + "1sOYFhej", + "LYmDkdJa", + "9AvZZulC", + "9TpOEnGQ", + "RTD3td7Z", + "EbUwI0Ci", + "VigDSi15", + "MPK4lZDY", + "LRc3Y10v", + "hpfgHHVi", + "zf7etcWk", + "AY8nPexE", + "UsGIMJ2a", + "ya5ZYXkT", + "Ewl9bPOE", + "IcOoY3Fd", + "meEp9J6P", + "Gt36xu4p", + "4PJpJJKj", + "9MHP5TQr", + "FdU3tGYq", + "s3sEjbJu", + "oaiGf0Cu", + "cADC7mM3", + "yR1boAvN", + "sGllzk9n", + "KIkNJRts", + "MXSnuNhR", + "B7LODzZb", + "BwjsEkNB", + "meCK7hiK", + "LAQjDJ8V", + "qBDuRkrp", + "qwwKbodF", + "BiotZhgQ", + "d4huXt8W", + "fqMxbyZW", + "barq59Fe", + "X7q6wKAa", + "LhxmKjwV", + "jd9dVlUv", + "bXAJZFnX", + "zspa7tIH", + "L8dZ06qE", + "ZXboExuA", + "8T5rJSHX", + "brFplhUj", + "uUljlh4i", + "hGDx5zLv", + "sxZdfXgX", + "L8OA3xGI", + "KNjZUbV2", + "6SwHv13Z", + "uiSJusOM", + "VmrZJY6Y", + "1osfTlLs", + "6xmgf5vv", + "PRpy2It3", + "Cay35u2J", + "ltXk1K5K", + "StYfRS5U", + "dvJ1c1nB", + "3wGicfCz", + "TVqZB00s", + "Z4GCDEhd", + "HuhuMQWY", + "hs87cQxS", + "oTjgUXpl", + "xq92bHt9", + "Qdu4Ovks", + "IZjA414Z", + "oN97q1bh", + "lfPTckFu", + "QplwCTjy", + "aKH41jFn", + "kl5ajjgu", + "1hNBoopU", + "6QJf3buJ", + "uMnSnV0V", + "l3AnBhDH", + "x4c779Gp", + "nzTSf2JK", + "40ySYXm7", + "O4jmfApS", + "UqlV90K2", + "gwxBAfOC", + "lsh7rZ8c", + "s974wWCK", + "ieGewWWJ", + "IWg1Z5mJ", + "Iv9NE033", + "Ddl7ujqW", + "9bIsTbhi", + "Gt0oFz5j", + "JUuQgvs3", + "sa3FXIiF", + "JaxVlPsg", + "tvv1p8UB", + "zNVieoBv", + "85zESh2n", + "4VrpnEqL", + "MoJ7DlPb", + "pdz4XbYo", + "euUlUJpL", + "kDPMXqXY", + "gqWWu2WE", + "uL35xaJ6", + "5T11KDuL", + "upEWzPL7", + "L1Msjf2g", + "z6UXt0JA", + "hcqJ2uM8", + "d0SZkNdX", + "HVD97oSC", + "OnC2mDuc", + "87qG0mcP", + "yDfrbwvP", + "5IAIDmsq", + "1HegG6vB", + "uUqFPVSu", + "JTWdwJAT", + "FbRcjoyo", + "KzNPPRKZ", + "2OrOlxct", + "QZQIip0l", + "2xFoqT9G", + "8kyPSsV3", + "GjpvNeP5", + "4Vb09gB8", + "KS3vBQ5i", + "NPmEADqc", + "Psy5QyFF", + "GVhMC0jF", + "WcfeRtsW", + "fDOxFLoy", + "5I2xTj1b", + "EKlLbMF8", + "HAWkglLj", + "TiU9A6SF", + "QPu5GIcD", + "2DyPoOss", + "SEcAUikr", + "HuNUxJTs", + "F61FCdMV", + "AJD2gqOd", + "jZxGCO8l", + "ICOE9Jsf", + "mWKcgDr7", + "HZe0cLXw", + "g3LVdy2b", + "hRVLy1VO", + "MCZrzmFk", + "Ryqih9p9", + "77dzlHmz", + "CFdDfVmy", + "UXPdKH9b", + "Je9Rk4Cx", + "HQ3gb7de", + "j5uMM0Wj", + "3FwkAdEs", + "6OGNVOoZ", + "ePZhBAIZ", + "ExJndpW1", + "QfdogwsK", + "yvmI3XeP", + "npXTx5pr", + "ZjP3Pq4E", + "s8cocuZd", + "jJPQdz1d", + "WM0TXybx", + "IALYw1J1", + "U2fOYiyl", + "dOXO1ekR", + "PPNXdlNm", + "sldtuPfE", + "DuHuZP6A", + "CpzbT4d9", + "TlqcsW0P", + "IwNGlfAn", + "H8LUoNB8", + "ABCY32pi", + "7jiibugv", + "pJR2Fqwm", + "X5l3pEeo", + "NmoZgLkN", + "YEqpZsUQ", + "Uh6rOrCb", + "MGnsRoAP", + "iIHx8eFi", + "RR2qcEow", + "Q2LjAXwj", + "MtYKhP1z", + "BtByX33T", + "Kh1mGgGA", + "5srNwTQr", + "p3T8tHy4", + "1ikSvyiV", + "4PRqBjBF", + "iGtiHsDe", + "JPaMO5d0", + "cBiMvAnH", + "GtKdDJ5k", + "Nl5li4IQ", + "bmskYajG", + "RWQIMBFG", + "WRAhRsV0", + "q81YjdCr", + "XjvUIj7a", + "J3gWZ9Y7", + "O8WpvCPU", + "RtG1V19k", + "FfOlqaAa", + "e4KxqQmi", + "bNTafyGZ", + "Us1KN3KZ", + "EEi7fSTX", + "2lbtkEPK", + "IhXA8B6k", + "St8x5BIB", + "pFoenNHf", + "qI7epCX8", + "bgYKlna4", + "if8HUfC3", + "bQjVTElj", + "w2I1xBkt", + "HvnvVG2s", + "XAHaH8pE", + "U7wvj4vx", + "zkV9MzSO", + "1ZFOZLG2", + "VyOfCLta", + "vafIGO2B", + "RVSNzF7P", + "iKOa7p2o", + "dg8z2kP4", + "xoWyMT9q", + "TyOkVRGf", + "r6XMA06U", + "mTb5Uwa7", + "6SatxhGZ", + "n9H74LC6", + "x7A0grqn", + "AFdUAvnz", + "RsuHrSG8", + "cWnkuNpP", + "oE23WzAY", + "GOh0fFoJ", + "J9mEyGH5", + "XkNgPSrY", + "vtaHEcnA", + "Hr1YuotO", + "ExBGHO1W", + "ciwrnpWQ", + "evqhhzq1", + "Jm03NtYN", + "4fHhiA9l", + "aWXGiFVe", + "s7fGI5DL", + "3vzQ401W", + "M8lZ4YIm", + "fccjP3vg", + "I7KNlIg7", + "3gmYeL8R", + "BAn3pfXW", + "zpobQtXe", + "UjH1bY5n", + "bId5K1EM", + "3t3qLyne", + "szULGs3b", + "7GXAUIxr", + "AbWgvZZP", + "SMSdfLOQ", + "5b38pJEY", + "crPAx75v", + "jEhoJmNF", + "YQeKG80h", + "wz5E39j6", + "o7mEAkNb", + "RQgvSMA6", + "8BhyyEg5", + "ekubtdIk", + "lMUs7SBz" + ], + "icon_url": "https://cdn.modrinth.com/data/NcUtCpym/80eb00784e250b99fb1789da35869387d14d5637.png", + "issues_url": "https://curseforge.com/minecraft/mc-mods/xaeros-world-map/issues", + "source_url": null, + "wiki_url": null, + "discord_url": null, + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/xaero96" + } + ], + "gallery": [], + "color": 3359430, + "thread_id": "NcUtCpym", + "monetization_status": "monetized" + }, + "Xaeros_Minimap_24.2.0_Fabric_1.20": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.7.10", + "1.8.9", + "1.12.2", + "1.14.4", + "1.15.2", + "1.16.2", + "1.16.3", + "1.16.4", + "1.16.5", + "1.17", + "1.17.1", + "1.18.2", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20-rc1", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3-rc1", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21", + "1.21.1" + ], + "id": "1bokaNcj", + "slug": "xaeros-minimap", + "project_type": "mod", + "team": "9lteWJca", + "organization": null, + "title": "Xaero's Minimap", + "description": "Displays a map of the nearby world terrain, players, mobs, entities in the corner of your screen. Lets you create waypoints which help you find the locations you've marked.", + "body": "

\n\n### Do not use XaeroPlus with this mod! It is not affiliated with me and causes critical untrackable bugs/crashes.\n\n

Unlike many other minimap mods, Xaero's minimap keeps the aesthetic of vanilla Minecraft, which helps it be a more seamless addition to the game. It is also the first rotating square minimap for Minecraft. Among a wide variety of customization settings, there is an option for a circle-shaped minimap and a separate setting for locking the minimap's rotation (using a direction arrow instead). The minimap can display the surrounding entities, including players, mobs and items, as dots with a custom color or as icons (usually heads). In addition to the default compass directions, you can place your own waypoints that are visible both on the minimap and in the game world. Waypoints help you find previously visited locations or reach specific coordinates, with optional teleportation. The minimap can display the surrounding blocks above ground and below ground (cave mode). These are just some of the features of the mod while there are many more. Please read the \"Minimap features\" section below for a more complete list. For the purposes of following multiplayer server rules, there are 2 mod editions, full and fair-play, the latter being designed for fair PVP. This mod is mostly client-sided. Installing it on the server side is optional for some additional features like world identification.

\n\n### Follow me on Mastodon (Twitter alternative)? mas.to/@xaero96\n\n### Support me on Patreon?
 patreon.com/xaero96\n\n

Thank you!

\n\n### Features\n\n
    \n
  • Look of vanilla Minecraft.
  • \n
  • Multiple minimap size options including automatic. 
  • \n
  • Multiple zoom options.
  • \n
  • Two minimap shape options: square or circle.
  • \n
  • Runs smoother than a lot of minimap mods.
  • \n
  • Can be placed anywhere on the screen using the \"Change Position\" setting/screen. You can even shift it by 1 pixel if you so wish. Can be useful when playing with other UI mods.
  • \n
  • 2 block color modes: Vanilla, which uses the colors of vanilla Minecraft maps and Accurate, which uses the colors of block textures and biomes. You can also enable biome colors for the Vanilla mode using a separate setting.
  • \n
  • A custom key binding (Z by default) to temporarily enlarge the minimap to take a better look around. All key bindings are in the vanilla controls menu. There are also settings for controlling the behavior of the minimap when it is enlarged, for example to center the minimap on the screen or to fully zoom out the minimap.
  • \n
  • Map shading customization with the \"Terrain Depth\" and \"Terrain Slopes\" settings.
  • \n
  • Compatible with Xaero's World Map. By default uses the map textures generated by the world map mod instead of generating its own. This improves performance when using both mods.
  • \n
  • Option to limit your minimap access by binding it to an item required in your hotbar or to be equipped. For example, add minimapItemId:minecraft:compass anywhere in the config file to bind it to the compass item. This way the minimap will not be displayed unless you have the compass in your hotbar or equipped.
  • \n
  • Potion effects to control the usage of the minimap or some of its features for the players on your server/map. The following potion effects exist as of writing this: xaerominimap:no_minimap, xaerominimap:no_entity_radar, xaerominimap:no_waypoints, xaerominimap:no_cave_maps. The effects are of the neutral type by default, but you can also specify a harmful type by appending _harmful to the end of the effect ID, for example xaerominimap:no_entity_radar_harmful.
  • \n
  • Translated to a lot of languages.
  • \n
  • Option to lock north to stop the minimap from rotating and instead display the direction of your character with an arrow.
  • \n
  • Works both above and under ground thanks to the automatic cave mode. Cave mode should also activate inside buildings. You can choose the size of the \"solid roof\" above you that the mod searches for to activate cave mode. Roof size 3x3 and above should prevent cave mode activation when standing under log blocks while cutting wood.
  • \n
  • Waypoints. Practically an infinite amount. Can be teleported to (permission for teleportation chat command needed). Waypoints are rendered in the game world and displayed on the minimap. You can hide all or specific waypoints. Press B to create a new waypoint. Press U to list all the waypoints. In the waypoints list, you can add/edit a single or multiple waypoints, sort them, view waypoints from other sub-worlds/dimensions and much more.
  • \n
  • Local and global waypoints. To clear the screen from unnecessary waypoints you can create local waypoints that, unlike global ones, are affected by the \"Max WP Draw Distance\" option. This enables you to set a single global waypoint for a large area/region and multiple local ones in the area/region. Only the global waypoints will be visible when you are beyond the maximum draw distance.
  • \n
  • Waypoint sets. You can organize your waypoints by sorting them into sets. Your current set can be quickly switched with a key binding. All key bindings are in the vanilla controls menu.
  • \n
  • Waypoint sharing. You can share your waypoints in the game chat with players on the server. This is done from the waypoints list (press U).
  • \n
  • Deathpoints. An automatic skull-shaped waypoint is created on each death. Old deathpoints are converted to regular waypoints, which you can disable using the \"Keep Old Deathpoints\" setting.
  • \n
  • Displays chunk claims and ally players from the Open Parties and Claims mod.
  • \n
  • Togglable chunk grid. The chunk grid shows you where block chunks begin and end. 
  • \n
  • Togglable slime chunks mode. The chunks where slimes can spawn are marked with a green overlay.
  • \n
  • Custom light overlay. You can setup a light overlay that will mark blocks with a custom color if they are within a custom light value range, which is block light from 0 to 7 by default. The default settings are meant for finding mob-spawnable blocks. You can use it for any purpose.
  • \n
  • Multi-world detection in multiplayer. If you install the minimap mod on the server side in addition to the client side, each server world should get a separate waypoints \"sub-world\". Otherwise a much less reliable world separation is used, which is based on the world spawnpoint. If you can't install the mod on the server side, it is recommended to turn off multi-world detection for servers that only have a single \"world\". You can do it through the Waypoints Menu (press U) -> Options screen.
  • \n
  • Displays mobs on the map as yellow dots. Hostile and friendly mobs can be colored differently. Can also be displayed as icons/heads. Check the \"Entity Radar\" settings.
  • \n
  • Displays players on the map as white dots or player heads. Can also be displayed as icons/heads. Check the \"Entity Radar\" settings.
  • \n
  • Displays items on the map as red dots. Check the \"Entity Radar\" settings.
  • \n
  • Displays all the other entities such as arrows and item frames as purple dots. Different types of entities can be disabled in the settings. Check the \"Entity Radar\" settings.
  • \n
  • Options for displaying entity names on the minimap in the \"Entity Radar\" settings.
  • \n
  • Zoom in and out key bindings (I and O by default) to efficiently change the zoom level to fit your preference or use case.
  • \n
  • Coordinates under the minimap.
  • \n
  • Current biome name under the minimap. Disabled by default and needs to be enabled in the mod settings (press Y).
  • \n
  • Light level under the minimap. Also disabled by default and needs to be enabled in the mod settings (press Y).
  • \n
  • Current game time under the minimap. Disabled by default. You can choose between the 12 hour and the 24 hour formats.
  • \n
  • Current camera angles under the minimap. Disabled by default.
  • \n
  • Setting to hide/unhide all waypoint coordinates from all UI screens. Can be useful for streams/videos.
  • \n
  • Setting to fully hide/unhide all mentions of server addresses in dropdown menus. The setting is set to \"Partial\" by default, which is probably good enough in most cases. 
  • \n
  • A LOT MORE SETTINGS. Too many to list them all here. Press Y in game to open the settings and take a look.
  • \n
  • 2 mod editions: full and fair-play. Full version does not have any limits. Fair-play version does not display any entities or cave maps which is more suitable for PVP against people who don't use a minimap.
  • \n
\n

Get fair-play edition

\n

Get Xaero's World Map

\n\n## FAQ\n\n### Why does waypoint teleportation not work for me?\n\n

There can be many reasons for this. The mod sends a chat command to teleport you to the waypoints, which is /tp @s x y z by default, so appropriate permission is necessary. The vanilla /tp command requires OP status (cheats enabled) but it's possible to have separate permissions for commands on a non-vanilla server with certain plugins installed. The used command can be changed in the minimap settings with the \"Default Teleport Command\" option or per server in the waypoints menu with the \"Teleport Chat Command\" option. Non-vanilla teleportation commands often don't support the selectors such as @s, so you might have to remove it from the configured command. Right-click teleportation on the world map uses its own setting for the command. You can read about it on the world map description page under FAQ.

\n

If the \"Teleport\" button is disabled, then it can also mean multiple things. The most common reason for this is manually using waypoints from a sub-world that isn't the \"auto\" one but still from the same dimension. If the \"auto\" sub-world isn't what is supposed to be automatically picked on a certain world, then select the correct sub-world and use \"Make Sub-world Auto\" in the waypoints menu Options. This will swap all waypoints data between the 2 sub-worlds and you'll be able to teleport to the waypoints, which are now in your \"auto\" sub-world.

\n

If the \"auto\" sub-world IS selected but the teleport button is still disabled, then it probably means that teleportation was manually disabled for the server/world. Check the teleportation option in the waypoints menu Options. If it's disabled, you can only enable it through the server-specific config file in the game directory -> XaeroWaypoints. I recommend exiting Minecraft before editing any config files. And make backups from time to time.

\n\n### Why are my waypoints no longer shown for a specific server?\n\n

Do not panic. It's almost certainly not actually deleted. If you use the world map mod and it has also reset, then please start by restoring it first before dealing with the waypoints. Read the \"Why has my world map \"reset\" for a specific server?\" section on the world map description page. Done with that? Please continue reading.

\n

Start by opening the full waypoint menu. Press U ingame to do so. Check the vanilla controls menu, if the U key doesn't work. Go through the sub-worlds listed in the top-right dropdown menu. All waypoint sub-worlds for the current server address should be there. If none of them have the right waypoints for the world/dimension that you are in, then the server address was likely changed. Find the old server address in the top-LEFT dropdown menu, select it and do Options -> Make World/Server Auto. You should now be able to find the correct sub-world in the top-right dropdown menu. If the right sub-world is already marked with (auto), which means that the sub-world is automatically selected for your current world/dimension, then you should be good to go. If the wrong sub-world is marked with (auto), then please continue reading.

\n

Using the world map mod?
One of the most common reasons for the wrong sub-world being automatically selected is the incorrect usage of the world map mod in multiplayer (since version 1.6). Make sure you select the correct map for your current world before confirming it. It affects which waypoints are being shown to you. The menu for map selection is on the world map screen, if you click the bottom left icon (unless it's open by default). Consider changing the map selection mode to one of the automatic ones, if it fits the server you're playing on. 

\n

Your currently confirmed map affects which waypoints sub-world in the minimap mod is considered automatic (auto). This allows each created map to have separate waypoints data. At any point in time, you can select and view any non-automatic waypoints sub-world by going to the waypoints menu (press U) and selecting it from top-right dropdown menu. You can make any sub-world automatic for your currently confirmed map by selecting Options -> Make Sub-World Auto.

\n

Not using the world map mod? 
The wrong sub-world being considered (auto) and therefore being automatically selected can be caused by a server plugin changing the behavior of the vanilla compass item and interfering with the mod's \"multiworld\" detection, if you have it enabled (disabled by default). In most such cases the compass item points to your bed instead of the global spawn point. Sleeping in the right bed again should bring everything back for you if sleeping in another one was the cause of the waypoints disappearing.
If this happened because of a new plugin being added (and if removing it is not an option for you), then here's how you can restore your waypoints:

\n

1. Find the right waypoints \"sub-world\" from the top-right dropdown menu in the waypoints screen, it's the one with the waypoints that you need in your current dimension. Perhaps start with overworld?

\n

2. Use Options -> Make sub-world auto. 

\n

3. Do the same for every dimension (enter the dimensions before doing it!).

\n

4. If it's a simple server with 1 world (no hub/lobby worlds, no minigame worlds, creative plot worlds etc), then also turn off \"Multiworld Detection\" in the same Options menu. You can turn it back on later if you ever need it.

Contact me if you have questions!

\n\n### How do I add my own entity icons or override the default ones?\n\n

First of all, make sure that you actually have the entity icons/heads enabled in the minimap settings -> Entity Radar Categories, whether you put it on \"Always\" or \"Player List\". Just make sure that you know how to display them. Those are the icons that this section is about.

\n

Starting from version 21.6.0 of the minimap mod you are able to override the default icons displayed for entities with your own sprites/images by making a resource pack (or including the required resources in your own mod). In addition to that, you are also able to add or improve entity type variants support (different variants of the same entity type having different icons) by creating a simple mod of your own or including some code in your existing mod. Although this is usually unnecessary for simpler multi-variant entity types (most entity types).
By default, the minimap mod renders all entity icons using the entity renderers/models bound to the entities. This supports all vanilla mobs and some simple bipedal/quadrupedal mobs whose models have easily identifiable head model parts (head, ears, nose etc). If the mod fails to do so, the colored dot is displayed instead.

\n

The relevant assets directory to the purpose of overriding the icons is /assets/xaerominimap/entity/icon/. You can find it inside the minimap mod's jar file and extract the contained files/folders for your reference. The jar contains an example file for overriding icons of a mod entity type /assets/xaerominimap/entity/icon/definition/example_mod/example_entity.json. The example file would corresponds to the entity type example_mod:example_entity, if such existed. Please read the comments in the file example_entity.json to learn about its structure, so that you are able to create your own icon definitions similar to it.
In addition to that, /assets/xaerominimap/entity/icon/definition/minecraft/ contains several example files for vanilla entity types that might require additional comments regarding the default entity type variants support. By default, entities have very simple variants support where the entity type variant ID is simply the entity's main texture resource location.
If you set the \"debugEntityVariantIds\" option in the minimap config file to true, then the variant IDs of newly encountered entities (variants) will be printed in the chat and the log/console.

\n

Starting from version 21.8.0 of the minimap mod you are also able to configure your own model-based rendering. Please read the comments in the example file /assets/xaerominimap/entity/icon/definition/example_mod/example_entity.json for all the information you need to know.

\n

Check out this awesome project by babybluetit, if you want to have a look at a real implementation of custom icons or actually use it: https://www.curseforge.com/minecraft/texture-packs/xaeros-minimap-modded-support

\n\n### How do I prohibit the use of cave mode and/or entity radar on my server?\n\n

To do that, please install the mod on the server side (requires a Forge/Fabric/Quilt server as of writing this). When you start your server, a new \"common\" config file will be created directly in the server directory (not the world folder). In the config file, you get multiple options that let you disable certain mod features for your players. Changes require a server restart.

\n

Alternatively, you can include the following strings in a server/system message sent to players (on login), which do the following:

\n

§f§a§i§r§x§a§e§r§o - causes the minimap to disable cave mode (including world map) and entity radar (fair-play mode)

\n

§x§a§e§r§o§w§m§n§e§t§h§e§r§i§s§f§a§i§r - causes world map cave mode to work in the nether despite the minimap being fair-play

\n

§n§o§m§i§n§i§m§a§p - disables the minimap completely

\n

§r§e§s§e§t§x§a§e§r§o - reset all the system message flags

\n\n### How do I let vanilla client players join my server that has the mod installed?\n\n

Look for a \"common\" config file directly in your server directory (not the world folder). In the config file, you get multiple options that let you disable certain mod features for your players. One of the options lets you disable the registration of status effects, which is what prevents players from joining. Changes require a server restart.

\n

You are allowed to make videos using this mod.

\n

Using it in your modpacks is allowed with the following conditions:

\n
    \n
  • Only monetization of the modpack through CurseForge or Modrinth is allowed (which includes sponsored links/banners in your modpack description), unless I have given you written permission to monetize it elsewhere. Feel free to private message me about it. I'm more likely to give you permission than not.
  • \n
  • If the modpack is distributed outside of CurseForge and Modrinth, then you must credit me by providing an easily accessible link to one of my official pages for the mod, to the users outside of CurseForge and Modrinth. 
  • \n
  • The name and/or description of the modpack must not be easily confused with the names/descriptions of my mods.
  • \n
  • If I have given you written permission to monetize the modpack outside of CurseForge and Modrinth, then, if I request you to, you must remove monetization outside of CurseForge and Modrinth. 
  • \n
", + "body_url": null, + "published": "2023-04-21T18:24:45.476148Z", + "updated": "2024-07-31T12:00:32.448144Z", + "approved": "2023-04-22T18:06:33.825340Z", + "queued": "2023-04-22T11:30:43.758317Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 6623969, + "followers": 4029, + "categories": [ + "adventure", + "transportation", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "w0s3P0Nx", + "HuGurbB3", + "ppMU6Z2I", + "SNmmqZ9B", + "wE8jIGuh", + "lC4hcOVE", + "6L5cMZ7K", + "iQUItHJR", + "tRGwafW7", + "J6KCYRdU", + "Nt4iodmn", + "FojbYoas", + "9zye2qw4", + "avJ1VxJU", + "s1rhJMTE", + "vrnch5iH", + "PAMrhxeC", + "cNhlRiJY", + "uNO68A27", + "I664qbcT", + "yrLYxo0u", + "nWIJL7XJ", + "1x0ILsMp", + "DRBTqWWE", + "2gZQVfXc", + "35H5aTCN", + "bGXg9vXe", + "4COs5reF", + "4BuZ2uQi", + "OFJPST0Q", + "r1kfKLex", + "WH47LcDi", + "wA5lTfMy", + "xJzUbNoJ", + "2Xp2lrxP", + "F7ZxANQI", + "RcafQ7Hm", + "5pbtWSsW", + "p2jt44Nx", + "IawL7pJb", + "rf2B3xu0", + "tqv1PQZK", + "PUnRwXus", + "2Xt8KsYf", + "DT38adQd", + "cme3p1dr", + "OFJFnVZT", + "2BTN3DDS", + "VStrXzaa", + "r3BpxmG2", + "gSD7DNhQ", + "vgcVyWHv", + "mdPiXUS4", + "6X8lqJyo", + "H4mYaGQp", + "X7nLQ7Vm", + "86aZhRJ3", + "Ch6QAiVR", + "a0QkQMyN", + "5GPcMgHh", + "ieTNfGnv", + "egu9I4vr", + "CHTHmLXn", + "bAL4VcAg", + "wTJUalwO", + "KwzRNV0o", + "JuD8yGgV", + "lli7W8KF", + "eJ0U2ijV", + "XEps1Upt", + "lFb1C2ui", + "EJBTntJm", + "8muNL0Eh", + "1iUK4vVw", + "yy1WVYt7", + "I8fXehdE", + "ETOFR9KA", + "1He0X0cq", + "I4vGxgUB", + "R5gkCslm", + "f8q94zoX", + "E44kO4Xa", + "dRt8YraU", + "3jmomVhT", + "ldf3azl1", + "V5hZALQK", + "4lEWVPp0", + "rp2rMxJo", + "H5ELiTaK", + "LnGnN6Wm", + "2smSuVIC", + "azeMJ1nM", + "iRhAjU2h", + "2e46Lw1V", + "46F7j3df", + "MEbqZZxa", + "qGhznNXo", + "YF6eFmhz", + "Raw6uF1V", + "diZGjEgD", + "WoTkTZa5", + "AG8u4P63", + "DOuiRwGe", + "4XS19D9K", + "l7pg6bKQ", + "M2P91buq", + "dz3fTToz", + "LKcX5Que", + "8dkr2uqW", + "Y6EQTA41", + "ZmtSgdIA", + "pv0bLIS8", + "kwIKobDl", + "2aWIxg96", + "7KbZF7xU", + "aCayHbYL", + "CZrrD2vf", + "NIltAf6R", + "CZCW5zom", + "vgQK87ti", + "mMUiMak0", + "JYAeUegn", + "fpSneDSW", + "UZgjnzyW", + "nhS6BPLW", + "XoheiGPr", + "7GBpgdcp", + "QklpOPx8", + "k6hvQZGk", + "5KksSxbC", + "qAFan3b8", + "9PQASEAD", + "1DxAMjCv", + "EdIwMhwf", + "LuOoX5b5", + "9vbdtcnn", + "KLeKPSCh", + "vMFtYCEm", + "TqQhSjej", + "DKslEExY", + "CVGBi4C4", + "EXBvAXXM", + "qGikrMjV", + "Jwydpps9", + "yFuICfIq", + "CHk4H0Bw", + "EytiG0aH", + "nQa4eu8m", + "yl9LzW11", + "QkupKzGm", + "SsdxxNbE", + "c0ZBWCnU", + "rn68Zxxt", + "J4KB9Suy", + "o9iEPpKI", + "P2UKqqd2", + "esECrPVt", + "oRdEqadv", + "4cvJrYme", + "yKrSoQTt", + "Ie68N63H", + "gLEgj2uV", + "644M8I6I", + "PPs1kSo7", + "Bt2DgBPL", + "Z2BuSrd0", + "mvZkcCUb", + "ueOtwpPw", + "lRxWUH4F", + "dCIiF7eS", + "vm3OXacK", + "x97XdhEs", + "NGfHdh11", + "r0ifUzPT", + "NTlgkgDO", + "qpZABZB9", + "CrO6o2Gq", + "6nZxo7pH", + "kZlaB1qq", + "Tp2vkR4G", + "lpFAQyvg", + "hSI8GBsH", + "hc8VPxDG", + "ydk6E03s", + "u8l9S1fp", + "AmT4OYf4", + "A7IHy1G0", + "6ZIEdzSQ", + "3hSJkWEr", + "7NZfxwRb", + "ezD5IzmS", + "TF00occI", + "7mx0aK7e", + "HEGX7Lg2", + "bSNv6PnW", + "8P0dTQAF", + "smx9Eynx", + "NeHIOK7r", + "VPlixW52", + "uDyNs1Rr", + "VLWE8oE9", + "S4W2r6uR", + "KINy3pYV", + "3z7K7JQE", + "rtDIk66P", + "ILxXvII1", + "DJ4hdETP", + "MVife7I0", + "KIsPEFnz", + "wZnIKkhI", + "ZNyDeTuJ", + "fN0KKPHy", + "hcfNyGnJ", + "sxmTEQGI", + "XVz9D1gr", + "ytsMBpyZ", + "3HsB1GGt", + "iztrg4XH", + "ULgQMMkf", + "7v8Wi6tb", + "MWEMQfOX", + "AVJcC2bL", + "QrF8T5cQ", + "nsKU3j5C", + "cUKMHnBo", + "esCEe3tL", + "UbBxgVDj", + "o7s7vL8t", + "WVRSa7j1", + "Szgz2P5P", + "s9D0ddkM", + "NDhL08bf", + "DZRJmAkj", + "QRPuTPr2", + "uzFgjSf0", + "nIClWGv7", + "5rdC6ZoX", + "P5sqtKJ1", + "JVEQUwgq", + "WdswP5tt", + "ZOXH5ibr", + "FQAIGl4y", + "8pCH7zn4", + "MhY87xwS", + "fTBtQrJL", + "GuT4Xl1k", + "ERh1PYbl", + "3fv1dVQx", + "xKJ0TybH", + "Icr9Uso2", + "kjc0zgWU", + "clNQKySD", + "uLqExVAM", + "fKz7XN1r", + "RZ1qbd4C", + "3kHivc7l", + "3l0ZI6yD", + "2PhDVr0e", + "c30OIq97", + "LvI0X86N", + "CJ72pbRS", + "fxo4zoHS", + "eVPUDXdi", + "hCSi4gjp", + "cC6hpPL6", + "evziehFm", + "1qgtbEJO", + "yfdwFDVK", + "FOH92M4F", + "MyHLjsuc", + "9AC4TDHp", + "CJuCOwm3", + "kbOfhmEZ", + "pLsaj6mq", + "5VUm1m7Z", + "yTnUZnVR", + "ZxOS5iG1", + "MmSg9jMk", + "Gw4WZ925", + "XxkAfYob", + "a8Yq1Qug", + "CqPkya2x", + "cLnTLfUI", + "wNvez3V6", + "2z34HtcM", + "YAHcKp6Q", + "JaqM6Gvz", + "nZqZ0aCE", + "Uzhe96qB", + "9CiT3jAu", + "L66gdxl9", + "ZlHF5Qac", + "U68R0rFS", + "fppiXBZ2", + "xFUEtVth", + "SBQ262QA", + "UdrmzjRD", + "YBgP6QdM", + "iuJPe4ni", + "m350JutC", + "MGpPp9kH", + "S5ek5ggz", + "KPtgbRwi", + "TxAPiOgr", + "Rn67Fnw2", + "fo6Bqntn", + "lnnUcQiF", + "W5b2EPKb", + "Zp26yPOc", + "ZGaMVApJ", + "WC4MSxy8", + "bNmU7aeV", + "2du1bm0c", + "gyxRW7KS", + "Nt0HqWYv", + "CfDmt6eX", + "e5VWn5iQ", + "iHZmaGst", + "I0FJpqoN", + "NswKWD6B", + "zgNWv1OW", + "gHdFelqh", + "KSDcShTK", + "2xJx9zro", + "S0r8i1Ol", + "lmSSKSg8", + "305nWW56", + "fRg7YyPu", + "xAyz6xnV", + "2xUOEAxL", + "2g3xC5Yk", + "aeLjQWMH", + "MxA7DpAu", + "SoNCC1sA", + "A0qsMhQD", + "PfhJ0nzQ", + "cx33FoE0", + "ajhC0UFK", + "Nvg8NDSW", + "6xOEvCyC", + "UaLwjU5j", + "OA7E6a9p", + "KlbD3D3B", + "yqp93Q5R", + "VuH8AYM3", + "NlaKBveu", + "CWHPcpYC", + "4GQMv7sQ", + "dMqrko5J", + "osXhdua5", + "rbY8QUIj", + "UduGhgss", + "4hUSZ0XT", + "TdsFTQCP", + "LLE04weG", + "wyaDomyx", + "grUAeQmH", + "rrL6at63", + "4BLJQ8Cw", + "F0QClxK7", + "vMQZ4GyL", + "CbKSFbgX", + "8Upb0VqF", + "9qSU7GXL", + "tqZP0sAt", + "cgS07Jhf", + "6vRoV7rt", + "AGBnAu6b", + "qwbkbzoh", + "XNk8u9Xv", + "6nrVJMjJ", + "DZKCme41", + "VkhLOjfb", + "hnrAEMVF", + "2sFvKLMq", + "HR0G2gSQ", + "6phDIoxa", + "xgO8iEoo", + "rnKIUx0M", + "W0vNiSUN", + "hLzKOgZG", + "Gwys2mC6", + "KxhgYv70", + "P0Lox3gc", + "uYw01UUg", + "TgVPhHX1", + "XGqIm613", + "pnRuTtkM", + "voIrfIDP", + "wzrBVYUb", + "cFc2AoCv", + "ydJkpNr9", + "ESCev80x", + "tEO0i9AC", + "I8PESUAB", + "N5jBKzC0", + "ERJt9Vyj", + "o5yk7ekg", + "RF88GIOq", + "I2SqxBuz", + "yvQWOsPM", + "pdo3FqBZ", + "oYc9KpLE", + "RRQpdsRM", + "O0Nj9jLg", + "GYaaSuBx", + "6kK8jWA8", + "ltsi0X3A", + "W4cxDNb2", + "uDqhLKbH", + "RXKv1vKp", + "RNq1NrjQ", + "gtz0RXPQ", + "pzvtRv7A", + "ys8sIlN4", + "j59kRx58", + "Cl6CKBcF", + "NNLpWIl6", + "n2MgcQOn", + "sPZxEpDf", + "6dJeamaz", + "SQZr10BS", + "dxsBIRkW", + "C2jbx7JG", + "encv7xNt", + "oCrCco57", + "8xtEYb9r", + "Hh9qQAAt", + "9SZyYgeA", + "a1aPoO3W", + "AE2guKuD", + "H5U9OIBR", + "grjC2cUV", + "YtAGhx5I", + "EmtRNLL4", + "3nguWW3k", + "4B2YTORj", + "quthv9KV", + "CXxfovCE", + "AZoazJZ9", + "RQjoN86f", + "terogn4c", + "5b9ZhxJB", + "73eENOzt", + "Sc6Vb5o3", + "LsUG4Ee3", + "zst4834Y", + "WQEX096d", + "vGHr0KR9", + "BSzbgv5g", + "1PbPiCss", + "IDSgysLe", + "HQSFfCfA", + "ebLQ6HBv", + "e1SKPr5a", + "lygDaDx8", + "pfjda4sr", + "z3OgNpRJ", + "qcuUYSKu", + "cDXVTAcY", + "enRPivaa", + "LF6xSpse" + ], + "icon_url": "https://cdn.modrinth.com/data/1bokaNcj/80eb00784e250b99fb1789da35869387d14d5637.png", + "issues_url": "https://curseforge.com/minecraft/mc-mods/xaeros-minimap/issues", + "source_url": null, + "wiki_url": null, + "discord_url": null, + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/xaero96" + } + ], + "gallery": [], + "color": 3359430, + "thread_id": "1bokaNcj", + "monetization_status": "monetized" + }, + "YetAnotherConfigLib-3.5.0+1.20.1-fabric": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.19", + "1.19.1", + "1.19.2", + "22w42a", + "1.19.3", + "23w05a", + "23w06a", + "1.19.4-pre1", + "1.19.4", + "1.20-pre1", + "1.20-pre2", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "1eAoo2KR", + "slug": "yacl", + "project_type": "mod", + "team": "Nwpe87D0", + "organization": null, + "title": "YetAnotherConfigLib", + "description": "A builder-based configuration library for Minecraft.", + "body": "# YetAnotherConfigLib\n\n![Enviroment](https://img.shields.io/badge/Enviroment-Client-purple)\n[![Java 17](https://img.shields.io/badge/Language-Java%2017-9B599A.svg?color=orange)](https://www.oracle.com/news/announcement/oracle-releases-java-17-2021-09-14)\n[![Discord](https://img.shields.io/discord/780023008668287017?color=blue&logo=discord&label=Discord)](https://short.isxander.dev/discord)\n\n[![Modrinth](https://img.shields.io/modrinth/dt/1eAoo2KR?color=00AF5C&label=downloads&logo=modrinth)](https://modrinth.com/mod/yacl)\n[![CurseForge](https://cf.way2muchnoise.eu/full_667299_downloads.svg)](https://curseforge.com/minecraft/mc-mods/yacl)\n\n[![Ko-fi](https://ko-fi.com/img/githubbutton_sm.svg)](https://ko-fi.com/isxander)\n\nYet Another Config Lib, like, what were you expecting?\n \n[![](https://www.bisecthosting.com/partners/custom-banners/08bbd3ff-5c0d-4480-8738-de0f070a04dd.png)](https://bisecthosting.com/xander)\n\n## Why does this mod even exist?\n\nThis mod was made to fill a hole in this area of Fabric modding. The existing main config libraries don't achieve what I want from them:\n\n- **[Cloth Config API](https://modrinth.com/mod/cloth-config)**: **It's stale.** The developer of cloth has clarified that they are likely not going to add any more features. They don't want to touch it. ([citation](https://user-images.githubusercontent.com/43245524/206530322-3ae46008-5356-468e-9a73-63b859364d4e.png))\n- **[SpruceUI](https://github.com/LambdAurora/SpruceUI)**: **It isn't designed for configuration.** In this essence the design feels cluttered. Further details available in [this issue](https://github.com/isXander/Zoomify/issues/85).\n- **[MidnightLib](https://modrinth.com/mod/midnightlib)**: **It has cosmetics among other utilities.** It may not be large but some players (including me) wouldn't want cosmetics out of nowhere.\n- **[OwoLib](https://modrinth.com/mod/owo-lib)**: **It's content focused.** It does a lot of other things as well as config, adding to the size.\n\nAs you can see, there's sadly a drawback with all of them and this is where YetAnotherConfigLib comes in.\n\n## How is YACL better?\n\nYACL has the favour of hindsight. Whilst developing this fresh library, I can make sure that it does everything right:\n\n- **Easy API.** YACL takes inspiration from [Sodium's](https://modrinth.com/mod/sodium) internal configuration library.\n- **It's styled to fit in Minecraft.** YACL's GUI is designed to fit right in.\n\n## Usage\n\n[The wiki](https://github.com/isXander/YetAnotherConfigLib/wiki/Usage) contains a full documentation on how to use YACL.\n\n## Screenshots\n\n
\n\n![java_A3zdbksGkC](https://user-images.githubusercontent.com/43245524/206924832-293b0780-2a8c-4b09-8765-155318d09ed9.png)\n\n
\n\n## License\n\nThis mod is under the [GNU Lesser General Public License, v3.0](LICENSE).\n", + "body_url": null, + "published": "2022-09-02T11:05:20.777780Z", + "updated": "2024-06-13T17:19:35.226992Z", + "approved": "2022-09-05T13:15:27.359550Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-or-later", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 7390757, + "followers": 3125, + "categories": [ + "library", + "management", + "utility" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "WRaSIAfC", + "9TFyuVJN", + "DM1biniZ", + "iYzpWd2Z", + "Af0BJTus", + "6Fl6Ilzn", + "RsiSJn8g", + "4M515h9Z", + "Op8HYd0I", + "knEInTQd", + "2To1GHMW", + "zngBEiw5", + "JLCAxM5G", + "FKVJYGyf", + "hbt0DzsC", + "FxNs8Edj", + "EyhlJvkj", + "VdIvtIwz", + "mW3CVg5N", + "UIAaWmvd", + "wibQ6TRj", + "GkKQsCJ6", + "3EWbdCzX", + "bIVYcRpm", + "eQtAB8nC", + "TWgoDEtx", + "TXnYvmpI", + "RmZvIqeu", + "A04AftxZ", + "RLTQViRg", + "51iCmuDG", + "sj4aPwnQ", + "NZpUvhBc", + "nMuzsoQt", + "M5iKxVFU", + "VHMFG82e", + "6EBKvxyG", + "qHhZ3Mlp", + "CSXeGyWW", + "zRlTTWFK", + "yShEHkWR", + "kr3UvTk4", + "jZFsc9tg", + "oIlFdLZI", + "8WHpxnmg", + "SiEAKMh4", + "gfyPkvYv", + "Vc0cNGqC", + "uRw9Zalc", + "HOxWjhyo", + "9ACWUOXp", + "wa9YGZhd", + "ZqWkEgYo", + "zoMzOEbl", + "LM15Ky9N", + "vASIPGay", + "zJ1Wh6pM", + "DjwHtlVp", + "omClzsLe", + "zU7Ejh24", + "g38uL3ti", + "3vGF9MOJ", + "SqpDFYpa", + "M1u6F79I", + "3HHSMwA9", + "IsGTmmrV", + "CgwTUAR2", + "RPlKFmas", + "VPm1SrE4", + "RpevhOax", + "gJ6ZmZ4Z", + "Jf2pciI1", + "HM9McfrA", + "O7kIps9X", + "RBAUxw9P", + "4EU2xyVo", + "u6jV7Q7R", + "lVQpbXSe", + "3hsIB5yP", + "smEdHeFU", + "vede4iWJ", + "n8X2J9Hh", + "ZytICJS4", + "IHHNzQkV", + "3TfeWIWo", + "cwavYrLH", + "vMzBhYIk", + "StXMrAsz", + "5Y3n1Apc", + "DretS191", + "WdbHS4uT", + "elFOHmh9", + "R7WWpY0Z", + "G8Aq3OEv", + "WTCAdLsq", + "MJUxq3kq", + "LXUa8bFw", + "h61Z2iVZ", + "dLAG06tP", + "CL7AHQsm", + "HHrwznjQ", + "XNQUud9H", + "rsM9VY0D", + "bovSU7Mt", + "EkAJiIZH", + "lALu7fvN", + "TD5Fv92S", + "ePcFYsKB", + "hf7D9v77", + "8DXWiiaq", + "mkXoQQMn", + "ZHFdxhFP", + "hCwZI62j", + "sDwfolBP", + "G2PcCpZl", + "3jH5u49m", + "RXrT2ogA", + "gQuF6HNa", + "C0nuSdTs", + "Jl7pSXPu", + "Ha6NtXW8", + "xiSmTJ03", + "zoyKoGDQ", + "Y8Wa10Re", + "DRI8KjDu", + "sjARwr7i" + ], + "icon_url": "https://cdn.modrinth.com/data/1eAoo2KR/1e43d5714f87ac6b20622e73b3ba7209be5ebafb.png", + "issues_url": "https://github.com/isXander/YetAnotherConfigLib/issues", + "source_url": "https://github.com/isXander/YetAnotherConfigLib", + "wiki_url": "https://docs.isxander.dev/yet-another-config-lib", + "discord_url": "https://short.isxander.dev/discord", + "donation_urls": [ + { + "id": "ko-fi", + "platform": "Ko-fi", + "url": "https://ko-fi.com/isxander" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/1eAoo2KR/images/f5f6bdad06350bc34c8a207df242705660231e8a.png", + "featured": true, + "title": "GUI", + "description": null, + "created": "2023-11-23T00:06:31.128111Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/1eAoo2KR/images/2f8ecdf72f4dabd147feeb53676e295a134a8b80.png", + "featured": false, + "title": "Old GUI", + "description": null, + "created": "2022-09-03T16:22:41.181669Z", + "ordering": 1 + } + ], + "color": 2236961, + "thread_id": "1eAoo2KR", + "monetization_status": "monetized" + }, + "YungsApi-1.20-Fabric-4.0.5": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4", + "1.21" + ], + "id": "Ua7DFN59", + "slug": "yungs-api", + "project_type": "mod", + "team": "3TidTIHz", + "organization": "nuVP8uUG", + "title": "YUNG's API", + "description": "Library mod for YUNG's mods.", + "body": "

\"\"

\n\"Join \"Follow \"Subscribe \"Support

\n

This is a library mod for YUNG's mods.

\n

For all my mod devs out there - This provides a lot of useful stuff, especially if you're a worldgen modder!

\n

The API includes the following:

\n
    \n
  • AutoRegistration system (1.18+ only). Register any field with only a simple annotation, regardless of mod loader!
  • \n
  • Custom reimplementation of Jigsaw Manager with improved performance and custom pool element types with various new properties. Check out the Better Dungeons code to see it in action.
  • \n
  • New criteria trigger for safely locating any structure. If the given structure doesn't exist, the trigger simply fails rather than instantly passing (unlike vanilla).
  • \n
  • Interfaces for JSON serialization & deserialization with built-in type adapters.
  • \n
  • Simple, lightweight math utilities for vectors and column positions
  • \n
  • BlockStateRandomizer and ItemRandomizer, data abstractions that make adding block and item randomization to your structures incredibly simple. I use these for all of my mods!
  • \n
\n

If you're curious, you can check the code for my mods (especially the newer ones) to see how things work. Feel free to ask me any questions on Discord!

\n


\n\"Use

", + "body_url": null, + "published": "2022-11-28T17:17:12.676483Z", + "updated": "2024-07-24T21:56:00.865165Z", + "approved": "2022-11-28T18:42:13.412406Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 2878297, + "followers": 1085, + "categories": [ + "library", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "xET3UZBe", + "UNVzqGkX", + "82XBGKbQ", + "xvoWCwex", + "LYoQlbQt", + "YwHWUw19", + "LEuKu3qt", + "Em3G31xp", + "dpSzBMP6", + "IOIGqCVr", + "i0Z1vSK9", + "YZE1pnbT", + "GNNfW5IV", + "IxuGYnWF", + "yIFytswN", + "h32n7OPC", + "4Ek11kQV", + "NmrTF2A5", + "TT8tnzlH", + "HIRzLg0r", + "pxmQWPn7", + "L5GqhLVE", + "QnR5jGmc", + "hyQxutx9", + "rbgh8n1F", + "5Zb55w2q", + "k1OTLc33", + "sE5QMX20", + "RXxBbRs7", + "wddoDji1", + "dpTBMhjf", + "jLW564iU", + "a7qxhSOZ", + "aMs83SRk", + "zPT7QfIk", + "Nx7XHO30", + "mBbkZrZ1", + "fFD2YR4D" + ], + "icon_url": "https://cdn.modrinth.com/data/Ua7DFN59/38049bae08310ffed43435f717e309b15ec6f29d.png", + "issues_url": "https://github.com/YUNG-GANG/YUNGs-API/issues", + "source_url": "https://github.com/YUNG-GANG/YUNGs-API", + "wiki_url": null, + "discord_url": "https://discord.gg/rns3beq", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/yungnickyoung" + } + ], + "gallery": [], + "color": 5970187, + "thread_id": "Ua7DFN59", + "monetization_status": "monetized" + }, + "YungsBetterDesertTemples-1.20-Fabric-3.0.3": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4" + ], + "id": "XNlO7sBv", + "slug": "yungs-better-desert-temples", + "project_type": "mod", + "team": "a0pXN0ys", + "organization": "nuVP8uUG", + "title": "YUNG's Better Desert Temples", + "description": "A complete redesign of Minecraft's desert temples!", + "body": "

\n\"YUNG's
\n\"Depends \"Join \"Follow \"Subscribe \"Support
\n\"What
\nThe ultimate upgrade to Minecraft's desert temples! YUNG's Better Desert Temples redesigns vanilla desert temples to be way more exciting, adding a variety of new puzzles, traps, & parkour challenges. And of course, you'll get much better loot than vanilla's desert temples for your troubles!\n

\n

\nBy default, mining fatigue will be applied to all players in the Better Desert Temple. Once you clear the temple (i.e. kill the pharaoh at the end of the temple), the mining fatigue effect for that temple will be permanently lifted! You can disable this feature in the config. Additionally, you can re-enable vanilla desert temples to spawn alongside Better Desert Temples in the config.\n

\n

\nCloser look:
\n\n

\n

\nAnimated trailer:
\n\n

\n

\n\"Compatibility\"
\nYUNG's Better Desert Temples is intended to be fully compatible with every worldgen mod, including:\n

\n\n


\n\"Use

", + "body_url": null, + "published": "2022-11-28T19:49:53.246560Z", + "updated": "2024-05-17T00:55:58.596148Z", + "approved": "2022-11-28T21:13:49.224359Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 1533580, + "followers": 1032, + "categories": [ + "adventure", + "decoration", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "QqT68vQL", + "L4h3G4u8", + "4szLNMTj", + "fPGcJ7Ts", + "MtlwvaOG", + "p8cwpZLc", + "XPZvt9X7", + "Sa1Psnly", + "ChDXLIZS", + "xrrG1pue", + "4a8fruuc", + "v4pDHgFV", + "lRK2ZA9U", + "1Z9HNWpj", + "sscYfIzO", + "Rnvv7pHS", + "dCWZlWYv", + "ubWx2R23", + "i3nkVPfA", + "9Hoqyuad", + "PPFN6otn", + "Rfwd8KoN", + "Hcmz4q2I", + "WSCc2UQ6", + "UR5dmUeN", + "cX43WPt5", + "wCG6Lqw9" + ], + "icon_url": "https://cdn.modrinth.com/data/XNlO7sBv/7c28d323155163f64343670e6553b85e681d7796.png", + "issues_url": "https://github.com/YUNG-GANG/YUNGs-Better-Desert-Temples/issues", + "source_url": "https://github.com/YUNG-GANG/YUNGs-Better-Desert-Temples", + "wiki_url": null, + "discord_url": "https://discord.gg/rns3beq", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/yungnickyoung" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/XNlO7sBv/images/2e73ada29fe12cb01ecdea5916a5c8b76bf92251.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-29T00:27:53.448869Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/XNlO7sBv/images/4666a27bbc0b4b8bf1eb32993c739b4fae5dab5e.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-29T00:27:46.045032Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/XNlO7sBv/images/b038f3cf881908855e839d8512f2e5c72d60b554.png", + "featured": true, + "title": null, + "description": null, + "created": "2022-11-29T00:27:56.123754Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/XNlO7sBv/images/c0981f08baa9c58eb2693dfd187d58afd3adf770.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-29T00:27:50.808017Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/XNlO7sBv/images/e2f8ce59e0967a2e6244d8ee6073526a54009335.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-29T00:27:48.348427Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/XNlO7sBv/images/e4540d16c2b4d6db2d54a75345492b005f81032e.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-29T00:27:43.271953Z", + "ordering": 0 + } + ], + "color": 3611151, + "thread_id": "XNlO7sBv", + "monetization_status": "monetized" + }, + "YungsBetterDungeons-1.20-Fabric-4.0.4": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4" + ], + "id": "o1C1Dkj5", + "slug": "yungs-better-dungeons", + "project_type": "mod", + "team": "dxsKu4w1", + "organization": "nuVP8uUG", + "title": "YUNG's Better Dungeons", + "description": "A complete redesign of Minecraft's dungeons!", + "body": "

\n\"YUNG's
\n\"Depends \"Join \"Follow \"Subscribe \"Support
\n\"What
\nA complete redesign of Minecraft's dungeons like never before. YUNG's Better Dungeons redesigns vanilla dungeons while also adding three new dungeons: Catacombs, Fortresses of the Undead, and Spider Caves!\n

\n

\n1.19.2 introduces the Nether Update! Now you can find small Nether dungeons scattered throughout the Nether. Note that this is an extra opt-in feature, meaning you will need to manually enable it in the mod's config.\n

\n\n

\n\"Compatibility\"
\nYUNG's Better Dungeons is intended to be fully compatible with every worldgen mod, including:\n

\n\n


\n\"Use

", + "body_url": null, + "published": "2022-11-28T18:36:45.255845Z", + "updated": "2024-05-17T00:45:14.433882Z", + "approved": "2022-11-28T21:13:53.947575Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 1983217, + "followers": 1225, + "categories": [ + "adventure", + "decoration", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "vhbhPrpZ", + "XOk0yK9M", + "xgwwD4nQ", + "So0mVHEW", + "ndfXFrkZ", + "JylvzoB0", + "sZO4lGuf", + "xraHSR9S", + "cJ2CwZT6", + "iOEKpSFY", + "yyEN8Zb4", + "bSSS84Op", + "sOx1vdMN", + "4RpKnxDR", + "xMqv6c8w", + "8zaPNLL8", + "9jmgNEyb", + "y2Ahguul", + "nidyvq2m", + "kPiQ6v4q", + "sSqM7waC", + "sR9iSOHj", + "60GnmH9u", + "5e0sLvAW", + "emTrSGfp", + "ISvARzqL" + ], + "icon_url": "https://cdn.modrinth.com/data/o1C1Dkj5/1f4ac6d7203008cedc2dc998ff1ad6df48732e38.png", + "issues_url": "https://github.com/YUNG-GANG/YUNGs-Better-Dungeons/issues", + "source_url": "https://github.com/YUNG-GANG/YUNGs-Better-Dungeons", + "wiki_url": null, + "discord_url": "https://discord.gg/rns3beq", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/yungnickyoung" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/o1C1Dkj5/images/16cf9b2e65c75afe44ed8f13d67ab539ac9fdf00.png", + "featured": false, + "title": "A Small Nether Dungeon, added in 1.19!", + "description": "Note that Small Nether Dungeons are an opt-in feature. They must be manually enabled in the mod's config.", + "created": "2022-11-28T18:50:40.770360Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/o1C1Dkj5/images/430a7b3df92615ef65e3e4d948f47d30c08a301d.png", + "featured": true, + "title": "Fortress of the Undead", + "description": null, + "created": "2022-11-28T18:50:31.432404Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/o1C1Dkj5/images/8dbfa5f91237d71785a78da80a7a2e35f9e0a936.png", + "featured": false, + "title": "Improved vanilla dungeon in an open cavern", + "description": " ", + "created": "2022-11-28T18:48:54.873666Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/o1C1Dkj5/images/c41f4ad0f6909dd705036dfafdbb5bb895444f20.png", + "featured": false, + "title": "The Catacombs (Floor 0)", + "description": null, + "created": "2022-11-28T18:50:33.264140Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/o1C1Dkj5/images/ce1b9c1e55d4570ba1e90e8852d0c14d5559bf6b.png", + "featured": false, + "title": "The Catacombs (Floor B1)", + "description": null, + "created": "2022-11-28T18:50:34.771287Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/o1C1Dkj5/images/cf57af53d46cbfdcd4bab45cad6f0d0facb0b2de.png", + "featured": false, + "title": "Spider Caves nesting room", + "description": null, + "created": "2022-11-28T18:50:38.170374Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/o1C1Dkj5/images/d3791d1eed6818c029ec6e2550c8a9e7c05ec564.png", + "featured": false, + "title": "Improved vanilla dungeons", + "description": " ", + "created": "2022-11-28T18:48:34.076498Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/o1C1Dkj5/images/e6466de1c65c2fab8324a732a9555d39074c586c.png", + "featured": false, + "title": "Catacombs surface entrance", + "description": null, + "created": "2022-11-28T18:50:36.580171Z", + "ordering": 0 + } + ], + "color": 3214106, + "thread_id": "o1C1Dkj5", + "monetization_status": "monetized" + }, + "YungsBetterEndIsland-1.20-Fabric-2.0.6": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19.2", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4" + ], + "id": "2BwBOmBQ", + "slug": "yungs-better-end-island", + "project_type": "mod", + "team": "lt2MvEeI", + "organization": "nuVP8uUG", + "title": "YUNG's Better End Island", + "description": "An overhaul of the main End Island where the dragon fight takes place!", + "body": "

\n\"YUNG's
\n\"Depends \"Join \"Follow \"Subscribe \"Support
\n\"What
\nAn overhaul of the main End Island where the dragon fight takes place!\n

Obsidian pillars, End gateways, the spawn platform, and the portal itself in the middle of the island have all been redesigned. Additionally, the dragon no longer spawns from the start - instead, it will be summoned once a player gets close to the bell tower in the center.

\n

To resummon the dragon, the 4 crystals no longer go right next to the portal. Instead, you'll see 4 bedrock blocks on the floor inside the tower, one in each directional wing of the building. The crystals can be placed on these 4 blocks to start summoning the dragon again. That being said, we do actually still support vanilla crystal summoning positions, to avoid confusing players who aren't familiar with the mod.

\n

The dragon's AI itself is unchanged.

\n

To use BEI on an existing world,\u00a0we've provided the /end_island reset command. Using this command while in the End will attempt to reset the dragon fight back to its initial state and replace any previous portal/pillars with our redesigned versions. But this command attempts some major things behind the scenes, so please back up your world before trying!\u00a0Also note that\u00a0simply deleting your End dimension files is not suffificient, and you will still need to run the command.

\n

If you're having issues with the portal/tower spawning after using the command, such as the portal spawning under the island, you can use the full command `/end_island reset true` to attempt to place the portal on the surface again. But once again, back up your world before trying it! Seriously!

\n

\n

\n\n

\n

\n\"Compatibility\"
\nYUNG's Better End Island is intended to be compatible with as many mods as possible. The following are compatibility notes for relevant End mods/datapacks:\n

\n
    \n
  • Endergetic Expansion
    • End Gateways in the Outer End will be from EE instead of BEI. Everything should still work properly though.
  • \n
  • Progressive Bosses
    • Extra cage placement may be a little scuffed in older versions of Progressive Bosses. Make sure you're on the latest version!
    • /end_island reset command may not properly reset fight history/progress on Progressive Bosses' side of things. If you use this command, you should also run /progressivebosses difficulty set dragon 0
  • \n
  • Better End
    • Since the island is smaller than in vanilla, obsidian spikes will spawn closer to the center
    • If any spikes are missing or you have any other issues with generation, try using the /end_island reset command while in the End
  • \n
  • Nullscape
    • Completely compatible on 1.19+. Not compatible on 1.18.2.
  • \n
  • Savage Ender Dragon
    • The crystals Better End Island adds in the center may rarely respawn, if crystal respawning from Savage Ender Dragon is enabled. Otherwise completely compatible.
  • \n
  • Ender Trigon
    • Completely compatible
  • \n
  • Incompatible
    • Stellarity
    • Valkyrien Skies
\n\n


\n\"Use

", + "body_url": null, + "published": "2023-08-10T22:08:54.700414Z", + "updated": "2024-05-17T01:23:16.466173Z", + "approved": "2023-09-15T18:13:58.063125Z", + "queued": "2023-09-14T18:08:00.979453Z", + "status": "approved", + "requested_status": "private", + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 1654745, + "followers": 693, + "categories": [ + "adventure", + "decoration", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "oV8ABTgb", + "TCi4C7SR", + "GzK0DHXl", + "61MlZk1C", + "2o3Fyh1D", + "AX0UDNyo", + "mId4Tfc1", + "rykIEAMG", + "5u2gcMh9", + "3aGqQrO1", + "25MjVFVn", + "7JaIbxzK", + "J2sdehqA", + "AlE4iEnJ", + "weh531it", + "KMWjIKnN", + "x7KJ0qFZ", + "mRCm0pL5", + "mjcajOXu", + "sPWRtsih", + "Izqhg3Va", + "qJTsmyiE", + "LjMYk6mH", + "PWvhCArM", + "C69Ea0wV", + "ZyoUJFuE", + "MFm60Cd1", + "xAXIqv7e" + ], + "icon_url": "https://cdn.modrinth.com/data/2BwBOmBQ/e4f0f8d1668eda0f22a87d8771bba8344ebfc4b9.png", + "issues_url": "https://github.com/yungnickyoung/YUNGs-Better-End-Island/issues", + "source_url": "https://github.com/yungnickyoung/YUNGs-Better-End-Island", + "wiki_url": null, + "discord_url": "https://discord.gg/rns3beq", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/yungnickyoung" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/2BwBOmBQ/images/540aa82dd7fa9d6490313b21e6261c15427ca1bf.png", + "featured": false, + "title": "New End Gateways", + "description": null, + "created": "2023-08-10T22:22:24.063975Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/2BwBOmBQ/images/7ea8218329da37c64a35b67166a610209bfdf5fc.png", + "featured": false, + "title": "Redesigned Spawn Platform", + "description": null, + "created": "2023-08-10T22:22:38.111353Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/2BwBOmBQ/images/bd46f8dbad600a98d88ace6d403e18856871a936.png", + "featured": false, + "title": "YUNG's Better End Island x Better End", + "description": null, + "created": "2023-08-10T22:22:00.969613Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/2BwBOmBQ/images/c94d0f0141791cf524d74dfe3cbafc738a5e636a.png", + "featured": true, + "title": null, + "description": null, + "created": "2023-09-23T22:39:19.768148Z", + "ordering": 0 + } + ], + "color": 2693433, + "thread_id": "1G0VKyCQ", + "monetization_status": "monetized" + }, + "YungsBetterJungleTemples-1.20-Fabric-2.0.5": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4" + ], + "id": "z9Ve58Ih", + "slug": "yungs-better-jungle-temples", + "project_type": "mod", + "team": "yK34icg8", + "organization": "nuVP8uUG", + "title": "YUNG's Better Jungle Temples", + "description": "A complete redesign of Minecraft's jungle temples!", + "body": "

\n\"YUNG's
\n\"Depends \"Join \"Follow \"Subscribe \"Support
\n\"What
\nA complete overhaul of Minecraft's jungle temples! YUNG's Better Jungle Temples completely redesigns jungle temples from the ground up, featuring a completely new design, traps, puzzles, and loot!\n

\n

\n\"Compatibility\"
\nYUNG's Better Jungle Temples includes built-in compatibility with many mods! If you're using any of the following mods, certain parts of the temple have a chance of spawning using special pieces. Note that this is an optional feature \u2014 these mods are not required to use Better Jungle Temples.\n

\n
    \n
  • Create
  • \n
  • Supplementaries
  • \n
  • Alex's Mobs (Forge only)
  • \n
  • Pick Your Poison (Fabric 1.19.2 only)
  • \n
\nYUNG's Better Jungle Temples is also intended to be fully compatible with every worldgen mod, including:\n\n


\n\"Use

", + "body_url": null, + "published": "2023-08-01T22:33:43.127062Z", + "updated": "2024-05-17T01:17:23.125474Z", + "approved": "2023-09-08T01:46:17.453047Z", + "queued": "2023-09-07T18:13:43.700807Z", + "status": "approved", + "requested_status": "private", + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 1688481, + "followers": 761, + "categories": [ + "adventure", + "decoration", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "nTG7jdrM", + "uLnkpEnp", + "nlCwNeL7", + "AaSzoIjG", + "REe7auh2", + "qk4AcUgB", + "Ak10Ymte", + "T8rVoTjv", + "ZnSyzkmN", + "1nV3BdLt", + "kvifUaXe", + "KrGANMei", + "uhy9jPGX", + "DIG3Vtjv", + "plZKEsHY", + "csNNUblm", + "ia46jcmb", + "kOYw43i3", + "kVVQp8zR", + "uXblfHXz", + "OBQVCOOK", + "Hno4zjlG", + "CXQc6EnZ", + "6LPrzuB0", + "oMIPxNmK", + "g6j5u6DM", + "Iq0fDEMt" + ], + "icon_url": "https://cdn.modrinth.com/data/z9Ve58Ih/4a410457d1eca88ad1d4a2c4e7672fc3014056e4.png", + "issues_url": "https://github.com/YUNG-GANG/YUNGs-Better-Jungle-Temples/issues", + "source_url": "https://github.com/YUNG-GANG/YUNGs-Better-Jungle-Temples", + "wiki_url": null, + "discord_url": "https://discord.gg/rns3beq", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/yungnickyoung" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/z9Ve58Ih/images/2a01851de68dbd1580254ae2cfaf2ad123d1ca6e.png", + "featured": true, + "title": "YUNG's Better Jungle Temples", + "description": null, + "created": "2023-08-01T22:41:10.421566Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/z9Ve58Ih/images/2edba993e580048f7985966807e60f44c3ee3028.png", + "featured": false, + "title": "A totally safe chest", + "description": null, + "created": "2023-08-01T22:41:38.165291Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/z9Ve58Ih/images/7bcc32ebe2cc66bbd964f31bb89bc6c541d6a8e1.png", + "featured": false, + "title": "Puzzles!", + "description": null, + "created": "2023-08-01T22:41:57.408901Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/z9Ve58Ih/images/be17d29a69a6b70f6cd8a81167e46f6847e2c6df.jpeg", + "featured": false, + "title": "Supplementaries compatibility", + "description": null, + "created": "2023-08-01T22:42:05.120140Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/z9Ve58Ih/images/dbe3bfee189de3eb6b41ad4f7d614ccceeec269a.png", + "featured": false, + "title": "Ancient statues", + "description": null, + "created": "2023-08-01T22:41:45.711915Z", + "ordering": 0 + } + ], + "color": 1253144, + "thread_id": "z9Ve58Ih", + "monetization_status": "monetized" + }, + "YungsBetterMineshafts-1.20-Fabric-4.0.4": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4" + ], + "id": "HjmxVlSr", + "slug": "yungs-better-mineshafts", + "project_type": "mod", + "team": "4X4QqWlw", + "organization": "nuVP8uUG", + "title": "YUNG's Better Mineshafts", + "description": "A long-awaited and much-needed abandoned mineshaft overhaul!", + "body": "

\n\"YUNG's
\n\"Depends \"Join \"Follow \"Subscribe \"Support
\n\"What
\nThis mod completely revamps vanilla abandoned mineshafts, changing them from boring straight lines into dynamic, varied webs of tunnels.
Find loot tucked away in the corners of abandoned workstations, or out in the open in a chest on a minecart.\n

\n
    \n
  • 13 biome variants, including a rare mushroom mineshaft!
  • \n
  • Abandoned workstations (common)
  • \n
  • Workstation cellars (less common)
  • \n
  • Ore deposits at the end of some tunnels with coal, iron, redstone, gold, lapis, emerald, and (very rarely) diamond!
  • \n
  • Abandoned miners' outposts (rare)
  • \n
  • Surface openings (very rare)
  • \n
\n

\n\"Compatibility\"
\nYUNG's Better Mineshafts is intended to be fully compatible with every worldgen mod, including:\n

\n\n


\n\"Use

", + "body_url": null, + "published": "2022-11-28T17:44:12.312404Z", + "updated": "2024-05-09T20:44:33.434449Z", + "approved": "2022-11-28T21:13:47.334644Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 1950006, + "followers": 1249, + "categories": [ + "adventure", + "decoration", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "iUlejQ4i", + "g2waVAZy", + "5abzcYs5", + "kA7MDzPW", + "TzrcWYpl", + "BcX4CMtc", + "JmB3Jh9x", + "McprBxTA", + "N75UXpfR", + "kbBSCFhO", + "UoFb8XqU", + "LAORtIY1", + "kVO57zxB", + "qLnQnqXS", + "vlpZvDsy", + "K4G8SGWy", + "tSco9t4E", + "2Z4xpeH5", + "a4fD45oH", + "St6cNi1U", + "JYbhvvYE", + "buSrqoIV", + "6bYbds1y" + ], + "icon_url": "https://cdn.modrinth.com/data/HjmxVlSr/947b35bc08547e1b16cd51e6fc1c621852ea30c9.png", + "issues_url": "https://github.com/YUNG-GANG/YUNGs-Better-Mineshafts/issues", + "source_url": "https://github.com/YUNG-GANG/YUNGs-Better-Mineshafts", + "wiki_url": null, + "discord_url": "https://discord.gg/rns3beq", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/yungnickyoung" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/HjmxVlSr/images/34a44aa5af1f4b20fe959fbb90a2299c8496a000.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-28T18:10:07.243676Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/HjmxVlSr/images/964c22df53b6b7a87df0e6f66fa5ea409c572225.png", + "featured": true, + "title": null, + "description": null, + "created": "2022-11-28T18:09:19.889684Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/HjmxVlSr/images/9e2e0764403af30a82c861dc9fe9821f24011264.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-28T18:10:02.285378Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/HjmxVlSr/images/eb599107a4feb2f0b61687e32b8f9138cce16280.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-28T18:09:59.608873Z", + "ordering": 0 + } + ], + "color": 2822148, + "thread_id": "HjmxVlSr", + "monetization_status": "monetized" + }, + "YungsBetterNetherFortresses-1.20-Fabric-2.0.6": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.18.2", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4" + ], + "id": "Z2mXHnxP", + "slug": "yungs-better-nether-fortresses", + "project_type": "mod", + "team": "5dSGn2do", + "organization": "nuVP8uUG", + "title": "YUNG's Better Nether Fortresses", + "description": "A complete redesign of Minecraft's Nether fortresses!", + "body": "

\n\"YUNG's
\n\"Depends \"Join \"Follow \"Subscribe \"Support
\n\"What
\nA complete overhaul of Minecraft's Nether fortresses! YUNG's Better Nether Fortresses completely redesigns Nether fortresses from the ground up. Compared to vanilla, Better Fortresses are much larger, more complex, and more rewarding. Each fortress is comprised of three parts\u00a0\u2014 the bridge networks, the Keep, and the Lava Halls that extend deep underground.\n

\n

\nYUNG's Better Nether Fortresses also includes built-in Create compatibility! If you're using Create, certain parts of the fortress have a chance of spawning using Create pieces. Note that this is an optional feature\u00a0\u2014 Create is not required to run this mod. Be sure to use the latest release of Create for your Minecraft version! Note that this is for 1.19.2+ only.\n

\n\n

\n\"Compatibility\"
\nYUNG's Better Nether Fortresses is intended to be fully compatible with every worldgen mod, including:\n

\n
    \n
  • YUNG's Ocean Monuments
  • \n
  • YUNG's Better Witch Huts
  • \n
  • YUNG's Extras
  • \n
  • Infernal Expansion, Better Nether & other Nether biome mods
  • \n
  • Apocalyptic Fortress: The AF fortress will spawn alongside the Better Fortress
  • \n
  • Bygone Nether: Better Fortresses will spawn instead of Bygone Nether's enhanced vanilla fortress
  • \n
\n


\n\"Use

", + "body_url": null, + "published": "2023-02-19T23:44:10.212939Z", + "updated": "2024-05-17T01:09:15.879520Z", + "approved": "2023-02-20T00:13:49.856348Z", + "queued": null, + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 1941135, + "followers": 1086, + "categories": [ + "adventure", + "decoration", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "Ge5jWFMt", + "LC6CBpn9", + "deDT156J", + "8Gq5f3b9", + "NySrIdMV", + "KAarwq7Z", + "kWtjzB64", + "uol0Ji2G", + "CogRXOHi", + "16pSLk6u", + "CthwWOrc", + "N2yKMcSO", + "gTTPcjUR", + "XzRYWtHN", + "tS9cnHTd", + "f3PibvQR", + "W4uRBVaV", + "9iPMgrMe", + "449b2DDy", + "YouhzPUf", + "iYszV4T0", + "RmyDSPdb", + "fQyD1cxI", + "kuHlZxVW", + "vKRSJIfJ", + "lrZS6PH1", + "qqIjSslt", + "QplnGAIz", + "wtF2F6Ax", + "lQXMx7kq", + "2nUEz0zq", + "FL88RLRu", + "jJn0Zg8g", + "W7R83Bhr", + "oVphbTam", + "IHNXXJ1L", + "BxEPEvgo", + "kDpdIch6", + "98DJ9gap", + "VYtNUWOc" + ], + "icon_url": "https://cdn.modrinth.com/data/Z2mXHnxP/c89b02a675b204bfbe1d7e494769e425355e23f9.png", + "issues_url": "https://github.com/YUNG-GANG/YUNGs-Better-Fortresses/issues", + "source_url": "https://github.com/YUNG-GANG/YUNGs-Better-Fortresses", + "wiki_url": null, + "discord_url": "https://discord.gg/rns3beq", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/yungnickyoung" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/Z2mXHnxP/images/243291a972d7eb4ab406fe42a77403dc9328521a.png", + "featured": false, + "title": "Bridges on bridges!", + "description": null, + "created": "2023-02-19T23:52:07.717526Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/Z2mXHnxP/images/53d6867990746adfd9f2ab7e62b707825072a63a.png", + "featured": false, + "title": "The Keep", + "description": null, + "created": "2023-02-19T23:51:51.338047Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/Z2mXHnxP/images/a1342b07e669e3a3bb7bcdd182d11d55b72876b2.png", + "featured": false, + "title": "Compatible with all sorts of biome mods!", + "description": null, + "created": "2023-02-19T23:52:28.072740Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/Z2mXHnxP/images/d31d5e626c5d8273d9c2afbc3b7ab268184c620e.png", + "featured": false, + "title": "Better Fortresses + Infernal Expansion", + "description": null, + "created": "2023-03-09T07:20:29.191779Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/Z2mXHnxP/images/df4f72afa15c0a7161b712b7bdaa8707e1c502d3.png", + "featured": true, + "title": "YUNG's Better Nether Fortresses", + "description": null, + "created": "2023-02-19T23:51:40.557007Z", + "ordering": 0 + } + ], + "color": 3345938, + "thread_id": "Z2mXHnxP", + "monetization_status": "monetized" + }, + "YungsBetterOceanMonuments-1.20-Fabric-3.0.4": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4" + ], + "id": "3dT9sgt4", + "slug": "yungs-better-ocean-monuments", + "project_type": "mod", + "team": "rMdUl4ik", + "organization": "nuVP8uUG", + "title": "YUNG's Better Ocean Monuments", + "description": "A complete redesign of Minecraft's ocean monuments!", + "body": "

\n\"YUNG's
\n\"Depends \"Join \"Follow \"Subscribe \"Support
\n\"What
\nA complete overhaul of Minecraft's ocean monuments! YUNG's Better Ocean Monuments fundamentally redesigns ocean monuments to be much more engaging and rewarding. Better Monuments are much larger than their vanilla counterparts and have completely randomized layouts. You'll find much better loot for your troubles, including Tridents and a Heart of the Sea!\n

\n\n

\n\"Compatibility\"
\nYUNG's Better Ocean Monuments is intended to be fully compatible with every worldgen mod, including:\n

\n\n


\n\"Use

", + "body_url": null, + "published": "2022-11-28T20:18:47.807434Z", + "updated": "2024-05-17T01:01:48.393747Z", + "approved": "2022-11-28T21:13:45.550489Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 1903135, + "followers": 1072, + "categories": [ + "adventure", + "decoration", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "xAjnizbV", + "sLd6wlQB", + "EeHu6MGe", + "8rQhPDfK", + "JY9IpWlt", + "4E8sbZ6U", + "QaEO28kO", + "QArcFtQd", + "zNEQO7qp", + "ZzZM3ac4", + "Sn8cPXAH", + "Uehc7tGO", + "unxdh73k", + "SyfairC7", + "SN4iZ7wf", + "4c00pjbt", + "XVZh8bzC", + "V46v23Uz", + "YIxZJeTP", + "M9acJ70z", + "nlziFcdk", + "wLGDeGkC", + "JWN07yAs", + "QIJxmFw7", + "M17dqdUp", + "un603qNR" + ], + "icon_url": "https://cdn.modrinth.com/data/3dT9sgt4/d8c15602c866a1cdddb10caec83e57f8ca33e146.png", + "issues_url": "https://github.com/YUNG-GANG/YUNGs-Better-Ocean-Monuments/issues", + "source_url": "https://github.com/YUNG-GANG/YUNGs-Better-Ocean-Monuments", + "wiki_url": null, + "discord_url": "https://discord.gg/rns3beq", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/yungnickyoung" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/3dT9sgt4/images/2391636af9661c98c7818bb5d3e5a78ee4fbebbe.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-29T00:25:45.022829Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/3dT9sgt4/images/442fae567e021185475ff9b2565eecd3b9bdff09.png", + "featured": true, + "title": null, + "description": null, + "created": "2022-11-29T00:25:47.910602Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/3dT9sgt4/images/51b111effed634b83de06dbf73fcdc088b9116d1.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-29T00:25:42.866784Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/3dT9sgt4/images/f0c8d67dc8dc17e029d6f327e1c33b6a4bb657e2.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-29T00:25:39.806033Z", + "ordering": 0 + } + ], + "color": 272682, + "thread_id": "3dT9sgt4", + "monetization_status": "monetized" + }, + "YungsBetterStrongholds-1.20-Fabric-4.0.3": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4" + ], + "id": "kidLKymU", + "slug": "yungs-better-strongholds", + "project_type": "mod", + "team": "2OSJ0L4h", + "organization": "nuVP8uUG", + "title": "YUNG's Better Strongholds", + "description": "A complete redesign of Minecraft's strongholds!", + "body": "

\n\"YUNG's
\n\"Depends \"Join \"Follow \"Subscribe \"Support
\n\"What
\nA complete redesign of Minecraft strongholds like never before, making them much more complex and exciting while still staying true to vanilla themes. There are over 15 different rooms, various types of tunnels and hallways, staircases, traps, and even hidden areas!\n

\n\n

\n\"Compatibility\"
\nYUNG's Better Strongholds is intended to be fully compatible with every worldgen mod, including:\n

\n
    \n
  • YUNG's Better Mineshafts
  • \n
  • YUNG's Better Dungeons
  • \n
  • YUNG's Extras
  • \n
  • YUNG's Bridges
  • \n
  • Better End
  • \n
  • End Remastered
  • \n
  • Repurposed Structures - If RS strongholds are enabled, Eyes of Ender will locate whichever stronghold is closest, regardless of if it's an RS stronghold or a Better Stronghold. RS also offers a custom data pack you can use in addition to the mod that adds repurposed versions of Better Strongholds to the Nether and End! Check it out here. Use the latest version of Repurposed Structures!!
  • \n
\n


\n\"Use

", + "body_url": null, + "published": "2022-11-28T18:15:54.501121Z", + "updated": "2024-05-17T00:38:09.615756Z", + "approved": "2022-11-28T21:13:51.293623Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 1844706, + "followers": 1179, + "categories": [ + "adventure", + "decoration", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "aW1VWzje", + "KZDwDgOz", + "ZpXd8UfW", + "YHxAEStw", + "AWml7PPK", + "tCcE7NO3", + "Q3DjpEP4", + "A5qUVGg0", + "z6g8BExo", + "VnyfzF7V", + "rwiShgsc", + "yV6hn0bB", + "4oLId1t7", + "Y05JQWx3", + "gQjNrmlk", + "lT8OssHA", + "ZtfRU7aq", + "uAbYQaPU", + "s54qs5Zb", + "a7u7DPrA", + "4tpvfG6R", + "kI0BeaJx" + ], + "icon_url": "https://cdn.modrinth.com/data/kidLKymU/c3c33be1c8b83ae8f69ba76cf0974cefcc620c47.png", + "issues_url": "https://github.com/YUNG-GANG/YUNGs-Better-Strongholds/issues", + "source_url": "https://github.com/YUNG-GANG/YUNGs-Better-Strongholds", + "wiki_url": null, + "discord_url": "https://discord.gg/rns3beq", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/yungnickyoung" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/kidLKymU/images/050aa0d8f566091b387eb44817f40d59808a9a25.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-29T00:30:03.084323Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/kidLKymU/images/50ee9e455a7a61cdb4652e5922ffaa573e33e377.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-29T00:30:00.950099Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/kidLKymU/images/b9781f7c78d89a5d4d34a41b9636055cf251800c.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-29T00:30:10.373573Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/kidLKymU/images/dea5e5a5f1422dfa68a90c35e873fe988782552d.png", + "featured": true, + "title": null, + "description": null, + "created": "2022-11-29T00:30:05.269722Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/kidLKymU/images/fd07e825b22e252f5d6f52db53461d97b4e3362e.png", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-29T00:30:07.625910Z", + "ordering": 0 + } + ], + "color": 1251873, + "thread_id": "kidLKymU", + "monetization_status": "monetized" + }, + "YungsBetterWitchHuts-1.20-Fabric-3.0.3": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4" + ], + "id": "t5FRdP87", + "slug": "yungs-better-witch-huts", + "project_type": "mod", + "team": "BqAnU8T5", + "organization": "nuVP8uUG", + "title": "YUNG's Better Witch Huts", + "description": "Adds overhauled witch huts to swamps!", + "body": "

\n\"YUNG's
\n\"Depends \"Join \"Follow \"Subscribe \"Support
\n\"What
\nAn upgrade to witch huts! This mod adds multiple new hut variants that can spawn as well as a witch's circle. Huts now have better designs and more meaningful loot. Brewing stands may contain items hinting at some of vanilla's potion recipes!

\n

\nBy default, vanilla witch huts will no longer spawn. You can re-enable them in the config.\n

\n

\n\"Compatibility\"
\nYUNG's Better Witch Huts is intended to be fully compatible with every worldgen mod, including:\n

\n\n


\n\"Use

", + "body_url": null, + "published": "2022-11-28T20:29:41.105726Z", + "updated": "2024-05-17T06:50:05.067308Z", + "approved": "2022-11-28T21:13:56.330550Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 1787640, + "followers": 958, + "categories": [ + "adventure", + "decoration", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "rAwSL8Wn", + "aGIYJrqz", + "4F6etNVF", + "dF8s3tl3", + "EVkItnSb", + "zbAesA1b", + "8j6is9ay", + "ymnwqLI1", + "EuHx0coi", + "ipDHJmCV", + "mwlYB7rq", + "lYpHN3iF", + "mO2Ou7pv", + "3CEVoaSN", + "SudRQQSY", + "hXyLPxPz", + "2kmhqa1o", + "hf9Pw91V", + "BIMTws7n", + "c5PmoGZz", + "ApxfQWlS", + "ZtIhxDv1" + ], + "icon_url": "https://cdn.modrinth.com/data/t5FRdP87/11a2ef27da06199842c8c10b3e3dc5e15fefd8a5.png", + "issues_url": "https://github.com/YUNG-GANG/YUNGs-Better-Witch-Huts/issues", + "source_url": "https://github.com/YUNG-GANG/YUNGs-Better-Witch-Huts", + "wiki_url": null, + "discord_url": "https://discord.gg/rns3beq", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/yungnickyoung" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/t5FRdP87/images/4d7edd1a8da8ee62802ec160399b93284afbf881.png", + "featured": false, + "title": null, + "description": "A witch's circle", + "created": "2022-11-29T00:31:10.290976Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/t5FRdP87/images/75a6d5eebcad1eb90d1df94a8e6aa1bb17ef0daf.png", + "featured": false, + "title": null, + "description": "Small witch hut", + "created": "2022-11-29T00:31:01.016799Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/t5FRdP87/images/cfd3722b525a373c7ad5b4d7bd30d796e4946635.png", + "featured": false, + "title": null, + "description": "Large witch hut", + "created": "2022-11-29T00:31:06.937600Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/t5FRdP87/images/d1ca4580ae1d2f90835355a1b1e07759ff1def3a.png", + "featured": true, + "title": null, + "description": "Duplex witch hut", + "created": "2022-11-29T00:31:04.218755Z", + "ordering": 0 + } + ], + "color": 1774086, + "thread_id": "t5FRdP87", + "monetization_status": "monetized" + }, + "YungsBridges-1.20-Fabric-4.0.3": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4" + ], + "id": "Ht4BfYp6", + "slug": "yungs-bridges", + "project_type": "mod", + "team": "13sU60QF", + "organization": "nuVP8uUG", + "title": "YUNG's Bridges", + "description": "Adds beautiful naturally generated bridges throughout the world!", + "body": "

\n\"YUNG's
\n\"Depends \"Join \"Follow \"Subscribe \"Support
\n\"What
\nYUNG's Bridges is the first Minecraft mod to ever add naturally generated bridges to the game. Explore the world and discover over 15 different types of bridges, each with biome-specific variants!\n

\n\n

\n\"Compatibility\"
\nYUNG's Bridges is intended to be fully compatible with every worldgen mod, including:\n

\n\n


\n\"Use

", + "body_url": null, + "published": "2022-11-28T22:06:46.403543Z", + "updated": "2024-05-17T07:05:14.135342Z", + "approved": "2022-11-28T23:37:21.230737Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 1516576, + "followers": 815, + "categories": [ + "adventure", + "decoration", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "rgVgefNE", + "42BwR2A5", + "W7cTjzEy", + "RHuxQShE", + "pWD9qGts", + "KqjSgDPc", + "kmK7n0CX", + "j10QkrM6", + "F6lxHU1v", + "KDibEgMd", + "KgO1gfM2", + "hvfjXu8d", + "UjHqaPUL", + "tx2e5Fjp", + "qxvR9ze6", + "1tsMy0YZ", + "agXdVUwG", + "3zaZ4cxk", + "eUYfoWxq", + "qWsaAXJc" + ], + "icon_url": "https://cdn.modrinth.com/data/Ht4BfYp6/1d55ae5220d5e8a3bd9224ce100c21492f43abb0.png", + "issues_url": "https://github.com/YUNG-GANG/YUNGs-Bridges/issues", + "source_url": "https://github.com/YUNG-GANG/YUNGs-Bridges", + "wiki_url": null, + "discord_url": "https://discord.gg/rns3beq", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/yungnickyoung" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/Ht4BfYp6/images/7a403ad4545200cf40c766a9b5f03678a726313f.jpeg", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-29T00:26:56.481564Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/Ht4BfYp6/images/acdbdc56bb8265197faaed79e27d9fa404aa794b.jpeg", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-29T00:26:57.255423Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/Ht4BfYp6/images/adad5a9cbe37071018e845def3eb9be9218fa615.jpeg", + "featured": false, + "title": null, + "description": null, + "created": "2022-11-29T00:26:58.476712Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/Ht4BfYp6/images/c9ce969fff7aed52a33885c443835d168703d721.jpeg", + "featured": true, + "title": null, + "description": null, + "created": "2022-11-29T00:26:55.582308Z", + "ordering": 0 + } + ], + "color": 3921308, + "thread_id": "Ht4BfYp6", + "monetization_status": "monetized" + }, + "YungsExtras-1.20-Fabric-4.0.3": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.4" + ], + "id": "ZYgyPyfq", + "slug": "yungs-extras", + "project_type": "mod", + "team": "DA5XhvGI", + "organization": "nuVP8uUG", + "title": "YUNG's Extras", + "description": "Extra structures, features, and vanilla+ content suitable for any modpack!", + "body": "

\n\"YUNG's
\n\"Depends \"Join \"Follow \"Subscribe \"Support
\n\"What
\n\u00a0A myriad of structures, features, and vanilla+ content. This mod is a collection of upgrades to vanilla Minecraft that are each individually too small for their own mods, but together create a nice finishing touch for your modpack. It's the cherry on top for any modpack.

\n

\nThe most recent release is the Swamp Structures for 1.18+, featuring:\n

    \n
  • Lots of\u00a0Ruins
  • \n
  • Ancient Pillars
  • \n
  • A few\u00a0very rare easter egg structures ;)
  • \n
\n

\n

\nThe initial release was the\u00a0Desert Decorations update, which included:\n

    \n
  • New and improved Desert Wells (including rare Wishing Wells which may have some treasure at the bottom!)
  • \n
  • Desert Obelisks
  • \n
  • Flame Outposts
  • \n
  • And more!
  • \n
\n

\nThis mod will receive content updates over time improving different parts of the game!
\nThis mod is very lightweight and has minimal performance impact.\n

\n

\n\"Compatibility\"
\nYUNG's Extras is intended to be fully compatible with every worldgen mod, including:\n

\n\n


\n\"Use

", + "body_url": null, + "published": "2022-11-28T20:37:43.727443Z", + "updated": "2024-05-17T06:55:53.319406Z", + "approved": "2022-11-28T22:09:14.642482Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 1281366, + "followers": 824, + "categories": [ + "adventure", + "decoration", + "worldgen" + ], + "additional_categories": [], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "Ltax470w", + "oODh25Uv", + "tEdVvBPJ", + "NxK9Eu2q", + "MUzrN78m", + "uJ7BZWEq", + "xV3hb9U8", + "jDmHcs7q", + "ES49Icuw", + "TKzbRjqo", + "h4m8J7w8", + "pfVTUz1L", + "YTvJanVJ", + "F1adMKW8", + "sPIYiD2o", + "3R3fnian", + "OwgN09h2", + "tA7Fnm1M", + "GiY3Uibv", + "hEhjUqf6" + ], + "icon_url": "https://cdn.modrinth.com/data/ZYgyPyfq/709b076c9de735145c95fb44c5239ff794ffac17.png", + "issues_url": "https://github.com/YUNG-GANG/YUNGs-Extras/issues", + "source_url": "https://github.com/YUNG-GANG/YUNGs-Extras", + "wiki_url": null, + "discord_url": "https://discord.gg/rns3beq", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/yungnickyoung" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/ZYgyPyfq/images/03212b89fe65986e8e5734719a8eff4820d68d4c.png", + "featured": true, + "title": null, + "description": "A large well in a Mojave Desert from BYG", + "created": "2022-11-29T00:29:08.220164Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ZYgyPyfq/images/1520712d84f41bf86cdc4a90e8df21109560d146.png", + "featured": false, + "title": null, + "description": "Nice little spot to take a seat and relax..", + "created": "2022-11-29T00:29:14.814065Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ZYgyPyfq/images/46d3b4ef0e51afd34abd7b651bdd8cd6597216e0.png", + "featured": false, + "title": null, + "description": "Desert Ruins", + "created": "2022-11-29T00:29:12.448063Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/ZYgyPyfq/images/b53da67c6e510c52b0b574343d2abb6f3c77230f.png", + "featured": false, + "title": null, + "description": "A lone Flame Outpost at the top of a sand dune", + "created": "2022-11-29T00:29:10.118465Z", + "ordering": 0 + } + ], + "color": 663064, + "thread_id": "ZYgyPyfq", + "monetization_status": "monetized" + }, + "YungsMenuTweaks-1.20.1-Fabric-1.0.2": { + "client_side": "required", + "server_side": "unsupported", + "game_versions": [ + "1.20.1", + "1.20.4", + "1.21" + ], + "id": "Hcy2DFKF", + "slug": "yungs-menu-tweaks", + "project_type": "mod", + "team": "liWua4gL", + "organization": "nuVP8uUG", + "title": "YUNG's Menu Tweaks", + "description": "A small, lightweight mod that makes browsing menus a lot easier", + "body": "

\n\"YUNG's
\n\"Depends \"Join \"Follow \"Subscribe \"Support
\n\"What
\nA lightweight client-side mod that makes navigating Minecraft's menus just a little bit easier.

\n

This mod allows you to:\n

    \n
  • Right click cycle buttons to go back to the previous option
  • \n
  • Use the mouse scroll wheel to change slider options
  • \n
  • Change the background of almost every options screen to any texture. No more dirt background!
  • \n
\nNote that the custom background option may result in invisible buttons when using certain modded menu layouts, so it is disabled by default.\n

\n

If you have ideas for other features we could add to this mod, feel free to let me know in the Discord!

\n

\n\"Compatibility\"
\nYUNG's Menu Tweaks should be compatible with any menu-changing mod, including ModMenu. Some important notes:\n

    \n
  • FancyMenu - Sometimes custom main menu screens made with FancyMenu will not work with the custom background option
  • \n
  • Sodium - The custom Video Settings menu that Sodium adds may not support the new menu navigation features this mod adds
  • \n
\n

\n

If you have any other compatibility issues, please let me know in the Discord!

\n


\n\"Use

", + "body_url": null, + "published": "2023-09-28T01:08:03.412614Z", + "updated": "2024-07-24T22:01:34.339096Z", + "approved": "2023-09-29T03:06:00.386385Z", + "queued": "2023-09-28T01:23:00.005352Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "LGPL-3.0-only", + "name": "GNU Lesser General Public License v3.0 only", + "url": null + }, + "downloads": 537105, + "followers": 188, + "categories": [ + "utility" + ], + "additional_categories": [ + "decoration", + "game-mechanics" + ], + "loaders": [ + "fabric", + "forge", + "neoforge" + ], + "versions": [ + "w1mW1SCE", + "F84m4wR5", + "5otRCiqG", + "JYUAcBh3", + "3FmFt8jI", + "QRV0K267", + "tvYcRU7g", + "H3lJxdVm", + "HWTQXfhm", + "rueMdpfd", + "slXHrjhI", + "yfBrdNmy", + "Y79h0GoV", + "P4Fc4m2Z" + ], + "icon_url": "https://cdn.modrinth.com/data/Hcy2DFKF/73a4e3df6a9f3915c0125ee5df9eec01c6f65da7.png", + "issues_url": "https://github.com/yungnickyoung/YUNGs-Menu-Tweaks/issues", + "source_url": "https://github.com/yungnickyoung/YUNGs-Menu-Tweaks", + "wiki_url": null, + "discord_url": "https://discord.gg/rns3beq", + "donation_urls": [ + { + "id": "patreon", + "platform": "Patreon", + "url": "https://www.patreon.com/yungnickyoung" + } + ], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/Hcy2DFKF/images/4b379beeefd4d45196ff52b2a4e9ae9c3681a7ae.png", + "featured": false, + "title": "Customized menu backgrounds", + "description": "Now you can finally make the background pink wool instead of dirt, just like you always wanted!", + "created": "2023-09-28T01:14:53.647622Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/Hcy2DFKF/images/8134c62547e5a3c1be69b1764db066ca9aecd980.png", + "featured": true, + "title": "Fully compatible with Catalogue!", + "description": null, + "created": "2023-09-28T01:14:42.215287Z", + "ordering": 0 + } + ], + "color": 397067, + "thread_id": "z5W9oiv5", + "monetization_status": "monetized" + }, + "zenith-1.2.3-1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20.1" + ], + "id": "TLZe11Uj", + "slug": "zenith", + "project_type": "mod", + "team": "v0Grnaux", + "organization": null, + "title": "Zenith", + "description": "Fabric apotheosis port, changes and expands upon many systems", + "body": "# Zenith\nA fabric port of [Apotheosis](https://www.curseforge.com/minecraft/mc-mods/apotheosis) by Shadows_of_Fire (Code) and Faellynna (Art). Do not report issues with Zenith to them! \n\n \n \n\nZenith is split into 6 modules, which all change different aspects of Minecraft's systems. \nRead the **Chronicle of Shadows** (Crafted with a book and a gold ingot) for more in depth information.\n\n\n
\nAdventure\n\nThe Adventure Module adds more interesting loot, bosses, gems and sockets\n\n![Mythic rarity netherite sword with affixes]( https://cdn.modrinth.com/data/TLZe11Uj/images/3fe5296894729e16effdc609b8a77dc5f22eeadb.png 'Example affix item tooltip')\nSalvaging \n\n\n
\n\n
\nEnchantment\n\nThe Enchantment module overhauls the enchanting system by changing the vanilla enchanting table \n\n![The new enchanting table screen, with more than just amount of bookshelves to keep a track of]( https://cdn.modrinth.com/data/TLZe11Uj/images/d9daef2b0d4a104acf74f515692cb1c66c5f8502.png 'New enchanting table screen')\n\n\n\nIt adds many enchantments, as well as a configurable max level for all enchantments\n![A netherite chestplate enchanted with higher level vanilla enchantments as well as some new enchantments]( https://cdn.modrinth.com/data/TLZe11Uj/images/5eb8921d3cf6611115a4b9cbb87f4096b23313a9.png 'Some Zenith enchantments, as well as some vanilla changes')\n\n
\n\n
\nPotion\n\nThe Potion module adds potions that are missing from the base game such as potions of resistance and luck, in addition to some new effects.\n\npicturesgohere \nIt also adds a potion charm, an item that\nmorepicturesgohere\n\n
\n\n
\nGarden\n\nThe Garden module allows for custom heights for cactus, sugarcane, and bamboo \n\n\npicturesgohere\n\n
\n\n
\nSpawner\n\nThe Spawner module allows for upgrading a spawner as well as moving it with silk touch\n\n\npicturesgohere \n\n\n
\n\n
\nVillage\n\nThe Village module adds a use to the fletching table, as well as new arrow types to craft with it. \n![The new UI for the Fletching Table, as well of a new arrow type]( https://cdn.modrinth.com/data/TLZe11Uj/images/e934f108e5bf77071048b97905b692a2bc732d2f.png 'New fletching table usage') \n\nIt also makes the wandering trader less useless. \n![A wandering trader with new and stronger trades]( https://cdn.modrinth.com/data/TLZe11Uj/images/1d58cc7f8b4317499bfbcc19f2355e4ab87f6a17.png 'Wandering Trader UI')\n\n\n
\n\n", + "body_url": null, + "published": "2023-10-15T04:37:09.283817Z", + "updated": "2024-07-29T04:14:57.053836Z", + "approved": "2023-10-16T18:19:32.290333Z", + "queued": "2023-10-15T06:33:03.381611Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 151557, + "followers": 60, + "categories": [ + "adventure", + "equipment", + "game-mechanics" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "ZCws70Mr", + "q9bMvwp6", + "akv2idqH", + "Ugl9yAJd", + "GWzcAhZt", + "AUnXFVm9", + "mi1W8TV7", + "p0JHjbwE", + "ZlXnnVaO", + "ab9Fx0Ly", + "ArIrGErM", + "SM6qKhBm", + "q2Wq7Ew7", + "ZR61NFKR", + "N25hDi8S", + "bI3ViGzW", + "kSzmZzip", + "V3JSVMqJ", + "XpgyfAYq", + "NOlXxFa1", + "umnY8aJj", + "bebiVoGn", + "xC39zQUU", + "P1A3tJnZ", + "Eo0Ojt3q", + "n59fTpXn", + "D9S0ua9V", + "ffgWpFS1", + "PwhBr7d6", + "XB1YPwyH", + "D3JxTPgz" + ], + "icon_url": "https://cdn.modrinth.com/data/TLZe11Uj/9ac577c0c25f1664a75eaa8bf04bbef94eb296b1.png", + "issues_url": "https://github.com/TheWinABagel/Zenith/issues", + "source_url": "https://github.com/TheWinABagel/Zenith/tree/1.20", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/TLZe11Uj/images/1d58cc7f8b4317499bfbcc19f2355e4ab87f6a17.png", + "featured": false, + "title": "New wandering trader trades", + "description": "A new tool added by the wandering trader", + "created": "2023-10-28T04:33:46.142550Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/TLZe11Uj/images/3fe5296894729e16effdc609b8a77dc5f22eeadb.png", + "featured": false, + "title": "Example Affix Item", + "description": "Netherite sword with affixes and increased attributes", + "created": "2023-10-28T02:20:28.008998Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/TLZe11Uj/images/5eb8921d3cf6611115a4b9cbb87f4096b23313a9.png", + "featured": false, + "title": "New Enchantments", + "description": "Example of some new enchantments, also shows off higher level vanilla enchantments", + "created": "2023-10-28T03:28:52.877622Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/TLZe11Uj/images/abd5cb8aaa232721317985a00bac58693bee8335.png", + "featured": false, + "title": "New gems", + "description": "Adventure module feature, dropped from bosses and obtained from loot sources", + "created": "2023-10-28T01:08:59.462297Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/TLZe11Uj/images/d9daef2b0d4a104acf74f515692cb1c66c5f8502.png", + "featured": true, + "title": "New and improved enchanting table", + "description": "The new enchanting table interface, allowing up to level 100 enchantments", + "created": "2023-10-15T06:31:07.887387Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/TLZe11Uj/images/e934f108e5bf77071048b97905b692a2bc732d2f.png", + "featured": false, + "title": "New Fletching table UI", + "description": "A new arrow type, as well as a crafting menu for the fletching table", + "created": "2023-10-28T05:22:45.896727Z", + "ordering": 0 + } + ], + "color": 5573748, + "thread_id": "1glulHVp", + "monetization_status": "monetized" + }, + "zenith_attributes-0.2.6": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20.1" + ], + "id": "9sxDq6mj", + "slug": "zenith-attributes", + "project_type": "mod", + "team": "nAxLGakD", + "organization": null, + "title": "Zenith Attributes", + "description": "Adds attributes, and an attributes viewer, used for Zenith", + "body": "Adds custom attributes that help in combat\n\nAdds a menu in the inventory to see all attributes that the player has\n\nReworks the armor and protection values to a slightly different curve", + "body_url": null, + "published": "2023-10-14T21:10:58.726695Z", + "updated": "2024-08-09T00:30:11.896103Z", + "approved": "2023-10-15T04:59:13.352914Z", + "queued": "2023-10-14T22:27:29.278254Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 156533, + "followers": 10, + "categories": [], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "owNV6y3U", + "JCoUSig8", + "7K1kUWqy", + "6EKSzRbI", + "NvtYt5vy", + "bSnZGn4p", + "cp2Ifvd4", + "qJaQgLN1", + "nA3p03QF", + "CSbFqyPt", + "MxESkOmd", + "Lqpt8Vi4", + "52biL8Om", + "jHgWOulM", + "MgBdJ4O4", + "KiTAjptK", + "xHhZfE2b", + "BdMGhfsy", + "kygPPNhU" + ], + "icon_url": "https://cdn.modrinth.com/data/9sxDq6mj/f44fbedca3f7e6326d9d1afedab08cfff5cee519.png", + "issues_url": "https://github.com/TheWinABagel/ZenithAttributes/issues", + "source_url": "https://github.com/TheWinABagel/ZenithAttributes", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": 8843403, + "thread_id": "F4hMpENJ", + "monetization_status": "monetized" + }, + "zephyr-0.5.0+1.20.1": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.20.1" + ], + "id": "14bALK1y", + "slug": "zephyr-mod", + "project_type": "mod", + "team": "kaYXX1Db", + "organization": null, + "title": "Zephyr", + "description": "Zenith Affixes and Gems for the RPG Series", + "body": "# Zephyr\nZenith Adventure Module content for the RPG Series\n\n## Required:\n- [Zenith](https://modrinth.com/mod/zenith)\n- [Spell Power Attributes](https://modrinth.com/mod/spell-power) \n### Optional\n- [Better Combat](https://modrinth.com/mod/better-combat) \n \n#### Note: As of 0.5+, Apotheosis is **no longer supported** via Sinytra Connector. A native port will probably be made at some point in the future. \n\n# \n[![Discord](https://img.shields.io/badge/Discord-gray?style=for-the-badge&logo=discord&labelColor=222222&color=888888)](https://lunapixel.studio/discord) \n[![GitHub](https://img.shields.io/badge/github-gray?style=for-the-badge&logo=github&labelColor=222222&color=888888)](https://github.com/muon-rw/)\n[![CurseForge](https://img.shields.io/badge/curseforge-gray?style=for-the-badge&logo=curseforge&labelColor=222222&color=888888)](https://www.curseforge.com/members/muonr/projects)\n[![Modrinth](https://img.shields.io/badge/modrinth-gray?style=for-the-badge&logo=modrinth&labelColor=222222&color=888888)](https://modrinth.com/user/muon-rw)\n\n\n## Content Added:\n### Gems:\n_There are gems for every major spell power school, and 6 tiers for every gem type_\n\n![Image of the fire gem, Dragonfire Spessartite.](https://github.com/muon-rw/cdn/blob/main/img/dragonfire_spessartite_large.png?raw=true)\n![Description of the frost gem, Dragonfire Spessartite. It can fit in fire weapons and armor, and gives fire-themed effects and attribute bonuses.](https://github.com/muon-rw/cdn/blob/main/img/dragonfire_spessartite_desc.png?raw=true)\n### Affixes:\n_There are affixes for every magic school type_\n![An example affixed frost staff, with high level frost spell power gems embedded and frost-specific effects. The name reads \"Volatile Netherite Frost Wand of Eternal Freezing\"](https://github.com/muon-rw/cdn/blob/main/img/affix_example.png?raw=true)\n#### Loot Categories:\n_You can manually override an item type in the adventure module config using any of this mod's 2 newly added types. Any weapon with the appropriate attributes should automatically receive a loot category, but you can override them in `adventure.cfg`:_\n\n`staff` (a two handed casting weapon)\n\n`wand` (a one handed casting weapon)\n\n_You can also sort affixes onto appropriate elemental gear automatically by placing them into an \"elemental/school_schoolname/\" directory._\n_\"schoolname\" should match up exactly with the registry name for a SpellSchool. For example:_\n`/data/zephyr/affixes/elemental/school_fire/attribute.json`\n\n\n\nOther features, such as bosses and affix loot entries, are planned.\n\nRequired both client and server side.", + "body_url": null, + "published": "2023-10-28T01:27:31.436616Z", + "updated": "2024-07-09T20:38:18.776674Z", + "approved": "2024-03-15T06:52:27.491073Z", + "queued": "2024-03-12T19:50:13.392918Z", + "status": "approved", + "requested_status": "approved", + "moderator_message": null, + "license": { + "id": "MIT", + "name": "MIT License", + "url": null + }, + "downloads": 5407, + "followers": 3, + "categories": [ + "adventure", + "magic" + ], + "additional_categories": [], + "loaders": [ + "fabric" + ], + "versions": [ + "GAb2b6SH", + "un0Mw9k3", + "m4Bmepoq", + "T4YaSwkN", + "tkZ95dgz", + "ZrNIKnPi", + "bpOmPXG1", + "f9CKJhXU" + ], + "icon_url": "https://cdn.modrinth.com/data/14bALK1y/34c9a049aba3944fa14276bfc43230bd52b2d70f.png", + "issues_url": "https://github.com/muon-rw/Zephyr/issues", + "source_url": "https://github.com/muon-rw/Zephyr", + "wiki_url": null, + "discord_url": null, + "donation_urls": [], + "gallery": [], + "color": 1056123, + "thread_id": "OHQhu073", + "monetization_status": "monetized" + }, + "[1.20.1-fabric]-Epic-Knights-9.8": { + "client_side": "required", + "server_side": "required", + "game_versions": [ + "1.12.2", + "1.16.5", + "1.17", + "1.17.1", + "1.18", + "1.18.1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2" + ], + "id": "L6jvzao4", + "slug": "epic-knights-shields-armor-and-weapons", + "project_type": "mod", + "team": "itzuYALb", + "organization": null, + "title": "Epic Knights: Shields Armor and Weapons", + "description": "Adds medieval armor and weapons", + "body": "

\"\"

\n

\"\"

\n

This mod aims to make the player feel like a medieval knight. At the moment, the modification contains a lot of new banner patterns, 15 sets of armor, 8 types of shields and 26 types of weapons, most of which can be made from 11 available materials: wood, stone, iron, gold, diamond, netherite, steel (new), copper, silver, tin, bronze.These weapons have special features like increased range and armor piercing. Also this mod adds steel to the game, which will not conflict with steel from other modifications. To craft steel, put an iron ingot in a blast furnace. On the latest version you can apply a banner on armor and horse armor (just like on a shield) and dye some types of armor. Configs are in the config/magistuarmory folder.

\n

IMPORTANT: Since 7.0 version this mod requires Architectury and Cloth Config to be installed.\"Discord

\n

\n

 

\n

\"\"

\n

Better Combat:
1.19.x and 1.18.x: Preset support.

\n

Epic Fight:
Epic Knights: Armor and Weapons is ideally combined with Epic Fight Mod on 1.16.5 version. To configure the Epic Fight Mod do the following:

\n

1.12.2: Download epicfight.cfg from Discord server and put it into the configs folder.

\n

1.16.5, 1.17 and 1.18: Download the datapack archieve from Discord server, unpack it and follow this tutorial: https://minecraft.fandom.com/wiki/Tutorials/Installing_a_data_pack.

\n

 

\n

\"\"

\n

\"Bisect

\n

 

\n

\"\"

\n

\n

 

\n

\"\"

\n

\"\"

\n

 

\n

\"\"

\n

\"\" Report me any bugs you found !!!

", + "body_url": null, + "published": "2022-11-26T07:28:04.495832Z", + "updated": "2024-04-30T17:50:28.186296Z", + "approved": "2022-11-26T18:38:41.427721Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": { + "message": "Please replace the CurseForge image links in your description with Modrinth gallery links", + "body": null + }, + "license": { + "id": "LicenseRef-All-Rights-Reserved", + "name": "", + "url": null + }, + "downloads": 180881, + "followers": 203, + "categories": [ + "equipment" + ], + "additional_categories": [ + "adventure" + ], + "loaders": [ + "fabric", + "forge" + ], + "versions": [ + "zZsO7TIO", + "FY86l4mQ", + "3aXIA1N9", + "s7HoL42h", + "ayPvmUtw", + "bMnOJJBH", + "SndsN5ka", + "CRd9JWXP", + "4EwSgOw5", + "5xo1YPpZ", + "iLU76NnU", + "GWYd9aZX", + "k7iuosNS", + "HqJpjMyJ", + "wC4Nldxb", + "h56Yc1HR", + "53hRuq5v", + "BASvFcsU", + "4h7fF1aA", + "WHcvqOVl", + "JDrMlEPq", + "DqSM2XNX" + ], + "icon_url": "https://cdn.modrinth.com/data/L6jvzao4/2eac93d65e0df5ce99db25a46209155281a37035.png", + "issues_url": "https://github.com/Magistu/Epic-Knights/issues", + "source_url": "https://github.com/Magistu/Epic-Knights", + "wiki_url": "https://docs.google.com/document/d/19cIxLeXQ2r_9zxP6q33WA7i4oFTGHVjnV5MTSIWXrKQ/edit?usp=sharing", + "discord_url": "https://discord.gg/R8U8Hpgr75", + "donation_urls": [], + "gallery": [], + "color": 3487285, + "thread_id": "L6jvzao4", + "monetization_status": "monetized" + }, + "[Fabric]CTOV-v3.4.6": { + "client_side": "unsupported", + "server_side": "required", + "game_versions": [ + "1.18.2-rc1", + "1.18.2", + "1.19", + "1.19.1", + "1.19.2", + "1.19.3", + "1.19.4", + "1.20", + "1.20.1", + "1.20.2", + "1.20.3", + "1.20.4", + "1.20.5", + "1.20.6", + "1.21" + ], + "id": "fgmhI8kH", + "slug": "ct-overhaul-village", + "project_type": "mod", + "team": "Zs08w8wX", + "organization": null, + "title": "ChoiceTheorem's Overhauled Village", + "description": "Enhances and creates new villages and pillager outposts, that perfectly fit into your Minecraft world.", + "body": "**![](https://www.bisecthosting.com/images/CF/CT_Overhauled_Village/BH_CT_HEADER.webp)**\n**![](https://www.bisecthosting.com/images/CF/CT_Overhauled_Village/BH_CT_BANNER1.webp)**\n\n**ChoiceTheorem's Overhauled Village (CTOV) is a mod that adds new and improved villages and pillager outposts to Minecraft.** It is available for both Forge and Fabric, and it works with most world-generation and structure mods. CTOV adds 23 village variants and 14 pillager outpost variants, each of which is tailored to the terrain, theme, and biome of your Minecraft world.\n\nCTOV will not be backported beyond 1.18.2 for the mod version and 1.17 for the datapack version. This means that if you are playing an older version of Minecraft, you will not be able to use CTOV.\n\n
FAQs\n\n1. **Is it safe to update CTOV to a newer version?**\nYes, it is safe to update CTOV to a newer version. However, if you do experience any problems, please let the mod author know so that they can fix them.\n\n2. **Is it safe to add CTOV to an already existing world?**\nYes, it is safe to add CTOV to an already existing world. However, the new structures will only spawn in newly generated chunks.\n\n3. **Is this mod for Forge or Fabric/Quilt?**\nCTOV is available for all three mod loaders: Forge, Fabric, and Quilt.\n\n4. **How can I locate the new structures?**\nTo locate the new structures, you can use the `/locate` command.\n For 1.18.2, you would use the following command:\n > /locate ctov:\\[structure\\_from\\_list\\]
\n\n For 1.19+, you would use the following command:\n > \u00a0/locate structure ctov:[structure_from_list]
\n\n The `[structure_from_list]` part of the command is the name of the structure that you want to locate. You can find a list of all the available structures in the CTOV documentation.\n\n5. **Does CTOV modify existing vanilla structures?**\nThe only structures that are modified by CTOV are vanilla villages in older versions. In newer versions, CTOV creates its own structures that are separate from vanilla villages.\n\n6. **What about the loot of these structures?**\nThe vast majority of structures use vanilla loot tables for better mod compatibility. However, they also use some custom loot tables to integrate said structures into the world better. You will still find pillager outpost loot in pillager outposts, profession chests in villages, as well as bells, workstations, etc., but you may also find new stuff like food, armour, and other goodies.\n\n7. **How can I report bugs/issues/suggestions?**\nTo report bugs, issues, or suggestions, please go to the CTOV GitHub repo and create an issue. You can also message the mod author on Discord.\n\n8. **Can I include CTOV in my modpack?**\nYes, you can include CTOV in your modpack. However, please be sure to give credit to the mod author and provide a link to their page.\n\n9. **Can I have CTOV for 1.x.x, please?**\nIf it's lower than 1.18.2, no. Please don't ask this question. The technical limit is too high here.\n\n10. **Can I give Choicetheorem any commission or support?**\nThe mod author does not accept commissions or monetary support. They are doing this as a hobby and do not want to be paid for their work.\n\nI hope this answers all of your questions.\n
\n\n**![](https://www.bisecthosting.com/images/CF/CT_Overhauled_Village/BH_CT_BANNER4.webp)**\n\n\nChoiceTheorem's Overhauled Village (CTOV) is compatible with most world-generation and structure mods. Full documentation is [here](https://github.com/ChoiceTheorem/ChoiceTheorem-s-overhauled-village/wiki/Compatibility)\n\nIt also works with Guard Villager and other structure packs by ChoiceTheorem.\nMods that add new villagers will need compatibility packs.\n\nHere are some more details about the compatibility of CTOV with other mods:\n\n- **World-generation mods:**\u00a0CTOV relies on vanilla biome Tags, so almost all world-generation mods like Terralith, Oh Biome You'll Go, and Biomes O'plenty will have appropriate CTOV villages in their biomes.\n- **Structure mods:** Various structure mods like Town&Tower and Repurposed structures also work well with CTOV. However, it is important to exercise caution when using too many mods, as this can cause instability. The same applies to Better Village.\n- **Other mods:**\u00a0Any other mod that doesn't affect villages and villagers will be compatible by default.\n- Mods that add new villagers will need compatibility packs, which can be found on the CurseForge website.\n\nMod integration\n\nAs a rule of thumb, it's compatible. If it isn't yet, It will be. Read this [wiki page](https://github.com/ChoiceTheorem/ChoiceTheorem-s-overhauled-village/wiki/Compatibility) for details!\n\nYou can suggest more mods in my GitHub Issue section.\n\n\n\n![](https://www.bisecthosting.com/images/CF/CT_Overhauled_Village/BH_CT_BANNER5.webp)\n\n[![discord-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/social/discord-plural_64h.png)](https://discord.gg/JzYEw7PxQv) \n[![github-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/social/github-plural_64h.png)](https://github.com/ChoiceTheorem/ChoiceTheorem-s-overhauled-village) \n[![twitter-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/social/twitter-plural_64h.png)](https://twitter.com/ChoiceTheorem)\n[![youtube-plural](https://cdn.jsdelivr.net/npm/@intergrav/devins-badges@3/assets/cozy-minimal/social/youtube-plural_64h.png)](https://www.youtube.com/channel/UCUSv0t-aWToQkpP5eonHmlA)\n\n**Credits**\n-----------\n\n* Vichy0623 for codesigning the builds\n* Robified for converting this datapack into a mod.\n\n[![](https://www.bisecthosting.com/images/CF/CT_Overhauled_Village/BH_CT_PROMO.webp)](https://bisecthosting.com/CT)", + "body_url": null, + "published": "2022-05-16T03:06:55.644362Z", + "updated": "2024-08-03T12:58:35.022255Z", + "approved": "2022-05-16T03:06:55.644362Z", + "queued": null, + "status": "approved", + "requested_status": null, + "moderator_message": null, + "license": { + "id": "CC-BY-NC-ND-4.0", + "name": "Creative Commons Attribution Non Commercial No Derivatives 4.0 International", + "url": null + }, + "downloads": 1319717, + "followers": 1483, + "categories": [ + "adventure", + "worldgen" + ], + "additional_categories": [ + "economy", + "utility" + ], + "loaders": [ + "fabric", + "forge", + "neoforge", + "quilt" + ], + "versions": [ + "sd27RBEO", + "N9bzxzVo", + "qvvu7W5e", + "BGJCx9uY", + "hWUQHLTy", + "vCg4Atsm", + "wP8LFpoA", + "JczZEgVm", + "VTwGNXsJ", + "LcnT1dY5", + "cSwNn8fR", + "KihNxY42", + "HuaUXmX8", + "9g99Yime", + "j703cf0E", + "3eXWBWdB", + "qC5GfpM0", + "Pg8s7GZE", + "mL9oaPkZ", + "JiU3eJDL", + "Fmf9SrAU", + "ygoCStaG", + "fFfVQkrT", + "D6NL63Wk", + "WCTtzdXO", + "tnyL873R", + "MrzGaj60", + "f51MDpat", + "j7JHN8EG", + "CXja9TJq", + "7LYJgioY", + "nF92O1uF", + "L6yQN8AJ", + "UlWylSLM", + "2pKy4ELO", + "vCaQDw8e", + "rKP4gGrZ", + "SHDgiWhe", + "KXEQACvr", + "BIB9Ritw", + "X39G2VTw", + "RifOWLPj", + "IA9IQPz7", + "wwPFyS91", + "Y209IY74", + "Hxo3cge6", + "LKEra9cd", + "b9dX0alZ", + "A6fGB12B", + "W3VoLOOK", + "5D3oDlLM" + ], + "icon_url": "https://cdn.modrinth.com/data/fgmhI8kH/76dd7230a35c12d4956985317ffd0c079d6a9148.jpeg", + "issues_url": "https://github.com/ChoiceTheorem/ChoiceTheorem-s-overhauled-village/issues", + "source_url": "https://github.com/ChoiceTheorem/ChoiceTheorem-s-overhauled-village", + "wiki_url": null, + "discord_url": "https://discord.gg/JzYEw7PxQv", + "donation_urls": [], + "gallery": [ + { + "url": "https://cdn.modrinth.com/data/fgmhI8kH/images/15d7bf1aa1b7174fde4a5dac2ed81d4b8adb4b06.png", + "featured": true, + "title": "Alpine-style mountain village", + "description": "Alpine-style mountain village next to a birch forest nearby", + "created": "2023-02-16T14:59:08.479569Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/fgmhI8kH/images/2f7b8e2fc46cbb9e7a83368a93ab1ba1feb110ed.webp", + "featured": false, + "title": "Banner image", + "description": null, + "created": "2023-08-30T14:36:27.082900Z", + "ordering": 0 + }, + { + "url": "https://cdn.modrinth.com/data/fgmhI8kH/images/576fb3e920f242512932434a51cba40b14da2750.png", + "featured": false, + "title": "Christmas styled village ", + "description": "Christmas styled village on Terralith mountainsCredit: Mugloved", + "created": "2022-05-16T03:14:39.271847Z", + "ordering": 0 + } + ], + "color": 5587502, + "thread_id": "fgmhI8kH", + "monetization_status": "monetized" + } + }, + "dependency_tree": { + "defK2XM3": { + "name": "adventurez-1.4.20", + "version_id": "mBYmRou0", + "dependencies": [ + "P7dR8mSH", + "9s6osm5g" + ] + }, + "sdaSaQEz": { + "name": "almostunified-fabric-1.20.1-0.9.4", + "version_id": "iVBf0ICr", + "dependencies": [] + }, + "fM515JnW": { + "name": "AmbientSounds_FABRIC_v6.0.3_mc1.20.1", + "version_id": "zTT9Dzv8", + "dependencies": [ + "OsZiaDHq", + "P7dR8mSH" + ] + }, + "k23mNPhZ": { + "name": "Aquamirae-6", + "version_id": "ouUaC54p", + "dependencies": [ + "P7dR8mSH", + "fU7jbFHc" + ] + }, + "QgooUXAJ": { + "name": "archers-1.2.5+1.20.1", + "version_id": "SOJ4DVD4", + "dependencies": [ + "AqaIIO6D", + "P7dR8mSH", + "XvoWJaA2", + "pduQXSbl" + ] + }, + "lhGA9TYQ": { + "name": "architectury-9.2.14-fabric", + "version_id": "WbL7MStR", + "dependencies": [ + "P7dR8mSH" + ] + }, + "td9zQQBq": { + "name": "archon-0.7.0", + "version_id": "lZt13Wur", + "dependencies": [ + "8ooWzSQP", + "P7dR8mSH" + ] + }, + "bb2EpKpx": { + "name": "Argonauts", + "version_id": "wLI6JsqG", + "dependencies": [ + "G1hIVOrD", + "P7dR8mSH" + ] + }, + "P0Mu4wcQ": { + "name": "artifacts-fabric-9.5.12", + "version_id": "jcPe37QH", + "dependencies": [ + "5aaWibi9", + "9s6osm5g", + "lhGA9TYQ" + ] + }, + "lOOpEntO": { + "name": "AttributeFix-Fabric-1.20.1-21.0.4", + "version_id": "B5XgR60E", + "dependencies": [ + "P7dR8mSH" + ] + }, + "8FdYDHF5": { + "name": "autotag-2.0.2+1.20", + "version_id": "ocD9XA8D", + "dependencies": [] + }, + "7zlUOZvb": { + "name": "azurelib-fabric-1.20.1-2.0.30", + "version_id": "Nj3DO9WH", + "dependencies": [ + "P7dR8mSH" + ] + }, + "pduQXSbl": { + "name": "azurelibarmor-fabric-1.20.1-2.0.6", + "version_id": "DLqxipmE", + "dependencies": [] + }, + "g96Z4WVZ": { + "name": "BadOptimizations-2.1.4-1.20.1", + "version_id": "GydKiUd0", + "dependencies": [] + }, + "MBAkmtvl": { + "name": "Balm", + "version_id": "mQSYta9T", + "dependencies": [ + "P7dR8mSH" + ] + }, + "sc2Pektv": { + "name": "basicweapons-1.2.3+1.20.1", + "version_id": "h0WwUNRU", + "dependencies": [] + }, + "BgNRHReB": { + "name": "bclib-3.0.14", + "version_id": "TPC86Pyz", + "dependencies": [ + "P7dR8mSH" + ] + }, + "Kt4RVKEd": { + "name": "beekeeperhut-fabric-mc1.20.1-2.0.1", + "version_id": "Iya1d63p", + "dependencies": [ + "P7dR8mSH" + ] + }, + "gc8OEnCC": { + "name": "better-end-4.0.11", + "version_id": "7QwyTILr", + "dependencies": [ + "BgNRHReB", + "P7dR8mSH" + ] + }, + "MpzVLzy5": { + "name": "better-nether-9.0.10", + "version_id": "IG7kgtJH", + "dependencies": [ + "BgNRHReB", + "P7dR8mSH" + ] + }, + "zCh7omyG": { + "name": "betterarcheology-1.1.9-1.20.1", + "version_id": "x5DacI7P", + "dependencies": [ + "Ua7DFN59" + ] + }, + "5sy6g3kz": { + "name": "bettercombat-fabric-1.8.5+1.20.1", + "version_id": "jhqZUDtT", + "dependencies": [ + "9s6osm5g", + "P7dR8mSH", + "gedNE4y2" + ] + }, + "VdEsgz29": { + "name": "bingus-1.20.1-fabric", + "version_id": "50PbwXLS", + "dependencies": [] + }, + "HXF82T3G": { + "name": "BiomesOPlenty-1.20.1-18.0.0.598", + "version_id": "peO5lWzX", + "dependencies": [ + "kkmrDlKT" + ] + }, + "1VSGxqkt": { + "name": "BlockRunner-v8.0.4-1.20.1-Fabric", + "version_id": "Bs0gyy0J", + "dependencies": [ + "QAGBst4M", + "ohNO6lps", + "P7dR8mSH" + ] + }, + "du3UfiLL": { + "name": "BOMD-1.7.5-1.20.1", + "version_id": "yoCCX4Cc", + "dependencies": [ + "8BmcQJ2H", + "9s6osm5g", + "Ha28R6CL", + "K01OU20C", + "P7dR8mSH" + ] + }, + "uy4Cnpcm": { + "name": "Bookshelf-Fabric-1.20.1-20.2.13", + "version_id": "CBnLZwRS", + "dependencies": [ + "P7dR8mSH" + ] + }, + "fEWKxVzh": { + "name": "Cadmus", + "version_id": "kzMsPbNB", + "dependencies": [ + "G1hIVOrD", + "P7dR8mSH" + ] + }, + "K01OU20C": { + "name": "cardinal-components-api-5.2.2", + "version_id": "qW85eawp", + "dependencies": [] + }, + "cChd25Tw": { + "name": "cavedweller-1.3.0", + "version_id": "qIrI7qcp", + "dependencies": [ + "8BmcQJ2H", + "P7dR8mSH", + "ccKDOlHs" + ] + }, + "9s6osm5g": { + "name": "cloth-config-11.1.118-fabric", + "version_id": "J3FLptsi", + "dependencies": [] + }, + "Wnxd13zP": { + "name": "Clumps-fabric-1.20.1-12.0.0.4", + "version_id": "hefSwtn6", + "dependencies": [ + "P7dR8mSH" + ] + }, + "e0M1UDsY": { + "name": "collective-1.20.1-7.80", + "version_id": "mLJbbJPj", + "dependencies": [] + }, + "wGKYL7st": { + "name": "combatroll-fabric-1.3.2+1.20.1", + "version_id": "rwRYD8bX", + "dependencies": [ + "gedNE4y2", + "9s6osm5g", + "P7dR8mSH" + ] + }, + "gMWAhU1n": { + "name": "convenientdecor-0.4.2", + "version_id": "N5ZG6AIP", + "dependencies": [ + "P7dR8mSH" + ] + }, + "OsZiaDHq": { + "name": "CreativeCore_FABRIC_v2.11.33_mc1.20.1", + "version_id": "NHhWpLCK", + "dependencies": [ + "P7dR8mSH" + ] + }, + "MI1LWe93": { + "name": "creeperoverhaul-3.0.2-fabric", + "version_id": "Mw0Hq1SZ", + "dependencies": [ + "8BmcQJ2H", + "G1hIVOrD", + "M1953qlQ" + ] + }, + "cl223EMc": { + "name": "cristellib-1.1.5-fabric", + "version_id": "tBnivdbu", + "dependencies": [ + "P7dR8mSH" + ] + }, + "meZK2DCX": { + "name": "dawn-5.0.0", + "version_id": "J6b05anw", + "dependencies": [ + "P7dR8mSH" + ] + }, + "QwxR6Gcd": { + "name": "Debugify-1.20.1+2.0", + "version_id": "6XDJoCks", + "dependencies": [ + "1eAoo2KR" + ] + }, + "t6BIRVZn": { + "name": "decorative_blocks-fabric-1.20.1-4.1.3", + "version_id": "FibgWXh0", + "dependencies": [ + "P7dR8mSH" + ] + }, + "fnAffV0n": { + "name": "deeperdarker-fabric-1.20-1.2.6", + "version_id": "Ze2TE9b0", + "dependencies": [ + "1eAoo2KR", + "P7dR8mSH" + ] + }, + "US6QuKdU": { + "name": "DEUF_Refabricated-MC1.20.1-1.1.0", + "version_id": "pizP8FAq", + "dependencies": [] + }, + "445bpKSe": { + "name": "Dimensional Sync Fixes", + "version_id": "ytqWo3I1", + "dependencies": [] + }, + "uCdwusMi": { + "name": "DistantHorizons-2.1.2-a-1.20.1-forge-fabric", + "version_id": "OwcStAhe", + "dependencies": [] + }, + "JrvR9OHr": { + "name": "doubledoors-1.20.1-5.9", + "version_id": "K8M8C81n", + "dependencies": [ + "e0M1UDsY" + ] + }, + "vZoqTqwv": { + "name": "Dungeon Now Loading-fabric-1.20.1-1.5", + "version_id": "e2aaNGip", + "dependencies": [] + }, + "tpehi7ww": { + "name": "dungeons-and-taverns-3.0.3.f", + "version_id": "d1sY0JqV", + "dependencies": [] + }, + "ENZmbSFZ": { + "name": "dungeon_difficulty-2.2.1+1.20.1", + "version_id": "nnllzcQl", + "dependencies": [ + "AqaIIO6D", + "P7dR8mSH" + ] + }, + "7YjclEGc": { + "name": "Dynamic Lights", + "version_id": "eU6PA0pr", + "dependencies": [] + }, + "nBaXIQY9": { + "name": "Eldritch_End-FABRIC-MC1.20.1-0.2.31", + "version_id": "Xx5Bo3G8", + "dependencies": [ + "7zlUOZvb", + "P1Kv5EAO" + ] + }, + "fRiHVvU7": { + "name": "emi-1.1.10+1.20.1+fabric", + "version_id": "8KtEM1az", + "dependencies": [] + }, + "OVuFYfre": { + "name": "enhancedblockentities-0.9+1.20", + "version_id": "i3v1Skck", + "dependencies": [ + "P7dR8mSH" + ] + }, + "NNAgCjsB": { + "name": "entityculling-fabric-1.6.6-mc1.20.1", + "version_id": "F3RXDl1W", + "dependencies": [ + "P7dR8mSH" + ] + }, + "4I1XuqiY": { + "name": "entity_model_features_fabric_1.20.1-2.1.3", + "version_id": "f3RkrLlq", + "dependencies": [ + "BVzZfTc1" + ] + }, + "BVzZfTc1": { + "name": "entity_texture_features_fabric_1.20.1-6.1.3", + "version_id": "fqFnWIXs", + "dependencies": [] + }, + "26nL5g7F": { + "name": "epicknightsnmages-0.0.2", + "version_id": "hrNxEvik", + "dependencies": [ + "7zlUOZvb", + "XvoWJaA2" + ] + }, + "RV1qfVQ8": { + "name": "ExplorersCompass-1.20.1-2.2.3-fabric", + "version_id": "9ntdShFb", + "dependencies": [] + }, + "P7dR8mSH": { + "name": "fabric-api-0.92.2+1.20.1", + "version_id": "P7uGFii0", + "dependencies": [] + }, + "ZJTGwAND": { + "name": "fabric-end-remastered-5.2.4", + "version_id": "4wKvHwVW", + "dependencies": [ + "P7dR8mSH" + ] + }, + "Ha28R6CL": { + "name": "fabric-language-kotlin-1.11.0+kotlin.2.0.0", + "version_id": "afsFajDC", + "dependencies": [] + }, + "ORX9fPw1": { + "name": "fakerlib-0.1.4", + "version_id": "7pRFET6N", + "dependencies": [ + "P7dR8mSH" + ] + }, + "Fb4jn8m6": { + "name": "FallingTree-1.20.1-4.3.4", + "version_id": "NrtzFkZE", + "dependencies": [] + }, + "uXXizFIs": { + "name": "ferritecore-6.0.1-fabric", + "version_id": "unerR5MN", + "dependencies": [] + }, + "ECOSu6pa": { + "name": "flowerymooblooms-fabric-mc1.20.1-2.0.2", + "version_id": "D9jX5JX6", + "dependencies": [ + "P7dR8mSH" + ] + }, + "ohNO6lps": { + "name": "ForgeConfigAPIPort-v8.0.0-1.20.1-Fabric", + "version_id": "CtENDTlF", + "dependencies": [ + "P7dR8mSH" + ] + }, + "5WeWGLoJ": { + "name": "ForgeConfigScreens-v8.0.2-1.20.1-Fabric", + "version_id": "nwy63zfI", + "dependencies": [ + "P7dR8mSH", + "mOgUt4GM", + "ohNO6lps" + ] + }, + "POQ2i9zu": { + "name": "friendsandfoes-fabric-mc1.20.1-2.0.15", + "version_id": "649c8iVS", + "dependencies": [ + "P7dR8mSH" + ] + }, + "LJ5wlCDr": { + "name": "fzzy_core-0.5.1+1.20.1", + "version_id": "G6CaE33O", + "dependencies": [ + "Ha28R6CL", + "P7dR8mSH" + ] + }, + "XIpMGI6r": { + "name": "gazebo-1.1.1+1.20.1", + "version_id": "7OXOb67d", + "dependencies": [ + "LrYZi08Q", + "P7dR8mSH" + ] + }, + "t7eXC8r7": { + "name": "gear_core-0.3.8+1.20.1", + "version_id": "I4jtbg7D", + "dependencies": [ + "Ha28R6CL", + "LJ5wlCDr", + "P7dR8mSH" + ] + }, + "8BmcQJ2H": { + "name": "geckolib-fabric-1.20.1-4.4.7", + "version_id": "BDftClTQ", + "dependencies": [ + "P7dR8mSH" + ] + }, + "TbriQCWD": { + "name": "GeckoLibIrisCompat-Fabric-1.0.0", + "version_id": "3Q4qBNwT", + "dependencies": [] + }, + "hl5OLM95": { + "name": "Geophilic v3.1.1 f15-48", + "version_id": "DI57oxoL", + "dependencies": [] + }, + "f4hp6FTb": { + "name": "grapplemod-1.8+1.20(.1)", + "version_id": "A6VKCyyT", + "dependencies": [] + }, + "ssUbhMkL": { + "name": "Gravestones", + "version_id": "Uw9uAQaY", + "dependencies": [ + "P7dR8mSH" + ] + }, + "59rkB3YY": { + "name": "guardvillagers-2.0.9-1.20.1", + "version_id": "86pJMC8z", + "dependencies": [ + "P7dR8mSH" + ] + }, + "pJmCFF0p": { + "name": "handcrafted-fabric-1.20.1-3.0.6", + "version_id": "NRw0CDAc", + "dependencies": [ + "G1hIVOrD", + "P7dR8mSH" + ] + }, + "lo90fZoB": { + "name": "Heracles", + "version_id": "Iw91uuFK", + "dependencies": [ + "G1hIVOrD", + "P7dR8mSH" + ] + }, + "5faXoLqX": { + "name": "Iceberg-1.20.1-fabric-1.1.18", + "version_id": "uu7sqQDO", + "dependencies": [] + }, + "5ZwdcRci": { + "name": "ImmediatelyFast-Fabric-1.2.18+1.20.4", + "version_id": "HX5WEfoR", + "dependencies": [] + }, + "XJ9is6vj": { + "name": "immersivemc-1.5.0-beta1-1.20.1-fabric", + "version_id": "D5i0F490", + "dependencies": [ + "ohNO6lps", + "lhGA9TYQ" + ] + }, + "eE2Db4YU": { + "name": "immersive_armors-1.6.1+1.20.1-fabric", + "version_id": "Waf0D48D", + "dependencies": [] + }, + "CVBAErky": { + "name": "imst-2.1.0", + "version_id": "C1fCIQSh", + "dependencies": [] + }, + "fECIioDQ": { + "name": "imst_n-1.1.0.zip", + "version_id": "DQPdL75T", + "dependencies": [] + }, + "Orvt0mRa": { + "name": "indium-1.0.34+mc1.20.1", + "version_id": "gofbpynL", + "dependencies": [ + "AANobbMI" + ] + }, + "5ibSyLAz": { + "name": "InventorySorter-1.9.0-1.20", + "version_id": "tr2ZGtz4", + "dependencies": [] + }, + "xwHe8V3O": { + "name": "invoke-0.2.4", + "version_id": "XKDV9Yjr", + "dependencies": [ + "NkGaQMDA" + ] + }, + "YL57xq9U": { + "name": "iris-1.7.2+mc1.20.1", + "version_id": "1CMVXDHo", + "dependencies": [ + "AANobbMI" + ] + }, + "nvQzSEkH": { + "name": "Jade-1.20-fabric-11.10.0", + "version_id": "vlM1OUBd", + "dependencies": [] + }, + "u6dRKJwZ": { + "name": "jei-1.20.1-fabric-15.10.0.29", + "version_id": "kjVUjoA6", + "dependencies": [] + }, + "sNJAIjUm": { + "name": "Jewelry-1.3.5+1.20.1", + "version_id": "nOwzxEZn", + "dependencies": [ + "5aaWibi9", + "8ooWzSQP", + "AqaIIO6D", + "LrYZi08Q", + "P7dR8mSH" + ] + }, + "Bb3Fi2JX": { + "name": "Kev's TieredZ Modifiers", + "version_id": "OvagV5Au", + "dependencies": [] + }, + "ZSeB6n9M": { + "name": "kevsequipmentsets-1.0.5", + "version_id": "HGvWNPM4", + "dependencies": [] + }, + "jq6pHt0U": { + "name": "kevslibrary-1.1.0", + "version_id": "L6vTMKdJ", + "dependencies": [] + }, + "zxQ8fN7I": { + "name": "kobold-outposts-2.0", + "version_id": "B4nzmoMh", + "dependencies": [] + }, + "atHH8NyV": { + "name": "LegendaryTooltips-1.20.1-fabric-1.4.5", + "version_id": "fvJtXL6i", + "dependencies": [ + "1OE8wbN0", + "5faXoLqX", + "ohNO6lps" + ] + }, + "uJXTNuf0": { + "name": "letsdo-camping-fabric-1.0.0", + "version_id": "w4TC1HEK", + "dependencies": [ + "5aaWibi9", + "lhGA9TYQ" + ] + }, + "yUBXc3AH": { + "name": "LibZ", + "version_id": "BEPAjfEE", + "dependencies": [ + "9s6osm5g", + "P7dR8mSH" + ] + }, + "gvQqBUqZ": { + "name": "lithium-fabric-mc1.20.1-0.11.2", + "version_id": "ZSNsJrPI", + "dependencies": [] + }, + "XaDC71GB": { + "name": "lithostitched-fabric-1.20.1-1.1.8", + "version_id": "6fbZrlp1", + "dependencies": [] + }, + "67kVxsaO": { + "name": "lmft-1.0.2+1.20-fabric", + "version_id": "IWpydKCV", + "dependencies": [] + }, + "TqCKvqjC": { + "name": "loadmyresources_fabric_1.0.4-1_MC_1.20", + "version_id": "vO7R2WNi", + "dependencies": [ + "P7dR8mSH" + ] + }, + "oMitr7dU": { + "name": "mcda-5.0.2", + "version_id": "kOZVEfRn", + "dependencies": [ + "Aqlf1Shp", + "FYpiwiBR", + "9s6osm5g", + "u58R1TMW", + "P7dR8mSH" + ] + }, + "FZmGDE43": { + "name": "mcdw-9.0.4", + "version_id": "S2yuB3CX", + "dependencies": [ + "9s6osm5g", + "Aqlf1Shp", + "FYpiwiBR", + "P7dR8mSH", + "u58R1TMW" + ] + }, + "GURcjz8O": { + "name": "mcw-bridges-3.0.0-mc1.20.1fabric", + "version_id": "RmsMXs3r", + "dependencies": [ + "P7dR8mSH" + ] + }, + "kNxa8z3e": { + "name": "mcw-doors-1.1.1fabric-mc1.20.1", + "version_id": "vkuwEpj0", + "dependencies": [ + "P7dR8mSH" + ] + }, + "GmwLse2I": { + "name": "mcw-fences-1.1.2-mc1.20.1fabric", + "version_id": "NxAYnOkJ", + "dependencies": [ + "P7dR8mSH" + ] + }, + "dtWC90iB": { + "name": "mcw-furniture-3.3.0-mc1.20.1fabric", + "version_id": "7aTbV3Sq", + "dependencies": [ + "P7dR8mSH" + ] + }, + "w4an97C2": { + "name": "mcw-lights-1.1.1-mc1.20.1fabric", + "version_id": "D8iZj41A", + "dependencies": [ + "P7dR8mSH" + ] + }, + "okE6QVAY": { + "name": "mcw-paintings-1.0.5-1.20.1fabric", + "version_id": "CwHvP3Pz", + "dependencies": [ + "P7dR8mSH" + ] + }, + "VRLhWB91": { + "name": "mcw-paths-1.0.5-1.20.1fabric", + "version_id": "vusBu5Up", + "dependencies": [ + "P7dR8mSH" + ] + }, + "B8jaH3P1": { + "name": "mcw-roofs-2.3.1-mc1.20.1fabric", + "version_id": "EOjhPmTj", + "dependencies": [ + "P7dR8mSH" + ] + }, + "n2fvCDlM": { + "name": "mcw-trapdoors-1.1.3-mc1.20.1fabric", + "version_id": "1UfQwdWq", + "dependencies": [ + "P7dR8mSH" + ] + }, + "C7I0BCni": { + "name": "mcw-windows-2.3.0-mc1.20.1fabric", + "version_id": "88sYNcv4", + "dependencies": [ + "P7dR8mSH" + ] + }, + "NRjRiSSD": { + "name": "memoryleakfix-fabric-1.17+-1.1.5", + "version_id": "5xvCCRjJ", + "dependencies": [] + }, + "9Qdvz1OV": { + "name": "minecells-1.8.3", + "version_id": "1Vbpo4ux", + "dependencies": [ + "P7dR8mSH", + "ccKDOlHs" + ] + }, + "3b1CFIR5": { + "name": "MobPlaques-v8.0.1-1.20.1-Fabric", + "version_id": "bcQFG4g7", + "dependencies": [ + "P7dR8mSH", + "QAGBst4M", + "ohNO6lps" + ] + }, + "avrKhvsK": { + "name": "mobs_of_mythology-fabric-1.20.1-2.0.2", + "version_id": "oSJicyN7", + "dependencies": [ + "7zlUOZvb", + "PuyPazRT", + "lhGA9TYQ" + ] + }, + "nmDcB62a": { + "name": "modernfix-fabric-5.19.0+mc1.20.1", + "version_id": "ZYnwHpym", + "dependencies": [] + }, + "mOgUt4GM": { + "name": "modmenu-7.2.2", + "version_id": "lEkperf6", + "dependencies": [] + }, + "Xt0pMhSq": { + "name": "more-totems-mod-2.16.0", + "version_id": "rOWXHX42", + "dependencies": [] + }, + "51shyZVL": { + "name": "moreculling-1.20.4-0.24.0", + "version_id": "3m5znPWm", + "dependencies": [ + "9s6osm5g" + ] + }, + "JiEhJ3WG": { + "name": "moremobvariants-fabric+1.20.1-1.3.1", + "version_id": "o6yyhzgj", + "dependencies": [ + "P7dR8mSH" + ] + }, + "derP0ten": { + "name": "MutantMonsters-v8.0.7-1.20.1-Fabric", + "version_id": "GEdQkhpr", + "dependencies": [ + "ohNO6lps", + "QAGBst4M", + "P7dR8mSH" + ] + }, + "kHc6jKsv": { + "name": "myLoot", + "version_id": "l74cjwnw", + "dependencies": [ + "40ytxGF2", + "P7dR8mSH" + ] + }, + "xP7vOoRA": { + "name": "mythic-mounts-1.20.1-7.2", + "version_id": "a9GfsY3e", + "dependencies": [ + "nU0bVIaL", + "8BmcQJ2H" + ] + }, + "ERH7cFoy": { + "name": "mythicupgrades-4.1.3+mc1.20.1", + "version_id": "KkROoKjO", + "dependencies": [ + "P7dR8mSH", + "ccKDOlHs" + ] + }, + "9daSQ9Yq": { + "name": "mythquest-1.2", + "version_id": "AwRDUZl5", + "dependencies": [] + }, + "F8BQNPWX": { + "name": "naturalist-fabric-4.0.3-1.20.1", + "version_id": "dMGBsRgz", + "dependencies": [ + "8BmcQJ2H" + ] + }, + "fPetb5Kh": { + "name": "NaturesCompass-1.20.1-2.2.3-fabric", + "version_id": "NovIXDxY", + "dependencies": [] + }, + "P1Kv5EAO": { + "name": "Necronomicon-Fabric-1.4.2", + "version_id": "twWimVNr", + "dependencies": [] + }, + "1s5x833P": { + "name": "Neruina-2.1.1-fabric+1.20.1", + "version_id": "IrhpPXR5", + "dependencies": [ + "P7dR8mSH" + ] + }, + "vI1QKJro": { + "name": "netherdepthsupgrade-fabric-3.1.6-1.20", + "version_id": "CdgX1NKy", + "dependencies": [ + "8BmcQJ2H" + ] + }, + "nPZr02ET": { + "name": "NetherPortalFix", + "version_id": "NANcEzKA", + "dependencies": [ + "MBAkmtvl" + ] + }, + "gsJ6q45e": { + "name": "nicer-skies-1.3.0+1.20.1", + "version_id": "CJ15oCV4", + "dependencies": [] + }, + "qQyHxfxd": { + "name": "NoChatReports-FABRIC-1.20.1-v2.2.2", + "version_id": "HeZZR2kF", + "dependencies": [] + }, + "fU7jbFHc": { + "name": "Obscure-API-16", + "version_id": "IWDYxZre", + "dependencies": [ + "P7dR8mSH" + ] + }, + "ccKDOlHs": { + "name": "owo-lib-0.11.2+1.20", + "version_id": "zyOBB7J4", + "dependencies": [ + "P7dR8mSH" + ] + }, + "wOZRkmgG": { + "name": "oxidized-1.8.2", + "version_id": "dH4eImYJ", + "dependencies": [ + "P7dR8mSH" + ] + }, + "c7m1mi73": { + "name": "packetfixer-fabric-1.4.2-1.19-to-1.20.1", + "version_id": "djNw6g8u", + "dependencies": [] + }, + "FxXkHaLe": { + "name": "paladins-1.3.1+1.20.1", + "version_id": "9FbzwRpY", + "dependencies": [ + "P7dR8mSH", + "XvoWJaA2", + "lP9Yrr1E", + "pduQXSbl", + "y9clIFY4" + ] + }, + "nU0bVIaL": { + "name": "Patchouli-1.20.1-84-FABRIC", + "version_id": "Y6tuH1cn", + "dependencies": [ + "P7dR8mSH" + ] + }, + "gedNE4y2": { + "name": "player-animation-lib-fabric-1.0.2-rc1+1.20", + "version_id": "yDqYTUaf", + "dependencies": [] + }, + "tagwiZkJ": { + "name": "polymorph-fabric-0.49.5+1.20.1", + "version_id": "EYWxtHOI", + "dependencies": [ + "P7dR8mSH" + ] + }, + "rcTfTZr3": { + "name": "PresenceFootsteps-1.9.4+1.20.1", + "version_id": "LjDXTyEn", + "dependencies": [ + "P7dR8mSH" + ] + }, + "1OE8wbN0": { + "name": "Prism-1.20.1-fabric-1.0.5", + "version_id": "Fmetb8IP", + "dependencies": [] + }, + "AOyJhFvl": { + "name": "projectile_damage-fabric-3.2.3+1.20.1", + "version_id": "TPkj1ZDs", + "dependencies": [ + "P7dR8mSH" + ] + }, + "GuE5FpvB": { + "name": "promenade-4.1.1", + "version_id": "A5YD9uS3", + "dependencies": [ + "P7dR8mSH", + "meZK2DCX" + ] + }, + "Udc4ShgP": { + "name": "ProtectionBalancer-FABRIC-1.1.0", + "version_id": "RUSThuct", + "dependencies": [ + "P1Kv5EAO", + "P7dR8mSH" + ] + }, + "FCFcFw09": { + "name": "puffish_attributes-0.5.0-1.20-fabric", + "version_id": "l9MXTh4H", + "dependencies": [ + "P7dR8mSH" + ] + }, + "hqQqvaa4": { + "name": "puffish_skills-0.12.2-1.20-fabric", + "version_id": "f7O8dT0T", + "dependencies": [ + "P7dR8mSH" + ] + }, + "QAGBst4M": { + "name": "PuzzlesLib-v8.1.21-1.20.1-Fabric", + "version_id": "xjQF8bha", + "dependencies": [ + "ohNO6lps", + "P7dR8mSH" + ] + }, + "AqaIIO6D": { + "name": "ranged_weapon_api-1.1.2+1.20.1", + "version_id": "R1YG5awX", + "dependencies": [ + "P7dR8mSH" + ] + }, + "r3VgI4QN": { + "name": "reacharound+1.20-1.3.0", + "version_id": "29DyXaiq", + "dependencies": [ + "P7dR8mSH" + ] + }, + "uZQipe0a": { + "name": "ReBalance-FABRIC-1.1.0", + "version_id": "pAXbnwiG", + "dependencies": [ + "P1Kv5EAO" + ] + }, + "sk4iFZGy": { + "name": "remove-terralith-intro-message-1.0", + "version_id": "2jAppOW4", + "dependencies": [ + "8oi3bsk5" + ] + }, + "muf0XoRe": { + "name": "repurposed_structures-7.1.15+1.20.1-fabric", + "version_id": "MuqUgLqO", + "dependencies": [ + "P7dR8mSH", + "codAaoxh" + ] + }, + "G1hIVOrD": { + "name": "Resourceful Lib", + "version_id": "4u04iwUx", + "dependencies": [ + "P7dR8mSH" + ] + }, + "M1953qlQ": { + "name": "resourcefulconfig-fabric-1.20.1-2.1.2", + "version_id": "PlEObkl9", + "dependencies": [] + }, + "MGRhpQYp": { + "name": "Revive", + "version_id": "eW6ZYUVj", + "dependencies": [ + "9s6osm5g", + "P7dR8mSH" + ] + }, + "3MKqoGuP": { + "name": "rogues-1.1.0+1.20.1", + "version_id": "Zv9heBzC", + "dependencies": [ + "P7dR8mSH", + "XvoWJaA2", + "pduQXSbl" + ] + }, + "lP9Yrr1E": { + "name": "runes-0.9.13+1.20.1", + "version_id": "Z915LCkR", + "dependencies": [ + "P7dR8mSH" + ] + }, + "lyvwxqAy": { + "name": "simplyskills-1.5.0+1.20.1", + "version_id": "oWdYf42D", + "dependencies": [ + "8ooWzSQP", + "FCFcFw09", + "XvoWJaA2", + "hqQqvaa4" + ] + }, + "bK3Ubu9p": { + "name": "simplyswords-fabric-1.55.0-1.20.1", + "version_id": "r5QBtUE9", + "dependencies": [ + "9s6osm5g", + "lhGA9TYQ" + ] + }, + "rGWEHQrP": { + "name": "smallships-fabric-1.20.1-2.0.0-b1.4", + "version_id": "gpbYUuEr", + "dependencies": [ + "P7dR8mSH" + ] + }, + "PuyPazRT": { + "name": "SmartBrainLib-fabric-1.20.1-1.14.2", + "version_id": "XsqXgUo1", + "dependencies": [] + }, + "BVgHoKxg": { + "name": "Sniffer+-fabric-1.20.1-0.3.0", + "version_id": "pJlIaMGq", + "dependencies": [] + }, + "PtjYWJkn": { + "name": "sodium-extra-0.5.4+mc1.20.1-build.115", + "version_id": "I7ggF6B5", + "dependencies": [ + "AANobbMI", + "P7dR8mSH" + ] + }, + "AANobbMI": { + "name": "sodium-fabric-0.5.11+mc1.20.1", + "version_id": "ygf8cVZg", + "dependencies": [] + }, + "oX6SohLj": { + "name": "soulslike-weaponry-1.1.4.1-1.20.1-fabric", + "version_id": "1KCOAajo", + "dependencies": [ + "AqaIIO6D", + "8BmcQJ2H", + "lOOpEntO", + "P7dR8mSH" + ] + }, + "qyVF9oeo": { + "name": "sound-physics-remastered-fabric-1.20.1-1.4.5", + "version_id": "MmKSrFU9", + "dependencies": [] + }, + "l6YH9Als": { + "name": "spark", + "version_id": "XGW2fviP", + "dependencies": [] + }, + "XvoWJaA2": { + "name": "spell_engine-0.15.8+1.20.1", + "version_id": "eX4YqiVK", + "dependencies": [ + "5aaWibi9", + "8ooWzSQP", + "9s6osm5g", + "P7dR8mSH", + "gedNE4y2" + ] + }, + "8ooWzSQP": { + "name": "spell_power-0.11.1+1.20.1", + "version_id": "nT0Hl1AE", + "dependencies": [ + "P7dR8mSH" + ] + }, + "40ytxGF2": { + "name": "SpoornPacks", + "version_id": "NSN0Yoyz", + "dependencies": [ + "P7dR8mSH" + ] + }, + "H8CaAYZC": { + "name": "starlight-1.1.2+fabric.dbc156f", + "version_id": "XGIsoVGT", + "dependencies": [] + }, + "6L3ydNi8": { + "name": "starterkit-1.20.1-7.1", + "version_id": "nGVvCsgb", + "dependencies": [ + "e0M1UDsY" + ] + }, + "kkmrDlKT": { + "name": "TerraBlender-fabric-1.20.1-3.0.1.7", + "version_id": "FZV63yhg", + "dependencies": [ + "P7dR8mSH" + ] + }, + "8oi3bsk5": { + "name": "Terralith_1.20.x_v2.5.4", + "version_id": "WeYhEb5d", + "dependencies": [] + }, + "QivVPB8W": { + "name": "The_Graveyard_3.1_(FABRIC)_for_1.20.1", + "version_id": "Hpn2GMza", + "dependencies": [ + "8BmcQJ2H" + ] + }, + "z6sMEexp": { + "name": "TieredZ", + "version_id": "GFUW7N2P", + "dependencies": [ + "8FdYDHF5", + "9s6osm5g", + "P7dR8mSH", + "yUBXc3AH" + ] + }, + "FGlHZl7X": { + "name": "tlc-fabric-1.0.1-1.20.X", + "version_id": "r1kI9nMD", + "dependencies": [ + "P7dR8mSH" + ] + }, + "w6JSkKSH": { + "name": "toofast-fabric-1.20-1.2.0", + "version_id": "ZyY2Xraw", + "dependencies": [] + }, + "5aaWibi9": { + "name": "trinkets-3.7.2", + "version_id": "AHxQGtuC", + "dependencies": [] + }, + "Pf8PJBb5": { + "name": "True Darkness Refabricated", + "version_id": "fH6YSSxd", + "dependencies": [ + "9s6osm5g" + ] + }, + "1imrOvDk": { + "name": "valentinesblessing 1.5.0 1.20.1 fabric", + "version_id": "gFWULXkY", + "dependencies": [] + }, + "XiC6HzoU": { + "name": "vc_gliders-fabric-1.1.5", + "version_id": "9Qu0MGnH", + "dependencies": [ + "P7dR8mSH" + ] + }, + "bRAPbNyF": { + "name": "veinmining-fabric-1.5.0+1.20.1", + "version_id": "PFFXEfYV", + "dependencies": [ + "P7dR8mSH" + ] + }, + "oHGMwNDR": { + "name": "VillagersPlus_3.1_(FABRIC)_for_1.20.1", + "version_id": "Tl5Kx50I", + "dependencies": [ + "P7dR8mSH" + ] + }, + "klXONLDA": { + "name": "villagesandpillages-fabric-mc1.20.1-1.0.0", + "version_id": "emWkyeQg", + "dependencies": [ + "Ua7DFN59", + "P7dR8mSH" + ] + }, + "KplTt9Ku": { + "name": "villagespawnpoint-1.20.1-4.4", + "version_id": "pmuo4Sz9", + "dependencies": [ + "e0M1UDsY" + ] + }, + "wGoQDPN5": { + "name": "vivecraft-1.20.1-1.1.11-fabric", + "version_id": "xC0Vh8WO", + "dependencies": [] + }, + "9eGKb6K1": { + "name": "voicechat-fabric-1.20.1-2.5.19", + "version_id": "OIOFhV0j", + "dependencies": [] + }, + "XpGUobxt": { + "name": "VR-Combat_v1.0.2_Fabric_ALL", + "version_id": "mW4eHntZ", + "dependencies": [ + "5sy6g3kz", + "wGoQDPN5" + ] + }, + "B3INNxum": { + "name": "vrapi-3.0.9-1.20.1-fabric", + "version_id": "4tJF8iTk", + "dependencies": [ + "lhGA9TYQ" + ] + }, + "Vr3O6THr": { + "name": "Wabi-Sabi-Structures-2.0.0-1.20-Fabric", + "version_id": "PSSSimgY", + "dependencies": [ + "P7dR8mSH" + ] + }, + "oUoetxfR": { + "name": "walljump-1.20.1-1.2.1-fabric", + "version_id": "xCmWdqxU", + "dependencies": [] + }, + "lO0vzQUy": { + "name": "way2wayfabric-0.0.6", + "version_id": "IBsP5dyt", + "dependencies": [ + "Ha28R6CL" + ] + }, + "8DfbfASn": { + "name": "When Dungeons Arise", + "version_id": "Vd5XOXlj", + "dependencies": [] + }, + "NkGaQMDA": { + "name": "wizards-1.3.0+1.20.1", + "version_id": "hMGphtUf", + "dependencies": [ + "8ooWzSQP", + "P7dR8mSH", + "XvoWJaA2", + "lP9Yrr1E", + "pduQXSbl" + ] + }, + "sTZr7NVo": { + "name": "wraith-waystones-3.3.2+mc1.20.1", + "version_id": "DZAntbmD", + "dependencies": [ + "P7dR8mSH", + "ccKDOlHs" + ] + }, + "NcUtCpym": { + "name": "XaerosWorldMap_1.38.8_Fabric_1.20", + "version_id": "szULGs3b", + "dependencies": [ + "P7dR8mSH" + ] + }, + "1bokaNcj": { + "name": "Xaeros_Minimap_24.2.0_Fabric_1.20", + "version_id": "WQEX096d", + "dependencies": [ + "P7dR8mSH" + ] + }, + "1eAoo2KR": { + "name": "YetAnotherConfigLib-3.5.0+1.20.1-fabric", + "version_id": "gQuF6HNa", + "dependencies": [ + "P7dR8mSH" + ] + }, + "Ua7DFN59": { + "name": "YungsApi-1.20-Fabric-4.0.5", + "version_id": "zPT7QfIk", + "dependencies": [ + "P7dR8mSH" + ] + }, + "XNlO7sBv": { + "name": "YungsBetterDesertTemples-1.20-Fabric-3.0.3", + "version_id": "1Z9HNWpj", + "dependencies": [ + "P7dR8mSH", + "Ua7DFN59", + "9s6osm5g" + ] + }, + "o1C1Dkj5": { + "name": "YungsBetterDungeons-1.20-Fabric-4.0.4", + "version_id": "nidyvq2m", + "dependencies": [ + "9s6osm5g", + "P7dR8mSH", + "Ua7DFN59" + ] + }, + "2BwBOmBQ": { + "name": "YungsBetterEndIsland-1.20-Fabric-2.0.6", + "version_id": "qJTsmyiE", + "dependencies": [ + "Ua7DFN59", + "9s6osm5g", + "P7dR8mSH" + ] + }, + "z9Ve58Ih": { + "name": "YungsBetterJungleTemples-1.20-Fabric-2.0.5", + "version_id": "6LPrzuB0", + "dependencies": [ + "Ua7DFN59", + "P7dR8mSH", + "9s6osm5g" + ] + }, + "HjmxVlSr": { + "name": "YungsBetterMineshafts-1.20-Fabric-4.0.4", + "version_id": "qLnQnqXS", + "dependencies": [ + "9s6osm5g", + "P7dR8mSH", + "Ua7DFN59" + ] + }, + "Z2mXHnxP": { + "name": "YungsBetterNetherFortresses-1.20-Fabric-2.0.6", + "version_id": "FL88RLRu", + "dependencies": [ + "Ua7DFN59", + "9s6osm5g", + "P7dR8mSH" + ] + }, + "3dT9sgt4": { + "name": "YungsBetterOceanMonuments-1.20-Fabric-3.0.4", + "version_id": "4c00pjbt", + "dependencies": [ + "9s6osm5g", + "P7dR8mSH", + "Ua7DFN59" + ] + }, + "kidLKymU": { + "name": "YungsBetterStrongholds-1.20-Fabric-4.0.3", + "version_id": "yV6hn0bB", + "dependencies": [ + "9s6osm5g", + "P7dR8mSH", + "Ua7DFN59" + ] + }, + "t5FRdP87": { + "name": "YungsBetterWitchHuts-1.20-Fabric-3.0.3", + "version_id": "lYpHN3iF", + "dependencies": [ + "9s6osm5g", + "P7dR8mSH", + "Ua7DFN59" + ] + }, + "Ht4BfYp6": { + "name": "YungsBridges-1.20-Fabric-4.0.3", + "version_id": "hvfjXu8d", + "dependencies": [ + "9s6osm5g", + "P7dR8mSH", + "Ua7DFN59" + ] + }, + "ZYgyPyfq": { + "name": "YungsExtras-1.20-Fabric-4.0.3", + "version_id": "pfVTUz1L", + "dependencies": [ + "9s6osm5g", + "P7dR8mSH", + "Ua7DFN59" + ] + }, + "Hcy2DFKF": { + "name": "YungsMenuTweaks-1.20.1-Fabric-1.0.2", + "version_id": "QRV0K267", + "dependencies": [ + "9s6osm5g", + "P7dR8mSH", + "Ua7DFN59" + ] + }, + "TLZe11Uj": { + "name": "zenith-1.2.3-1.20.1", + "version_id": "D3JxTPgz", + "dependencies": [ + "9sxDq6mj", + "ORX9fPw1", + "P7dR8mSH" + ] + }, + "9sxDq6mj": { + "name": "zenith_attributes-0.2.6", + "version_id": "BdMGhfsy", + "dependencies": [ + "ORX9fPw1", + "P7dR8mSH" + ] + }, + "14bALK1y": { + "name": "zephyr-0.5.0+1.20.1", + "version_id": "f9CKJhXU", + "dependencies": [ + "TLZe11Uj", + "XvoWJaA2" + ] + }, + "L6jvzao4": { + "name": "[1.20.1-fabric]-Epic-Knights-9.8", + "version_id": "4h7fF1aA", + "dependencies": [ + "9s6osm5g", + "lhGA9TYQ" + ] + }, + "fgmhI8kH": { + "name": "[Fabric]CTOV-v3.4.6", + "version_id": "LKEra9cd", + "dependencies": [ + "XaDC71GB" + ] + } + } +} \ No newline at end of file diff --git a/website/pico.min.css b/website/pico.min.css new file mode 100644 index 0000000..5928ed7 --- /dev/null +++ b/website/pico.min.css @@ -0,0 +1,4 @@ +@charset "UTF-8";/*! + * Pico CSS ✨ v2.0.6 (https://picocss.com) + * Copyright 2019-2024 - Licensed under MIT + */:root{--pico-font-family-emoji:"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--pico-font-family-sans-serif:system-ui,"Segoe UI",Roboto,Oxygen,Ubuntu,Cantarell,Helvetica,Arial,"Helvetica Neue",sans-serif,var(--pico-font-family-emoji);--pico-font-family-monospace:ui-monospace,SFMono-Regular,"SF Mono",Menlo,Consolas,"Liberation Mono",monospace,var(--pico-font-family-emoji);--pico-font-family:var(--pico-font-family-sans-serif);--pico-line-height:1.5;--pico-font-weight:400;--pico-font-size:100%;--pico-text-underline-offset:0.1rem;--pico-border-radius:0.25rem;--pico-border-width:0.0625rem;--pico-outline-width:0.125rem;--pico-transition:0.2s ease-in-out;--pico-spacing:1rem;--pico-typography-spacing-vertical:1rem;--pico-block-spacing-vertical:var(--pico-spacing);--pico-block-spacing-horizontal:var(--pico-spacing);--pico-grid-column-gap:var(--pico-spacing);--pico-grid-row-gap:var(--pico-spacing);--pico-form-element-spacing-vertical:0.75rem;--pico-form-element-spacing-horizontal:1rem;--pico-group-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-group-box-shadow-focus-with-button:0 0 0 var(--pico-outline-width) var(--pico-primary-focus);--pico-group-box-shadow-focus-with-input:0 0 0 0.0625rem var(--pico-form-element-border-color);--pico-modal-overlay-backdrop-filter:blur(0.375rem);--pico-nav-element-spacing-vertical:1rem;--pico-nav-element-spacing-horizontal:0.5rem;--pico-nav-link-spacing-vertical:0.5rem;--pico-nav-link-spacing-horizontal:0.5rem;--pico-nav-breadcrumb-divider:">";--pico-icon-checkbox:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(255, 255, 255)' stroke-width='4' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-minus:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(255, 255, 255)' stroke-width='4' stroke-linecap='round' stroke-linejoin='round'%3E%3Cline x1='5' y1='12' x2='19' y2='12'%3E%3C/line%3E%3C/svg%3E");--pico-icon-chevron:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='6 9 12 15 18 9'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-date:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Crect x='3' y='4' width='18' height='18' rx='2' ry='2'%3E%3C/rect%3E%3Cline x1='16' y1='2' x2='16' y2='6'%3E%3C/line%3E%3Cline x1='8' y1='2' x2='8' y2='6'%3E%3C/line%3E%3Cline x1='3' y1='10' x2='21' y2='10'%3E%3C/line%3E%3C/svg%3E");--pico-icon-time:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cpolyline points='12 6 12 12 16 14'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-search:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='1.5' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='11' cy='11' r='8'%3E%3C/circle%3E%3Cline x1='21' y1='21' x2='16.65' y2='16.65'%3E%3C/line%3E%3C/svg%3E");--pico-icon-close:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='3' stroke-linecap='round' stroke-linejoin='round'%3E%3Cline x1='18' y1='6' x2='6' y2='18'%3E%3C/line%3E%3Cline x1='6' y1='6' x2='18' y2='18'%3E%3C/line%3E%3C/svg%3E");--pico-icon-loading:url("data:image/svg+xml,%3Csvg fill='none' height='24' width='24' viewBox='0 0 24 24' xmlns='http://www.w3.org/2000/svg' %3E%3Cstyle%3E g %7B animation: rotate 2s linear infinite; transform-origin: center center; %7D circle %7B stroke-dasharray: 75,100; stroke-dashoffset: -5; animation: dash 1.5s ease-in-out infinite; stroke-linecap: round; %7D @keyframes rotate %7B 0%25 %7B transform: rotate(0deg); %7D 100%25 %7B transform: rotate(360deg); %7D %7D @keyframes dash %7B 0%25 %7B stroke-dasharray: 1,100; stroke-dashoffset: 0; %7D 50%25 %7B stroke-dasharray: 44.5,100; stroke-dashoffset: -17.5; %7D 100%25 %7B stroke-dasharray: 44.5,100; stroke-dashoffset: -62; %7D %7D %3C/style%3E%3Cg%3E%3Ccircle cx='12' cy='12' r='10' fill='none' stroke='rgb(136, 145, 164)' stroke-width='4' /%3E%3C/g%3E%3C/svg%3E")}@media (min-width:576px){:root{--pico-font-size:106.25%}}@media (min-width:768px){:root{--pico-font-size:112.5%}}@media (min-width:1024px){:root{--pico-font-size:118.75%}}@media (min-width:1280px){:root{--pico-font-size:125%}}@media (min-width:1536px){:root{--pico-font-size:131.25%}}a{--pico-text-decoration:underline}a.contrast,a.secondary{--pico-text-decoration:underline}small{--pico-font-size:0.875em}h1,h2,h3,h4,h5,h6{--pico-font-weight:700}h1{--pico-font-size:2rem;--pico-line-height:1.125;--pico-typography-spacing-top:3rem}h2{--pico-font-size:1.75rem;--pico-line-height:1.15;--pico-typography-spacing-top:2.625rem}h3{--pico-font-size:1.5rem;--pico-line-height:1.175;--pico-typography-spacing-top:2.25rem}h4{--pico-font-size:1.25rem;--pico-line-height:1.2;--pico-typography-spacing-top:1.874rem}h5{--pico-font-size:1.125rem;--pico-line-height:1.225;--pico-typography-spacing-top:1.6875rem}h6{--pico-font-size:1rem;--pico-line-height:1.25;--pico-typography-spacing-top:1.5rem}tfoot td,tfoot th,thead td,thead th{--pico-font-weight:600;--pico-border-width:0.1875rem}code,kbd,pre,samp{--pico-font-family:var(--pico-font-family-monospace)}kbd{--pico-font-weight:bolder}:where(select,textarea),input:not([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-outline-width:0.0625rem}[type=search]{--pico-border-radius:5rem}[type=checkbox],[type=radio]{--pico-border-width:0.125rem}[type=checkbox][role=switch]{--pico-border-width:0.1875rem}details.dropdown summary:not([role=button]){--pico-outline-width:0.0625rem}nav details.dropdown summary:focus-visible{--pico-outline-width:0.125rem}[role=search]{--pico-border-radius:5rem}[role=group]:has(button.secondary:focus,[type=submit].secondary:focus,[type=button].secondary:focus,[role=button].secondary:focus),[role=search]:has(button.secondary:focus,[type=submit].secondary:focus,[type=button].secondary:focus,[role=button].secondary:focus){--pico-group-box-shadow-focus-with-button:0 0 0 var(--pico-outline-width) var(--pico-secondary-focus)}[role=group]:has(button.contrast:focus,[type=submit].contrast:focus,[type=button].contrast:focus,[role=button].contrast:focus),[role=search]:has(button.contrast:focus,[type=submit].contrast:focus,[type=button].contrast:focus,[role=button].contrast:focus){--pico-group-box-shadow-focus-with-button:0 0 0 var(--pico-outline-width) var(--pico-contrast-focus)}[role=group] [role=button],[role=group] [type=button],[role=group] [type=submit],[role=group] button,[role=search] [role=button],[role=search] [type=button],[role=search] [type=submit],[role=search] button{--pico-form-element-spacing-horizontal:2rem}details summary[role=button]:not(.outline)::after{filter:brightness(0) invert(1)}[aria-busy=true]:not(input,select,textarea):is(button,[type=submit],[type=button],[type=reset],[role=button]):not(.outline)::before{filter:brightness(0) invert(1)}:root:not([data-theme=dark]),[data-theme=light]{--pico-background-color:#fff;--pico-color:#373c44;--pico-text-selection-color:rgba(2, 154, 232, 0.25);--pico-muted-color:#646b79;--pico-muted-border-color:#e7eaf0;--pico-primary:#0172ad;--pico-primary-background:#0172ad;--pico-primary-border:var(--pico-primary-background);--pico-primary-underline:rgba(1, 114, 173, 0.5);--pico-primary-hover:#015887;--pico-primary-hover-background:#02659a;--pico-primary-hover-border:var(--pico-primary-hover-background);--pico-primary-hover-underline:var(--pico-primary-hover);--pico-primary-focus:rgba(2, 154, 232, 0.5);--pico-primary-inverse:#fff;--pico-secondary:#5d6b89;--pico-secondary-background:#525f7a;--pico-secondary-border:var(--pico-secondary-background);--pico-secondary-underline:rgba(93, 107, 137, 0.5);--pico-secondary-hover:#48536b;--pico-secondary-hover-background:#48536b;--pico-secondary-hover-border:var(--pico-secondary-hover-background);--pico-secondary-hover-underline:var(--pico-secondary-hover);--pico-secondary-focus:rgba(93, 107, 137, 0.25);--pico-secondary-inverse:#fff;--pico-contrast:#181c25;--pico-contrast-background:#181c25;--pico-contrast-border:var(--pico-contrast-background);--pico-contrast-underline:rgba(24, 28, 37, 0.5);--pico-contrast-hover:#000;--pico-contrast-hover-background:#000;--pico-contrast-hover-border:var(--pico-contrast-hover-background);--pico-contrast-hover-underline:var(--pico-secondary-hover);--pico-contrast-focus:rgba(93, 107, 137, 0.25);--pico-contrast-inverse:#fff;--pico-box-shadow:0.0145rem 0.029rem 0.174rem rgba(129, 145, 181, 0.01698),0.0335rem 0.067rem 0.402rem rgba(129, 145, 181, 0.024),0.0625rem 0.125rem 0.75rem rgba(129, 145, 181, 0.03),0.1125rem 0.225rem 1.35rem rgba(129, 145, 181, 0.036),0.2085rem 0.417rem 2.502rem rgba(129, 145, 181, 0.04302),0.5rem 1rem 6rem rgba(129, 145, 181, 0.06),0 0 0 0.0625rem rgba(129, 145, 181, 0.015);--pico-h1-color:#2d3138;--pico-h2-color:#373c44;--pico-h3-color:#424751;--pico-h4-color:#4d535e;--pico-h5-color:#5c6370;--pico-h6-color:#646b79;--pico-mark-background-color:#fde7c0;--pico-mark-color:#0f1114;--pico-ins-color:#1d6a54;--pico-del-color:#883935;--pico-blockquote-border-color:var(--pico-muted-border-color);--pico-blockquote-footer-color:var(--pico-muted-color);--pico-button-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-button-hover-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-table-border-color:var(--pico-muted-border-color);--pico-table-row-stripped-background-color:rgba(111, 120, 135, 0.0375);--pico-code-background-color:#f3f5f7;--pico-code-color:#646b79;--pico-code-kbd-background-color:var(--pico-color);--pico-code-kbd-color:var(--pico-background-color);--pico-form-element-background-color:#fbfcfc;--pico-form-element-selected-background-color:#dfe3eb;--pico-form-element-border-color:#cfd5e2;--pico-form-element-color:#23262c;--pico-form-element-placeholder-color:var(--pico-muted-color);--pico-form-element-active-background-color:#fff;--pico-form-element-active-border-color:var(--pico-primary-border);--pico-form-element-focus-color:var(--pico-primary-border);--pico-form-element-disabled-opacity:0.5;--pico-form-element-invalid-border-color:#b86a6b;--pico-form-element-invalid-active-border-color:#c84f48;--pico-form-element-invalid-focus-color:var(--pico-form-element-invalid-active-border-color);--pico-form-element-valid-border-color:#4c9b8a;--pico-form-element-valid-active-border-color:#279977;--pico-form-element-valid-focus-color:var(--pico-form-element-valid-active-border-color);--pico-switch-background-color:#bfc7d9;--pico-switch-checked-background-color:var(--pico-primary-background);--pico-switch-color:#fff;--pico-switch-thumb-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-range-border-color:#dfe3eb;--pico-range-active-border-color:#bfc7d9;--pico-range-thumb-border-color:var(--pico-background-color);--pico-range-thumb-color:var(--pico-secondary-background);--pico-range-thumb-active-color:var(--pico-primary-background);--pico-accordion-border-color:var(--pico-muted-border-color);--pico-accordion-active-summary-color:var(--pico-primary-hover);--pico-accordion-close-summary-color:var(--pico-color);--pico-accordion-open-summary-color:var(--pico-muted-color);--pico-card-background-color:var(--pico-background-color);--pico-card-border-color:var(--pico-muted-border-color);--pico-card-box-shadow:var(--pico-box-shadow);--pico-card-sectioning-background-color:#fbfcfc;--pico-dropdown-background-color:#fff;--pico-dropdown-border-color:#eff1f4;--pico-dropdown-box-shadow:var(--pico-box-shadow);--pico-dropdown-color:var(--pico-color);--pico-dropdown-hover-background-color:#eff1f4;--pico-loading-spinner-opacity:0.5;--pico-modal-overlay-background-color:rgba(232, 234, 237, 0.75);--pico-progress-background-color:#dfe3eb;--pico-progress-color:var(--pico-primary-background);--pico-tooltip-background-color:var(--pico-contrast-background);--pico-tooltip-color:var(--pico-contrast-inverse);--pico-icon-valid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(76, 155, 138)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-invalid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(200, 79, 72)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cline x1='12' y1='8' x2='12' y2='12'%3E%3C/line%3E%3Cline x1='12' y1='16' x2='12.01' y2='16'%3E%3C/line%3E%3C/svg%3E");color-scheme:light}:root:not([data-theme=dark]) input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]),[data-theme=light] input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-form-element-focus-color:var(--pico-primary-focus)}@media only screen and (prefers-color-scheme:dark){:root:not([data-theme]){--pico-background-color:#13171f;--pico-color:#c2c7d0;--pico-text-selection-color:rgba(1, 170, 255, 0.1875);--pico-muted-color:#7b8495;--pico-muted-border-color:#202632;--pico-primary:#01aaff;--pico-primary-background:#0172ad;--pico-primary-border:var(--pico-primary-background);--pico-primary-underline:rgba(1, 170, 255, 0.5);--pico-primary-hover:#79c0ff;--pico-primary-hover-background:#017fc0;--pico-primary-hover-border:var(--pico-primary-hover-background);--pico-primary-hover-underline:var(--pico-primary-hover);--pico-primary-focus:rgba(1, 170, 255, 0.375);--pico-primary-inverse:#fff;--pico-secondary:#969eaf;--pico-secondary-background:#525f7a;--pico-secondary-border:var(--pico-secondary-background);--pico-secondary-underline:rgba(150, 158, 175, 0.5);--pico-secondary-hover:#b3b9c5;--pico-secondary-hover-background:#5d6b89;--pico-secondary-hover-border:var(--pico-secondary-hover-background);--pico-secondary-hover-underline:var(--pico-secondary-hover);--pico-secondary-focus:rgba(144, 158, 190, 0.25);--pico-secondary-inverse:#fff;--pico-contrast:#dfe3eb;--pico-contrast-background:#eff1f4;--pico-contrast-border:var(--pico-contrast-background);--pico-contrast-underline:rgba(223, 227, 235, 0.5);--pico-contrast-hover:#fff;--pico-contrast-hover-background:#fff;--pico-contrast-hover-border:var(--pico-contrast-hover-background);--pico-contrast-hover-underline:var(--pico-contrast-hover);--pico-contrast-focus:rgba(207, 213, 226, 0.25);--pico-contrast-inverse:#000;--pico-box-shadow:0.0145rem 0.029rem 0.174rem rgba(7, 9, 12, 0.01698),0.0335rem 0.067rem 0.402rem rgba(7, 9, 12, 0.024),0.0625rem 0.125rem 0.75rem rgba(7, 9, 12, 0.03),0.1125rem 0.225rem 1.35rem rgba(7, 9, 12, 0.036),0.2085rem 0.417rem 2.502rem rgba(7, 9, 12, 0.04302),0.5rem 1rem 6rem rgba(7, 9, 12, 0.06),0 0 0 0.0625rem rgba(7, 9, 12, 0.015);--pico-h1-color:#f0f1f3;--pico-h2-color:#e0e3e7;--pico-h3-color:#c2c7d0;--pico-h4-color:#b3b9c5;--pico-h5-color:#a4acba;--pico-h6-color:#8891a4;--pico-mark-background-color:#014063;--pico-mark-color:#fff;--pico-ins-color:#62af9a;--pico-del-color:#ce7e7b;--pico-blockquote-border-color:var(--pico-muted-border-color);--pico-blockquote-footer-color:var(--pico-muted-color);--pico-button-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-button-hover-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-table-border-color:var(--pico-muted-border-color);--pico-table-row-stripped-background-color:rgba(111, 120, 135, 0.0375);--pico-code-background-color:#1a1f28;--pico-code-color:#8891a4;--pico-code-kbd-background-color:var(--pico-color);--pico-code-kbd-color:var(--pico-background-color);--pico-form-element-background-color:#1c212c;--pico-form-element-selected-background-color:#2a3140;--pico-form-element-border-color:#2a3140;--pico-form-element-color:#e0e3e7;--pico-form-element-placeholder-color:#8891a4;--pico-form-element-active-background-color:#1a1f28;--pico-form-element-active-border-color:var(--pico-primary-border);--pico-form-element-focus-color:var(--pico-primary-border);--pico-form-element-disabled-opacity:0.5;--pico-form-element-invalid-border-color:#964a50;--pico-form-element-invalid-active-border-color:#b7403b;--pico-form-element-invalid-focus-color:var(--pico-form-element-invalid-active-border-color);--pico-form-element-valid-border-color:#2a7b6f;--pico-form-element-valid-active-border-color:#16896a;--pico-form-element-valid-focus-color:var(--pico-form-element-valid-active-border-color);--pico-switch-background-color:#333c4e;--pico-switch-checked-background-color:var(--pico-primary-background);--pico-switch-color:#fff;--pico-switch-thumb-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-range-border-color:#202632;--pico-range-active-border-color:#2a3140;--pico-range-thumb-border-color:var(--pico-background-color);--pico-range-thumb-color:var(--pico-secondary-background);--pico-range-thumb-active-color:var(--pico-primary-background);--pico-accordion-border-color:var(--pico-muted-border-color);--pico-accordion-active-summary-color:var(--pico-primary-hover);--pico-accordion-close-summary-color:var(--pico-color);--pico-accordion-open-summary-color:var(--pico-muted-color);--pico-card-background-color:#181c25;--pico-card-border-color:var(--pico-card-background-color);--pico-card-box-shadow:var(--pico-box-shadow);--pico-card-sectioning-background-color:#1a1f28;--pico-dropdown-background-color:#181c25;--pico-dropdown-border-color:#202632;--pico-dropdown-box-shadow:var(--pico-box-shadow);--pico-dropdown-color:var(--pico-color);--pico-dropdown-hover-background-color:#202632;--pico-loading-spinner-opacity:0.5;--pico-modal-overlay-background-color:rgba(8, 9, 10, 0.75);--pico-progress-background-color:#202632;--pico-progress-color:var(--pico-primary-background);--pico-tooltip-background-color:var(--pico-contrast-background);--pico-tooltip-color:var(--pico-contrast-inverse);--pico-icon-valid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(42, 123, 111)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-invalid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(150, 74, 80)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cline x1='12' y1='8' x2='12' y2='12'%3E%3C/line%3E%3Cline x1='12' y1='16' x2='12.01' y2='16'%3E%3C/line%3E%3C/svg%3E");color-scheme:dark}:root:not([data-theme]) input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-form-element-focus-color:var(--pico-primary-focus)}:root:not([data-theme]) details summary[role=button].contrast:not(.outline)::after{filter:brightness(0)}:root:not([data-theme]) [aria-busy=true]:not(input,select,textarea).contrast:is(button,[type=submit],[type=button],[type=reset],[role=button]):not(.outline)::before{filter:brightness(0)}}[data-theme=dark]{--pico-background-color:#13171f;--pico-color:#c2c7d0;--pico-text-selection-color:rgba(1, 170, 255, 0.1875);--pico-muted-color:#7b8495;--pico-muted-border-color:#202632;--pico-primary:#01aaff;--pico-primary-background:#0172ad;--pico-primary-border:var(--pico-primary-background);--pico-primary-underline:rgba(1, 170, 255, 0.5);--pico-primary-hover:#79c0ff;--pico-primary-hover-background:#017fc0;--pico-primary-hover-border:var(--pico-primary-hover-background);--pico-primary-hover-underline:var(--pico-primary-hover);--pico-primary-focus:rgba(1, 170, 255, 0.375);--pico-primary-inverse:#fff;--pico-secondary:#969eaf;--pico-secondary-background:#525f7a;--pico-secondary-border:var(--pico-secondary-background);--pico-secondary-underline:rgba(150, 158, 175, 0.5);--pico-secondary-hover:#b3b9c5;--pico-secondary-hover-background:#5d6b89;--pico-secondary-hover-border:var(--pico-secondary-hover-background);--pico-secondary-hover-underline:var(--pico-secondary-hover);--pico-secondary-focus:rgba(144, 158, 190, 0.25);--pico-secondary-inverse:#fff;--pico-contrast:#dfe3eb;--pico-contrast-background:#eff1f4;--pico-contrast-border:var(--pico-contrast-background);--pico-contrast-underline:rgba(223, 227, 235, 0.5);--pico-contrast-hover:#fff;--pico-contrast-hover-background:#fff;--pico-contrast-hover-border:var(--pico-contrast-hover-background);--pico-contrast-hover-underline:var(--pico-contrast-hover);--pico-contrast-focus:rgba(207, 213, 226, 0.25);--pico-contrast-inverse:#000;--pico-box-shadow:0.0145rem 0.029rem 0.174rem rgba(7, 9, 12, 0.01698),0.0335rem 0.067rem 0.402rem rgba(7, 9, 12, 0.024),0.0625rem 0.125rem 0.75rem rgba(7, 9, 12, 0.03),0.1125rem 0.225rem 1.35rem rgba(7, 9, 12, 0.036),0.2085rem 0.417rem 2.502rem rgba(7, 9, 12, 0.04302),0.5rem 1rem 6rem rgba(7, 9, 12, 0.06),0 0 0 0.0625rem rgba(7, 9, 12, 0.015);--pico-h1-color:#f0f1f3;--pico-h2-color:#e0e3e7;--pico-h3-color:#c2c7d0;--pico-h4-color:#b3b9c5;--pico-h5-color:#a4acba;--pico-h6-color:#8891a4;--pico-mark-background-color:#014063;--pico-mark-color:#fff;--pico-ins-color:#62af9a;--pico-del-color:#ce7e7b;--pico-blockquote-border-color:var(--pico-muted-border-color);--pico-blockquote-footer-color:var(--pico-muted-color);--pico-button-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-button-hover-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-table-border-color:var(--pico-muted-border-color);--pico-table-row-stripped-background-color:rgba(111, 120, 135, 0.0375);--pico-code-background-color:#1a1f28;--pico-code-color:#8891a4;--pico-code-kbd-background-color:var(--pico-color);--pico-code-kbd-color:var(--pico-background-color);--pico-form-element-background-color:#1c212c;--pico-form-element-selected-background-color:#2a3140;--pico-form-element-border-color:#2a3140;--pico-form-element-color:#e0e3e7;--pico-form-element-placeholder-color:#8891a4;--pico-form-element-active-background-color:#1a1f28;--pico-form-element-active-border-color:var(--pico-primary-border);--pico-form-element-focus-color:var(--pico-primary-border);--pico-form-element-disabled-opacity:0.5;--pico-form-element-invalid-border-color:#964a50;--pico-form-element-invalid-active-border-color:#b7403b;--pico-form-element-invalid-focus-color:var(--pico-form-element-invalid-active-border-color);--pico-form-element-valid-border-color:#2a7b6f;--pico-form-element-valid-active-border-color:#16896a;--pico-form-element-valid-focus-color:var(--pico-form-element-valid-active-border-color);--pico-switch-background-color:#333c4e;--pico-switch-checked-background-color:var(--pico-primary-background);--pico-switch-color:#fff;--pico-switch-thumb-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-range-border-color:#202632;--pico-range-active-border-color:#2a3140;--pico-range-thumb-border-color:var(--pico-background-color);--pico-range-thumb-color:var(--pico-secondary-background);--pico-range-thumb-active-color:var(--pico-primary-background);--pico-accordion-border-color:var(--pico-muted-border-color);--pico-accordion-active-summary-color:var(--pico-primary-hover);--pico-accordion-close-summary-color:var(--pico-color);--pico-accordion-open-summary-color:var(--pico-muted-color);--pico-card-background-color:#181c25;--pico-card-border-color:var(--pico-card-background-color);--pico-card-box-shadow:var(--pico-box-shadow);--pico-card-sectioning-background-color:#1a1f28;--pico-dropdown-background-color:#181c25;--pico-dropdown-border-color:#202632;--pico-dropdown-box-shadow:var(--pico-box-shadow);--pico-dropdown-color:var(--pico-color);--pico-dropdown-hover-background-color:#202632;--pico-loading-spinner-opacity:0.5;--pico-modal-overlay-background-color:rgba(8, 9, 10, 0.75);--pico-progress-background-color:#202632;--pico-progress-color:var(--pico-primary-background);--pico-tooltip-background-color:var(--pico-contrast-background);--pico-tooltip-color:var(--pico-contrast-inverse);--pico-icon-valid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(42, 123, 111)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-invalid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(150, 74, 80)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cline x1='12' y1='8' x2='12' y2='12'%3E%3C/line%3E%3Cline x1='12' y1='16' x2='12.01' y2='16'%3E%3C/line%3E%3C/svg%3E");color-scheme:dark}[data-theme=dark] input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-form-element-focus-color:var(--pico-primary-focus)}[data-theme=dark] details summary[role=button].contrast:not(.outline)::after{filter:brightness(0)}[data-theme=dark] [aria-busy=true]:not(input,select,textarea).contrast:is(button,[type=submit],[type=button],[type=reset],[role=button]):not(.outline)::before{filter:brightness(0)}[type=checkbox],[type=radio],[type=range],progress{accent-color:var(--pico-primary)}*,::after,::before{box-sizing:border-box;background-repeat:no-repeat}::after,::before{text-decoration:inherit;vertical-align:inherit}:where(:root){-webkit-tap-highlight-color:transparent;-webkit-text-size-adjust:100%;-moz-text-size-adjust:100%;text-size-adjust:100%;background-color:var(--pico-background-color);color:var(--pico-color);font-weight:var(--pico-font-weight);font-size:var(--pico-font-size);line-height:var(--pico-line-height);font-family:var(--pico-font-family);text-underline-offset:var(--pico-text-underline-offset);text-rendering:optimizeLegibility;overflow-wrap:break-word;-moz-tab-size:4;-o-tab-size:4;tab-size:4}body{width:100%;margin:0}main{display:block}body>footer,body>header,body>main{padding-block:var(--pico-block-spacing-vertical)}section{margin-bottom:var(--pico-block-spacing-vertical)}.container,.container-fluid{width:100%;margin-right:auto;margin-left:auto;padding-right:var(--pico-spacing);padding-left:var(--pico-spacing)}@media (min-width:576px){.container{max-width:510px;padding-right:0;padding-left:0}}@media (min-width:768px){.container{max-width:700px}}@media (min-width:1024px){.container{max-width:950px}}@media (min-width:1280px){.container{max-width:1200px}}@media (min-width:1536px){.container{max-width:1450px}}.grid{grid-column-gap:var(--pico-grid-column-gap);grid-row-gap:var(--pico-grid-row-gap);display:grid;grid-template-columns:1fr}@media (min-width:768px){.grid{grid-template-columns:repeat(auto-fit,minmax(0%,1fr))}}.grid>*{min-width:0}.overflow-auto{overflow:auto}b,strong{font-weight:bolder}sub,sup{position:relative;font-size:.75em;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}address,blockquote,dl,ol,p,pre,table,ul{margin-top:0;margin-bottom:var(--pico-typography-spacing-vertical);color:var(--pico-color);font-style:normal;font-weight:var(--pico-font-weight)}h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:var(--pico-typography-spacing-vertical);color:var(--pico-color);font-weight:var(--pico-font-weight);font-size:var(--pico-font-size);line-height:var(--pico-line-height);font-family:var(--pico-font-family)}h1{--pico-color:var(--pico-h1-color)}h2{--pico-color:var(--pico-h2-color)}h3{--pico-color:var(--pico-h3-color)}h4{--pico-color:var(--pico-h4-color)}h5{--pico-color:var(--pico-h5-color)}h6{--pico-color:var(--pico-h6-color)}:where(article,address,blockquote,dl,figure,form,ol,p,pre,table,ul)~:is(h1,h2,h3,h4,h5,h6){margin-top:var(--pico-typography-spacing-top)}p{margin-bottom:var(--pico-typography-spacing-vertical)}hgroup{margin-bottom:var(--pico-typography-spacing-vertical)}hgroup>*{margin-top:0;margin-bottom:0}hgroup>:not(:first-child):last-child{--pico-color:var(--pico-muted-color);--pico-font-weight:unset;font-size:1rem}:where(ol,ul) li{margin-bottom:calc(var(--pico-typography-spacing-vertical) * .25)}:where(dl,ol,ul) :where(dl,ol,ul){margin:0;margin-top:calc(var(--pico-typography-spacing-vertical) * .25)}ul li{list-style:square}mark{padding:.125rem .25rem;background-color:var(--pico-mark-background-color);color:var(--pico-mark-color);vertical-align:baseline}blockquote{display:block;margin:var(--pico-typography-spacing-vertical) 0;padding:var(--pico-spacing);border-right:none;border-left:.25rem solid var(--pico-blockquote-border-color);border-inline-start:0.25rem solid var(--pico-blockquote-border-color);border-inline-end:none}blockquote footer{margin-top:calc(var(--pico-typography-spacing-vertical) * .5);color:var(--pico-blockquote-footer-color)}abbr[title]{border-bottom:1px dotted;text-decoration:none;cursor:help}ins{color:var(--pico-ins-color);text-decoration:none}del{color:var(--pico-del-color)}::-moz-selection{background-color:var(--pico-text-selection-color)}::selection{background-color:var(--pico-text-selection-color)}:where(a:not([role=button])),[role=link]{--pico-color:var(--pico-primary);--pico-background-color:transparent;--pico-underline:var(--pico-primary-underline);outline:0;background-color:var(--pico-background-color);color:var(--pico-color);-webkit-text-decoration:var(--pico-text-decoration);text-decoration:var(--pico-text-decoration);text-decoration-color:var(--pico-underline);text-underline-offset:0.125em;transition:background-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition),-webkit-text-decoration var(--pico-transition);transition:background-color var(--pico-transition),color var(--pico-transition),text-decoration var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),color var(--pico-transition),text-decoration var(--pico-transition),box-shadow var(--pico-transition),-webkit-text-decoration var(--pico-transition)}:where(a:not([role=button])):is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[role=link]:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-primary-hover);--pico-underline:var(--pico-primary-hover-underline);--pico-text-decoration:underline}:where(a:not([role=button])):focus-visible,[role=link]:focus-visible{box-shadow:0 0 0 var(--pico-outline-width) var(--pico-primary-focus)}:where(a:not([role=button])).secondary,[role=link].secondary{--pico-color:var(--pico-secondary);--pico-underline:var(--pico-secondary-underline)}:where(a:not([role=button])).secondary:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[role=link].secondary:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-secondary-hover);--pico-underline:var(--pico-secondary-hover-underline)}:where(a:not([role=button])).contrast,[role=link].contrast{--pico-color:var(--pico-contrast);--pico-underline:var(--pico-contrast-underline)}:where(a:not([role=button])).contrast:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[role=link].contrast:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-contrast-hover);--pico-underline:var(--pico-contrast-hover-underline)}a[role=button]{display:inline-block}button{margin:0;overflow:visible;font-family:inherit;text-transform:none}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[role=button],[type=button],[type=file]::file-selector-button,[type=reset],[type=submit],button{--pico-background-color:var(--pico-primary-background);--pico-border-color:var(--pico-primary-border);--pico-color:var(--pico-primary-inverse);--pico-box-shadow:var(--pico-button-box-shadow, 0 0 0 rgba(0, 0, 0, 0));padding:var(--pico-form-element-spacing-vertical) var(--pico-form-element-spacing-horizontal);border:var(--pico-border-width) solid var(--pico-border-color);border-radius:var(--pico-border-radius);outline:0;background-color:var(--pico-background-color);box-shadow:var(--pico-box-shadow);color:var(--pico-color);font-weight:var(--pico-font-weight);font-size:1rem;line-height:var(--pico-line-height);text-align:center;text-decoration:none;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;transition:background-color var(--pico-transition),border-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition)}[role=button]:is(:hover,:active,:focus),[role=button]:is([aria-current]:not([aria-current=false])),[type=button]:is(:hover,:active,:focus),[type=button]:is([aria-current]:not([aria-current=false])),[type=file]::file-selector-button:is(:hover,:active,:focus),[type=file]::file-selector-button:is([aria-current]:not([aria-current=false])),[type=reset]:is(:hover,:active,:focus),[type=reset]:is([aria-current]:not([aria-current=false])),[type=submit]:is(:hover,:active,:focus),[type=submit]:is([aria-current]:not([aria-current=false])),button:is(:hover,:active,:focus),button:is([aria-current]:not([aria-current=false])){--pico-background-color:var(--pico-primary-hover-background);--pico-border-color:var(--pico-primary-hover-border);--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0));--pico-color:var(--pico-primary-inverse)}[role=button]:focus,[role=button]:is([aria-current]:not([aria-current=false])):focus,[type=button]:focus,[type=button]:is([aria-current]:not([aria-current=false])):focus,[type=file]::file-selector-button:focus,[type=file]::file-selector-button:is([aria-current]:not([aria-current=false])):focus,[type=reset]:focus,[type=reset]:is([aria-current]:not([aria-current=false])):focus,[type=submit]:focus,[type=submit]:is([aria-current]:not([aria-current=false])):focus,button:focus,button:is([aria-current]:not([aria-current=false])):focus{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-primary-focus)}[type=button],[type=reset],[type=submit]{margin-bottom:var(--pico-spacing)}:is(button,[type=submit],[type=button],[role=button]).secondary,[type=file]::file-selector-button,[type=reset]{--pico-background-color:var(--pico-secondary-background);--pico-border-color:var(--pico-secondary-border);--pico-color:var(--pico-secondary-inverse);cursor:pointer}:is(button,[type=submit],[type=button],[role=button]).secondary:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[type=file]::file-selector-button:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[type=reset]:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-background-color:var(--pico-secondary-hover-background);--pico-border-color:var(--pico-secondary-hover-border);--pico-color:var(--pico-secondary-inverse)}:is(button,[type=submit],[type=button],[role=button]).secondary:focus,:is(button,[type=submit],[type=button],[role=button]).secondary:is([aria-current]:not([aria-current=false])):focus,[type=file]::file-selector-button:focus,[type=file]::file-selector-button:is([aria-current]:not([aria-current=false])):focus,[type=reset]:focus,[type=reset]:is([aria-current]:not([aria-current=false])):focus{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-secondary-focus)}:is(button,[type=submit],[type=button],[role=button]).contrast{--pico-background-color:var(--pico-contrast-background);--pico-border-color:var(--pico-contrast-border);--pico-color:var(--pico-contrast-inverse)}:is(button,[type=submit],[type=button],[role=button]).contrast:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-background-color:var(--pico-contrast-hover-background);--pico-border-color:var(--pico-contrast-hover-border);--pico-color:var(--pico-contrast-inverse)}:is(button,[type=submit],[type=button],[role=button]).contrast:focus,:is(button,[type=submit],[type=button],[role=button]).contrast:is([aria-current]:not([aria-current=false])):focus{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-contrast-focus)}:is(button,[type=submit],[type=button],[role=button]).outline,[type=reset].outline{--pico-background-color:transparent;--pico-color:var(--pico-primary);--pico-border-color:var(--pico-primary)}:is(button,[type=submit],[type=button],[role=button]).outline:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[type=reset].outline:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-background-color:transparent;--pico-color:var(--pico-primary-hover);--pico-border-color:var(--pico-primary-hover)}:is(button,[type=submit],[type=button],[role=button]).outline.secondary,[type=reset].outline{--pico-color:var(--pico-secondary);--pico-border-color:var(--pico-secondary)}:is(button,[type=submit],[type=button],[role=button]).outline.secondary:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[type=reset].outline:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-secondary-hover);--pico-border-color:var(--pico-secondary-hover)}:is(button,[type=submit],[type=button],[role=button]).outline.contrast{--pico-color:var(--pico-contrast);--pico-border-color:var(--pico-contrast)}:is(button,[type=submit],[type=button],[role=button]).outline.contrast:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-contrast-hover);--pico-border-color:var(--pico-contrast-hover)}:where(button,[type=submit],[type=reset],[type=button],[role=button])[disabled],:where(fieldset[disabled]) :is(button,[type=submit],[type=button],[type=reset],[role=button]){opacity:.5;pointer-events:none}:where(table){width:100%;border-collapse:collapse;border-spacing:0;text-indent:0}td,th{padding:calc(var(--pico-spacing)/ 2) var(--pico-spacing);border-bottom:var(--pico-border-width) solid var(--pico-table-border-color);background-color:var(--pico-background-color);color:var(--pico-color);font-weight:var(--pico-font-weight);text-align:left;text-align:start}tfoot td,tfoot th{border-top:var(--pico-border-width) solid var(--pico-table-border-color);border-bottom:0}table.striped tbody tr:nth-child(odd) td,table.striped tbody tr:nth-child(odd) th{background-color:var(--pico-table-row-stripped-background-color)}:where(audio,canvas,iframe,img,svg,video){vertical-align:middle}audio,video{display:inline-block}audio:not([controls]){display:none;height:0}:where(iframe){border-style:none}img{max-width:100%;height:auto;border-style:none}:where(svg:not([fill])){fill:currentColor}svg:not(:root){overflow:hidden}code,kbd,pre,samp{font-size:.875em;font-family:var(--pico-font-family)}pre code{font-size:inherit;font-family:inherit}pre{-ms-overflow-style:scrollbar;overflow:auto}code,kbd,pre{border-radius:var(--pico-border-radius);background:var(--pico-code-background-color);color:var(--pico-code-color);font-weight:var(--pico-font-weight);line-height:initial}code,kbd{display:inline-block;padding:.375rem}pre{display:block;margin-bottom:var(--pico-spacing);overflow-x:auto}pre>code{display:block;padding:var(--pico-spacing);background:0 0;line-height:var(--pico-line-height)}kbd{background-color:var(--pico-code-kbd-background-color);color:var(--pico-code-kbd-color);vertical-align:baseline}figure{display:block;margin:0;padding:0}figure figcaption{padding:calc(var(--pico-spacing) * .5) 0;color:var(--pico-muted-color)}hr{height:0;margin:var(--pico-typography-spacing-vertical) 0;border:0;border-top:1px solid var(--pico-muted-border-color);color:inherit}[hidden],template{display:none!important}canvas{display:inline-block}input,optgroup,select,textarea{margin:0;font-size:1rem;line-height:var(--pico-line-height);font-family:inherit;letter-spacing:inherit}input{overflow:visible}select{text-transform:none}legend{max-width:100%;padding:0;color:inherit;white-space:normal}textarea{overflow:auto}[type=checkbox],[type=radio]{padding:0}::-webkit-inner-spin-button,::-webkit-outer-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}[type=search]::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{-webkit-appearance:button;font:inherit}::-moz-focus-inner{padding:0;border-style:none}:-moz-focusring{outline:0}:-moz-ui-invalid{box-shadow:none}::-ms-expand{display:none}[type=file],[type=range]{padding:0;border-width:0}input:not([type=checkbox],[type=radio],[type=range]){height:calc(1rem * var(--pico-line-height) + var(--pico-form-element-spacing-vertical) * 2 + var(--pico-border-width) * 2)}fieldset{width:100%;margin:0;margin-bottom:var(--pico-spacing);padding:0;border:0}fieldset legend,label{display:block;margin-bottom:calc(var(--pico-spacing) * .375);color:var(--pico-color);font-weight:var(--pico-form-label-font-weight,var(--pico-font-weight))}fieldset legend{margin-bottom:calc(var(--pico-spacing) * .5)}button[type=submit],input:not([type=checkbox],[type=radio]),select,textarea{width:100%}input:not([type=checkbox],[type=radio],[type=range],[type=file]),select,textarea{-webkit-appearance:none;-moz-appearance:none;appearance:none;padding:var(--pico-form-element-spacing-vertical) var(--pico-form-element-spacing-horizontal)}input,select,textarea{--pico-background-color:var(--pico-form-element-background-color);--pico-border-color:var(--pico-form-element-border-color);--pico-color:var(--pico-form-element-color);--pico-box-shadow:none;border:var(--pico-border-width) solid var(--pico-border-color);border-radius:var(--pico-border-radius);outline:0;background-color:var(--pico-background-color);box-shadow:var(--pico-box-shadow);color:var(--pico-color);font-weight:var(--pico-font-weight);transition:background-color var(--pico-transition),border-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition)}:where(select,textarea):not([readonly]):is(:active,:focus),input:not([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[readonly]):is(:active,:focus){--pico-background-color:var(--pico-form-element-active-background-color)}:where(select,textarea):not([readonly]):is(:active,:focus),input:not([type=submit],[type=button],[type=reset],[role=switch],[readonly]):is(:active,:focus){--pico-border-color:var(--pico-form-element-active-border-color)}:where(select,textarea):not([readonly]):focus,input:not([type=submit],[type=button],[type=reset],[type=range],[type=file],[readonly]):focus{--pico-box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-focus-color)}:where(fieldset[disabled]) :is(input:not([type=submit],[type=button],[type=reset]),select,textarea),input:not([type=submit],[type=button],[type=reset])[disabled],label[aria-disabled=true],select[disabled],textarea[disabled]{opacity:var(--pico-form-element-disabled-opacity);pointer-events:none}label[aria-disabled=true] input[disabled]{opacity:1}:where(input,select,textarea):not([type=checkbox],[type=radio],[type=date],[type=datetime-local],[type=month],[type=time],[type=week],[type=range])[aria-invalid]{padding-right:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem)!important;padding-left:var(--pico-form-element-spacing-horizontal);padding-inline-start:var(--pico-form-element-spacing-horizontal)!important;padding-inline-end:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem)!important;background-position:center right .75rem;background-size:1rem auto;background-repeat:no-repeat}:where(input,select,textarea):not([type=checkbox],[type=radio],[type=date],[type=datetime-local],[type=month],[type=time],[type=week],[type=range])[aria-invalid=false]:not(select){background-image:var(--pico-icon-valid)}:where(input,select,textarea):not([type=checkbox],[type=radio],[type=date],[type=datetime-local],[type=month],[type=time],[type=week],[type=range])[aria-invalid=true]:not(select){background-image:var(--pico-icon-invalid)}:where(input,select,textarea)[aria-invalid=false]{--pico-border-color:var(--pico-form-element-valid-border-color)}:where(input,select,textarea)[aria-invalid=false]:is(:active,:focus){--pico-border-color:var(--pico-form-element-valid-active-border-color)!important}:where(input,select,textarea)[aria-invalid=false]:is(:active,:focus):not([type=checkbox],[type=radio]){--pico-box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-valid-focus-color)!important}:where(input,select,textarea)[aria-invalid=true]{--pico-border-color:var(--pico-form-element-invalid-border-color)}:where(input,select,textarea)[aria-invalid=true]:is(:active,:focus){--pico-border-color:var(--pico-form-element-invalid-active-border-color)!important}:where(input,select,textarea)[aria-invalid=true]:is(:active,:focus):not([type=checkbox],[type=radio]){--pico-box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-invalid-focus-color)!important}[dir=rtl] :where(input,select,textarea):not([type=checkbox],[type=radio]):is([aria-invalid],[aria-invalid=true],[aria-invalid=false]){background-position:center left .75rem}input::-webkit-input-placeholder,input::placeholder,select:invalid,textarea::-webkit-input-placeholder,textarea::placeholder{color:var(--pico-form-element-placeholder-color);opacity:1}input:not([type=checkbox],[type=radio]),select,textarea{margin-bottom:var(--pico-spacing)}select::-ms-expand{border:0;background-color:transparent}select:not([multiple],[size]){padding-right:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem);padding-left:var(--pico-form-element-spacing-horizontal);padding-inline-start:var(--pico-form-element-spacing-horizontal);padding-inline-end:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem);background-image:var(--pico-icon-chevron);background-position:center right .75rem;background-size:1rem auto;background-repeat:no-repeat}select[multiple] option:checked{background:var(--pico-form-element-selected-background-color);color:var(--pico-form-element-color)}[dir=rtl] select:not([multiple],[size]){background-position:center left .75rem}textarea{display:block;resize:vertical}textarea[aria-invalid]{--pico-icon-height:calc(1rem * var(--pico-line-height) + var(--pico-form-element-spacing-vertical) * 2 + var(--pico-border-width) * 2);background-position:top right .75rem!important;background-size:1rem var(--pico-icon-height)!important}:where(input,select,textarea,fieldset,.grid)+small{display:block;width:100%;margin-top:calc(var(--pico-spacing) * -.75);margin-bottom:var(--pico-spacing);color:var(--pico-muted-color)}:where(input,select,textarea,fieldset,.grid)[aria-invalid=false]+small{color:var(--pico-ins-color)}:where(input,select,textarea,fieldset,.grid)[aria-invalid=true]+small{color:var(--pico-del-color)}label>:where(input,select,textarea){margin-top:calc(var(--pico-spacing) * .25)}label:has([type=checkbox],[type=radio]){width:-moz-fit-content;width:fit-content;cursor:pointer}[type=checkbox],[type=radio]{-webkit-appearance:none;-moz-appearance:none;appearance:none;width:1.25em;height:1.25em;margin-top:-.125em;margin-inline-end:.5em;border-width:var(--pico-border-width);vertical-align:middle;cursor:pointer}[type=checkbox]::-ms-check,[type=radio]::-ms-check{display:none}[type=checkbox]:checked,[type=checkbox]:checked:active,[type=checkbox]:checked:focus,[type=radio]:checked,[type=radio]:checked:active,[type=radio]:checked:focus{--pico-background-color:var(--pico-primary-background);--pico-border-color:var(--pico-primary-border);background-image:var(--pico-icon-checkbox);background-position:center;background-size:.75em auto;background-repeat:no-repeat}[type=checkbox]~label,[type=radio]~label{display:inline-block;margin-bottom:0;cursor:pointer}[type=checkbox]~label:not(:last-of-type),[type=radio]~label:not(:last-of-type){margin-inline-end:1em}[type=checkbox]:indeterminate{--pico-background-color:var(--pico-primary-background);--pico-border-color:var(--pico-primary-border);background-image:var(--pico-icon-minus);background-position:center;background-size:.75em auto;background-repeat:no-repeat}[type=radio]{border-radius:50%}[type=radio]:checked,[type=radio]:checked:active,[type=radio]:checked:focus{--pico-background-color:var(--pico-primary-inverse);border-width:.35em;background-image:none}[type=checkbox][role=switch]{--pico-background-color:var(--pico-switch-background-color);--pico-color:var(--pico-switch-color);width:2.25em;height:1.25em;border:var(--pico-border-width) solid var(--pico-border-color);border-radius:1.25em;background-color:var(--pico-background-color);line-height:1.25em}[type=checkbox][role=switch]:not([aria-invalid]){--pico-border-color:var(--pico-switch-background-color)}[type=checkbox][role=switch]:before{display:block;aspect-ratio:1;height:100%;border-radius:50%;background-color:var(--pico-color);box-shadow:var(--pico-switch-thumb-box-shadow);content:"";transition:margin .1s ease-in-out}[type=checkbox][role=switch]:focus{--pico-background-color:var(--pico-switch-background-color);--pico-border-color:var(--pico-switch-background-color)}[type=checkbox][role=switch]:checked{--pico-background-color:var(--pico-switch-checked-background-color);--pico-border-color:var(--pico-switch-checked-background-color);background-image:none}[type=checkbox][role=switch]:checked::before{margin-inline-start:calc(2.25em - 1.25em)}[type=checkbox][role=switch][disabled]{--pico-background-color:var(--pico-border-color)}[type=checkbox][aria-invalid=false]:checked,[type=checkbox][aria-invalid=false]:checked:active,[type=checkbox][aria-invalid=false]:checked:focus,[type=checkbox][role=switch][aria-invalid=false]:checked,[type=checkbox][role=switch][aria-invalid=false]:checked:active,[type=checkbox][role=switch][aria-invalid=false]:checked:focus{--pico-background-color:var(--pico-form-element-valid-border-color)}[type=checkbox]:checked:active[aria-invalid=true],[type=checkbox]:checked:focus[aria-invalid=true],[type=checkbox]:checked[aria-invalid=true],[type=checkbox][role=switch]:checked:active[aria-invalid=true],[type=checkbox][role=switch]:checked:focus[aria-invalid=true],[type=checkbox][role=switch]:checked[aria-invalid=true]{--pico-background-color:var(--pico-form-element-invalid-border-color)}[type=checkbox][aria-invalid=false]:checked,[type=checkbox][aria-invalid=false]:checked:active,[type=checkbox][aria-invalid=false]:checked:focus,[type=checkbox][role=switch][aria-invalid=false]:checked,[type=checkbox][role=switch][aria-invalid=false]:checked:active,[type=checkbox][role=switch][aria-invalid=false]:checked:focus,[type=radio][aria-invalid=false]:checked,[type=radio][aria-invalid=false]:checked:active,[type=radio][aria-invalid=false]:checked:focus{--pico-border-color:var(--pico-form-element-valid-border-color)}[type=checkbox]:checked:active[aria-invalid=true],[type=checkbox]:checked:focus[aria-invalid=true],[type=checkbox]:checked[aria-invalid=true],[type=checkbox][role=switch]:checked:active[aria-invalid=true],[type=checkbox][role=switch]:checked:focus[aria-invalid=true],[type=checkbox][role=switch]:checked[aria-invalid=true],[type=radio]:checked:active[aria-invalid=true],[type=radio]:checked:focus[aria-invalid=true],[type=radio]:checked[aria-invalid=true]{--pico-border-color:var(--pico-form-element-invalid-border-color)}[type=color]::-webkit-color-swatch-wrapper{padding:0}[type=color]::-moz-focus-inner{padding:0}[type=color]::-webkit-color-swatch{border:0;border-radius:calc(var(--pico-border-radius) * .5)}[type=color]::-moz-color-swatch{border:0;border-radius:calc(var(--pico-border-radius) * .5)}input:not([type=checkbox],[type=radio],[type=range],[type=file]):is([type=date],[type=datetime-local],[type=month],[type=time],[type=week]){--pico-icon-position:0.75rem;--pico-icon-width:1rem;padding-right:calc(var(--pico-icon-width) + var(--pico-icon-position));background-image:var(--pico-icon-date);background-position:center right var(--pico-icon-position);background-size:var(--pico-icon-width) auto;background-repeat:no-repeat}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=time]{background-image:var(--pico-icon-time)}[type=date]::-webkit-calendar-picker-indicator,[type=datetime-local]::-webkit-calendar-picker-indicator,[type=month]::-webkit-calendar-picker-indicator,[type=time]::-webkit-calendar-picker-indicator,[type=week]::-webkit-calendar-picker-indicator{width:var(--pico-icon-width);margin-right:calc(var(--pico-icon-width) * -1);margin-left:var(--pico-icon-position);opacity:0}@-moz-document url-prefix(){[type=date],[type=datetime-local],[type=month],[type=time],[type=week]{padding-right:var(--pico-form-element-spacing-horizontal)!important;background-image:none!important}}[dir=rtl] :is([type=date],[type=datetime-local],[type=month],[type=time],[type=week]){text-align:right}[type=file]{--pico-color:var(--pico-muted-color);margin-left:calc(var(--pico-outline-width) * -1);padding:calc(var(--pico-form-element-spacing-vertical) * .5) 0;padding-left:var(--pico-outline-width);border:0;border-radius:0;background:0 0}[type=file]::file-selector-button{margin-right:calc(var(--pico-spacing)/ 2);padding:calc(var(--pico-form-element-spacing-vertical) * .5) var(--pico-form-element-spacing-horizontal)}[type=file]:is(:hover,:active,:focus)::file-selector-button{--pico-background-color:var(--pico-secondary-hover-background);--pico-border-color:var(--pico-secondary-hover-border)}[type=file]:focus::file-selector-button{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-secondary-focus)}[type=range]{-webkit-appearance:none;-moz-appearance:none;appearance:none;width:100%;height:1.25rem;background:0 0}[type=range]::-webkit-slider-runnable-track{width:100%;height:.375rem;border-radius:var(--pico-border-radius);background-color:var(--pico-range-border-color);-webkit-transition:background-color var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),box-shadow var(--pico-transition)}[type=range]::-moz-range-track{width:100%;height:.375rem;border-radius:var(--pico-border-radius);background-color:var(--pico-range-border-color);-moz-transition:background-color var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),box-shadow var(--pico-transition)}[type=range]::-ms-track{width:100%;height:.375rem;border-radius:var(--pico-border-radius);background-color:var(--pico-range-border-color);-ms-transition:background-color var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),box-shadow var(--pico-transition)}[type=range]::-webkit-slider-thumb{-webkit-appearance:none;width:1.25rem;height:1.25rem;margin-top:-.4375rem;border:2px solid var(--pico-range-thumb-border-color);border-radius:50%;background-color:var(--pico-range-thumb-color);cursor:pointer;-webkit-transition:background-color var(--pico-transition),transform var(--pico-transition);transition:background-color var(--pico-transition),transform var(--pico-transition)}[type=range]::-moz-range-thumb{-webkit-appearance:none;width:1.25rem;height:1.25rem;margin-top:-.4375rem;border:2px solid var(--pico-range-thumb-border-color);border-radius:50%;background-color:var(--pico-range-thumb-color);cursor:pointer;-moz-transition:background-color var(--pico-transition),transform var(--pico-transition);transition:background-color var(--pico-transition),transform var(--pico-transition)}[type=range]::-ms-thumb{-webkit-appearance:none;width:1.25rem;height:1.25rem;margin-top:-.4375rem;border:2px solid var(--pico-range-thumb-border-color);border-radius:50%;background-color:var(--pico-range-thumb-color);cursor:pointer;-ms-transition:background-color var(--pico-transition),transform var(--pico-transition);transition:background-color var(--pico-transition),transform var(--pico-transition)}[type=range]:active,[type=range]:focus-within{--pico-range-border-color:var(--pico-range-active-border-color);--pico-range-thumb-color:var(--pico-range-thumb-active-color)}[type=range]:active::-webkit-slider-thumb{transform:scale(1.25)}[type=range]:active::-moz-range-thumb{transform:scale(1.25)}[type=range]:active::-ms-thumb{transform:scale(1.25)}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search]{padding-inline-start:calc(var(--pico-form-element-spacing-horizontal) + 1.75rem);background-image:var(--pico-icon-search);background-position:center left calc(var(--pico-form-element-spacing-horizontal) + .125rem);background-size:1rem auto;background-repeat:no-repeat}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid]{padding-inline-start:calc(var(--pico-form-element-spacing-horizontal) + 1.75rem)!important;background-position:center left 1.125rem,center right .75rem}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid=false]{background-image:var(--pico-icon-search),var(--pico-icon-valid)}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid=true]{background-image:var(--pico-icon-search),var(--pico-icon-invalid)}[dir=rtl] :where(input):not([type=checkbox],[type=radio],[type=range],[type=file])[type=search]{background-position:center right 1.125rem}[dir=rtl] :where(input):not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid]{background-position:center right 1.125rem,center left .75rem}details{display:block;margin-bottom:var(--pico-spacing)}details summary{line-height:1rem;list-style-type:none;cursor:pointer;transition:color var(--pico-transition)}details summary:not([role]){color:var(--pico-accordion-close-summary-color)}details summary::-webkit-details-marker{display:none}details summary::marker{display:none}details summary::-moz-list-bullet{list-style-type:none}details summary::after{display:block;width:1rem;height:1rem;margin-inline-start:calc(var(--pico-spacing,1rem) * .5);float:right;transform:rotate(-90deg);background-image:var(--pico-icon-chevron);background-position:right center;background-size:1rem auto;background-repeat:no-repeat;content:"";transition:transform var(--pico-transition)}details summary:focus{outline:0}details summary:focus:not([role]){color:var(--pico-accordion-active-summary-color)}details summary:focus-visible:not([role]){outline:var(--pico-outline-width) solid var(--pico-primary-focus);outline-offset:calc(var(--pico-spacing,1rem) * 0.5);color:var(--pico-primary)}details summary[role=button]{width:100%;text-align:left}details summary[role=button]::after{height:calc(1rem * var(--pico-line-height,1.5))}details[open]>summary{margin-bottom:var(--pico-spacing)}details[open]>summary:not([role]):not(:focus){color:var(--pico-accordion-open-summary-color)}details[open]>summary::after{transform:rotate(0)}[dir=rtl] details summary{text-align:right}[dir=rtl] details summary::after{float:left;background-position:left center}article{margin-bottom:var(--pico-block-spacing-vertical);padding:var(--pico-block-spacing-vertical) var(--pico-block-spacing-horizontal);border-radius:var(--pico-border-radius);background:var(--pico-card-background-color);box-shadow:var(--pico-card-box-shadow)}article>footer,article>header{margin-right:calc(var(--pico-block-spacing-horizontal) * -1);margin-left:calc(var(--pico-block-spacing-horizontal) * -1);padding:calc(var(--pico-block-spacing-vertical) * .66) var(--pico-block-spacing-horizontal);background-color:var(--pico-card-sectioning-background-color)}article>header{margin-top:calc(var(--pico-block-spacing-vertical) * -1);margin-bottom:var(--pico-block-spacing-vertical);border-bottom:var(--pico-border-width) solid var(--pico-card-border-color);border-top-right-radius:var(--pico-border-radius);border-top-left-radius:var(--pico-border-radius)}article>footer{margin-top:var(--pico-block-spacing-vertical);margin-bottom:calc(var(--pico-block-spacing-vertical) * -1);border-top:var(--pico-border-width) solid var(--pico-card-border-color);border-bottom-right-radius:var(--pico-border-radius);border-bottom-left-radius:var(--pico-border-radius)}details.dropdown{position:relative;border-bottom:none}details.dropdown summary::after,details.dropdown>a::after,details.dropdown>button::after{display:block;width:1rem;height:calc(1rem * var(--pico-line-height,1.5));margin-inline-start:.25rem;float:right;transform:rotate(0) translateX(.2rem);background-image:var(--pico-icon-chevron);background-position:right center;background-size:1rem auto;background-repeat:no-repeat;content:""}nav details.dropdown{margin-bottom:0}details.dropdown summary:not([role]){height:calc(1rem * var(--pico-line-height) + var(--pico-form-element-spacing-vertical) * 2 + var(--pico-border-width) * 2);padding:var(--pico-form-element-spacing-vertical) var(--pico-form-element-spacing-horizontal);border:var(--pico-border-width) solid var(--pico-form-element-border-color);border-radius:var(--pico-border-radius);background-color:var(--pico-form-element-background-color);color:var(--pico-form-element-placeholder-color);line-height:inherit;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;transition:background-color var(--pico-transition),border-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition)}details.dropdown summary:not([role]):active,details.dropdown summary:not([role]):focus{border-color:var(--pico-form-element-active-border-color);background-color:var(--pico-form-element-active-background-color)}details.dropdown summary:not([role]):focus{box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-focus-color)}details.dropdown summary:not([role]):focus-visible{outline:0}details.dropdown summary:not([role])[aria-invalid=false]{--pico-form-element-border-color:var(--pico-form-element-valid-border-color);--pico-form-element-active-border-color:var(--pico-form-element-valid-focus-color);--pico-form-element-focus-color:var(--pico-form-element-valid-focus-color)}details.dropdown summary:not([role])[aria-invalid=true]{--pico-form-element-border-color:var(--pico-form-element-invalid-border-color);--pico-form-element-active-border-color:var(--pico-form-element-invalid-focus-color);--pico-form-element-focus-color:var(--pico-form-element-invalid-focus-color)}nav details.dropdown{display:inline;margin:calc(var(--pico-nav-element-spacing-vertical) * -1) 0}nav details.dropdown summary::after{transform:rotate(0) translateX(0)}nav details.dropdown summary:not([role]){height:calc(1rem * var(--pico-line-height) + var(--pico-nav-link-spacing-vertical) * 2);padding:calc(var(--pico-nav-link-spacing-vertical) - var(--pico-border-width) * 2) var(--pico-nav-link-spacing-horizontal)}nav details.dropdown summary:not([role]):focus-visible{box-shadow:0 0 0 var(--pico-outline-width) var(--pico-primary-focus)}details.dropdown summary+ul{display:flex;z-index:99;position:absolute;left:0;flex-direction:column;width:100%;min-width:-moz-fit-content;min-width:fit-content;margin:0;margin-top:var(--pico-outline-width);padding:0;border:var(--pico-border-width) solid var(--pico-dropdown-border-color);border-radius:var(--pico-border-radius);background-color:var(--pico-dropdown-background-color);box-shadow:var(--pico-dropdown-box-shadow);color:var(--pico-dropdown-color);white-space:nowrap;opacity:0;transition:opacity var(--pico-transition),transform 0s ease-in-out 1s}details.dropdown summary+ul[dir=rtl]{right:0;left:auto}details.dropdown summary+ul li{width:100%;margin-bottom:0;padding:calc(var(--pico-form-element-spacing-vertical) * .5) var(--pico-form-element-spacing-horizontal);list-style:none}details.dropdown summary+ul li:first-of-type{margin-top:calc(var(--pico-form-element-spacing-vertical) * .5)}details.dropdown summary+ul li:last-of-type{margin-bottom:calc(var(--pico-form-element-spacing-vertical) * .5)}details.dropdown summary+ul li a{display:block;margin:calc(var(--pico-form-element-spacing-vertical) * -.5) calc(var(--pico-form-element-spacing-horizontal) * -1);padding:calc(var(--pico-form-element-spacing-vertical) * .5) var(--pico-form-element-spacing-horizontal);overflow:hidden;border-radius:0;color:var(--pico-dropdown-color);text-decoration:none;text-overflow:ellipsis}details.dropdown summary+ul li a:active,details.dropdown summary+ul li a:focus,details.dropdown summary+ul li a:focus-visible,details.dropdown summary+ul li a:hover,details.dropdown summary+ul li a[aria-current]:not([aria-current=false]){background-color:var(--pico-dropdown-hover-background-color)}details.dropdown summary+ul li label{width:100%}details.dropdown summary+ul li:has(label):hover{background-color:var(--pico-dropdown-hover-background-color)}details.dropdown[open] summary{margin-bottom:0}details.dropdown[open] summary+ul{transform:scaleY(1);opacity:1;transition:opacity var(--pico-transition),transform 0s ease-in-out 0s}details.dropdown[open] summary::before{display:block;z-index:1;position:fixed;width:100vw;height:100vh;inset:0;background:0 0;content:"";cursor:default}label>details.dropdown{margin-top:calc(var(--pico-spacing) * .25)}[role=group],[role=search]{display:inline-flex;position:relative;width:100%;margin-bottom:var(--pico-spacing);border-radius:var(--pico-border-radius);box-shadow:var(--pico-group-box-shadow,0 0 0 transparent);vertical-align:middle;transition:box-shadow var(--pico-transition)}[role=group] input:not([type=checkbox],[type=radio]),[role=group] select,[role=group]>*,[role=search] input:not([type=checkbox],[type=radio]),[role=search] select,[role=search]>*{position:relative;flex:1 1 auto;margin-bottom:0}[role=group] input:not([type=checkbox],[type=radio]):not(:first-child),[role=group] select:not(:first-child),[role=group]>:not(:first-child),[role=search] input:not([type=checkbox],[type=radio]):not(:first-child),[role=search] select:not(:first-child),[role=search]>:not(:first-child){margin-left:0;border-top-left-radius:0;border-bottom-left-radius:0}[role=group] input:not([type=checkbox],[type=radio]):not(:last-child),[role=group] select:not(:last-child),[role=group]>:not(:last-child),[role=search] input:not([type=checkbox],[type=radio]):not(:last-child),[role=search] select:not(:last-child),[role=search]>:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}[role=group] input:not([type=checkbox],[type=radio]):focus,[role=group] select:focus,[role=group]>:focus,[role=search] input:not([type=checkbox],[type=radio]):focus,[role=search] select:focus,[role=search]>:focus{z-index:2}[role=group] [role=button]:not(:first-child),[role=group] [type=button]:not(:first-child),[role=group] [type=reset]:not(:first-child),[role=group] [type=submit]:not(:first-child),[role=group] button:not(:first-child),[role=group] input:not([type=checkbox],[type=radio]):not(:first-child),[role=group] select:not(:first-child),[role=search] [role=button]:not(:first-child),[role=search] [type=button]:not(:first-child),[role=search] [type=reset]:not(:first-child),[role=search] [type=submit]:not(:first-child),[role=search] button:not(:first-child),[role=search] input:not([type=checkbox],[type=radio]):not(:first-child),[role=search] select:not(:first-child){margin-left:calc(var(--pico-border-width) * -1)}[role=group] [role=button],[role=group] [type=button],[role=group] [type=reset],[role=group] [type=submit],[role=group] button,[role=search] [role=button],[role=search] [type=button],[role=search] [type=reset],[role=search] [type=submit],[role=search] button{width:auto}@supports selector(:has(*)){[role=group]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus),[role=search]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus){--pico-group-box-shadow:var(--pico-group-box-shadow-focus-with-button)}[role=group]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) input:not([type=checkbox],[type=radio]),[role=group]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) select,[role=search]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) input:not([type=checkbox],[type=radio]),[role=search]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) select{border-color:transparent}[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus),[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus){--pico-group-box-shadow:var(--pico-group-box-shadow-focus-with-input)}[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) [role=button],[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=button],[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=submit],[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) button,[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) [role=button],[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=button],[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=submit],[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) button{--pico-button-box-shadow:0 0 0 var(--pico-border-width) var(--pico-primary-border);--pico-button-hover-box-shadow:0 0 0 var(--pico-border-width) var(--pico-primary-hover-border)}[role=group] [role=button]:focus,[role=group] [type=button]:focus,[role=group] [type=reset]:focus,[role=group] [type=submit]:focus,[role=group] button:focus,[role=search] [role=button]:focus,[role=search] [type=button]:focus,[role=search] [type=reset]:focus,[role=search] [type=submit]:focus,[role=search] button:focus{box-shadow:none}}[role=search]>:first-child{border-top-left-radius:5rem;border-bottom-left-radius:5rem}[role=search]>:last-child{border-top-right-radius:5rem;border-bottom-right-radius:5rem}[aria-busy=true]:not(input,select,textarea,html){white-space:nowrap}[aria-busy=true]:not(input,select,textarea,html)::before{display:inline-block;width:1em;height:1em;background-image:var(--pico-icon-loading);background-size:1em auto;background-repeat:no-repeat;content:"";vertical-align:-.125em}[aria-busy=true]:not(input,select,textarea,html):not(:empty)::before{margin-inline-end:calc(var(--pico-spacing) * .5)}[aria-busy=true]:not(input,select,textarea,html):empty{text-align:center}[role=button][aria-busy=true],[type=button][aria-busy=true],[type=reset][aria-busy=true],[type=submit][aria-busy=true],a[aria-busy=true],button[aria-busy=true]{pointer-events:none}:root{--pico-scrollbar-width:0px}dialog{display:flex;z-index:999;position:fixed;top:0;right:0;bottom:0;left:0;align-items:center;justify-content:center;width:inherit;min-width:100%;height:inherit;min-height:100%;padding:0;border:0;-webkit-backdrop-filter:var(--pico-modal-overlay-backdrop-filter);backdrop-filter:var(--pico-modal-overlay-backdrop-filter);background-color:var(--pico-modal-overlay-background-color);color:var(--pico-color)}dialog article{width:100%;max-height:calc(100vh - var(--pico-spacing) * 2);margin:var(--pico-spacing);overflow:auto}@media (min-width:576px){dialog article{max-width:510px}}@media (min-width:768px){dialog article{max-width:700px}}dialog article>header>*{margin-bottom:0}dialog article>header .close,dialog article>header :is(a,button)[rel=prev]{margin:0;margin-left:var(--pico-spacing);padding:0;float:right}dialog article>footer{text-align:right}dialog article>footer [role=button],dialog article>footer button{margin-bottom:0}dialog article>footer [role=button]:not(:first-of-type),dialog article>footer button:not(:first-of-type){margin-left:calc(var(--pico-spacing) * .5)}dialog article .close,dialog article :is(a,button)[rel=prev]{display:block;width:1rem;height:1rem;margin-top:calc(var(--pico-spacing) * -1);margin-bottom:var(--pico-spacing);margin-left:auto;border:none;background-image:var(--pico-icon-close);background-position:center;background-size:auto 1rem;background-repeat:no-repeat;background-color:transparent;opacity:.5;transition:opacity var(--pico-transition)}dialog article .close:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),dialog article :is(a,button)[rel=prev]:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){opacity:1}dialog:not([open]),dialog[open=false]{display:none}.modal-is-open{padding-right:var(--pico-scrollbar-width,0);overflow:hidden;pointer-events:none;touch-action:none}.modal-is-open dialog{pointer-events:auto;touch-action:auto}:where(.modal-is-opening,.modal-is-closing) dialog,:where(.modal-is-opening,.modal-is-closing) dialog>article{animation-duration:.2s;animation-timing-function:ease-in-out;animation-fill-mode:both}:where(.modal-is-opening,.modal-is-closing) dialog{animation-duration:.8s;animation-name:modal-overlay}:where(.modal-is-opening,.modal-is-closing) dialog>article{animation-delay:.2s;animation-name:modal}.modal-is-closing dialog,.modal-is-closing dialog>article{animation-delay:0s;animation-direction:reverse}@keyframes modal-overlay{from{-webkit-backdrop-filter:none;backdrop-filter:none;background-color:transparent}}@keyframes modal{from{transform:translateY(-100%);opacity:0}}:where(nav li)::before{float:left;content:"​"}nav,nav ul{display:flex}nav{justify-content:space-between;overflow:visible}nav ol,nav ul{align-items:center;margin-bottom:0;padding:0;list-style:none}nav ol:first-of-type,nav ul:first-of-type{margin-left:calc(var(--pico-nav-element-spacing-horizontal) * -1)}nav ol:last-of-type,nav ul:last-of-type{margin-right:calc(var(--pico-nav-element-spacing-horizontal) * -1)}nav li{display:inline-block;margin:0;padding:var(--pico-nav-element-spacing-vertical) var(--pico-nav-element-spacing-horizontal)}nav li :where(a,[role=link]){display:inline-block;margin:calc(var(--pico-nav-link-spacing-vertical) * -1) calc(var(--pico-nav-link-spacing-horizontal) * -1);padding:var(--pico-nav-link-spacing-vertical) var(--pico-nav-link-spacing-horizontal);border-radius:var(--pico-border-radius)}nav li :where(a,[role=link]):not(:hover){text-decoration:none}nav li [role=button],nav li [type=button],nav li button,nav li input:not([type=checkbox],[type=radio],[type=range],[type=file]),nav li select{height:auto;margin-right:inherit;margin-bottom:0;margin-left:inherit;padding:calc(var(--pico-nav-link-spacing-vertical) - var(--pico-border-width) * 2) var(--pico-nav-link-spacing-horizontal)}nav[aria-label=breadcrumb]{align-items:center;justify-content:start}nav[aria-label=breadcrumb] ul li:not(:first-child){margin-inline-start:var(--pico-nav-link-spacing-horizontal)}nav[aria-label=breadcrumb] ul li a{margin:calc(var(--pico-nav-link-spacing-vertical) * -1) 0;margin-inline-start:calc(var(--pico-nav-link-spacing-horizontal) * -1)}nav[aria-label=breadcrumb] ul li:not(:last-child)::after{display:inline-block;position:absolute;width:calc(var(--pico-nav-link-spacing-horizontal) * 4);margin:0 calc(var(--pico-nav-link-spacing-horizontal) * -1);content:var(--pico-nav-breadcrumb-divider);color:var(--pico-muted-color);text-align:center;text-decoration:none;white-space:nowrap}nav[aria-label=breadcrumb] a[aria-current]:not([aria-current=false]){background-color:transparent;color:inherit;text-decoration:none;pointer-events:none}aside li,aside nav,aside ol,aside ul{display:block}aside li{padding:calc(var(--pico-nav-element-spacing-vertical) * .5) var(--pico-nav-element-spacing-horizontal)}aside li a{display:block}aside li [role=button]{margin:inherit}[dir=rtl] nav[aria-label=breadcrumb] ul li:not(:last-child) ::after{content:"\\"}progress{display:inline-block;vertical-align:baseline}progress{-webkit-appearance:none;-moz-appearance:none;display:inline-block;appearance:none;width:100%;height:.5rem;margin-bottom:calc(var(--pico-spacing) * .5);overflow:hidden;border:0;border-radius:var(--pico-border-radius);background-color:var(--pico-progress-background-color);color:var(--pico-progress-color)}progress::-webkit-progress-bar{border-radius:var(--pico-border-radius);background:0 0}progress[value]::-webkit-progress-value{background-color:var(--pico-progress-color);-webkit-transition:inline-size var(--pico-transition);transition:inline-size var(--pico-transition)}progress::-moz-progress-bar{background-color:var(--pico-progress-color)}@media (prefers-reduced-motion:no-preference){progress:indeterminate{background:var(--pico-progress-background-color) linear-gradient(to right,var(--pico-progress-color) 30%,var(--pico-progress-background-color) 30%) top left/150% 150% no-repeat;animation:progress-indeterminate 1s linear infinite}progress:indeterminate[value]::-webkit-progress-value{background-color:transparent}progress:indeterminate::-moz-progress-bar{background-color:transparent}}@media (prefers-reduced-motion:no-preference){[dir=rtl] progress:indeterminate{animation-direction:reverse}}@keyframes progress-indeterminate{0%{background-position:200% 0}100%{background-position:-200% 0}}[data-tooltip]{position:relative}[data-tooltip]:not(a,button,input){border-bottom:1px dotted;text-decoration:none;cursor:help}[data-tooltip]::after,[data-tooltip]::before,[data-tooltip][data-placement=top]::after,[data-tooltip][data-placement=top]::before{display:block;z-index:99;position:absolute;bottom:100%;left:50%;padding:.25rem .5rem;overflow:hidden;transform:translate(-50%,-.25rem);border-radius:var(--pico-border-radius);background:var(--pico-tooltip-background-color);content:attr(data-tooltip);color:var(--pico-tooltip-color);font-style:normal;font-weight:var(--pico-font-weight);font-size:.875rem;text-decoration:none;text-overflow:ellipsis;white-space:nowrap;opacity:0;pointer-events:none}[data-tooltip]::after,[data-tooltip][data-placement=top]::after{padding:0;transform:translate(-50%,0);border-top:.3rem solid;border-right:.3rem solid transparent;border-left:.3rem solid transparent;border-radius:0;background-color:transparent;content:"";color:var(--pico-tooltip-background-color)}[data-tooltip][data-placement=bottom]::after,[data-tooltip][data-placement=bottom]::before{top:100%;bottom:auto;transform:translate(-50%,.25rem)}[data-tooltip][data-placement=bottom]:after{transform:translate(-50%,-.3rem);border:.3rem solid transparent;border-bottom:.3rem solid}[data-tooltip][data-placement=left]::after,[data-tooltip][data-placement=left]::before{top:50%;right:100%;bottom:auto;left:auto;transform:translate(-.25rem,-50%)}[data-tooltip][data-placement=left]:after{transform:translate(.3rem,-50%);border:.3rem solid transparent;border-left:.3rem solid}[data-tooltip][data-placement=right]::after,[data-tooltip][data-placement=right]::before{top:50%;right:auto;bottom:auto;left:100%;transform:translate(.25rem,-50%)}[data-tooltip][data-placement=right]:after{transform:translate(-.3rem,-50%);border:.3rem solid transparent;border-right:.3rem solid}[data-tooltip]:focus::after,[data-tooltip]:focus::before,[data-tooltip]:hover::after,[data-tooltip]:hover::before{opacity:1}@media (hover:hover) and (pointer:fine){[data-tooltip]:focus::after,[data-tooltip]:focus::before,[data-tooltip]:hover::after,[data-tooltip]:hover::before{--pico-tooltip-slide-to:translate(-50%, -0.25rem);transform:translate(-50%,.75rem);animation-duration:.2s;animation-fill-mode:forwards;animation-name:tooltip-slide;opacity:0}[data-tooltip]:focus::after,[data-tooltip]:hover::after{--pico-tooltip-caret-slide-to:translate(-50%, 0rem);transform:translate(-50%,-.25rem);animation-name:tooltip-caret-slide}[data-tooltip][data-placement=bottom]:focus::after,[data-tooltip][data-placement=bottom]:focus::before,[data-tooltip][data-placement=bottom]:hover::after,[data-tooltip][data-placement=bottom]:hover::before{--pico-tooltip-slide-to:translate(-50%, 0.25rem);transform:translate(-50%,-.75rem);animation-name:tooltip-slide}[data-tooltip][data-placement=bottom]:focus::after,[data-tooltip][data-placement=bottom]:hover::after{--pico-tooltip-caret-slide-to:translate(-50%, -0.3rem);transform:translate(-50%,-.5rem);animation-name:tooltip-caret-slide}[data-tooltip][data-placement=left]:focus::after,[data-tooltip][data-placement=left]:focus::before,[data-tooltip][data-placement=left]:hover::after,[data-tooltip][data-placement=left]:hover::before{--pico-tooltip-slide-to:translate(-0.25rem, -50%);transform:translate(.75rem,-50%);animation-name:tooltip-slide}[data-tooltip][data-placement=left]:focus::after,[data-tooltip][data-placement=left]:hover::after{--pico-tooltip-caret-slide-to:translate(0.3rem, -50%);transform:translate(.05rem,-50%);animation-name:tooltip-caret-slide}[data-tooltip][data-placement=right]:focus::after,[data-tooltip][data-placement=right]:focus::before,[data-tooltip][data-placement=right]:hover::after,[data-tooltip][data-placement=right]:hover::before{--pico-tooltip-slide-to:translate(0.25rem, -50%);transform:translate(-.75rem,-50%);animation-name:tooltip-slide}[data-tooltip][data-placement=right]:focus::after,[data-tooltip][data-placement=right]:hover::after{--pico-tooltip-caret-slide-to:translate(-0.3rem, -50%);transform:translate(-.05rem,-50%);animation-name:tooltip-caret-slide}}@keyframes tooltip-slide{to{transform:var(--pico-tooltip-slide-to);opacity:1}}@keyframes tooltip-caret-slide{50%{opacity:0}to{transform:var(--pico-tooltip-caret-slide-to);opacity:1}}[aria-controls]{cursor:pointer}[aria-disabled=true],[disabled]{cursor:not-allowed}[aria-hidden=false][hidden]{display:initial}[aria-hidden=false][hidden]:not(:focus){clip:rect(0,0,0,0);position:absolute}[tabindex],a,area,button,input,label,select,summary,textarea{-ms-touch-action:manipulation}[dir=rtl]{direction:rtl}@media (prefers-reduced-motion:reduce){:not([aria-busy=true]),:not([aria-busy=true])::after,:not([aria-busy=true])::before{background-attachment:initial!important;animation-duration:1ms!important;animation-delay:-1ms!important;animation-iteration-count:1!important;scroll-behavior:auto!important;transition-delay:0s!important;transition-duration:0s!important}} \ No newline at end of file diff --git a/website/style.css b/website/style.css new file mode 100644 index 0000000..7db8eab --- /dev/null +++ b/website/style.css @@ -0,0 +1,23 @@ +/* Mod descriptions layout */ +#mod-descriptions { + display: grid; + gap: 10px; + grid-template-columns: repeat(auto-fill, minmax(20em, 1fr)); + grid-template-rows: masonry; +} + +.mod-description { + width: 100%; +} + +@media screen and (max-width: 768px) { + #mod-descriptions { + grid-template-columns: repeat(2, 1fr); + } +} + +@media screen and (max-width: 480px) { + #mod-descriptions { + grid-template-columns: 1fr; + } +} \ No newline at end of file